summaryrefslogtreecommitdiffstats
path: root/bitbake
diff options
context:
space:
mode:
Diffstat (limited to 'bitbake')
-rw-r--r--bitbake/README36
-rw-r--r--bitbake/SECURITY.md24
-rwxr-xr-xbitbake/bin/bitbake5
-rwxr-xr-xbitbake/bin/bitbake-diffsigs13
-rwxr-xr-xbitbake/bin/bitbake-getvar32
-rwxr-xr-xbitbake/bin/bitbake-hashclient303
-rwxr-xr-xbitbake/bin/bitbake-hashserv145
-rwxr-xr-xbitbake/bin/bitbake-layers16
-rwxr-xr-xbitbake/bin/bitbake-prserv106
-rwxr-xr-xbitbake/bin/bitbake-selftest2
-rwxr-xr-xbitbake/bin/bitbake-server12
-rwxr-xr-xbitbake/bin/bitbake-worker117
-rwxr-xr-xbitbake/bin/git-make-shallow34
-rwxr-xr-xbitbake/bin/toaster12
-rwxr-xr-xbitbake/bin/toaster-eventreplay80
-rw-r--r--bitbake/contrib/vim/indent/bitbake.vim6
-rw-r--r--bitbake/contrib/vim/syntax/bitbake.vim8
-rw-r--r--bitbake/doc/README4
-rw-r--r--bitbake/doc/_templates/footer.html9
-rw-r--r--bitbake/doc/bitbake-user-manual/bitbake-user-manual-execution.rst69
-rw-r--r--bitbake/doc/bitbake-user-manual/bitbake-user-manual-fetching.rst53
-rw-r--r--bitbake/doc/bitbake-user-manual/bitbake-user-manual-hello.rst137
-rw-r--r--bitbake/doc/bitbake-user-manual/bitbake-user-manual-metadata.rst85
-rw-r--r--bitbake/doc/bitbake-user-manual/bitbake-user-manual-ref-variables-context.rst91
-rw-r--r--bitbake/doc/bitbake-user-manual/bitbake-user-manual-ref-variables.rst129
-rw-r--r--bitbake/doc/index.rst1
-rw-r--r--bitbake/doc/releases.rst82
-rw-r--r--bitbake/lib/bb/__init__.py29
-rwxr-xr-xbitbake/lib/bb/acl.py215
-rw-r--r--bitbake/lib/bb/asyncrpc/__init__.py35
-rw-r--r--bitbake/lib/bb/asyncrpc/client.py293
-rw-r--r--bitbake/lib/bb/asyncrpc/connection.py146
-rw-r--r--bitbake/lib/bb/asyncrpc/exceptions.py21
-rw-r--r--bitbake/lib/bb/asyncrpc/serv.py388
-rw-r--r--bitbake/lib/bb/build.py175
-rw-r--r--bitbake/lib/bb/cache.py298
-rw-r--r--bitbake/lib/bb/codeparser.py113
-rw-r--r--bitbake/lib/bb/command.py76
-rw-r--r--bitbake/lib/bb/cooker.py531
-rw-r--r--bitbake/lib/bb/cookerdata.py144
-rw-r--r--bitbake/lib/bb/data.py118
-rw-r--r--bitbake/lib/bb/data_smart.py63
-rw-r--r--bitbake/lib/bb/event.py132
-rw-r--r--bitbake/lib/bb/fetch2/__init__.py202
-rw-r--r--bitbake/lib/bb/fetch2/crate.py32
-rw-r--r--bitbake/lib/bb/fetch2/gcp.py102
-rw-r--r--bitbake/lib/bb/fetch2/git.py198
-rw-r--r--bitbake/lib/bb/fetch2/gitsm.py27
-rw-r--r--bitbake/lib/bb/fetch2/hg.py1
-rw-r--r--bitbake/lib/bb/fetch2/local.py8
-rw-r--r--bitbake/lib/bb/fetch2/npm.py13
-rw-r--r--bitbake/lib/bb/fetch2/npmsw.py77
-rw-r--r--bitbake/lib/bb/fetch2/sftp.py2
-rw-r--r--bitbake/lib/bb/fetch2/ssh.py6
-rw-r--r--bitbake/lib/bb/fetch2/svn.py3
-rw-r--r--bitbake/lib/bb/fetch2/wget.py39
-rwxr-xr-xbitbake/lib/bb/main.py400
-rw-r--r--bitbake/lib/bb/monitordisk.py7
-rw-r--r--bitbake/lib/bb/msg.py2
-rw-r--r--bitbake/lib/bb/parse/__init__.py22
-rw-r--r--bitbake/lib/bb/parse/ast.py73
-rw-r--r--bitbake/lib/bb/parse/parse_py/BBHandler.py26
-rw-r--r--bitbake/lib/bb/parse/parse_py/ConfHandler.py20
-rw-r--r--bitbake/lib/bb/persist_data.py21
-rw-r--r--bitbake/lib/bb/runqueue.py612
-rw-r--r--bitbake/lib/bb/server/process.py319
-rw-r--r--bitbake/lib/bb/server/xmlrpcserver.py2
-rw-r--r--bitbake/lib/bb/siggen.py606
-rw-r--r--bitbake/lib/bb/tests/codeparser.py88
-rw-r--r--bitbake/lib/bb/tests/color.py2
-rw-r--r--bitbake/lib/bb/tests/data.py41
-rw-r--r--bitbake/lib/bb/tests/event.py62
-rw-r--r--bitbake/lib/bb/tests/fetch-testdata/software/libxml2/2.10/index.html20
-rw-r--r--bitbake/lib/bb/tests/fetch-testdata/software/libxml2/2.9/index.html40
-rw-r--r--bitbake/lib/bb/tests/fetch-testdata/software/libxml2/index.html19
-rw-r--r--bitbake/lib/bb/tests/fetch.py664
-rw-r--r--bitbake/lib/bb/tests/parse.py137
-rw-r--r--bitbake/lib/bb/tests/runqueue.py2
-rw-r--r--bitbake/lib/bb/tests/siggen.py77
-rw-r--r--bitbake/lib/bb/tinfoil.py18
-rw-r--r--bitbake/lib/bb/ui/buildinfohelper.py18
-rw-r--r--bitbake/lib/bb/ui/eventreplay.py86
-rw-r--r--bitbake/lib/bb/ui/knotty.py91
-rw-r--r--bitbake/lib/bb/ui/ncurses.py3
-rw-r--r--bitbake/lib/bb/ui/taskexp.py2
-rwxr-xr-xbitbake/lib/bb/ui/taskexp_ncurses.py1511
-rw-r--r--bitbake/lib/bb/ui/toasterui.py2
-rw-r--r--bitbake/lib/bb/ui/uievent.py30
-rw-r--r--bitbake/lib/bb/utils.py157
-rwxr-xr-xbitbake/lib/bb/xattr.py126
-rw-r--r--bitbake/lib/bblayers/action.py13
-rw-r--r--bitbake/lib/bblayers/layerindex.py25
-rw-r--r--bitbake/lib/bblayers/query.py22
-rw-r--r--bitbake/lib/bs4/tests/test_tree.py2
-rw-r--r--bitbake/lib/codegen.py12
-rw-r--r--bitbake/lib/hashserv/__init__.py199
-rw-r--r--bitbake/lib/hashserv/client.py307
-rw-r--r--bitbake/lib/hashserv/server.py1003
-rw-r--r--bitbake/lib/hashserv/sqlalchemy.py598
-rw-r--r--bitbake/lib/hashserv/sqlite.py562
-rw-r--r--bitbake/lib/hashserv/tests.py1118
-rw-r--r--bitbake/lib/layerindexlib/__init__.py15
-rw-r--r--bitbake/lib/ply/yacc.py7
-rw-r--r--bitbake/lib/progressbar/progressbar.py2
-rw-r--r--bitbake/lib/prserv/__init__.py97
-rw-r--r--bitbake/lib/prserv/client.py54
-rw-r--r--bitbake/lib/prserv/db.py430
-rw-r--r--bitbake/lib/prserv/serv.py278
-rw-r--r--bitbake/lib/prserv/tests.py386
-rw-r--r--bitbake/lib/toaster/bldcollector/urls.py2
-rw-r--r--bitbake/lib/toaster/bldcollector/views.py3
-rw-r--r--bitbake/lib/toaster/bldcontrol/models.py4
-rw-r--r--bitbake/lib/toaster/logs/.gitignore1
-rw-r--r--bitbake/lib/toaster/orm/fixtures/README2
-rwxr-xr-xbitbake/lib/toaster/orm/fixtures/gen_fixtures.py14
-rw-r--r--bitbake/lib/toaster/orm/fixtures/oe-core.xml26
-rw-r--r--bitbake/lib/toaster/orm/fixtures/poky.xml38
-rw-r--r--bitbake/lib/toaster/orm/fixtures/settings.xml2
-rw-r--r--bitbake/lib/toaster/orm/management/commands/lsupdates.py2
-rw-r--r--bitbake/lib/toaster/orm/migrations/0021_eventlogsimports.py22
-rw-r--r--bitbake/lib/toaster/orm/models.py44
-rw-r--r--bitbake/lib/toaster/pytest.ini16
-rw-r--r--bitbake/lib/toaster/tests/browser/selenium_helpers_base.py76
-rw-r--r--bitbake/lib/toaster/tests/browser/test_all_builds_page.py315
-rw-r--r--bitbake/lib/toaster/tests/browser/test_all_projects_page.py162
-rw-r--r--bitbake/lib/toaster/tests/browser/test_builddashboard_page.py15
-rw-r--r--bitbake/lib/toaster/tests/browser/test_builddashboard_page_artifacts.py8
-rw-r--r--bitbake/lib/toaster/tests/browser/test_delete_project.py103
-rw-r--r--bitbake/lib/toaster/tests/browser/test_landing_page.py131
-rw-r--r--bitbake/lib/toaster/tests/browser/test_layerdetails_page.py39
-rw-r--r--bitbake/lib/toaster/tests/browser/test_most_recent_builds_states.py24
-rw-r--r--bitbake/lib/toaster/tests/browser/test_new_custom_image_page.py14
-rw-r--r--bitbake/lib/toaster/tests/browser/test_new_project_page.py16
-rw-r--r--bitbake/lib/toaster/tests/browser/test_project_builds_page.py4
-rw-r--r--bitbake/lib/toaster/tests/browser/test_project_config_page.py33
-rw-r--r--bitbake/lib/toaster/tests/browser/test_sample.py10
-rw-r--r--bitbake/lib/toaster/tests/browser/test_toastertable_ui.py11
-rw-r--r--bitbake/lib/toaster/tests/builds/buildtest.py13
-rw-r--r--bitbake/lib/toaster/tests/builds/test_core_image_min.py20
-rw-r--r--bitbake/lib/toaster/tests/commands/test_loaddata.py4
-rw-r--r--bitbake/lib/toaster/tests/commands/test_lsupdates.py3
-rw-r--r--bitbake/lib/toaster/tests/commands/test_runbuilds.py13
-rw-r--r--bitbake/lib/toaster/tests/db/test_db.py3
-rw-r--r--bitbake/lib/toaster/tests/functional/functional_helpers.py82
-rw-r--r--bitbake/lib/toaster/tests/functional/test_create_new_project.py179
-rw-r--r--bitbake/lib/toaster/tests/functional/test_functional_basic.py195
-rw-r--r--bitbake/lib/toaster/tests/functional/test_project_config.py341
-rw-r--r--bitbake/lib/toaster/tests/functional/test_project_page.py792
-rw-r--r--bitbake/lib/toaster/tests/functional/test_project_page_tab_config.py528
-rw-r--r--bitbake/lib/toaster/tests/functional/utils.py89
-rw-r--r--bitbake/lib/toaster/tests/toaster-tests-requirements.txt8
-rw-r--r--bitbake/lib/toaster/tests/views/test_views.py20
-rw-r--r--bitbake/lib/toaster/toastergui/api.py26
-rw-r--r--bitbake/lib/toaster/toastergui/fixtures/toastergui-unittest-data.xml24
-rw-r--r--bitbake/lib/toaster/toastergui/forms.py14
-rw-r--r--bitbake/lib/toaster/toastergui/static/css/default.css28
-rw-r--r--bitbake/lib/toaster/toastergui/static/css/jquery.dataTables-1.13.8.min.css1
-rw-r--r--bitbake/lib/toaster/toastergui/static/js/bootstrap-3.4.1.js (renamed from bitbake/lib/toaster/toastergui/static/js/bootstrap.js)431
-rw-r--r--bitbake/lib/toaster/toastergui/static/js/bootstrap-3.4.1.min.js6
-rw-r--r--bitbake/lib/toaster/toastergui/static/js/bootstrap.min.js7
-rw-r--r--bitbake/lib/toaster/toastergui/static/js/jquery-3.7.1.min.js2
-rw-r--r--bitbake/lib/toaster/toastergui/static/js/jquery-3.7.1.min.map1
-rw-r--r--bitbake/lib/toaster/toastergui/static/js/jquery.dataTables-1.13.8.min.js4
-rw-r--r--bitbake/lib/toaster/toastergui/static/js/libtoaster.js2
-rw-r--r--bitbake/lib/toaster/toastergui/static/js/projectpage.js2
-rw-r--r--bitbake/lib/toaster/toastergui/templates/base.html9
-rw-r--r--bitbake/lib/toaster/toastergui/templates/base_specific.html4
-rw-r--r--bitbake/lib/toaster/toastergui/templates/command_line_builds.html209
-rw-r--r--bitbake/lib/toaster/toastergui/templates/js-unit-tests.html2
-rw-r--r--bitbake/lib/toaster/toastergui/templates/landing.html12
-rw-r--r--bitbake/lib/toaster/toastergui/templates/mrb_section.html2
-rw-r--r--bitbake/lib/toaster/toastergui/templates/package_built_dependencies.html8
-rw-r--r--bitbake/lib/toaster/toastergui/templates/package_included_dependencies.html8
-rw-r--r--bitbake/lib/toaster/toastergui/templates/package_included_reverse_dependencies.html4
-rw-r--r--bitbake/lib/toaster/toastergui/templates/recipe.html4
-rw-r--r--bitbake/lib/toaster/toastergui/templates/target.html4
-rw-r--r--bitbake/lib/toaster/toastergui/templatetags/projecttags.py4
-rw-r--r--bitbake/lib/toaster/toastergui/urls.py6
-rw-r--r--bitbake/lib/toaster/toastergui/views.py196
-rw-r--r--bitbake/lib/toaster/toastergui/widgets.py10
-rw-r--r--bitbake/lib/toaster/toastermain/logs.py158
-rw-r--r--bitbake/lib/toaster/toastermain/management/commands/buildimport.py2
-rw-r--r--bitbake/lib/toaster/toastermain/management/commands/checksocket.py4
-rw-r--r--bitbake/lib/toaster/toastermain/settings.py82
-rw-r--r--bitbake/lib/toaster/toastermain/settings_test.py4
-rw-r--r--bitbake/lib/toaster/toastermain/urls.py4
-rw-r--r--bitbake/lib/toaster/tox.ini24
-rw-r--r--bitbake/toaster-requirements.txt3
188 files changed, 16256 insertions, 4016 deletions
diff --git a/bitbake/README b/bitbake/README
index 80a97118b9..e9f4c858ee 100644
--- a/bitbake/README
+++ b/bitbake/README
@@ -13,19 +13,24 @@ Bitbake plain documentation can be found under the doc directory or its integrat
html version at the Yocto Project website:
https://docs.yoctoproject.org
+Bitbake requires Python version 3.8 or newer.
+
Contributing
------------
-Please refer to
-https://www.openembedded.org/wiki/How_to_submit_a_patch_to_OpenEmbedded
-for guidelines on how to submit patches, just note that the latter documentation is intended
-for OpenEmbedded (and its core) not bitbake patches (bitbake-devel@lists.openembedded.org)
-but in general main guidelines apply. Once the commit(s) have been created, the way to send
-the patch is through git-send-email. For example, to send the last commit (HEAD) on current
-branch, type:
+Please refer to our contributor guide here: https://docs.yoctoproject.org/contributor-guide/
+for full details on how to submit changes.
+
+As a quick guide, patches should be sent to bitbake-devel@lists.openembedded.org
+The git command to do that would be:
git send-email -M -1 --to bitbake-devel@lists.openembedded.org
+If you're sending a patch related to the BitBake manual, make sure you copy
+the Yocto Project documentation mailing list:
+
+ git send-email -M -1 --to bitbake-devel@lists.openembedded.org --cc docs@lists.yoctoproject.org
+
Mailing list:
https://lists.openembedded.org/g/bitbake-devel
@@ -34,10 +39,25 @@ Source code:
https://git.openembedded.org/bitbake/
-Testing:
+Testing
+-------
Bitbake has a testsuite located in lib/bb/tests/ whichs aim to try and prevent regressions.
You can run this with "bitbake-selftest". In particular the fetcher is well covered since
it has so many corner cases. The datastore has many tests too. Testing with the testsuite is
recommended before submitting patches, particularly to the fetcher and datastore. We also
appreciate new test cases and may require them for more obscure issues.
+
+To run the tests "zstd" and "git" must be installed.
+
+The assumption is made that this testsuite is run from an initialized OpenEmbedded build
+environment (i.e. `source oe-init-build-env` is used). If this is not the case, run the
+testsuite as follows:
+
+ export PATH=$(pwd)/bin:$PATH
+ bin/bitbake-selftest
+
+The testsuite can alternatively be executed using pytest, e.g. obtained from PyPI (in this
+case, the PATH is configured automatically):
+
+ pytest
diff --git a/bitbake/SECURITY.md b/bitbake/SECURITY.md
new file mode 100644
index 0000000000..7d2ce1f631
--- /dev/null
+++ b/bitbake/SECURITY.md
@@ -0,0 +1,24 @@
+How to Report a Potential Vulnerability?
+========================================
+
+If you would like to report a public issue (for example, one with a released
+CVE number), please report it using the
+[https://bugzilla.yoctoproject.org/enter_bug.cgi?product=Security Security Bugzilla].
+If you have a patch ready, submit it following the same procedure as any other
+patch as described in README.md.
+
+If you are dealing with a not-yet released or urgent issue, please send a
+message to security AT yoctoproject DOT org, including as many details as
+possible: the layer or software module affected, the recipe and its version,
+and any example code, if available.
+
+Branches maintained with security fixes
+---------------------------------------
+
+See [https://wiki.yoctoproject.org/wiki/Stable_Release_and_LTS Stable release and LTS]
+for detailed info regarding the policies and maintenance of Stable branches.
+
+The [https://wiki.yoctoproject.org/wiki/Releases Release page] contains a list of all
+releases of the Yocto Project. Versions in grey are no longer actively maintained with
+security patches, but well-tested patches may still be accepted for them for
+significant issues.
diff --git a/bitbake/bin/bitbake b/bitbake/bin/bitbake
index b56f6207c6..8622a7bf94 100755
--- a/bitbake/bin/bitbake
+++ b/bitbake/bin/bitbake
@@ -25,10 +25,9 @@ except RuntimeError as exc:
from bb import cookerdata
from bb.main import bitbake_main, BitBakeConfigParameters, BBMainException
-if sys.getfilesystemencoding() != "utf-8":
- sys.exit("Please use a locale setting which supports UTF-8 (such as LANG=en_US.UTF-8).\nPython can't change the filesystem locale after loading so we need a UTF-8 when Python starts or things won't work.")
+bb.utils.check_system_locale()
-__version__ = "2.0.1"
+__version__ = "2.9.1"
if __name__ == "__main__":
if __version__ != bb.__version__:
diff --git a/bitbake/bin/bitbake-diffsigs b/bitbake/bin/bitbake-diffsigs
index fe0f33eea1..8202c78623 100755
--- a/bitbake/bin/bitbake-diffsigs
+++ b/bitbake/bin/bitbake-diffsigs
@@ -72,13 +72,16 @@ def find_siginfo_task(bbhandler, pn, taskname, sig1=None, sig2=None):
elif sig2 not in sigfiles:
logger.error('No sigdata files found matching %s %s with signature %s' % (pn, taskname, sig2))
sys.exit(1)
- latestfiles = [sigfiles[sig1], sigfiles[sig2]]
else:
- filedates = find_siginfo(bbhandler, pn, taskname)
- latestfiles = sorted(filedates.keys(), key=lambda f: filedates[f])[-2:]
- if not latestfiles:
+ sigfiles = find_siginfo(bbhandler, pn, taskname)
+ latestsigs = sorted(sigfiles.keys(), key=lambda h: sigfiles[h]['time'])[-2:]
+ if not latestsigs:
logger.error('No sigdata files found matching %s %s' % (pn, taskname))
sys.exit(1)
+ sig1 = latestsigs[0]
+ sig2 = latestsigs[1]
+
+ latestfiles = [sigfiles[sig1]['path'], sigfiles[sig2]['path']]
return latestfiles
@@ -96,7 +99,7 @@ def recursecb(key, hash1, hash2):
elif hash2 not in hashfiles:
recout.append("Unable to find matching sigdata for %s with hash %s" % (key, hash2))
else:
- out2 = bb.siggen.compare_sigfiles(hashfiles[hash1], hashfiles[hash2], recursecb, color=color)
+ out2 = bb.siggen.compare_sigfiles(hashfiles[hash1]['path'], hashfiles[hash2]['path'], recursecb, color=color)
for change in out2:
for line in change.splitlines():
recout.append(' ' + line)
diff --git a/bitbake/bin/bitbake-getvar b/bitbake/bin/bitbake-getvar
index 5435a8d797..8901f99ae2 100755
--- a/bitbake/bin/bitbake-getvar
+++ b/bitbake/bin/bitbake-getvar
@@ -25,26 +25,36 @@ if __name__ == "__main__":
parser.add_argument('-u', '--unexpand', help='Do not expand the value (with --value)', action="store_true")
parser.add_argument('-f', '--flag', help='Specify a variable flag to query (with --value)', default=None)
parser.add_argument('--value', help='Only report the value, no history and no variable name', action="store_true")
+ parser.add_argument('-q', '--quiet', help='Silence bitbake server logging', action="store_true")
+ parser.add_argument('--ignore-undefined', help='Suppress any errors related to undefined variables', action="store_true")
args = parser.parse_args()
- if args.unexpand and not args.value:
- print("--unexpand only makes sense with --value")
- sys.exit(1)
+ if not args.value:
+ if args.unexpand:
+ sys.exit("--unexpand only makes sense with --value")
- if args.flag and not args.value:
- print("--flag only makes sense with --value")
- sys.exit(1)
+ if args.flag:
+ sys.exit("--flag only makes sense with --value")
- with bb.tinfoil.Tinfoil(tracking=True) as tinfoil:
+ quiet = args.quiet or args.value
+ with bb.tinfoil.Tinfoil(tracking=True, setup_logging=not quiet) as tinfoil:
if args.recipe:
- tinfoil.prepare(quiet=2)
+ tinfoil.prepare(quiet=3 if quiet else 2)
d = tinfoil.parse_recipe(args.recipe)
else:
tinfoil.prepare(quiet=2, config_only=True)
d = tinfoil.config_data
+
+ value = None
if args.flag:
- print(str(d.getVarFlag(args.variable, args.flag, expand=(not args.unexpand))))
- elif args.value:
- print(str(d.getVar(args.variable, expand=(not args.unexpand))))
+ value = d.getVarFlag(args.variable, args.flag, expand=not args.unexpand)
+ if value is None and not args.ignore_undefined:
+ sys.exit(f"The flag '{args.flag}' is not defined for variable '{args.variable}'")
+ else:
+ value = d.getVar(args.variable, expand=not args.unexpand)
+ if value is None and not args.ignore_undefined:
+ sys.exit(f"The variable '{args.variable}' is not defined")
+ if args.value:
+ print(str(value if value is not None else ""))
else:
bb.data.emit_var(args.variable, d=d, all=True)
diff --git a/bitbake/bin/bitbake-hashclient b/bitbake/bin/bitbake-hashclient
index 494f17592a..5d6f67046b 100755
--- a/bitbake/bin/bitbake-hashclient
+++ b/bitbake/bin/bitbake-hashclient
@@ -14,6 +14,9 @@ import sys
import threading
import time
import warnings
+import netrc
+import json
+import statistics
warnings.simplefilter("default")
try:
@@ -36,18 +39,42 @@ except ImportError:
sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(__file__)), 'lib'))
import hashserv
+import bb.asyncrpc
DEFAULT_ADDRESS = 'unix://./hashserve.sock'
METHOD = 'stress.test.method'
+def print_user(u):
+ print(f"Username: {u['username']}")
+ if "permissions" in u:
+ print("Permissions: " + " ".join(u["permissions"]))
+ if "token" in u:
+ print(f"Token: {u['token']}")
+
def main():
+ def handle_get(args, client):
+ result = client.get_taskhash(args.method, args.taskhash, all_properties=True)
+ if not result:
+ return 0
+
+ print(json.dumps(result, sort_keys=True, indent=4))
+ return 0
+
+ def handle_get_outhash(args, client):
+ result = client.get_outhash(args.method, args.outhash, args.taskhash)
+ if not result:
+ return 0
+
+ print(json.dumps(result, sort_keys=True, indent=4))
+ return 0
+
def handle_stats(args, client):
if args.reset:
s = client.reset_stats()
else:
s = client.get_stats()
- pprint.pprint(s)
+ print(json.dumps(s, sort_keys=True, indent=4))
return 0
def handle_stress(args, client):
@@ -55,47 +82,59 @@ def main():
nonlocal found_hashes
nonlocal missed_hashes
nonlocal max_time
+ nonlocal times
- client = hashserv.create_client(args.address)
-
- for i in range(args.requests):
- taskhash = hashlib.sha256()
- taskhash.update(args.taskhash_seed.encode('utf-8'))
- taskhash.update(str(i).encode('utf-8'))
+ with hashserv.create_client(args.address) as client:
+ for i in range(args.requests):
+ taskhash = hashlib.sha256()
+ taskhash.update(args.taskhash_seed.encode('utf-8'))
+ taskhash.update(str(i).encode('utf-8'))
- start_time = time.perf_counter()
- l = client.get_unihash(METHOD, taskhash.hexdigest())
- elapsed = time.perf_counter() - start_time
+ start_time = time.perf_counter()
+ l = client.get_unihash(METHOD, taskhash.hexdigest())
+ elapsed = time.perf_counter() - start_time
- with lock:
- if l:
- found_hashes += 1
- else:
- missed_hashes += 1
+ with lock:
+ if l:
+ found_hashes += 1
+ else:
+ missed_hashes += 1
- max_time = max(elapsed, max_time)
- pbar.update()
+ times.append(elapsed)
+ pbar.update()
max_time = 0
found_hashes = 0
missed_hashes = 0
lock = threading.Lock()
- total_requests = args.clients * args.requests
+ times = []
start_time = time.perf_counter()
- with ProgressBar(total=total_requests) as pbar:
+ with ProgressBar(total=args.clients * args.requests) as pbar:
threads = [threading.Thread(target=thread_main, args=(pbar, lock), daemon=False) for _ in range(args.clients)]
for t in threads:
t.start()
for t in threads:
t.join()
+ total_elapsed = time.perf_counter() - start_time
- elapsed = time.perf_counter() - start_time
with lock:
- print("%d requests in %.1fs. %.1f requests per second" % (total_requests, elapsed, total_requests / elapsed))
- print("Average request time %.8fs" % (elapsed / total_requests))
- print("Max request time was %.8fs" % max_time)
- print("Found %d hashes, missed %d" % (found_hashes, missed_hashes))
+ mean = statistics.mean(times)
+ median = statistics.median(times)
+ stddev = statistics.pstdev(times)
+
+ print(f"Number of clients: {args.clients}")
+ print(f"Requests per client: {args.requests}")
+ print(f"Number of requests: {len(times)}")
+ print(f"Total elapsed time: {total_elapsed:.3f}s")
+ print(f"Total request rate: {len(times)/total_elapsed:.3f} req/s")
+ print(f"Average request time: {mean:.3f}s")
+ print(f"Median request time: {median:.3f}s")
+ print(f"Request time std dev: {stddev:.3f}s")
+ print(f"Maximum request time: {max(times):.3f}s")
+ print(f"Minimum request time: {min(times):.3f}s")
+ print(f"Hashes found: {found_hashes}")
+ print(f"Hashes missed: {missed_hashes}")
if args.report:
with ProgressBar(total=args.requests) as pbar:
@@ -113,12 +152,140 @@ def main():
with lock:
pbar.update()
+ def handle_remove(args, client):
+ where = {k: v for k, v in args.where}
+ if where:
+ result = client.remove(where)
+ print("Removed %d row(s)" % (result["count"]))
+ else:
+ print("No query specified")
+
+ def handle_clean_unused(args, client):
+ result = client.clean_unused(args.max_age)
+ print("Removed %d rows" % (result["count"]))
+ return 0
+
+ def handle_refresh_token(args, client):
+ r = client.refresh_token(args.username)
+ print_user(r)
+
+ def handle_set_user_permissions(args, client):
+ r = client.set_user_perms(args.username, args.permissions)
+ print_user(r)
+
+ def handle_get_user(args, client):
+ r = client.get_user(args.username)
+ print_user(r)
+
+ def handle_get_all_users(args, client):
+ users = client.get_all_users()
+ print("{username:20}| {permissions}".format(username="Username", permissions="Permissions"))
+ print(("-" * 20) + "+" + ("-" * 20))
+ for u in users:
+ print("{username:20}| {permissions}".format(username=u["username"], permissions=" ".join(u["permissions"])))
+
+ def handle_new_user(args, client):
+ r = client.new_user(args.username, args.permissions)
+ print_user(r)
+
+ def handle_delete_user(args, client):
+ r = client.delete_user(args.username)
+ print_user(r)
+
+ def handle_get_db_usage(args, client):
+ usage = client.get_db_usage()
+ print(usage)
+ tables = sorted(usage.keys())
+ print("{name:20}| {rows:20}".format(name="Table name", rows="Rows"))
+ print(("-" * 20) + "+" + ("-" * 20))
+ for t in tables:
+ print("{name:20}| {rows:<20}".format(name=t, rows=usage[t]["rows"]))
+ print()
+
+ total_rows = sum(t["rows"] for t in usage.values())
+ print(f"Total rows: {total_rows}")
+
+ def handle_get_db_query_columns(args, client):
+ columns = client.get_db_query_columns()
+ print("\n".join(sorted(columns)))
+
+ def handle_gc_status(args, client):
+ result = client.gc_status()
+ if not result["mark"]:
+ print("No Garbage collection in progress")
+ return 0
+
+ print("Current Mark: %s" % result["mark"])
+ print("Total hashes to keep: %d" % result["keep"])
+ print("Total hashes to remove: %s" % result["remove"])
+ return 0
+
+ def handle_gc_mark(args, client):
+ where = {k: v for k, v in args.where}
+ result = client.gc_mark(args.mark, where)
+ print("New hashes marked: %d" % result["count"])
+ return 0
+
+ def handle_gc_sweep(args, client):
+ result = client.gc_sweep(args.mark)
+ print("Removed %d rows" % result["count"])
+ return 0
+
+ def handle_unihash_exists(args, client):
+ result = client.unihash_exists(args.unihash)
+ if args.quiet:
+ return 0 if result else 1
+
+ print("true" if result else "false")
+ return 0
+
+ def handle_ping(args, client):
+ times = []
+ for i in range(1, args.count + 1):
+ if not args.quiet:
+ print(f"Ping {i} of {args.count}... ", end="")
+ start_time = time.perf_counter()
+ client.ping()
+ elapsed = time.perf_counter() - start_time
+ times.append(elapsed)
+ if not args.quiet:
+ print(f"{elapsed:.3f}s")
+
+ mean = statistics.mean(times)
+ median = statistics.median(times)
+ std_dev = statistics.pstdev(times)
+
+ if not args.quiet:
+ print("------------------------")
+ print(f"Number of pings: {len(times)}")
+ print(f"Average round trip time: {mean:.3f}s")
+ print(f"Median round trip time: {median:.3f}s")
+ print(f"Round trip time std dev: {std_dev:.3f}s")
+ print(f"Min time is: {min(times):.3f}s")
+ print(f"Max time is: {max(times):.3f}s")
+ return 0
+
parser = argparse.ArgumentParser(description='Hash Equivalence Client')
parser.add_argument('--address', default=DEFAULT_ADDRESS, help='Server address (default "%(default)s")')
parser.add_argument('--log', default='WARNING', help='Set logging level')
+ parser.add_argument('--login', '-l', metavar="USERNAME", help="Authenticate as USERNAME")
+ parser.add_argument('--password', '-p', metavar="TOKEN", help="Authenticate using token TOKEN")
+ parser.add_argument('--become', '-b', metavar="USERNAME", help="Impersonate user USERNAME (if allowed) when performing actions")
+ parser.add_argument('--no-netrc', '-n', action="store_false", dest="netrc", help="Do not use .netrc")
subparsers = parser.add_subparsers()
+ get_parser = subparsers.add_parser('get', help="Get the unihash for a taskhash")
+ get_parser.add_argument("method", help="Method to query")
+ get_parser.add_argument("taskhash", help="Task hash to query")
+ get_parser.set_defaults(func=handle_get)
+
+ get_outhash_parser = subparsers.add_parser('get-outhash', help="Get output hash information")
+ get_outhash_parser.add_argument("method", help="Method to query")
+ get_outhash_parser.add_argument("outhash", help="Output hash to query")
+ get_outhash_parser.add_argument("taskhash", help="Task hash to query")
+ get_outhash_parser.set_defaults(func=handle_get_outhash)
+
stats_parser = subparsers.add_parser('stats', help='Show server stats')
stats_parser.add_argument('--reset', action='store_true',
help='Reset server stats')
@@ -137,6 +304,69 @@ def main():
help='Include string in outhash')
stress_parser.set_defaults(func=handle_stress)
+ remove_parser = subparsers.add_parser('remove', help="Remove hash entries")
+ remove_parser.add_argument("--where", "-w", metavar="KEY VALUE", nargs=2, action="append", default=[],
+ help="Remove entries from table where KEY == VALUE")
+ remove_parser.set_defaults(func=handle_remove)
+
+ clean_unused_parser = subparsers.add_parser('clean-unused', help="Remove unused database entries")
+ clean_unused_parser.add_argument("max_age", metavar="SECONDS", type=int, help="Remove unused entries older than SECONDS old")
+ clean_unused_parser.set_defaults(func=handle_clean_unused)
+
+ refresh_token_parser = subparsers.add_parser('refresh-token', help="Refresh auth token")
+ refresh_token_parser.add_argument("--username", "-u", help="Refresh the token for another user (if authorized)")
+ refresh_token_parser.set_defaults(func=handle_refresh_token)
+
+ set_user_perms_parser = subparsers.add_parser('set-user-perms', help="Set new permissions for user")
+ set_user_perms_parser.add_argument("--username", "-u", help="Username", required=True)
+ set_user_perms_parser.add_argument("permissions", metavar="PERM", nargs="*", default=[], help="New permissions")
+ set_user_perms_parser.set_defaults(func=handle_set_user_permissions)
+
+ get_user_parser = subparsers.add_parser('get-user', help="Get user")
+ get_user_parser.add_argument("--username", "-u", help="Username")
+ get_user_parser.set_defaults(func=handle_get_user)
+
+ get_all_users_parser = subparsers.add_parser('get-all-users', help="List all users")
+ get_all_users_parser.set_defaults(func=handle_get_all_users)
+
+ new_user_parser = subparsers.add_parser('new-user', help="Create new user")
+ new_user_parser.add_argument("--username", "-u", help="Username", required=True)
+ new_user_parser.add_argument("permissions", metavar="PERM", nargs="*", default=[], help="New permissions")
+ new_user_parser.set_defaults(func=handle_new_user)
+
+ delete_user_parser = subparsers.add_parser('delete-user', help="Delete user")
+ delete_user_parser.add_argument("--username", "-u", help="Username", required=True)
+ delete_user_parser.set_defaults(func=handle_delete_user)
+
+ db_usage_parser = subparsers.add_parser('get-db-usage', help="Database Usage")
+ db_usage_parser.set_defaults(func=handle_get_db_usage)
+
+ db_query_columns_parser = subparsers.add_parser('get-db-query-columns', help="Show columns that can be used in database queries")
+ db_query_columns_parser.set_defaults(func=handle_get_db_query_columns)
+
+ gc_status_parser = subparsers.add_parser("gc-status", help="Show garbage collection status")
+ gc_status_parser.set_defaults(func=handle_gc_status)
+
+ gc_mark_parser = subparsers.add_parser('gc-mark', help="Mark hashes to be kept for garbage collection")
+ gc_mark_parser.add_argument("mark", help="Mark for this garbage collection operation")
+ gc_mark_parser.add_argument("--where", "-w", metavar="KEY VALUE", nargs=2, action="append", default=[],
+ help="Keep entries in table where KEY == VALUE")
+ gc_mark_parser.set_defaults(func=handle_gc_mark)
+
+ gc_sweep_parser = subparsers.add_parser('gc-sweep', help="Perform garbage collection and delete any entries that are not marked")
+ gc_sweep_parser.add_argument("mark", help="Mark for this garbage collection operation")
+ gc_sweep_parser.set_defaults(func=handle_gc_sweep)
+
+ unihash_exists_parser = subparsers.add_parser('unihash-exists', help="Check if a unihash is known to the server")
+ unihash_exists_parser.add_argument("--quiet", action="store_true", help="Don't print status. Instead, exit with 0 if unihash exists and 1 if it does not")
+ unihash_exists_parser.add_argument("unihash", help="Unihash to check")
+ unihash_exists_parser.set_defaults(func=handle_unihash_exists)
+
+ ping_parser = subparsers.add_parser('ping', help="Ping server")
+ ping_parser.add_argument("-n", "--count", type=int, help="Number of pings. Default is %(default)s", default=10)
+ ping_parser.add_argument("-q", "--quiet", action="store_true", help="Don't print each ping; only print results")
+ ping_parser.set_defaults(func=handle_ping)
+
args = parser.parse_args()
logger = logging.getLogger('hashserv')
@@ -150,11 +380,30 @@ def main():
console.setLevel(level)
logger.addHandler(console)
+ login = args.login
+ password = args.password
+
+ if login is None and args.netrc:
+ try:
+ n = netrc.netrc()
+ auth = n.authenticators(args.address)
+ if auth is not None:
+ login, _, password = auth
+ except FileNotFoundError:
+ pass
+ except netrc.NetrcParseError as e:
+ sys.stderr.write(f"Error parsing {e.filename}:{e.lineno}: {e.msg}\n")
+
func = getattr(args, 'func', None)
if func:
- client = hashserv.create_client(args.address)
-
- return func(args, client)
+ try:
+ with hashserv.create_client(args.address, login, password) as client:
+ if args.become:
+ client.become_user(args.become)
+ return func(args, client)
+ except bb.asyncrpc.InvokeError as e:
+ print(f"ERROR: {e}")
+ return 1
return 0
diff --git a/bitbake/bin/bitbake-hashserv b/bitbake/bin/bitbake-hashserv
index 00af76b2d1..4bfb7abfbc 100755
--- a/bitbake/bin/bitbake-hashserv
+++ b/bitbake/bin/bitbake-hashserv
@@ -11,56 +11,161 @@ import logging
import argparse
import sqlite3
import warnings
+
warnings.simplefilter("default")
-sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(__file__)), 'lib'))
+sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(__file__)), "lib"))
import hashserv
+from hashserv.server import DEFAULT_ANON_PERMS
VERSION = "1.0.0"
-DEFAULT_BIND = 'unix://./hashserve.sock'
+DEFAULT_BIND = "unix://./hashserve.sock"
def main():
- parser = argparse.ArgumentParser(description='Hash Equivalence Reference Server. Version=%s' % VERSION,
- epilog='''The bind address is the path to a unix domain socket if it is
- prefixed with "unix://". Otherwise, it is an IP address
- and port in form ADDRESS:PORT. To bind to all addresses, leave
- the ADDRESS empty, e.g. "--bind :8686". To bind to a specific
- IPv6 address, enclose the address in "[]", e.g.
- "--bind [::1]:8686"'''
- )
-
- parser.add_argument('-b', '--bind', default=DEFAULT_BIND, help='Bind address (default "%(default)s")')
- parser.add_argument('-d', '--database', default='./hashserv.db', help='Database file (default "%(default)s")')
- parser.add_argument('-l', '--log', default='WARNING', help='Set logging level')
- parser.add_argument('-u', '--upstream', help='Upstream hashserv to pull hashes from')
- parser.add_argument('-r', '--read-only', action='store_true', help='Disallow write operations from clients')
+ parser = argparse.ArgumentParser(
+ description="Hash Equivalence Reference Server. Version=%s" % VERSION,
+ formatter_class=argparse.RawTextHelpFormatter,
+ epilog="""
+The bind address may take one of the following formats:
+ unix://PATH - Bind to unix domain socket at PATH
+ ws://ADDRESS:PORT - Bind to websocket on ADDRESS:PORT
+ ADDRESS:PORT - Bind to raw TCP socket on ADDRESS:PORT
+
+To bind to all addresses, leave the ADDRESS empty, e.g. "--bind :8686" or
+"--bind ws://:8686". To bind to a specific IPv6 address, enclose the address in
+"[]", e.g. "--bind [::1]:8686" or "--bind ws://[::1]:8686"
+
+Note that the default Anonymous permissions are designed to not break existing
+server instances when upgrading, but are not particularly secure defaults. If
+you want to use authentication, it is recommended that you use "--anon-perms
+@read" to only give anonymous users read access, or "--anon-perms @none" to
+give un-authenticated users no access at all.
+
+Setting "--anon-perms @all" or "--anon-perms @user-admin" is not allowed, since
+this would allow anonymous users to manage all users accounts, which is a bad
+idea.
+
+If you are using user authentication, you should run your server in websockets
+mode with an SSL terminating load balancer in front of it (as this server does
+not implement SSL). Otherwise all usernames and passwords will be transmitted
+in the clear. When configured this way, clients can connect using a secure
+websocket, as in "wss://SERVER:PORT"
+
+The following permissions are supported by the server:
+
+ @none - No permissions
+ @read - The ability to read equivalent hashes from the server
+ @report - The ability to report equivalent hashes to the server
+ @db-admin - Manage the hash database(s). This includes cleaning the
+ database, removing hashes, etc.
+ @user-admin - The ability to manage user accounts. This includes, creating
+ users, deleting users, resetting login tokens, and assigning
+ permissions.
+ @all - All possible permissions, including any that may be added
+ in the future
+ """,
+ )
+
+ parser.add_argument(
+ "-b",
+ "--bind",
+ default=os.environ.get("HASHSERVER_BIND", DEFAULT_BIND),
+ help='Bind address (default $HASHSERVER_BIND, "%(default)s")',
+ )
+ parser.add_argument(
+ "-d",
+ "--database",
+ default=os.environ.get("HASHSERVER_DB", "./hashserv.db"),
+ help='Database file (default $HASHSERVER_DB, "%(default)s")',
+ )
+ parser.add_argument(
+ "-l",
+ "--log",
+ default=os.environ.get("HASHSERVER_LOG_LEVEL", "WARNING"),
+ help='Set logging level (default $HASHSERVER_LOG_LEVEL, "%(default)s")',
+ )
+ parser.add_argument(
+ "-u",
+ "--upstream",
+ default=os.environ.get("HASHSERVER_UPSTREAM", None),
+ help="Upstream hashserv to pull hashes from ($HASHSERVER_UPSTREAM)",
+ )
+ parser.add_argument(
+ "-r",
+ "--read-only",
+ action="store_true",
+ help="Disallow write operations from clients ($HASHSERVER_READ_ONLY)",
+ )
+ parser.add_argument(
+ "--db-username",
+ default=os.environ.get("HASHSERVER_DB_USERNAME", None),
+ help="Database username ($HASHSERVER_DB_USERNAME)",
+ )
+ parser.add_argument(
+ "--db-password",
+ default=os.environ.get("HASHSERVER_DB_PASSWORD", None),
+ help="Database password ($HASHSERVER_DB_PASSWORD)",
+ )
+ parser.add_argument(
+ "--anon-perms",
+ metavar="PERM[,PERM[,...]]",
+ default=os.environ.get("HASHSERVER_ANON_PERMS", ",".join(DEFAULT_ANON_PERMS)),
+ help='Permissions to give anonymous users (default $HASHSERVER_ANON_PERMS, "%(default)s")',
+ )
+ parser.add_argument(
+ "--admin-user",
+ default=os.environ.get("HASHSERVER_ADMIN_USER", None),
+ help="Create default admin user with name ADMIN_USER ($HASHSERVER_ADMIN_USER)",
+ )
+ parser.add_argument(
+ "--admin-password",
+ default=os.environ.get("HASHSERVER_ADMIN_PASSWORD", None),
+ help="Create default admin user with password ADMIN_PASSWORD ($HASHSERVER_ADMIN_PASSWORD)",
+ )
args = parser.parse_args()
- logger = logging.getLogger('hashserv')
+ logger = logging.getLogger("hashserv")
level = getattr(logging, args.log.upper(), None)
if not isinstance(level, int):
- raise ValueError('Invalid log level: %s' % args.log)
+ raise ValueError("Invalid log level: %s (Try ERROR/WARNING/INFO/DEBUG)" % args.log)
logger.setLevel(level)
console = logging.StreamHandler()
console.setLevel(level)
logger.addHandler(console)
- server = hashserv.create_server(args.bind, args.database, upstream=args.upstream, read_only=args.read_only)
+ read_only = (os.environ.get("HASHSERVER_READ_ONLY", "0") == "1") or args.read_only
+ if "," in args.anon_perms:
+ anon_perms = args.anon_perms.split(",")
+ else:
+ anon_perms = args.anon_perms.split()
+
+ server = hashserv.create_server(
+ args.bind,
+ args.database,
+ upstream=args.upstream,
+ read_only=read_only,
+ db_username=args.db_username,
+ db_password=args.db_password,
+ anon_perms=anon_perms,
+ admin_username=args.admin_user,
+ admin_password=args.admin_password,
+ )
server.serve_forever()
return 0
-if __name__ == '__main__':
+if __name__ == "__main__":
try:
ret = main()
except Exception:
ret = 1
import traceback
+
traceback.print_exc()
sys.exit(ret)
diff --git a/bitbake/bin/bitbake-layers b/bitbake/bin/bitbake-layers
index 449434d468..aebb5100c2 100755
--- a/bitbake/bin/bitbake-layers
+++ b/bitbake/bin/bitbake-layers
@@ -33,7 +33,7 @@ def main():
add_help=False)
parser.add_argument('-d', '--debug', help='Enable debug output', action='store_true')
parser.add_argument('-q', '--quiet', help='Print only errors', action='store_true')
- parser.add_argument('-F', '--force', help='Force add without recipe parse verification', action='store_true')
+ parser.add_argument('-F', '--force', help='Forced execution: can be specified multiple times. -F will force add without recipe parse verification and -FF will additionally force the run withput layer parsing.', action='count', default=0)
parser.add_argument('--color', choices=['auto', 'always', 'never'], default='auto', help='Colorize output (where %(metavar)s is %(choices)s)', metavar='COLOR')
global_args, unparsed_args = parser.parse_known_args()
@@ -59,20 +59,24 @@ def main():
plugins = []
tinfoil = bb.tinfoil.Tinfoil(tracking=True)
tinfoil.logger.setLevel(logger.getEffectiveLevel())
- try:
+ if global_args.force > 1:
+ bbpaths = []
+ else:
tinfoil.prepare(True)
- for path in ([topdir] +
- tinfoil.config_data.getVar('BBPATH').split(':')):
+ bbpaths = tinfoil.config_data.getVar('BBPATH').split(':')
+
+ try:
+ for path in ([topdir] + bbpaths):
pluginpath = os.path.join(path, 'lib', 'bblayers')
bb.utils.load_plugins(logger, plugins, pluginpath)
registered = False
for plugin in plugins:
+ if hasattr(plugin, 'tinfoil_init') and global_args.force <= 1:
+ plugin.tinfoil_init(tinfoil)
if hasattr(plugin, 'register_commands'):
registered = True
plugin.register_commands(subparsers)
- if hasattr(plugin, 'tinfoil_init'):
- plugin.tinfoil_init(tinfoil)
if not registered:
logger.error("No commands registered - missing plugins?")
diff --git a/bitbake/bin/bitbake-prserv b/bitbake/bin/bitbake-prserv
index 5be42f3ce5..580e021fda 100755
--- a/bitbake/bin/bitbake-prserv
+++ b/bitbake/bin/bitbake-prserv
@@ -7,49 +7,97 @@
import os
import sys,logging
-import optparse
+import argparse
import warnings
warnings.simplefilter("default")
-sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(__file__)),'lib'))
+sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(__file__)), "lib"))
import prserv
import prserv.serv
-__version__="1.0.0"
+VERSION = "2.0.0"
-PRHOST_DEFAULT='0.0.0.0'
+PRHOST_DEFAULT="0.0.0.0"
PRPORT_DEFAULT=8585
+def init_logger(logfile, loglevel):
+ numeric_level = getattr(logging, loglevel.upper(), None)
+ if not isinstance(numeric_level, int):
+ raise ValueError("Invalid log level: %s" % loglevel)
+ FORMAT = "%(asctime)-15s %(message)s"
+ logging.basicConfig(level=numeric_level, filename=logfile, format=FORMAT)
+
def main():
- parser = optparse.OptionParser(
- version="Bitbake PR Service Core version %s, %%prog version %s" % (prserv.__version__, __version__),
- usage = "%prog < --start | --stop > [options]")
+ parser = argparse.ArgumentParser(
+ description="BitBake PR Server. Version=%s" % VERSION,
+ formatter_class=argparse.RawTextHelpFormatter)
- parser.add_option("-f", "--file", help="database filename(default: prserv.sqlite3)", action="store",
- dest="dbfile", type="string", default="prserv.sqlite3")
- parser.add_option("-l", "--log", help="log filename(default: prserv.log)", action="store",
- dest="logfile", type="string", default="prserv.log")
- parser.add_option("--loglevel", help="logging level, i.e. CRITICAL, ERROR, WARNING, INFO, DEBUG",
- action = "store", type="string", dest="loglevel", default = "INFO")
- parser.add_option("--start", help="start daemon",
- action="store_true", dest="start")
- parser.add_option("--stop", help="stop daemon",
- action="store_true", dest="stop")
- parser.add_option("--host", help="ip address to bind", action="store",
- dest="host", type="string", default=PRHOST_DEFAULT)
- parser.add_option("--port", help="port number(default: 8585)", action="store",
- dest="port", type="int", default=PRPORT_DEFAULT)
- parser.add_option("-r", "--read-only", help="open database in read-only mode",
- action="store_true")
+ parser.add_argument(
+ "-f",
+ "--file",
+ default="prserv.sqlite3",
+ help="database filename (default: prserv.sqlite3)",
+ )
+ parser.add_argument(
+ "-l",
+ "--log",
+ default="prserv.log",
+ help="log filename(default: prserv.log)",
+ )
+ parser.add_argument(
+ "--loglevel",
+ default="INFO",
+ help="logging level, i.e. CRITICAL, ERROR, WARNING, INFO, DEBUG",
+ )
+ parser.add_argument(
+ "--start",
+ action="store_true",
+ help="start daemon",
+ )
+ parser.add_argument(
+ "--stop",
+ action="store_true",
+ help="stop daemon",
+ )
+ parser.add_argument(
+ "--host",
+ help="ip address to bind",
+ default=PRHOST_DEFAULT,
+ )
+ parser.add_argument(
+ "--port",
+ type=int,
+ default=PRPORT_DEFAULT,
+ help="port number (default: 8585)",
+ )
+ parser.add_argument(
+ "-r",
+ "--read-only",
+ action="store_true",
+ help="open database in read-only mode",
+ )
+ parser.add_argument(
+ "-u",
+ "--upstream",
+ default=os.environ.get("PRSERVER_UPSTREAM", None),
+ help="Upstream PR service (host:port)",
+ )
- options, args = parser.parse_args(sys.argv)
- prserv.init_logger(os.path.abspath(options.logfile),options.loglevel)
+ args = parser.parse_args()
+ init_logger(os.path.abspath(args.log), args.loglevel)
- if options.start:
- ret=prserv.serv.start_daemon(options.dbfile, options.host, options.port,os.path.abspath(options.logfile), options.read_only)
- elif options.stop:
- ret=prserv.serv.stop_daemon(options.host, options.port)
+ if args.start:
+ ret=prserv.serv.start_daemon(
+ args.file,
+ args.host,
+ args.port,
+ os.path.abspath(args.log),
+ args.read_only,
+ args.upstream
+ )
+ elif args.stop:
+ ret=prserv.serv.stop_daemon(args.host, args.port)
else:
ret=parser.print_help()
return ret
diff --git a/bitbake/bin/bitbake-selftest b/bitbake/bin/bitbake-selftest
index f25f23b1ae..ce901232fe 100755
--- a/bitbake/bin/bitbake-selftest
+++ b/bitbake/bin/bitbake-selftest
@@ -15,6 +15,7 @@ import unittest
try:
import bb
import hashserv
+ import prserv
import layerindexlib
except RuntimeError as exc:
sys.exit(str(exc))
@@ -33,6 +34,7 @@ tests = ["bb.tests.codeparser",
"bb.tests.utils",
"bb.tests.compression",
"hashserv.tests",
+ "prserv.tests",
"layerindexlib.tests.layerindexobj",
"layerindexlib.tests.restapi",
"layerindexlib.tests.cooker"]
diff --git a/bitbake/bin/bitbake-server b/bitbake/bin/bitbake-server
index f53f88b6b0..454a3919aa 100755
--- a/bitbake/bin/bitbake-server
+++ b/bitbake/bin/bitbake-server
@@ -12,11 +12,12 @@ warnings.simplefilter("default")
import logging
sys.path.insert(0, os.path.join(os.path.dirname(os.path.dirname(sys.argv[0])), 'lib'))
-if sys.getfilesystemencoding() != "utf-8":
- sys.exit("Please use a locale setting which supports UTF-8 (such as LANG=en_US.UTF-8).\nPython can't change the filesystem locale after loading so we need a UTF-8 when Python starts or things won't work.")
+import bb
+
+bb.utils.check_system_locale()
# Users shouldn't be running this code directly
-if len(sys.argv) != 10 or not sys.argv[1].startswith("decafbad"):
+if len(sys.argv) != 11 or not sys.argv[1].startswith("decafbad"):
print("bitbake-server is meant for internal execution by bitbake itself, please don't use it standalone.")
sys.exit(1)
@@ -28,7 +29,8 @@ logfile = sys.argv[4]
lockname = sys.argv[5]
sockname = sys.argv[6]
timeout = float(sys.argv[7])
-xmlrpcinterface = (sys.argv[8], int(sys.argv[9]))
+profile = bool(int(sys.argv[8]))
+xmlrpcinterface = (sys.argv[9], int(sys.argv[10]))
if xmlrpcinterface[0] == "None":
xmlrpcinterface = (None, xmlrpcinterface[1])
@@ -49,5 +51,5 @@ logger = logging.getLogger("BitBake")
handler = bb.event.LogHandler()
logger.addHandler(handler)
-bb.server.process.execServer(lockfd, readypipeinfd, lockname, sockname, timeout, xmlrpcinterface)
+bb.server.process.execServer(lockfd, readypipeinfd, lockname, sockname, timeout, xmlrpcinterface, profile)
diff --git a/bitbake/bin/bitbake-worker b/bitbake/bin/bitbake-worker
index 7be39370b3..e8073f2ac3 100755
--- a/bitbake/bin/bitbake-worker
+++ b/bitbake/bin/bitbake-worker
@@ -24,8 +24,7 @@ import subprocess
from multiprocessing import Lock
from threading import Thread
-if sys.getfilesystemencoding() != "utf-8":
- sys.exit("Please use a locale setting which supports UTF-8 (such as LANG=en_US.UTF-8).\nPython can't change the filesystem locale after loading so we need a UTF-8 when Python starts or things won't work.")
+bb.utils.check_system_locale()
# Users shouldn't be running this code directly
if len(sys.argv) != 2 or not sys.argv[1].startswith("decafbad"):
@@ -92,19 +91,19 @@ def worker_fire_prepickled(event):
worker_thread_exit = False
def worker_flush(worker_queue):
- worker_queue_int = b""
+ worker_queue_int = bytearray()
global worker_pipe, worker_thread_exit
while True:
try:
- worker_queue_int = worker_queue_int + worker_queue.get(True, 1)
+ worker_queue_int.extend(worker_queue.get(True, 1))
except queue.Empty:
pass
while (worker_queue_int or not worker_queue.empty()):
try:
(_, ready, _) = select.select([], [worker_pipe], [], 1)
if not worker_queue.empty():
- worker_queue_int = worker_queue_int + worker_queue.get()
+ worker_queue_int.extend(worker_queue.get())
written = os.write(worker_pipe, worker_queue_int)
worker_queue_int = worker_queue_int[written:]
except (IOError, OSError) as e:
@@ -122,11 +121,10 @@ def worker_child_fire(event, d):
data = b"<event>" + pickle.dumps(event) + b"</event>"
try:
- worker_pipe_lock.acquire()
- while(len(data)):
- written = worker_pipe.write(data)
- data = data[written:]
- worker_pipe_lock.release()
+ with bb.utils.lock_timeout(worker_pipe_lock):
+ while(len(data)):
+ written = worker_pipe.write(data)
+ data = data[written:]
except IOError:
sigterm_handler(None, None)
raise
@@ -145,7 +143,17 @@ def sigterm_handler(signum, frame):
os.killpg(0, signal.SIGTERM)
sys.exit()
-def fork_off_task(cfg, data, databuilder, workerdata, fn, task, taskname, taskhash, unihash, appends, taskdepdata, extraconfigdata, quieterrors=False, dry_run_exec=False):
+def fork_off_task(cfg, data, databuilder, workerdata, extraconfigdata, runtask):
+
+ fn = runtask['fn']
+ task = runtask['task']
+ taskname = runtask['taskname']
+ taskhash = runtask['taskhash']
+ unihash = runtask['unihash']
+ appends = runtask['appends']
+ layername = runtask['layername']
+ taskdepdata = runtask['taskdepdata']
+ quieterrors = runtask['quieterrors']
# We need to setup the environment BEFORE the fork, since
# a fork() or exec*() activates PSEUDO...
@@ -157,8 +165,7 @@ def fork_off_task(cfg, data, databuilder, workerdata, fn, task, taskname, taskha
uid = os.getuid()
gid = os.getgid()
-
- taskdep = workerdata["taskdeps"][fn]
+ taskdep = runtask['taskdep']
if 'umask' in taskdep and taskname in taskdep['umask']:
umask = taskdep['umask'][taskname]
elif workerdata["umask"]:
@@ -170,25 +177,25 @@ def fork_off_task(cfg, data, databuilder, workerdata, fn, task, taskname, taskha
except TypeError:
pass
- dry_run = cfg.dry_run or dry_run_exec
+ dry_run = cfg.dry_run or runtask['dry_run']
# We can't use the fakeroot environment in a dry run as it possibly hasn't been built
if 'fakeroot' in taskdep and taskname in taskdep['fakeroot'] and not dry_run:
fakeroot = True
- envvars = (workerdata["fakerootenv"][fn] or "").split()
- for key, value in (var.split('=') for var in envvars):
+ envvars = (runtask['fakerootenv'] or "").split()
+ for key, value in (var.split('=',1) for var in envvars):
envbackup[key] = os.environ.get(key)
os.environ[key] = value
fakeenv[key] = value
- fakedirs = (workerdata["fakerootdirs"][fn] or "").split()
+ fakedirs = (runtask['fakerootdirs'] or "").split()
for p in fakedirs:
bb.utils.mkdirhier(p)
logger.debug2('Running %s:%s under fakeroot, fakedirs: %s' %
(fn, taskname, ', '.join(fakedirs)))
else:
- envvars = (workerdata["fakerootnoenv"][fn] or "").split()
- for key, value in (var.split('=') for var in envvars):
+ envvars = (runtask['fakerootnoenv'] or "").split()
+ for key, value in (var.split('=',1) for var in envvars):
envbackup[key] = os.environ.get(key)
os.environ[key] = value
fakeenv[key] = value
@@ -230,15 +237,16 @@ def fork_off_task(cfg, data, databuilder, workerdata, fn, task, taskname, taskha
# Let SIGHUP exit as SIGTERM
signal.signal(signal.SIGHUP, sigterm_handler)
- # No stdin
- newsi = os.open(os.devnull, os.O_RDWR)
- os.dup2(newsi, sys.stdin.fileno())
+ # No stdin & stdout
+ # stdout is used as a status report channel and must not be used by child processes.
+ dumbio = os.open(os.devnull, os.O_RDWR)
+ os.dup2(dumbio, sys.stdin.fileno())
+ os.dup2(dumbio, sys.stdout.fileno())
- if umask:
+ if umask is not None:
os.umask(umask)
try:
- bb_cache = bb.cache.NoCache(databuilder)
(realfn, virtual, mc) = bb.cache.virtualfn2realfn(fn)
the_data = databuilder.mcdata[mc]
the_data.setVar("BB_WORKERCONTEXT", "1")
@@ -257,13 +265,14 @@ def fork_off_task(cfg, data, databuilder, workerdata, fn, task, taskname, taskha
bb.parse.siggen.set_taskhashes(workerdata["newhashes"])
ret = 0
- the_data = bb_cache.loadDataFull(fn, appends)
+ the_data = databuilder.parseRecipe(fn, appends, layername)
the_data.setVar('BB_TASKHASH', taskhash)
the_data.setVar('BB_UNIHASH', unihash)
+ bb.parse.siggen.setup_datacache_from_datastore(fn, the_data)
bb.utils.set_process_name("%s:%s" % (the_data.getVar("PN"), taskname.replace("do_", "")))
- if not the_data.getVarFlag(taskname, 'network', False):
+ if not bb.utils.to_boolean(the_data.getVarFlag(taskname, 'network')):
if bb.utils.is_local_uid(uid):
logger.debug("Attempting to disable network for %s" % taskname)
bb.utils.disable_network(uid, gid)
@@ -298,6 +307,10 @@ def fork_off_task(cfg, data, databuilder, workerdata, fn, task, taskname, taskha
if not quieterrors:
logger.critical(traceback.format_exc())
os._exit(1)
+
+ sys.stdout.flush()
+ sys.stderr.flush()
+
try:
if dry_run:
return 0
@@ -339,12 +352,12 @@ class runQueueWorkerPipe():
if pipeout:
pipeout.close()
bb.utils.nonblockingfd(self.input)
- self.queue = b""
+ self.queue = bytearray()
def read(self):
start = len(self.queue)
try:
- self.queue = self.queue + (self.input.read(102400) or b"")
+ self.queue.extend(self.input.read(102400) or b"")
except (OSError, IOError) as e:
if e.errno != errno.EAGAIN:
raise
@@ -372,7 +385,7 @@ class BitbakeWorker(object):
def __init__(self, din):
self.input = din
bb.utils.nonblockingfd(self.input)
- self.queue = b""
+ self.queue = bytearray()
self.cookercfg = None
self.databuilder = None
self.data = None
@@ -406,7 +419,7 @@ class BitbakeWorker(object):
if len(r) == 0:
# EOF on pipe, server must have terminated
self.sigterm_exception(signal.SIGTERM, None)
- self.queue = self.queue + r
+ self.queue.extend(r)
except (OSError, IOError):
pass
if len(self.queue):
@@ -426,18 +439,30 @@ class BitbakeWorker(object):
while self.process_waitpid():
continue
-
def handle_item(self, item, func):
- if self.queue.startswith(b"<" + item + b">"):
- index = self.queue.find(b"</" + item + b">")
- while index != -1:
- try:
- func(self.queue[(len(item) + 2):index])
- except pickle.UnpicklingError:
- workerlog_write("Unable to unpickle data: %s\n" % ":".join("{:02x}".format(c) for c in self.queue))
- raise
- self.queue = self.queue[(index + len(item) + 3):]
- index = self.queue.find(b"</" + item + b">")
+ opening_tag = b"<" + item + b">"
+ if not self.queue.startswith(opening_tag):
+ return
+
+ tag_len = len(opening_tag)
+ if len(self.queue) < tag_len + 4:
+ # we need to receive more data
+ return
+ header = self.queue[tag_len:tag_len + 4]
+ payload_len = int.from_bytes(header, 'big')
+ # closing tag has length (tag_len + 1)
+ if len(self.queue) < tag_len * 2 + 1 + payload_len:
+ # we need to receive more data
+ return
+
+ index = self.queue.find(b"</" + item + b">")
+ if index != -1:
+ try:
+ func(self.queue[(tag_len + 4):index])
+ except pickle.UnpicklingError:
+ workerlog_write("Unable to unpickle data: %s\n" % ":".join("{:02x}".format(c) for c in self.queue))
+ raise
+ self.queue = self.queue[(index + len(b"</") + len(item) + len(b">")):]
def handle_cookercfg(self, data):
self.cookercfg = pickle.loads(data)
@@ -475,11 +500,15 @@ class BitbakeWorker(object):
sys.exit(0)
def handle_runtask(self, data):
- fn, task, taskname, taskhash, unihash, quieterrors, appends, taskdepdata, dry_run_exec = pickle.loads(data)
- workerlog_write("Handling runtask %s %s %s\n" % (task, fn, taskname))
+ runtask = pickle.loads(data)
- pid, pipein, pipeout = fork_off_task(self.cookercfg, self.data, self.databuilder, self.workerdata, fn, task, taskname, taskhash, unihash, appends, taskdepdata, self.extraconfigdata, quieterrors, dry_run_exec)
+ fn = runtask['fn']
+ task = runtask['task']
+ taskname = runtask['taskname']
+
+ workerlog_write("Handling runtask %s %s %s\n" % (task, fn, taskname))
+ pid, pipein, pipeout = fork_off_task(self.cookercfg, self.data, self.databuilder, self.workerdata, self.extraconfigdata, runtask)
self.build_pids[pid] = task
self.build_pipes[pid] = runQueueWorkerPipe(pipein, pipeout)
diff --git a/bitbake/bin/git-make-shallow b/bitbake/bin/git-make-shallow
index d0532c5ab8..9de557c10e 100755
--- a/bitbake/bin/git-make-shallow
+++ b/bitbake/bin/git-make-shallow
@@ -24,15 +24,17 @@ warnings.simplefilter("default")
version = 1.0
+git_cmd = ['git', '-c', 'safe.bareRepository=all']
+
def main():
if sys.version_info < (3, 4, 0):
sys.exit('Python 3.4 or greater is required')
- git_dir = check_output(['git', 'rev-parse', '--git-dir']).rstrip()
+ git_dir = check_output(git_cmd + ['rev-parse', '--git-dir']).rstrip()
shallow_file = os.path.join(git_dir, 'shallow')
if os.path.exists(shallow_file):
try:
- check_output(['git', 'fetch', '--unshallow'])
+ check_output(git_cmd + ['fetch', '--unshallow'])
except subprocess.CalledProcessError:
try:
os.unlink(shallow_file)
@@ -41,21 +43,21 @@ def main():
raise
args = process_args()
- revs = check_output(['git', 'rev-list'] + args.revisions).splitlines()
+ revs = check_output(git_cmd + ['rev-list'] + args.revisions).splitlines()
make_shallow(shallow_file, args.revisions, args.refs)
- ref_revs = check_output(['git', 'rev-list'] + args.refs).splitlines()
+ ref_revs = check_output(git_cmd + ['rev-list'] + args.refs).splitlines()
remaining_history = set(revs) & set(ref_revs)
for rev in remaining_history:
- if check_output(['git', 'rev-parse', '{}^@'.format(rev)]):
+ if check_output(git_cmd + ['rev-parse', '{}^@'.format(rev)]):
sys.exit('Error: %s was not made shallow' % rev)
filter_refs(args.refs)
if args.shrink:
shrink_repo(git_dir)
- subprocess.check_call(['git', 'fsck', '--unreachable'])
+ subprocess.check_call(git_cmd + ['fsck', '--unreachable'])
def process_args():
@@ -72,12 +74,12 @@ def process_args():
args = parser.parse_args()
if args.refs:
- args.refs = check_output(['git', 'rev-parse', '--symbolic-full-name'] + args.refs).splitlines()
+ args.refs = check_output(git_cmd + ['rev-parse', '--symbolic-full-name'] + args.refs).splitlines()
else:
args.refs = get_all_refs(lambda r, t, tt: t == 'commit' or tt == 'commit')
args.refs = list(filter(lambda r: not r.endswith('/HEAD'), args.refs))
- args.revisions = check_output(['git', 'rev-parse'] + ['%s^{}' % i for i in args.revisions]).splitlines()
+ args.revisions = check_output(git_cmd + ['rev-parse'] + ['%s^{}' % i for i in args.revisions]).splitlines()
return args
@@ -95,7 +97,7 @@ def make_shallow(shallow_file, revisions, refs):
def get_all_refs(ref_filter=None):
"""Return all the existing refs in this repository, optionally filtering the refs."""
- ref_output = check_output(['git', 'for-each-ref', '--format=%(refname)\t%(objecttype)\t%(*objecttype)'])
+ ref_output = check_output(git_cmd + ['for-each-ref', '--format=%(refname)\t%(objecttype)\t%(*objecttype)'])
ref_split = [tuple(iter_extend(l.rsplit('\t'), 3)) for l in ref_output.splitlines()]
if ref_filter:
ref_split = (e for e in ref_split if ref_filter(*e))
@@ -113,7 +115,7 @@ def filter_refs(refs):
all_refs = get_all_refs()
to_remove = set(all_refs) - set(refs)
if to_remove:
- check_output(['xargs', '-0', '-n', '1', 'git', 'update-ref', '-d', '--no-deref'],
+ check_output(['xargs', '-0', '-n', '1'] + git_cmd + ['update-ref', '-d', '--no-deref'],
input=''.join(l + '\0' for l in to_remove))
@@ -126,7 +128,7 @@ def follow_history_intersections(revisions, refs):
if rev in seen:
continue
- parents = check_output(['git', 'rev-parse', '%s^@' % rev]).splitlines()
+ parents = check_output(git_cmd + ['rev-parse', '%s^@' % rev]).splitlines()
yield rev
seen.add(rev)
@@ -134,12 +136,12 @@ def follow_history_intersections(revisions, refs):
if not parents:
continue
- check_refs = check_output(['git', 'merge-base', '--independent'] + sorted(refs)).splitlines()
+ check_refs = check_output(git_cmd + ['merge-base', '--independent'] + sorted(refs)).splitlines()
for parent in parents:
for ref in check_refs:
print("Checking %s vs %s" % (parent, ref))
try:
- merge_base = check_output(['git', 'merge-base', parent, ref]).rstrip()
+ merge_base = check_output(git_cmd + ['merge-base', parent, ref]).rstrip()
except subprocess.CalledProcessError:
continue
else:
@@ -159,14 +161,14 @@ def iter_except(func, exception, start=None):
def shrink_repo(git_dir):
"""Shrink the newly shallow repository, removing the unreachable objects."""
- subprocess.check_call(['git', 'reflog', 'expire', '--expire-unreachable=now', '--all'])
- subprocess.check_call(['git', 'repack', '-ad'])
+ subprocess.check_call(git_cmd + ['reflog', 'expire', '--expire-unreachable=now', '--all'])
+ subprocess.check_call(git_cmd + ['repack', '-ad'])
try:
os.unlink(os.path.join(git_dir, 'objects', 'info', 'alternates'))
except OSError as exc:
if exc.errno != errno.ENOENT:
raise
- subprocess.check_call(['git', 'prune', '--expire', 'now'])
+ subprocess.check_call(git_cmd + ['prune', '--expire', 'now'])
if __name__ == '__main__':
diff --git a/bitbake/bin/toaster b/bitbake/bin/toaster
index 558a819570..f002c8c159 100755
--- a/bitbake/bin/toaster
+++ b/bitbake/bin/toaster
@@ -84,7 +84,7 @@ webserverStartAll()
echo "Starting webserver..."
$MANAGE runserver --noreload "$ADDR_PORT" \
- </dev/null >>${BUILDDIR}/toaster_web.log 2>&1 \
+ </dev/null >>${TOASTER_LOGS_DIR}/web.log 2>&1 \
& echo $! >${BUILDDIR}/.toastermain.pid
sleep 1
@@ -181,6 +181,14 @@ WEBSERVER=1
export TOASTER_BUILDSERVER=1
ADDR_PORT="localhost:8000"
TOASTERDIR=`dirname $BUILDDIR`
+# ${BUILDDIR}/toaster_logs/ became the default location for toaster logs
+# This is needed for implemented django-log-viewer: https://pypi.org/project/django-log-viewer/
+# If the directory does not exist, create it.
+TOASTER_LOGS_DIR="${BUILDDIR}/toaster_logs/"
+if [ ! -d $TOASTER_LOGS_DIR ]
+then
+ mkdir $TOASTER_LOGS_DIR
+fi
unset CMD
for param in $*; do
case $param in
@@ -299,7 +307,7 @@ case $CMD in
export BITBAKE_UI='toasterui'
if [ $TOASTER_BUILDSERVER -eq 1 ] ; then
$MANAGE runbuilds \
- </dev/null >>${BUILDDIR}/toaster_runbuilds.log 2>&1 \
+ </dev/null >>${TOASTER_LOGS_DIR}/toaster_runbuilds.log 2>&1 \
& echo $! >${BUILDDIR}/.runbuilds.pid
else
echo "Toaster build server not started."
diff --git a/bitbake/bin/toaster-eventreplay b/bitbake/bin/toaster-eventreplay
index 404b61f516..74a319320e 100755
--- a/bitbake/bin/toaster-eventreplay
+++ b/bitbake/bin/toaster-eventreplay
@@ -30,79 +30,23 @@ sys.path.insert(0, join(dirname(dirname(abspath(__file__))), 'lib'))
import bb.cooker
from bb.ui import toasterui
-
-class EventPlayer:
- """Emulate a connection to a bitbake server."""
-
- def __init__(self, eventfile, variables):
- self.eventfile = eventfile
- self.variables = variables
- self.eventmask = []
-
- def waitEvent(self, _timeout):
- """Read event from the file."""
- line = self.eventfile.readline().strip()
- if not line:
- return
- try:
- event_str = json.loads(line)['vars'].encode('utf-8')
- event = pickle.loads(codecs.decode(event_str, 'base64'))
- event_name = "%s.%s" % (event.__module__, event.__class__.__name__)
- if event_name not in self.eventmask:
- return
- return event
- except ValueError as err:
- print("Failed loading ", line)
- raise err
-
- def runCommand(self, command_line):
- """Emulate running a command on the server."""
- name = command_line[0]
-
- if name == "getVariable":
- var_name = command_line[1]
- variable = self.variables.get(var_name)
- if variable:
- return variable['v'], None
- return None, "Missing variable %s" % var_name
-
- elif name == "getAllKeysWithFlags":
- dump = {}
- flaglist = command_line[1]
- for key, val in self.variables.items():
- try:
- if not key.startswith("__"):
- dump[key] = {
- 'v': val['v'],
- 'history' : val['history'],
- }
- for flag in flaglist:
- dump[key][flag] = val[flag]
- except Exception as err:
- print(err)
- return (dump, None)
-
- elif name == 'setEventMask':
- self.eventmask = command_line[-1]
- return True, None
-
- else:
- raise Exception("Command %s not implemented" % command_line[0])
-
- def getEventHandle(self):
- """
- This method is called by toasterui.
- The return value is passed to self.runCommand but not used there.
- """
- pass
+from bb.ui import eventreplay
def main(argv):
with open(argv[-1]) as eventfile:
# load variables from the first line
- variables = json.loads(eventfile.readline().strip())['allvariables']
-
+ variables = None
+ while line := eventfile.readline().strip():
+ try:
+ variables = json.loads(line)['allvariables']
+ break
+ except (KeyError, json.JSONDecodeError):
+ continue
+ if not variables:
+ sys.exit("Cannot find allvariables entry in event log file %s" % argv[-1])
+ eventfile.seek(0)
params = namedtuple('ConfigParams', ['observe_only'])(True)
- player = EventPlayer(eventfile, variables)
+ player = eventreplay.EventPlayer(eventfile, variables)
return toasterui.main(player, player, params)
diff --git a/bitbake/contrib/vim/indent/bitbake.vim b/bitbake/contrib/vim/indent/bitbake.vim
index 1381034098..7ee9d69938 100644
--- a/bitbake/contrib/vim/indent/bitbake.vim
+++ b/bitbake/contrib/vim/indent/bitbake.vim
@@ -40,7 +40,7 @@ set cpo&vim
let s:maxoff = 50 " maximum number of lines to look backwards for ()
-function GetPythonIndent(lnum)
+function! GetBBPythonIndent(lnum)
" If this line is explicitly joined: If the previous line was also joined,
" line it up with that one, otherwise add two 'shiftwidth'
@@ -257,7 +257,7 @@ let b:did_indent = 1
setlocal indentkeys+=0\"
-function BitbakeIndent(lnum)
+function! BitbakeIndent(lnum)
if !has('syntax_items')
return -1
endif
@@ -315,7 +315,7 @@ function BitbakeIndent(lnum)
endif
if index(["bbPyDefRegion", "bbPyFuncRegion"], name) != -1
- let ret = GetPythonIndent(a:lnum)
+ let ret = GetBBPythonIndent(a:lnum)
" Should normally always be indented by at least one shiftwidth; but allow
" return of -1 (defer to autoindent) or -2 (force indent to 0)
if ret == 0
diff --git a/bitbake/contrib/vim/syntax/bitbake.vim b/bitbake/contrib/vim/syntax/bitbake.vim
index c5ea80fdf2..8f39b8f951 100644
--- a/bitbake/contrib/vim/syntax/bitbake.vim
+++ b/bitbake/contrib/vim/syntax/bitbake.vim
@@ -63,13 +63,14 @@ syn region bbVarFlagFlag matchgroup=bbArrayBrackets start="\[" end="\]\s*
" Includes and requires
syn keyword bbInclude inherit include require contained
-syn match bbIncludeRest ".*$" contained contains=bbString,bbVarDeref
+syn match bbIncludeRest ".*$" contained contains=bbString,bbVarDeref,bbVarPyValue
syn match bbIncludeLine "^\(inherit\|include\|require\)\s\+" contains=bbInclude nextgroup=bbIncludeRest
" Add taks and similar
syn keyword bbStatement addtask deltask addhandler after before EXPORT_FUNCTIONS contained
-syn match bbStatementRest ".*$" skipwhite contained contains=bbStatement
-syn match bbStatementLine "^\(addtask\|deltask\|addhandler\|after\|before\|EXPORT_FUNCTIONS\)\s\+" contains=bbStatement nextgroup=bbStatementRest
+syn match bbStatementRest /[^\\]*$/ skipwhite contained contains=bbStatement,bbVarDeref,bbVarPyValue
+syn region bbStatementRestCont start=/.*\\$/ end=/^[^\\]*$/ contained contains=bbStatement,bbVarDeref,bbVarPyValue,bbContinue keepend
+syn match bbStatementLine "^\(addtask\|deltask\|addhandler\|after\|before\|EXPORT_FUNCTIONS\)\s\+" contains=bbStatement nextgroup=bbStatementRest,bbStatementRestCont
" OE Important Functions
syn keyword bbOEFunctions do_fetch do_unpack do_patch do_configure do_compile do_stage do_install do_package contained
@@ -122,6 +123,7 @@ hi def link bbPyFlag Type
hi def link bbPyDef Statement
hi def link bbStatement Statement
hi def link bbStatementRest Identifier
+hi def link bbStatementRestCont Identifier
hi def link bbOEFunctions Special
hi def link bbVarPyValue PreProc
hi def link bbOverrideOperator Operator
diff --git a/bitbake/doc/README b/bitbake/doc/README
index cdbb23776e..d4f56afa37 100644
--- a/bitbake/doc/README
+++ b/bitbake/doc/README
@@ -47,8 +47,8 @@ To install all required packages run:
To build the documentation locally, run:
- $ cd documentation
- $ make -f Makefile.sphinx html
+ $ cd doc
+ $ make html
The resulting HTML index page will be _build/html/index.html, and you
can browse your own copy of the locally generated documentation with
diff --git a/bitbake/doc/_templates/footer.html b/bitbake/doc/_templates/footer.html
new file mode 100644
index 0000000000..1398f20d7e
--- /dev/null
+++ b/bitbake/doc/_templates/footer.html
@@ -0,0 +1,9 @@
+<footer>
+ <hr/>
+ <div role="contentinfo">
+ <p>&copy; Copyright {{ copyright }}
+ <br>Last updated on {{ last_updated }} from the <a href="https://git.openembedded.org/bitbake/">bitbake</a> git repository.
+ </p>
+ </div>
+</footer>
+
diff --git a/bitbake/doc/bitbake-user-manual/bitbake-user-manual-execution.rst b/bitbake/doc/bitbake-user-manual/bitbake-user-manual-execution.rst
index 7a22e96edf..d58fbb32ea 100644
--- a/bitbake/doc/bitbake-user-manual/bitbake-user-manual-execution.rst
+++ b/bitbake/doc/bitbake-user-manual/bitbake-user-manual-execution.rst
@@ -552,8 +552,8 @@ through dependency chains are more complex and are generally
accomplished with a Python function. The code in
``meta/lib/oe/sstatesig.py`` shows two examples of this and also
illustrates how you can insert your own policy into the system if so
-desired. This file defines the two basic signature generators
-OpenEmbedded-Core uses: "OEBasic" and "OEBasicHash". By default, there
+desired. This file defines the basic signature generator
+OpenEmbedded-Core uses: "OEBasicHash". By default, there
is a dummy "noop" signature handler enabled in BitBake. This means that
behavior is unchanged from previous versions. ``OE-Core`` uses the
"OEBasicHash" signature handler by default through this setting in the
@@ -561,14 +561,13 @@ behavior is unchanged from previous versions. ``OE-Core`` uses the
BB_SIGNATURE_HANDLER ?= "OEBasicHash"
-The "OEBasicHash" :term:`BB_SIGNATURE_HANDLER` is the same as the "OEBasic"
-version but adds the task hash to the stamp files. This results in any
-metadata change that changes the task hash, automatically causing the
-task to be run again. This removes the need to bump
-:term:`PR` values, and changes to metadata automatically
-ripple across the build.
+The main feature of the "OEBasicHash" :term:`BB_SIGNATURE_HANDLER` is that
+it adds the task hash to the stamp files. Thanks to this, any metadata
+change will change the task hash, automatically causing the task to be run
+again. This removes the need to bump :term:`PR` values, and changes to
+metadata automatically ripple across the build.
-It is also worth noting that the end result of these signature
+It is also worth noting that the end result of signature
generators is to make some dependency and hash information available to
the build. This information includes:
@@ -587,10 +586,11 @@ or possibly those defined in the metadata/signature handler itself. The
simplest parameter to pass is "none", which causes a set of signature
information to be written out into ``STAMPS_DIR`` corresponding to the
targets specified. The other currently available parameter is
-"printdiff", which causes BitBake to try to establish the closest
+"printdiff", which causes BitBake to try to establish the most recent
signature match it can (e.g. in the sstate cache) and then run
-``bitbake-diffsigs`` over the matches to determine the stamps and delta
-where these two stamp trees diverge.
+compare the matched signatures to determine the stamps and delta
+where these two stamp trees diverge. This can be used to determine why
+tasks need to be re-run in situations where that is not expected.
.. note::
@@ -657,7 +657,7 @@ builds are when execute, bitbake also supports user defined
configuration of the `Python
logging <https://docs.python.org/3/library/logging.html>`__ facilities
through the :term:`BB_LOGCONFIG` variable. This
-variable defines a json or yaml `logging
+variable defines a JSON or YAML `logging
configuration <https://docs.python.org/3/library/logging.config.html>`__
that will be intelligently merged into the default configuration. The
logging configuration is merged using the following rules:
@@ -691,9 +691,9 @@ logging configuration is merged using the following rules:
adds a filter called ``BitBake.defaultFilter``, both filters will be
applied to the logger
-As an example, consider the following user logging configuration file
-which logs all Hash Equivalence related messages of VERBOSE or higher to
-a file called ``hashequiv.log`` ::
+As a first example, you can create a ``hashequiv.json`` user logging
+configuration file to log all Hash Equivalence related messages of ``VERBOSE``
+or higher priority to a file called ``hashequiv.log``::
{
"version": 1,
@@ -722,3 +722,40 @@ a file called ``hashequiv.log`` ::
}
}
}
+
+Then set the :term:`BB_LOGCONFIG` variable in ``conf/local.conf``::
+
+ BB_LOGCONFIG = "hashequiv.json"
+
+Another example is this ``warn.json`` file to log all ``WARNING`` and
+higher priority messages to a ``warn.log`` file::
+
+ {
+ "version": 1,
+ "formatters": {
+ "warnlogFormatter": {
+ "()": "bb.msg.BBLogFormatter",
+ "format": "%(levelname)s: %(message)s"
+ }
+ },
+
+ "handlers": {
+ "warnlog": {
+ "class": "logging.FileHandler",
+ "formatter": "warnlogFormatter",
+ "level": "WARNING",
+ "filename": "warn.log"
+ }
+ },
+
+ "loggers": {
+ "BitBake": {
+ "handlers": ["warnlog"]
+ }
+ },
+
+ "@disable_existing_loggers": false
+ }
+
+Note that BitBake's helper classes for structured logging are implemented in
+``lib/bb/msg.py``.
diff --git a/bitbake/doc/bitbake-user-manual/bitbake-user-manual-fetching.rst b/bitbake/doc/bitbake-user-manual/bitbake-user-manual-fetching.rst
index 9c269ca837..fb4f0a23d7 100644
--- a/bitbake/doc/bitbake-user-manual/bitbake-user-manual-fetching.rst
+++ b/bitbake/doc/bitbake-user-manual/bitbake-user-manual-fetching.rst
@@ -424,8 +424,8 @@ This fetcher supports the following parameters:
- *"nobranch":* Tells the fetcher to not check the SHA validation for
the branch when set to "1". The default is "0". Set this option for
- the recipe that refers to the commit that is valid for a tag instead
- of the branch.
+ the recipe that refers to the commit that is valid for any namespace
+ (branch, tag, ...) instead of the branch.
- *"bareclone":* Tells the fetcher to clone a bare clone into the
destination directory without checking out a working tree. Only the
@@ -476,6 +476,14 @@ Here are some example URLs::
easy to share metadata without removing passwords. SSH keys, ``~/.netrc``
and ``~/.ssh/config`` files can be used as alternatives.
+Using tags with the git fetcher may cause surprising behaviour. Bitbake needs to
+resolve the tag to a specific revision and to do that, it has to connect to and use
+the upstream repository. This is because the revision the tags point at can change and
+we've seen cases of this happening in well known public repositories. This can mean
+many more network connections than expected and recipes may be reparsed at every build.
+Source mirrors will also be bypassed as the upstream repository is the only source
+of truth to resolve the revision accurately. For these reasons, whilst the fetcher
+can support tags, we recommend being specific about revisions in recipes.
.. _gitsm-fetcher:
@@ -688,6 +696,41 @@ Here is an example URL::
It can also be used when setting mirrors definitions using the :term:`PREMIRRORS` variable.
+.. _gcp-fetcher:
+
+GCP Fetcher (``gs://``)
+--------------------------
+
+This submodule fetches data from a
+`Google Cloud Storage Bucket <https://cloud.google.com/storage/docs/buckets>`__.
+It uses the `Google Cloud Storage Python Client <https://cloud.google.com/python/docs/reference/storage/latest>`__
+to check the status of objects in the bucket and download them.
+The use of the Python client makes it substantially faster than using command
+line tools such as gsutil.
+
+The fetcher requires the Google Cloud Storage Python Client to be installed, along
+with the gsutil tool.
+
+The fetcher requires that the machine has valid credentials for accessing the
+chosen bucket. Instructions for authentication can be found in the
+`Google Cloud documentation <https://cloud.google.com/docs/authentication/provide-credentials-adc#local-dev>`__.
+
+If it used from the OpenEmbedded build system, the fetcher can be used for
+fetching sstate artifacts from a GCS bucket by specifying the
+``SSTATE_MIRRORS`` variable as shown below::
+
+ SSTATE_MIRRORS ?= "\
+ file://.* gs://<bucket name>/PATH \
+ "
+
+The fetcher can also be used in recipes::
+
+ SRC_URI = "gs://<bucket name>/<foo_container>/<bar_file>"
+
+However, the checksum of the file should be also be provided::
+
+ SRC_URI[sha256sum] = "<sha256 string>"
+
.. _crate-fetcher:
Crate Fetcher (``crate://``)
@@ -740,7 +783,7 @@ Here is an example URL with both fetchers::
"
See :yocto_docs:`Creating Node Package Manager (NPM) Packages
-</dev-manual/common-tasks.html#creating-node-package-manager-npm-packages>`
+</dev-manual/packages.html#creating-node-package-manager-npm-packages>`
in the Yocto Project manual for details about using
:yocto_docs:`devtool <https://docs.yoctoproject.org/ref-manual/devtool-reference.html>`
to automatically create a recipe from an NPM URL.
@@ -777,7 +820,7 @@ the package which has such dependencies, for example::
Such a file can automatically be generated using
:yocto_docs:`devtool <https://docs.yoctoproject.org/ref-manual/devtool-reference.html>`
as described in the :yocto_docs:`Creating Node Package Manager (NPM) Packages
-</dev-manual/common-tasks.html#creating-node-package-manager-npm-packages>`
+</dev-manual/packages.html#creating-node-package-manager-npm-packages>`
section of the Yocto Project.
Other Fetchers
@@ -791,6 +834,8 @@ Fetch submodules also exist for the following:
- OSC (``osc://``)
+- S3 (``s3://``)
+
- Secure FTP (``sftp://``)
- Secure Shell (``ssh://``)
diff --git a/bitbake/doc/bitbake-user-manual/bitbake-user-manual-hello.rst b/bitbake/doc/bitbake-user-manual/bitbake-user-manual-hello.rst
index 722dc5a2cc..654196ca24 100644
--- a/bitbake/doc/bitbake-user-manual/bitbake-user-manual-hello.rst
+++ b/bitbake/doc/bitbake-user-manual/bitbake-user-manual-hello.rst
@@ -18,28 +18,32 @@ it.
Obtaining BitBake
=================
-See the :ref:`bitbake-user-manual/bitbake-user-manual-hello:obtaining bitbake` section for
+See the :ref:`bitbake-user-manual/bitbake-user-manual-intro:obtaining bitbake` section for
information on how to obtain BitBake. Once you have the source code on
your machine, the BitBake directory appears as follows::
$ ls -al
- total 100
- drwxrwxr-x. 9 wmat wmat 4096 Jan 31 13:44 .
- drwxrwxr-x. 3 wmat wmat 4096 Feb 4 10:45 ..
- -rw-rw-r--. 1 wmat wmat 365 Nov 26 04:55 AUTHORS
- drwxrwxr-x. 2 wmat wmat 4096 Nov 26 04:55 bin
- drwxrwxr-x. 4 wmat wmat 4096 Jan 31 13:44 build
- -rw-rw-r--. 1 wmat wmat 16501 Nov 26 04:55 ChangeLog
- drwxrwxr-x. 2 wmat wmat 4096 Nov 26 04:55 classes
- drwxrwxr-x. 2 wmat wmat 4096 Nov 26 04:55 conf
- drwxrwxr-x. 3 wmat wmat 4096 Nov 26 04:55 contrib
- -rw-rw-r--. 1 wmat wmat 17987 Nov 26 04:55 COPYING
- drwxrwxr-x. 3 wmat wmat 4096 Nov 26 04:55 doc
- -rw-rw-r--. 1 wmat wmat 69 Nov 26 04:55 .gitignore
- -rw-rw-r--. 1 wmat wmat 849 Nov 26 04:55 HEADER
- drwxrwxr-x. 5 wmat wmat 4096 Jan 31 13:44 lib
- -rw-rw-r--. 1 wmat wmat 195 Nov 26 04:55 MANIFEST.in
- -rw-rw-r--. 1 wmat wmat 2887 Nov 26 04:55 TODO
+ total 108
+ drwxr-xr-x 9 fawkh 10000 4096 feb 24 12:10 .
+ drwx------ 36 fawkh 10000 4096 mar 2 17:00 ..
+ -rw-r--r-- 1 fawkh 10000 365 feb 24 12:10 AUTHORS
+ drwxr-xr-x 2 fawkh 10000 4096 feb 24 12:10 bin
+ -rw-r--r-- 1 fawkh 10000 16501 feb 24 12:10 ChangeLog
+ drwxr-xr-x 2 fawkh 10000 4096 feb 24 12:10 classes
+ drwxr-xr-x 2 fawkh 10000 4096 feb 24 12:10 conf
+ drwxr-xr-x 5 fawkh 10000 4096 feb 24 12:10 contrib
+ drwxr-xr-x 6 fawkh 10000 4096 feb 24 12:10 doc
+ drwxr-xr-x 8 fawkh 10000 4096 mar 2 16:26 .git
+ -rw-r--r-- 1 fawkh 10000 31 feb 24 12:10 .gitattributes
+ -rw-r--r-- 1 fawkh 10000 392 feb 24 12:10 .gitignore
+ drwxr-xr-x 13 fawkh 10000 4096 feb 24 12:11 lib
+ -rw-r--r-- 1 fawkh 10000 1224 feb 24 12:10 LICENSE
+ -rw-r--r-- 1 fawkh 10000 15394 feb 24 12:10 LICENSE.GPL-2.0-only
+ -rw-r--r-- 1 fawkh 10000 1286 feb 24 12:10 LICENSE.MIT
+ -rw-r--r-- 1 fawkh 10000 229 feb 24 12:10 MANIFEST.in
+ -rw-r--r-- 1 fawkh 10000 2413 feb 24 12:10 README
+ -rw-r--r-- 1 fawkh 10000 43 feb 24 12:10 toaster-requirements.txt
+ -rw-r--r-- 1 fawkh 10000 2887 feb 24 12:10 TODO
At this point, you should have BitBake cloned to a directory that
matches the previous listing except for dates and user names.
@@ -52,7 +56,7 @@ directory to where your local BitBake files are and run the following
command::
$ ./bin/bitbake --version
- BitBake Build Tool Core version 1.23.0, bitbake version 1.23.0
+ BitBake Build Tool Core version 2.3.1
The console output tells you what version
you are running.
@@ -130,23 +134,8 @@ Following is the complete "Hello World" example.
directory. Run the ``bitbake`` command and see what it does::
$ bitbake
- The BBPATH variable is not set and bitbake did not
- find a conf/bblayers.conf file in the expected location.
+ ERROR: The BBPATH variable is not set and bitbake did not find a conf/bblayers.conf file in the expected location.
Maybe you accidentally invoked bitbake from the wrong directory?
- DEBUG: Removed the following variables from the environment:
- GNOME_DESKTOP_SESSION_ID, XDG_CURRENT_DESKTOP,
- GNOME_KEYRING_CONTROL, DISPLAY, SSH_AGENT_PID, LANG, no_proxy,
- XDG_SESSION_PATH, XAUTHORITY, SESSION_MANAGER, SHLVL,
- MANDATORY_PATH, COMPIZ_CONFIG_PROFILE, WINDOWID, EDITOR,
- GPG_AGENT_INFO, SSH_AUTH_SOCK, GDMSESSION, GNOME_KEYRING_PID,
- XDG_SEAT_PATH, XDG_CONFIG_DIRS, LESSOPEN, DBUS_SESSION_BUS_ADDRESS,
- _, XDG_SESSION_COOKIE, DESKTOP_SESSION, LESSCLOSE, DEFAULTS_PATH,
- UBUNTU_MENUPROXY, OLDPWD, XDG_DATA_DIRS, COLORTERM, LS_COLORS
-
- The majority of this output is specific to environment variables that
- are not directly relevant to BitBake. However, the very first
- message regarding the :term:`BBPATH` variable and the
- ``conf/bblayers.conf`` file is relevant.
When you run BitBake, it begins looking for metadata files. The
:term:`BBPATH` variable is what tells BitBake where
@@ -179,20 +168,14 @@ Following is the complete "Hello World" example.
``bitbake`` command again::
$ bitbake
- ERROR: Traceback (most recent call last):
- File "/home/scott-lenovo/bitbake/lib/bb/cookerdata.py", line 163, in wrapped
- return func(fn, *args)
- File "/home/scott-lenovo/bitbake/lib/bb/cookerdata.py", line 173, in parse_config_file
- return bb.parse.handle(fn, data, include)
- File "/home/scott-lenovo/bitbake/lib/bb/parse/__init__.py", line 99, in handle
- return h['handle'](fn, data, include)
- File "/home/scott-lenovo/bitbake/lib/bb/parse/parse_py/ConfHandler.py", line 120, in handle
- abs_fn = resolve_file(fn, data)
- File "/home/scott-lenovo/bitbake/lib/bb/parse/__init__.py", line 117, in resolve_file
- raise IOError("file %s not found in %s" % (fn, bbpath))
- IOError: file conf/bitbake.conf not found in /home/scott-lenovo/hello
-
- ERROR: Unable to parse conf/bitbake.conf: file conf/bitbake.conf not found in /home/scott-lenovo/hello
+ ERROR: Unable to parse /home/scott-lenovo/bitbake/lib/bb/parse/__init__.py
+ Traceback (most recent call last):
+ File "/home/scott-lenovo/bitbake/lib/bb/parse/__init__.py", line 127, in resolve_file(fn='conf/bitbake.conf', d=<bb.data_smart.DataSmart object at 0x7f22919a3df0>):
+ if not newfn:
+ > raise IOError(errno.ENOENT, "file %s not found in %s" % (fn, bbpath))
+ fn = newfn
+ FileNotFoundError: [Errno 2] file conf/bitbake.conf not found in <projectdirectory>
+
This sample output shows that BitBake could not find the
``conf/bitbake.conf`` file in the project directory. This file is
@@ -226,12 +209,12 @@ Following is the complete "Hello World" example.
.. note::
- Without a value for PN , the variables STAMP , T , and B , prevent more
- than one recipe from working. You can fix this by either setting PN to
+ Without a value for :term:`PN`, the variables :term:`STAMP`, :term:`T`, and :term:`B`, prevent more
+ than one recipe from working. You can fix this by either setting :term:`PN` to
have a value similar to what OpenEmbedded and BitBake use in the default
- bitbake.conf file (see previous example). Or, by manually updating each
- recipe to set PN . You will also need to include PN as part of the STAMP
- , T , and B variable definitions in the local.conf file.
+ ``bitbake.conf`` file (see previous example). Or, by manually updating each
+ recipe to set :term:`PN`. You will also need to include :term:`PN` as part of the :term:`STAMP`,
+ :term:`T`, and :term:`B` variable definitions in the ``local.conf`` file.
The ``TMPDIR`` variable establishes a directory that BitBake uses
for build output and intermediate files other than the cached
@@ -254,18 +237,14 @@ Following is the complete "Hello World" example.
exists, you can run the ``bitbake`` command again::
$ bitbake
- ERROR: Traceback (most recent call last):
- File "/home/scott-lenovo/bitbake/lib/bb/cookerdata.py", line 163, in wrapped
- return func(fn, *args)
- File "/home/scott-lenovo/bitbake/lib/bb/cookerdata.py", line 177, in _inherit
- bb.parse.BBHandler.inherit(bbclass, "configuration INHERITs", 0, data)
- File "/home/scott-lenovo/bitbake/lib/bb/parse/parse_py/BBHandler.py", line 92, in inherit
- include(fn, file, lineno, d, "inherit")
- File "/home/scott-lenovo/bitbake/lib/bb/parse/parse_py/ConfHandler.py", line 100, in include
- raise ParseError("Could not %(error_out)s file %(fn)s" % vars(), oldfn, lineno)
- ParseError: ParseError in configuration INHERITs: Could not inherit file classes/base.bbclass
-
- ERROR: Unable to parse base: ParseError in configuration INHERITs: Could not inherit file classes/base.bbclass
+ ERROR: Unable to parse /home/scott-lenovo/bitbake/lib/bb/parse/parse_py/BBHandler.py
+ Traceback (most recent call last):
+ File "/home/scott-lenovo/bitbake/lib/bb/parse/parse_py/BBHandler.py", line 67, in inherit(files=['base'], fn='configuration INHERITs', lineno=0, d=<bb.data_smart.DataSmart object at 0x7fab6815edf0>):
+ if not os.path.exists(file):
+ > raise ParseError("Could not inherit file %s" % (file), fn, lineno)
+
+ bb.parse.ParseError: ParseError in configuration INHERITs: Could not inherit file classes/base.bbclass
+
In the sample output,
BitBake could not find the ``classes/base.bbclass`` file. You need
@@ -284,7 +263,10 @@ Following is the complete "Hello World" example.
$ mkdir classes
Move to the ``classes`` directory and then create the
- ``base.bbclass`` file by inserting this single line: addtask build
+ ``base.bbclass`` file by inserting this single line::
+
+ addtask build
+
The minimal task that BitBake runs is the ``do_build`` task. This is
all the example needs in order to build the project. Of course, the
``base.bbclass`` can have much more depending on which build
@@ -328,10 +310,19 @@ Following is the complete "Hello World" example.
BBFILES += "${LAYERDIR}/*.bb"
BBFILE_COLLECTIONS += "mylayer"
BBFILE_PATTERN_mylayer := "^${LAYERDIR_RE}/"
+ LAYERSERIES_CORENAMES = "hello_world_example"
+ LAYERSERIES_COMPAT_mylayer = "hello_world_example"
For information on these variables, click on :term:`BBFILES`,
- :term:`LAYERDIR`, :term:`BBFILE_COLLECTIONS` or :term:`BBFILE_PATTERN_mylayer <BBFILE_PATTERN>`
- to go to the definitions in the glossary.
+ :term:`LAYERDIR`, :term:`BBFILE_COLLECTIONS`, :term:`BBFILE_PATTERN_mylayer <BBFILE_PATTERN>`
+ or :term:`LAYERSERIES_COMPAT` to go to the definitions in the glossary.
+
+ .. note::
+
+ We are setting both ``LAYERSERIES_CORENAMES`` and :term:`LAYERSERIES_COMPAT` in this particular case, because we
+ are using bitbake without OpenEmbedded.
+ You should usually just use :term:`LAYERSERIES_COMPAT` to specify the OE-Core versions for which your layer
+ is compatible, and add the meta-openembedded layer to your project.
You need to create the recipe file next. Inside your layer at the
top-level, use an editor and create a recipe file named
@@ -389,12 +380,14 @@ Following is the complete "Hello World" example.
target::
$ bitbake printhello
+ Loading cache: 100% |
+ Loaded 0 entries from dependency cache.
Parsing recipes: 100% |##################################################################################|
- Time: 00:00:00
Parsing of 1 .bb files complete (0 cached, 1 parsed). 1 targets, 0 skipped, 0 masked, 0 errors.
NOTE: Resolving any missing task queue dependencies
- NOTE: Preparing RunQueue
- NOTE: Executing RunQueue Tasks
+ Initialising tasks: 100% |###############################################################################|
+ NOTE: No setscene tasks
+ NOTE: Executing Tasks
********************
* *
* Hello, World! *
diff --git a/bitbake/doc/bitbake-user-manual/bitbake-user-manual-metadata.rst b/bitbake/doc/bitbake-user-manual/bitbake-user-manual-metadata.rst
index 337821612c..58975f4c88 100644
--- a/bitbake/doc/bitbake-user-manual/bitbake-user-manual-metadata.rst
+++ b/bitbake/doc/bitbake-user-manual/bitbake-user-manual-metadata.rst
@@ -319,6 +319,10 @@ The variable ``D`` becomes "dvaladditional data".
You must control all spacing when you use the override syntax.
+.. note::
+
+ The overrides are applied in this order, ":append", ":prepend", ":remove".
+
It is also possible to append and prepend to shell functions and
BitBake-style Python functions. See the ":ref:`bitbake-user-manual/bitbake-user-manual-metadata:shell functions`" and ":ref:`bitbake-user-manual/bitbake-user-manual-metadata:bitbake-style python functions`"
sections for examples.
@@ -330,7 +334,8 @@ Removal (Override Style Syntax)
You can remove values from lists using the removal override style
syntax. Specifying a value for removal causes all occurrences of that
-value to be removed from the variable.
+value to be removed from the variable. Unlike ":append" and ":prepend",
+there is no need to add a leading or trailing space to the value.
When you use this syntax, BitBake expects one or more strings.
Surrounding spaces and spacing are preserved. Here is an example::
@@ -351,6 +356,28 @@ The variable ``FOO`` becomes
Like ":append" and ":prepend", ":remove" is applied at variable
expansion time.
+.. note::
+
+ The overrides are applied in this order, ":append", ":prepend", ":remove".
+ This implies it is not possible to re-append previously removed strings.
+ However, one can undo a ":remove" by using an intermediate variable whose
+ content is passed to the ":remove" so that modifying the intermediate
+ variable equals to keeping the string in::
+
+ FOOREMOVE = "123 456 789"
+ FOO:remove = "${FOOREMOVE}"
+ ...
+ FOOREMOVE = "123 789"
+
+ This expands to ``FOO:remove = "123 789"``.
+
+.. note::
+
+ Override application order may not match variable parse history, i.e.
+ the output of ``bitbake -e`` may contain ":remove" before ":append",
+ but the result will be removed string, because ":remove" is handled
+ last.
+
Override Style Operation Advantages
-----------------------------------
@@ -421,6 +448,12 @@ documentation to a BitBake variable as follows::
CACHE[doc] = "The directory holding the cache of the metadata."
+.. note::
+
+ Variable flag names starting with an underscore (``_``) character
+ are allowed but are ignored by ``d.getVarFlags("VAR")``
+ in Python code. Such flag names are used internally by BitBake.
+
Inline Python Variable Expansion
--------------------------------
@@ -1463,12 +1496,35 @@ functionality of the task:
directory listed is used as the current working directory for the
task.
+- ``[file-checksums]``: Controls the file dependencies for a task. The
+ baseline file list is the set of files associated with
+ :term:`SRC_URI`. May be used to set additional dependencies on
+ files not associated with :term:`SRC_URI`.
+
+ The value set to the list is a file-boolean pair where the first
+ value is the file name and the second is whether or not it
+ physically exists on the filesystem. ::
+
+ do_configure[file-checksums] += "${MY_DIRPATH}/my-file.txt:True"
+
+ It is important to record any paths which the task looked at and
+ which didn't exist. This means that if these do exist at a later
+ time, the task can be rerun with the new additional files. The
+ "exists" True or False value after the path allows this to be
+ handled.
+
- ``[lockfiles]``: Specifies one or more lockfiles to lock while the
task executes. Only one task may hold a lockfile, and any task that
attempts to lock an already locked file will block until the lock is
released. You can use this variable flag to accomplish mutual
exclusion.
+- ``[network]``: When set to "1", allows a task to access the network. By
+ default, only the ``do_fetch`` task is granted network access. Recipes
+ shouldn't access the network outside of ``do_fetch`` as it usually
+ undermines fetcher source mirroring, image and licence manifests, software
+ auditing and supply chain security.
+
- ``[noexec]``: When set to "1", marks the task as being empty, with
no execution required. You can use the ``[noexec]`` flag to set up
tasks as dependency placeholders, or to disable tasks defined
@@ -1922,6 +1978,33 @@ looking at the source code of the ``bb`` module, which is in
the commonly used functions ``bb.utils.contains()`` and
``bb.utils.mkdirhier()``, which come with docstrings.
+Extending Python Library Code
+-----------------------------
+
+If you wish to add your own Python library code (e.g. to provide
+functions/classes you can use from Python functions in the metadata)
+you can do so from any layer using the ``addpylib`` directive.
+This directive is typically added to your layer configuration (
+``conf/layer.conf``) although it will be handled in any ``.conf`` file.
+
+Usage is of the form::
+
+ addpylib <directory> <namespace>
+
+Where <directory> specifies the directory to add to the library path.
+The specified <namespace> is imported automatically, and if the imported
+module specifies an attribute named ``BBIMPORTS``, that list of
+sub-modules is iterated and imported too.
+
+Testing and Debugging BitBake Python code
+-----------------------------------------
+
+The OpenEmbedded build system implements a convenient ``pydevshell`` target which
+you can use to access the BitBake datastore and experiment with your own Python
+code. See :yocto_docs:`Using a Python Development Shell
+</dev-manual/python-development-shell.html#using-a-python-development-shell>` in the Yocto
+Project manual for details.
+
Task Checksums and Setscene
===========================
diff --git a/bitbake/doc/bitbake-user-manual/bitbake-user-manual-ref-variables-context.rst b/bitbake/doc/bitbake-user-manual/bitbake-user-manual-ref-variables-context.rst
new file mode 100644
index 0000000000..e9c454ba11
--- /dev/null
+++ b/bitbake/doc/bitbake-user-manual/bitbake-user-manual-ref-variables-context.rst
@@ -0,0 +1,91 @@
+.. SPDX-License-Identifier: CC-BY-2.5
+
+================
+Variable Context
+================
+
+|
+
+Variables might only have an impact or can be used in certain contexts. Some
+should only be used in global files like ``.conf``, while others are intended only
+for local files like ``.bb``. This chapter aims to describe some important variable
+contexts.
+
+.. _ref-varcontext-configuration:
+
+BitBake's own configuration
+===========================
+
+Variables starting with ``BB_`` usually configure the behaviour of BitBake itself.
+For example, one could configure:
+
+- System resources, like disk space to be used (:term:`BB_DISKMON_DIRS`),
+ or the number of tasks to be run in parallel by BitBake (:term:`BB_NUMBER_THREADS`).
+
+- How the fetchers shall behave, e.g., :term:`BB_FETCH_PREMIRRORONLY` is used
+ by BitBake to determine if BitBake's fetcher shall search only
+ :term:`PREMIRRORS` for files.
+
+Those variables are usually configured globally.
+
+BitBake configuration
+=====================
+
+There are variables:
+
+- Like :term:`B` or :term:`T`, that are used to specify directories used by
+ BitBake during the build of a particular recipe. Those variables are
+ specified in ``bitbake.conf``. Some, like :term:`B`, are quite often
+ overwritten in recipes.
+
+- Starting with ``FAKEROOT``, to configure how the ``fakeroot`` command is
+ handled. Those are usually set by ``bitbake.conf`` and might get adapted in a
+ ``bbclass``.
+
+- Detailing where BitBake will store and fetch information from, for
+ data reuse between build runs like :term:`CACHE`, :term:`DL_DIR` or
+ :term:`PERSISTENT_DIR`. Those are usually global.
+
+
+Layers and files
+================
+
+Variables starting with ``LAYER`` configure how BitBake handles layers.
+Additionally, variables starting with ``BB`` configure how layers and files are
+handled. For example:
+
+- :term:`LAYERDEPENDS` is used to configure on which layers a given layer
+ depends.
+
+- The configured layers are contained in :term:`BBLAYERS` and files in
+ :term:`BBFILES`.
+
+Those variables are often used in the files ``layer.conf`` and ``bblayers.conf``.
+
+Recipes and packages
+====================
+
+Variables handling recipes and packages can be split into:
+
+- :term:`PN`, :term:`PV` or :term:`PF` for example, contain information about
+ the name or revision of a recipe or package. Usually, the default set in
+ ``bitbake.conf`` is used, but those are from time to time overwritten in
+ recipes.
+
+- :term:`SUMMARY`, :term:`DESCRIPTION`, :term:`LICENSE` or :term:`HOMEPAGE`
+ contain the expected information and should be set specifically for every
+ recipe.
+
+- In recipes, variables are also used to control build and runtime
+ dependencies between recipes/packages with other recipes/packages. The
+ most common should be: :term:`PROVIDES`, :term:`RPROVIDES`, :term:`DEPENDS`,
+ and :term:`RDEPENDS`.
+
+- There are further variables starting with ``SRC`` that specify the sources in
+ a recipe like :term:`SRC_URI` or :term:`SRCDATE`. Those are also usually set
+ in recipes.
+
+- Which version or provider of a recipe should be given preference when
+ multiple recipes would provide the same item, is controlled by variables
+ starting with ``PREFERRED_``. Those are normally set in the configuration
+ files of a ``MACHINE`` or ``DISTRO``.
diff --git a/bitbake/doc/bitbake-user-manual/bitbake-user-manual-ref-variables.rst b/bitbake/doc/bitbake-user-manual/bitbake-user-manual-ref-variables.rst
index 12aef3cbb7..899e584f91 100644
--- a/bitbake/doc/bitbake-user-manual/bitbake-user-manual-ref-variables.rst
+++ b/bitbake/doc/bitbake-user-manual/bitbake-user-manual-ref-variables.rst
@@ -40,8 +40,7 @@ overview of their function and contents.
Azure Storage Shared Access Signature, when using the
:ref:`Azure Storage fetcher <bitbake-user-manual/bitbake-user-manual-fetching:fetchers>`
This variable can be defined to be used by the fetcher to authenticate
- and gain access to non-public artifacts.
- ::
+ and gain access to non-public artifacts::
AZ_SAS = ""se=2021-01-01&sp=r&sv=2018-11-09&sr=c&skoid=<skoid>&sig=<signature>""
@@ -100,10 +99,26 @@ overview of their function and contents.
the path of the build. BitBake's output should not (and usually does
not) depend on the directory in which it was built.
+ :term:`BB_CACHEDIR`
+ Specifies the code parser cache directory (distinct from :term:`CACHE`
+ and :term:`PERSISTENT_DIR` although they can be set to the same value
+ if desired). The default value is "${TOPDIR}/cache".
+
:term:`BB_CHECK_SSL_CERTS`
Specifies if SSL certificates should be checked when fetching. The default
value is ``1`` and certificates are not checked if the value is set to ``0``.
+ :term:`BB_HASH_CODEPARSER_VALS`
+ Specifies values for variables to use when populating the codeparser cache.
+ This can be used selectively to set dummy values for variables to avoid
+ the codeparser cache growing on every parse. Variables that would typically
+ be included are those where the value is not significant for where the
+ codeparser cache is used (i.e. when calculating variable dependencies for
+ code fragments.) The value is space-separated without quoting values, for
+ example::
+
+ BB_HASH_CODEPARSER_VALS = "T=/ WORKDIR=/ DATE=1234 TIME=1234"
+
:term:`BB_CONSOLELOG`
Specifies the path to a log file into which BitBake's user interface
writes output during the build.
@@ -344,6 +359,14 @@ overview of their function and contents.
For example usage, see :term:`BB_GIT_SHALLOW`.
+ :term:`BB_GLOBAL_PYMODULES`
+ Specifies the list of Python modules to place in the global namespace.
+ It is intended that only the core layer should set this and it is meant
+ to be a very small list, typically just ``os`` and ``sys``.
+ :term:`BB_GLOBAL_PYMODULES` is expected to be set before the first
+ ``addpylib`` directive.
+ See also ":ref:`bitbake-user-manual/bitbake-user-manual-metadata:extending python library code`".
+
:term:`BB_HASHCHECK_FUNCTION`
Specifies the name of the function to call during the "setscene" part
of the task's execution in order to validate the list of task hashes.
@@ -409,6 +432,15 @@ overview of their function and contents.
``ConfigParsed`` event can set the variable to trigger the re-parse.
You must be careful to avoid recursive loops with this functionality.
+ :term:`BB_LOADFACTOR_MAX`
+ Setting this to a value will cause BitBake to check the system load
+ average before executing new tasks. If the load average is above the
+ the number of CPUs multipled by this factor, no new task will be started
+ unless there is no task executing. A value of "1.5" has been found to
+ work reasonably. This is helpful for systems which don't have pressure
+ regulation enabled, which is more granular. Pressure values take
+ precedence over loadfactor.
+
:term:`BB_LOGCONFIG`
Specifies the name of a config file that contains the user logging
configuration. See
@@ -483,13 +515,64 @@ overview of their function and contents.
You must set this variable in the external environment in order
for it to work.
+ :term:`BB_PRESSURE_MAX_CPU`
+ Specifies a maximum CPU pressure threshold, above which BitBake's
+ scheduler will not start new tasks (providing there is at least
+ one active task). If no value is set, CPU pressure is not
+ monitored when starting tasks.
+
+ The pressure data is calculated based upon what Linux kernels since
+ version 4.20 expose under ``/proc/pressure``. The threshold represents
+ the difference in "total" pressure from the previous second. The
+ minimum value is 1.0 (extremely slow builds) and the maximum is
+ 1000000 (a pressure value unlikely to ever be reached).
+
+ This threshold can be set in ``conf/local.conf`` as::
+
+ BB_PRESSURE_MAX_CPU = "500"
+
+ :term:`BB_PRESSURE_MAX_IO`
+ Specifies a maximum I/O pressure threshold, above which BitBake's
+ scheduler will not start new tasks (providing there is at least
+ one active task). If no value is set, I/O pressure is not
+ monitored when starting tasks.
+
+ The pressure data is calculated based upon what Linux kernels since
+ version 4.20 expose under ``/proc/pressure``. The threshold represents
+ the difference in "total" pressure from the previous second. The
+ minimum value is 1.0 (extremely slow builds) and the maximum is
+ 1000000 (a pressure value unlikely to ever be reached).
+
+ At this point in time, experiments show that IO pressure tends to
+ be short-lived and regulating just the CPU with
+ :term:`BB_PRESSURE_MAX_CPU` can help to reduce it.
+
+ :term:`BB_PRESSURE_MAX_MEMORY`
+
+ Specifies a maximum memory pressure threshold, above which BitBake's
+ scheduler will not start new tasks (providing there is at least
+ one active task). If no value is set, memory pressure is not
+ monitored when starting tasks.
+
+ The pressure data is calculated based upon what Linux kernels since
+ version 4.20 expose under ``/proc/pressure``. The threshold represents
+ the difference in "total" pressure from the previous second. The
+ minimum value is 1.0 (extremely slow builds) and the maximum is
+ 1000000 (a pressure value unlikely to ever be reached).
+
+ Memory pressure is experienced when time is spent swapping,
+ refaulting pages from the page cache or performing direct reclaim.
+ This is why memory pressure is rarely seen, but setting this variable
+ might be useful as a last resort to prevent OOM errors if they are
+ occurring during builds.
+
:term:`BB_RUNFMT`
Specifies the name of the executable script files (i.e. run files)
saved into ``${``\ :term:`T`\ ``}``. By default, the
:term:`BB_RUNFMT` variable is undefined and the run filenames get
created using the following form::
- run.{task}.{pid}
+ run.{func}.{pid}
If you want to force run files to take a specific name, you can set this
variable in a configuration file.
@@ -846,9 +929,9 @@ overview of their function and contents.
section.
:term:`BBPATH`
- Used by BitBake to locate class (``.bbclass``) and configuration
- (``.conf``) files. This variable is analogous to the ``PATH``
- variable.
+ A colon-separated list used by BitBake to locate class (``.bbclass``)
+ and configuration (``.conf``) files. This variable is analogous to the
+ ``PATH`` variable.
If you run BitBake from a directory outside of the build directory,
you must be sure to set :term:`BBPATH` to point to the build directory.
@@ -940,7 +1023,7 @@ overview of their function and contents.
``bblayers.conf`` configuration file.
To exclude a recipe from a world build using this variable, set the
- variable to "1" in the recipe.
+ variable to "1" in the recipe. Set it to "0" to add it back to world build.
.. note::
@@ -998,6 +1081,11 @@ overview of their function and contents.
environment variable. The value is a colon-separated list of
directories that are searched left-to-right in order.
+ :term:`FILE_LAYERNAME`
+ During parsing and task execution, this is set to the name of the
+ layer containing the recipe file. Code can use this to identify which
+ layer a recipe is from.
+
:term:`GITDIR`
The directory in which a local copy of a Git repository is stored
when it is cloned.
@@ -1046,6 +1134,29 @@ overview of their function and contents.
variable is not available outside of ``layer.conf`` and references
are expanded immediately when parsing of the file completes.
+ :term:`LAYERSERIES_COMPAT`
+ Lists the versions of the OpenEmbedded-Core (OE-Core) for which
+ a layer is compatible. Using the :term:`LAYERSERIES_COMPAT` variable
+ allows the layer maintainer to indicate which combinations of the
+ layer and OE-Core can be expected to work. The variable gives the
+ system a way to detect when a layer has not been tested with new
+ releases of OE-Core (e.g. the layer is not maintained).
+
+ To specify the OE-Core versions for which a layer is compatible, use
+ this variable in your layer's ``conf/layer.conf`` configuration file.
+ For the list, use the Yocto Project release name (e.g. "kirkstone",
+ "mickledore"). To specify multiple OE-Core versions for the layer, use
+ a space-separated list::
+
+ LAYERSERIES_COMPAT_layer_root_name = "kirkstone mickledore"
+
+ .. note::
+
+ Setting :term:`LAYERSERIES_COMPAT` is required by the Yocto Project
+ Compatible version 2 standard.
+ The OpenEmbedded build system produces a warning if the variable
+ is not set for any given layer.
+
:term:`LAYERVERSION`
Optionally specifies the version of a layer as a single number. You
can use this variable within
@@ -1068,8 +1179,8 @@ overview of their function and contents.
order.
:term:`OVERRIDES`
- BitBake uses :term:`OVERRIDES` to control what variables are overridden
- after BitBake parses recipes and configuration files.
+ A colon-separated list that BitBake uses to control what variables are
+ overridden after BitBake parses recipes and configuration files.
Following is a simple example that uses an overrides list based on
machine architectures: OVERRIDES = "arm:x86:mips:powerpc" You can
diff --git a/bitbake/doc/index.rst b/bitbake/doc/index.rst
index 3ff8b1580f..ee1660ac15 100644
--- a/bitbake/doc/index.rst
+++ b/bitbake/doc/index.rst
@@ -13,6 +13,7 @@ BitBake User Manual
bitbake-user-manual/bitbake-user-manual-intro
bitbake-user-manual/bitbake-user-manual-execution
bitbake-user-manual/bitbake-user-manual-metadata
+ bitbake-user-manual/bitbake-user-manual-ref-variables-context
bitbake-user-manual/bitbake-user-manual-fetching
bitbake-user-manual/bitbake-user-manual-ref-variables
bitbake-user-manual/bitbake-user-manual-hello
diff --git a/bitbake/doc/releases.rst b/bitbake/doc/releases.rst
index 6635032c01..b38b1c0652 100644
--- a/bitbake/doc/releases.rst
+++ b/bitbake/doc/releases.rst
@@ -1,61 +1,63 @@
.. SPDX-License-Identifier: CC-BY-2.5
-===========================
- Supported Release Manuals
-===========================
+=================================
+BitBake Supported Release Manuals
+=================================
-******************************
-Release Series 3.4 (honister)
-******************************
+*******************************
+Release Series 4.2 (mickledore)
+*******************************
-- :yocto_docs:`3.4 BitBake User Manual </3.4/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.4.1 BitBake User Manual </3.4.1/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.4.2 BitBake User Manual </3.4.2/bitbake-user-manual/bitbake-user-manual.html>`
+- :yocto_docs:`BitBake 2.4 User Manual </bitbake/2.4/>`
******************************
-Release Series 3.3 (hardknott)
+Release Series 4.0 (kirkstone)
******************************
-- :yocto_docs:`3.3 BitBake User Manual </3.3/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.3.1 BitBake User Manual </3.3.1/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.3.2 BitBake User Manual </3.3.2/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.3.3 BitBake User Manual </3.3.3/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.3.4 BitBake User Manual </3.3.4/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.3.5 BitBake User Manual </3.3.5/bitbake-user-manual/bitbake-user-manual.html>`
+- :yocto_docs:`BitBake 2.0 User Manual </bitbake/2.0/>`
****************************
Release Series 3.1 (dunfell)
****************************
-- :yocto_docs:`3.1 BitBake User Manual </3.1/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.1.1 BitBake User Manual </3.1.1/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.1.2 BitBake User Manual </3.1.2/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.1.3 BitBake User Manual </3.1.3/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.1.4 BitBake User Manual </3.1.4/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.1.5 BitBake User Manual </3.1.5/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.1.6 BitBake User Manual </3.1.6/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.1.7 BitBake User Manual </3.1.7/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.1.8 BitBake User Manual </3.1.8/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.1.9 BitBake User Manual </3.1.9/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.1.10 BitBake User Manual </3.1.10/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.1.11 BitBake User Manual </3.1.11/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.1.12 BitBake User Manual </3.1.12/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.1.13 BitBake User Manual </3.1.13/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.1.14 BitBake User Manual </3.1.14/bitbake-user-manual/bitbake-user-manual.html>`
-
-==========================
- Outdated Release Manuals
-==========================
+- :yocto_docs:`BitBake 1.46 User Manual </bitbake/1.46/>`
+
+================================
+BitBake Outdated Release Manuals
+================================
+
+*****************************
+Release Series 4.1 (langdale)
+*****************************
+
+- :yocto_docs:`BitBake 2.2 User Manual </bitbake/2.2/>`
+
+******************************
+Release Series 3.4 (honister)
+******************************
+
+- :yocto_docs:`BitBake 1.52 User Manual </bitbake/1.52/>`
+
+******************************
+Release Series 3.3 (hardknott)
+******************************
+
+- :yocto_docs:`BitBake 1.50 User Manual </bitbake/1.50/>`
*******************************
Release Series 3.2 (gatesgarth)
*******************************
-- :yocto_docs:`3.2 BitBake User Manual </3.2/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.2.1 BitBake User Manual </3.2.1/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.2.2 BitBake User Manual </3.2.2/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.2.3 BitBake User Manual </3.2.3/bitbake-user-manual/bitbake-user-manual.html>`
-- :yocto_docs:`3.2.4 BitBake User Manual </3.2.4/bitbake-user-manual/bitbake-user-manual.html>`
+- :yocto_docs:`BitBake 1.48 User Manual </bitbake/1.48/>`
+
+*******************************************
+Release Series 3.1 (dunfell first versions)
+*******************************************
+
+- :yocto_docs:`3.1 BitBake User Manual </3.1/bitbake-user-manual/bitbake-user-manual.html>`
+- :yocto_docs:`3.1.1 BitBake User Manual </3.1.1/bitbake-user-manual/bitbake-user-manual.html>`
+- :yocto_docs:`3.1.2 BitBake User Manual </3.1.2/bitbake-user-manual/bitbake-user-manual.html>`
+- :yocto_docs:`3.1.3 BitBake User Manual </3.1.3/bitbake-user-manual/bitbake-user-manual.html>`
*************************
Release Series 3.0 (zeus)
diff --git a/bitbake/lib/bb/__init__.py b/bitbake/lib/bb/__init__.py
index 6b470aa195..b04d4c8a83 100644
--- a/bitbake/lib/bb/__init__.py
+++ b/bitbake/lib/bb/__init__.py
@@ -9,12 +9,19 @@
# SPDX-License-Identifier: GPL-2.0-only
#
-__version__ = "2.0.1"
+__version__ = "2.9.1"
import sys
-if sys.version_info < (3, 6, 0):
- raise RuntimeError("Sorry, python 3.6.0 or later is required for this version of bitbake")
+if sys.version_info < (3, 8, 0):
+ raise RuntimeError("Sorry, python 3.8.0 or later is required for this version of bitbake")
+if sys.version_info < (3, 10, 0):
+ # With python 3.8 and 3.9, we see errors of "libgcc_s.so.1 must be installed for pthread_cancel to work"
+ # https://stackoverflow.com/questions/64797838/libgcc-s-so-1-must-be-installed-for-pthread-cancel-to-work
+ # https://bugs.ams1.psf.io/issue42888
+ # so ensure libgcc_s is loaded early on
+ import ctypes
+ libgcc_s = ctypes.CDLL('libgcc_s.so.1')
class BBHandledException(Exception):
"""
@@ -29,6 +36,7 @@ class BBHandledException(Exception):
import os
import logging
+from collections import namedtuple
class NullHandler(logging.Handler):
@@ -60,6 +68,10 @@ class BBLoggerMixin(object):
return
if loglevel < bb.msg.loggerDefaultLogLevel:
return
+
+ if not isinstance(level, int) or not isinstance(msg, str):
+ mainlogger.warning("Invalid arguments in bbdebug: %s" % repr((level, msg,) + args))
+
return self.log(loglevel, msg, *args, **kwargs)
def plain(self, msg, *args, **kwargs):
@@ -216,3 +228,14 @@ def deprecate_import(current, modulename, fromlist, renames = None):
setattr(sys.modules[current], newname, newobj)
+TaskData = namedtuple("TaskData", [
+ "pn",
+ "taskname",
+ "fn",
+ "deps",
+ "provides",
+ "taskhash",
+ "unihash",
+ "hashfn",
+ "taskhash_deps",
+])
diff --git a/bitbake/lib/bb/acl.py b/bitbake/lib/bb/acl.py
new file mode 100755
index 0000000000..0f41b275cf
--- /dev/null
+++ b/bitbake/lib/bb/acl.py
@@ -0,0 +1,215 @@
+#! /usr/bin/env python3
+#
+# Copyright 2023 by Garmin Ltd. or its subsidiaries
+#
+# SPDX-License-Identifier: MIT
+
+
+import sys
+import ctypes
+import os
+import errno
+import pwd
+import grp
+
+libacl = ctypes.CDLL("libacl.so.1", use_errno=True)
+
+
+ACL_TYPE_ACCESS = 0x8000
+ACL_TYPE_DEFAULT = 0x4000
+
+ACL_FIRST_ENTRY = 0
+ACL_NEXT_ENTRY = 1
+
+ACL_UNDEFINED_TAG = 0x00
+ACL_USER_OBJ = 0x01
+ACL_USER = 0x02
+ACL_GROUP_OBJ = 0x04
+ACL_GROUP = 0x08
+ACL_MASK = 0x10
+ACL_OTHER = 0x20
+
+ACL_READ = 0x04
+ACL_WRITE = 0x02
+ACL_EXECUTE = 0x01
+
+acl_t = ctypes.c_void_p
+acl_entry_t = ctypes.c_void_p
+acl_permset_t = ctypes.c_void_p
+acl_perm_t = ctypes.c_uint
+
+acl_tag_t = ctypes.c_int
+
+libacl.acl_free.argtypes = [acl_t]
+
+
+def acl_free(acl):
+ libacl.acl_free(acl)
+
+
+libacl.acl_get_file.restype = acl_t
+libacl.acl_get_file.argtypes = [ctypes.c_char_p, ctypes.c_uint]
+
+
+def acl_get_file(path, typ):
+ acl = libacl.acl_get_file(os.fsencode(path), typ)
+ if acl is None:
+ err = ctypes.get_errno()
+ raise OSError(err, os.strerror(err), str(path))
+
+ return acl
+
+
+libacl.acl_get_entry.argtypes = [acl_t, ctypes.c_int, ctypes.c_void_p]
+
+
+def acl_get_entry(acl, entry_id):
+ entry = acl_entry_t()
+ ret = libacl.acl_get_entry(acl, entry_id, ctypes.byref(entry))
+ if ret < 0:
+ err = ctypes.get_errno()
+ raise OSError(err, os.strerror(err))
+
+ if ret == 0:
+ return None
+
+ return entry
+
+
+libacl.acl_get_tag_type.argtypes = [acl_entry_t, ctypes.c_void_p]
+
+
+def acl_get_tag_type(entry_d):
+ tag = acl_tag_t()
+ ret = libacl.acl_get_tag_type(entry_d, ctypes.byref(tag))
+ if ret < 0:
+ err = ctypes.get_errno()
+ raise OSError(err, os.strerror(err))
+ return tag.value
+
+
+libacl.acl_get_qualifier.restype = ctypes.c_void_p
+libacl.acl_get_qualifier.argtypes = [acl_entry_t]
+
+
+def acl_get_qualifier(entry_d):
+ ret = libacl.acl_get_qualifier(entry_d)
+ if ret is None:
+ err = ctypes.get_errno()
+ raise OSError(err, os.strerror(err))
+ return ctypes.c_void_p(ret)
+
+
+libacl.acl_get_permset.argtypes = [acl_entry_t, ctypes.c_void_p]
+
+
+def acl_get_permset(entry_d):
+ permset = acl_permset_t()
+ ret = libacl.acl_get_permset(entry_d, ctypes.byref(permset))
+ if ret < 0:
+ err = ctypes.get_errno()
+ raise OSError(err, os.strerror(err))
+
+ return permset
+
+
+libacl.acl_get_perm.argtypes = [acl_permset_t, acl_perm_t]
+
+
+def acl_get_perm(permset_d, perm):
+ ret = libacl.acl_get_perm(permset_d, perm)
+ if ret < 0:
+ err = ctypes.get_errno()
+ raise OSError(err, os.strerror(err))
+ return bool(ret)
+
+
+class Entry(object):
+ def __init__(self, tag, qualifier, mode):
+ self.tag = tag
+ self.qualifier = qualifier
+ self.mode = mode
+
+ def __str__(self):
+ typ = ""
+ qual = ""
+ if self.tag == ACL_USER:
+ typ = "user"
+ qual = pwd.getpwuid(self.qualifier).pw_name
+ elif self.tag == ACL_GROUP:
+ typ = "group"
+ qual = grp.getgrgid(self.qualifier).gr_name
+ elif self.tag == ACL_USER_OBJ:
+ typ = "user"
+ elif self.tag == ACL_GROUP_OBJ:
+ typ = "group"
+ elif self.tag == ACL_MASK:
+ typ = "mask"
+ elif self.tag == ACL_OTHER:
+ typ = "other"
+
+ r = "r" if self.mode & ACL_READ else "-"
+ w = "w" if self.mode & ACL_WRITE else "-"
+ x = "x" if self.mode & ACL_EXECUTE else "-"
+
+ return f"{typ}:{qual}:{r}{w}{x}"
+
+
+class ACL(object):
+ def __init__(self, acl):
+ self.acl = acl
+
+ def __del__(self):
+ acl_free(self.acl)
+
+ def entries(self):
+ entry_id = ACL_FIRST_ENTRY
+ while True:
+ entry = acl_get_entry(self.acl, entry_id)
+ if entry is None:
+ break
+
+ permset = acl_get_permset(entry)
+
+ mode = 0
+ for m in (ACL_READ, ACL_WRITE, ACL_EXECUTE):
+ if acl_get_perm(permset, m):
+ mode |= m
+
+ qualifier = None
+ tag = acl_get_tag_type(entry)
+
+ if tag == ACL_USER or tag == ACL_GROUP:
+ qual = acl_get_qualifier(entry)
+ qualifier = ctypes.cast(qual, ctypes.POINTER(ctypes.c_int))[0]
+
+ yield Entry(tag, qualifier, mode)
+
+ entry_id = ACL_NEXT_ENTRY
+
+ @classmethod
+ def from_path(cls, path, typ):
+ acl = acl_get_file(path, typ)
+ return cls(acl)
+
+
+def main():
+ import argparse
+ import pwd
+ import grp
+ from pathlib import Path
+
+ parser = argparse.ArgumentParser()
+ parser.add_argument("path", help="File Path", type=Path)
+
+ args = parser.parse_args()
+
+ acl = ACL.from_path(args.path, ACL_TYPE_ACCESS)
+ for entry in acl.entries():
+ print(str(entry))
+
+ return 0
+
+
+if __name__ == "__main__":
+ sys.exit(main())
diff --git a/bitbake/lib/bb/asyncrpc/__init__.py b/bitbake/lib/bb/asyncrpc/__init__.py
index 9a85e9965b..639e1607f8 100644
--- a/bitbake/lib/bb/asyncrpc/__init__.py
+++ b/bitbake/lib/bb/asyncrpc/__init__.py
@@ -4,30 +4,13 @@
# SPDX-License-Identifier: GPL-2.0-only
#
-import itertools
-import json
-# The Python async server defaults to a 64K receive buffer, so we hardcode our
-# maximum chunk size. It would be better if the client and server reported to
-# each other what the maximum chunk sizes were, but that will slow down the
-# connection setup with a round trip delay so I'd rather not do that unless it
-# is necessary
-DEFAULT_MAX_CHUNK = 32 * 1024
-
-
-def chunkify(msg, max_chunk):
- if len(msg) < max_chunk - 1:
- yield ''.join((msg, "\n"))
- else:
- yield ''.join((json.dumps({
- 'chunk-stream': None
- }), "\n"))
-
- args = [iter(msg)] * (max_chunk - 1)
- for m in map(''.join, itertools.zip_longest(*args, fillvalue='')):
- yield ''.join(itertools.chain(m, "\n"))
- yield "\n"
-
-
-from .client import AsyncClient, Client
-from .serv import AsyncServer, AsyncServerConnection, ClientError, ServerError
+from .client import AsyncClient, Client, ClientPool
+from .serv import AsyncServer, AsyncServerConnection
+from .connection import DEFAULT_MAX_CHUNK
+from .exceptions import (
+ ClientError,
+ ServerError,
+ ConnectionClosedError,
+ InvokeError,
+)
diff --git a/bitbake/lib/bb/asyncrpc/client.py b/bitbake/lib/bb/asyncrpc/client.py
index 881434d2e9..b49de99313 100644
--- a/bitbake/lib/bb/asyncrpc/client.py
+++ b/bitbake/lib/bb/asyncrpc/client.py
@@ -10,47 +10,150 @@ import json
import os
import socket
import sys
-from . import chunkify, DEFAULT_MAX_CHUNK
+import re
+import contextlib
+from threading import Thread
+from .connection import StreamConnection, WebsocketConnection, DEFAULT_MAX_CHUNK
+from .exceptions import ConnectionClosedError, InvokeError
+
+UNIX_PREFIX = "unix://"
+WS_PREFIX = "ws://"
+WSS_PREFIX = "wss://"
+
+ADDR_TYPE_UNIX = 0
+ADDR_TYPE_TCP = 1
+ADDR_TYPE_WS = 2
+
+WEBSOCKETS_MIN_VERSION = (9, 1)
+# Need websockets 10 with python 3.10+
+if sys.version_info >= (3, 10, 0):
+ WEBSOCKETS_MIN_VERSION = (10, 0)
+
+def parse_address(addr):
+ if addr.startswith(UNIX_PREFIX):
+ return (ADDR_TYPE_UNIX, (addr[len(UNIX_PREFIX) :],))
+ elif addr.startswith(WS_PREFIX) or addr.startswith(WSS_PREFIX):
+ return (ADDR_TYPE_WS, (addr,))
+ else:
+ m = re.match(r"\[(?P<host>[^\]]*)\]:(?P<port>\d+)$", addr)
+ if m is not None:
+ host = m.group("host")
+ port = m.group("port")
+ else:
+ host, port = addr.split(":")
+
+ return (ADDR_TYPE_TCP, (host, int(port)))
class AsyncClient(object):
- def __init__(self, proto_name, proto_version, logger, timeout=30):
- self.reader = None
- self.writer = None
+ def __init__(
+ self,
+ proto_name,
+ proto_version,
+ logger,
+ timeout=30,
+ server_headers=False,
+ headers={},
+ ):
+ self.socket = None
self.max_chunk = DEFAULT_MAX_CHUNK
self.proto_name = proto_name
self.proto_version = proto_version
self.logger = logger
self.timeout = timeout
+ self.needs_server_headers = server_headers
+ self.server_headers = {}
+ self.headers = headers
async def connect_tcp(self, address, port):
async def connect_sock():
- return await asyncio.open_connection(address, port)
+ reader, writer = await asyncio.open_connection(address, port)
+ return StreamConnection(reader, writer, self.timeout, self.max_chunk)
self._connect_sock = connect_sock
async def connect_unix(self, path):
async def connect_sock():
- return await asyncio.open_unix_connection(path)
+ # AF_UNIX has path length issues so chdir here to workaround
+ cwd = os.getcwd()
+ try:
+ os.chdir(os.path.dirname(path))
+ # The socket must be opened synchronously so that CWD doesn't get
+ # changed out from underneath us so we pass as a sock into asyncio
+ sock = socket.socket(socket.AF_UNIX, socket.SOCK_STREAM, 0)
+ sock.connect(os.path.basename(path))
+ finally:
+ os.chdir(cwd)
+ reader, writer = await asyncio.open_unix_connection(sock=sock)
+ return StreamConnection(reader, writer, self.timeout, self.max_chunk)
+
+ self._connect_sock = connect_sock
+
+ async def connect_websocket(self, uri):
+ import websockets
+
+ try:
+ version = tuple(
+ int(v)
+ for v in websockets.__version__.split(".")[
+ 0 : len(WEBSOCKETS_MIN_VERSION)
+ ]
+ )
+ except ValueError:
+ raise ImportError(
+ f"Unable to parse websockets version '{websockets.__version__}'"
+ )
+
+ if version < WEBSOCKETS_MIN_VERSION:
+ min_ver_str = ".".join(str(v) for v in WEBSOCKETS_MIN_VERSION)
+ raise ImportError(
+ f"Websockets version {websockets.__version__} is less than minimum required version {min_ver_str}"
+ )
+
+ async def connect_sock():
+ websocket = await websockets.connect(uri, ping_interval=None)
+ return WebsocketConnection(websocket, self.timeout)
self._connect_sock = connect_sock
async def setup_connection(self):
- s = '%s %s\n\n' % (self.proto_name, self.proto_version)
- self.writer.write(s.encode("utf-8"))
- await self.writer.drain()
+ # Send headers
+ await self.socket.send("%s %s" % (self.proto_name, self.proto_version))
+ await self.socket.send(
+ "needs-headers: %s" % ("true" if self.needs_server_headers else "false")
+ )
+ for k, v in self.headers.items():
+ await self.socket.send("%s: %s" % (k, v))
+
+ # End of headers
+ await self.socket.send("")
+
+ self.server_headers = {}
+ if self.needs_server_headers:
+ while True:
+ line = await self.socket.recv()
+ if not line:
+ # End headers
+ break
+ tag, value = line.split(":", 1)
+ self.server_headers[tag.lower()] = value.strip()
+
+ async def get_header(self, tag, default):
+ await self.connect()
+ return self.server_headers.get(tag, default)
async def connect(self):
- if self.reader is None or self.writer is None:
- (self.reader, self.writer) = await self._connect_sock()
+ if self.socket is None:
+ self.socket = await self._connect_sock()
await self.setup_connection()
- async def close(self):
- self.reader = None
+ async def disconnect(self):
+ if self.socket is not None:
+ await self.socket.close()
+ self.socket = None
- if self.writer is not None:
- self.writer.close()
- self.writer = None
+ async def close(self):
+ await self.disconnect()
async def _send_wrapper(self, proc):
count = 0
@@ -61,6 +164,7 @@ class AsyncClient(object):
except (
OSError,
ConnectionError,
+ ConnectionClosedError,
json.JSONDecodeError,
UnicodeDecodeError,
) as e:
@@ -72,49 +176,27 @@ class AsyncClient(object):
await self.close()
count += 1
- async def send_message(self, msg):
- async def get_line():
- try:
- line = await asyncio.wait_for(self.reader.readline(), self.timeout)
- except asyncio.TimeoutError:
- raise ConnectionError("Timed out waiting for server")
-
- if not line:
- raise ConnectionError("Connection closed")
-
- line = line.decode("utf-8")
-
- if not line.endswith("\n"):
- raise ConnectionError("Bad message %r" % (line))
-
- return line
+ def check_invoke_error(self, msg):
+ if isinstance(msg, dict) and "invoke-error" in msg:
+ raise InvokeError(msg["invoke-error"]["message"])
+ async def invoke(self, msg):
async def proc():
- for c in chunkify(json.dumps(msg), self.max_chunk):
- self.writer.write(c.encode("utf-8"))
- await self.writer.drain()
+ await self.socket.send_message(msg)
+ return await self.socket.recv_message()
- l = await get_line()
+ result = await self._send_wrapper(proc)
+ self.check_invoke_error(result)
+ return result
- m = json.loads(l)
- if m and "chunk-stream" in m:
- lines = []
- while True:
- l = (await get_line()).rstrip("\n")
- if not l:
- break
- lines.append(l)
-
- m = json.loads("".join(lines))
-
- return m
+ async def ping(self):
+ return await self.invoke({"ping": {}})
- return await self._send_wrapper(proc)
+ async def __aenter__(self):
+ return self
- async def ping(self):
- return await self.send_message(
- {'ping': {}}
- )
+ async def __aexit__(self, exc_type, exc_value, traceback):
+ await self.close()
class Client(object):
@@ -132,7 +214,7 @@ class Client(object):
# required (but harmless) with it.
asyncio.set_event_loop(self.loop)
- self._add_methods('connect_tcp', 'ping')
+ self._add_methods("connect_tcp", "ping")
@abc.abstractmethod
def _get_async_client(self):
@@ -150,14 +232,8 @@ class Client(object):
setattr(self, m, self._get_downcall_wrapper(downcall))
def connect_unix(self, path):
- # AF_UNIX has path length issues so chdir here to workaround
- cwd = os.getcwd()
- try:
- os.chdir(os.path.dirname(path))
- self.loop.run_until_complete(self.client.connect_unix(os.path.basename(path)))
- self.loop.run_until_complete(self.client.connect())
- finally:
- os.chdir(cwd)
+ self.loop.run_until_complete(self.client.connect_unix(path))
+ self.loop.run_until_complete(self.client.connect())
@property
def max_chunk(self):
@@ -167,8 +243,95 @@ class Client(object):
def max_chunk(self, value):
self.client.max_chunk = value
- def close(self):
+ def disconnect(self):
self.loop.run_until_complete(self.client.close())
- if sys.version_info >= (3, 6):
+
+ def close(self):
+ if self.loop:
+ self.loop.run_until_complete(self.client.close())
+ if sys.version_info >= (3, 6):
+ self.loop.run_until_complete(self.loop.shutdown_asyncgens())
+ self.loop.close()
+ self.loop = None
+
+ def __enter__(self):
+ return self
+
+ def __exit__(self, exc_type, exc_value, traceback):
+ self.close()
+ return False
+
+
+class ClientPool(object):
+ def __init__(self, max_clients):
+ self.avail_clients = []
+ self.num_clients = 0
+ self.max_clients = max_clients
+ self.loop = None
+ self.client_condition = None
+
+ @abc.abstractmethod
+ async def _new_client(self):
+ raise NotImplementedError("Must be implemented in derived class")
+
+ def close(self):
+ if self.client_condition:
+ self.client_condition = None
+
+ if self.loop:
+ self.loop.run_until_complete(self.__close_clients())
self.loop.run_until_complete(self.loop.shutdown_asyncgens())
- self.loop.close()
+ self.loop.close()
+ self.loop = None
+
+ def run_tasks(self, tasks):
+ if not self.loop:
+ self.loop = asyncio.new_event_loop()
+
+ thread = Thread(target=self.__thread_main, args=(tasks,))
+ thread.start()
+ thread.join()
+
+ @contextlib.asynccontextmanager
+ async def get_client(self):
+ async with self.client_condition:
+ if self.avail_clients:
+ client = self.avail_clients.pop()
+ elif self.num_clients < self.max_clients:
+ self.num_clients += 1
+ client = await self._new_client()
+ else:
+ while not self.avail_clients:
+ await self.client_condition.wait()
+ client = self.avail_clients.pop()
+
+ try:
+ yield client
+ finally:
+ async with self.client_condition:
+ self.avail_clients.append(client)
+ self.client_condition.notify()
+
+ def __thread_main(self, tasks):
+ async def process_task(task):
+ async with self.get_client() as client:
+ await task(client)
+
+ asyncio.set_event_loop(self.loop)
+ if not self.client_condition:
+ self.client_condition = asyncio.Condition()
+ tasks = [process_task(t) for t in tasks]
+ self.loop.run_until_complete(asyncio.gather(*tasks))
+
+ async def __close_clients(self):
+ for c in self.avail_clients:
+ await c.close()
+ self.avail_clients = []
+ self.num_clients = 0
+
+ def __enter__(self):
+ return self
+
+ def __exit__(self, exc_type, exc_value, traceback):
+ self.close()
+ return False
diff --git a/bitbake/lib/bb/asyncrpc/connection.py b/bitbake/lib/bb/asyncrpc/connection.py
new file mode 100644
index 0000000000..7f0cf6ba96
--- /dev/null
+++ b/bitbake/lib/bb/asyncrpc/connection.py
@@ -0,0 +1,146 @@
+#
+# Copyright BitBake Contributors
+#
+# SPDX-License-Identifier: GPL-2.0-only
+#
+
+import asyncio
+import itertools
+import json
+from datetime import datetime
+from .exceptions import ClientError, ConnectionClosedError
+
+
+# The Python async server defaults to a 64K receive buffer, so we hardcode our
+# maximum chunk size. It would be better if the client and server reported to
+# each other what the maximum chunk sizes were, but that will slow down the
+# connection setup with a round trip delay so I'd rather not do that unless it
+# is necessary
+DEFAULT_MAX_CHUNK = 32 * 1024
+
+
+def chunkify(msg, max_chunk):
+ if len(msg) < max_chunk - 1:
+ yield "".join((msg, "\n"))
+ else:
+ yield "".join((json.dumps({"chunk-stream": None}), "\n"))
+
+ args = [iter(msg)] * (max_chunk - 1)
+ for m in map("".join, itertools.zip_longest(*args, fillvalue="")):
+ yield "".join(itertools.chain(m, "\n"))
+ yield "\n"
+
+
+def json_serialize(obj):
+ if isinstance(obj, datetime):
+ return obj.isoformat()
+ raise TypeError("Type %s not serializeable" % type(obj))
+
+
+class StreamConnection(object):
+ def __init__(self, reader, writer, timeout, max_chunk=DEFAULT_MAX_CHUNK):
+ self.reader = reader
+ self.writer = writer
+ self.timeout = timeout
+ self.max_chunk = max_chunk
+
+ @property
+ def address(self):
+ return self.writer.get_extra_info("peername")
+
+ async def send_message(self, msg):
+ for c in chunkify(json.dumps(msg, default=json_serialize), self.max_chunk):
+ self.writer.write(c.encode("utf-8"))
+ await self.writer.drain()
+
+ async def recv_message(self):
+ l = await self.recv()
+
+ m = json.loads(l)
+ if not m:
+ return m
+
+ if "chunk-stream" in m:
+ lines = []
+ while True:
+ l = await self.recv()
+ if not l:
+ break
+ lines.append(l)
+
+ m = json.loads("".join(lines))
+
+ return m
+
+ async def send(self, msg):
+ self.writer.write(("%s\n" % msg).encode("utf-8"))
+ await self.writer.drain()
+
+ async def recv(self):
+ if self.timeout < 0:
+ line = await self.reader.readline()
+ else:
+ try:
+ line = await asyncio.wait_for(self.reader.readline(), self.timeout)
+ except asyncio.TimeoutError:
+ raise ConnectionError("Timed out waiting for data")
+
+ if not line:
+ raise ConnectionClosedError("Connection closed")
+
+ line = line.decode("utf-8")
+
+ if not line.endswith("\n"):
+ raise ConnectionError("Bad message %r" % (line))
+
+ return line.rstrip()
+
+ async def close(self):
+ self.reader = None
+ if self.writer is not None:
+ self.writer.close()
+ self.writer = None
+
+
+class WebsocketConnection(object):
+ def __init__(self, socket, timeout):
+ self.socket = socket
+ self.timeout = timeout
+
+ @property
+ def address(self):
+ return ":".join(str(s) for s in self.socket.remote_address)
+
+ async def send_message(self, msg):
+ await self.send(json.dumps(msg, default=json_serialize))
+
+ async def recv_message(self):
+ m = await self.recv()
+ return json.loads(m)
+
+ async def send(self, msg):
+ import websockets.exceptions
+
+ try:
+ await self.socket.send(msg)
+ except websockets.exceptions.ConnectionClosed:
+ raise ConnectionClosedError("Connection closed")
+
+ async def recv(self):
+ import websockets.exceptions
+
+ try:
+ if self.timeout < 0:
+ return await self.socket.recv()
+
+ try:
+ return await asyncio.wait_for(self.socket.recv(), self.timeout)
+ except asyncio.TimeoutError:
+ raise ConnectionError("Timed out waiting for data")
+ except websockets.exceptions.ConnectionClosed:
+ raise ConnectionClosedError("Connection closed")
+
+ async def close(self):
+ if self.socket is not None:
+ await self.socket.close()
+ self.socket = None
diff --git a/bitbake/lib/bb/asyncrpc/exceptions.py b/bitbake/lib/bb/asyncrpc/exceptions.py
new file mode 100644
index 0000000000..ae1043a38b
--- /dev/null
+++ b/bitbake/lib/bb/asyncrpc/exceptions.py
@@ -0,0 +1,21 @@
+#
+# Copyright BitBake Contributors
+#
+# SPDX-License-Identifier: GPL-2.0-only
+#
+
+
+class ClientError(Exception):
+ pass
+
+
+class InvokeError(Exception):
+ pass
+
+
+class ServerError(Exception):
+ pass
+
+
+class ConnectionClosedError(Exception):
+ pass
diff --git a/bitbake/lib/bb/asyncrpc/serv.py b/bitbake/lib/bb/asyncrpc/serv.py
index 5cf45f908a..a66117acad 100644
--- a/bitbake/lib/bb/asyncrpc/serv.py
+++ b/bitbake/lib/bb/asyncrpc/serv.py
@@ -12,241 +12,333 @@ import signal
import socket
import sys
import multiprocessing
-from . import chunkify, DEFAULT_MAX_CHUNK
+import logging
+from .connection import StreamConnection, WebsocketConnection
+from .exceptions import ClientError, ServerError, ConnectionClosedError, InvokeError
-class ClientError(Exception):
- pass
-
-
-class ServerError(Exception):
- pass
+class ClientLoggerAdapter(logging.LoggerAdapter):
+ def process(self, msg, kwargs):
+ return f"[Client {self.extra['address']}] {msg}", kwargs
class AsyncServerConnection(object):
- def __init__(self, reader, writer, proto_name, logger):
- self.reader = reader
- self.writer = writer
+ # If a handler returns this object (e.g. `return self.NO_RESPONSE`), no
+ # return message will be automatically be sent back to the client
+ NO_RESPONSE = object()
+
+ def __init__(self, socket, proto_name, logger):
+ self.socket = socket
self.proto_name = proto_name
- self.max_chunk = DEFAULT_MAX_CHUNK
self.handlers = {
- 'chunk-stream': self.handle_chunk,
- 'ping': self.handle_ping,
+ "ping": self.handle_ping,
}
- self.logger = logger
+ self.logger = ClientLoggerAdapter(
+ logger,
+ {
+ "address": socket.address,
+ },
+ )
+ self.client_headers = {}
+
+ async def close(self):
+ await self.socket.close()
+
+ async def handle_headers(self, headers):
+ return {}
async def process_requests(self):
try:
- self.addr = self.writer.get_extra_info('peername')
- self.logger.debug('Client %r connected' % (self.addr,))
+ self.logger.info("Client %r connected" % (self.socket.address,))
# Read protocol and version
- client_protocol = await self.reader.readline()
- if client_protocol is None:
+ client_protocol = await self.socket.recv()
+ if not client_protocol:
return
- (client_proto_name, client_proto_version) = client_protocol.decode('utf-8').rstrip().split()
+ (client_proto_name, client_proto_version) = client_protocol.split()
if client_proto_name != self.proto_name:
- self.logger.debug('Rejecting invalid protocol %s' % (self.proto_name))
+ self.logger.debug("Rejecting invalid protocol %s" % (self.proto_name))
return
- self.proto_version = tuple(int(v) for v in client_proto_version.split('.'))
+ self.proto_version = tuple(int(v) for v in client_proto_version.split("."))
if not self.validate_proto_version():
- self.logger.debug('Rejecting invalid protocol version %s' % (client_proto_version))
+ self.logger.debug(
+ "Rejecting invalid protocol version %s" % (client_proto_version)
+ )
return
- # Read headers. Currently, no headers are implemented, so look for
- # an empty line to signal the end of the headers
+ # Read headers
+ self.client_headers = {}
while True:
- line = await self.reader.readline()
- if line is None:
- return
-
- line = line.decode('utf-8').rstrip()
- if not line:
+ header = await self.socket.recv()
+ if not header:
+ # Empty line. End of headers
break
+ tag, value = header.split(":", 1)
+ self.client_headers[tag.lower()] = value.strip()
+
+ if self.client_headers.get("needs-headers", "false") == "true":
+ for k, v in (await self.handle_headers(self.client_headers)).items():
+ await self.socket.send("%s: %s" % (k, v))
+ await self.socket.send("")
# Handle messages
while True:
- d = await self.read_message()
+ d = await self.socket.recv_message()
if d is None:
break
- await self.dispatch_message(d)
- await self.writer.drain()
- except ClientError as e:
+ try:
+ response = await self.dispatch_message(d)
+ except InvokeError as e:
+ await self.socket.send_message(
+ {"invoke-error": {"message": str(e)}}
+ )
+ break
+
+ if response is not self.NO_RESPONSE:
+ await self.socket.send_message(response)
+
+ except ConnectionClosedError as e:
+ self.logger.info(str(e))
+ except (ClientError, ConnectionError) as e:
self.logger.error(str(e))
finally:
- self.writer.close()
+ await self.close()
async def dispatch_message(self, msg):
for k in self.handlers.keys():
if k in msg:
- self.logger.debug('Handling %s' % k)
- await self.handlers[k](msg[k])
- return
+ self.logger.debug("Handling %s" % k)
+ return await self.handlers[k](msg[k])
raise ClientError("Unrecognized command %r" % msg)
- def write_message(self, msg):
- for c in chunkify(json.dumps(msg), self.max_chunk):
- self.writer.write(c.encode('utf-8'))
+ async def handle_ping(self, request):
+ return {"alive": True}
- async def read_message(self):
- l = await self.reader.readline()
- if not l:
- return None
- try:
- message = l.decode('utf-8')
+class StreamServer(object):
+ def __init__(self, handler, logger):
+ self.handler = handler
+ self.logger = logger
+ self.closed = False
- if not message.endswith('\n'):
- return None
+ async def handle_stream_client(self, reader, writer):
+ # writer.transport.set_write_buffer_limits(0)
+ socket = StreamConnection(reader, writer, -1)
+ if self.closed:
+ await socket.close()
+ return
+
+ await self.handler(socket)
+
+ async def stop(self):
+ self.closed = True
+
+
+class TCPStreamServer(StreamServer):
+ def __init__(self, host, port, handler, logger):
+ super().__init__(handler, logger)
+ self.host = host
+ self.port = port
+
+ def start(self, loop):
+ self.server = loop.run_until_complete(
+ asyncio.start_server(self.handle_stream_client, self.host, self.port)
+ )
+
+ for s in self.server.sockets:
+ self.logger.debug("Listening on %r" % (s.getsockname(),))
+ # Newer python does this automatically. Do it manually here for
+ # maximum compatibility
+ s.setsockopt(socket.SOL_TCP, socket.TCP_NODELAY, 1)
+ s.setsockopt(socket.SOL_TCP, socket.TCP_QUICKACK, 1)
+
+ # Enable keep alives. This prevents broken client connections
+ # from persisting on the server for long periods of time.
+ s.setsockopt(socket.SOL_SOCKET, socket.SO_KEEPALIVE, 1)
+ s.setsockopt(socket.IPPROTO_TCP, socket.TCP_KEEPIDLE, 30)
+ s.setsockopt(socket.IPPROTO_TCP, socket.TCP_KEEPINTVL, 15)
+ s.setsockopt(socket.IPPROTO_TCP, socket.TCP_KEEPCNT, 4)
+
+ name = self.server.sockets[0].getsockname()
+ if self.server.sockets[0].family == socket.AF_INET6:
+ self.address = "[%s]:%d" % (name[0], name[1])
+ else:
+ self.address = "%s:%d" % (name[0], name[1])
+
+ return [self.server.wait_closed()]
+
+ async def stop(self):
+ await super().stop()
+ self.server.close()
+
+ def cleanup(self):
+ pass
- return json.loads(message)
- except (json.JSONDecodeError, UnicodeDecodeError) as e:
- self.logger.error('Bad message from client: %r' % message)
- raise e
- async def handle_chunk(self, request):
- lines = []
- try:
- while True:
- l = await self.reader.readline()
- l = l.rstrip(b"\n").decode("utf-8")
- if not l:
- break
- lines.append(l)
+class UnixStreamServer(StreamServer):
+ def __init__(self, path, handler, logger):
+ super().__init__(handler, logger)
+ self.path = path
- msg = json.loads(''.join(lines))
- except (json.JSONDecodeError, UnicodeDecodeError) as e:
- self.logger.error('Bad message from client: %r' % lines)
- raise e
+ def start(self, loop):
+ cwd = os.getcwd()
+ try:
+ # Work around path length limits in AF_UNIX
+ os.chdir(os.path.dirname(self.path))
+ self.server = loop.run_until_complete(
+ asyncio.start_unix_server(
+ self.handle_stream_client, os.path.basename(self.path)
+ )
+ )
+ finally:
+ os.chdir(cwd)
- if 'chunk-stream' in msg:
- raise ClientError("Nested chunks are not allowed")
+ self.logger.debug("Listening on %r" % self.path)
+ self.address = "unix://%s" % os.path.abspath(self.path)
+ return [self.server.wait_closed()]
- await self.dispatch_message(msg)
+ async def stop(self):
+ await super().stop()
+ self.server.close()
- async def handle_ping(self, request):
- response = {'alive': True}
- self.write_message(response)
+ def cleanup(self):
+ os.unlink(self.path)
-class AsyncServer(object):
- def __init__(self, logger):
- self._cleanup_socket = None
+class WebsocketsServer(object):
+ def __init__(self, host, port, handler, logger):
+ self.host = host
+ self.port = port
+ self.handler = handler
self.logger = logger
- self.start = None
- self.address = None
- self.loop = None
- def start_tcp_server(self, host, port):
- def start_tcp():
- self.server = self.loop.run_until_complete(
- asyncio.start_server(self.handle_client, host, port)
+ def start(self, loop):
+ import websockets.server
+
+ self.server = loop.run_until_complete(
+ websockets.server.serve(
+ self.client_handler,
+ self.host,
+ self.port,
+ ping_interval=None,
)
+ )
- for s in self.server.sockets:
- self.logger.debug('Listening on %r' % (s.getsockname(),))
- # Newer python does this automatically. Do it manually here for
- # maximum compatibility
- s.setsockopt(socket.SOL_TCP, socket.TCP_NODELAY, 1)
- s.setsockopt(socket.SOL_TCP, socket.TCP_QUICKACK, 1)
+ for s in self.server.sockets:
+ self.logger.debug("Listening on %r" % (s.getsockname(),))
- # Enable keep alives. This prevents broken client connections
- # from persisting on the server for long periods of time.
- s.setsockopt(socket.SOL_SOCKET, socket.SO_KEEPALIVE, 1)
- s.setsockopt(socket.IPPROTO_TCP, socket.TCP_KEEPIDLE, 30)
- s.setsockopt(socket.IPPROTO_TCP, socket.TCP_KEEPINTVL, 15)
- s.setsockopt(socket.IPPROTO_TCP, socket.TCP_KEEPCNT, 4)
+ # Enable keep alives. This prevents broken client connections
+ # from persisting on the server for long periods of time.
+ s.setsockopt(socket.SOL_SOCKET, socket.SO_KEEPALIVE, 1)
+ s.setsockopt(socket.IPPROTO_TCP, socket.TCP_KEEPIDLE, 30)
+ s.setsockopt(socket.IPPROTO_TCP, socket.TCP_KEEPINTVL, 15)
+ s.setsockopt(socket.IPPROTO_TCP, socket.TCP_KEEPCNT, 4)
- name = self.server.sockets[0].getsockname()
- if self.server.sockets[0].family == socket.AF_INET6:
- self.address = "[%s]:%d" % (name[0], name[1])
- else:
- self.address = "%s:%d" % (name[0], name[1])
+ name = self.server.sockets[0].getsockname()
+ if self.server.sockets[0].family == socket.AF_INET6:
+ self.address = "ws://[%s]:%d" % (name[0], name[1])
+ else:
+ self.address = "ws://%s:%d" % (name[0], name[1])
- self.start = start_tcp
+ return [self.server.wait_closed()]
- def start_unix_server(self, path):
- def cleanup():
- os.unlink(path)
+ async def stop(self):
+ self.server.close()
- def start_unix():
- cwd = os.getcwd()
- try:
- # Work around path length limits in AF_UNIX
- os.chdir(os.path.dirname(path))
- self.server = self.loop.run_until_complete(
- asyncio.start_unix_server(self.handle_client, os.path.basename(path))
- )
- finally:
- os.chdir(cwd)
+ def cleanup(self):
+ pass
- self.logger.debug('Listening on %r' % path)
+ async def client_handler(self, websocket):
+ socket = WebsocketConnection(websocket, -1)
+ await self.handler(socket)
- self._cleanup_socket = cleanup
- self.address = "unix://%s" % os.path.abspath(path)
- self.start = start_unix
+class AsyncServer(object):
+ def __init__(self, logger):
+ self.logger = logger
+ self.loop = None
+ self.run_tasks = []
- @abc.abstractmethod
- def accept_client(self, reader, writer):
- pass
+ def start_tcp_server(self, host, port):
+ self.server = TCPStreamServer(host, port, self._client_handler, self.logger)
- async def handle_client(self, reader, writer):
- # writer.transport.set_write_buffer_limits(0)
+ def start_unix_server(self, path):
+ self.server = UnixStreamServer(path, self._client_handler, self.logger)
+
+ def start_websocket_server(self, host, port):
+ self.server = WebsocketsServer(host, port, self._client_handler, self.logger)
+
+ async def _client_handler(self, socket):
+ address = socket.address
try:
- client = self.accept_client(reader, writer)
+ client = self.accept_client(socket)
await client.process_requests()
except Exception as e:
import traceback
- self.logger.error('Error from client: %s' % str(e), exc_info=True)
+
+ self.logger.error(
+ "Error from client %s: %s" % (address, str(e)), exc_info=True
+ )
traceback.print_exc()
- writer.close()
- self.logger.debug('Client disconnected')
+ finally:
+ self.logger.debug("Client %s disconnected", address)
+ await socket.close()
- def run_loop_forever(self):
- try:
- self.loop.run_forever()
- except KeyboardInterrupt:
- pass
+ @abc.abstractmethod
+ def accept_client(self, socket):
+ pass
+
+ async def stop(self):
+ self.logger.debug("Stopping server")
+ await self.server.stop()
+
+ def start(self):
+ tasks = self.server.start(self.loop)
+ self.address = self.server.address
+ return tasks
def signal_handler(self):
self.logger.debug("Got exit signal")
- self.loop.stop()
+ self.loop.create_task(self.stop())
- def _serve_forever(self):
+ def _serve_forever(self, tasks):
try:
self.loop.add_signal_handler(signal.SIGTERM, self.signal_handler)
+ self.loop.add_signal_handler(signal.SIGINT, self.signal_handler)
+ self.loop.add_signal_handler(signal.SIGQUIT, self.signal_handler)
signal.pthread_sigmask(signal.SIG_UNBLOCK, [signal.SIGTERM])
- self.run_loop_forever()
- self.server.close()
+ self.loop.run_until_complete(asyncio.gather(*tasks))
- self.loop.run_until_complete(self.server.wait_closed())
- self.logger.debug('Server shutting down')
+ self.logger.debug("Server shutting down")
finally:
- if self._cleanup_socket is not None:
- self._cleanup_socket()
+ self.server.cleanup()
def serve_forever(self):
"""
Serve requests in the current process
"""
+ self._create_loop()
+ tasks = self.start()
+ self._serve_forever(tasks)
+ self.loop.close()
+
+ def _create_loop(self):
# Create loop and override any loop that may have existed in
# a parent process. It is possible that the usecases of
# serve_forever might be constrained enough to allow using
# get_event_loop here, but better safe than sorry for now.
self.loop = asyncio.new_event_loop()
asyncio.set_event_loop(self.loop)
- self.start()
- self._serve_forever()
- def serve_as_process(self, *, prefunc=None, args=()):
+ def serve_as_process(self, *, prefunc=None, args=(), log_level=None):
"""
Serve requests in a child process
"""
+
def run(queue):
# Create loop and override any loop that may have existed
# in a parent process. Without doing this and instead
@@ -259,18 +351,22 @@ class AsyncServer(object):
# more general, though, as any potential use of asyncio in
# Cooker could create a loop that needs to replaced in this
# new process.
- self.loop = asyncio.new_event_loop()
- asyncio.set_event_loop(self.loop)
+ self._create_loop()
try:
- self.start()
+ self.address = None
+ tasks = self.start()
finally:
+ # Always put the server address to wake up the parent task
queue.put(self.address)
queue.close()
if prefunc is not None:
prefunc(self, *args)
- self._serve_forever()
+ if log_level is not None:
+ self.logger.setLevel(log_level)
+
+ self._serve_forever(tasks)
if sys.version_info >= (3, 6):
self.loop.run_until_complete(self.loop.shutdown_asyncgens())
diff --git a/bitbake/lib/bb/build.py b/bitbake/lib/bb/build.py
index b8c1099ef5..ab8bce3d57 100644
--- a/bitbake/lib/bb/build.py
+++ b/bitbake/lib/bb/build.py
@@ -25,6 +25,7 @@ import bb
import bb.msg
import bb.process
import bb.progress
+from io import StringIO
from bb import data, event, utils
bblogger = logging.getLogger('BitBake')
@@ -177,7 +178,9 @@ class StdoutNoopContextManager:
@property
def name(self):
- return sys.stdout.name
+ if "name" in dir(sys.stdout):
+ return sys.stdout.name
+ return "<mem>"
def exec_func(func, d, dirs = None):
@@ -194,6 +197,8 @@ def exec_func(func, d, dirs = None):
for cdir in d.expand(cleandirs).split():
bb.utils.remove(cdir, True)
bb.utils.mkdirhier(cdir)
+ if cdir == oldcwd:
+ os.chdir(cdir)
if flags and dirs is None:
dirs = flags.get('dirs')
@@ -296,9 +301,21 @@ def exec_func_python(func, d, runfile, cwd=None):
lineno = int(d.getVarFlag(func, "lineno", False))
bb.methodpool.insert_method(func, text, fn, lineno - 1)
+ if verboseStdoutLogging:
+ sys.stdout.flush()
+ sys.stderr.flush()
+ currout = sys.stdout
+ currerr = sys.stderr
+ sys.stderr = sys.stdout = execio = StringIO()
comp = utils.better_compile(code, func, "exec_func_python() autogenerated")
utils.better_exec(comp, {"d": d}, code, "exec_func_python() autogenerated")
finally:
+ if verboseStdoutLogging:
+ execio.flush()
+ logger.plain("%s" % execio.getvalue())
+ sys.stdout = currout
+ sys.stderr = currerr
+ execio.close()
# We want any stdout/stderr to be printed before any other log messages to make debugging
# more accurate. In some cases we seem to lose stdout/stderr entirely in logging tests without this.
sys.stdout.flush()
@@ -441,7 +458,11 @@ exit $ret
if fakerootcmd:
cmd = [fakerootcmd, runfile]
- if verboseStdoutLogging:
+ # We only want to output to logger via LogTee if stdout is sys.__stdout__ (which will either
+ # be real stdout or subprocess PIPE or similar). In other cases we are being run "recursively",
+ # ie. inside another function, in which case stdout is already being captured so we don't
+ # want to Tee here as output would be printed twice, and out of order.
+ if verboseStdoutLogging and sys.stdout == sys.__stdout__:
logfile = LogTee(logger, StdoutNoopContextManager())
else:
logfile = StdoutNoopContextManager()
@@ -572,7 +593,6 @@ def _task_data(fn, task, d):
localdata.setVar('BB_FILENAME', fn)
localdata.setVar('OVERRIDES', 'task-%s:%s' %
(task[3:].replace('_', '-'), d.getVar('OVERRIDES', False)))
- localdata.finalize()
bb.data.expandKeys(localdata)
return localdata
@@ -773,44 +793,7 @@ def exec_task(fn, task, d, profile = False):
event.fire(failedevent, d)
return 1
-def stamp_internal(taskname, d, file_name, baseonly=False, noextra=False):
- """
- Internal stamp helper function
- Makes sure the stamp directory exists
- Returns the stamp path+filename
-
- In the bitbake core, d can be a CacheData and file_name will be set.
- When called in task context, d will be a data store, file_name will not be set
- """
- taskflagname = taskname
- if taskname.endswith("_setscene") and taskname != "do_setscene":
- taskflagname = taskname.replace("_setscene", "")
-
- if file_name:
- stamp = d.stamp[file_name]
- extrainfo = d.stamp_extrainfo[file_name].get(taskflagname) or ""
- else:
- stamp = d.getVar('STAMP')
- file_name = d.getVar('BB_FILENAME')
- extrainfo = d.getVarFlag(taskflagname, 'stamp-extra-info') or ""
-
- if baseonly:
- return stamp
- if noextra:
- extrainfo = ""
-
- if not stamp:
- return
-
- stamp = bb.parse.siggen.stampfile(stamp, file_name, taskname, extrainfo)
-
- stampdir = os.path.dirname(stamp)
- if cached_mtime_noerror(stampdir) == 0:
- bb.utils.mkdirhier(stampdir)
-
- return stamp
-
-def stamp_cleanmask_internal(taskname, d, file_name):
+def _get_cleanmask(taskname, mcfn):
"""
Internal stamp helper function to generate stamp cleaning mask
Returns the stamp path+filename
@@ -818,27 +801,14 @@ def stamp_cleanmask_internal(taskname, d, file_name):
In the bitbake core, d can be a CacheData and file_name will be set.
When called in task context, d will be a data store, file_name will not be set
"""
- taskflagname = taskname
- if taskname.endswith("_setscene") and taskname != "do_setscene":
- taskflagname = taskname.replace("_setscene", "")
-
- if file_name:
- stamp = d.stampclean[file_name]
- extrainfo = d.stamp_extrainfo[file_name].get(taskflagname) or ""
- else:
- stamp = d.getVar('STAMPCLEAN')
- file_name = d.getVar('BB_FILENAME')
- extrainfo = d.getVarFlag(taskflagname, 'stamp-extra-info') or ""
-
- if not stamp:
- return []
-
- cleanmask = bb.parse.siggen.stampcleanmask(stamp, file_name, taskname, extrainfo)
-
- return [cleanmask, cleanmask.replace(taskflagname, taskflagname + "_setscene")]
-
-def clean_stamp(task, d, file_name = None):
- cleanmask = stamp_cleanmask_internal(task, d, file_name)
+ cleanmask = bb.parse.siggen.stampcleanmask_mcfn(taskname, mcfn)
+ taskflagname = taskname.replace("_setscene", "")
+ if cleanmask:
+ return [cleanmask, cleanmask.replace(taskflagname, taskflagname + "_setscene")]
+ return []
+
+def clean_stamp_mcfn(task, mcfn):
+ cleanmask = _get_cleanmask(task, mcfn)
for mask in cleanmask:
for name in glob.glob(mask):
# Preserve sigdata files in the stamps directory
@@ -848,33 +818,46 @@ def clean_stamp(task, d, file_name = None):
if name.endswith('.taint'):
continue
os.unlink(name)
- return
-def make_stamp(task, d, file_name = None):
+def clean_stamp(task, d):
+ mcfn = d.getVar('BB_FILENAME')
+ clean_stamp_mcfn(task, mcfn)
+
+def make_stamp_mcfn(task, mcfn):
+
+ basestamp = bb.parse.siggen.stampfile_mcfn(task, mcfn)
+
+ stampdir = os.path.dirname(basestamp)
+ if cached_mtime_noerror(stampdir) == 0:
+ bb.utils.mkdirhier(stampdir)
+
+ clean_stamp_mcfn(task, mcfn)
+
+ # Remove the file and recreate to force timestamp
+ # change on broken NFS filesystems
+ if basestamp:
+ bb.utils.remove(basestamp)
+ open(basestamp, "w").close()
+
+def make_stamp(task, d):
"""
Creates/updates a stamp for a given task
- (d can be a data dict or dataCache)
"""
- clean_stamp(task, d, file_name)
+ mcfn = d.getVar('BB_FILENAME')
- stamp = stamp_internal(task, d, file_name)
- # Remove the file and recreate to force timestamp
- # change on broken NFS filesystems
- if stamp:
- bb.utils.remove(stamp)
- open(stamp, "w").close()
+ make_stamp_mcfn(task, mcfn)
# If we're in task context, write out a signature file for each task
# as it completes
- if not task.endswith("_setscene") and task != "do_setscene" and not file_name:
- stampbase = stamp_internal(task, d, None, True)
- file_name = d.getVar('BB_FILENAME')
- bb.parse.siggen.dump_sigtask(file_name, task, stampbase, True)
-
-def find_stale_stamps(task, d, file_name=None):
- current = stamp_internal(task, d, file_name)
- current2 = stamp_internal(task + "_setscene", d, file_name)
- cleanmask = stamp_cleanmask_internal(task, d, file_name)
+ if not task.endswith("_setscene"):
+ stampbase = bb.parse.siggen.stampfile_base(mcfn)
+ bb.parse.siggen.dump_sigtask(mcfn, task, stampbase, True)
+
+
+def find_stale_stamps(task, mcfn):
+ current = bb.parse.siggen.stampfile_mcfn(task, mcfn)
+ current2 = bb.parse.siggen.stampfile_mcfn(task + "_setscene", mcfn)
+ cleanmask = _get_cleanmask(task, mcfn)
found = []
for mask in cleanmask:
for name in glob.glob(mask):
@@ -888,38 +871,14 @@ def find_stale_stamps(task, d, file_name=None):
found.append(name)
return found
-def del_stamp(task, d, file_name = None):
- """
- Removes a stamp for a given task
- (d can be a data dict or dataCache)
- """
- stamp = stamp_internal(task, d, file_name)
- bb.utils.remove(stamp)
-
-def write_taint(task, d, file_name = None):
+def write_taint(task, d):
"""
Creates a "taint" file which will force the specified task and its
dependents to be re-run the next time by influencing the value of its
taskhash.
- (d can be a data dict or dataCache)
- """
- import uuid
- if file_name:
- taintfn = d.stamp[file_name] + '.' + task + '.taint'
- else:
- taintfn = d.getVar('STAMP') + '.' + task + '.taint'
- bb.utils.mkdirhier(os.path.dirname(taintfn))
- # The specific content of the taint file is not really important,
- # we just need it to be random, so a random UUID is used
- with open(taintfn, 'w') as taintf:
- taintf.write(str(uuid.uuid4()))
-
-def stampfile(taskname, d, file_name = None, noextra=False):
- """
- Return the stamp for a given task
- (d can be a data dict or dataCache)
"""
- return stamp_internal(taskname, d, file_name, noextra=noextra)
+ mcfn = d.getVar('BB_FILENAME')
+ bb.parse.siggen.invalidate_task(task, mcfn)
def add_tasks(tasklist, d):
task_deps = d.getVar('_task_deps', False)
diff --git a/bitbake/lib/bb/cache.py b/bitbake/lib/bb/cache.py
index 988c596c39..18d5574a31 100644
--- a/bitbake/lib/bb/cache.py
+++ b/bitbake/lib/bb/cache.py
@@ -28,7 +28,7 @@ import shutil
logger = logging.getLogger("BitBake.Cache")
-__cache_version__ = "154"
+__cache_version__ = "155"
def getCacheFile(path, filename, mc, data_hash):
mcspec = ''
@@ -105,7 +105,7 @@ class CoreRecipeInfo(RecipeInfoCommon):
self.tasks = metadata.getVar('__BBTASKS', False)
- self.basetaskhashes = self.taskvar('BB_BASEHASH', self.tasks, metadata)
+ self.basetaskhashes = metadata.getVar('__siggen_basehashes', False) or {}
self.hashfilename = self.getvar('BB_HASHFILENAME', metadata)
self.task_deps = metadata.getVar('_task_deps', False) or {'tasks': [], 'parents': {}}
@@ -216,7 +216,7 @@ class CoreRecipeInfo(RecipeInfoCommon):
# Collect files we may need for possible world-dep
# calculations
- if not self.not_world:
+ if not bb.utils.to_boolean(self.not_world):
cachedata.possible_world.append(fn)
#else:
# logger.debug2("EXCLUDE FROM WORLD: %s", fn)
@@ -238,15 +238,113 @@ class CoreRecipeInfo(RecipeInfoCommon):
cachedata.fakerootlogs[fn] = self.fakerootlogs
cachedata.extradepsfunc[fn] = self.extradepsfunc
+
+class SiggenRecipeInfo(RecipeInfoCommon):
+ __slots__ = ()
+
+ classname = "SiggenRecipeInfo"
+ cachefile = "bb_cache_" + classname +".dat"
+ # we don't want to show this information in graph files so don't set cachefields
+ #cachefields = []
+
+ def __init__(self, filename, metadata):
+ self.siggen_gendeps = metadata.getVar("__siggen_gendeps", False)
+ self.siggen_varvals = metadata.getVar("__siggen_varvals", False)
+ self.siggen_taskdeps = metadata.getVar("__siggen_taskdeps", False)
+
+ @classmethod
+ def init_cacheData(cls, cachedata):
+ cachedata.siggen_taskdeps = {}
+ cachedata.siggen_gendeps = {}
+ cachedata.siggen_varvals = {}
+
+ def add_cacheData(self, cachedata, fn):
+ cachedata.siggen_gendeps[fn] = self.siggen_gendeps
+ cachedata.siggen_varvals[fn] = self.siggen_varvals
+ cachedata.siggen_taskdeps[fn] = self.siggen_taskdeps
+
+ # The siggen variable data is large and impacts:
+ # - bitbake's overall memory usage
+ # - the amount of data sent over IPC between parsing processes and the server
+ # - the size of the cache files on disk
+ # - the size of "sigdata" hash information files on disk
+ # The data consists of strings (some large) or frozenset lists of variables
+ # As such, we a) deplicate the data here and b) pass references to the object at second
+ # access (e.g. over IPC or saving into pickle).
+
+ store = {}
+ save_map = {}
+ save_count = 1
+ restore_map = {}
+ restore_count = {}
+
+ @classmethod
+ def reset(cls):
+ # Needs to be called before starting new streamed data in a given process
+ # (e.g. writing out the cache again)
+ cls.save_map = {}
+ cls.save_count = 1
+ cls.restore_map = {}
+
+ @classmethod
+ def _save(cls, deps):
+ ret = []
+ if not deps:
+ return deps
+ for dep in deps:
+ fs = deps[dep]
+ if fs is None:
+ ret.append((dep, None, None))
+ elif fs in cls.save_map:
+ ret.append((dep, None, cls.save_map[fs]))
+ else:
+ cls.save_map[fs] = cls.save_count
+ ret.append((dep, fs, cls.save_count))
+ cls.save_count = cls.save_count + 1
+ return ret
+
+ @classmethod
+ def _restore(cls, deps, pid):
+ ret = {}
+ if not deps:
+ return deps
+ if pid not in cls.restore_map:
+ cls.restore_map[pid] = {}
+ map = cls.restore_map[pid]
+ for dep, fs, mapnum in deps:
+ if fs is None and mapnum is None:
+ ret[dep] = None
+ elif fs is None:
+ ret[dep] = map[mapnum]
+ else:
+ try:
+ fs = cls.store[fs]
+ except KeyError:
+ cls.store[fs] = fs
+ map[mapnum] = fs
+ ret[dep] = fs
+ return ret
+
+ def __getstate__(self):
+ ret = {}
+ for key in ["siggen_gendeps", "siggen_taskdeps", "siggen_varvals"]:
+ ret[key] = self._save(self.__dict__[key])
+ ret['pid'] = os.getpid()
+ return ret
+
+ def __setstate__(self, state):
+ pid = state['pid']
+ for key in ["siggen_gendeps", "siggen_taskdeps", "siggen_varvals"]:
+ setattr(self, key, self._restore(state[key], pid))
+
+
def virtualfn2realfn(virtualfn):
"""
Convert a virtual file name to a real one + the associated subclass keyword
"""
mc = ""
if virtualfn.startswith('mc:') and virtualfn.count(':') >= 2:
- elems = virtualfn.split(':')
- mc = elems[1]
- virtualfn = ":".join(elems[2:])
+ (_, mc, virtualfn) = virtualfn.split(':', 2)
fn = virtualfn
cls = ""
@@ -269,7 +367,7 @@ def realfn2virtual(realfn, cls, mc):
def variant2virtual(realfn, variant):
"""
- Convert a real filename + the associated subclass keyword to a virtual filename
+ Convert a real filename + a variant to a virtual filename
"""
if variant == "":
return realfn
@@ -280,75 +378,18 @@ def variant2virtual(realfn, variant):
return "mc:" + elems[1] + ":" + realfn
return "virtual:" + variant + ":" + realfn
-def parse_recipe(bb_data, bbfile, appends, mc=''):
- """
- Parse a recipe
- """
-
- bb_data.setVar("__BBMULTICONFIG", mc)
-
- bbfile_loc = os.path.abspath(os.path.dirname(bbfile))
- bb.parse.cached_mtime_noerror(bbfile_loc)
-
- if appends:
- bb_data.setVar('__BBAPPEND', " ".join(appends))
- bb_data = bb.parse.handle(bbfile, bb_data)
- return bb_data
-
-
-class NoCache(object):
-
- def __init__(self, databuilder):
- self.databuilder = databuilder
- self.data = databuilder.data
-
- def loadDataFull(self, virtualfn, appends):
- """
- Return a complete set of data for fn.
- To do this, we need to parse the file.
- """
- logger.debug("Parsing %s (full)" % virtualfn)
- (fn, virtual, mc) = virtualfn2realfn(virtualfn)
- bb_data = self.load_bbfile(virtualfn, appends, virtonly=True)
- return bb_data[virtual]
-
- def load_bbfile(self, bbfile, appends, virtonly = False, mc=None):
- """
- Load and parse one .bb build file
- Return the data and whether parsing resulted in the file being skipped
- """
-
- if virtonly:
- (bbfile, virtual, mc) = virtualfn2realfn(bbfile)
- bb_data = self.databuilder.mcdata[mc].createCopy()
- bb_data.setVar("__ONLYFINALISE", virtual or "default")
- datastores = parse_recipe(bb_data, bbfile, appends, mc)
- return datastores
-
- if mc is not None:
- bb_data = self.databuilder.mcdata[mc].createCopy()
- return parse_recipe(bb_data, bbfile, appends, mc)
-
- bb_data = self.data.createCopy()
- datastores = parse_recipe(bb_data, bbfile, appends)
-
- for mc in self.databuilder.mcdata:
- if not mc:
- continue
- bb_data = self.databuilder.mcdata[mc].createCopy()
- newstores = parse_recipe(bb_data, bbfile, appends, mc)
- for ns in newstores:
- datastores["mc:%s:%s" % (mc, ns)] = newstores[ns]
-
- return datastores
-
-class Cache(NoCache):
+#
+# Cooker calls cacheValid on its recipe list, then either calls loadCached
+# from it's main thread or parse from separate processes to generate an up to
+# date cache
+#
+class Cache(object):
"""
BitBake Cache implementation
"""
def __init__(self, databuilder, mc, data_hash, caches_array):
- super().__init__(databuilder)
- data = databuilder.data
+ self.databuilder = databuilder
+ self.data = databuilder.data
# Pass caches_array information into Cache Constructor
# It will be used later for deciding whether we
@@ -356,7 +397,7 @@ class Cache(NoCache):
self.mc = mc
self.logger = PrefixLoggerAdapter("Cache: %s: " % (mc if mc else "default"), logger)
self.caches_array = caches_array
- self.cachedir = data.getVar("CACHE")
+ self.cachedir = self.data.getVar("CACHE")
self.clean = set()
self.checked = set()
self.depends_cache = {}
@@ -366,20 +407,12 @@ class Cache(NoCache):
self.filelist_regex = re.compile(r'(?:(?<=:True)|(?<=:False))\s+')
if self.cachedir in [None, '']:
- self.has_cache = False
- self.logger.info("Not using a cache. "
- "Set CACHE = <directory> to enable.")
- return
-
- self.has_cache = True
+ bb.fatal("Please ensure CACHE is set to the cache directory for BitBake to use")
def getCacheFile(self, cachefile):
return getCacheFile(self.cachedir, cachefile, self.mc, self.data_hash)
def prepare_cache(self, progress):
- if not self.has_cache:
- return 0
-
loaded = 0
self.cachefile = self.getCacheFile("bb_cache.dat")
@@ -418,9 +451,6 @@ class Cache(NoCache):
return loaded
def cachesize(self):
- if not self.has_cache:
- return 0
-
cachesize = 0
for cache_class in self.caches_array:
cachefile = self.getCacheFile(cache_class.cachefile)
@@ -482,11 +512,11 @@ class Cache(NoCache):
return len(self.depends_cache)
- def parse(self, filename, appends):
+ def parse(self, filename, appends, layername):
"""Parse the specified filename, returning the recipe information"""
self.logger.debug("Parsing %s", filename)
infos = []
- datastores = self.load_bbfile(filename, appends, mc=self.mc)
+ datastores = self.databuilder.parseRecipeVariants(filename, appends, mc=self.mc, layername=layername)
depends = []
variants = []
# Process the "real" fn last so we can store variants list
@@ -508,43 +538,19 @@ class Cache(NoCache):
return infos
- def load(self, filename, appends):
+ def loadCached(self, filename, appends):
"""Obtain the recipe information for the specified filename,
- using cached values if available, otherwise parsing.
-
- Note that if it does parse to obtain the info, it will not
- automatically add the information to the cache or to your
- CacheData. Use the add or add_info method to do so after
- running this, or use loadData instead."""
- cached = self.cacheValid(filename, appends)
- if cached:
- infos = []
- # info_array item is a list of [CoreRecipeInfo, XXXRecipeInfo]
- info_array = self.depends_cache[filename]
- for variant in info_array[0].variants:
- virtualfn = variant2virtual(filename, variant)
- infos.append((virtualfn, self.depends_cache[virtualfn]))
- else:
- return self.parse(filename, appends, configdata, self.caches_array)
-
- return cached, infos
-
- def loadData(self, fn, appends, cacheData):
- """Load the recipe info for the specified filename,
- parsing and adding to the cache if necessary, and adding
- the recipe information to the supplied CacheData instance."""
- skipped, virtuals = 0, 0
+ using cached values.
+ """
- cached, infos = self.load(fn, appends)
- for virtualfn, info_array in infos:
- if info_array[0].skipped:
- self.logger.debug("Skipping %s: %s", virtualfn, info_array[0].skipreason)
- skipped += 1
- else:
- self.add_info(virtualfn, info_array, cacheData, not cached)
- virtuals += 1
+ infos = []
+ # info_array item is a list of [CoreRecipeInfo, XXXRecipeInfo]
+ info_array = self.depends_cache[filename]
+ for variant in info_array[0].variants:
+ virtualfn = variant2virtual(filename, variant)
+ infos.append((virtualfn, self.depends_cache[virtualfn]))
- return cached, skipped, virtuals
+ return infos
def cacheValid(self, fn, appends):
"""
@@ -553,10 +559,6 @@ class Cache(NoCache):
"""
if fn not in self.checked:
self.cacheValidUpdate(fn, appends)
-
- # Is cache enabled?
- if not self.has_cache:
- return False
if fn in self.clean:
return True
return False
@@ -566,10 +568,6 @@ class Cache(NoCache):
Is the cache valid for fn?
Make thorough (slower) checks including timestamps.
"""
- # Is cache enabled?
- if not self.has_cache:
- return False
-
self.checked.add(fn)
# File isn't in depends_cache
@@ -676,10 +674,6 @@ class Cache(NoCache):
Save the cache
Called from the parser when complete (or exiting)
"""
-
- if not self.has_cache:
- return
-
if self.cacheclean:
self.logger.debug2("Cache is clean, not saving.")
return
@@ -700,6 +694,7 @@ class Cache(NoCache):
p.dump(info)
del self.depends_cache
+ SiggenRecipeInfo.reset()
@staticmethod
def mtime(cachefile):
@@ -722,26 +717,11 @@ class Cache(NoCache):
if watcher:
watcher(info_array[0].file_depends)
- if not self.has_cache:
- return
-
if (info_array[0].skipped or 'SRCREVINACTION' not in info_array[0].pv) and not info_array[0].nocache:
if parsed:
self.cacheclean = False
self.depends_cache[filename] = info_array
- def add(self, file_name, data, cacheData, parsed=None):
- """
- Save data we need into the cache
- """
-
- realfn = virtualfn2realfn(file_name)[0]
-
- info_array = []
- for cache_class in self.caches_array:
- info_array.append(cache_class(realfn, data))
- self.add_info(file_name, info_array, cacheData, parsed)
-
class MulticonfigCache(Mapping):
def __init__(self, databuilder, data_hash, caches_array):
def progress(p):
@@ -778,6 +758,7 @@ class MulticonfigCache(Mapping):
loaded = 0
for c in self.__caches.values():
+ SiggenRecipeInfo.reset()
loaded += c.prepare_cache(progress)
previous_progress = current_progress
@@ -855,11 +836,10 @@ class MultiProcessCache(object):
self.cachedata = self.create_cachedata()
self.cachedata_extras = self.create_cachedata()
- def init_cache(self, d, cache_file_name=None):
- cachedir = (d.getVar("PERSISTENT_DIR") or
- d.getVar("CACHE"))
- if cachedir in [None, '']:
+ def init_cache(self, cachedir, cache_file_name=None):
+ if not cachedir:
return
+
bb.utils.mkdirhier(cachedir)
self.cachefile = os.path.join(cachedir,
cache_file_name or self.__class__.cache_file_name)
@@ -890,6 +870,10 @@ class MultiProcessCache(object):
if not self.cachefile:
return
+ have_data = any(self.cachedata_extras)
+ if not have_data:
+ return
+
glf = bb.utils.lockfile(self.cachefile + ".lock", shared=True)
i = os.getpid()
@@ -924,6 +908,8 @@ class MultiProcessCache(object):
data = self.cachedata
+ have_data = False
+
for f in [y for y in os.listdir(os.path.dirname(self.cachefile)) if y.startswith(os.path.basename(self.cachefile) + '-')]:
f = os.path.join(os.path.dirname(self.cachefile), f)
try:
@@ -938,12 +924,14 @@ class MultiProcessCache(object):
os.unlink(f)
continue
+ have_data = True
self.merge_data(extradata, data)
os.unlink(f)
- with open(self.cachefile, "wb") as f:
- p = pickle.Pickler(f, -1)
- p.dump([data, self.__class__.CACHE_VERSION])
+ if have_data:
+ with open(self.cachefile, "wb") as f:
+ p = pickle.Pickler(f, -1)
+ p.dump([data, self.__class__.CACHE_VERSION])
bb.utils.unlockfile(glf)
diff --git a/bitbake/lib/bb/codeparser.py b/bitbake/lib/bb/codeparser.py
index 9d66d3ae41..691bdff75e 100644
--- a/bitbake/lib/bb/codeparser.py
+++ b/bitbake/lib/bb/codeparser.py
@@ -27,6 +27,7 @@ import ast
import sys
import codegen
import logging
+import inspect
import bb.pysh as pysh
import bb.utils, bb.data
import hashlib
@@ -58,10 +59,40 @@ def check_indent(codestr):
return codestr
-# A custom getstate/setstate using tuples is actually worth 15% cachesize by
-# avoiding duplication of the attribute names!
+modulecode_deps = {}
+def add_module_functions(fn, functions, namespace):
+ import os
+ fstat = os.stat(fn)
+ fixedhash = fn + ":" + str(fstat.st_size) + ":" + str(fstat.st_mtime)
+ for f in functions:
+ name = "%s.%s" % (namespace, f)
+ parser = PythonParser(name, logger)
+ try:
+ parser.parse_python(None, filename=fn, lineno=1, fixedhash=fixedhash+f)
+ #bb.warn("Cached %s" % f)
+ except KeyError:
+ lines, lineno = inspect.getsourcelines(functions[f])
+ src = "".join(lines)
+ parser.parse_python(src, filename=fn, lineno=lineno, fixedhash=fixedhash+f)
+ #bb.warn("Not cached %s" % f)
+ execs = parser.execs.copy()
+ # Expand internal module exec references
+ for e in parser.execs:
+ if e in functions:
+ execs.remove(e)
+ execs.add(namespace + "." + e)
+ modulecode_deps[name] = [parser.references.copy(), execs, parser.var_execs.copy(), parser.contains.copy()]
+ #bb.warn("%s: %s\nRefs:%s Execs: %s %s %s" % (name, fn, parser.references, parser.execs, parser.var_execs, parser.contains))
+
+def update_module_dependencies(d):
+ for mod in modulecode_deps:
+ excludes = set((d.getVarFlag(mod, "vardepsexclude") or "").split())
+ if excludes:
+ modulecode_deps[mod] = [modulecode_deps[mod][0] - excludes, modulecode_deps[mod][1] - excludes, modulecode_deps[mod][2] - excludes, modulecode_deps[mod][3]]
+# A custom getstate/setstate using tuples is actually worth 15% cachesize by
+# avoiding duplication of the attribute names!
class SetCache(object):
def __init__(self):
self.setcache = {}
@@ -154,12 +185,12 @@ class CodeParserCache(MultiProcessCache):
self.shellcachelines[h] = cacheline
return cacheline
- def init_cache(self, d):
+ def init_cache(self, cachedir):
# Check if we already have the caches
if self.pythoncache:
return
- MultiProcessCache.init_cache(self, d)
+ MultiProcessCache.init_cache(self, cachedir)
# cachedata gets re-assigned in the parent
self.pythoncache = self.cachedata[0]
@@ -171,8 +202,8 @@ class CodeParserCache(MultiProcessCache):
codeparsercache = CodeParserCache()
-def parser_cache_init(d):
- codeparsercache.init_cache(d)
+def parser_cache_init(cachedir):
+ codeparsercache.init_cache(cachedir)
def parser_cache_save():
codeparsercache.save_extras()
@@ -225,19 +256,19 @@ class PythonParser():
def visit_Call(self, node):
name = self.called_node_name(node.func)
if name and (name.endswith(self.getvars) or name.endswith(self.getvarflags) or name in self.containsfuncs or name in self.containsanyfuncs):
- if isinstance(node.args[0], ast.Str):
- varname = node.args[0].s
- if name in self.containsfuncs and isinstance(node.args[1], ast.Str):
+ if isinstance(node.args[0], ast.Constant) and isinstance(node.args[0].value, str):
+ varname = node.args[0].value
+ if name in self.containsfuncs and isinstance(node.args[1], ast.Constant):
if varname not in self.contains:
self.contains[varname] = set()
- self.contains[varname].add(node.args[1].s)
- elif name in self.containsanyfuncs and isinstance(node.args[1], ast.Str):
+ self.contains[varname].add(node.args[1].value)
+ elif name in self.containsanyfuncs and isinstance(node.args[1], ast.Constant):
if varname not in self.contains:
self.contains[varname] = set()
- self.contains[varname].update(node.args[1].s.split())
+ self.contains[varname].update(node.args[1].value.split())
elif name.endswith(self.getvarflags):
- if isinstance(node.args[1], ast.Str):
- self.references.add('%s[%s]' % (varname, node.args[1].s))
+ if isinstance(node.args[1], ast.Constant):
+ self.references.add('%s[%s]' % (varname, node.args[1].value))
else:
self.warn(node.func, node.args[1])
else:
@@ -245,8 +276,8 @@ class PythonParser():
else:
self.warn(node.func, node.args[0])
elif name and name.endswith(".expand"):
- if isinstance(node.args[0], ast.Str):
- value = node.args[0].s
+ if isinstance(node.args[0], ast.Constant):
+ value = node.args[0].value
d = bb.data.init()
parser = d.expandWithRefs(value, self.name)
self.references |= parser.references
@@ -256,8 +287,8 @@ class PythonParser():
self.contains[varname] = set()
self.contains[varname] |= parser.contains[varname]
elif name in self.execfuncs:
- if isinstance(node.args[0], ast.Str):
- self.var_execs.add(node.args[0].s)
+ if isinstance(node.args[0], ast.Constant):
+ self.var_execs.add(node.args[0].value)
else:
self.warn(node.func, node.args[0])
elif name and isinstance(node.func, (ast.Name, ast.Attribute)):
@@ -289,11 +320,17 @@ class PythonParser():
self.unhandled_message = "in call of %s, argument '%s' is not a string literal"
self.unhandled_message = "while parsing %s, %s" % (name, self.unhandled_message)
- def parse_python(self, node, lineno=0, filename="<string>"):
- if not node or not node.strip():
+ # For the python module code it is expensive to have the function text so it is
+ # uses a different fixedhash to cache against. We can take the hit on obtaining the
+ # text if it isn't in the cache.
+ def parse_python(self, node, lineno=0, filename="<string>", fixedhash=None):
+ if not fixedhash and (not node or not node.strip()):
return
- h = bbhash(str(node))
+ if fixedhash:
+ h = fixedhash
+ else:
+ h = bbhash(str(node))
if h in codeparsercache.pythoncache:
self.references = set(codeparsercache.pythoncache[h].refs)
@@ -311,6 +348,9 @@ class PythonParser():
self.contains[i] = set(codeparsercache.pythoncacheextras[h].contains[i])
return
+ if fixedhash and not node:
+ raise KeyError
+
# Need to parse so take the hit on the real log buffer
self.log = BufferedLogger('BitBake.Data.PythonParser', logging.DEBUG, self._log)
@@ -444,19 +484,34 @@ class ShellParser():
"""
words = list(words)
- for word in list(words):
+ for word in words:
wtree = pyshlex.make_wordtree(word[1])
for part in wtree:
if not isinstance(part, list):
continue
- if part[0] in ('`', '$('):
- command = pyshlex.wordtree_as_string(part[1:-1])
- self._parse_shell(command)
-
- if word[0] in ("cmd_name", "cmd_word"):
- if word in words:
- words.remove(word)
+ candidates = [part]
+
+ # If command is of type:
+ #
+ # var="... $(cmd [...]) ..."
+ #
+ # Then iterate on what's between the quotes and if we find a
+ # list, make that what we check for below.
+ if len(part) >= 3 and part[0] == '"':
+ for p in part[1:-1]:
+ if isinstance(p, list):
+ candidates.append(p)
+
+ for candidate in candidates:
+ if len(candidate) >= 2:
+ if candidate[0] in ('`', '$('):
+ command = pyshlex.wordtree_as_string(candidate[1:-1])
+ self._parse_shell(command)
+
+ if word[0] in ("cmd_name", "cmd_word"):
+ if word in words:
+ words.remove(word)
usetoken = False
for word in words:
diff --git a/bitbake/lib/bb/command.py b/bitbake/lib/bb/command.py
index ec86885220..1fcb9bf14c 100644
--- a/bitbake/lib/bb/command.py
+++ b/bitbake/lib/bb/command.py
@@ -51,20 +51,21 @@ class Command:
"""
A queue of asynchronous commands for bitbake
"""
- def __init__(self, cooker):
+ def __init__(self, cooker, process_server):
self.cooker = cooker
self.cmds_sync = CommandsSync()
self.cmds_async = CommandsAsync()
self.remotedatastores = None
- # FIXME Add lock for this
+ self.process_server = process_server
+ # Access with locking using process_server.{get/set/clear}_async_cmd()
self.currentAsyncCommand = None
- def runCommand(self, commandline, ro_only = False):
+ def runCommand(self, commandline, process_server, ro_only=False):
command = commandline.pop(0)
# Ensure cooker is ready for commands
- if command != "updateConfig" and command != "setFeatures":
+ if command not in ["updateConfig", "setFeatures", "ping"]:
try:
self.cooker.init_configdata()
if not self.remotedatastores:
@@ -84,7 +85,6 @@ class Command:
if not hasattr(command_method, 'readonly') or not getattr(command_method, 'readonly'):
return None, "Not able to execute not readonly commands in readonly mode"
try:
- self.cooker.process_inotify_updates()
if getattr(command_method, 'needconfig', True):
self.cooker.updateCacheSync()
result = command_method(self, commandline)
@@ -99,24 +99,23 @@ class Command:
return None, traceback.format_exc()
else:
return result, None
- if self.currentAsyncCommand is not None:
- return None, "Busy (%s in progress)" % self.currentAsyncCommand[0]
if command not in CommandsAsync.__dict__:
return None, "No such command"
- self.currentAsyncCommand = (command, commandline)
- self.cooker.idleCallBackRegister(self.cooker.runCommands, self.cooker)
+ if not process_server.set_async_cmd((command, commandline)):
+ return None, "Busy (%s in progress)" % self.process_server.get_async_cmd()[0]
+ self.cooker.idleCallBackRegister(self.runAsyncCommand, process_server)
return True, None
- def runAsyncCommand(self):
+ def runAsyncCommand(self, _, process_server, halt):
try:
- self.cooker.process_inotify_updates()
if self.cooker.state in (bb.cooker.state.error, bb.cooker.state.shutdown, bb.cooker.state.forceshutdown):
# updateCache will trigger a shutdown of the parser
# and then raise BBHandledException triggering an exit
self.cooker.updateCache()
- return False
- if self.currentAsyncCommand is not None:
- (command, options) = self.currentAsyncCommand
+ return bb.server.process.idleFinish("Cooker in error state")
+ cmd = process_server.get_async_cmd()
+ if cmd is not None:
+ (command, options) = cmd
commandmethod = getattr(CommandsAsync, command)
needcache = getattr( commandmethod, "needcache" )
if needcache and self.cooker.state != bb.cooker.state.running:
@@ -126,24 +125,21 @@ class Command:
commandmethod(self.cmds_async, self, options)
return False
else:
- return False
+ return bb.server.process.idleFinish("Nothing to do, no async command?")
except KeyboardInterrupt as exc:
- self.finishAsyncCommand("Interrupted")
- return False
+ return bb.server.process.idleFinish("Interrupted")
except SystemExit as exc:
arg = exc.args[0]
if isinstance(arg, str):
- self.finishAsyncCommand(arg)
+ return bb.server.process.idleFinish(arg)
else:
- self.finishAsyncCommand("Exited with %s" % arg)
- return False
+ return bb.server.process.idleFinish("Exited with %s" % arg)
except Exception as exc:
import traceback
if isinstance(exc, bb.BBHandledException):
- self.finishAsyncCommand("")
+ return bb.server.process.idleFinish("")
else:
- self.finishAsyncCommand(traceback.format_exc())
- return False
+ return bb.server.process.idleFinish(traceback.format_exc())
def finishAsyncCommand(self, msg=None, code=None):
if msg or msg == "":
@@ -152,8 +148,8 @@ class Command:
bb.event.fire(CommandExit(code), self.cooker.data)
else:
bb.event.fire(CommandCompleted(), self.cooker.data)
- self.currentAsyncCommand = None
self.cooker.finishcommand()
+ self.process_server.clear_async_cmd()
def reset(self):
if self.remotedatastores:
@@ -166,6 +162,14 @@ class CommandsSync:
These must not influence any running synchronous command.
"""
+ def ping(self, command, params):
+ """
+ Allow a UI to check the server is still alive
+ """
+ return "Still alive!"
+ ping.needconfig = False
+ ping.readonly = True
+
def stateShutdown(self, command, params):
"""
Trigger cooker 'shutdown' mode
@@ -303,6 +307,11 @@ class CommandsSync:
return ret
getLayerPriorities.readonly = True
+ def revalidateCaches(self, command, params):
+ """Called by UI clients when metadata may have changed"""
+ command.cooker.revalidateCaches()
+ parseConfiguration.needconfig = False
+
def getRecipes(self, command, params):
try:
mc = params[0]
@@ -541,8 +550,8 @@ class CommandsSync:
and return a datastore object representing the environment
for the recipe.
"""
- fn = params[0]
- mc = bb.runqueue.mc_from_tid(fn)
+ virtualfn = params[0]
+ (fn, cls, mc) = bb.cache.virtualfn2realfn(virtualfn)
appends = params[1]
appendlist = params[2]
if len(params) > 3:
@@ -557,6 +566,7 @@ class CommandsSync:
appendfiles = command.cooker.collections[mc].get_file_appends(fn)
else:
appendfiles = []
+ layername = command.cooker.collections[mc].calc_bbfile_priority(fn)[2]
# We are calling bb.cache locally here rather than on the server,
# but that's OK because it doesn't actually need anything from
# the server barring the global datastore (which we have a remote
@@ -564,11 +574,10 @@ class CommandsSync:
if config_data:
# We have to use a different function here if we're passing in a datastore
# NOTE: we took a copy above, so we don't do it here again
- envdata = bb.cache.parse_recipe(config_data, fn, appendfiles, mc)['']
+ envdata = command.cooker.databuilder._parse_recipe(config_data, fn, appendfiles, mc, layername)[cls]
else:
# Use the standard path
- parser = bb.cache.NoCache(command.cooker.databuilder)
- envdata = parser.loadDataFull(fn, appendfiles)
+ envdata = command.cooker.databuilder.parseRecipe(virtualfn, appendfiles, layername)
idx = command.remotedatastores.store(envdata)
return DataStoreConnectionHandle(idx)
parseRecipeFile.readonly = True
@@ -741,7 +750,7 @@ class CommandsAsync:
"""
event = params[0]
bb.event.fire(eval(event), command.cooker.data)
- command.currentAsyncCommand = None
+ process_server.clear_async_cmd()
triggerEvent.needcache = False
def resetCooker(self, command, params):
@@ -768,7 +777,14 @@ class CommandsAsync:
(mc, pn) = bb.runqueue.split_mc(params[0])
taskname = params[1]
sigs = params[2]
+ bb.siggen.check_siggen_version(bb.siggen)
res = bb.siggen.find_siginfo(pn, taskname, sigs, command.cooker.databuilder.mcdata[mc])
bb.event.fire(bb.event.FindSigInfoResult(res), command.cooker.databuilder.mcdata[mc])
command.finishAsyncCommand()
findSigInfo.needcache = False
+
+ def getTaskSignatures(self, command, params):
+ res = command.cooker.getTaskSignatures(params[0], params[1])
+ bb.event.fire(bb.event.GetTaskSignatureResult(res), command.cooker.data)
+ command.finishAsyncCommand()
+ getTaskSignatures.needcache = True
diff --git a/bitbake/lib/bb/cooker.py b/bitbake/lib/bb/cooker.py
index 1b6ee3032c..255b9f199a 100644
--- a/bitbake/lib/bb/cooker.py
+++ b/bitbake/lib/bb/cooker.py
@@ -22,7 +22,6 @@ from bb import utils, data, parse, event, cache, providers, taskdata, runqueue,
import queue
import signal
import prserv.serv
-import pyinotify
import json
import pickle
import codecs
@@ -80,7 +79,7 @@ class SkippedPackage:
class CookerFeatures(object):
- _feature_list = [HOB_EXTRA_CACHES, BASEDATASTORE_TRACKING, SEND_SANITYEVENTS] = list(range(3))
+ _feature_list = [HOB_EXTRA_CACHES, BASEDATASTORE_TRACKING, SEND_SANITYEVENTS, RECIPE_SIGGEN_INFO] = list(range(4))
def __init__(self):
self._features=set()
@@ -103,12 +102,15 @@ class CookerFeatures(object):
class EventWriter:
def __init__(self, cooker, eventfile):
- self.file_inited = None
self.cooker = cooker
self.eventfile = eventfile
self.event_queue = []
- def write_event(self, event):
+ def write_variables(self):
+ with open(self.eventfile, "a") as f:
+ f.write("%s\n" % json.dumps({ "allvariables" : self.cooker.getAllKeysWithFlags(["doc", "func"])}))
+
+ def send(self, event):
with open(self.eventfile, "a") as f:
try:
str_event = codecs.encode(pickle.dumps(event), 'base64').decode('utf-8')
@@ -118,28 +120,6 @@ class EventWriter:
import traceback
print(err, traceback.format_exc())
- def send(self, event):
- if self.file_inited:
- # we have the file, just write the event
- self.write_event(event)
- else:
- # init on bb.event.BuildStarted
- name = "%s.%s" % (event.__module__, event.__class__.__name__)
- if name in ("bb.event.BuildStarted", "bb.cooker.CookerExit"):
- with open(self.eventfile, "w") as f:
- f.write("%s\n" % json.dumps({ "allvariables" : self.cooker.getAllKeysWithFlags(["doc", "func"])}))
-
- self.file_inited = True
-
- # write pending events
- for evt in self.event_queue:
- self.write_event(evt)
-
- # also write the current event
- self.write_event(event)
- else:
- # queue all events until the file is inited
- self.event_queue.append(event)
#============================================================================#
# BBCooker
@@ -149,8 +129,10 @@ class BBCooker:
Manages one bitbake build run
"""
- def __init__(self, featureSet=None, idleCallBackRegister=None):
+ def __init__(self, featureSet=None, server=None):
self.recipecaches = None
+ self.baseconfig_valid = False
+ self.parsecache_valid = False
self.eventlog = None
self.skiplist = {}
self.featureset = CookerFeatures()
@@ -163,20 +145,17 @@ class BBCooker:
self.configuration = bb.cookerdata.CookerConfiguration()
- self.idleCallBackRegister = idleCallBackRegister
+ self.process_server = server
+ self.idleCallBackRegister = None
+ self.waitIdle = None
+ if server:
+ self.idleCallBackRegister = server.register_idle_function
+ self.waitIdle = server.wait_for_idle
bb.debug(1, "BBCooker starting %s" % time.time())
- sys.stdout.flush()
-
- self.configwatcher = None
- self.confignotifier = None
-
- self.watchmask = pyinotify.IN_CLOSE_WRITE | pyinotify.IN_CREATE | pyinotify.IN_DELETE | \
- pyinotify.IN_DELETE_SELF | pyinotify.IN_MODIFY | pyinotify.IN_MOVE_SELF | \
- pyinotify.IN_MOVED_FROM | pyinotify.IN_MOVED_TO
- self.watcher = None
- self.notifier = None
+ self.configwatched = {}
+ self.parsewatched = {}
# If being called by something like tinfoil, we need to clean cached data
# which may now be invalid
@@ -187,14 +166,6 @@ class BBCooker:
self.hashserv = None
self.hashservaddr = None
- self.inotify_modified_files = []
-
- def _process_inotify_updates(server, cooker, halt):
- cooker.process_inotify_updates()
- return 1.0
-
- self.idleCallBackRegister(_process_inotify_updates, self)
-
# TOSTOP must not be set or our children will hang when they output
try:
fd = sys.stdout.fileno()
@@ -208,7 +179,7 @@ class BBCooker:
except UnsupportedOperation:
pass
- self.command = bb.command.Command(self)
+ self.command = bb.command.Command(self, self.process_server)
self.state = state.initial
self.parser = None
@@ -218,116 +189,37 @@ class BBCooker:
signal.signal(signal.SIGHUP, self.sigterm_exception)
bb.debug(1, "BBCooker startup complete %s" % time.time())
- sys.stdout.flush()
def init_configdata(self):
if not hasattr(self, "data"):
self.initConfigurationData()
bb.debug(1, "BBCooker parsed base configuration %s" % time.time())
- sys.stdout.flush()
self.handlePRServ()
- def setupConfigWatcher(self):
- if self.configwatcher:
- self.configwatcher.close()
- self.confignotifier = None
- self.configwatcher = None
- self.configwatcher = pyinotify.WatchManager()
- self.configwatcher.bbseen = set()
- self.configwatcher.bbwatchedfiles = set()
- self.confignotifier = pyinotify.Notifier(self.configwatcher, self.config_notifications)
-
- def setupParserWatcher(self):
- if self.watcher:
- self.watcher.close()
- self.notifier = None
- self.watcher = None
- self.watcher = pyinotify.WatchManager()
- self.watcher.bbseen = set()
- self.watcher.bbwatchedfiles = set()
- self.notifier = pyinotify.Notifier(self.watcher, self.notifications)
-
- def process_inotify_updates(self):
- for n in [self.confignotifier, self.notifier]:
- if n and n.check_events(timeout=0):
- # read notified events and enqeue them
- n.read_events()
- n.process_events()
-
- def config_notifications(self, event):
- if event.maskname == "IN_Q_OVERFLOW":
- bb.warn("inotify event queue overflowed, invalidating caches.")
- self.parsecache_valid = False
- self.baseconfig_valid = False
- bb.parse.clear_cache()
- return
- if not event.pathname in self.configwatcher.bbwatchedfiles:
- return
- if "IN_ISDIR" in event.maskname:
- if "IN_CREATE" in event.maskname or "IN_DELETE" in event.maskname:
- if event.pathname in self.configwatcher.bbseen:
- self.configwatcher.bbseen.remove(event.pathname)
- # Could remove all entries starting with the directory but for now...
- bb.parse.clear_cache()
- if not event.pathname in self.inotify_modified_files:
- self.inotify_modified_files.append(event.pathname)
- self.baseconfig_valid = False
-
- def notifications(self, event):
- if event.maskname == "IN_Q_OVERFLOW":
- bb.warn("inotify event queue overflowed, invalidating caches.")
- self.parsecache_valid = False
- bb.parse.clear_cache()
- return
- if event.pathname.endswith("bitbake-cookerdaemon.log") \
- or event.pathname.endswith("bitbake.lock"):
- return
- if "IN_ISDIR" in event.maskname:
- if "IN_CREATE" in event.maskname or "IN_DELETE" in event.maskname:
- if event.pathname in self.watcher.bbseen:
- self.watcher.bbseen.remove(event.pathname)
- # Could remove all entries starting with the directory but for now...
- bb.parse.clear_cache()
- if not event.pathname in self.inotify_modified_files:
- self.inotify_modified_files.append(event.pathname)
- self.parsecache_valid = False
+ def _baseconfig_set(self, value):
+ if value and not self.baseconfig_valid:
+ bb.server.process.serverlog("Base config valid")
+ elif not value and self.baseconfig_valid:
+ bb.server.process.serverlog("Base config invalidated")
+ self.baseconfig_valid = value
+
+ def _parsecache_set(self, value):
+ if value and not self.parsecache_valid:
+ bb.server.process.serverlog("Parse cache valid")
+ elif not value and self.parsecache_valid:
+ bb.server.process.serverlog("Parse cache invalidated")
+ self.parsecache_valid = value
+
+ def add_filewatch(self, deps, configwatcher=False):
+ if configwatcher:
+ watcher = self.configwatched
+ else:
+ watcher = self.parsewatched
- def add_filewatch(self, deps, watcher=None, dirs=False):
- if not watcher:
- watcher = self.watcher
for i in deps:
- watcher.bbwatchedfiles.add(i[0])
- if dirs:
- f = i[0]
- else:
- f = os.path.dirname(i[0])
- if f in watcher.bbseen:
- continue
- watcher.bbseen.add(f)
- watchtarget = None
- while True:
- # We try and add watches for files that don't exist but if they did, would influence
- # the parser. The parent directory of these files may not exist, in which case we need
- # to watch any parent that does exist for changes.
- try:
- watcher.add_watch(f, self.watchmask, quiet=False)
- if watchtarget:
- watcher.bbwatchedfiles.add(watchtarget)
- break
- except pyinotify.WatchManagerError as e:
- if 'ENOENT' in str(e):
- watchtarget = f
- f = os.path.dirname(f)
- if f in watcher.bbseen:
- break
- watcher.bbseen.add(f)
- continue
- if 'ENOSPC' in str(e):
- providerlog.error("No space left on device or exceeds fs.inotify.max_user_watches?")
- providerlog.error("To check max_user_watches: sysctl -n fs.inotify.max_user_watches.")
- providerlog.error("To modify max_user_watches: sysctl -n -w fs.inotify.max_user_watches=<value>.")
- providerlog.error("Root privilege is required to modify max_user_watches.")
- raise
+ f = i[0]
+ mtime = i[1]
+ watcher[f] = mtime
def sigterm_exception(self, signum, stackframe):
if signum == signal.SIGTERM:
@@ -335,6 +227,7 @@ class BBCooker:
elif signum == signal.SIGHUP:
bb.warn("Cooker received SIGHUP, shutting down...")
self.state = state.forceshutdown
+ bb.event._should_exit.set()
def setFeatures(self, features):
# we only accept a new feature set if we're in state initial, so we can reset without problems
@@ -357,7 +250,7 @@ class BBCooker:
if mod not in self.orig_sysmodules:
del sys.modules[mod]
- self.setupConfigWatcher()
+ self.configwatched = {}
# Need to preserve BB_CONSOLELOG over resets
consolelog = None
@@ -367,12 +260,12 @@ class BBCooker:
if CookerFeatures.BASEDATASTORE_TRACKING in self.featureset:
self.enableDataTracking()
- all_extra_cache_names = []
+ caches_name_array = ['bb.cache:CoreRecipeInfo']
# We hardcode all known cache types in a single place, here.
if CookerFeatures.HOB_EXTRA_CACHES in self.featureset:
- all_extra_cache_names.append("bb.cache_extra:HobRecipeInfo")
-
- caches_name_array = ['bb.cache:CoreRecipeInfo'] + all_extra_cache_names
+ caches_name_array.append("bb.cache_extra:HobRecipeInfo")
+ if CookerFeatures.RECIPE_SIGGEN_INFO in self.featureset:
+ caches_name_array.append("bb.cache:SiggenRecipeInfo")
# At least CoreRecipeInfo will be loaded, so caches_array will never be empty!
# This is the entry point, no further check needed!
@@ -391,6 +284,10 @@ class BBCooker:
self.data_hash = self.databuilder.data_hash
self.extraconfigdata = {}
+ eventlog = self.data.getVar("BB_DEFAULT_EVENTLOG")
+ if not self.configuration.writeeventlog and eventlog:
+ self.setupEventLog(eventlog)
+
if consolelog:
self.data.setVar("BB_CONSOLELOG", consolelog)
@@ -400,12 +297,10 @@ class BBCooker:
self.disableDataTracking()
for mc in self.databuilder.mcdata.values():
- mc.renameVar("__depends", "__base_depends")
- self.add_filewatch(mc.getVar("__base_depends", False), self.configwatcher)
- mc.setVar("__bbclasstype", "recipe")
+ self.add_filewatch(mc.getVar("__base_depends", False), configwatcher=True)
- self.baseconfig_valid = True
- self.parsecache_valid = False
+ self._baseconfig_set(True)
+ self._parsecache_set(False)
def handlePRServ(self):
# Setup a PR Server based on the new configuration
@@ -420,13 +315,13 @@ class BBCooker:
dbfile = (self.data.getVar("PERSISTENT_DIR") or self.data.getVar("CACHE")) + "/hashserv.db"
upstream = self.data.getVar("BB_HASHSERVE_UPSTREAM") or None
if upstream:
- import socket
try:
- sock = socket.create_connection(upstream.split(":"), 5)
- sock.close()
- except socket.error as e:
- bb.warn("BB_HASHSERVE_UPSTREAM is not valid, unable to connect hash equivalence server at '%s': %s"
+ with hashserv.create_client(upstream) as client:
+ client.ping()
+ except (ConnectionError, ImportError) as e:
+ bb.warn("BB_HASHSERVE_UPSTREAM is not valid, unable to connect hash equivalence server at '%s': %s"
% (upstream, repr(e)))
+ upstream = None
self.hashservaddr = "unix://%s/hashserve.sock" % self.data.getVar("TOPDIR")
self.hashserv = hashserv.create_server(
@@ -435,11 +330,9 @@ class BBCooker:
sync=False,
upstream=upstream,
)
- self.hashserv.serve_as_process()
- self.data.setVar("BB_HASHSERVE", self.hashservaddr)
- self.databuilder.origdata.setVar("BB_HASHSERVE", self.hashservaddr)
- self.databuilder.data.setVar("BB_HASHSERVE", self.hashservaddr)
+ self.hashserv.serve_as_process(log_level=logging.WARNING)
for mc in self.databuilder.mcdata:
+ self.databuilder.mcorigdata[mc].setVar("BB_HASHSERVE", self.hashservaddr)
self.databuilder.mcdata[mc].setVar("BB_HASHSERVE", self.hashservaddr)
bb.parse.init_parser(self.data)
@@ -454,6 +347,29 @@ class BBCooker:
if hasattr(self, "data"):
self.data.disableTracking()
+ def revalidateCaches(self):
+ bb.parse.clear_cache()
+
+ clean = True
+ for f in self.configwatched:
+ if not bb.parse.check_mtime(f, self.configwatched[f]):
+ bb.server.process.serverlog("Found %s changed, invalid cache" % f)
+ self._baseconfig_set(False)
+ self._parsecache_set(False)
+ clean = False
+ break
+
+ if clean:
+ for f in self.parsewatched:
+ if not bb.parse.check_mtime(f, self.parsewatched[f]):
+ bb.server.process.serverlog("Found %s changed, invalid cache" % f)
+ self._parsecache_set(False)
+ clean = False
+ break
+
+ if not clean:
+ bb.parse.BBHandler.cached_statements = {}
+
def parseConfiguration(self):
self.updateCacheSync()
@@ -472,8 +388,24 @@ class BBCooker:
self.recipecaches[mc] = bb.cache.CacheData(self.caches_array)
self.handleCollections(self.data.getVar("BBFILE_COLLECTIONS"))
-
- self.parsecache_valid = False
+ self.collections = {}
+ for mc in self.multiconfigs:
+ self.collections[mc] = CookerCollectFiles(self.bbfile_config_priorities, mc)
+
+ self._parsecache_set(False)
+
+ def setupEventLog(self, eventlog):
+ if self.eventlog and self.eventlog[0] != eventlog:
+ bb.event.unregister_UIHhandler(self.eventlog[1])
+ self.eventlog = None
+ if not self.eventlog or self.eventlog[0] != eventlog:
+ # we log all events to a file if so directed
+ # register the log file writer as UI Handler
+ if not os.path.exists(os.path.dirname(eventlog)):
+ bb.utils.mkdirhier(os.path.dirname(eventlog))
+ writer = EventWriter(self, eventlog)
+ EventLogWriteHandler = namedtuple('EventLogWriteHandler', ['event'])
+ self.eventlog = (eventlog, bb.event.register_UIHhandler(EventLogWriteHandler(writer)), writer)
def updateConfigOpts(self, options, environment, cmdline):
self.ui_cmdline = cmdline
@@ -494,14 +426,7 @@ class BBCooker:
setattr(self.configuration, o, options[o])
if self.configuration.writeeventlog:
- if self.eventlog and self.eventlog[0] != self.configuration.writeeventlog:
- bb.event.unregister_UIHhandler(self.eventlog[1])
- if not self.eventlog or self.eventlog[0] != self.configuration.writeeventlog:
- # we log all events to a file if so directed
- # register the log file writer as UI Handler
- writer = EventWriter(self, self.configuration.writeeventlog)
- EventLogWriteHandler = namedtuple('EventLogWriteHandler', ['event'])
- self.eventlog = (self.configuration.writeeventlog, bb.event.register_UIHhandler(EventLogWriteHandler(writer)))
+ self.setupEventLog(self.configuration.writeeventlog)
bb.msg.loggerDefaultLogLevel = self.configuration.default_loglevel
bb.msg.loggerDefaultDomains = self.configuration.debug_domains
@@ -531,19 +456,11 @@ class BBCooker:
# Now update all the variables not in the datastore to match
self.configuration.env = environment
+ self.revalidateCaches()
if not clean:
logger.debug("Base environment change, triggering reparse")
self.reset()
- def runCommands(self, server, data, halt):
- """
- Run any queued asynchronous command
- This is done by the idle handler so it runs in true context rather than
- tied to any UI.
- """
-
- return self.command.runAsyncCommand()
-
def showVersions(self):
(latest_versions, preferred_versions, required) = self.findProviders()
@@ -617,14 +534,14 @@ class BBCooker:
if fn:
try:
- bb_caches = bb.cache.MulticonfigCache(self.databuilder, self.data_hash, self.caches_array)
- envdata = bb_caches[mc].loadDataFull(fn, self.collections[mc].get_file_appends(fn))
+ layername = self.collections[mc].calc_bbfile_priority(fn)[2]
+ envdata = self.databuilder.parseRecipe(fn, self.collections[mc].get_file_appends(fn), layername)
except Exception as e:
parselog.exception("Unable to read %s", fn)
raise
else:
if not mc in self.databuilder.mcdata:
- bb.fatal('Not multiconfig named "%s" found' % mc)
+ bb.fatal('No multiconfig named "%s" found' % mc)
envdata = self.databuilder.mcdata[mc]
data.expandKeys(envdata)
parse.ast.runAnonFuncs(envdata)
@@ -763,14 +680,14 @@ class BBCooker:
bb.event.fire(bb.event.TreeDataPreparationCompleted(len(fulltargetlist)), self.data)
return taskdata, runlist
- def prepareTreeData(self, pkgs_to_build, task):
+ def prepareTreeData(self, pkgs_to_build, task, halt=False):
"""
Prepare a runqueue and taskdata object for iteration over pkgs_to_build
"""
# We set halt to False here to prevent unbuildable targets raising
# an exception when we're just generating data
- taskdata, runlist = self.buildTaskData(pkgs_to_build, task, False, allowincomplete=True)
+ taskdata, runlist = self.buildTaskData(pkgs_to_build, task, halt, allowincomplete=True)
return runlist, taskdata
@@ -784,7 +701,7 @@ class BBCooker:
if not task.startswith("do_"):
task = "do_%s" % task
- runlist, taskdata = self.prepareTreeData(pkgs_to_build, task)
+ runlist, taskdata = self.prepareTreeData(pkgs_to_build, task, halt=True)
rq = bb.runqueue.RunQueue(self, self.data, self.recipecaches, taskdata, runlist)
rq.rqdata.prepare()
return self.buildDependTree(rq, taskdata)
@@ -1277,15 +1194,15 @@ class BBCooker:
except bb.utils.VersionStringException as vse:
bb.fatal('Error parsing LAYERRECOMMENDS_%s: %s' % (c, str(vse)))
if not res:
- parselog.debug(3,"Layer '%s' recommends version %s of layer '%s', but version %s is currently enabled in your configuration. Check that you are using the correct matching versions/branches of these two layers.", c, opstr, rec, layerver)
+ parselog.debug3("Layer '%s' recommends version %s of layer '%s', but version %s is currently enabled in your configuration. Check that you are using the correct matching versions/branches of these two layers.", c, opstr, rec, layerver)
continue
else:
- parselog.debug(3,"Layer '%s' recommends version %s of layer '%s', which exists in your configuration but does not specify a version. Check that you are using the correct matching versions/branches of these two layers.", c, opstr, rec)
+ parselog.debug3("Layer '%s' recommends version %s of layer '%s', which exists in your configuration but does not specify a version. Check that you are using the correct matching versions/branches of these two layers.", c, opstr, rec)
continue
- parselog.debug(3,"Layer '%s' recommends layer '%s', so we are adding it", c, rec)
+ parselog.debug3("Layer '%s' recommends layer '%s', so we are adding it", c, rec)
collection_depends[c].append(rec)
else:
- parselog.debug(3,"Layer '%s' recommends layer '%s', but this layer is not enabled in your configuration", c, rec)
+ parselog.debug3("Layer '%s' recommends layer '%s', but this layer is not enabled in your configuration", c, rec)
# Recursively work out collection priorities based on dependencies
def calc_layer_priority(collection):
@@ -1297,7 +1214,7 @@ class BBCooker:
if depprio > max_depprio:
max_depprio = depprio
max_depprio += 1
- parselog.debug(1, "Calculated priority of layer %s as %d", collection, max_depprio)
+ parselog.debug("Calculated priority of layer %s as %d", collection, max_depprio)
collection_priorities[collection] = max_depprio
# Calculate all layer priorities using calc_layer_priority and store in bbfile_config_priorities
@@ -1309,7 +1226,7 @@ class BBCooker:
errors = True
continue
elif regex == "":
- parselog.debug(1, "BBFILE_PATTERN_%s is empty" % c)
+ parselog.debug("BBFILE_PATTERN_%s is empty" % c)
cre = re.compile('^NULL$')
errors = False
else:
@@ -1356,8 +1273,8 @@ class BBCooker:
if bf.startswith("/") or bf.startswith("../"):
bf = os.path.abspath(bf)
- self.collections = {mc: CookerCollectFiles(self.bbfile_config_priorities, mc)}
- filelist, masked, searchdirs = self.collections[mc].collect_bbfiles(self.databuilder.mcdata[mc], self.databuilder.mcdata[mc])
+ collections = {mc: CookerCollectFiles(self.bbfile_config_priorities, mc)}
+ filelist, masked, searchdirs = collections[mc].collect_bbfiles(self.databuilder.mcdata[mc], self.databuilder.mcdata[mc])
try:
os.stat(bf)
bf = os.path.abspath(bf)
@@ -1423,7 +1340,8 @@ class BBCooker:
bb_caches = bb.cache.MulticonfigCache(self.databuilder, self.data_hash, self.caches_array)
- infos = bb_caches[mc].parse(fn, self.collections[mc].get_file_appends(fn))
+ layername = self.collections[mc].calc_bbfile_priority(fn)[2]
+ infos = bb_caches[mc].parse(fn, self.collections[mc].get_file_appends(fn), layername)
infos = dict(infos)
fn = bb.cache.realfn2virtual(fn, cls, mc)
@@ -1449,10 +1367,12 @@ class BBCooker:
self.recipecaches[mc].rundeps[fn] = defaultdict(list)
self.recipecaches[mc].runrecs[fn] = defaultdict(list)
+ bb.parse.siggen.setup_datacache(self.recipecaches)
+
# Invalidate task for target if force mode active
if self.configuration.force:
logger.verbose("Invalidate task %s, %s", task, fn)
- bb.parse.siggen.invalidate_task(task, self.recipecaches[mc], fn)
+ bb.parse.siggen.invalidate_task(task, fn)
# Setup taskdata structure
taskdata = {}
@@ -1466,6 +1386,9 @@ class BBCooker:
buildname = self.databuilder.mcdata[mc].getVar("BUILDNAME")
if fireevents:
bb.event.fire(bb.event.BuildStarted(buildname, [item]), self.databuilder.mcdata[mc])
+ if self.eventlog:
+ self.eventlog[2].write_variables()
+ bb.event.enable_heartbeat()
# Execute the runqueue
runlist = [[mc, item, task, fn]]
@@ -1491,28 +1414,57 @@ class BBCooker:
failures += len(exc.args)
retval = False
except SystemExit as exc:
- self.command.finishAsyncCommand(str(exc))
if quietlog:
bb.runqueue.logger.setLevel(rqloglevel)
- return False
+ return bb.server.process.idleFinish(str(exc))
if not retval:
if fireevents:
bb.event.fire(bb.event.BuildCompleted(len(rq.rqdata.runtaskentries), buildname, item, failures, interrupted), self.databuilder.mcdata[mc])
- self.command.finishAsyncCommand(msg)
+ bb.event.disable_heartbeat()
# We trashed self.recipecaches above
- self.parsecache_valid = False
+ self._parsecache_set(False)
self.configuration.limited_deps = False
bb.parse.siggen.reset(self.data)
if quietlog:
bb.runqueue.logger.setLevel(rqloglevel)
- return False
+ return bb.server.process.idleFinish(msg)
if retval is True:
return True
return retval
self.idleCallBackRegister(buildFileIdle, rq)
+ def getTaskSignatures(self, target, tasks):
+ sig = []
+ getAllTaskSignatures = False
+
+ if not tasks:
+ tasks = ["do_build"]
+ getAllTaskSignatures = True
+
+ for task in tasks:
+ taskdata, runlist = self.buildTaskData(target, task, self.configuration.halt)
+ rq = bb.runqueue.RunQueue(self, self.data, self.recipecaches, taskdata, runlist)
+ rq.rqdata.prepare()
+
+ for l in runlist:
+ mc, pn, taskname, fn = l
+
+ taskdep = rq.rqdata.dataCaches[mc].task_deps[fn]
+ for t in taskdep['tasks']:
+ if t in taskdep['nostamp'] or "setscene" in t:
+ continue
+ tid = bb.runqueue.build_tid(mc, fn, t)
+
+ if t in task or getAllTaskSignatures:
+ try:
+ sig.append([pn, t, rq.rqdata.get_task_unihash(tid)])
+ except KeyError:
+ sig.append(self.getTaskSignatures(target, [t])[0])
+
+ return sig
+
def buildTargets(self, targets, task):
"""
Attempt to build the targets specified
@@ -1522,6 +1474,7 @@ class BBCooker:
msg = None
interrupted = 0
if halt or self.state == state.forceshutdown:
+ bb.event._should_exit.set()
rq.finish_runqueue(True)
msg = "Forced shutdown"
interrupted = 2
@@ -1536,16 +1489,16 @@ class BBCooker:
failures += len(exc.args)
retval = False
except SystemExit as exc:
- self.command.finishAsyncCommand(str(exc))
- return False
+ return bb.server.process.idleFinish(str(exc))
if not retval:
try:
for mc in self.multiconfigs:
bb.event.fire(bb.event.BuildCompleted(len(rq.rqdata.runtaskentries), buildname, targets, failures, interrupted), self.databuilder.mcdata[mc])
finally:
- self.command.finishAsyncCommand(msg)
- return False
+ bb.event.disable_heartbeat()
+ return bb.server.process.idleFinish(msg)
+
if retval is True:
return True
return retval
@@ -1577,6 +1530,9 @@ class BBCooker:
for mc in self.multiconfigs:
bb.event.fire(bb.event.BuildStarted(buildname, ntargets), self.databuilder.mcdata[mc])
+ if self.eventlog:
+ self.eventlog[2].write_variables()
+ bb.event.enable_heartbeat()
rq = bb.runqueue.RunQueue(self, self.data, self.recipecaches, taskdata, runlist)
if 'universe' in targets:
@@ -1586,7 +1542,13 @@ class BBCooker:
def getAllKeysWithFlags(self, flaglist):
+ def dummy_autorev(d):
+ return
+
dump = {}
+ # Horrible but for now we need to avoid any sideeffects of autorev being called
+ saved = bb.fetch2.get_autorev
+ bb.fetch2.get_autorev = dummy_autorev
for k in self.data.keys():
try:
expand = True
@@ -1606,6 +1568,7 @@ class BBCooker:
dump[k][d] = None
except Exception as e:
print(e)
+ bb.fetch2.get_autorev = saved
return dump
@@ -1613,13 +1576,6 @@ class BBCooker:
if self.state == state.running:
return
- # reload files for which we got notifications
- for p in self.inotify_modified_files:
- bb.parse.update_cache(p)
- if p in bb.parse.BBHandler.cached_statements:
- del bb.parse.BBHandler.cached_statements[p]
- self.inotify_modified_files = []
-
if not self.baseconfig_valid:
logger.debug("Reloading base configuration data")
self.initConfigurationData()
@@ -1640,7 +1596,8 @@ class BBCooker:
self.updateCacheSync()
if self.state != state.parsing and not self.parsecache_valid:
- self.setupParserWatcher()
+ bb.server.process.serverlog("Parsing started")
+ self.parsewatched = {}
bb.parse.siggen.reset(self.data)
self.parseConfiguration ()
@@ -1655,30 +1612,27 @@ class BBCooker:
for dep in self.configuration.extra_assume_provided:
self.recipecaches[mc].ignored_dependencies.add(dep)
- self.collections = {}
-
mcfilelist = {}
total_masked = 0
searchdirs = set()
for mc in self.multiconfigs:
- self.collections[mc] = CookerCollectFiles(self.bbfile_config_priorities, mc)
(filelist, masked, search) = self.collections[mc].collect_bbfiles(self.databuilder.mcdata[mc], self.databuilder.mcdata[mc])
mcfilelist[mc] = filelist
total_masked += masked
searchdirs |= set(search)
- # Add inotify watches for directories searched for bb/bbappend files
+ # Add mtimes for directories searched for bb/bbappend files
for dirent in searchdirs:
- self.add_filewatch([[dirent]], dirs=True)
+ self.add_filewatch([(dirent, bb.parse.cached_mtime_noerror(dirent))])
self.parser = CookerParser(self, mcfilelist, total_masked)
- self.parsecache_valid = True
+ self._parsecache_set(True)
self.state = state.parsing
if not self.parser.parse_next():
- collectlog.debug(1, "parsing complete")
+ collectlog.debug("parsing complete")
if self.parser.error:
raise bb.BBHandledException()
self.show_appends_with_no_recipes()
@@ -1723,7 +1677,7 @@ class BBCooker:
if 'universe' in pkgs_to_build:
parselog.verbnote("The \"universe\" target is only intended for testing and may produce errors.")
- parselog.debug(1, "collating packages for \"universe\"")
+ parselog.debug("collating packages for \"universe\"")
pkgs_to_build.remove('universe')
for mc in self.multiconfigs:
for t in self.recipecaches[mc].universe_target:
@@ -1756,22 +1710,28 @@ class BBCooker:
if hasattr(self, "data"):
bb.event.fire(CookerExit(), self.data)
- def shutdown(self, force = False):
+ def shutdown(self, force=False):
if force:
self.state = state.forceshutdown
+ bb.event._should_exit.set()
else:
self.state = state.shutdown
if self.parser:
- self.parser.shutdown(clean=not force)
+ self.parser.shutdown(clean=False)
self.parser.final_cleanup()
def finishcommand(self):
+ if hasattr(self.parser, 'shutdown'):
+ self.parser.shutdown(clean=False)
+ self.parser.final_cleanup()
self.state = state.initial
+ bb.event._should_exit.clear()
def reset(self):
if hasattr(bb.parse, "siggen"):
bb.parse.siggen.exit()
+ self.finishcommand()
self.initConfigurationData()
self.handlePRServ()
@@ -1783,9 +1743,9 @@ class BBCooker:
if hasattr(self, "data"):
self.databuilder.reset()
self.data = self.databuilder.data
- self.parsecache_valid = False
- self.baseconfig_valid = False
-
+ # In theory tinfoil could have modified the base data before parsing,
+ # ideally need to track if anything did modify the datastore
+ self._parsecache_set(False)
class CookerExit(bb.event.Event):
"""
@@ -1806,10 +1766,10 @@ class CookerCollectFiles(object):
self.bbfile_config_priorities = sorted(priorities, key=lambda tup: tup[1], reverse=True)
def calc_bbfile_priority(self, filename):
- for _, _, regex, pri in self.bbfile_config_priorities:
+ for layername, _, regex, pri in self.bbfile_config_priorities:
if regex.match(filename):
- return pri, regex
- return 0, None
+ return pri, regex, layername
+ return 0, None, None
def get_bbfiles(self):
"""Get list of default .bb files by reading out the current directory"""
@@ -1828,7 +1788,7 @@ class CookerCollectFiles(object):
for ignored in ('SCCS', 'CVS', '.svn'):
if ignored in dirs:
dirs.remove(ignored)
- found += [os.path.join(dir, f) for f in files if (f.endswith(['.bb', '.bbappend']))]
+ found += [os.path.join(dir, f) for f in files if (f.endswith(('.bb', '.bbappend')))]
return found
@@ -1836,7 +1796,7 @@ class CookerCollectFiles(object):
"""Collect all available .bb build files"""
masked = 0
- collectlog.debug(1, "collecting .bb files")
+ collectlog.debug("collecting .bb files")
files = (config.getVar( "BBFILES") or "").split()
@@ -1851,7 +1811,7 @@ class CookerCollectFiles(object):
collectlog.error("no recipe files to build, check your BBPATH and BBFILES?")
bb.event.fire(CookerExit(), eventdata)
- # We need to track where we look so that we can add inotify watches. There
+ # We need to track where we look so that we can know when the cache is invalid. There
# is no nice way to do this, this is horrid. We intercept the os.listdir()
# (or os.scandir() for python 3.6+) calls while we run glob().
origlistdir = os.listdir
@@ -1923,7 +1883,7 @@ class CookerCollectFiles(object):
bbappend = []
for f in newfiles:
if bbmask and bbmask_compiled.search(f):
- collectlog.debug(1, "skipping masked file %s", f)
+ collectlog.debug("skipping masked file %s", f)
masked += 1
continue
if f.endswith('.bb'):
@@ -1931,7 +1891,7 @@ class CookerCollectFiles(object):
elif f.endswith('.bbappend'):
bbappend.append(f)
else:
- collectlog.debug(1, "skipping %s: unknown file extension", f)
+ collectlog.debug("skipping %s: unknown file extension", f)
# Build a list of .bbappend files for each .bb file
for f in bbappend:
@@ -1982,7 +1942,7 @@ class CookerCollectFiles(object):
# Calculate priorities for each file
for p in pkgfns:
realfn, cls, mc = bb.cache.virtualfn2realfn(p)
- priorities[p], regex = self.calc_bbfile_priority(realfn)
+ priorities[p], regex, _ = self.calc_bbfile_priority(realfn)
if regex in unmatched_regex:
matched_regex.add(regex)
unmatched_regex.remove(regex)
@@ -2092,34 +2052,34 @@ class Parser(multiprocessing.Process):
multiprocessing.util.Finalize(None, bb.fetch.fetcher_parse_save, exitpriority=1)
pending = []
+ havejobs = True
try:
- while True:
- try:
- self.quit.get_nowait()
- except queue.Empty:
- pass
- else:
+ while havejobs or pending:
+ if self.quit.is_set():
break
- if pending:
- result = pending.pop()
- else:
- try:
- job = self.jobs.pop()
- except IndexError:
- break
+ job = None
+ try:
+ job = self.jobs.pop()
+ except IndexError:
+ havejobs = False
+ if job:
result = self.parse(*job)
# Clear the siggen cache after parsing to control memory usage, its huge
bb.parse.siggen.postparsing_clean_cache()
- try:
- self.results.put(result, timeout=0.25)
- except queue.Full:
pending.append(result)
+
+ if pending:
+ try:
+ result = pending.pop()
+ self.results.put(result, timeout=0.05)
+ except queue.Full:
+ pending.append(result)
finally:
self.results.close()
self.results.join_thread()
- def parse(self, mc, cache, filename, appends):
+ def parse(self, mc, cache, filename, appends, layername):
try:
origfilter = bb.event.LogHandler.filter
# Record the filename we're parsing into any events generated
@@ -2133,7 +2093,7 @@ class Parser(multiprocessing.Process):
bb.event.set_class_handlers(self.handlers.copy())
bb.event.LogHandler.filter = parse_filter
- return True, mc, cache.parse(filename, appends)
+ return True, mc, cache.parse(filename, appends, layername)
except Exception as exc:
tb = sys.exc_info()[2]
exc.recipe = filename
@@ -2173,10 +2133,11 @@ class CookerParser(object):
for mc in self.cooker.multiconfigs:
for filename in self.mcfilelist[mc]:
appends = self.cooker.collections[mc].get_file_appends(filename)
+ layername = self.cooker.collections[mc].calc_bbfile_priority(filename)[2]
if not self.bb_caches[mc].cacheValid(filename, appends):
- self.willparse.add((mc, self.bb_caches[mc], filename, appends))
+ self.willparse.add((mc, self.bb_caches[mc], filename, appends, layername))
else:
- self.fromcache.add((mc, self.bb_caches[mc], filename, appends))
+ self.fromcache.add((mc, self.bb_caches[mc], filename, appends, layername))
self.total = len(self.fromcache) + len(self.willparse)
self.toparse = len(self.willparse)
@@ -2185,6 +2146,7 @@ class CookerParser(object):
self.num_processes = min(int(self.cfgdata.getVar("BB_NUMBER_PARSE_THREADS") or
multiprocessing.cpu_count()), self.toparse)
+ bb.cache.SiggenRecipeInfo.reset()
self.start()
self.haveshutdown = False
self.syncthread = None
@@ -2195,7 +2157,7 @@ class CookerParser(object):
if self.toparse:
bb.event.fire(bb.event.ParseStarted(self.toparse), self.cfgdata)
- self.parser_quit = multiprocessing.Queue(maxsize=self.num_processes)
+ self.parser_quit = multiprocessing.Event()
self.result_queue = multiprocessing.Queue()
def chunkify(lst,n):
@@ -2210,7 +2172,7 @@ class CookerParser(object):
self.results = itertools.chain(self.results, self.parse_generator())
- def shutdown(self, clean=True):
+ def shutdown(self, clean=True, eventmsg="Parsing halted due to errors"):
if not self.toparse:
return
if self.haveshutdown:
@@ -2225,11 +2187,9 @@ class CookerParser(object):
bb.event.fire(event, self.cfgdata)
else:
+ bb.event.fire(bb.event.ParseError(eventmsg), self.cfgdata)
bb.error("Parsing halted due to errors, see error messages above")
- for process in self.processes:
- self.parser_quit.put(None)
-
# Cleanup the queue before call process.join(), otherwise there might be
# deadlocks.
while True:
@@ -2238,6 +2198,16 @@ class CookerParser(object):
except queue.Empty:
break
+ def sync_caches():
+ for c in self.bb_caches.values():
+ bb.cache.SiggenRecipeInfo.reset()
+ c.sync()
+
+ self.syncthread = threading.Thread(target=sync_caches, name="SyncThread")
+ self.syncthread.start()
+
+ self.parser_quit.set()
+
for process in self.processes:
process.join(0.5)
@@ -2258,18 +2228,9 @@ class CookerParser(object):
if hasattr(process, "close"):
process.close()
- self.parser_quit.close()
- # Allow data left in the cancel queue to be discarded
- self.parser_quit.cancel_join_thread()
-
- def sync_caches():
- for c in self.bb_caches.values():
- c.sync()
-
- sync = threading.Thread(target=sync_caches, name="SyncThread")
- self.syncthread = sync
- sync.start()
+ bb.codeparser.parser_cache_save()
bb.codeparser.parser_cache_savemerge()
+ bb.cache.SiggenRecipeInfo.reset()
bb.fetch.fetcher_parse_done()
if self.cooker.configuration.profile:
profiles = []
@@ -2287,9 +2248,9 @@ class CookerParser(object):
self.syncthread.join()
def load_cached(self):
- for mc, cache, filename, appends in self.fromcache:
- cached, infos = cache.load(filename, appends)
- yield not cached, mc, infos
+ for mc, cache, filename, appends, layername in self.fromcache:
+ infos = cache.loadCached(filename, appends)
+ yield False, mc, infos
def parse_generator(self):
empty = False
@@ -2344,7 +2305,7 @@ class CookerParser(object):
except bb.parse.ParseError as exc:
self.error += 1
logger.error(str(exc))
- self.shutdown(clean=False)
+ self.shutdown(clean=False, eventmsg=str(exc))
return False
except bb.data_smart.ExpansionError as exc:
self.error += 1
@@ -2387,11 +2348,13 @@ class CookerParser(object):
return True
def reparse(self, filename):
+ bb.cache.SiggenRecipeInfo.reset()
to_reparse = set()
for mc in self.cooker.multiconfigs:
- to_reparse.add((mc, filename, self.cooker.collections[mc].get_file_appends(filename)))
+ layername = self.cooker.collections[mc].calc_bbfile_priority(filename)[2]
+ to_reparse.add((mc, filename, self.cooker.collections[mc].get_file_appends(filename), layername))
- for mc, filename, appends in to_reparse:
- infos = self.bb_caches[mc].parse(filename, appends)
+ for mc, filename, appends, layername in to_reparse:
+ infos = self.bb_caches[mc].parse(filename, appends, layername)
for vfn, info_array in infos:
self.cooker.recipecaches[mc].add_from_recipeinfo(vfn, info_array)
diff --git a/bitbake/lib/bb/cookerdata.py b/bitbake/lib/bb/cookerdata.py
index 9706948ab3..0649e40995 100644
--- a/bitbake/lib/bb/cookerdata.py
+++ b/bitbake/lib/bb/cookerdata.py
@@ -160,12 +160,7 @@ def catch_parse_error(func):
def wrapped(fn, *args):
try:
return func(fn, *args)
- except IOError as exc:
- import traceback
- parselog.critical(traceback.format_exc())
- parselog.critical("Unable to parse %s: %s" % (fn, exc))
- raise bb.BBHandledException()
- except bb.data_smart.ExpansionError as exc:
+ except Exception as exc:
import traceback
bbdir = os.path.dirname(__file__) + os.sep
@@ -177,14 +172,11 @@ def catch_parse_error(func):
break
parselog.critical("Unable to parse %s" % fn, exc_info=(exc_class, exc, tb))
raise bb.BBHandledException()
- except bb.parse.ParseError as exc:
- parselog.critical(str(exc))
- raise bb.BBHandledException()
return wrapped
@catch_parse_error
def parse_config_file(fn, data, include=True):
- return bb.parse.handle(fn, data, include)
+ return bb.parse.handle(fn, data, include, baseconfig=True)
@catch_parse_error
def _inherit(bbclass, data):
@@ -263,6 +255,7 @@ class CookerDataBuilder(object):
self.mcdata = {}
def parseBaseConfiguration(self, worker=False):
+ mcdata = {}
data_hash = hashlib.sha256()
try:
self.data = self.parseConfigurationFiles(self.prefiles, self.postfiles)
@@ -270,7 +263,6 @@ class CookerDataBuilder(object):
if self.data.getVar("BB_WORKERCONTEXT", False) is None and not worker:
bb.fetch.fetcher_init(self.data)
bb.parse.init_parser(self.data)
- bb.codeparser.parser_cache_init(self.data)
bb.event.fire(bb.event.ConfigParsed(), self.data)
@@ -288,29 +280,25 @@ class CookerDataBuilder(object):
bb.parse.init_parser(self.data)
data_hash.update(self.data.get_hash().encode('utf-8'))
- self.mcdata[''] = self.data
+ mcdata[''] = self.data
multiconfig = (self.data.getVar("BBMULTICONFIG") or "").split()
for config in multiconfig:
if config[0].isdigit():
bb.fatal("Multiconfig name '%s' is invalid as multiconfigs cannot start with a digit" % config)
- mcdata = self.parseConfigurationFiles(self.prefiles, self.postfiles, config)
- bb.event.fire(bb.event.ConfigParsed(), mcdata)
- self.mcdata[config] = mcdata
- data_hash.update(mcdata.get_hash().encode('utf-8'))
+ parsed_mcdata = self.parseConfigurationFiles(self.prefiles, self.postfiles, config)
+ bb.event.fire(bb.event.ConfigParsed(), parsed_mcdata)
+ mcdata[config] = parsed_mcdata
+ data_hash.update(parsed_mcdata.get_hash().encode('utf-8'))
if multiconfig:
- bb.event.fire(bb.event.MultiConfigParsed(self.mcdata), self.data)
+ bb.event.fire(bb.event.MultiConfigParsed(mcdata), self.data)
self.data_hash = data_hash.hexdigest()
- except (SyntaxError, bb.BBHandledException):
- raise bb.BBHandledException()
except bb.data_smart.ExpansionError as e:
logger.error(str(e))
raise bb.BBHandledException()
- except Exception:
- logger.exception("Error parsing configuration files")
- raise bb.BBHandledException()
+ bb.codeparser.update_module_dependencies(self.data)
# Handle obsolete variable names
d = self.data
@@ -331,17 +319,23 @@ class CookerDataBuilder(object):
if issues:
raise bb.BBHandledException()
+ for mc in mcdata:
+ mcdata[mc].renameVar("__depends", "__base_depends")
+ mcdata[mc].setVar("__bbclasstype", "recipe")
+
# Create a copy so we can reset at a later date when UIs disconnect
- self.origdata = self.data
- self.data = bb.data.createCopy(self.origdata)
- self.mcdata[''] = self.data
+ self.mcorigdata = mcdata
+ for mc in mcdata:
+ self.mcdata[mc] = bb.data.createCopy(mcdata[mc])
+ self.data = self.mcdata['']
def reset(self):
# We may not have run parseBaseConfiguration() yet
- if not hasattr(self, 'origdata'):
+ if not hasattr(self, 'mcorigdata'):
return
- self.data = bb.data.createCopy(self.origdata)
- self.mcdata[''] = self.data
+ for mc in self.mcorigdata:
+ self.mcdata[mc] = bb.data.createCopy(self.mcorigdata[mc])
+ self.data = self.mcdata['']
def _findLayerConf(self, data):
return findConfigFile("bblayers.conf", data)
@@ -356,12 +350,17 @@ class CookerDataBuilder(object):
layerconf = self._findLayerConf(data)
if layerconf:
- parselog.debug(2, "Found bblayers.conf (%s)", layerconf)
+ parselog.debug2("Found bblayers.conf (%s)", layerconf)
# By definition bblayers.conf is in conf/ of TOPDIR.
# We may have been called with cwd somewhere else so reset TOPDIR
data.setVar("TOPDIR", os.path.dirname(os.path.dirname(layerconf)))
data = parse_config_file(layerconf, data)
+ if not data.getVar("BB_CACHEDIR"):
+ data.setVar("BB_CACHEDIR", "${TOPDIR}/cache")
+
+ bb.codeparser.parser_cache_init(data.getVar("BB_CACHEDIR"))
+
layers = (data.getVar('BBLAYERS') or "").split()
broken_layers = []
@@ -383,8 +382,10 @@ class CookerDataBuilder(object):
parselog.critical("Please check BBLAYERS in %s" % (layerconf))
raise bb.BBHandledException()
+ layerseries = None
+ compat_entries = {}
for layer in layers:
- parselog.debug(2, "Adding layer %s", layer)
+ parselog.debug2("Adding layer %s", layer)
if 'HOME' in approved and '~' in layer:
layer = os.path.expanduser(layer)
if layer.endswith('/'):
@@ -395,8 +396,27 @@ class CookerDataBuilder(object):
data.expandVarref('LAYERDIR')
data.expandVarref('LAYERDIR_RE')
+ # Sadly we can't have nice things.
+ # Some layers think they're going to be 'clever' and copy the values from
+ # another layer, e.g. using ${LAYERSERIES_COMPAT_core}. The whole point of
+ # this mechanism is to make it clear which releases a layer supports and
+ # show when a layer master branch is bitrotting and is unmaintained.
+ # We therefore avoid people doing this here.
+ collections = (data.getVar('BBFILE_COLLECTIONS') or "").split()
+ for c in collections:
+ compat_entry = data.getVar("LAYERSERIES_COMPAT_%s" % c)
+ if compat_entry:
+ compat_entries[c] = set(compat_entry.split())
+ data.delVar("LAYERSERIES_COMPAT_%s" % c)
+ if not layerseries:
+ layerseries = set((data.getVar("LAYERSERIES_CORENAMES") or "").split())
+ if layerseries:
+ data.delVar("LAYERSERIES_CORENAMES")
+
data.delVar('LAYERDIR_RE')
data.delVar('LAYERDIR')
+ for c in compat_entries:
+ data.setVar("LAYERSERIES_COMPAT_%s" % c, " ".join(sorted(compat_entries[c])))
bbfiles_dynamic = (data.getVar('BBFILES_DYNAMIC') or "").split()
collections = (data.getVar('BBFILE_COLLECTIONS') or "").split()
@@ -415,13 +435,15 @@ class CookerDataBuilder(object):
if invalid:
bb.fatal("BBFILES_DYNAMIC entries must be of the form {!}<collection name>:<filename pattern>, not:\n %s" % "\n ".join(invalid))
- layerseries = set((data.getVar("LAYERSERIES_CORENAMES") or "").split())
collections_tmp = collections[:]
for c in collections:
collections_tmp.remove(c)
if c in collections_tmp:
bb.fatal("Found duplicated BBFILE_COLLECTIONS '%s', check bblayers.conf or layer.conf to fix it." % c)
- compat = set((data.getVar("LAYERSERIES_COMPAT_%s" % c) or "").split())
+
+ compat = set()
+ if c in compat_entries:
+ compat = compat_entries[c]
if compat and not layerseries:
bb.fatal("No core layer found to work with layer '%s'. Missing entry in bblayers.conf?" % c)
if compat and not (compat & layerseries):
@@ -430,16 +452,21 @@ class CookerDataBuilder(object):
elif not compat and not data.getVar("BB_WORKERCONTEXT"):
bb.warn("Layer %s should set LAYERSERIES_COMPAT_%s in its conf/layer.conf file to list the core layer names it is compatible with." % (c, c))
+ data.setVar("LAYERSERIES_CORENAMES", " ".join(sorted(layerseries)))
+
if not data.getVar("BBPATH"):
msg = "The BBPATH variable is not set"
if not layerconf:
msg += (" and bitbake did not find a conf/bblayers.conf file in"
" the expected location.\nMaybe you accidentally"
" invoked bitbake from the wrong directory?")
- raise SystemExit(msg)
+ bb.fatal(msg)
if not data.getVar("TOPDIR"):
data.setVar("TOPDIR", os.path.abspath(os.getcwd()))
+ if not data.getVar("BB_CACHEDIR"):
+ data.setVar("BB_CACHEDIR", "${TOPDIR}/cache")
+ bb.codeparser.parser_cache_init(data.getVar("BB_CACHEDIR"))
data = parse_config_file(os.path.join("conf", "bitbake.conf"), data)
@@ -466,3 +493,54 @@ class CookerDataBuilder(object):
return data
+ @staticmethod
+ def _parse_recipe(bb_data, bbfile, appends, mc, layername):
+ bb_data.setVar("__BBMULTICONFIG", mc)
+ bb_data.setVar("FILE_LAYERNAME", layername)
+
+ bbfile_loc = os.path.abspath(os.path.dirname(bbfile))
+ bb.parse.cached_mtime_noerror(bbfile_loc)
+
+ if appends:
+ bb_data.setVar('__BBAPPEND', " ".join(appends))
+
+ return bb.parse.handle(bbfile, bb_data)
+
+ def parseRecipeVariants(self, bbfile, appends, virtonly=False, mc=None, layername=None):
+ """
+ Load and parse one .bb build file
+ Return the data and whether parsing resulted in the file being skipped
+ """
+
+ if virtonly:
+ (bbfile, virtual, mc) = bb.cache.virtualfn2realfn(bbfile)
+ bb_data = self.mcdata[mc].createCopy()
+ bb_data.setVar("__ONLYFINALISE", virtual or "default")
+ return self._parse_recipe(bb_data, bbfile, appends, mc, layername)
+
+ if mc is not None:
+ bb_data = self.mcdata[mc].createCopy()
+ return self._parse_recipe(bb_data, bbfile, appends, mc, layername)
+
+ bb_data = self.data.createCopy()
+ datastores = self._parse_recipe(bb_data, bbfile, appends, '', layername)
+
+ for mc in self.mcdata:
+ if not mc:
+ continue
+ bb_data = self.mcdata[mc].createCopy()
+ newstores = self._parse_recipe(bb_data, bbfile, appends, mc, layername)
+ for ns in newstores:
+ datastores["mc:%s:%s" % (mc, ns)] = newstores[ns]
+
+ return datastores
+
+ def parseRecipe(self, virtualfn, appends, layername):
+ """
+ Return a complete set of data for fn.
+ To do this, we need to parse the file.
+ """
+ logger.debug("Parsing %s (full)" % virtualfn)
+ (fn, virtual, mc) = bb.cache.virtualfn2realfn(virtualfn)
+ datastores = self.parseRecipeVariants(virtualfn, appends, virtonly=True, layername=layername)
+ return datastores[virtual]
diff --git a/bitbake/lib/bb/data.py b/bitbake/lib/bb/data.py
index 53fe34825d..505f42950f 100644
--- a/bitbake/lib/bb/data.py
+++ b/bitbake/lib/bb/data.py
@@ -4,14 +4,16 @@ BitBake 'Data' implementations
Functions for interacting with the data structure used by the
BitBake build tools.
-The expandKeys and update_data are the most expensive
-operations. At night the cookie monster came by and
+expandKeys and datastore iteration are the most expensive
+operations. Updating overrides is now "on the fly" but still based
+on the idea of the cookie monster introduced by zecke:
+"At night the cookie monster came by and
suggested 'give me cookies on setting the variables and
things will work out'. Taking this suggestion into account
applying the skills from the not yet passed 'Entwurf und
Analyse von Algorithmen' lecture and the cookie
monster seems to be right. We will track setVar more carefully
-to have faster update_data and expandKeys operations.
+to have faster datastore operations."
This is a trade-off between speed and memory again but
the speed is more critical here.
@@ -26,11 +28,6 @@ the speed is more critical here.
import sys, os, re
import hashlib
-if sys.argv[0][-5:] == "pydoc":
- path = os.path.dirname(os.path.dirname(sys.argv[1]))
-else:
- path = os.path.dirname(os.path.dirname(sys.argv[0]))
-sys.path.insert(0, path)
from itertools import groupby
from bb import data_smart
@@ -70,10 +67,6 @@ def keys(d):
"""Return a list of keys in d"""
return d.keys()
-
-__expand_var_regexp__ = re.compile(r"\${[^{}]+}")
-__expand_python_regexp__ = re.compile(r"\${@.+?}")
-
def expand(s, d, varname = None):
"""Variable expansion using the data store"""
return d.expand(s, varname)
@@ -121,8 +114,8 @@ def emit_var(var, o=sys.__stdout__, d = init(), all=False):
if d.getVarFlag(var, 'python', False) and func:
return False
- export = d.getVarFlag(var, "export", False)
- unexport = d.getVarFlag(var, "unexport", False)
+ export = bb.utils.to_boolean(d.getVarFlag(var, "export"))
+ unexport = bb.utils.to_boolean(d.getVarFlag(var, "unexport"))
if not all and not export and not unexport and not func:
return False
@@ -195,8 +188,8 @@ def emit_env(o=sys.__stdout__, d = init(), all=False):
def exported_keys(d):
return (key for key in d.keys() if not key.startswith('__') and
- d.getVarFlag(key, 'export', False) and
- not d.getVarFlag(key, 'unexport', False))
+ bb.utils.to_boolean(d.getVarFlag(key, 'export')) and
+ not bb.utils.to_boolean(d.getVarFlag(key, 'unexport')))
def exported_vars(d):
k = list(exported_keys(d))
@@ -268,13 +261,41 @@ def emit_func_python(func, o=sys.__stdout__, d = init()):
newdeps |= set((d.getVarFlag(dep, "vardeps") or "").split())
newdeps -= seen
-def update_data(d):
- """Performs final steps upon the datastore, including application of overrides"""
- d.finalize(parent = True)
+def build_dependencies(key, keys, mod_funcs, shelldeps, varflagsexcl, ignored_vars, d, codeparsedata):
+ def handle_contains(value, contains, exclusions, d):
+ newvalue = []
+ if value:
+ newvalue.append(str(value))
+ for k in sorted(contains):
+ if k in exclusions or k in ignored_vars:
+ continue
+ l = (d.getVar(k) or "").split()
+ for item in sorted(contains[k]):
+ for word in item.split():
+ if not word in l:
+ newvalue.append("\n%s{%s} = Unset" % (k, item))
+ break
+ else:
+ newvalue.append("\n%s{%s} = Set" % (k, item))
+ return "".join(newvalue)
+
+ def handle_remove(value, deps, removes, d):
+ for r in sorted(removes):
+ r2 = d.expandWithRefs(r, None)
+ value += "\n_remove of %s" % r
+ deps |= r2.references
+ deps = deps | (keys & r2.execs)
+ value = handle_contains(value, r2.contains, exclusions, d)
+ return value
-def build_dependencies(key, keys, shelldeps, varflagsexcl, ignored_vars, d):
deps = set()
try:
+ if key in mod_funcs:
+ exclusions = set()
+ moddep = bb.codeparser.modulecode_deps[key]
+ value = handle_contains("", moddep[3], exclusions, d)
+ return frozenset((moddep[0] | keys & moddep[1]) - ignored_vars), value
+
if key[-1] == ']':
vf = key[:-1].split('[')
if vf[1] == "vardepvalueexclude":
@@ -282,48 +303,24 @@ def build_dependencies(key, keys, shelldeps, varflagsexcl, ignored_vars, d):
value, parser = d.getVarFlag(vf[0], vf[1], False, retparser=True)
deps |= parser.references
deps = deps | (keys & parser.execs)
- return deps, value
+ deps -= ignored_vars
+ return frozenset(deps), value
varflags = d.getVarFlags(key, ["vardeps", "vardepvalue", "vardepsexclude", "exports", "postfuncs", "prefuncs", "lineno", "filename"]) or {}
vardeps = varflags.get("vardeps")
exclusions = varflags.get("vardepsexclude", "").split()
- def handle_contains(value, contains, exclusions, d):
- newvalue = []
- if value:
- newvalue.append(str(value))
- for k in sorted(contains):
- if k in exclusions or k in ignored_vars:
- continue
- l = (d.getVar(k) or "").split()
- for item in sorted(contains[k]):
- for word in item.split():
- if not word in l:
- newvalue.append("\n%s{%s} = Unset" % (k, item))
- break
- else:
- newvalue.append("\n%s{%s} = Set" % (k, item))
- return "".join(newvalue)
-
- def handle_remove(value, deps, removes, d):
- for r in sorted(removes):
- r2 = d.expandWithRefs(r, None)
- value += "\n_remove of %s" % r
- deps |= r2.references
- deps = deps | (keys & r2.execs)
- return value
-
if "vardepvalue" in varflags:
value = varflags.get("vardepvalue")
elif varflags.get("func"):
if varflags.get("python"):
- value = d.getVarFlag(key, "_content", False)
+ value = codeparsedata.getVarFlag(key, "_content", False)
parser = bb.codeparser.PythonParser(key, logger)
parser.parse_python(value, filename=varflags.get("filename"), lineno=varflags.get("lineno"))
deps = deps | parser.references
deps = deps | (keys & parser.execs)
value = handle_contains(value, parser.contains, exclusions, d)
else:
- value, parsedvar = d.getVarFlag(key, "_content", False, retparser=True)
+ value, parsedvar = codeparsedata.getVarFlag(key, "_content", False, retparser=True)
parser = bb.codeparser.ShellParser(key, logger)
parser.parse_shell(parsedvar.value)
deps = deps | shelldeps
@@ -365,36 +362,43 @@ def build_dependencies(key, keys, shelldeps, varflagsexcl, ignored_vars, d):
deps |= set((vardeps or "").split())
deps -= set(exclusions)
+ deps -= ignored_vars
except bb.parse.SkipRecipe:
raise
except Exception as e:
bb.warn("Exception during build_dependencies for %s" % key)
raise
- return deps, value
+ return frozenset(deps), value
#bb.note("Variable %s references %s and calls %s" % (key, str(deps), str(execs)))
#d.setVarFlag(key, "vardeps", deps)
def generate_dependencies(d, ignored_vars):
- keys = set(key for key in d if not key.startswith("__"))
- shelldeps = set(key for key in d.getVar("__exportlist", False) if d.getVarFlag(key, "export", False) and not d.getVarFlag(key, "unexport", False))
+ mod_funcs = set(bb.codeparser.modulecode_deps.keys())
+ keys = set(key for key in d if not key.startswith("__")) | mod_funcs
+ shelldeps = set(key for key in d.getVar("__exportlist", False) if bb.utils.to_boolean(d.getVarFlag(key, "export")) and not bb.utils.to_boolean(d.getVarFlag(key, "unexport")))
varflagsexcl = d.getVar('BB_SIGNATURE_EXCLUDE_FLAGS')
+ codeparserd = d.createCopy()
+ for forced in (d.getVar('BB_HASH_CODEPARSER_VALS') or "").split():
+ key, value = forced.split("=", 1)
+ codeparserd.setVar(key, value)
+
deps = {}
values = {}
tasklist = d.getVar('__BBTASKS', False) or []
for task in tasklist:
- deps[task], values[task] = build_dependencies(task, keys, shelldeps, varflagsexcl, ignored_vars, d)
+ deps[task], values[task] = build_dependencies(task, keys, mod_funcs, shelldeps, varflagsexcl, ignored_vars, d, codeparserd)
newdeps = deps[task]
seen = set()
while newdeps:
- nextdeps = newdeps - ignored_vars
+ nextdeps = newdeps
seen |= nextdeps
newdeps = set()
for dep in nextdeps:
if dep not in deps:
- deps[dep], values[dep] = build_dependencies(dep, keys, shelldeps, varflagsexcl, ignored_vars, d)
+ deps[dep], values[dep] = build_dependencies(dep, keys, mod_funcs, shelldeps, varflagsexcl, ignored_vars, d, codeparserd)
newdeps |= deps[dep]
newdeps -= seen
#print "For %s: %s" % (task, str(deps[task]))
@@ -413,7 +417,6 @@ def generate_dependency_hash(tasklist, gendeps, lookupcache, ignored_vars, fn):
else:
data = [data]
- gendeps[task] -= ignored_vars
newdeps = gendeps[task]
seen = set()
while newdeps:
@@ -421,9 +424,6 @@ def generate_dependency_hash(tasklist, gendeps, lookupcache, ignored_vars, fn):
seen |= nextdeps
newdeps = set()
for dep in nextdeps:
- if dep in ignored_vars:
- continue
- gendeps[dep] -= ignored_vars
newdeps |= gendeps[dep]
newdeps -= seen
@@ -435,7 +435,7 @@ def generate_dependency_hash(tasklist, gendeps, lookupcache, ignored_vars, fn):
data.append(str(var))
k = fn + ":" + task
basehash[k] = hashlib.sha256("".join(data).encode("utf-8")).hexdigest()
- taskdeps[task] = alldeps
+ taskdeps[task] = frozenset(seen)
return taskdeps, basehash
diff --git a/bitbake/lib/bb/data_smart.py b/bitbake/lib/bb/data_smart.py
index dd20ca557e..0128a5bb17 100644
--- a/bitbake/lib/bb/data_smart.py
+++ b/bitbake/lib/bb/data_smart.py
@@ -16,7 +16,10 @@ BitBake build tools.
#
# Based on functions from the base bb module, Copyright 2003 Holger Schurig
-import copy, re, sys, traceback
+import builtins
+import copy
+import re
+import sys
from collections.abc import MutableMapping
import logging
import hashlib
@@ -29,7 +32,7 @@ logger = logging.getLogger("BitBake.Data")
__setvar_keyword__ = [":append", ":prepend", ":remove"]
__setvar_regexp__ = re.compile(r'(?P<base>.*?)(?P<keyword>:append|:prepend|:remove)(:(?P<add>[^A-Z]*))?$')
__expand_var_regexp__ = re.compile(r"\${[a-zA-Z0-9\-_+./~:]+?}")
-__expand_python_regexp__ = re.compile(r"\${@.+?}")
+__expand_python_regexp__ = re.compile(r"\${@(?:{.*?}|.)+?}")
__whitespace_split__ = re.compile(r'(\s)')
__override_regexp__ = re.compile(r'[a-z0-9]+')
@@ -92,10 +95,11 @@ def infer_caller_details(loginfo, parent = False, varval = True):
loginfo['func'] = func
class VariableParse:
- def __init__(self, varname, d, val = None):
+ def __init__(self, varname, d, unexpanded_value = None, val = None):
self.varname = varname
self.d = d
self.value = val
+ self.unexpanded_value = unexpanded_value
self.references = set()
self.execs = set()
@@ -119,6 +123,11 @@ class VariableParse:
else:
code = match.group()[3:-1]
+ # Do not run code that contains one or more unexpanded variables
+ # instead return the code with the characters we removed put back
+ if __expand_var_regexp__.findall(code):
+ return "${@" + code + "}"
+
if self.varname:
varname = 'Var <%s>' % self.varname
else:
@@ -144,19 +153,21 @@ class VariableParse:
value = utils.better_eval(codeobj, DataContext(self.d), {'d' : self.d})
return str(value)
-
class DataContext(dict):
+ excluded = set([i for i in dir(builtins) if not i.startswith('_')] + ['oe'])
+
def __init__(self, metadata, **kwargs):
self.metadata = metadata
dict.__init__(self, **kwargs)
self['d'] = metadata
+ self.context = set(bb.utils.get_context())
def __missing__(self, key):
- # Skip commonly accessed invalid variables
- if key in ['bb', 'oe', 'int', 'bool', 'time', 'str', 'os']:
+ if key in self.excluded or key in self.context:
raise KeyError(key)
+
value = self.metadata.getVar(key)
- if value is None or self.metadata.getVarFlag(key, 'func', False):
+ if value is None:
raise KeyError(key)
else:
return value
@@ -442,9 +453,9 @@ class DataSmart(MutableMapping):
def expandWithRefs(self, s, varname):
if not isinstance(s, str): # sanity check
- return VariableParse(varname, self, s)
+ return VariableParse(varname, self, s, s)
- varparse = VariableParse(varname, self)
+ varparse = VariableParse(varname, self, s)
while s.find('${') != -1:
olds = s
@@ -476,24 +487,19 @@ class DataSmart(MutableMapping):
def expand(self, s, varname = None):
return self.expandWithRefs(s, varname).value
- def finalize(self, parent = False):
- return
-
- def internal_finalize(self, parent = False):
- """Performs final steps upon the datastore, including application of overrides"""
- self.overrides = None
-
def need_overrides(self):
if self.overrides is not None:
return
if self.inoverride:
return
+ overrride_stack = []
for count in range(5):
self.inoverride = True
# Can end up here recursively so setup dummy values
self.overrides = []
self.overridesset = set()
self.overrides = (self.getVar("OVERRIDES") or "").split(":") or []
+ overrride_stack.append(self.overrides)
self.overridesset = set(self.overrides)
self.inoverride = False
self.expand_cache = {}
@@ -503,7 +509,7 @@ class DataSmart(MutableMapping):
self.overrides = newoverrides
self.overridesset = set(self.overrides)
else:
- bb.fatal("Overrides could not be expanded into a stable state after 5 iterations, overrides must be being referenced by other overridden variables in some recursive fashion. Please provide your configuration to bitbake-devel so we can laugh, er, I mean try and understand how to make it work.")
+ bb.fatal("Overrides could not be expanded into a stable state after 5 iterations, overrides must be being referenced by other overridden variables in some recursive fashion. Please provide your configuration to bitbake-devel so we can laugh, er, I mean try and understand how to make it work. The list of failing override expansions: %s" % "\n".join(str(s) for s in overrride_stack))
def initVar(self, var):
self.expand_cache = {}
@@ -514,18 +520,18 @@ class DataSmart(MutableMapping):
dest = self.dict
while dest:
if var in dest:
- return dest[var], self.overridedata.get(var, None)
+ return dest[var]
if "_data" not in dest:
break
dest = dest["_data"]
- return None, self.overridedata.get(var, None)
+ return None
def _makeShadowCopy(self, var):
if var in self.dict:
return
- local_var, _ = self._findVar(var)
+ local_var = self._findVar(var)
if local_var:
self.dict[var] = copy.copy(local_var)
@@ -633,7 +639,7 @@ class DataSmart(MutableMapping):
nextnew.update(vardata.references)
nextnew.update(vardata.contains.keys())
new = nextnew
- self.internal_finalize(True)
+ self.overrides = None
def _setvar_update_overrides(self, var, **loginfo):
# aka pay the cookie monster
@@ -720,7 +726,7 @@ class DataSmart(MutableMapping):
if ':' in var:
override = var[var.rfind(':')+1:]
shortvar = var[:var.rfind(':')]
- while override and override.islower():
+ while override and __override_regexp__.match(override):
try:
if shortvar in self.overridedata:
# Force CoW by recreating the list first
@@ -775,13 +781,18 @@ class DataSmart(MutableMapping):
return None
cachename = var + "[" + flag + "]"
+ if not expand and retparser and cachename in self.expand_cache:
+ return self.expand_cache[cachename].unexpanded_value, self.expand_cache[cachename]
+
if expand and cachename in self.expand_cache:
return self.expand_cache[cachename].value
- local_var, overridedata = self._findVar(var)
+ local_var = self._findVar(var)
value = None
removes = set()
- if flag == "_content" and overridedata is not None and not parsing:
+ if flag == "_content" and not parsing:
+ overridedata = self.overridedata.get(var, None)
+ if flag == "_content" and not parsing and overridedata is not None:
match = False
active = {}
self.need_overrides()
@@ -896,7 +907,7 @@ class DataSmart(MutableMapping):
def delVarFlag(self, var, flag, **loginfo):
self.expand_cache = {}
- local_var, _ = self._findVar(var)
+ local_var = self._findVar(var)
if not local_var:
return
if not var in self.dict:
@@ -939,7 +950,7 @@ class DataSmart(MutableMapping):
self.dict[var][i] = flags[i]
def getVarFlags(self, var, expand = False, internalflags=False):
- local_var, _ = self._findVar(var)
+ local_var = self._findVar(var)
flags = {}
if local_var:
diff --git a/bitbake/lib/bb/event.py b/bitbake/lib/bb/event.py
index 97668601a1..4761c86880 100644
--- a/bitbake/lib/bb/event.py
+++ b/bitbake/lib/bb/event.py
@@ -68,29 +68,39 @@ _catchall_handlers = {}
_eventfilter = None
_uiready = False
_thread_lock = threading.Lock()
-_thread_lock_enabled = False
-
-if hasattr(__builtins__, '__setitem__'):
- builtins = __builtins__
-else:
- builtins = __builtins__.__dict__
+_heartbeat_enabled = False
+_should_exit = threading.Event()
def enable_threadlock():
- global _thread_lock_enabled
- _thread_lock_enabled = True
+ # Always needed now
+ return
def disable_threadlock():
- global _thread_lock_enabled
- _thread_lock_enabled = False
+ # Always needed now
+ return
+
+def enable_heartbeat():
+ global _heartbeat_enabled
+ _heartbeat_enabled = True
+
+def disable_heartbeat():
+ global _heartbeat_enabled
+ _heartbeat_enabled = False
+
+#
+# In long running code, this function should be called periodically
+# to check if we should exit due to an interuption (.e.g Ctrl+C from the UI)
+#
+def check_for_interrupts(d):
+ global _should_exit
+ if _should_exit.is_set():
+ bb.warn("Exiting due to interrupt.")
+ raise bb.BBHandledException()
def execute_handler(name, handler, event, d):
event.data = d
- addedd = False
- if 'd' not in builtins:
- builtins['d'] = d
- addedd = True
try:
- ret = handler(event)
+ ret = handler(event, d)
except (bb.parse.SkipRecipe, bb.BBHandledException):
raise
except Exception:
@@ -104,8 +114,7 @@ def execute_handler(name, handler, event, d):
raise
finally:
del event.data
- if addedd:
- del builtins['d']
+
def fire_class_handlers(event, d):
if isinstance(event, logging.LogRecord):
@@ -180,36 +189,30 @@ def print_ui_queue():
def fire_ui_handlers(event, d):
global _thread_lock
- global _thread_lock_enabled
if not _uiready:
# No UI handlers registered yet, queue up the messages
ui_queue.append(event)
return
- if _thread_lock_enabled:
- _thread_lock.acquire()
-
- errors = []
- for h in _ui_handlers:
- #print "Sending event %s" % event
- try:
- if not _ui_logfilters[h].filter(event):
- continue
- # We use pickle here since it better handles object instances
- # which xmlrpc's marshaller does not. Events *must* be serializable
- # by pickle.
- if hasattr(_ui_handlers[h].event, "sendpickle"):
- _ui_handlers[h].event.sendpickle((pickle.dumps(event)))
- else:
- _ui_handlers[h].event.send(event)
- except:
- errors.append(h)
- for h in errors:
- del _ui_handlers[h]
-
- if _thread_lock_enabled:
- _thread_lock.release()
+ with bb.utils.lock_timeout(_thread_lock):
+ errors = []
+ for h in _ui_handlers:
+ #print "Sending event %s" % event
+ try:
+ if not _ui_logfilters[h].filter(event):
+ continue
+ # We use pickle here since it better handles object instances
+ # which xmlrpc's marshaller does not. Events *must* be serializable
+ # by pickle.
+ if hasattr(_ui_handlers[h].event, "sendpickle"):
+ _ui_handlers[h].event.sendpickle((pickle.dumps(event)))
+ else:
+ _ui_handlers[h].event.send(event)
+ except:
+ errors.append(h)
+ for h in errors:
+ del _ui_handlers[h]
def fire(event, d):
"""Fire off an Event"""
@@ -253,15 +256,16 @@ def register(name, handler, mask=None, filename=None, lineno=None, data=None):
if handler is not None:
# handle string containing python code
if isinstance(handler, str):
- tmp = "def %s(e):\n%s" % (name, handler)
+ tmp = "def %s(e, d):\n%s" % (name, handler)
+ # Inject empty lines to make code match lineno in filename
+ if lineno is not None:
+ tmp = "\n" * (lineno-1) + tmp
try:
code = bb.methodpool.compile_cache(tmp)
if not code:
if filename is None:
- filename = "%s(e)" % name
+ filename = "%s(e, d)" % name
code = compile(tmp, filename, "exec", ast.PyCF_ONLY_AST)
- if lineno is not None:
- ast.increment_lineno(code, lineno-1)
code = compile(code, filename, "exec")
bb.methodpool.compile_cache_add(tmp, code)
except SyntaxError:
@@ -323,21 +327,23 @@ def set_eventfilter(func):
_eventfilter = func
def register_UIHhandler(handler, mainui=False):
- bb.event._ui_handler_seq = bb.event._ui_handler_seq + 1
- _ui_handlers[_ui_handler_seq] = handler
- level, debug_domains = bb.msg.constructLogOptions()
- _ui_logfilters[_ui_handler_seq] = UIEventFilter(level, debug_domains)
- if mainui:
- global _uiready
- _uiready = _ui_handler_seq
- return _ui_handler_seq
+ with bb.utils.lock_timeout(_thread_lock):
+ bb.event._ui_handler_seq = bb.event._ui_handler_seq + 1
+ _ui_handlers[_ui_handler_seq] = handler
+ level, debug_domains = bb.msg.constructLogOptions()
+ _ui_logfilters[_ui_handler_seq] = UIEventFilter(level, debug_domains)
+ if mainui:
+ global _uiready
+ _uiready = _ui_handler_seq
+ return _ui_handler_seq
def unregister_UIHhandler(handlerNum, mainui=False):
if mainui:
global _uiready
_uiready = False
- if handlerNum in _ui_handlers:
- del _ui_handlers[handlerNum]
+ with bb.utils.lock_timeout(_thread_lock):
+ if handlerNum in _ui_handlers:
+ del _ui_handlers[handlerNum]
return
def get_uihandler():
@@ -851,3 +857,19 @@ class FindSigInfoResult(Event):
def __init__(self, result):
Event.__init__(self)
self.result = result
+
+class GetTaskSignatureResult(Event):
+ """
+ Event to return results from GetTaskSignatures command
+ """
+ def __init__(self, sig):
+ Event.__init__(self)
+ self.sig = sig
+
+class ParseError(Event):
+ """
+ Event to indicate parse failed
+ """
+ def __init__(self, msg):
+ super().__init__()
+ self._msg = msg
diff --git a/bitbake/lib/bb/fetch2/__init__.py b/bitbake/lib/bb/fetch2/__init__.py
index 0fb718b23e..5bf2c4b8cf 100644
--- a/bitbake/lib/bb/fetch2/__init__.py
+++ b/bitbake/lib/bb/fetch2/__init__.py
@@ -290,12 +290,12 @@ class URI(object):
def _param_str_split(self, string, elmdelim, kvdelim="="):
ret = collections.OrderedDict()
- for k, v in [x.split(kvdelim, 1) for x in string.split(elmdelim) if x]:
+ for k, v in [x.split(kvdelim, 1) if kvdelim in x else (x, None) for x in string.split(elmdelim) if x]:
ret[k] = v
return ret
def _param_str_join(self, dict_, elmdelim, kvdelim="="):
- return elmdelim.join([kvdelim.join([k, v]) for k, v in dict_.items()])
+ return elmdelim.join([kvdelim.join([k, v]) if v else k for k, v in dict_.items()])
@property
def hostport(self):
@@ -388,7 +388,7 @@ def decodeurl(url):
if s:
if not '=' in s:
raise MalformedUrl(url, "The URL: '%s' is invalid: parameter %s does not specify a value (missing '=')" % (url, s))
- s1, s2 = s.split('=')
+ s1, s2 = s.split('=', 1)
p[s1] = s2
return type, host, urllib.parse.unquote(path), user, pswd, p
@@ -469,6 +469,7 @@ def uri_replace(ud, uri_find, uri_replace, replacements, d, mirrortarball=None):
basename = os.path.basename(mirrortarball)
# Kill parameters, they make no sense for mirror tarballs
uri_decoded[5] = {}
+ uri_find_decoded[5] = {}
elif ud.localpath and ud.method.supports_checksum(ud):
basename = os.path.basename(ud.localpath)
if basename:
@@ -517,7 +518,7 @@ def fetcher_init(d):
else:
raise FetchError("Invalid SRCREV cache policy of: %s" % srcrev_policy)
- _checksum_cache.init_cache(d)
+ _checksum_cache.init_cache(d.getVar("BB_CACHEDIR"))
for m in methods:
if hasattr(m, "init"):
@@ -545,7 +546,7 @@ def mirror_from_string(data):
bb.warn('Invalid mirror data %s, should have paired members.' % data)
return list(zip(*[iter(mirrors)]*2))
-def verify_checksum(ud, d, precomputed={}):
+def verify_checksum(ud, d, precomputed={}, localpath=None, fatal_nochecksum=True):
"""
verify the MD5 and SHA256 checksum for downloaded src
@@ -559,17 +560,19 @@ def verify_checksum(ud, d, precomputed={}):
file against those in the recipe each time, rather than only after
downloading. See https://bugzilla.yoctoproject.org/show_bug.cgi?id=5571.
"""
-
if ud.ignore_checksums or not ud.method.supports_checksum(ud):
return {}
+ if localpath is None:
+ localpath = ud.localpath
+
def compute_checksum_info(checksum_id):
checksum_name = getattr(ud, "%s_name" % checksum_id)
if checksum_id in precomputed:
checksum_data = precomputed[checksum_id]
else:
- checksum_data = getattr(bb.utils, "%s_file" % checksum_id)(ud.localpath)
+ checksum_data = getattr(bb.utils, "%s_file" % checksum_id)(localpath)
checksum_expected = getattr(ud, "%s_expected" % checksum_id)
@@ -595,17 +598,13 @@ def verify_checksum(ud, d, precomputed={}):
checksum_lines = ["SRC_URI[%s] = \"%s\"" % (ci["name"], ci["data"])]
# If no checksum has been provided
- if ud.method.recommends_checksum(ud) and all(ci["expected"] is None for ci in checksum_infos):
+ if fatal_nochecksum and ud.method.recommends_checksum(ud) and all(ci["expected"] is None for ci in checksum_infos):
messages = []
strict = d.getVar("BB_STRICT_CHECKSUM") or "0"
# If strict checking enabled and neither sum defined, raise error
if strict == "1":
- messages.append("No checksum specified for '%s', please add at " \
- "least one to the recipe:" % ud.localpath)
- messages.extend(checksum_lines)
- logger.error("\n".join(messages))
- raise NoChecksumError("Missing SRC_URI checksum", ud.url)
+ raise NoChecksumError("\n".join(checksum_lines))
bb.event.fire(MissingChecksumEvent(ud.url, **checksum_event), d)
@@ -627,7 +626,7 @@ def verify_checksum(ud, d, precomputed={}):
for ci in checksum_infos:
if ci["expected"] and ci["expected"] != ci["data"]:
messages.append("File: '%s' has %s checksum '%s' when '%s' was " \
- "expected" % (ud.localpath, ci["id"], ci["data"], ci["expected"]))
+ "expected" % (localpath, ci["id"], ci["data"], ci["expected"]))
bad_checksum = ci["data"]
if bad_checksum:
@@ -745,13 +744,16 @@ def subprocess_setup():
# SIGPIPE errors are known issues with gzip/bash
signal.signal(signal.SIGPIPE, signal.SIG_DFL)
-def get_autorev(d):
- # only not cache src rev in autorev case
+def mark_recipe_nocache(d):
if d.getVar('BB_SRCREV_POLICY') != "cache":
d.setVar('BB_DONT_CACHE', '1')
+
+def get_autorev(d):
+ mark_recipe_nocache(d)
+ d.setVar("__BBAUTOREV_SEEN", True)
return "AUTOINC"
-def get_srcrev(d, method_name='sortable_revision'):
+def _get_srcrev(d, method_name='sortable_revision'):
"""
Return the revision string, usually for use in the version string (PV) of the current package
Most packages usually only have one SCM so we just pass on the call.
@@ -765,13 +767,14 @@ def get_srcrev(d, method_name='sortable_revision'):
that fetcher provides a method with the given name and the same signature as sortable_revision.
"""
- d.setVar("__BBSEENSRCREV", "1")
+ d.setVar("__BBSRCREV_SEEN", "1")
recursion = d.getVar("__BBINSRCREV")
if recursion:
raise FetchError("There are recursive references in fetcher variables, likely through SRC_URI")
d.setVar("__BBINSRCREV", True)
scms = []
+ revs = []
fetcher = Fetch(d.getVar('SRC_URI').split(), d)
urldata = fetcher.ud
for u in urldata:
@@ -779,16 +782,19 @@ def get_srcrev(d, method_name='sortable_revision'):
scms.append(u)
if not scms:
- raise FetchError("SRCREV was used yet no valid SCM was found in SRC_URI")
+ d.delVar("__BBINSRCREV")
+ return "", revs
+
if len(scms) == 1 and len(urldata[scms[0]].names) == 1:
autoinc, rev = getattr(urldata[scms[0]].method, method_name)(urldata[scms[0]], d, urldata[scms[0]].names[0])
+ revs.append(rev)
if len(rev) > 10:
rev = rev[:10]
d.delVar("__BBINSRCREV")
if autoinc:
- return "AUTOINC+" + rev
- return rev
+ return "AUTOINC+" + rev, revs
+ return rev, revs
#
# Mutiple SCMs are in SRC_URI so we resort to SRCREV_FORMAT
@@ -804,6 +810,7 @@ def get_srcrev(d, method_name='sortable_revision'):
ud = urldata[scm]
for name in ud.names:
autoinc, rev = getattr(ud.method, method_name)(ud, d, name)
+ revs.append(rev)
seenautoinc = seenautoinc or autoinc
if len(rev) > 10:
rev = rev[:10]
@@ -821,7 +828,21 @@ def get_srcrev(d, method_name='sortable_revision'):
format = "AUTOINC+" + format
d.delVar("__BBINSRCREV")
- return format
+ return format, revs
+
+def get_hashvalue(d, method_name='sortable_revision'):
+ pkgv, revs = _get_srcrev(d, method_name=method_name)
+ return " ".join(revs)
+
+def get_pkgv_string(d, method_name='sortable_revision'):
+ pkgv, revs = _get_srcrev(d, method_name=method_name)
+ return pkgv
+
+def get_srcrev(d, method_name='sortable_revision'):
+ pkgv, revs = _get_srcrev(d, method_name=method_name)
+ if not pkgv:
+ raise FetchError("SRCREV was used yet no valid SCM was found in SRC_URI")
+ return pkgv
def localpath(url, d):
fetcher = bb.fetch2.Fetch([url], d)
@@ -847,10 +868,17 @@ FETCH_EXPORT_VARS = ['HOME', 'PATH',
'DBUS_SESSION_BUS_ADDRESS',
'P4CONFIG',
'SSL_CERT_FILE',
+ 'NODE_EXTRA_CA_CERTS',
'AWS_PROFILE',
'AWS_ACCESS_KEY_ID',
'AWS_SECRET_ACCESS_KEY',
- 'AWS_DEFAULT_REGION']
+ 'AWS_ROLE_ARN',
+ 'AWS_WEB_IDENTITY_TOKEN_FILE',
+ 'AWS_DEFAULT_REGION',
+ 'AWS_SESSION_TOKEN',
+ 'GIT_CACHE_PATH',
+ 'REMOTE_CONTAINERS_IPC',
+ 'SSL_CERT_DIR']
def get_fetcher_environment(d):
newenv = {}
@@ -915,7 +943,10 @@ def runfetchcmd(cmd, d, quiet=False, cleanup=None, log=None, workdir=None):
elif e.stderr:
output = "output:\n%s" % e.stderr
else:
- output = "no output"
+ if log:
+ output = "see logfile for output"
+ else:
+ output = "no output"
error_message = "Fetch command %s failed with exit code %s, %s" % (e.command, e.exitcode, output)
except bb.process.CmdError as e:
error_message = "Fetch command %s could not be run:\n%s" % (e.command, e.msg)
@@ -977,6 +1008,7 @@ def build_mirroruris(origud, mirrors, ld):
try:
newud = FetchData(newuri, ld)
+ newud.ignore_checksums = True
newud.setup_localpath(ld)
except bb.fetch2.BBFetchException as e:
logger.debug("Mirror fetch failure for url %s (original url: %s)" % (newuri, origud.url))
@@ -1086,7 +1118,8 @@ def try_mirror_url(fetch, origud, ud, ld, check = False):
logger.debug("Mirror fetch failure for url %s (original url: %s)" % (ud.url, origud.url))
logger.debug(str(e))
try:
- ud.method.clean(ud, ld)
+ if ud.method.cleanup_upon_failure():
+ ud.method.clean(ud, ld)
except UnboundLocalError:
pass
return False
@@ -1211,6 +1244,7 @@ def srcrev_internal_helper(ud, d, name):
if srcrev == "INVALID" or not srcrev:
raise FetchError("Please set a valid SRCREV for url %s (possible key names are %s, or use a ;rev=X URL parameter)" % (str(attempts), ud.url), ud.url)
if srcrev == "AUTOINC":
+ d.setVar("__BBAUTOREV_ACTED_UPON", True)
srcrev = ud.method.latest_revision(ud, d, name)
return srcrev
@@ -1227,7 +1261,7 @@ def get_checksum_file_list(d):
ud = fetch.ud[u]
if ud and isinstance(ud.method, local.Local):
found = False
- paths = ud.method.localpaths(ud, d)
+ paths = ud.method.localfile_searchpaths(ud, d)
for f in paths:
pth = ud.decodedurl
if os.path.exists(f):
@@ -1283,18 +1317,13 @@ class FetchData(object):
if checksum_name in self.parm:
checksum_expected = self.parm[checksum_name]
- elif self.type not in ["http", "https", "ftp", "ftps", "sftp", "s3", "az"]:
+ elif self.type not in ["http", "https", "ftp", "ftps", "sftp", "s3", "az", "crate", "gs"]:
checksum_expected = None
else:
checksum_expected = d.getVarFlag("SRC_URI", checksum_name)
setattr(self, "%s_expected" % checksum_id, checksum_expected)
- for checksum_id in CHECKSUM_LIST:
- configure_checksum(checksum_id)
-
- self.ignore_checksums = False
-
self.names = self.parm.get("name",'default').split(',')
self.method = None
@@ -1316,6 +1345,11 @@ class FetchData(object):
if hasattr(self.method, "urldata_init"):
self.method.urldata_init(self, d)
+ for checksum_id in CHECKSUM_LIST:
+ configure_checksum(checksum_id)
+
+ self.ignore_checksums = False
+
if "localpath" in self.parm:
# if user sets localpath for file, use it instead.
self.localpath = self.parm["localpath"]
@@ -1395,6 +1429,9 @@ class FetchMethod(object):
Is localpath something that can be represented by a checksum?
"""
+ # We cannot compute checksums for None
+ if urldata.localpath is None:
+ return False
# We cannot compute checksums for directories
if os.path.isdir(urldata.localpath):
return False
@@ -1407,6 +1444,12 @@ class FetchMethod(object):
"""
return False
+ def cleanup_upon_failure(self):
+ """
+ When a fetch fails, should clean() be called?
+ """
+ return True
+
def verify_donestamp(self, ud, d):
"""
Verify the donestamp file
@@ -1549,6 +1592,7 @@ class FetchMethod(object):
unpackdir = rootdir
if not unpack or not cmd:
+ urldata.unpack_tracer.unpack("file-copy", unpackdir)
# If file == dest, then avoid any copies, as we already put the file into dest!
dest = os.path.join(unpackdir, os.path.basename(file))
if file != dest and not (os.path.exists(dest) and os.path.samefile(file, dest)):
@@ -1563,6 +1607,8 @@ class FetchMethod(object):
destdir = urlpath.rsplit("/", 1)[0] + '/'
bb.utils.mkdirhier("%s/%s" % (unpackdir, destdir))
cmd = 'cp -fpPRH "%s" "%s"' % (file, destdir)
+ else:
+ urldata.unpack_tracer.unpack("archive-extract", unpackdir)
if not cmd:
return
@@ -1654,6 +1700,55 @@ class FetchMethod(object):
"""
return []
+
+class DummyUnpackTracer(object):
+ """
+ Abstract API definition for a class that traces unpacked source files back
+ to their respective upstream SRC_URI entries, for software composition
+ analysis, license compliance and detailed SBOM generation purposes.
+ User may load their own unpack tracer class (instead of the dummy
+ one) by setting the BB_UNPACK_TRACER_CLASS config parameter.
+ """
+ def start(self, unpackdir, urldata_dict, d):
+ """
+ Start tracing the core Fetch.unpack process, using an index to map
+ unpacked files to each SRC_URI entry.
+ This method is called by Fetch.unpack and it may receive nested calls by
+ gitsm and npmsw fetchers, that expand SRC_URI entries by adding implicit
+ URLs and by recursively calling Fetch.unpack from new (nested) Fetch
+ instances.
+ """
+ return
+ def start_url(self, url):
+ """Start tracing url unpack process.
+ This method is called by Fetch.unpack before the fetcher-specific unpack
+ method starts, and it may receive nested calls by gitsm and npmsw
+ fetchers.
+ """
+ return
+ def unpack(self, unpack_type, destdir):
+ """
+ Set unpack_type and destdir for current url.
+ This method is called by the fetcher-specific unpack method after url
+ tracing started.
+ """
+ return
+ def finish_url(self, url):
+ """Finish tracing url unpack process and update the file index.
+ This method is called by Fetch.unpack after the fetcher-specific unpack
+ method finished its job, and it may receive nested calls by gitsm
+ and npmsw fetchers.
+ """
+ return
+ def complete(self):
+ """
+ Finish tracing the Fetch.unpack process, and check if all nested
+ Fecth.unpack calls (if any) have been completed; if so, save collected
+ metadata.
+ """
+ return
+
+
class Fetch(object):
def __init__(self, urls, d, cache = True, localonly = False, connection_cache = None):
if localonly and cache:
@@ -1674,10 +1769,30 @@ class Fetch(object):
if key in urldata_cache:
self.ud = urldata_cache[key]
+ # the unpack_tracer object needs to be made available to possible nested
+ # Fetch instances (when those are created by gitsm and npmsw fetchers)
+ # so we set it as a global variable
+ global unpack_tracer
+ try:
+ unpack_tracer
+ except NameError:
+ class_path = d.getVar("BB_UNPACK_TRACER_CLASS")
+ if class_path:
+ # use user-defined unpack tracer class
+ import importlib
+ module_name, _, class_name = class_path.rpartition(".")
+ module = importlib.import_module(module_name)
+ class_ = getattr(module, class_name)
+ unpack_tracer = class_()
+ else:
+ # fall back to the dummy/abstract class
+ unpack_tracer = DummyUnpackTracer()
+
for url in urls:
if url not in self.ud:
try:
self.ud[url] = FetchData(url, d, localonly)
+ self.ud[url].unpack_tracer = unpack_tracer
except NonLocalMethod:
if localonly:
self.ud[url] = None
@@ -1716,6 +1831,7 @@ class Fetch(object):
network = self.d.getVar("BB_NO_NETWORK")
premirroronly = bb.utils.to_boolean(self.d.getVar("BB_FETCH_PREMIRRORONLY"))
+ checksum_missing_messages = []
for u in urls:
ud = self.ud[u]
ud.setup_localpath(self.d)
@@ -1727,7 +1843,6 @@ class Fetch(object):
try:
self.d.setVar("BB_NO_NETWORK", network)
-
if m.verify_donestamp(ud, self.d) and not m.need_update(ud, self.d):
done = True
elif m.try_premirror(ud, self.d):
@@ -1780,7 +1895,7 @@ class Fetch(object):
logger.debug(str(e))
firsterr = e
# Remove any incomplete fetch
- if not verified_stamp:
+ if not verified_stamp and m.cleanup_upon_failure():
m.clean(ud, self.d)
logger.debug("Trying MIRRORS")
mirrors = mirror_from_string(self.d.getVar('MIRRORS'))
@@ -1799,13 +1914,20 @@ class Fetch(object):
raise ChecksumError("Stale Error Detected")
except BBFetchException as e:
- if isinstance(e, ChecksumError):
+ if isinstance(e, NoChecksumError):
+ (message, _) = e.args
+ checksum_missing_messages.append(message)
+ continue
+ elif isinstance(e, ChecksumError):
logger.error("Checksum failure fetching %s" % u)
raise
finally:
if ud.lockfile:
bb.utils.unlockfile(lf)
+ if checksum_missing_messages:
+ logger.error("Missing SRC_URI checksum, please add those to the recipe: \n%s", "\n".join(checksum_missing_messages))
+ raise BBFetchException("There was some missing checksums in the recipe")
def checkstatus(self, urls=None):
"""
@@ -1836,7 +1958,7 @@ class Fetch(object):
ret = m.try_mirrors(self, ud, self.d, mirrors, True)
if not ret:
- raise FetchError("URL %s doesn't work" % u, u)
+ raise FetchError("URL doesn't work", u)
def unpack(self, root, urls=None):
"""
@@ -1846,6 +1968,8 @@ class Fetch(object):
if not urls:
urls = self.urls
+ unpack_tracer.start(root, self.ud, self.d)
+
for u in urls:
ud = self.ud[u]
ud.setup_localpath(self.d)
@@ -1853,11 +1977,15 @@ class Fetch(object):
if ud.lockfile:
lf = bb.utils.lockfile(ud.lockfile)
+ unpack_tracer.start_url(u)
ud.method.unpack(ud, root, self.d)
+ unpack_tracer.finish_url(u)
if ud.lockfile:
bb.utils.unlockfile(lf)
+ unpack_tracer.complete()
+
def clean(self, urls=None):
"""
Clean files that the fetcher gets or places
@@ -1959,6 +2087,7 @@ from . import npm
from . import npmsw
from . import az
from . import crate
+from . import gcp
methods.append(local.Local())
methods.append(wget.Wget())
@@ -1980,3 +2109,4 @@ methods.append(npm.Npm())
methods.append(npmsw.NpmShrinkWrap())
methods.append(az.Az())
methods.append(crate.Crate())
+methods.append(gcp.GCP())
diff --git a/bitbake/lib/bb/fetch2/crate.py b/bitbake/lib/bb/fetch2/crate.py
index f4ddc782a9..e611736f06 100644
--- a/bitbake/lib/bb/fetch2/crate.py
+++ b/bitbake/lib/bb/fetch2/crate.py
@@ -33,7 +33,7 @@ class Crate(Wget):
return ud.type in ['crate']
def recommends_checksum(self, urldata):
- return False
+ return True
def urldata_init(self, ud, d):
"""
@@ -56,22 +56,26 @@ class Crate(Wget):
if len(parts) < 5:
raise bb.fetch2.ParameterError("Invalid URL: Must be crate://HOST/NAME/VERSION", ud.url)
- # last field is version
- version = parts[len(parts) - 1]
+ # version is expected to be the last token
+ # but ignore possible url parameters which will be used
+ # by the top fetcher class
+ version = parts[-1].split(";")[0]
# second to last field is name
- name = parts[len(parts) - 2]
+ name = parts[-2]
# host (this is to allow custom crate registries to be specified
- host = '/'.join(parts[2:len(parts) - 2])
+ host = '/'.join(parts[2:-2])
# if using upstream just fix it up nicely
if host == 'crates.io':
host = 'crates.io/api/v1/crates'
ud.url = "https://%s/%s/%s/download" % (host, name, version)
+ ud.versionsurl = "https://%s/%s/versions" % (host, name)
ud.parm['downloadfilename'] = "%s-%s.crate" % (name, version)
- ud.parm['name'] = name
+ if 'name' not in ud.parm:
+ ud.parm['name'] = '%s-%s' % (name, version)
- logger.debug("Fetching %s to %s" % (ud.url, ud.parm['downloadfilename']))
+ logger.debug2("Fetching %s to %s" % (ud.url, ud.parm['downloadfilename']))
def unpack(self, ud, rootdir, d):
"""
@@ -95,11 +99,13 @@ class Crate(Wget):
save_cwd = os.getcwd()
os.chdir(rootdir)
- pn = d.getVar('BPN')
- if pn == ud.parm.get('name'):
+ bp = d.getVar('BP')
+ if bp == ud.parm.get('name'):
cmd = "tar -xz --no-same-owner -f %s" % thefile
+ ud.unpack_tracer.unpack("crate-extract", rootdir)
else:
cargo_bitbake = self._cargo_bitbake_path(rootdir)
+ ud.unpack_tracer.unpack("cargo-extract", cargo_bitbake)
cmd = "tar -xz --no-same-owner -f %s -C %s" % (thefile, cargo_bitbake)
@@ -134,3 +140,11 @@ class Crate(Wget):
mdpath = os.path.join(bbpath, cratepath, mdfile)
with open(mdpath, "w") as f:
json.dump(metadata, f)
+
+ def latest_versionstring(self, ud, d):
+ from functools import cmp_to_key
+ json_data = json.loads(self._fetch_index(ud.versionsurl, ud, d))
+ versions = [(0, i["num"], "") for i in json_data["versions"]]
+ versions = sorted(versions, key=cmp_to_key(bb.utils.vercmp))
+
+ return (versions[-1][1], "")
diff --git a/bitbake/lib/bb/fetch2/gcp.py b/bitbake/lib/bb/fetch2/gcp.py
new file mode 100644
index 0000000000..eb3e0c6a6b
--- /dev/null
+++ b/bitbake/lib/bb/fetch2/gcp.py
@@ -0,0 +1,102 @@
+"""
+BitBake 'Fetch' implementation for Google Cloup Platform Storage.
+
+Class for fetching files from Google Cloud Storage using the
+Google Cloud Storage Python Client. The GCS Python Client must
+be correctly installed, configured and authenticated prior to use.
+Additionally, gsutil must also be installed.
+
+"""
+
+# Copyright (C) 2023, Snap Inc.
+#
+# Based in part on bb.fetch2.s3:
+# Copyright (C) 2017 Andre McCurdy
+#
+# SPDX-License-Identifier: GPL-2.0-only
+#
+# Based on functions from the base bb module, Copyright 2003 Holger Schurig
+
+import os
+import bb
+import urllib.parse, urllib.error
+from bb.fetch2 import FetchMethod
+from bb.fetch2 import FetchError
+from bb.fetch2 import logger
+from bb.fetch2 import runfetchcmd
+
+class GCP(FetchMethod):
+ """
+ Class to fetch urls via GCP's Python API.
+ """
+ def __init__(self):
+ self.gcp_client = None
+
+ def supports(self, ud, d):
+ """
+ Check to see if a given url can be fetched with GCP.
+ """
+ return ud.type in ['gs']
+
+ def recommends_checksum(self, urldata):
+ return True
+
+ def urldata_init(self, ud, d):
+ if 'downloadfilename' in ud.parm:
+ ud.basename = ud.parm['downloadfilename']
+ else:
+ ud.basename = os.path.basename(ud.path)
+
+ ud.localfile = d.expand(urllib.parse.unquote(ud.basename))
+ ud.basecmd = "gsutil stat"
+
+ def get_gcp_client(self):
+ from google.cloud import storage
+ self.gcp_client = storage.Client(project=None)
+
+ def download(self, ud, d):
+ """
+ Fetch urls using the GCP API.
+ Assumes localpath was called first.
+ """
+ logger.debug2(f"Trying to download gs://{ud.host}{ud.path} to {ud.localpath}")
+ if self.gcp_client is None:
+ self.get_gcp_client()
+
+ bb.fetch2.check_network_access(d, ud.basecmd, f"gs://{ud.host}{ud.path}")
+ runfetchcmd("%s %s" % (ud.basecmd, f"gs://{ud.host}{ud.path}"), d)
+
+ # Path sometimes has leading slash, so strip it
+ path = ud.path.lstrip("/")
+ blob = self.gcp_client.bucket(ud.host).blob(path)
+ blob.download_to_filename(ud.localpath)
+
+ # Additional sanity checks copied from the wget class (although there
+ # are no known issues which mean these are required, treat the GCP API
+ # tool with a little healthy suspicion).
+ if not os.path.exists(ud.localpath):
+ raise FetchError(f"The GCP API returned success for gs://{ud.host}{ud.path} but {ud.localpath} doesn't exist?!")
+
+ if os.path.getsize(ud.localpath) == 0:
+ os.remove(ud.localpath)
+ raise FetchError(f"The downloaded file for gs://{ud.host}{ud.path} resulted in a zero size file?! Deleting and failing since this isn't right.")
+
+ return True
+
+ def checkstatus(self, fetch, ud, d):
+ """
+ Check the status of a URL.
+ """
+ logger.debug2(f"Checking status of gs://{ud.host}{ud.path}")
+ if self.gcp_client is None:
+ self.get_gcp_client()
+
+ bb.fetch2.check_network_access(d, ud.basecmd, f"gs://{ud.host}{ud.path}")
+ runfetchcmd("%s %s" % (ud.basecmd, f"gs://{ud.host}{ud.path}"), d)
+
+ # Path sometimes has leading slash, so strip it
+ path = ud.path.lstrip("/")
+ if self.gcp_client.bucket(ud.host).blob(path).exists() == False:
+ raise FetchError(f"The GCP API reported that gs://{ud.host}{ud.path} does not exist")
+ else:
+ return True
diff --git a/bitbake/lib/bb/fetch2/git.py b/bitbake/lib/bb/fetch2/git.py
index 4534bd7580..c7ff769fdf 100644
--- a/bitbake/lib/bb/fetch2/git.py
+++ b/bitbake/lib/bb/fetch2/git.py
@@ -44,13 +44,27 @@ Supported SRC_URI options are:
- nobranch
Don't check the SHA validation for branch. set this option for the recipe
- referring to commit which is valid in tag instead of branch.
+ referring to commit which is valid in any namespace (branch, tag, ...)
+ instead of branch.
The default is "0", set nobranch=1 if needed.
+- subpath
+ Limit the checkout to a specific subpath of the tree.
+ By default, checkout the whole tree, set subpath=<path> if needed
+
+- destsuffix
+ The name of the path in which to place the checkout.
+ By default, the path is git/, set destsuffix=<suffix> if needed
+
- usehead
For local git:// urls to use the current branch HEAD as the revision for use with
AUTOREV. Implies nobranch.
+- lfs
+ Enable the checkout to use LFS for large files. This will download all LFS files
+ in the download step, as the unpack step does not have network access.
+ The default is "1", set lfs=0 to skip.
+
"""
# Copyright (C) 2005 Richard Purdie
@@ -64,6 +78,7 @@ import fnmatch
import os
import re
import shlex
+import shutil
import subprocess
import tempfile
import bb
@@ -72,6 +87,7 @@ from contextlib import contextmanager
from bb.fetch2 import FetchMethod
from bb.fetch2 import runfetchcmd
from bb.fetch2 import logger
+from bb.fetch2 import trusted_network
sha1_re = re.compile(r'^[0-9a-f]{40}$')
@@ -134,6 +150,9 @@ class Git(FetchMethod):
def supports_checksum(self, urldata):
return False
+ def cleanup_upon_failure(self):
+ return False
+
def urldata_init(self, ud, d):
"""
init git specific variable within url data
@@ -243,7 +262,7 @@ class Git(FetchMethod):
for name in ud.names:
ud.unresolvedrev[name] = 'HEAD'
- ud.basecmd = d.getVar("FETCHCMD_git") or "git -c core.fsyncobjectfiles=0 -c gc.autoDetach=false -c core.pager=cat"
+ ud.basecmd = d.getVar("FETCHCMD_git") or "git -c gc.autoDetach=false -c core.pager=cat -c safe.bareRepository=all"
write_tarballs = d.getVar("BB_GENERATE_MIRROR_TARBALLS") or "0"
ud.write_tarballs = write_tarballs != "0" or ud.rebaseable
@@ -258,7 +277,7 @@ class Git(FetchMethod):
ud.unresolvedrev[name] = ud.revisions[name]
ud.revisions[name] = self.latest_revision(ud, d, name)
- gitsrcname = '%s%s' % (ud.host.replace(':', '.'), ud.path.replace('/', '.').replace('*', '.').replace(' ','_'))
+ gitsrcname = '%s%s' % (ud.host.replace(':', '.'), ud.path.replace('/', '.').replace('*', '.').replace(' ','_').replace('(', '_').replace(')', '_'))
if gitsrcname.startswith('.'):
gitsrcname = gitsrcname[1:]
@@ -309,7 +328,10 @@ class Git(FetchMethod):
return ud.clonedir
def need_update(self, ud, d):
- return self.clonedir_need_update(ud, d) or self.shallow_tarball_need_update(ud) or self.tarball_need_update(ud)
+ return self.clonedir_need_update(ud, d) \
+ or self.shallow_tarball_need_update(ud) \
+ or self.tarball_need_update(ud) \
+ or self.lfs_need_update(ud, d)
def clonedir_need_update(self, ud, d):
if not os.path.exists(ud.clonedir):
@@ -321,6 +343,15 @@ class Git(FetchMethod):
return True
return False
+ def lfs_need_update(self, ud, d):
+ if self.clonedir_need_update(ud, d):
+ return True
+
+ for name in ud.names:
+ if not self._lfs_objects_downloaded(ud, d, name, ud.clonedir):
+ return True
+ return False
+
def clonedir_need_shallow_revs(self, ud, d):
for rev in ud.shallow_revs:
try:
@@ -340,6 +371,16 @@ class Git(FetchMethod):
# is not possible
if bb.utils.to_boolean(d.getVar("BB_FETCH_PREMIRRORONLY")):
return True
+ # If the url is not in trusted network, that is, BB_NO_NETWORK is set to 0
+ # and BB_ALLOWED_NETWORKS does not contain the host that ud.url uses, then
+ # we need to try premirrors first as using upstream is destined to fail.
+ if not trusted_network(d, ud.url):
+ return True
+ # the following check is to ensure incremental fetch in downloads, this is
+ # because the premirror might be old and does not contain the new rev required,
+ # and this will cause a total removal and new clone. So if we can reach to
+ # network, we prefer upstream over premirror, though the premirror might contain
+ # the new rev.
if os.path.exists(ud.clonedir):
return False
return True
@@ -360,15 +401,47 @@ class Git(FetchMethod):
else:
tmpdir = tempfile.mkdtemp(dir=d.getVar('DL_DIR'))
runfetchcmd("tar -xzf %s" % ud.fullmirror, d, workdir=tmpdir)
- fetch_cmd = "LANG=C %s fetch -f --progress %s " % (ud.basecmd, shlex.quote(tmpdir))
+ output = runfetchcmd("%s remote" % ud.basecmd, d, quiet=True, workdir=ud.clonedir)
+ if 'mirror' in output:
+ runfetchcmd("%s remote rm mirror" % ud.basecmd, d, workdir=ud.clonedir)
+ runfetchcmd("%s remote add --mirror=fetch mirror %s" % (ud.basecmd, tmpdir), d, workdir=ud.clonedir)
+ fetch_cmd = "LANG=C %s fetch -f --update-head-ok --progress mirror " % (ud.basecmd)
runfetchcmd(fetch_cmd, d, workdir=ud.clonedir)
repourl = self._get_repo_url(ud)
+ needs_clone = False
+ if os.path.exists(ud.clonedir):
+ # The directory may exist, but not be the top level of a bare git
+ # repository in which case it needs to be deleted and re-cloned.
+ try:
+ # Since clones can be bare, use --absolute-git-dir instead of --show-toplevel
+ output = runfetchcmd("LANG=C %s rev-parse --absolute-git-dir" % ud.basecmd, d, workdir=ud.clonedir)
+ toplevel = output.rstrip()
+
+ if not bb.utils.path_is_descendant(toplevel, ud.clonedir):
+ logger.warning("Top level directory '%s' is not a descendant of '%s'. Re-cloning", toplevel, ud.clonedir)
+ needs_clone = True
+ except bb.fetch2.FetchError as e:
+ logger.warning("Unable to get top level for %s (not a git directory?): %s", ud.clonedir, e)
+ needs_clone = True
+ except FileNotFoundError as e:
+ logger.warning("%s", e)
+ needs_clone = True
+
+ if needs_clone:
+ shutil.rmtree(ud.clonedir)
+ else:
+ needs_clone = True
+
# If the repo still doesn't exist, fallback to cloning it
- if not os.path.exists(ud.clonedir):
- # We do this since git will use a "-l" option automatically for local urls where possible
+ if needs_clone:
+ # We do this since git will use a "-l" option automatically for local urls where possible,
+ # but it doesn't work when git/objects is a symlink, only works when it is a directory.
if repourl.startswith("file://"):
- repourl = repourl[7:]
+ repourl_path = repourl[7:]
+ objects = os.path.join(repourl_path, 'objects')
+ if os.path.isdir(objects) and not os.path.islink(objects):
+ repourl = repourl_path
clone_cmd = "LANG=C %s clone --bare --mirror %s %s --progress" % (ud.basecmd, shlex.quote(repourl), ud.clonedir)
if ud.proto.lower() != 'file':
bb.fetch2.check_network_access(d, clone_cmd, ud.url)
@@ -382,7 +455,11 @@ class Git(FetchMethod):
runfetchcmd("%s remote rm origin" % ud.basecmd, d, workdir=ud.clonedir)
runfetchcmd("%s remote add --mirror=fetch origin %s" % (ud.basecmd, shlex.quote(repourl)), d, workdir=ud.clonedir)
- fetch_cmd = "LANG=C %s fetch -f --progress %s refs/*:refs/*" % (ud.basecmd, shlex.quote(repourl))
+
+ if ud.nobranch:
+ fetch_cmd = "LANG=C %s fetch -f --progress %s refs/*:refs/*" % (ud.basecmd, shlex.quote(repourl))
+ else:
+ fetch_cmd = "LANG=C %s fetch -f --progress %s refs/heads/*:refs/heads/* refs/tags/*:refs/tags/*" % (ud.basecmd, shlex.quote(repourl))
if ud.proto.lower() != 'file':
bb.fetch2.check_network_access(d, fetch_cmd, ud.url)
progresshandler = GitProgressHandler(d)
@@ -405,15 +482,14 @@ class Git(FetchMethod):
if missing_rev:
raise bb.fetch2.FetchError("Unable to find revision %s even from upstream" % missing_rev)
- if self._contains_lfs(ud, d, ud.clonedir) and self._need_lfs(ud):
+ if self.lfs_need_update(ud, d):
# Unpack temporary working copy, use it to run 'git checkout' to force pre-fetching
# of all LFS blobs needed at the srcrev.
#
# It would be nice to just do this inline here by running 'git-lfs fetch'
# on the bare clonedir, but that operation requires a working copy on some
# releases of Git LFS.
- tmpdir = tempfile.mkdtemp(dir=d.getVar('DL_DIR'))
- try:
+ with tempfile.TemporaryDirectory(dir=d.getVar('DL_DIR')) as tmpdir:
# Do the checkout. This implicitly involves a Git LFS fetch.
Git.unpack(self, ud, tmpdir, d)
@@ -429,10 +505,8 @@ class Git(FetchMethod):
# Only do this if the unpack resulted in a .git/lfs directory being
# created; this only happens if at least one blob needed to be
# downloaded.
- if os.path.exists(os.path.join(tmpdir, "git", ".git", "lfs")):
- runfetchcmd("tar -cf - lfs | tar -xf - -C %s" % ud.clonedir, d, workdir="%s/git/.git" % tmpdir)
- finally:
- bb.utils.remove(tmpdir, recurse=True)
+ if os.path.exists(os.path.join(ud.destdir, ".git", "lfs")):
+ runfetchcmd("tar -cf - lfs | tar -xf - -C %s" % ud.clonedir, d, workdir="%s/.git" % ud.destdir)
def build_mirror_data(self, ud, d):
@@ -470,7 +544,7 @@ class Git(FetchMethod):
logger.info("Creating tarball of git repository")
with create_atomic(ud.fullmirror) as tfile:
- mtime = runfetchcmd("git log --all -1 --format=%cD", d,
+ mtime = runfetchcmd("{} log --all -1 --format=%cD".format(ud.basecmd), d,
quiet=True, workdir=ud.clonedir)
runfetchcmd("tar -czf %s --owner oe:0 --group oe:0 --mtime \"%s\" ."
% (tfile, mtime), d, workdir=ud.clonedir)
@@ -558,6 +632,8 @@ class Git(FetchMethod):
destdir = ud.destdir = os.path.join(destdir, destsuffix)
if os.path.exists(destdir):
bb.utils.prunedir(destdir)
+ if not ud.bareclone:
+ ud.unpack_tracer.unpack("git", destdir)
need_lfs = self._need_lfs(ud)
@@ -567,13 +643,12 @@ class Git(FetchMethod):
source_found = False
source_error = []
- if not source_found:
- clonedir_is_up_to_date = not self.clonedir_need_update(ud, d)
- if clonedir_is_up_to_date:
- runfetchcmd("%s clone %s %s/ %s" % (ud.basecmd, ud.cloneflags, ud.clonedir, destdir), d)
- source_found = True
- else:
- source_error.append("clone directory not available or not up to date: " + ud.clonedir)
+ clonedir_is_up_to_date = not self.clonedir_need_update(ud, d)
+ if clonedir_is_up_to_date:
+ runfetchcmd("%s clone %s %s/ %s" % (ud.basecmd, ud.cloneflags, ud.clonedir, destdir), d)
+ source_found = True
+ else:
+ source_error.append("clone directory not available or not up to date: " + ud.clonedir)
if not source_found:
if ud.shallow:
@@ -597,6 +672,8 @@ class Git(FetchMethod):
raise bb.fetch2.FetchError("Repository %s has LFS content, install git-lfs on host to download (or set lfs=0 to ignore it)" % (repourl))
elif not need_lfs:
bb.note("Repository %s has LFS content but it is not being fetched" % (repourl))
+ else:
+ runfetchcmd("%s lfs install --local" % ud.basecmd, d, workdir=destdir)
if not ud.nocheckout:
if subpath:
@@ -648,6 +725,35 @@ class Git(FetchMethod):
raise bb.fetch2.FetchError("The command '%s' gave output with more then 1 line unexpectedly, output: '%s'" % (cmd, output))
return output.split()[0] != "0"
+ def _lfs_objects_downloaded(self, ud, d, name, wd):
+ """
+ Verifies whether the LFS objects for requested revisions have already been downloaded
+ """
+ # Bail out early if this repository doesn't use LFS
+ if not self._need_lfs(ud) or not self._contains_lfs(ud, d, wd):
+ return True
+
+ # The Git LFS specification specifies ([1]) the LFS folder layout so it should be safe to check for file
+ # existence.
+ # [1] https://github.com/git-lfs/git-lfs/blob/main/docs/spec.md#intercepting-git
+ cmd = "%s lfs ls-files -l %s" \
+ % (ud.basecmd, ud.revisions[name])
+ output = runfetchcmd(cmd, d, quiet=True, workdir=wd).rstrip()
+ # Do not do any further matching if no objects are managed by LFS
+ if not output:
+ return True
+
+ # Match all lines beginning with the hexadecimal OID
+ oid_regex = re.compile("^(([a-fA-F0-9]{2})([a-fA-F0-9]{2})[A-Fa-f0-9]+)")
+ for line in output.split("\n"):
+ oid = re.search(oid_regex, line)
+ if not oid:
+ bb.warn("git lfs ls-files output '%s' did not match expected format." % line)
+ if not os.path.exists(os.path.join(wd, "lfs", "objects", oid.group(2), oid.group(3), oid.group(1))):
+ return False
+
+ return True
+
def _need_lfs(self, ud):
return ud.parm.get("lfs", "1") == "1"
@@ -656,13 +762,11 @@ class Git(FetchMethod):
Check if the repository has 'lfs' (large file) content
"""
- if not ud.nobranch:
- branchname = ud.branches[ud.names[0]]
- else:
- branchname = "master"
-
- # The bare clonedir doesn't use the remote names; it has the branch immediately.
- if wd == ud.clonedir:
+ if ud.nobranch:
+ # If no branch is specified, use the current git commit
+ refname = self._build_revision(ud, d, ud.names[0])
+ elif wd == ud.clonedir:
+ # The bare clonedir doesn't use the remote names; it has the branch immediately.
refname = ud.branches[ud.names[0]]
else:
refname = "origin/%s" % ud.branches[ud.names[0]]
@@ -737,11 +841,11 @@ class Git(FetchMethod):
"""
Compute the HEAD revision for the url
"""
- if not d.getVar("__BBSEENSRCREV"):
+ if not d.getVar("__BBSRCREV_SEEN"):
raise bb.fetch2.FetchError("Recipe uses a floating tag/branch '%s' for repo '%s' without a fixed SRCREV yet doesn't call bb.fetch2.get_srcrev() (use SRCPV in PV for OE)." % (ud.unresolvedrev[name], ud.host+ud.path))
# Ensure we mark as not cached
- bb.fetch2.get_autorev(d)
+ bb.fetch2.mark_recipe_nocache(d)
output = self._lsremote(ud, d, "")
# Tags of the form ^{} may not work, need to fallback to other form
@@ -767,38 +871,42 @@ class Git(FetchMethod):
"""
pupver = ('', '')
- tagregex = re.compile(d.getVar('UPSTREAM_CHECK_GITTAGREGEX') or r"(?P<pver>([0-9][\.|_]?)+)")
try:
output = self._lsremote(ud, d, "refs/tags/*")
except (bb.fetch2.FetchError, bb.fetch2.NetworkAccess) as e:
bb.note("Could not list remote: %s" % str(e))
return pupver
+ rev_tag_re = re.compile(r"([0-9a-f]{40})\s+refs/tags/(.*)")
+ pver_re = re.compile(d.getVar('UPSTREAM_CHECK_GITTAGREGEX') or r"(?P<pver>([0-9][\.|_]?)+)")
+ nonrel_re = re.compile(r"(alpha|beta|rc|final)+")
+
verstring = ""
- revision = ""
for line in output.split("\n"):
if not line:
break
- tag_head = line.split("/")[-1]
+ m = rev_tag_re.match(line)
+ if not m:
+ continue
+
+ (revision, tag) = m.groups()
+
# Ignore non-released branches
- m = re.search(r"(alpha|beta|rc|final)+", tag_head)
- if m:
+ if nonrel_re.search(tag):
continue
# search for version in the line
- tag = tagregex.search(tag_head)
- if tag is None:
+ m = pver_re.search(tag)
+ if not m:
continue
- tag = tag.group('pver')
- tag = tag.replace("_", ".")
+ pver = m.group('pver').replace("_", ".")
- if verstring and bb.utils.vercmp(("0", tag, ""), ("0", verstring, "")) < 0:
+ if verstring and bb.utils.vercmp(("0", pver, ""), ("0", verstring, "")) < 0:
continue
- verstring = tag
- revision = line.split()[0]
+ verstring = pver
pupver = (verstring, revision)
return pupver
diff --git a/bitbake/lib/bb/fetch2/gitsm.py b/bitbake/lib/bb/fetch2/gitsm.py
index c1950e4819..f7f3af7212 100644
--- a/bitbake/lib/bb/fetch2/gitsm.py
+++ b/bitbake/lib/bb/fetch2/gitsm.py
@@ -90,7 +90,7 @@ class GitSM(Git):
# Convert relative to absolute uri based on parent uri
if uris[m].startswith('..') or uris[m].startswith('./'):
newud = copy.copy(ud)
- newud.path = os.path.realpath(os.path.join(newud.path, uris[m]))
+ newud.path = os.path.normpath(os.path.join(newud.path, uris[m]))
uris[m] = Git._get_repo_url(self, newud)
for module in submodules:
@@ -115,10 +115,21 @@ class GitSM(Git):
# This has to be a file reference
proto = "file"
url = "gitsm://" + uris[module]
+ if url.endswith("{}{}".format(ud.host, ud.path)):
+ raise bb.fetch2.FetchError("Submodule refers to the parent repository. This will cause deadlock situation in current version of Bitbake." \
+ "Consider using git fetcher instead.")
url += ';protocol=%s' % proto
url += ";name=%s" % module
url += ";subpath=%s" % module
+ url += ";nobranch=1"
+ url += ";lfs=%s" % self._need_lfs(ud)
+ # Note that adding "user=" here to give credentials to the
+ # submodule is not supported. Since using SRC_URI to give git://
+ # URL a password is not supported, one have to use one of the
+ # recommended way (eg. ~/.netrc or SSH config) which does specify
+ # the user (See comment in git.py).
+ # So, we will not take patches adding "user=" support here.
ld = d.createCopy()
# Not necessary to set SRC_URI, since we're passing the URI to
@@ -207,6 +218,10 @@ class GitSM(Git):
try:
newfetch = Fetch([url], d, cache=False)
+ # modpath is needed by unpack tracer to calculate submodule
+ # checkout dir
+ new_ud = newfetch.ud[url]
+ new_ud.modpath = modpath
newfetch.unpack(root=os.path.dirname(os.path.join(repo_conf, 'modules', module)))
except Exception as e:
logger.error('gitsm: submodule unpack failed: %s %s' % (type(e).__name__, str(e)))
@@ -232,10 +247,12 @@ class GitSM(Git):
ret = self.process_submodules(ud, ud.destdir, unpack_submodules, d)
if not ud.bareclone and ret:
- # All submodules should already be downloaded and configured in the tree. This simply sets
- # up the configuration and checks out the files. The main project config should remain
- # unmodified, and no download from the internet should occur.
- runfetchcmd("%s submodule update --recursive --no-fetch" % (ud.basecmd), d, quiet=True, workdir=ud.destdir)
+ # All submodules should already be downloaded and configured in the tree. This simply
+ # sets up the configuration and checks out the files. The main project config should
+ # remain unmodified, and no download from the internet should occur. As such, lfs smudge
+ # should also be skipped as these files were already smudged in the fetch stage if lfs
+ # was enabled.
+ runfetchcmd("GIT_LFS_SKIP_SMUDGE=1 %s submodule update --recursive --no-fetch" % (ud.basecmd), d, quiet=True, workdir=ud.destdir)
def implicit_urldata(self, ud, d):
import shutil, subprocess, tempfile
diff --git a/bitbake/lib/bb/fetch2/hg.py b/bitbake/lib/bb/fetch2/hg.py
index 063e13008a..cbff8c490c 100644
--- a/bitbake/lib/bb/fetch2/hg.py
+++ b/bitbake/lib/bb/fetch2/hg.py
@@ -242,6 +242,7 @@ class Hg(FetchMethod):
revflag = "-r %s" % ud.revision
subdir = ud.parm.get("destsuffix", ud.module)
codir = "%s/%s" % (destdir, subdir)
+ ud.unpack_tracer.unpack("hg", codir)
scmdata = ud.parm.get("scmdata", "")
if scmdata != "nokeep":
diff --git a/bitbake/lib/bb/fetch2/local.py b/bitbake/lib/bb/fetch2/local.py
index 0bb987c644..7d7668110e 100644
--- a/bitbake/lib/bb/fetch2/local.py
+++ b/bitbake/lib/bb/fetch2/local.py
@@ -41,9 +41,9 @@ class Local(FetchMethod):
"""
Return the local filename of a given url assuming a successful fetch.
"""
- return self.localpaths(urldata, d)[-1]
+ return self.localfile_searchpaths(urldata, d)[-1]
- def localpaths(self, urldata, d):
+ def localfile_searchpaths(self, urldata, d):
"""
Return the local filename of a given url assuming a successful fetch.
"""
@@ -51,11 +51,13 @@ class Local(FetchMethod):
path = urldata.decodedurl
newpath = path
if path[0] == "/":
+ logger.debug2("Using absolute %s" % (path))
return [path]
filespath = d.getVar('FILESPATH')
if filespath:
logger.debug2("Searching for %s in paths:\n %s" % (path, "\n ".join(filespath.split(":"))))
newpath, hist = bb.utils.which(filespath, path, history=True)
+ logger.debug2("Using %s for %s" % (newpath, path))
searched.extend(hist)
return searched
@@ -72,7 +74,7 @@ class Local(FetchMethod):
filespath = d.getVar('FILESPATH')
if filespath:
locations = filespath.split(":")
- msg = "Unable to find file " + urldata.url + " anywhere. The paths that were searched were:\n " + "\n ".join(locations)
+ msg = "Unable to find file " + urldata.url + " anywhere to download to " + urldata.localpath + ". The paths that were searched were:\n " + "\n ".join(locations)
raise FetchError(msg)
return True
diff --git a/bitbake/lib/bb/fetch2/npm.py b/bitbake/lib/bb/fetch2/npm.py
index 8f7c10ac9b..15f3f19bc8 100644
--- a/bitbake/lib/bb/fetch2/npm.py
+++ b/bitbake/lib/bb/fetch2/npm.py
@@ -44,9 +44,12 @@ def npm_package(package):
"""Convert the npm package name to remove unsupported character"""
# Scoped package names (with the @) use the same naming convention
# as the 'npm pack' command.
- if package.startswith("@"):
- return re.sub("/", "-", package[1:])
- return package
+ name = re.sub("/", "-", package)
+ name = name.lower()
+ name = re.sub(r"[^\-a-z0-9]", "", name)
+ name = name.strip("-")
+ return name
+
def npm_filename(package, version):
"""Get the filename of a npm package"""
@@ -103,6 +106,7 @@ class NpmEnvironment(object):
"""Run npm command in a controlled environment"""
with tempfile.TemporaryDirectory() as tmpdir:
d = bb.data.createCopy(self.d)
+ d.setVar("PATH", d.getVar("PATH")) # PATH might contain $HOME - evaluate it before patching
d.setVar("HOME", tmpdir)
if not workdir:
@@ -156,7 +160,7 @@ class Npm(FetchMethod):
raise ParameterError("Invalid 'version' parameter", ud.url)
# Extract the 'registry' part of the url
- ud.registry = re.sub(r"^npm://", "http://", ud.url.split(";")[0])
+ ud.registry = re.sub(r"^npm://", "https://", ud.url.split(";")[0])
# Using the 'downloadfilename' parameter as local filename
# or the npm package name.
@@ -294,6 +298,7 @@ class Npm(FetchMethod):
destsuffix = ud.parm.get("destsuffix", "npm")
destdir = os.path.join(rootdir, destsuffix)
npm_unpack(ud.localpath, destdir, d)
+ ud.unpack_tracer.unpack("npm", destdir)
def clean(self, ud, d):
"""Clean any existing full or partial download"""
diff --git a/bitbake/lib/bb/fetch2/npmsw.py b/bitbake/lib/bb/fetch2/npmsw.py
index a8c4d3528f..b55e885d7b 100644
--- a/bitbake/lib/bb/fetch2/npmsw.py
+++ b/bitbake/lib/bb/fetch2/npmsw.py
@@ -41,8 +41,9 @@ def foreach_dependencies(shrinkwrap, callback=None, dev=False):
with:
name = the package name (string)
params = the package parameters (dictionary)
- deptree = the package dependency tree (array of strings)
+ destdir = the destination of the package (string)
"""
+ # For handling old style dependencies entries in shinkwrap files
def _walk_deps(deps, deptree):
for name in deps:
subtree = [*deptree, name]
@@ -52,9 +53,22 @@ def foreach_dependencies(shrinkwrap, callback=None, dev=False):
continue
elif deps[name].get("bundled", False):
continue
- callback(name, deps[name], subtree)
-
- _walk_deps(shrinkwrap.get("dependencies", {}), [])
+ destsubdirs = [os.path.join("node_modules", dep) for dep in subtree]
+ destsuffix = os.path.join(*destsubdirs)
+ callback(name, deps[name], destsuffix)
+
+ # packages entry means new style shrinkwrap file, else use dependencies
+ packages = shrinkwrap.get("packages", None)
+ if packages is not None:
+ for package in packages:
+ if package != "":
+ name = package.split('node_modules/')[-1]
+ package_infos = packages.get(package, {})
+ if dev == False and package_infos.get("dev", False):
+ continue
+ callback(name, package_infos, package)
+ else:
+ _walk_deps(shrinkwrap.get("dependencies", {}), [])
class NpmShrinkWrap(FetchMethod):
"""Class to fetch all package from a shrinkwrap file"""
@@ -75,12 +89,10 @@ class NpmShrinkWrap(FetchMethod):
# Resolve the dependencies
ud.deps = []
- def _resolve_dependency(name, params, deptree):
+ def _resolve_dependency(name, params, destsuffix):
url = None
localpath = None
extrapaths = []
- destsubdirs = [os.path.join("node_modules", dep) for dep in deptree]
- destsuffix = os.path.join(*destsubdirs)
unpack = True
integrity = params.get("integrity", None)
@@ -129,10 +141,28 @@ class NpmShrinkWrap(FetchMethod):
localpath = os.path.join(d.getVar("DL_DIR"), localfile)
+ # Handle local tarball and link sources
+ elif version.startswith("file"):
+ localpath = version[5:]
+ if not version.endswith(".tgz"):
+ unpack = False
+
# Handle git sources
- elif version.startswith("git"):
+ elif version.startswith(("git", "bitbucket","gist")) or (
+ not version.endswith((".tgz", ".tar", ".tar.gz"))
+ and not version.startswith((".", "@", "/"))
+ and "/" in version
+ ):
if version.startswith("github:"):
version = "git+https://github.com/" + version[len("github:"):]
+ elif version.startswith("gist:"):
+ version = "git+https://gist.github.com/" + version[len("gist:"):]
+ elif version.startswith("bitbucket:"):
+ version = "git+https://bitbucket.org/" + version[len("bitbucket:"):]
+ elif version.startswith("gitlab:"):
+ version = "git+https://gitlab.com/" + version[len("gitlab:"):]
+ elif not version.startswith(("git+","git:")):
+ version = "git+https://github.com/" + version
regex = re.compile(r"""
^
git\+
@@ -158,16 +188,12 @@ class NpmShrinkWrap(FetchMethod):
url = str(uri)
- # Handle local tarball and link sources
- elif version.startswith("file"):
- localpath = version[5:]
- if not version.endswith(".tgz"):
- unpack = False
-
else:
raise ParameterError("Unsupported dependency: %s" % name, ud.url)
+ # name is needed by unpack tracer for module mapping
ud.deps.append({
+ "name": name,
"url": url,
"localpath": localpath,
"extrapaths": extrapaths,
@@ -193,19 +219,23 @@ class NpmShrinkWrap(FetchMethod):
# This fetcher resolves multiple URIs from a shrinkwrap file and then
# forwards it to a proxy fetcher. The management of the donestamp file,
# the lockfile and the checksums are forwarded to the proxy fetcher.
- ud.proxy = Fetch([dep["url"] for dep in ud.deps if dep["url"]], data)
+ shrinkwrap_urls = [dep["url"] for dep in ud.deps if dep["url"]]
+ if shrinkwrap_urls:
+ ud.proxy = Fetch(shrinkwrap_urls, data)
ud.needdonestamp = False
@staticmethod
def _foreach_proxy_method(ud, handle):
returns = []
- for proxy_url in ud.proxy.urls:
- proxy_ud = ud.proxy.ud[proxy_url]
- proxy_d = ud.proxy.d
- proxy_ud.setup_localpath(proxy_d)
- lf = lockfile(proxy_ud.lockfile)
- returns.append(handle(proxy_ud.method, proxy_ud, proxy_d))
- unlockfile(lf)
+ #Check if there are dependencies before try to fetch them
+ if len(ud.deps) > 0:
+ for proxy_url in ud.proxy.urls:
+ proxy_ud = ud.proxy.ud[proxy_url]
+ proxy_d = ud.proxy.d
+ proxy_ud.setup_localpath(proxy_d)
+ lf = lockfile(proxy_ud.lockfile)
+ returns.append(handle(proxy_ud.method, proxy_ud, proxy_d))
+ unlockfile(lf)
return returns
def verify_donestamp(self, ud, d):
@@ -238,10 +268,11 @@ class NpmShrinkWrap(FetchMethod):
def unpack(self, ud, rootdir, d):
"""Unpack the downloaded dependencies"""
- destdir = d.getVar("S")
+ destdir = rootdir
destsuffix = ud.parm.get("destsuffix")
if destsuffix:
destdir = os.path.join(rootdir, destsuffix)
+ ud.unpack_tracer.unpack("npm-shrinkwrap", destdir)
bb.utils.mkdirhier(destdir)
bb.utils.copyfile(ud.shrinkwrap_file,
diff --git a/bitbake/lib/bb/fetch2/sftp.py b/bitbake/lib/bb/fetch2/sftp.py
index f87f292e5d..7884cce949 100644
--- a/bitbake/lib/bb/fetch2/sftp.py
+++ b/bitbake/lib/bb/fetch2/sftp.py
@@ -103,7 +103,7 @@ class SFTP(FetchMethod):
if path[:3] == '/~/':
path = path[3:]
- remote = '%s%s:%s' % (user, urlo.hostname, path)
+ remote = '"%s%s:%s"' % (user, urlo.hostname, path)
cmd = '%s %s %s %s' % (basecmd, port, remote, lpath)
diff --git a/bitbake/lib/bb/fetch2/ssh.py b/bitbake/lib/bb/fetch2/ssh.py
index 8d082b38c1..0cbb2a6f25 100644
--- a/bitbake/lib/bb/fetch2/ssh.py
+++ b/bitbake/lib/bb/fetch2/ssh.py
@@ -150,8 +150,6 @@ class SSH(FetchMethod):
)
check_network_access(d, cmd, urldata.url)
+ runfetchcmd(cmd, d)
- if runfetchcmd(cmd, d):
- return True
-
- return False
+ return True
diff --git a/bitbake/lib/bb/fetch2/svn.py b/bitbake/lib/bb/fetch2/svn.py
index d40e4d2909..0852108e7d 100644
--- a/bitbake/lib/bb/fetch2/svn.py
+++ b/bitbake/lib/bb/fetch2/svn.py
@@ -210,3 +210,6 @@ class Svn(FetchMethod):
def _build_revision(self, ud, d):
return ud.revision
+
+ def supports_checksum(self, urldata):
+ return False
diff --git a/bitbake/lib/bb/fetch2/wget.py b/bitbake/lib/bb/fetch2/wget.py
index b2b542e1dc..fbfa6938ac 100644
--- a/bitbake/lib/bb/fetch2/wget.py
+++ b/bitbake/lib/bb/fetch2/wget.py
@@ -26,7 +26,6 @@ from bb.fetch2 import FetchMethod
from bb.fetch2 import FetchError
from bb.fetch2 import logger
from bb.fetch2 import runfetchcmd
-from bb.utils import export_proxies
from bs4 import BeautifulSoup
from bs4 import SoupStrainer
@@ -88,7 +87,10 @@ class Wget(FetchMethod):
if not ud.localfile:
ud.localfile = d.expand(urllib.parse.unquote(ud.host + ud.path).replace("/", "."))
- self.basecmd = d.getVar("FETCHCMD_wget") or "/usr/bin/env wget -t 2 -T 30 --passive-ftp"
+ self.basecmd = d.getVar("FETCHCMD_wget") or "/usr/bin/env wget -t 2 -T 30"
+
+ if ud.type == 'ftp' or ud.type == 'ftps':
+ self.basecmd += " --passive-ftp"
if not self.check_certs(d):
self.basecmd += " --no-check-certificate"
@@ -132,6 +134,11 @@ class Wget(FetchMethod):
self._runwget(ud, d, fetchcmd, False)
+ # Try and verify any checksum now, meaning if it isn't correct, we don't remove the
+ # original file, which might be a race (imagine two recipes referencing the same
+ # source, one with an incorrect checksum)
+ bb.fetch2.verify_checksum(ud, d, localpath=localpath, fatal_nochecksum=False)
+
# Remove the ".tmp" and move the file into position atomically
# Our lock prevents multiple writers but mirroring code may grab incomplete files
os.rename(localpath, localpath[:-4])
@@ -336,7 +343,8 @@ class Wget(FetchMethod):
opener = urllib.request.build_opener(*handlers)
try:
- uri = ud.url.split(";")[0]
+ uri_base = ud.url.split(";")[0]
+ uri = "{}://{}{}".format(urllib.parse.urlparse(uri_base).scheme, ud.host, ud.path)
r = urllib.request.Request(uri)
r.get_method = lambda: "HEAD"
# Some servers (FusionForge, as used on Alioth) require that the
@@ -355,29 +363,22 @@ class Wget(FetchMethod):
try:
import netrc
- n = netrc.netrc()
- login, unused, password = n.authenticators(urllib.parse.urlparse(uri).hostname)
- add_basic_auth("%s:%s" % (login, password), r)
- except (TypeError, ImportError, IOError, netrc.NetrcParseError):
+ auth_data = netrc.netrc().authenticators(urllib.parse.urlparse(uri).hostname)
+ if auth_data:
+ login, _, password = auth_data
+ add_basic_auth("%s:%s" % (login, password), r)
+ except (FileNotFoundError, netrc.NetrcParseError):
pass
with opener.open(r, timeout=30) as response:
pass
- except urllib.error.URLError as e:
- if try_again:
- logger.debug2("checkstatus: trying again")
- return self.checkstatus(fetch, ud, d, False)
- else:
- # debug for now to avoid spamming the logs in e.g. remote sstate searches
- logger.debug2("checkstatus() urlopen failed: %s" % e)
- return False
- except ConnectionResetError as e:
+ except (urllib.error.URLError, ConnectionResetError, TimeoutError) as e:
if try_again:
logger.debug2("checkstatus: trying again")
return self.checkstatus(fetch, ud, d, False)
else:
# debug for now to avoid spamming the logs in e.g. remote sstate searches
- logger.debug2("checkstatus() urlopen failed: %s" % e)
+ logger.debug2("checkstatus() urlopen failed for %s: %s" % (uri,e))
return False
return True
@@ -639,10 +640,10 @@ class Wget(FetchMethod):
# search for version matches on folders inside the path, like:
# "5.7" in http://download.gnome.org/sources/${PN}/5.7/${PN}-${PV}.tar.gz
dirver_regex = re.compile(r"(?P<dirver>[^/]*(\d+\.)*\d+([-_]r\d+)*)/")
- m = dirver_regex.search(path)
+ m = dirver_regex.findall(path)
if m:
pn = d.getVar('PN')
- dirver = m.group('dirver')
+ dirver = m[-1][0]
dirver_pn_regex = re.compile(r"%s\d?" % (re.escape(pn)))
if not dirver_pn_regex.search(dirver):
diff --git a/bitbake/lib/bb/main.py b/bitbake/lib/bb/main.py
index 93eda3632e..bca8ebfa09 100755
--- a/bitbake/lib/bb/main.py
+++ b/bitbake/lib/bb/main.py
@@ -12,11 +12,12 @@
import os
import sys
import logging
-import optparse
+import argparse
import warnings
import fcntl
import time
import traceback
+import datetime
import bb
from bb import event
@@ -43,18 +44,18 @@ def present_options(optionlist):
else:
return optionlist[0]
-class BitbakeHelpFormatter(optparse.IndentedHelpFormatter):
- def format_option(self, option):
+class BitbakeHelpFormatter(argparse.HelpFormatter):
+ def _get_help_string(self, action):
# We need to do this here rather than in the text we supply to
# add_option() because we don't want to call list_extension_modules()
# on every execution (since it imports all of the modules)
# Note also that we modify option.help rather than the returned text
# - this is so that we don't have to re-format the text ourselves
- if option.dest == 'ui':
+ if action.dest == 'ui':
valid_uis = list_extension_modules(bb.ui, 'main')
- option.help = option.help.replace('@CHOICES@', present_options(valid_uis))
+ return action.help.replace('@CHOICES@', present_options(valid_uis))
- return optparse.IndentedHelpFormatter.format_option(self, option)
+ return action.help
def list_extension_modules(pkg, checkattr):
"""
@@ -114,180 +115,207 @@ def _showwarning(message, category, filename, lineno, file=None, line=None):
warnings.showwarning = _showwarning
def create_bitbake_parser():
- parser = optparse.OptionParser(
- formatter=BitbakeHelpFormatter(),
- version="BitBake Build Tool Core version %s" % bb.__version__,
- usage="""%prog [options] [recipename/target recipe:do_task ...]
-
- Executes the specified task (default is 'build') for a given set of target recipes (.bb files).
- It is assumed there is a conf/bblayers.conf available in cwd or in BBPATH which
- will provide the layer, BBFILES and other configuration information.""")
-
- parser.add_option("-b", "--buildfile", action="store", dest="buildfile", default=None,
- help="Execute tasks from a specific .bb recipe directly. WARNING: Does "
- "not handle any dependencies from other recipes.")
-
- parser.add_option("-k", "--continue", action="store_false", dest="halt", default=True,
- help="Continue as much as possible after an error. While the target that "
- "failed and anything depending on it cannot be built, as much as "
- "possible will be built before stopping.")
-
- parser.add_option("-f", "--force", action="store_true", dest="force", default=False,
- help="Force the specified targets/task to run (invalidating any "
- "existing stamp file).")
-
- parser.add_option("-c", "--cmd", action="store", dest="cmd",
- help="Specify the task to execute. The exact options available "
- "depend on the metadata. Some examples might be 'compile'"
- " or 'populate_sysroot' or 'listtasks' may give a list of "
- "the tasks available.")
-
- parser.add_option("-C", "--clear-stamp", action="store", dest="invalidate_stamp",
- help="Invalidate the stamp for the specified task such as 'compile' "
- "and then run the default task for the specified target(s).")
-
- parser.add_option("-r", "--read", action="append", dest="prefile", default=[],
- help="Read the specified file before bitbake.conf.")
-
- parser.add_option("-R", "--postread", action="append", dest="postfile", default=[],
- help="Read the specified file after bitbake.conf.")
-
- parser.add_option("-v", "--verbose", action="store_true", dest="verbose", default=False,
- help="Enable tracing of shell tasks (with 'set -x'). "
- "Also print bb.note(...) messages to stdout (in "
- "addition to writing them to ${T}/log.do_<task>).")
-
- parser.add_option("-D", "--debug", action="count", dest="debug", default=0,
- help="Increase the debug level. You can specify this "
- "more than once. -D sets the debug level to 1, "
- "where only bb.debug(1, ...) messages are printed "
- "to stdout; -DD sets the debug level to 2, where "
- "both bb.debug(1, ...) and bb.debug(2, ...) "
- "messages are printed; etc. Without -D, no debug "
- "messages are printed. Note that -D only affects "
- "output to stdout. All debug messages are written "
- "to ${T}/log.do_taskname, regardless of the debug "
- "level.")
-
- parser.add_option("-q", "--quiet", action="count", dest="quiet", default=0,
- help="Output less log message data to the terminal. You can specify this more than once.")
-
- parser.add_option("-n", "--dry-run", action="store_true", dest="dry_run", default=False,
- help="Don't execute, just go through the motions.")
-
- parser.add_option("-S", "--dump-signatures", action="append", dest="dump_signatures",
- default=[], metavar="SIGNATURE_HANDLER",
- help="Dump out the signature construction information, with no task "
- "execution. The SIGNATURE_HANDLER parameter is passed to the "
- "handler. Two common values are none and printdiff but the handler "
- "may define more/less. none means only dump the signature, printdiff"
- " means compare the dumped signature with the cached one.")
-
- parser.add_option("-p", "--parse-only", action="store_true",
- dest="parse_only", default=False,
- help="Quit after parsing the BB recipes.")
-
- parser.add_option("-s", "--show-versions", action="store_true",
- dest="show_versions", default=False,
- help="Show current and preferred versions of all recipes.")
-
- parser.add_option("-e", "--environment", action="store_true",
- dest="show_environment", default=False,
- help="Show the global or per-recipe environment complete with information"
- " about where variables were set/changed.")
-
- parser.add_option("-g", "--graphviz", action="store_true", dest="dot_graph", default=False,
- help="Save dependency tree information for the specified "
- "targets in the dot syntax.")
-
- parser.add_option("-I", "--ignore-deps", action="append",
- dest="extra_assume_provided", default=[],
- help="Assume these dependencies don't exist and are already provided "
- "(equivalent to ASSUME_PROVIDED). Useful to make dependency "
- "graphs more appealing")
-
- parser.add_option("-l", "--log-domains", action="append", dest="debug_domains", default=[],
- help="Show debug logging for the specified logging domains")
-
- parser.add_option("-P", "--profile", action="store_true", dest="profile", default=False,
- help="Profile the command and save reports.")
+ parser = argparse.ArgumentParser(
+ description="""\
+ It is assumed there is a conf/bblayers.conf available in cwd or in BBPATH which
+ will provide the layer, BBFILES and other configuration information.
+ """,
+ formatter_class=BitbakeHelpFormatter,
+ allow_abbrev=False,
+ add_help=False, # help is manually added below in a specific argument group
+ )
+
+ general_group = parser.add_argument_group('General options')
+ task_group = parser.add_argument_group('Task control options')
+ exec_group = parser.add_argument_group('Execution control options')
+ logging_group = parser.add_argument_group('Logging/output control options')
+ server_group = parser.add_argument_group('Server options')
+ config_group = parser.add_argument_group('Configuration options')
+
+ general_group.add_argument("targets", nargs="*", metavar="recipename/target",
+ help="Execute the specified task (default is 'build') for these target "
+ "recipes (.bb files).")
+
+ general_group.add_argument("-s", "--show-versions", action="store_true",
+ help="Show current and preferred versions of all recipes.")
+
+ general_group.add_argument("-e", "--environment", action="store_true",
+ dest="show_environment",
+ help="Show the global or per-recipe environment complete with information"
+ " about where variables were set/changed.")
+
+ general_group.add_argument("-g", "--graphviz", action="store_true", dest="dot_graph",
+ help="Save dependency tree information for the specified "
+ "targets in the dot syntax.")
# @CHOICES@ is substituted out by BitbakeHelpFormatter above
- parser.add_option("-u", "--ui", action="store", dest="ui",
- default=os.environ.get('BITBAKE_UI', 'knotty'),
- help="The user interface to use (@CHOICES@ - default %default).")
-
- parser.add_option("", "--token", action="store", dest="xmlrpctoken",
- default=os.environ.get("BBTOKEN"),
- help="Specify the connection token to be used when connecting "
- "to a remote server.")
-
- parser.add_option("", "--revisions-changed", action="store_true",
- dest="revisions_changed", default=False,
- help="Set the exit code depending on whether upstream floating "
- "revisions have changed or not.")
-
- parser.add_option("", "--server-only", action="store_true",
- dest="server_only", default=False,
- help="Run bitbake without a UI, only starting a server "
- "(cooker) process.")
-
- parser.add_option("-B", "--bind", action="store", dest="bind", default=False,
- help="The name/address for the bitbake xmlrpc server to bind to.")
-
- parser.add_option("-T", "--idle-timeout", type=float, dest="server_timeout",
- default=os.getenv("BB_SERVER_TIMEOUT"),
- help="Set timeout to unload bitbake server due to inactivity, "
- "set to -1 means no unload, "
- "default: Environment variable BB_SERVER_TIMEOUT.")
-
- parser.add_option("", "--no-setscene", action="store_true",
- dest="nosetscene", default=False,
- help="Do not run any setscene tasks. sstate will be ignored and "
- "everything needed, built.")
-
- parser.add_option("", "--skip-setscene", action="store_true",
- dest="skipsetscene", default=False,
- help="Skip setscene tasks if they would be executed. Tasks previously "
- "restored from sstate will be kept, unlike --no-setscene")
-
- parser.add_option("", "--setscene-only", action="store_true",
- dest="setsceneonly", default=False,
- help="Only run setscene tasks, don't run any real tasks.")
-
- parser.add_option("", "--remote-server", action="store", dest="remote_server",
- default=os.environ.get("BBSERVER"),
- help="Connect to the specified server.")
-
- parser.add_option("-m", "--kill-server", action="store_true",
- dest="kill_server", default=False,
- help="Terminate any running bitbake server.")
-
- parser.add_option("", "--observe-only", action="store_true",
- dest="observe_only", default=False,
- help="Connect to a server as an observing-only client.")
-
- parser.add_option("", "--status-only", action="store_true",
- dest="status_only", default=False,
- help="Check the status of the remote bitbake server.")
-
- parser.add_option("-w", "--write-log", action="store", dest="writeeventlog",
- default=os.environ.get("BBEVENTLOG"),
- help="Writes the event log of the build to a bitbake event json file. "
- "Use '' (empty string) to assign the name automatically.")
-
- parser.add_option("", "--runall", action="append", dest="runall",
- help="Run the specified task for any recipe in the taskgraph of the specified target (even if it wouldn't otherwise have run).")
-
- parser.add_option("", "--runonly", action="append", dest="runonly",
- help="Run only the specified task within the taskgraph of the specified targets (and any task dependencies those tasks may have).")
+ general_group.add_argument("-u", "--ui",
+ default=os.environ.get('BITBAKE_UI', 'knotty'),
+ help="The user interface to use (@CHOICES@ - default %(default)s).")
+
+ general_group.add_argument("--version", action="store_true",
+ help="Show programs version and exit.")
+
+ general_group.add_argument('-h', '--help', action='help',
+ help='Show this help message and exit.')
+
+
+ task_group.add_argument("-f", "--force", action="store_true",
+ help="Force the specified targets/task to run (invalidating any "
+ "existing stamp file).")
+
+ task_group.add_argument("-c", "--cmd",
+ help="Specify the task to execute. The exact options available "
+ "depend on the metadata. Some examples might be 'compile'"
+ " or 'populate_sysroot' or 'listtasks' may give a list of "
+ "the tasks available.")
+
+ task_group.add_argument("-C", "--clear-stamp", dest="invalidate_stamp",
+ help="Invalidate the stamp for the specified task such as 'compile' "
+ "and then run the default task for the specified target(s).")
+
+ task_group.add_argument("--runall", action="append", default=[],
+ help="Run the specified task for any recipe in the taskgraph of the "
+ "specified target (even if it wouldn't otherwise have run).")
+
+ task_group.add_argument("--runonly", action="append",
+ help="Run only the specified task within the taskgraph of the "
+ "specified targets (and any task dependencies those tasks may have).")
+
+ task_group.add_argument("--no-setscene", action="store_true",
+ dest="nosetscene",
+ help="Do not run any setscene tasks. sstate will be ignored and "
+ "everything needed, built.")
+
+ task_group.add_argument("--skip-setscene", action="store_true",
+ dest="skipsetscene",
+ help="Skip setscene tasks if they would be executed. Tasks previously "
+ "restored from sstate will be kept, unlike --no-setscene.")
+
+ task_group.add_argument("--setscene-only", action="store_true",
+ dest="setsceneonly",
+ help="Only run setscene tasks, don't run any real tasks.")
+
+
+ exec_group.add_argument("-n", "--dry-run", action="store_true",
+ help="Don't execute, just go through the motions.")
+
+ exec_group.add_argument("-p", "--parse-only", action="store_true",
+ help="Quit after parsing the BB recipes.")
+
+ exec_group.add_argument("-k", "--continue", action="store_false", dest="halt",
+ help="Continue as much as possible after an error. While the target that "
+ "failed and anything depending on it cannot be built, as much as "
+ "possible will be built before stopping.")
+
+ exec_group.add_argument("-P", "--profile", action="store_true",
+ help="Profile the command and save reports.")
+
+ exec_group.add_argument("-S", "--dump-signatures", action="append",
+ default=[], metavar="SIGNATURE_HANDLER",
+ help="Dump out the signature construction information, with no task "
+ "execution. The SIGNATURE_HANDLER parameter is passed to the "
+ "handler. Two common values are none and printdiff but the handler "
+ "may define more/less. none means only dump the signature, printdiff"
+ " means recursively compare the dumped signature with the most recent"
+ " one in a local build or sstate cache (can be used to find out why tasks re-run"
+ " when that is not expected)")
+
+ exec_group.add_argument("--revisions-changed", action="store_true",
+ help="Set the exit code depending on whether upstream floating "
+ "revisions have changed or not.")
+
+ exec_group.add_argument("-b", "--buildfile",
+ help="Execute tasks from a specific .bb recipe directly. WARNING: Does "
+ "not handle any dependencies from other recipes.")
+
+ logging_group.add_argument("-D", "--debug", action="count", default=0,
+ help="Increase the debug level. You can specify this "
+ "more than once. -D sets the debug level to 1, "
+ "where only bb.debug(1, ...) messages are printed "
+ "to stdout; -DD sets the debug level to 2, where "
+ "both bb.debug(1, ...) and bb.debug(2, ...) "
+ "messages are printed; etc. Without -D, no debug "
+ "messages are printed. Note that -D only affects "
+ "output to stdout. All debug messages are written "
+ "to ${T}/log.do_taskname, regardless of the debug "
+ "level.")
+
+ logging_group.add_argument("-l", "--log-domains", action="append", dest="debug_domains",
+ default=[],
+ help="Show debug logging for the specified logging domains.")
+
+ logging_group.add_argument("-v", "--verbose", action="store_true",
+ help="Enable tracing of shell tasks (with 'set -x'). "
+ "Also print bb.note(...) messages to stdout (in "
+ "addition to writing them to ${T}/log.do_<task>).")
+
+ logging_group.add_argument("-q", "--quiet", action="count", default=0,
+ help="Output less log message data to the terminal. You can specify this "
+ "more than once.")
+
+ logging_group.add_argument("-w", "--write-log", dest="writeeventlog",
+ default=os.environ.get("BBEVENTLOG"),
+ help="Writes the event log of the build to a bitbake event json file. "
+ "Use '' (empty string) to assign the name automatically.")
+
+
+ server_group.add_argument("-B", "--bind", default=False,
+ help="The name/address for the bitbake xmlrpc server to bind to.")
+
+ server_group.add_argument("-T", "--idle-timeout", type=float, dest="server_timeout",
+ default=os.getenv("BB_SERVER_TIMEOUT"),
+ help="Set timeout to unload bitbake server due to inactivity, "
+ "set to -1 means no unload, "
+ "default: Environment variable BB_SERVER_TIMEOUT.")
+
+ server_group.add_argument("--remote-server",
+ default=os.environ.get("BBSERVER"),
+ help="Connect to the specified server.")
+
+ server_group.add_argument("-m", "--kill-server", action="store_true",
+ help="Terminate any running bitbake server.")
+
+ server_group.add_argument("--token", dest="xmlrpctoken",
+ default=os.environ.get("BBTOKEN"),
+ help="Specify the connection token to be used when connecting "
+ "to a remote server.")
+
+ server_group.add_argument("--observe-only", action="store_true",
+ help="Connect to a server as an observing-only client.")
+
+ server_group.add_argument("--status-only", action="store_true",
+ help="Check the status of the remote bitbake server.")
+
+ server_group.add_argument("--server-only", action="store_true",
+ help="Run bitbake without a UI, only starting a server "
+ "(cooker) process.")
+
+
+ config_group.add_argument("-r", "--read", action="append", dest="prefile", default=[],
+ help="Read the specified file before bitbake.conf.")
+
+ config_group.add_argument("-R", "--postread", action="append", dest="postfile", default=[],
+ help="Read the specified file after bitbake.conf.")
+
+
+ config_group.add_argument("-I", "--ignore-deps", action="append",
+ dest="extra_assume_provided", default=[],
+ help="Assume these dependencies don't exist and are already provided "
+ "(equivalent to ASSUME_PROVIDED). Useful to make dependency "
+ "graphs more appealing.")
+
return parser
class BitBakeConfigParameters(cookerdata.ConfigParameters):
def parseCommandLine(self, argv=sys.argv):
parser = create_bitbake_parser()
- options, targets = parser.parse_args(argv)
+ options = parser.parse_intermixed_args(argv[1:])
+
+ if options.version:
+ print("BitBake Build Tool Core version %s" % bb.__version__)
+ sys.exit(0)
if options.quiet and options.verbose:
parser.error("options --quiet and --verbose are mutually exclusive")
@@ -319,7 +347,7 @@ class BitBakeConfigParameters(cookerdata.ConfigParameters):
else:
options.xmlrpcinterface = (None, 0)
- return options, targets[1:]
+ return options, options.targets
def bitbake_main(configParams, configuration):
@@ -384,6 +412,9 @@ def bitbake_main(configParams, configuration):
return 1
+def timestamp():
+ return datetime.datetime.now().strftime('%H:%M:%S.%f')
+
def setup_bitbake(configParams, extrafeatures=None):
# Ensure logging messages get sent to the UI as events
handler = bb.event.LogHandler()
@@ -391,6 +422,11 @@ def setup_bitbake(configParams, extrafeatures=None):
# In status only mode there are no logs and no UI
logger.addHandler(handler)
+ if configParams.dump_signatures:
+ if extrafeatures is None:
+ extrafeatures = []
+ extrafeatures.append(bb.cooker.CookerFeatures.RECIPE_SIGGEN_INFO)
+
if configParams.server_only:
featureset = []
ui_module = None
@@ -418,7 +454,7 @@ def setup_bitbake(configParams, extrafeatures=None):
retries = 8
while retries:
try:
- topdir, lock = lockBitbake()
+ topdir, lock, lockfile = lockBitbake()
sockname = topdir + "/bitbake.sock"
if lock:
if configParams.status_only or configParams.kill_server:
@@ -429,18 +465,22 @@ def setup_bitbake(configParams, extrafeatures=None):
logger.info("Starting bitbake server...")
# Clear the event queue since we already displayed messages
bb.event.ui_queue = []
- server = bb.server.process.BitBakeServer(lock, sockname, featureset, configParams.server_timeout, configParams.xmlrpcinterface)
+ server = bb.server.process.BitBakeServer(lock, sockname, featureset, configParams.server_timeout, configParams.xmlrpcinterface, configParams.profile)
else:
logger.info("Reconnecting to bitbake server...")
if not os.path.exists(sockname):
- logger.info("Previous bitbake instance shutting down?, waiting to retry...")
+ logger.info("Previous bitbake instance shutting down?, waiting to retry... (%s)" % timestamp())
+ procs = bb.server.process.get_lockfile_process_msg(lockfile)
+ if procs:
+ logger.info("Processes holding bitbake.lock (missing socket %s):\n%s" % (sockname, procs))
+ logger.info("Directory listing: %s" % (str(os.listdir(topdir))))
i = 0
lock = None
# Wait for 5s or until we can get the lock
while not lock and i < 50:
time.sleep(0.1)
- _, lock = lockBitbake()
+ _, lock, _ = lockBitbake()
i += 1
if lock:
bb.utils.unlockfile(lock)
@@ -459,9 +499,9 @@ def setup_bitbake(configParams, extrafeatures=None):
retries -= 1
tryno = 8 - retries
if isinstance(e, (bb.server.process.ProcessTimeout, BrokenPipeError, EOFError, SystemExit)):
- logger.info("Retrying server connection (#%d)..." % tryno)
+ logger.info("Retrying server connection (#%d)... (%s)" % (tryno, timestamp()))
else:
- logger.info("Retrying server connection (#%d)... (%s)" % (tryno, traceback.format_exc()))
+ logger.info("Retrying server connection (#%d)... (%s, %s)" % (tryno, traceback.format_exc(), timestamp()))
if not retries:
bb.fatal("Unable to connect to bitbake server, or start one (server startup failures would be in bitbake-cookerdaemon.log).")
@@ -490,5 +530,5 @@ def lockBitbake():
bb.error("Unable to find conf/bblayers.conf or conf/bitbake.conf. BBPATH is unset and/or not in a build directory?")
raise BBMainFatal
lockfile = topdir + "/bitbake.lock"
- return topdir, bb.utils.lockfile(lockfile, False, False)
+ return topdir, bb.utils.lockfile(lockfile, False, False), lockfile
diff --git a/bitbake/lib/bb/monitordisk.py b/bitbake/lib/bb/monitordisk.py
index a1b910007d..f928210351 100644
--- a/bitbake/lib/bb/monitordisk.py
+++ b/bitbake/lib/bb/monitordisk.py
@@ -234,9 +234,10 @@ class diskMonitor:
freeInode = st.f_favail
if minInode and freeInode < minInode:
- # Some filesystems use dynamic inodes so can't run out
- # (e.g. btrfs). This is reported by the inode count being 0.
- if st.f_files == 0:
+ # Some filesystems use dynamic inodes so can't run out.
+ # This is reported by the inode count being 0 (btrfs) or the free
+ # inode count being -1 (cephfs).
+ if st.f_files == 0 or st.f_favail == -1:
self.devDict[k][2] = None
continue
# Always show warning, the self.checked would always be False if the action is WARN
diff --git a/bitbake/lib/bb/msg.py b/bitbake/lib/bb/msg.py
index 93575d89c4..3e18596faa 100644
--- a/bitbake/lib/bb/msg.py
+++ b/bitbake/lib/bb/msg.py
@@ -230,7 +230,7 @@ def logger_create(name, output=sys.stderr, level=logging.INFO, preserve_handlers
console = logging.StreamHandler(output)
console.addFilter(bb.msg.LogFilterShowOnce())
format = bb.msg.BBLogFormatter("%(levelname)s: %(message)s")
- if color == 'always' or (color == 'auto' and output.isatty()):
+ if color == 'always' or (color == 'auto' and output.isatty() and os.environ.get('NO_COLOR', '') == ''):
format.enable_color()
console.setFormatter(format)
if preserve_handlers:
diff --git a/bitbake/lib/bb/parse/__init__.py b/bitbake/lib/bb/parse/__init__.py
index 347609513b..7ffdaa6fd7 100644
--- a/bitbake/lib/bb/parse/__init__.py
+++ b/bitbake/lib/bb/parse/__init__.py
@@ -49,20 +49,32 @@ class SkipPackage(SkipRecipe):
__mtime_cache = {}
def cached_mtime(f):
if f not in __mtime_cache:
- __mtime_cache[f] = os.stat(f)[stat.ST_MTIME]
+ res = os.stat(f)
+ __mtime_cache[f] = (res.st_mtime_ns, res.st_size, res.st_ino)
return __mtime_cache[f]
def cached_mtime_noerror(f):
if f not in __mtime_cache:
try:
- __mtime_cache[f] = os.stat(f)[stat.ST_MTIME]
+ res = os.stat(f)
+ __mtime_cache[f] = (res.st_mtime_ns, res.st_size, res.st_ino)
except OSError:
return 0
return __mtime_cache[f]
+def check_mtime(f, mtime):
+ try:
+ res = os.stat(f)
+ current_mtime = (res.st_mtime_ns, res.st_size, res.st_ino)
+ __mtime_cache[f] = current_mtime
+ except OSError:
+ current_mtime = 0
+ return current_mtime == mtime
+
def update_mtime(f):
try:
- __mtime_cache[f] = os.stat(f)[stat.ST_MTIME]
+ res = os.stat(f)
+ __mtime_cache[f] = (res.st_mtime_ns, res.st_size, res.st_ino)
except OSError:
if f in __mtime_cache:
del __mtime_cache[f]
@@ -99,12 +111,12 @@ def supports(fn, data):
return 1
return 0
-def handle(fn, data, include = 0):
+def handle(fn, data, include=0, baseconfig=False):
"""Call the handler that is appropriate for this file"""
for h in handlers:
if h['supports'](fn, data):
with data.inchistory.include(fn):
- return h['handle'](fn, data, include)
+ return h['handle'](fn, data, include, baseconfig)
raise ParseError("not a BitBake file", fn)
def init(fn, data):
diff --git a/bitbake/lib/bb/parse/ast.py b/bitbake/lib/bb/parse/ast.py
index 9e0a0f5c98..7581d003fd 100644
--- a/bitbake/lib/bb/parse/ast.py
+++ b/bitbake/lib/bb/parse/ast.py
@@ -9,6 +9,7 @@
# SPDX-License-Identifier: GPL-2.0-only
#
+import sys
import bb
from bb import methodpool
from bb.parse import logger
@@ -210,10 +211,12 @@ class ExportFuncsNode(AstNode):
def eval(self, data):
+ sentinel = " # Export function set\n"
for func in self.n:
calledfunc = self.classname + "_" + func
- if data.getVar(func, False) and not data.getVarFlag(func, 'export_func', False):
+ basevar = data.getVar(func, False)
+ if basevar and sentinel not in basevar:
continue
if data.getVar(func, False):
@@ -230,12 +233,11 @@ class ExportFuncsNode(AstNode):
data.setVarFlag(func, "lineno", 1)
if data.getVarFlag(calledfunc, "python", False):
- data.setVar(func, " bb.build.exec_func('" + calledfunc + "', d)\n", parsing=True)
+ data.setVar(func, sentinel + " bb.build.exec_func('" + calledfunc + "', d)\n", parsing=True)
else:
if "-" in self.classname:
bb.fatal("The classname %s contains a dash character and is calling an sh function %s using EXPORT_FUNCTIONS. Since a dash is illegal in sh function names, this cannot work, please rename the class or don't use EXPORT_FUNCTIONS." % (self.classname, calledfunc))
- data.setVar(func, " " + calledfunc + "\n", parsing=True)
- data.setVarFlag(func, 'export_func', '1')
+ data.setVar(func, sentinel + " " + calledfunc + "\n", parsing=True)
class AddTaskNode(AstNode):
def __init__(self, filename, lineno, func, before, after):
@@ -269,6 +271,41 @@ class BBHandlerNode(AstNode):
data.setVarFlag(h, "handler", 1)
data.setVar('__BBHANDLERS', bbhands)
+class PyLibNode(AstNode):
+ def __init__(self, filename, lineno, libdir, namespace):
+ AstNode.__init__(self, filename, lineno)
+ self.libdir = libdir
+ self.namespace = namespace
+
+ def eval(self, data):
+ global_mods = (data.getVar("BB_GLOBAL_PYMODULES") or "").split()
+ for m in global_mods:
+ if m not in bb.utils._context:
+ bb.utils._context[m] = __import__(m)
+
+ libdir = data.expand(self.libdir)
+ if libdir not in sys.path:
+ sys.path.append(libdir)
+ try:
+ bb.utils._context[self.namespace] = __import__(self.namespace)
+ toimport = getattr(bb.utils._context[self.namespace], "BBIMPORTS", [])
+ for i in toimport:
+ bb.utils._context[self.namespace] = __import__(self.namespace + "." + i)
+ mod = getattr(bb.utils._context[self.namespace], i)
+ fn = getattr(mod, "__file__")
+ funcs = {}
+ for f in dir(mod):
+ if f.startswith("_"):
+ continue
+ fcall = getattr(mod, f)
+ if not callable(fcall):
+ continue
+ funcs[f] = fcall
+ bb.codeparser.add_module_functions(fn, funcs, "%s.%s" % (self.namespace, i))
+
+ except AttributeError as e:
+ bb.error("Error importing OE modules: %s" % str(e))
+
class InheritNode(AstNode):
def __init__(self, filename, lineno, classes):
AstNode.__init__(self, filename, lineno)
@@ -277,6 +314,16 @@ class InheritNode(AstNode):
def eval(self, data):
bb.parse.BBHandler.inherit(self.classes, self.filename, self.lineno, data)
+class InheritDeferredNode(AstNode):
+ def __init__(self, filename, lineno, classes):
+ AstNode.__init__(self, filename, lineno)
+ self.inherit = (classes, filename, lineno)
+
+ def eval(self, data):
+ inherits = data.getVar('__BBDEFINHERITS', False) or []
+ inherits.append(self.inherit)
+ data.setVar('__BBDEFINHERITS', inherits)
+
def handleInclude(statements, filename, lineno, m, force):
statements.append(IncludeNode(filename, lineno, m.group(1), force))
@@ -320,10 +367,17 @@ def handleDelTask(statements, filename, lineno, m):
def handleBBHandlers(statements, filename, lineno, m):
statements.append(BBHandlerNode(filename, lineno, m.group(1)))
+def handlePyLib(statements, filename, lineno, m):
+ statements.append(PyLibNode(filename, lineno, m.group(1), m.group(2)))
+
def handleInherit(statements, filename, lineno, m):
classes = m.group(1)
statements.append(InheritNode(filename, lineno, classes))
+def handleInheritDeferred(statements, filename, lineno, m):
+ classes = m.group(1)
+ statements.append(InheritDeferredNode(filename, lineno, classes))
+
def runAnonFuncs(d):
code = []
for funcname in d.getVar("__BBANONFUNCS", False) or []:
@@ -361,6 +415,9 @@ def finalize(fn, d, variant = None):
d.setVar('BBINCLUDED', bb.parse.get_file_depends(d))
+ if d.getVar('__BBAUTOREV_SEEN') and d.getVar('__BBSRCREV_SEEN') and not d.getVar("__BBAUTOREV_ACTED_UPON"):
+ bb.fatal("AUTOREV/SRCPV set too late for the fetcher to work properly, please set the variables earlier in parsing. Erroring instead of later obtuse build failures.")
+
bb.event.fire(bb.event.RecipeParsed(fn), d)
finally:
bb.event.set_handlers(saved_handlers)
@@ -387,6 +444,14 @@ def multi_finalize(fn, d):
logger.debug("Appending .bbappend file %s to %s", append, fn)
bb.parse.BBHandler.handle(append, d, True)
+ while True:
+ inherits = d.getVar('__BBDEFINHERITS', False) or []
+ if not inherits:
+ break
+ inherit, filename, lineno = inherits.pop(0)
+ d.setVar('__BBDEFINHERITS', inherits)
+ bb.parse.BBHandler.inherit(inherit, filename, lineno, d, deferred=True)
+
onlyfinalise = d.getVar("__ONLYFINALISE", False)
safe_d = d
diff --git a/bitbake/lib/bb/parse/parse_py/BBHandler.py b/bitbake/lib/bb/parse/parse_py/BBHandler.py
index 18e6868387..c13e4b9755 100644
--- a/bitbake/lib/bb/parse/parse_py/BBHandler.py
+++ b/bitbake/lib/bb/parse/parse_py/BBHandler.py
@@ -21,6 +21,7 @@ from .ConfHandler import include, init
__func_start_regexp__ = re.compile(r"(((?P<py>python(?=(\s|\()))|(?P<fr>fakeroot(?=\s)))\s*)*(?P<func>[\w\.\-\+\{\}\$:]+)?\s*\(\s*\)\s*{$" )
__inherit_regexp__ = re.compile(r"inherit\s+(.+)" )
+__inherit_def_regexp__ = re.compile(r"inherit_defer\s+(.+)" )
__export_func_regexp__ = re.compile(r"EXPORT_FUNCTIONS\s+(.+)" )
__addtask_regexp__ = re.compile(r"addtask\s+(?P<func>\w+)\s*((before\s*(?P<before>((.*(?=after))|(.*))))|(after\s*(?P<after>((.*(?=before))|(.*)))))*")
__deltask_regexp__ = re.compile(r"deltask\s+(.+)")
@@ -33,6 +34,7 @@ __infunc__ = []
__inpython__ = False
__body__ = []
__classname__ = ""
+__residue__ = []
cached_statements = {}
@@ -40,8 +42,10 @@ def supports(fn, d):
"""Return True if fn has a supported extension"""
return os.path.splitext(fn)[-1] in [".bb", ".bbclass", ".inc"]
-def inherit(files, fn, lineno, d):
+def inherit(files, fn, lineno, d, deferred=False):
__inherit_cache = d.getVar('__inherit_cache', False) or []
+ #if "${" in files and not deferred:
+ # bb.warn("%s:%s has non deferred conditional inherit" % (fn, lineno))
files = d.expand(files).split()
for file in files:
classtype = d.getVar("__bbclasstype", False)
@@ -77,7 +81,7 @@ def inherit(files, fn, lineno, d):
__inherit_cache = d.getVar('__inherit_cache', False) or []
def get_statements(filename, absolute_filename, base_name):
- global cached_statements
+ global cached_statements, __residue__, __body__
try:
return cached_statements[absolute_filename]
@@ -97,12 +101,17 @@ def get_statements(filename, absolute_filename, base_name):
# add a blank line to close out any python definition
feeder(lineno, "", filename, base_name, statements, eof=True)
+ if __residue__:
+ raise ParseError("Unparsed lines %s: %s" % (filename, str(__residue__)), filename, lineno)
+ if __body__:
+ raise ParseError("Unparsed lines from unclosed function %s: %s" % (filename, str(__body__)), filename, lineno)
+
if filename.endswith(".bbclass") or filename.endswith(".inc"):
cached_statements[absolute_filename] = statements
return statements
-def handle(fn, d, include):
- global __func_start_regexp__, __inherit_regexp__, __export_func_regexp__, __addtask_regexp__, __addhandler_regexp__, __infunc__, __body__, __residue__, __classname__
+def handle(fn, d, include, baseconfig=False):
+ global __infunc__, __body__, __residue__, __classname__
__body__ = []
__infunc__ = []
__classname__ = ""
@@ -154,7 +163,7 @@ def handle(fn, d, include):
return d
def feeder(lineno, s, fn, root, statements, eof=False):
- global __func_start_regexp__, __inherit_regexp__, __export_func_regexp__, __addtask_regexp__, __addhandler_regexp__, __def_regexp__, __python_func_regexp__, __inpython__, __infunc__, __body__, bb, __residue__, __classname__
+ global __inpython__, __infunc__, __body__, __residue__, __classname__
# Check tabs in python functions:
# - def py_funcname(): covered by __inpython__
@@ -265,7 +274,12 @@ def feeder(lineno, s, fn, root, statements, eof=False):
ast.handleInherit(statements, fn, lineno, m)
return
- return ConfHandler.feeder(lineno, s, fn, statements)
+ m = __inherit_def_regexp__.match(s)
+ if m:
+ ast.handleInheritDeferred(statements, fn, lineno, m)
+ return
+
+ return ConfHandler.feeder(lineno, s, fn, statements, conffile=False)
# Add us to the handlers list
from .. import handlers
diff --git a/bitbake/lib/bb/parse/parse_py/ConfHandler.py b/bitbake/lib/bb/parse/parse_py/ConfHandler.py
index 451e68dd66..7826dee7d3 100644
--- a/bitbake/lib/bb/parse/parse_py/ConfHandler.py
+++ b/bitbake/lib/bb/parse/parse_py/ConfHandler.py
@@ -21,7 +21,7 @@ __config_regexp__ = re.compile( r"""
^
(?P<exp>export\s+)?
(?P<var>[a-zA-Z0-9\-_+.${}/~:]+?)
- (\[(?P<flag>[a-zA-Z0-9\-_+.]+)\])?
+ (\[(?P<flag>[a-zA-Z0-9\-_+.][a-zA-Z0-9\-_+.@]*)\])?
\s* (
(?P<colon>:=) |
@@ -45,7 +45,8 @@ __include_regexp__ = re.compile( r"include\s+(.+)" )
__require_regexp__ = re.compile( r"require\s+(.+)" )
__export_regexp__ = re.compile( r"export\s+([a-zA-Z0-9\-_+.${}/~]+)$" )
__unset_regexp__ = re.compile( r"unset\s+([a-zA-Z0-9\-_+.${}/~]+)$" )
-__unset_flag_regexp__ = re.compile( r"unset\s+([a-zA-Z0-9\-_+.${}/~]+)\[([a-zA-Z0-9\-_+.]+)\]$" )
+__unset_flag_regexp__ = re.compile( r"unset\s+([a-zA-Z0-9\-_+.${}/~]+)\[([a-zA-Z0-9\-_+.][a-zA-Z0-9\-_+.@]+)\]$" )
+__addpylib_regexp__ = re.compile(r"addpylib\s+(.+)\s+(.+)" )
def init(data):
return
@@ -102,12 +103,12 @@ def include_single_file(parentfn, fn, lineno, data, error_out):
# We have an issue where a UI might want to enforce particular settings such as
# an empty DISTRO variable. If configuration files do something like assigning
# a weak default, it turns out to be very difficult to filter out these changes,
-# particularly when the weak default might appear half way though parsing a chain
+# particularly when the weak default might appear half way though parsing a chain
# of configuration files. We therefore let the UIs hook into configuration file
# parsing. This turns out to be a hard problem to solve any other way.
confFilters = []
-def handle(fn, data, include):
+def handle(fn, data, include, baseconfig=False):
init(data)
if include == 0:
@@ -144,7 +145,7 @@ def handle(fn, data, include):
# skip comments
if s[0] == '#':
continue
- feeder(lineno, s, abs_fn, statements)
+ feeder(lineno, s, abs_fn, statements, baseconfig=baseconfig)
# DONE WITH PARSING... time to evaluate
data.setVar('FILE', abs_fn)
@@ -157,7 +158,9 @@ def handle(fn, data, include):
return data
-def feeder(lineno, s, fn, statements):
+# baseconfig is set for the bblayers/layer.conf cookerdata config parsing
+# The function is also used by BBHandler, conffile would be False
+def feeder(lineno, s, fn, statements, baseconfig=False, conffile=True):
m = __config_regexp__.match(s)
if m:
groupd = m.groupdict()
@@ -189,6 +192,11 @@ def feeder(lineno, s, fn, statements):
ast.handleUnsetFlag(statements, fn, lineno, m)
return
+ m = __addpylib_regexp__.match(s)
+ if baseconfig and conffile and m:
+ ast.handlePyLib(statements, fn, lineno, m)
+ return
+
raise ParseError("unparsed line: '%s'" % s, fn, lineno);
# Add us to the handlers list
diff --git a/bitbake/lib/bb/persist_data.py b/bitbake/lib/bb/persist_data.py
index ce84a15825..bcca791edf 100644
--- a/bitbake/lib/bb/persist_data.py
+++ b/bitbake/lib/bb/persist_data.py
@@ -249,4 +249,23 @@ def persist(domain, d):
bb.utils.mkdirhier(cachedir)
cachefile = os.path.join(cachedir, "bb_persist_data.sqlite3")
- return SQLTable(cachefile, domain)
+
+ try:
+ return SQLTable(cachefile, domain)
+ except sqlite3.OperationalError:
+ # Sqlite fails to open database when its path is too long.
+ # After testing, 504 is the biggest path length that can be opened by
+ # sqlite.
+ # Note: This code is called before sanity.bbclass and its path length
+ # check
+ max_len = 504
+ if len(cachefile) > max_len:
+ logger.critical("The path of the cache file is too long "
+ "({0} chars > {1}) to be opened by sqlite! "
+ "Your cache file is \"{2}\"".format(
+ len(cachefile),
+ max_len,
+ cachefile))
+ sys.exit(1)
+ else:
+ raise
diff --git a/bitbake/lib/bb/runqueue.py b/bitbake/lib/bb/runqueue.py
index d0ffe3932c..93079a9776 100644
--- a/bitbake/lib/bb/runqueue.py
+++ b/bitbake/lib/bb/runqueue.py
@@ -155,9 +155,9 @@ class RunQueueScheduler(object):
self.stamps = {}
for tid in self.rqdata.runtaskentries:
(mc, fn, taskname, taskfn) = split_tid_mcfn(tid)
- self.stamps[tid] = bb.build.stampfile(taskname, self.rqdata.dataCaches[mc], taskfn, noextra=True)
+ self.stamps[tid] = bb.parse.siggen.stampfile_mcfn(taskname, taskfn, extrainfo=False)
if tid in self.rq.runq_buildable:
- self.buildable.append(tid)
+ self.buildable.add(tid)
self.rev_prio_map = None
self.is_pressure_usable()
@@ -180,7 +180,7 @@ class RunQueueScheduler(object):
self.prev_pressure_time = time.time()
self.check_pressure = True
except:
- bb.warn("The /proc/pressure files can't be read. Continuing build without monitoring pressure")
+ bb.note("The /proc/pressure files can't be read. Continuing build without monitoring pressure")
self.check_pressure = False
else:
self.check_pressure = False
@@ -198,16 +198,38 @@ class RunQueueScheduler(object):
curr_cpu_pressure = cpu_pressure_fds.readline().split()[4].split("=")[1]
curr_io_pressure = io_pressure_fds.readline().split()[4].split("=")[1]
curr_memory_pressure = memory_pressure_fds.readline().split()[4].split("=")[1]
- exceeds_cpu_pressure = self.rq.max_cpu_pressure and (float(curr_cpu_pressure) - float(self.prev_cpu_pressure)) > self.rq.max_cpu_pressure
- exceeds_io_pressure = self.rq.max_io_pressure and (float(curr_io_pressure) - float(self.prev_io_pressure)) > self.rq.max_io_pressure
- exceeds_memory_pressure = self.rq.max_memory_pressure and (float(curr_memory_pressure) - float(self.prev_memory_pressure)) > self.rq.max_memory_pressure
now = time.time()
- if now - self.prev_pressure_time > 1.0:
+ tdiff = now - self.prev_pressure_time
+ psi_accumulation_interval = 1.0
+ cpu_pressure = (float(curr_cpu_pressure) - float(self.prev_cpu_pressure)) / tdiff
+ io_pressure = (float(curr_io_pressure) - float(self.prev_io_pressure)) / tdiff
+ memory_pressure = (float(curr_memory_pressure) - float(self.prev_memory_pressure)) / tdiff
+ exceeds_cpu_pressure = self.rq.max_cpu_pressure and cpu_pressure > self.rq.max_cpu_pressure
+ exceeds_io_pressure = self.rq.max_io_pressure and io_pressure > self.rq.max_io_pressure
+ exceeds_memory_pressure = self.rq.max_memory_pressure and memory_pressure > self.rq.max_memory_pressure
+
+ if tdiff > psi_accumulation_interval:
self.prev_cpu_pressure = curr_cpu_pressure
self.prev_io_pressure = curr_io_pressure
self.prev_memory_pressure = curr_memory_pressure
self.prev_pressure_time = now
+
+ pressure_state = (exceeds_cpu_pressure, exceeds_io_pressure, exceeds_memory_pressure)
+ pressure_values = (round(cpu_pressure,1), self.rq.max_cpu_pressure, round(io_pressure,1), self.rq.max_io_pressure, round(memory_pressure,1), self.rq.max_memory_pressure)
+ if hasattr(self, "pressure_state") and pressure_state != self.pressure_state:
+ bb.note("Pressure status changed to CPU: %s, IO: %s, Mem: %s (CPU: %s/%s, IO: %s/%s, Mem: %s/%s) - using %s/%s bitbake threads" % (pressure_state + pressure_values + (len(self.rq.runq_running.difference(self.rq.runq_complete)), self.rq.number_tasks)))
+ self.pressure_state = pressure_state
return (exceeds_cpu_pressure or exceeds_io_pressure or exceeds_memory_pressure)
+ elif self.rq.max_loadfactor:
+ limit = False
+ loadfactor = float(os.getloadavg()[0]) / os.cpu_count()
+ # bb.warn("Comparing %s to %s" % (loadfactor, self.rq.max_loadfactor))
+ if loadfactor > self.rq.max_loadfactor:
+ limit = True
+ if hasattr(self, "loadfactor_limit") and limit != self.loadfactor_limit:
+ bb.note("Load average limiting set to %s as load average: %s - using %s/%s bitbake threads" % (limit, loadfactor, len(self.rq.runq_running.difference(self.rq.runq_complete)), self.rq.number_tasks))
+ self.loadfactor_limit = limit
+ return limit
return False
def next_buildable_task(self):
@@ -258,11 +280,11 @@ class RunQueueScheduler(object):
best = None
bestprio = None
for tid in buildable:
- taskname = taskname_from_tid(tid)
- if taskname in skip_buildable and skip_buildable[taskname] >= int(self.skip_maxthread[taskname]):
- continue
prio = self.rev_prio_map[tid]
if bestprio is None or bestprio > prio:
+ taskname = taskname_from_tid(tid)
+ if taskname in skip_buildable and skip_buildable[taskname] >= int(self.skip_maxthread[taskname]):
+ continue
stamp = self.stamps[tid]
if stamp in self.rq.build_stamps.values():
continue
@@ -651,8 +673,11 @@ class RunQueueData:
# Nothing to do
return 0
+ bb.parse.siggen.setup_datacache(self.dataCaches)
+
self.init_progress_reporter.start()
self.init_progress_reporter.next_stage()
+ bb.event.check_for_interrupts(self.cooker.data)
# Step A - Work out a list of tasks to run
#
@@ -698,6 +723,8 @@ class RunQueueData:
frommc = mcdependency[1]
mcdep = mcdependency[2]
deptask = mcdependency[4]
+ if mcdep not in taskData:
+ bb.fatal("Multiconfig '%s' is referenced in multiconfig dependency '%s' but not enabled in BBMULTICONFIG?" % (mcdep, dep))
if mc == frommc:
fn = taskData[mcdep].build_targets[pn][0]
newdep = '%s:%s' % (fn,deptask)
@@ -799,6 +826,7 @@ class RunQueueData:
#self.dump_data()
self.init_progress_reporter.next_stage()
+ bb.event.check_for_interrupts(self.cooker.data)
# Resolve recursive 'recrdeptask' dependencies (Part B)
#
@@ -895,6 +923,7 @@ class RunQueueData:
self.runtaskentries[tid].depends.difference_update(recursivetasksselfref)
self.init_progress_reporter.next_stage()
+ bb.event.check_for_interrupts(self.cooker.data)
#self.dump_data()
@@ -933,7 +962,7 @@ class RunQueueData:
bb.debug(1, "Task %s is marked nostamp, cannot invalidate this task" % taskname)
else:
logger.verbose("Invalidate task %s, %s", taskname, fn)
- bb.parse.siggen.invalidate_task(taskname, self.dataCaches[mc], taskfn)
+ bb.parse.siggen.invalidate_task(taskname, taskfn)
self.target_tids = []
for (mc, target, task, fn) in self.targets:
@@ -976,6 +1005,7 @@ class RunQueueData:
mark_active(tid, 1)
self.init_progress_reporter.next_stage()
+ bb.event.check_for_interrupts(self.cooker.data)
# Step C - Prune all inactive tasks
#
@@ -984,25 +1014,32 @@ class RunQueueData:
# Handle --runall
if self.cooker.configuration.runall:
# re-run the mark_active and then drop unused tasks from new list
- reduced_tasklist = set(self.runtaskentries.keys())
- for tid in list(self.runtaskentries.keys()):
- if tid not in runq_build:
- reduced_tasklist.remove(tid)
- runq_build = {}
- for task in self.cooker.configuration.runall:
- if not task.startswith("do_"):
- task = "do_{0}".format(task)
- runall_tids = set()
- for tid in reduced_tasklist:
- wanttid = "{0}:{1}".format(fn_from_tid(tid), task)
- if wanttid in self.runtaskentries:
- runall_tids.add(wanttid)
+ runall_tids = set()
+ added = True
+ while added:
+ reduced_tasklist = set(self.runtaskentries.keys())
+ for tid in list(self.runtaskentries.keys()):
+ if tid not in runq_build:
+ reduced_tasklist.remove(tid)
+ runq_build = {}
- for tid in list(runall_tids):
- mark_active(tid, 1)
- if self.cooker.configuration.force:
- invalidate_task(tid, False)
+ orig = runall_tids
+ runall_tids = set()
+ for task in self.cooker.configuration.runall:
+ if not task.startswith("do_"):
+ task = "do_{0}".format(task)
+ for tid in reduced_tasklist:
+ wanttid = "{0}:{1}".format(fn_from_tid(tid), task)
+ if wanttid in self.runtaskentries:
+ runall_tids.add(wanttid)
+
+ for tid in list(runall_tids):
+ mark_active(tid, 1)
+ self.target_tids.append(tid)
+ if self.cooker.configuration.force:
+ invalidate_task(tid, False)
+ added = runall_tids - orig
delcount = set()
for tid in list(self.runtaskentries.keys()):
@@ -1015,6 +1052,7 @@ class RunQueueData:
bb.msg.fatal("RunQueue", "Could not find any tasks with the tasknames %s to run within the recipes of the taskgraphs of the targets %s" % (str(self.cooker.configuration.runall), str(self.targets)))
self.init_progress_reporter.next_stage()
+ bb.event.check_for_interrupts(self.cooker.data)
# Handle runonly
if self.cooker.configuration.runonly:
@@ -1055,6 +1093,7 @@ class RunQueueData:
logger.verbose("Assign Weightings")
self.init_progress_reporter.next_stage()
+ bb.event.check_for_interrupts(self.cooker.data)
# Generate a list of reverse dependencies to ease future calculations
for tid in self.runtaskentries:
@@ -1062,6 +1101,7 @@ class RunQueueData:
self.runtaskentries[dep].revdeps.add(tid)
self.init_progress_reporter.next_stage()
+ bb.event.check_for_interrupts(self.cooker.data)
# Identify tasks at the end of dependency chains
# Error on circular dependency loops (length two)
@@ -1078,12 +1118,14 @@ class RunQueueData:
logger.verbose("Compute totals (have %s endpoint(s))", len(endpoints))
self.init_progress_reporter.next_stage()
+ bb.event.check_for_interrupts(self.cooker.data)
# Calculate task weights
# Check of higher length circular dependencies
self.runq_weight = self.calculate_task_weights(endpoints)
self.init_progress_reporter.next_stage()
+ bb.event.check_for_interrupts(self.cooker.data)
# Sanity Check - Check for multiple tasks building the same provider
for mc in self.dataCaches:
@@ -1184,6 +1226,7 @@ class RunQueueData:
self.init_progress_reporter.next_stage()
self.init_progress_reporter.next_stage()
+ bb.event.check_for_interrupts(self.cooker.data)
# Iterate over the task list looking for tasks with a 'setscene' function
self.runq_setscene_tids = set()
@@ -1196,6 +1239,7 @@ class RunQueueData:
self.runq_setscene_tids.add(tid)
self.init_progress_reporter.next_stage()
+ bb.event.check_for_interrupts(self.cooker.data)
# Invalidate task if force mode active
if self.cooker.configuration.force:
@@ -1212,6 +1256,7 @@ class RunQueueData:
invalidate_task(fn + ":" + st, True)
self.init_progress_reporter.next_stage()
+ bb.event.check_for_interrupts(self.cooker.data)
# Create and print to the logs a virtual/xxxx -> PN (fn) table
for mc in taskData:
@@ -1224,30 +1269,45 @@ class RunQueueData:
bb.parse.siggen.tasks_resolved(virtmap, virtpnmap, self.dataCaches[mc])
self.init_progress_reporter.next_stage()
+ bb.event.check_for_interrupts(self.cooker.data)
bb.parse.siggen.set_setscene_tasks(self.runq_setscene_tids)
+ starttime = time.time()
+ lasttime = starttime
+
# Iterate over the task list and call into the siggen code
dealtwith = set()
todeal = set(self.runtaskentries)
while todeal:
+ ready = set()
for tid in todeal.copy():
if not (self.runtaskentries[tid].depends - dealtwith):
- dealtwith.add(tid)
- todeal.remove(tid)
- self.prepare_task_hash(tid)
+ self.runtaskentries[tid].taskhash_deps = bb.parse.siggen.prep_taskhash(tid, self.runtaskentries[tid].depends, self.dataCaches)
+ # get_taskhash for a given tid *must* be called before get_unihash* below
+ self.runtaskentries[tid].hash = bb.parse.siggen.get_taskhash(tid, self.runtaskentries[tid].depends, self.dataCaches)
+ ready.add(tid)
+ unihashes = bb.parse.siggen.get_unihashes(ready)
+ for tid in ready:
+ dealtwith.add(tid)
+ todeal.remove(tid)
+ self.runtaskentries[tid].unihash = unihashes[tid]
+
+ bb.event.check_for_interrupts(self.cooker.data)
+
+ if time.time() > (lasttime + 30):
+ lasttime = time.time()
+ hashequiv_logger.verbose("Initial setup loop progress: %s of %s in %s" % (len(todeal), len(self.runtaskentries), lasttime - starttime))
+
+ endtime = time.time()
+ if (endtime-starttime > 60):
+ hashequiv_logger.verbose("Initial setup loop took: %s" % (endtime-starttime))
bb.parse.siggen.writeout_file_checksum_cache()
#self.dump_data()
return len(self.runtaskentries)
- def prepare_task_hash(self, tid):
- dc = bb.parse.siggen.get_data_caches(self.dataCaches, mc_from_tid(tid))
- bb.parse.siggen.prep_taskhash(tid, self.runtaskentries[tid].depends, dc)
- self.runtaskentries[tid].hash = bb.parse.siggen.get_taskhash(tid, self.runtaskentries[tid].depends, dc)
- self.runtaskentries[tid].unihash = bb.parse.siggen.get_unihash(tid)
-
def dump_data(self):
"""
Dump some debug information on the internal data structures
@@ -1289,32 +1349,40 @@ class RunQueue:
self.worker = {}
self.fakeworker = {}
+ @staticmethod
+ def send_pickled_data(worker, data, name):
+ msg = bytearray()
+ msg.extend(b"<" + name.encode() + b">")
+ pickled_data = pickle.dumps(data)
+ msg.extend(len(pickled_data).to_bytes(4, 'big'))
+ msg.extend(pickled_data)
+ msg.extend(b"</" + name.encode() + b">")
+ worker.stdin.write(msg)
+
def _start_worker(self, mc, fakeroot = False, rqexec = None):
logger.debug("Starting bitbake-worker")
magic = "decafbad"
if self.cooker.configuration.profile:
magic = "decafbadbad"
fakerootlogs = None
+
+ workerscript = os.path.realpath(os.path.dirname(__file__) + "/../../bin/bitbake-worker")
if fakeroot:
magic = magic + "beef"
mcdata = self.cooker.databuilder.mcdata[mc]
fakerootcmd = shlex.split(mcdata.getVar("FAKEROOTCMD"))
fakerootenv = (mcdata.getVar("FAKEROOTBASEENV") or "").split()
env = os.environ.copy()
- for key, value in (var.split('=') for var in fakerootenv):
+ for key, value in (var.split('=',1) for var in fakerootenv):
env[key] = value
- worker = subprocess.Popen(fakerootcmd + ["bitbake-worker", magic], stdout=subprocess.PIPE, stdin=subprocess.PIPE, env=env)
+ worker = subprocess.Popen(fakerootcmd + [sys.executable, workerscript, magic], stdout=subprocess.PIPE, stdin=subprocess.PIPE, env=env)
fakerootlogs = self.rqdata.dataCaches[mc].fakerootlogs
else:
- worker = subprocess.Popen(["bitbake-worker", magic], stdout=subprocess.PIPE, stdin=subprocess.PIPE)
+ worker = subprocess.Popen([sys.executable, workerscript, magic], stdout=subprocess.PIPE, stdin=subprocess.PIPE)
bb.utils.nonblockingfd(worker.stdout)
workerpipe = runQueuePipe(worker.stdout, None, self.cfgData, self, rqexec, fakerootlogs=fakerootlogs)
workerdata = {
- "taskdeps" : self.rqdata.dataCaches[mc].task_deps,
- "fakerootenv" : self.rqdata.dataCaches[mc].fakerootenv,
- "fakerootdirs" : self.rqdata.dataCaches[mc].fakerootdirs,
- "fakerootnoenv" : self.rqdata.dataCaches[mc].fakerootnoenv,
"sigdata" : bb.parse.siggen.get_taskdata(),
"logdefaultlevel" : bb.msg.loggerDefaultLogLevel,
"build_verbose_shell" : self.cooker.configuration.build_verbose_shell,
@@ -1328,9 +1396,9 @@ class RunQueue:
"umask" : self.cfgData.getVar("BB_DEFAULT_UMASK"),
}
- worker.stdin.write(b"<cookerconfig>" + pickle.dumps(self.cooker.configuration) + b"</cookerconfig>")
- worker.stdin.write(b"<extraconfigdata>" + pickle.dumps(self.cooker.extraconfigdata) + b"</extraconfigdata>")
- worker.stdin.write(b"<workerdata>" + pickle.dumps(workerdata) + b"</workerdata>")
+ RunQueue.send_pickled_data(worker, self.cooker.configuration, "cookerconfig")
+ RunQueue.send_pickled_data(worker, self.cooker.extraconfigdata, "extraconfigdata")
+ RunQueue.send_pickled_data(worker, workerdata, "workerdata")
worker.stdin.flush()
return RunQueueWorker(worker, workerpipe)
@@ -1340,7 +1408,7 @@ class RunQueue:
return
logger.debug("Teardown for bitbake-worker")
try:
- worker.process.stdin.write(b"<quit></quit>")
+ RunQueue.send_pickled_data(worker.process, b"", "quit")
worker.process.stdin.flush()
worker.process.stdin.close()
except IOError:
@@ -1352,12 +1420,12 @@ class RunQueue:
continue
worker.pipe.close()
- def start_worker(self):
+ def start_worker(self, rqexec):
if self.worker:
self.teardown_workers()
self.teardown = False
for mc in self.rqdata.dataCaches:
- self.worker[mc] = self._start_worker(mc)
+ self.worker[mc] = self._start_worker(mc, False, rqexec)
def start_fakeworker(self, rqexec, mc):
if not mc in self.fakeworker:
@@ -1399,7 +1467,7 @@ class RunQueue:
if taskname is None:
taskname = tn
- stampfile = bb.build.stampfile(taskname, self.rqdata.dataCaches[mc], taskfn)
+ stampfile = bb.parse.siggen.stampfile_mcfn(taskname, taskfn)
# If the stamp is missing, it's not current
if not os.access(stampfile, os.F_OK):
@@ -1411,7 +1479,7 @@ class RunQueue:
logger.debug2("%s.%s is nostamp\n", fn, taskname)
return False
- if taskname != "do_setscene" and taskname.endswith("_setscene"):
+ if taskname.endswith("_setscene"):
return True
if cache is None:
@@ -1422,8 +1490,8 @@ class RunQueue:
for dep in self.rqdata.runtaskentries[tid].depends:
if iscurrent:
(mc2, fn2, taskname2, taskfn2) = split_tid_mcfn(dep)
- stampfile2 = bb.build.stampfile(taskname2, self.rqdata.dataCaches[mc2], taskfn2)
- stampfile3 = bb.build.stampfile(taskname2 + "_setscene", self.rqdata.dataCaches[mc2], taskfn2)
+ stampfile2 = bb.parse.siggen.stampfile_mcfn(taskname2, taskfn2)
+ stampfile3 = bb.parse.siggen.stampfile_mcfn(taskname2 + "_setscene", taskfn2)
t2 = get_timestamp(stampfile2)
t3 = get_timestamp(stampfile3)
if t3 and not t2:
@@ -1484,6 +1552,7 @@ class RunQueue:
"""
retval = True
+ bb.event.check_for_interrupts(self.cooker.data)
if self.state is runQueuePrepare:
# NOTE: if you add, remove or significantly refactor the stages of this
@@ -1512,10 +1581,13 @@ class RunQueue:
if not self.dm_event_handler_registered:
res = bb.event.register(self.dm_event_handler_name,
- lambda x: self.dm.check(self) if self.state in [runQueueRunning, runQueueCleanUp] else False,
+ lambda x, y: self.dm.check(self) if self.state in [runQueueRunning, runQueueCleanUp] else False,
('bb.event.HeartbeatEvent',), data=self.cfgData)
self.dm_event_handler_registered = True
+ self.rqdata.init_progress_reporter.next_stage()
+ self.rqexe = RunQueueExecute(self)
+
dump = self.cooker.configuration.dump_signatures
if dump:
self.rqdata.init_progress_reporter.finish()
@@ -1527,10 +1599,8 @@ class RunQueue:
self.state = runQueueComplete
if self.state is runQueueSceneInit:
- self.rqdata.init_progress_reporter.next_stage()
- self.start_worker()
- self.rqdata.init_progress_reporter.next_stage()
- self.rqexe = RunQueueExecute(self)
+ self.start_worker(self.rqexe)
+ self.rqdata.init_progress_reporter.finish()
# If we don't have any setscene functions, skip execution
if not self.rqdata.runq_setscene_tids:
@@ -1609,29 +1679,28 @@ class RunQueue:
else:
self.rqexe.finish()
- def rq_dump_sigfn(self, fn, options):
- bb_cache = bb.cache.NoCache(self.cooker.databuilder)
- mc = bb.runqueue.mc_from_tid(fn)
- the_data = bb_cache.loadDataFull(fn, self.cooker.collections[mc].get_file_appends(fn))
- siggen = bb.parse.siggen
- dataCaches = self.rqdata.dataCaches
- siggen.dump_sigfn(fn, dataCaches, options)
+ def _rq_dump_sigtid(self, tids):
+ for tid in tids:
+ (mc, fn, taskname, taskfn) = split_tid_mcfn(tid)
+ dataCaches = self.rqdata.dataCaches
+ bb.parse.siggen.dump_sigtask(taskfn, taskname, dataCaches[mc].stamp[taskfn], True)
def dump_signatures(self, options):
- fns = set()
- bb.note("Reparsing files to collect dependency data")
+ if bb.cooker.CookerFeatures.RECIPE_SIGGEN_INFO not in self.cooker.featureset:
+ bb.fatal("The dump signatures functionality needs the RECIPE_SIGGEN_INFO feature enabled")
- for tid in self.rqdata.runtaskentries:
- fn = fn_from_tid(tid)
- fns.add(fn)
+ bb.note("Writing task signature files")
max_process = int(self.cfgData.getVar("BB_NUMBER_PARSE_THREADS") or os.cpu_count() or 1)
+ def chunkify(l, n):
+ return [l[i::n] for i in range(n)]
+ tids = chunkify(list(self.rqdata.runtaskentries), max_process)
# We cannot use the real multiprocessing.Pool easily due to some local data
# that can't be pickled. This is a cheap multi-process solution.
launched = []
- while fns:
+ while tids:
if len(launched) < max_process:
- p = Process(target=self.rq_dump_sigfn, args=(fns.pop(), options))
+ p = Process(target=self._rq_dump_sigtid, args=(tids.pop(), ))
p.start()
launched.append(p)
for q in launched:
@@ -1646,6 +1715,17 @@ class RunQueue:
return
def print_diffscenetasks(self):
+ def get_root_invalid_tasks(task, taskdepends, valid, noexec, visited_invalid):
+ invalidtasks = []
+ for t in taskdepends[task].depends:
+ if t not in valid and t not in visited_invalid:
+ invalidtasks.extend(get_root_invalid_tasks(t, taskdepends, valid, noexec, visited_invalid))
+ visited_invalid.add(t)
+
+ direct_invalid = [t for t in taskdepends[task].depends if t not in valid]
+ if not direct_invalid and task not in noexec:
+ invalidtasks = [task]
+ return invalidtasks
noexec = []
tocheck = set()
@@ -1679,46 +1759,49 @@ class RunQueue:
valid_new.add(dep)
invalidtasks = set()
- for tid in self.rqdata.runtaskentries:
- if tid not in valid_new and tid not in noexec:
- invalidtasks.add(tid)
- found = set()
- processed = set()
- for tid in invalidtasks:
+ toptasks = set(["{}:{}".format(t[3], t[2]) for t in self.rqdata.targets])
+ for tid in toptasks:
toprocess = set([tid])
while toprocess:
next = set()
+ visited_invalid = set()
for t in toprocess:
- for dep in self.rqdata.runtaskentries[t].depends:
- if dep in invalidtasks:
- found.add(tid)
- if dep not in processed:
- processed.add(dep)
+ if t not in valid_new and t not in noexec:
+ invalidtasks.update(get_root_invalid_tasks(t, self.rqdata.runtaskentries, valid_new, noexec, visited_invalid))
+ continue
+ if t in self.rqdata.runq_setscene_tids:
+ for dep in self.rqexe.sqdata.sq_deps[t]:
next.add(dep)
+ continue
+
+ for dep in self.rqdata.runtaskentries[t].depends:
+ next.add(dep)
+
toprocess = next
- if tid in found:
- toprocess = set()
tasklist = []
- for tid in invalidtasks.difference(found):
+ for tid in invalidtasks:
tasklist.append(tid)
if tasklist:
bb.plain("The differences between the current build and any cached tasks start at the following tasks:\n" + "\n".join(tasklist))
- return invalidtasks.difference(found)
+ return invalidtasks
def write_diffscenetasks(self, invalidtasks):
+ bb.siggen.check_siggen_version(bb.siggen)
# Define recursion callback
def recursecb(key, hash1, hash2):
hashes = [hash1, hash2]
+ bb.debug(1, "Recursively looking for recipe {} hashes {}".format(key, hashes))
hashfiles = bb.siggen.find_siginfo(key, None, hashes, self.cfgData)
+ bb.debug(1, "Found hashfiles:\n{}".format(hashfiles))
recout = []
if len(hashfiles) == 2:
- out2 = bb.siggen.compare_sigfiles(hashfiles[hash1], hashfiles[hash2], recursecb)
+ out2 = bb.siggen.compare_sigfiles(hashfiles[hash1]['path'], hashfiles[hash2]['path'], recursecb)
recout.extend(list(' ' + l for l in out2))
else:
recout.append("Unable to find matching sigdata for %s with hashes %s or %s" % (key, hash1, hash2))
@@ -1729,20 +1812,25 @@ class RunQueue:
for tid in invalidtasks:
(mc, fn, taskname, taskfn) = split_tid_mcfn(tid)
pn = self.rqdata.dataCaches[mc].pkg_fn[taskfn]
- h = self.rqdata.runtaskentries[tid].hash
+ h = self.rqdata.runtaskentries[tid].unihash
+ bb.debug(1, "Looking for recipe {} task {}".format(pn, taskname))
matches = bb.siggen.find_siginfo(pn, taskname, [], self.cooker.databuilder.mcdata[mc])
+ bb.debug(1, "Found hashfiles:\n{}".format(matches))
match = None
- for m in matches:
- if h in m:
- match = m
+ for m in matches.values():
+ if h in m['path']:
+ match = m['path']
if match is None:
- bb.fatal("Can't find a task we're supposed to have written out? (hash: %s)?" % h)
+ bb.fatal("Can't find a task we're supposed to have written out? (hash: %s tid: %s)?" % (h, tid))
matches = {k : v for k, v in iter(matches.items()) if h not in k}
+ matches_local = {k : v for k, v in iter(matches.items()) if h not in k and not v['sstate']}
+ if matches_local:
+ matches = matches_local
if matches:
- latestmatch = sorted(matches.keys(), key=lambda f: matches[f])[-1]
+ latestmatch = matches[sorted(matches.keys(), key=lambda h: matches[h]['time'])[-1]]['path']
prevh = __find_sha256__.search(latestmatch).group(0)
output = bb.siggen.compare_sigfiles(latestmatch, match, recursecb)
- bb.plain("\nTask %s:%s couldn't be used from the cache because:\n We need hash %s, closest matching task was %s\n " % (pn, taskname, h, prevh) + '\n '.join(output))
+ bb.plain("\nTask %s:%s couldn't be used from the cache because:\n We need hash %s, most recent matching task was %s\n " % (pn, taskname, h, prevh) + '\n '.join(output))
class RunQueueExecute:
@@ -1758,6 +1846,7 @@ class RunQueueExecute:
self.max_cpu_pressure = self.cfgData.getVar("BB_PRESSURE_MAX_CPU")
self.max_io_pressure = self.cfgData.getVar("BB_PRESSURE_MAX_IO")
self.max_memory_pressure = self.cfgData.getVar("BB_PRESSURE_MAX_MEMORY")
+ self.max_loadfactor = self.cfgData.getVar("BB_LOADFACTOR_MAX")
self.sq_buildable = set()
self.sq_running = set()
@@ -1775,6 +1864,8 @@ class RunQueueExecute:
self.build_stamps2 = []
self.failed_tids = []
self.sq_deferred = {}
+ self.sq_needed_harddeps = set()
+ self.sq_harddep_deferred = set()
self.stampcache = {}
@@ -1784,11 +1875,6 @@ class RunQueueExecute:
self.stats = RunQueueStats(len(self.rqdata.runtaskentries), len(self.rqdata.runq_setscene_tids))
- for mc in rq.worker:
- rq.worker[mc].pipe.setrunqueueexec(self)
- for mc in rq.fakeworker:
- rq.fakeworker[mc].pipe.setrunqueueexec(self)
-
if self.number_tasks <= 0:
bb.fatal("Invalid BB_NUMBER_THREADS %s" % self.number_tasks)
@@ -1814,6 +1900,11 @@ class RunQueueExecute:
bb.fatal("Invalid BB_PRESSURE_MAX_MEMORY %s, minimum value is %s." % (self.max_memory_pressure, lower_limit))
if self.max_memory_pressure > upper_limit:
bb.warn("Your build will be largely unregulated since BB_PRESSURE_MAX_MEMORY is set to %s. It is very unlikely that such high pressure will be experienced." % (self.max_io_pressure))
+
+ if self.max_loadfactor:
+ self.max_loadfactor = float(self.max_loadfactor)
+ if self.max_loadfactor <= 0:
+ bb.fatal("Invalid BB_LOADFACTOR_MAX %s, needs to be greater than zero." % (self.max_loadfactor))
# List of setscene tasks which we've covered
self.scenequeue_covered = set()
@@ -1824,11 +1915,6 @@ class RunQueueExecute:
self.tasks_notcovered = set()
self.scenequeue_notneeded = set()
- # We can't skip specified target tasks which aren't setscene tasks
- self.cantskip = set(self.rqdata.target_tids)
- self.cantskip.difference_update(self.rqdata.runq_setscene_tids)
- self.cantskip.intersection_update(self.rqdata.runtaskentries)
-
schedulers = self.get_schedulers()
for scheduler in schedulers:
if self.scheduler == scheduler.name:
@@ -1841,7 +1927,25 @@ class RunQueueExecute:
#if self.rqdata.runq_setscene_tids:
self.sqdata = SQData()
- build_scenequeue_data(self.sqdata, self.rqdata, self.rq, self.cooker, self.stampcache, self)
+ build_scenequeue_data(self.sqdata, self.rqdata, self)
+
+ update_scenequeue_data(self.sqdata.sq_revdeps, self.sqdata, self.rqdata, self.rq, self.cooker, self.stampcache, self, summary=True)
+
+ # Compute a list of 'stale' sstate tasks where the current hash does not match the one
+ # in any stamp files. Pass the list out to metadata as an event.
+ found = {}
+ for tid in self.rqdata.runq_setscene_tids:
+ (mc, fn, taskname, taskfn) = split_tid_mcfn(tid)
+ stamps = bb.build.find_stale_stamps(taskname, taskfn)
+ if stamps:
+ if mc not in found:
+ found[mc] = {}
+ found[mc][tid] = stamps
+ for mc in found:
+ event = bb.event.StaleSetSceneTasks(found[mc])
+ bb.event.fire(event, self.cooker.databuilder.mcdata[mc])
+
+ self.build_taskdepdata_cache()
def runqueue_process_waitpid(self, task, status, fakerootlog=None):
@@ -1867,14 +1971,14 @@ class RunQueueExecute:
def finish_now(self):
for mc in self.rq.worker:
try:
- self.rq.worker[mc].process.stdin.write(b"<finishnow></finishnow>")
+ RunQueue.send_pickled_data(self.rq.worker[mc].process, b"", "finishnow")
self.rq.worker[mc].process.stdin.flush()
except IOError:
# worker must have died?
pass
for mc in self.rq.fakeworker:
try:
- self.rq.fakeworker[mc].process.stdin.write(b"<finishnow></finishnow>")
+ RunQueue.send_pickled_data(self.rq.fakeworker[mc].process, b"", "finishnow")
self.rq.fakeworker[mc].process.stdin.flush()
except IOError:
# worker must have died?
@@ -1943,8 +2047,7 @@ class RunQueueExecute:
try:
module = __import__(modname, fromlist=(name,))
except ImportError as exc:
- logger.critical("Unable to import scheduler '%s' from '%s': %s" % (name, modname, exc))
- raise SystemExit(1)
+ bb.fatal("Unable to import scheduler '%s' from '%s': %s" % (name, modname, exc))
else:
schedulers.add(getattr(module, name))
return schedulers
@@ -1974,11 +2077,19 @@ class RunQueueExecute:
self.setbuildable(revdep)
logger.debug("Marking task %s as buildable", revdep)
- for t in self.sq_deferred.copy():
+ found = None
+ for t in sorted(self.sq_deferred.copy()):
if self.sq_deferred[t] == task:
- logger.debug2("Deferred task %s now buildable" % t)
- del self.sq_deferred[t]
- update_scenequeue_data([t], self.sqdata, self.rqdata, self.rq, self.cooker, self.stampcache, self, summary=False)
+ # Allow the next deferred task to run. Any other deferred tasks should be deferred after that task.
+ # We shouldn't allow all to run at once as it is prone to races.
+ if not found:
+ bb.debug(1, "Deferred task %s now buildable" % t)
+ del self.sq_deferred[t]
+ update_scenequeue_data([t], self.sqdata, self.rqdata, self.rq, self.cooker, self.stampcache, self, summary=False)
+ found = t
+ else:
+ bb.debug(1, "Deferring %s after %s" % (t, found))
+ self.sq_deferred[t] = found
def task_complete(self, task):
self.stats.taskCompleted()
@@ -2083,8 +2194,11 @@ class RunQueueExecute:
if not self.sqdone and self.can_start_task():
# Find the next setscene to run
for nexttask in self.sorted_setscene_tids:
- if nexttask in self.sq_buildable and nexttask not in self.sq_running and self.sqdata.stamps[nexttask] not in self.build_stamps.values():
- if nexttask not in self.sqdata.unskippable and self.sqdata.sq_revdeps[nexttask] and self.sqdata.sq_revdeps[nexttask].issubset(self.scenequeue_covered) and self.check_dependencies(nexttask, self.sqdata.sq_revdeps[nexttask]):
+ if nexttask in self.sq_buildable and nexttask not in self.sq_running and self.sqdata.stamps[nexttask] not in self.build_stamps.values() and nexttask not in self.sq_harddep_deferred:
+ if nexttask not in self.sqdata.unskippable and self.sqdata.sq_revdeps[nexttask] and \
+ nexttask not in self.sq_needed_harddeps and \
+ self.sqdata.sq_revdeps[nexttask].issubset(self.scenequeue_covered) and \
+ self.check_dependencies(nexttask, self.sqdata.sq_revdeps[nexttask]):
if nexttask not in self.rqdata.target_tids:
logger.debug2("Skipping setscene for task %s" % nexttask)
self.sq_task_skip(nexttask)
@@ -2092,6 +2206,19 @@ class RunQueueExecute:
if nexttask in self.sq_deferred:
del self.sq_deferred[nexttask]
return True
+ if nexttask in self.sqdata.sq_harddeps_rev and not self.sqdata.sq_harddeps_rev[nexttask].issubset(self.scenequeue_covered | self.scenequeue_notcovered):
+ logger.debug2("Deferring %s due to hard dependencies" % nexttask)
+ updated = False
+ for dep in self.sqdata.sq_harddeps_rev[nexttask]:
+ if dep not in self.sq_needed_harddeps:
+ logger.debug2("Enabling task %s as it is a hard dependency" % dep)
+ self.sq_buildable.add(dep)
+ self.sq_needed_harddeps.add(dep)
+ updated = True
+ self.sq_harddep_deferred.add(nexttask)
+ if updated:
+ return True
+ continue
# If covered tasks are running, need to wait for them to complete
for t in self.sqdata.sq_covered_tasks[nexttask]:
if t in self.runq_running and t not in self.runq_complete:
@@ -2140,21 +2267,35 @@ class RunQueueExecute:
startevent = sceneQueueTaskStarted(task, self.stats, self.rq)
bb.event.fire(startevent, self.cfgData)
- taskdepdata = self.sq_build_taskdepdata(task)
-
taskdep = self.rqdata.dataCaches[mc].task_deps[taskfn]
- taskhash = self.rqdata.get_task_hash(task)
- unihash = self.rqdata.get_task_unihash(task)
+ realfn = bb.cache.virtualfn2realfn(taskfn)[0]
+ runtask = {
+ 'fn' : taskfn,
+ 'task' : task,
+ 'taskname' : taskname,
+ 'taskhash' : self.rqdata.get_task_hash(task),
+ 'unihash' : self.rqdata.get_task_unihash(task),
+ 'quieterrors' : True,
+ 'appends' : self.cooker.collections[mc].get_file_appends(taskfn),
+ 'layername' : self.cooker.collections[mc].calc_bbfile_priority(realfn)[2],
+ 'taskdepdata' : self.sq_build_taskdepdata(task),
+ 'dry_run' : False,
+ 'taskdep': taskdep,
+ 'fakerootenv' : self.rqdata.dataCaches[mc].fakerootenv[taskfn],
+ 'fakerootdirs' : self.rqdata.dataCaches[mc].fakerootdirs[taskfn],
+ 'fakerootnoenv' : self.rqdata.dataCaches[mc].fakerootnoenv[taskfn]
+ }
+
if 'fakeroot' in taskdep and taskname in taskdep['fakeroot'] and not self.cooker.configuration.dry_run:
if not mc in self.rq.fakeworker:
self.rq.start_fakeworker(self, mc)
- self.rq.fakeworker[mc].process.stdin.write(b"<runtask>" + pickle.dumps((taskfn, task, taskname, taskhash, unihash, True, self.cooker.collections[mc].get_file_appends(taskfn), taskdepdata, False)) + b"</runtask>")
+ RunQueue.send_pickled_data(self.rq.fakeworker[mc].process, runtask, "runtask")
self.rq.fakeworker[mc].process.stdin.flush()
else:
- self.rq.worker[mc].process.stdin.write(b"<runtask>" + pickle.dumps((taskfn, task, taskname, taskhash, unihash, True, self.cooker.collections[mc].get_file_appends(taskfn), taskdepdata, False)) + b"</runtask>")
+ RunQueue.send_pickled_data(self.rq.worker[mc].process, runtask, "runtask")
self.rq.worker[mc].process.stdin.flush()
- self.build_stamps[task] = bb.build.stampfile(taskname, self.rqdata.dataCaches[mc], taskfn, noextra=True)
+ self.build_stamps[task] = bb.parse.siggen.stampfile_mcfn(taskname, taskfn, extrainfo=False)
self.build_stamps2.append(self.build_stamps[task])
self.sq_running.add(task)
self.sq_live.add(task)
@@ -2214,18 +2355,32 @@ class RunQueueExecute:
self.runq_running.add(task)
self.stats.taskActive()
if not (self.cooker.configuration.dry_run or self.rqdata.setscene_enforce):
- bb.build.make_stamp(taskname, self.rqdata.dataCaches[mc], taskfn)
+ bb.build.make_stamp_mcfn(taskname, taskfn)
self.task_complete(task)
return True
else:
startevent = runQueueTaskStarted(task, self.stats, self.rq)
bb.event.fire(startevent, self.cfgData)
- taskdepdata = self.build_taskdepdata(task)
-
taskdep = self.rqdata.dataCaches[mc].task_deps[taskfn]
- taskhash = self.rqdata.get_task_hash(task)
- unihash = self.rqdata.get_task_unihash(task)
+ realfn = bb.cache.virtualfn2realfn(taskfn)[0]
+ runtask = {
+ 'fn' : taskfn,
+ 'task' : task,
+ 'taskname' : taskname,
+ 'taskhash' : self.rqdata.get_task_hash(task),
+ 'unihash' : self.rqdata.get_task_unihash(task),
+ 'quieterrors' : False,
+ 'appends' : self.cooker.collections[mc].get_file_appends(taskfn),
+ 'layername' : self.cooker.collections[mc].calc_bbfile_priority(realfn)[2],
+ 'taskdepdata' : self.build_taskdepdata(task),
+ 'dry_run' : self.rqdata.setscene_enforce,
+ 'taskdep': taskdep,
+ 'fakerootenv' : self.rqdata.dataCaches[mc].fakerootenv[taskfn],
+ 'fakerootdirs' : self.rqdata.dataCaches[mc].fakerootdirs[taskfn],
+ 'fakerootnoenv' : self.rqdata.dataCaches[mc].fakerootnoenv[taskfn]
+ }
+
if 'fakeroot' in taskdep and taskname in taskdep['fakeroot'] and not (self.cooker.configuration.dry_run or self.rqdata.setscene_enforce):
if not mc in self.rq.fakeworker:
try:
@@ -2235,13 +2390,13 @@ class RunQueueExecute:
self.rq.state = runQueueFailed
self.stats.taskFailed()
return True
- self.rq.fakeworker[mc].process.stdin.write(b"<runtask>" + pickle.dumps((taskfn, task, taskname, taskhash, unihash, False, self.cooker.collections[mc].get_file_appends(taskfn), taskdepdata, self.rqdata.setscene_enforce)) + b"</runtask>")
+ RunQueue.send_pickled_data(self.rq.fakeworker[mc].process, runtask, "runtask")
self.rq.fakeworker[mc].process.stdin.flush()
else:
- self.rq.worker[mc].process.stdin.write(b"<runtask>" + pickle.dumps((taskfn, task, taskname, taskhash, unihash, False, self.cooker.collections[mc].get_file_appends(taskfn), taskdepdata, self.rqdata.setscene_enforce)) + b"</runtask>")
+ RunQueue.send_pickled_data(self.rq.worker[mc].process, runtask, "runtask")
self.rq.worker[mc].process.stdin.flush()
- self.build_stamps[task] = bb.build.stampfile(taskname, self.rqdata.dataCaches[mc], taskfn, noextra=True)
+ self.build_stamps[task] = bb.parse.siggen.stampfile_mcfn(taskname, taskfn, extrainfo=False)
self.build_stamps2.append(self.build_stamps[task])
self.runq_running.add(task)
self.stats.taskActive()
@@ -2256,7 +2411,7 @@ class RunQueueExecute:
if self.sq_deferred:
deferred_tid = list(self.sq_deferred.keys())[0]
blocking_tid = self.sq_deferred.pop(deferred_tid)
- logger.warning("Runqeueue deadlocked on deferred tasks, forcing task %s blocked by %s" % (deferred_tid, blocking_tid))
+ logger.warning("Runqueue deadlocked on deferred tasks, forcing task %s blocked by %s" % (deferred_tid, blocking_tid))
return True
if self.failed_tids:
@@ -2292,6 +2447,25 @@ class RunQueueExecute:
ret.add(dep)
return ret
+ # Build the individual cache entries in advance once to save time
+ def build_taskdepdata_cache(self):
+ taskdepdata_cache = {}
+ for task in self.rqdata.runtaskentries:
+ (mc, fn, taskname, taskfn) = split_tid_mcfn(task)
+ taskdepdata_cache[task] = bb.TaskData(
+ pn = self.rqdata.dataCaches[mc].pkg_fn[taskfn],
+ taskname = taskname,
+ fn = fn,
+ deps = self.filtermcdeps(task, mc, self.rqdata.runtaskentries[task].depends),
+ provides = self.rqdata.dataCaches[mc].fn_provides[taskfn],
+ taskhash = self.rqdata.runtaskentries[task].hash,
+ unihash = self.rqdata.runtaskentries[task].unihash,
+ hashfn = self.rqdata.dataCaches[mc].hashfn[taskfn],
+ taskhash_deps = self.rqdata.runtaskentries[task].taskhash_deps,
+ )
+
+ self.taskdepdata_cache = taskdepdata_cache
+
# We filter out multiconfig dependencies from taskdepdata we pass to the tasks
# as most code can't handle them
def build_taskdepdata(self, task):
@@ -2303,15 +2477,11 @@ class RunQueueExecute:
while next:
additional = []
for revdep in next:
- (mc, fn, taskname, taskfn) = split_tid_mcfn(revdep)
- pn = self.rqdata.dataCaches[mc].pkg_fn[taskfn]
- deps = self.rqdata.runtaskentries[revdep].depends
- provides = self.rqdata.dataCaches[mc].fn_provides[taskfn]
- taskhash = self.rqdata.runtaskentries[revdep].hash
- unihash = self.rqdata.runtaskentries[revdep].unihash
- deps = self.filtermcdeps(task, mc, deps)
- taskdepdata[revdep] = [pn, taskname, fn, deps, provides, taskhash, unihash]
- for revdep2 in deps:
+ self.taskdepdata_cache[revdep] = self.taskdepdata_cache[revdep]._replace(
+ unihash=self.rqdata.runtaskentries[revdep].unihash
+ )
+ taskdepdata[revdep] = self.taskdepdata_cache[revdep]
+ for revdep2 in self.taskdepdata_cache[revdep].deps:
if revdep2 not in taskdepdata:
additional.append(revdep2)
next = additional
@@ -2325,7 +2495,7 @@ class RunQueueExecute:
return
notcovered = set(self.scenequeue_notcovered)
- notcovered |= self.cantskip
+ notcovered |= self.sqdata.cantskip
for tid in self.scenequeue_notcovered:
notcovered |= self.sqdata.sq_covered_tasks[tid]
notcovered |= self.sqdata.unskippable.difference(self.rqdata.runq_setscene_tids)
@@ -2405,18 +2575,28 @@ class RunQueueExecute:
elif self.rqdata.runtaskentries[p].depends.isdisjoint(total):
next.add(p)
+ starttime = time.time()
+ lasttime = starttime
+
# When an item doesn't have dependencies in total, we can process it. Drop items from total when handled
while next:
current = next.copy()
next = set()
+ ready = {}
for tid in current:
if self.rqdata.runtaskentries[p].depends and not self.rqdata.runtaskentries[tid].depends.isdisjoint(total):
continue
+ # get_taskhash for a given tid *must* be called before get_unihash* below
+ ready[tid] = bb.parse.siggen.get_taskhash(tid, self.rqdata.runtaskentries[tid].depends, self.rqdata.dataCaches)
+
+ unihashes = bb.parse.siggen.get_unihashes(ready.keys())
+
+ for tid in ready:
orighash = self.rqdata.runtaskentries[tid].hash
- dc = bb.parse.siggen.get_data_caches(self.rqdata.dataCaches, mc_from_tid(tid))
- newhash = bb.parse.siggen.get_taskhash(tid, self.rqdata.runtaskentries[tid].depends, dc)
+ newhash = ready[tid]
origuni = self.rqdata.runtaskentries[tid].unihash
- newuni = bb.parse.siggen.get_unihash(tid)
+ newuni = unihashes[tid]
+
# FIXME, need to check it can come from sstate at all for determinism?
remapped = False
if newuni == origuni:
@@ -2437,12 +2617,21 @@ class RunQueueExecute:
next |= self.rqdata.runtaskentries[tid].revdeps
total.remove(tid)
next.intersection_update(total)
+ bb.event.check_for_interrupts(self.cooker.data)
+
+ if time.time() > (lasttime + 30):
+ lasttime = time.time()
+ hashequiv_logger.verbose("Rehash loop slow progress: %s in %s" % (len(total), lasttime - starttime))
+
+ endtime = time.time()
+ if (endtime-starttime > 60):
+ hashequiv_logger.verbose("Rehash loop took more than 60s: %s" % (endtime-starttime))
if changed:
for mc in self.rq.worker:
- self.rq.worker[mc].process.stdin.write(b"<newtaskhashes>" + pickle.dumps(bb.parse.siggen.get_taskhashes()) + b"</newtaskhashes>")
+ RunQueue.send_pickled_data(self.rq.worker[mc].process, bb.parse.siggen.get_taskhashes(), "newtaskhashes")
for mc in self.rq.fakeworker:
- self.rq.fakeworker[mc].process.stdin.write(b"<newtaskhashes>" + pickle.dumps(bb.parse.siggen.get_taskhashes()) + b"</newtaskhashes>")
+ RunQueue.send_pickled_data(self.rq.fakeworker[mc].process, bb.parse.siggen.get_taskhashes(), "newtaskhashes")
hashequiv_logger.debug(pprint.pformat("Tasks changed:\n%s" % (changed)))
@@ -2489,17 +2678,6 @@ class RunQueueExecute:
self.sq_buildable.remove(tid)
if tid in self.sq_running:
self.sq_running.remove(tid)
- harddepfail = False
- for t in self.sqdata.sq_harddeps:
- if tid in self.sqdata.sq_harddeps[t] and t in self.scenequeue_notcovered:
- harddepfail = True
- break
- if not harddepfail and self.sqdata.sq_revdeps[tid].issubset(self.scenequeue_covered | self.scenequeue_notcovered):
- if tid not in self.sq_buildable:
- self.sq_buildable.add(tid)
- if not self.sqdata.sq_revdeps[tid]:
- self.sq_buildable.add(tid)
-
if tid in self.sqdata.outrightfail:
self.sqdata.outrightfail.remove(tid)
if tid in self.scenequeue_notcovered:
@@ -2510,7 +2688,7 @@ class RunQueueExecute:
self.scenequeue_notneeded.remove(tid)
(mc, fn, taskname, taskfn) = split_tid_mcfn(tid)
- self.sqdata.stamps[tid] = bb.build.stampfile(taskname + "_setscene", self.rqdata.dataCaches[mc], taskfn, noextra=True)
+ self.sqdata.stamps[tid] = bb.parse.siggen.stampfile_mcfn(taskname, taskfn, extrainfo=False)
if tid in self.stampcache:
del self.stampcache[tid]
@@ -2518,34 +2696,52 @@ class RunQueueExecute:
if tid in self.build_stamps:
del self.build_stamps[tid]
- update_tasks.append((tid, harddepfail, tid in self.sqdata.valid))
+ update_tasks.append(tid)
- if update_tasks:
+ update_tasks2 = []
+ for tid in update_tasks:
+ harddepfail = False
+ for t in self.sqdata.sq_harddeps_rev[tid]:
+ if t in self.scenequeue_notcovered:
+ harddepfail = True
+ break
+ if not harddepfail and self.sqdata.sq_revdeps[tid].issubset(self.scenequeue_covered | self.scenequeue_notcovered):
+ if tid not in self.sq_buildable:
+ self.sq_buildable.add(tid)
+ if not self.sqdata.sq_revdeps[tid]:
+ self.sq_buildable.add(tid)
+
+ update_tasks2.append((tid, harddepfail, tid in self.sqdata.valid))
+
+ if update_tasks2:
self.sqdone = False
for mc in sorted(self.sqdata.multiconfigs):
- for tid in sorted([t[0] for t in update_tasks]):
+ for tid in sorted([t[0] for t in update_tasks2]):
if mc_from_tid(tid) != mc:
continue
h = pending_hash_index(tid, self.rqdata)
if h in self.sqdata.hashes and tid != self.sqdata.hashes[h]:
self.sq_deferred[tid] = self.sqdata.hashes[h]
bb.note("Deferring %s after %s" % (tid, self.sqdata.hashes[h]))
- update_scenequeue_data([t[0] for t in update_tasks], self.sqdata, self.rqdata, self.rq, self.cooker, self.stampcache, self, summary=False)
+ update_scenequeue_data([t[0] for t in update_tasks2], self.sqdata, self.rqdata, self.rq, self.cooker, self.stampcache, self, summary=False)
- for (tid, harddepfail, origvalid) in update_tasks:
+ for (tid, harddepfail, origvalid) in update_tasks2:
if tid in self.sqdata.valid and not origvalid:
hashequiv_logger.verbose("Setscene task %s became valid" % tid)
if harddepfail:
+ logger.debug2("%s has an unavailable hard dependency so skipping" % (tid))
self.sq_task_failoutright(tid)
if changed:
self.stats.updateCovered(len(self.scenequeue_covered), len(self.scenequeue_notcovered))
+ self.sq_needed_harddeps = set()
+ self.sq_harddep_deferred = set()
self.holdoff_need_update = True
def scenequeue_updatecounters(self, task, fail=False):
- for dep in sorted(self.sqdata.sq_deps[task]):
- if fail and task in self.sqdata.sq_harddeps and dep in self.sqdata.sq_harddeps[task]:
+ if fail and task in self.sqdata.sq_harddeps:
+ for dep in sorted(self.sqdata.sq_harddeps[task]):
if dep in self.scenequeue_covered or dep in self.scenequeue_notcovered:
# dependency could be already processed, e.g. noexec setscene task
continue
@@ -2555,6 +2751,7 @@ class RunQueueExecute:
logger.debug2("%s was unavailable and is a hard dependency of %s so skipping" % (task, dep))
self.sq_task_failoutright(dep)
continue
+ for dep in sorted(self.sqdata.sq_deps[task]):
if self.sqdata.sq_revdeps[dep].issubset(self.scenequeue_covered | self.scenequeue_notcovered):
if dep not in self.sq_buildable:
self.sq_buildable.add(dep)
@@ -2573,6 +2770,13 @@ class RunQueueExecute:
new.add(dep)
next = new
+ # If this task was one which other setscene tasks have a hard dependency upon, we need
+ # to walk through the hard dependencies and allow execution of those which have completed dependencies.
+ if task in self.sqdata.sq_harddeps:
+ for dep in self.sq_harddep_deferred.copy():
+ if self.sqdata.sq_harddeps_rev[dep].issubset(self.scenequeue_covered | self.scenequeue_notcovered):
+ self.sq_harddep_deferred.remove(dep)
+
self.stats.updateCovered(len(self.scenequeue_covered), len(self.scenequeue_notcovered))
self.holdoff_need_update = True
@@ -2641,12 +2845,19 @@ class RunQueueExecute:
additional = []
for revdep in next:
(mc, fn, taskname, taskfn) = split_tid_mcfn(revdep)
- pn = self.rqdata.dataCaches[mc].pkg_fn[taskfn]
deps = getsetscenedeps(revdep)
- provides = self.rqdata.dataCaches[mc].fn_provides[taskfn]
- taskhash = self.rqdata.runtaskentries[revdep].hash
- unihash = self.rqdata.runtaskentries[revdep].unihash
- taskdepdata[revdep] = [pn, taskname, fn, deps, provides, taskhash, unihash]
+
+ taskdepdata[revdep] = bb.TaskData(
+ pn = self.rqdata.dataCaches[mc].pkg_fn[taskfn],
+ taskname = taskname,
+ fn = fn,
+ deps = deps,
+ provides = self.rqdata.dataCaches[mc].fn_provides[taskfn],
+ taskhash = self.rqdata.runtaskentries[revdep].hash,
+ unihash = self.rqdata.runtaskentries[revdep].unihash,
+ hashfn = self.rqdata.dataCaches[mc].hashfn[taskfn],
+ taskhash_deps = self.rqdata.runtaskentries[revdep].taskhash_deps,
+ )
for revdep2 in deps:
if revdep2 not in taskdepdata:
additional.append(revdep2)
@@ -2690,6 +2901,7 @@ class SQData(object):
self.sq_revdeps = {}
# Injected inter-setscene task dependencies
self.sq_harddeps = {}
+ self.sq_harddeps_rev = {}
# Cache of stamp files so duplicates can't run in parallel
self.stamps = {}
# Setscene tasks directly depended upon by the build
@@ -2699,12 +2911,17 @@ class SQData(object):
# A list of normal tasks a setscene task covers
self.sq_covered_tasks = {}
-def build_scenequeue_data(sqdata, rqdata, rq, cooker, stampcache, sqrq):
+def build_scenequeue_data(sqdata, rqdata, sqrq):
sq_revdeps = {}
sq_revdeps_squash = {}
sq_collated_deps = {}
+ # We can't skip specified target tasks which aren't setscene tasks
+ sqdata.cantskip = set(rqdata.target_tids)
+ sqdata.cantskip.difference_update(rqdata.runq_setscene_tids)
+ sqdata.cantskip.intersection_update(rqdata.runtaskentries)
+
# We need to construct a dependency graph for the setscene functions. Intermediate
# dependencies between the setscene tasks only complicate the code. This code
# therefore aims to collapse the huge runqueue dependency tree into a smaller one
@@ -2773,7 +2990,7 @@ def build_scenequeue_data(sqdata, rqdata, rq, cooker, stampcache, sqrq):
for tid in rqdata.runtaskentries:
if not rqdata.runtaskentries[tid].revdeps:
sqdata.unskippable.add(tid)
- sqdata.unskippable |= sqrq.cantskip
+ sqdata.unskippable |= sqdata.cantskip
while new:
new = False
orig = sqdata.unskippable.copy()
@@ -2810,7 +3027,9 @@ def build_scenequeue_data(sqdata, rqdata, rq, cooker, stampcache, sqrq):
(mc, fn, taskname, taskfn) = split_tid_mcfn(tid)
realtid = tid + "_setscene"
idepends = rqdata.taskData[mc].taskentries[realtid].idepends
- sqdata.stamps[tid] = bb.build.stampfile(taskname + "_setscene", rqdata.dataCaches[mc], taskfn, noextra=True)
+ sqdata.stamps[tid] = bb.parse.siggen.stampfile_mcfn(taskname, taskfn, extrainfo=False)
+
+ sqdata.sq_harddeps_rev[tid] = set()
for (depname, idependtask) in idepends:
if depname not in rqdata.taskData[mc].build_targets:
@@ -2823,20 +3042,15 @@ def build_scenequeue_data(sqdata, rqdata, rq, cooker, stampcache, sqrq):
if deptid not in rqdata.runtaskentries:
bb.msg.fatal("RunQueue", "Task %s depends upon non-existent task %s:%s" % (realtid, depfn, idependtask))
+ logger.debug2("Adding hard setscene dependency %s for %s" % (deptid, tid))
+
if not deptid in sqdata.sq_harddeps:
sqdata.sq_harddeps[deptid] = set()
sqdata.sq_harddeps[deptid].add(tid)
-
- sq_revdeps_squash[tid].add(deptid)
- # Have to zero this to avoid circular dependencies
- sq_revdeps_squash[deptid] = set()
+ sqdata.sq_harddeps_rev[tid].add(deptid)
rqdata.init_progress_reporter.next_stage()
- for task in sqdata.sq_harddeps:
- for dep in sqdata.sq_harddeps[task]:
- sq_revdeps_squash[dep].add(task)
-
rqdata.init_progress_reporter.next_stage()
#for tid in sq_revdeps_squash:
@@ -2863,7 +3077,7 @@ def build_scenequeue_data(sqdata, rqdata, rq, cooker, stampcache, sqrq):
if not sqdata.sq_revdeps[tid]:
sqrq.sq_buildable.add(tid)
- rqdata.init_progress_reporter.finish()
+ rqdata.init_progress_reporter.next_stage()
sqdata.noexec = set()
sqdata.stamppresent = set()
@@ -2880,23 +3094,7 @@ def build_scenequeue_data(sqdata, rqdata, rq, cooker, stampcache, sqrq):
sqdata.hashes[h] = tid
else:
sqrq.sq_deferred[tid] = sqdata.hashes[h]
- bb.note("Deferring %s after %s" % (tid, sqdata.hashes[h]))
-
- update_scenequeue_data(sqdata.sq_revdeps, sqdata, rqdata, rq, cooker, stampcache, sqrq, summary=True)
-
- # Compute a list of 'stale' sstate tasks where the current hash does not match the one
- # in any stamp files. Pass the list out to metadata as an event.
- found = {}
- for tid in rqdata.runq_setscene_tids:
- (mc, fn, taskname, taskfn) = split_tid_mcfn(tid)
- stamps = bb.build.find_stale_stamps(taskname, rqdata.dataCaches[mc], taskfn)
- if stamps:
- if mc not in found:
- found[mc] = {}
- found[mc][tid] = stamps
- for mc in found:
- event = bb.event.StaleSetSceneTasks(found[mc])
- bb.event.fire(event, cooker.databuilder.mcdata[mc])
+ bb.debug(1, "Deferring %s after %s" % (tid, sqdata.hashes[h]))
def check_setscene_stamps(tid, rqdata, rq, stampcache, noexecstamp=False):
@@ -2905,7 +3103,7 @@ def check_setscene_stamps(tid, rqdata, rq, stampcache, noexecstamp=False):
taskdep = rqdata.dataCaches[mc].task_deps[taskfn]
if 'noexec' in taskdep and taskname in taskdep['noexec']:
- bb.build.make_stamp(taskname + "_setscene", rqdata.dataCaches[mc], taskfn)
+ bb.build.make_stamp_mcfn(taskname + "_setscene", taskfn)
return True, False
if rq.check_stamp_task(tid, taskname + "_setscene", cache=stampcache):
@@ -2935,11 +3133,13 @@ def update_scenequeue_data(tids, sqdata, rqdata, rq, cooker, stampcache, sqrq, s
if noexec:
sqdata.noexec.add(tid)
sqrq.sq_task_skip(tid)
+ logger.debug2("%s is noexec so skipping setscene" % (tid))
continue
if stamppresent:
sqdata.stamppresent.add(tid)
sqrq.sq_task_skip(tid)
+ logger.debug2("%s has a valid stamp, skipping" % (tid))
continue
tocheck.add(tid)
@@ -2960,6 +3160,7 @@ def update_scenequeue_data(tids, sqdata, rqdata, rq, cooker, stampcache, sqrq, s
if tid in sqrq.sq_deferred:
continue
sqdata.outrightfail.add(tid)
+ logger.debug2("%s already handled (fallthrough), skipping" % (tid))
class TaskFailure(Exception):
"""
@@ -3089,15 +3290,12 @@ class runQueuePipe():
if pipeout:
pipeout.close()
bb.utils.nonblockingfd(self.input)
- self.queue = b""
+ self.queue = bytearray()
self.d = d
self.rq = rq
self.rqexec = rqexec
self.fakerootlogs = fakerootlogs
- def setrunqueueexec(self, rqexec):
- self.rqexec = rqexec
-
def read(self):
for workers, name in [(self.rq.worker, "Worker"), (self.rq.fakeworker, "Fakeroot")]:
for worker in workers.values():
@@ -3108,7 +3306,7 @@ class runQueuePipe():
start = len(self.queue)
try:
- self.queue = self.queue + (self.input.read(102400) or b"")
+ self.queue.extend(self.input.read(102400) or b"")
except (OSError, IOError) as e:
if e.errno != errno.EAGAIN:
raise
diff --git a/bitbake/lib/bb/server/process.py b/bitbake/lib/bb/server/process.py
index 5d02c0b9f5..76b189291d 100644
--- a/bitbake/lib/bb/server/process.py
+++ b/bitbake/lib/bb/server/process.py
@@ -28,6 +28,7 @@ import datetime
import pickle
import traceback
import gc
+import stat
import bb.server.xmlrpcserver
from bb import daemonize
from multiprocessing import queues
@@ -37,9 +38,46 @@ logger = logging.getLogger('BitBake')
class ProcessTimeout(SystemExit):
pass
+def currenttime():
+ return datetime.datetime.now().strftime('%H:%M:%S.%f')
+
def serverlog(msg):
- print(str(os.getpid()) + " " + datetime.datetime.now().strftime('%H:%M:%S.%f') + " " + msg)
- sys.stdout.flush()
+ print(str(os.getpid()) + " " + currenttime() + " " + msg)
+ #Seems a flush here triggers filesytem sync like behaviour and long hangs in the server
+ #sys.stdout.flush()
+
+#
+# When we have lockfile issues, try and find infomation about which process is
+# using the lockfile
+#
+def get_lockfile_process_msg(lockfile):
+ # Some systems may not have lsof available
+ procs = None
+ try:
+ procs = subprocess.check_output(["lsof", '-w', lockfile], stderr=subprocess.STDOUT)
+ except subprocess.CalledProcessError:
+ # File was deleted?
+ pass
+ except OSError as e:
+ if e.errno != errno.ENOENT:
+ raise
+ if procs is None:
+ # Fall back to fuser if lsof is unavailable
+ try:
+ procs = subprocess.check_output(["fuser", '-v', lockfile], stderr=subprocess.STDOUT)
+ except subprocess.CalledProcessError:
+ # File was deleted?
+ pass
+ except OSError as e:
+ if e.errno != errno.ENOENT:
+ raise
+ if procs:
+ return procs.decode("utf-8")
+ return None
+
+class idleFinish():
+ def __init__(self, msg):
+ self.msg = msg
class ProcessServer():
profile_filename = "profile.log"
@@ -58,12 +96,19 @@ class ProcessServer():
self.maxuiwait = 30
self.xmlrpc = False
+ self.idle = None
+ # Need a lock for _idlefuns changes
self._idlefuns = {}
+ self._idlefuncsLock = threading.Lock()
+ self.idle_cond = threading.Condition(self._idlefuncsLock)
self.bitbake_lock = lock
self.bitbake_lock_name = lockname
self.sock = sock
self.sockname = sockname
+ # It is possible the directory may be renamed. Cache the inode of the socket file
+ # so we can tell if things changed.
+ self.sockinode = os.stat(self.sockname)[stat.ST_INO]
self.server_timeout = server_timeout
self.timeout = self.server_timeout
@@ -72,7 +117,9 @@ class ProcessServer():
def register_idle_function(self, function, data):
"""Register a function to be called while the server is idle"""
assert hasattr(function, '__call__')
- self._idlefuns[function] = data
+ with bb.utils.lock_timeout(self._idlefuncsLock):
+ self._idlefuns[function] = data
+ serverlog("Registering idle function %s" % str(function))
def run(self):
@@ -111,6 +158,31 @@ class ProcessServer():
return ret
+ def _idle_check(self):
+ return len(self._idlefuns) == 0 and self.cooker.command.currentAsyncCommand is None
+
+ def wait_for_idle(self, timeout=30):
+ # Wait for the idle loop to have cleared
+ with bb.utils.lock_timeout(self._idlefuncsLock):
+ return self.idle_cond.wait_for(self._idle_check, timeout) is not False
+
+ def set_async_cmd(self, cmd):
+ with bb.utils.lock_timeout(self._idlefuncsLock):
+ ret = self.idle_cond.wait_for(self._idle_check, 30)
+ if ret is False:
+ return False
+ self.cooker.command.currentAsyncCommand = cmd
+ return True
+
+ def clear_async_cmd(self):
+ with bb.utils.lock_timeout(self._idlefuncsLock):
+ self.cooker.command.currentAsyncCommand = None
+ self.idle_cond.notify_all()
+
+ def get_async_cmd(self):
+ with bb.utils.lock_timeout(self._idlefuncsLock):
+ return self.cooker.command.currentAsyncCommand
+
def main(self):
self.cooker.pre_serve()
@@ -125,14 +197,19 @@ class ProcessServer():
fds.append(self.xmlrpc)
seendata = False
serverlog("Entering server connection loop")
+ serverlog("Lockfile is: %s\nSocket is %s (%s)" % (self.bitbake_lock_name, self.sockname, os.path.exists(self.sockname)))
def disconnect_client(self, fds):
- serverlog("Disconnecting Client")
+ serverlog("Disconnecting Client (socket: %s)" % os.path.exists(self.sockname))
if self.controllersock:
fds.remove(self.controllersock)
self.controllersock.close()
self.controllersock = False
if self.haveui:
+ # Wait for the idle loop to have cleared (30s max)
+ if not self.wait_for_idle(30):
+ serverlog("Idle loop didn't finish queued commands after 30s, exiting.")
+ self.quit = True
fds.remove(self.command_channel)
bb.event.unregister_UIHhandler(self.event_handle, True)
self.command_channel_reply.writer.close()
@@ -144,7 +221,7 @@ class ProcessServer():
self.cooker.clientComplete()
self.haveui = False
ready = select.select(fds,[],[],0)[0]
- if newconnections:
+ if newconnections and not self.quit:
serverlog("Starting new client")
conn = newconnections.pop(-1)
fds.append(conn)
@@ -216,8 +293,10 @@ class ProcessServer():
continue
try:
serverlog("Running command %s" % command)
- self.command_channel_reply.send(self.cooker.command.runCommand(command))
- serverlog("Command Completed")
+ reply = self.cooker.command.runCommand(command, self)
+ serverlog("Sending reply %s" % repr(reply))
+ self.command_channel_reply.send(reply)
+ serverlog("Command Completed (socket: %s)" % os.path.exists(self.sockname))
except Exception as e:
stack = traceback.format_exc()
serverlog('Exception in server main event loop running command %s (%s)' % (command, stack))
@@ -244,16 +323,25 @@ class ProcessServer():
ready = self.idle_commands(.1, fds)
- serverlog("Exiting")
+ if self.idle:
+ self.idle.join()
+
+ serverlog("Exiting (socket: %s)" % os.path.exists(self.sockname))
# Remove the socket file so we don't get any more connections to avoid races
+ # The build directory could have been renamed so if the file isn't the one we created
+ # we shouldn't delete it.
try:
- os.unlink(self.sockname)
- except:
- pass
+ sockinode = os.stat(self.sockname)[stat.ST_INO]
+ if sockinode == self.sockinode:
+ os.unlink(self.sockname)
+ else:
+ serverlog("bitbake.sock inode mismatch (%s vs %s), not deleting." % (sockinode, self.sockinode))
+ except Exception as err:
+ serverlog("Removing socket file '%s' failed (%s)" % (self.sockname, err))
self.sock.close()
try:
- self.cooker.shutdown(True)
+ self.cooker.shutdown(True, idle=False)
self.cooker.notifier.stop()
self.cooker.confignotifier.stop()
except:
@@ -279,20 +367,21 @@ class ProcessServer():
except FileNotFoundError:
return None
- lockcontents = get_lock_contents(lockfile)
- serverlog("Original lockfile contents: " + str(lockcontents))
-
lock.close()
lock = None
while not lock:
i = 0
lock = None
+ if not os.path.exists(os.path.basename(lockfile)):
+ serverlog("Lockfile directory gone, exiting.")
+ return
+
while not lock and i < 30:
lock = bb.utils.lockfile(lockfile, shared=False, retry=False, block=False)
if not lock:
newlockcontents = get_lock_contents(lockfile)
- if newlockcontents != lockcontents:
+ if not newlockcontents[0].startswith([f"{os.getpid()}\n", f"{os.getpid()} "]):
# A new server was started, the lockfile contents changed, we can exit
serverlog("Lockfile now contains different contents, exiting: " + str(newlockcontents))
return
@@ -306,80 +395,108 @@ class ProcessServer():
return
if not lock:
- # Some systems may not have lsof available
- procs = None
- try:
- procs = subprocess.check_output(["lsof", '-w', lockfile], stderr=subprocess.STDOUT)
- except subprocess.CalledProcessError:
- # File was deleted?
- continue
- except OSError as e:
- if e.errno != errno.ENOENT:
- raise
- if procs is None:
- # Fall back to fuser if lsof is unavailable
- try:
- procs = subprocess.check_output(["fuser", '-v', lockfile], stderr=subprocess.STDOUT)
- except subprocess.CalledProcessError:
- # File was deleted?
- continue
- except OSError as e:
- if e.errno != errno.ENOENT:
- raise
-
+ procs = get_lockfile_process_msg(lockfile)
msg = ["Delaying shutdown due to active processes which appear to be holding bitbake.lock"]
if procs:
- msg.append(":\n%s" % str(procs.decode("utf-8")))
+ msg.append(":\n%s" % procs)
serverlog("".join(msg))
- def idle_commands(self, delay, fds=None):
- nextsleep = delay
- if not fds:
- fds = []
-
- for function, data in list(self._idlefuns.items()):
+ def idle_thread(self):
+ if self.cooker.configuration.profile:
try:
- retval = function(self, data, False)
- if retval is False:
- del self._idlefuns[function]
- nextsleep = None
- elif retval is True:
- nextsleep = None
- elif isinstance(retval, float) and nextsleep:
- if (retval < nextsleep):
- nextsleep = retval
- elif nextsleep is None:
- continue
- else:
- fds = fds + retval
- except SystemExit:
- raise
- except Exception as exc:
- if not isinstance(exc, bb.BBHandledException):
- logger.exception('Running idle function')
+ import cProfile as profile
+ except:
+ import profile
+ prof = profile.Profile()
+
+ ret = profile.Profile.runcall(prof, self.idle_thread_internal)
+
+ prof.dump_stats("profile-mainloop.log")
+ bb.utils.process_profilelog("profile-mainloop.log")
+ serverlog("Raw profiling information saved to profile-mainloop.log and processed statistics to profile-mainloop.log.processed")
+ else:
+ self.idle_thread_internal()
+
+ def idle_thread_internal(self):
+ def remove_idle_func(function):
+ with bb.utils.lock_timeout(self._idlefuncsLock):
del self._idlefuns[function]
- self.quit = True
+ self.idle_cond.notify_all()
+
+ while not self.quit:
+ nextsleep = 0.1
+ fds = []
+
+ with bb.utils.lock_timeout(self._idlefuncsLock):
+ items = list(self._idlefuns.items())
- # Create new heartbeat event?
- now = time.time()
- if now >= self.next_heartbeat:
- # We might have missed heartbeats. Just trigger once in
- # that case and continue after the usual delay.
- self.next_heartbeat += self.heartbeat_seconds
- if self.next_heartbeat <= now:
- self.next_heartbeat = now + self.heartbeat_seconds
- if hasattr(self.cooker, "data"):
- heartbeat = bb.event.HeartbeatEvent(now)
+ for function, data in items:
try:
- bb.event.fire(heartbeat, self.cooker.data)
+ retval = function(self, data, False)
+ if isinstance(retval, idleFinish):
+ serverlog("Removing idle function %s at idleFinish" % str(function))
+ remove_idle_func(function)
+ self.cooker.command.finishAsyncCommand(retval.msg)
+ nextsleep = None
+ elif retval is False:
+ serverlog("Removing idle function %s" % str(function))
+ remove_idle_func(function)
+ nextsleep = None
+ elif retval is True:
+ nextsleep = None
+ elif isinstance(retval, float) and nextsleep:
+ if (retval < nextsleep):
+ nextsleep = retval
+ elif nextsleep is None:
+ continue
+ else:
+ fds = fds + retval
+ except SystemExit:
+ raise
except Exception as exc:
if not isinstance(exc, bb.BBHandledException):
- logger.exception('Running heartbeat function')
+ logger.exception('Running idle function')
+ remove_idle_func(function)
+ serverlog("Exception %s broke the idle_thread, exiting" % traceback.format_exc())
self.quit = True
- if nextsleep and now + nextsleep > self.next_heartbeat:
- # Shorten timeout so that we we wake up in time for
- # the heartbeat.
- nextsleep = self.next_heartbeat - now
+
+ # Create new heartbeat event?
+ now = time.time()
+ if bb.event._heartbeat_enabled and now >= self.next_heartbeat:
+ # We might have missed heartbeats. Just trigger once in
+ # that case and continue after the usual delay.
+ self.next_heartbeat += self.heartbeat_seconds
+ if self.next_heartbeat <= now:
+ self.next_heartbeat = now + self.heartbeat_seconds
+ if hasattr(self.cooker, "data"):
+ heartbeat = bb.event.HeartbeatEvent(now)
+ try:
+ bb.event.fire(heartbeat, self.cooker.data)
+ except Exception as exc:
+ if not isinstance(exc, bb.BBHandledException):
+ logger.exception('Running heartbeat function')
+ serverlog("Exception %s broke in idle_thread, exiting" % traceback.format_exc())
+ self.quit = True
+ if nextsleep and bb.event._heartbeat_enabled and now + nextsleep > self.next_heartbeat:
+ # Shorten timeout so that we we wake up in time for
+ # the heartbeat.
+ nextsleep = self.next_heartbeat - now
+
+ if nextsleep is not None:
+ select.select(fds,[],[],nextsleep)[0]
+
+ def idle_commands(self, delay, fds=None):
+ nextsleep = delay
+ if not fds:
+ fds = []
+
+ if not self.idle:
+ self.idle = threading.Thread(target=self.idle_thread)
+ self.idle.start()
+ elif self.idle and not self.idle.is_alive():
+ serverlog("Idle thread terminated, main thread exiting too")
+ bb.error("Idle thread terminated, main thread exiting too")
+ self.quit = True
if nextsleep is not None:
if self.xmlrpc:
@@ -399,12 +516,18 @@ class ServerCommunicator():
self.recv = recv
def runCommand(self, command):
- self.connection.send(command)
+ try:
+ self.connection.send(command)
+ except BrokenPipeError as e:
+ raise BrokenPipeError("bitbake-server might have died or been forcibly stopped, ie. OOM killed") from e
if not self.recv.poll(30):
- logger.info("No reply from server in 30s")
+ logger.info("No reply from server in 30s (for command %s at %s)" % (command[0], currenttime()))
if not self.recv.poll(30):
- raise ProcessTimeout("Timeout while waiting for a reply from the bitbake server (60s)")
- ret, exc = self.recv.get()
+ raise ProcessTimeout("Timeout while waiting for a reply from the bitbake server (60s at %s)" % currenttime())
+ try:
+ ret, exc = self.recv.get()
+ except EOFError as e:
+ raise EOFError("bitbake-server might have died or been forcibly stopped, ie. OOM killed") from e
# Should probably turn all exceptions in exc back into exceptions?
# For now, at least handle BBHandledException
if exc and ("BBHandledException" in exc or "SystemExit" in exc):
@@ -448,13 +571,14 @@ start_log_datetime_format = '%Y-%m-%d %H:%M:%S.%f'
class BitBakeServer(object):
- def __init__(self, lock, sockname, featureset, server_timeout, xmlrpcinterface):
+ def __init__(self, lock, sockname, featureset, server_timeout, xmlrpcinterface, profile):
self.server_timeout = server_timeout
self.xmlrpcinterface = xmlrpcinterface
self.featureset = featureset
self.sockname = sockname
self.bitbake_lock = lock
+ self.profile = profile
self.readypipe, self.readypipein = os.pipe()
# Place the log in the builddirectory alongside the lock file
@@ -518,9 +642,9 @@ class BitBakeServer(object):
os.set_inheritable(self.bitbake_lock.fileno(), True)
os.set_inheritable(self.readypipein, True)
serverscript = os.path.realpath(os.path.dirname(__file__) + "/../../../bin/bitbake-server")
- os.execl(sys.executable, "bitbake-server", serverscript, "decafbad", str(self.bitbake_lock.fileno()), str(self.readypipein), self.logfile, self.bitbake_lock.name, self.sockname, str(self.server_timeout or 0), str(self.xmlrpcinterface[0]), str(self.xmlrpcinterface[1]))
+ os.execl(sys.executable, sys.executable, serverscript, "decafbad", str(self.bitbake_lock.fileno()), str(self.readypipein), self.logfile, self.bitbake_lock.name, self.sockname, str(self.server_timeout or 0), str(int(self.profile)), str(self.xmlrpcinterface[0]), str(self.xmlrpcinterface[1]))
-def execServer(lockfd, readypipeinfd, lockname, sockname, server_timeout, xmlrpcinterface):
+def execServer(lockfd, readypipeinfd, lockname, sockname, server_timeout, xmlrpcinterface, profile):
import bb.cookerdata
import bb.cooker
@@ -532,6 +656,7 @@ def execServer(lockfd, readypipeinfd, lockname, sockname, server_timeout, xmlrpc
# Create server control socket
if os.path.exists(sockname):
+ serverlog("WARNING: removing existing socket file '%s'" % sockname)
os.unlink(sockname)
sock = socket.socket(socket.AF_UNIX, socket.SOCK_STREAM)
@@ -548,7 +673,8 @@ def execServer(lockfd, readypipeinfd, lockname, sockname, server_timeout, xmlrpc
writer = ConnectionWriter(readypipeinfd)
try:
featureset = []
- cooker = bb.cooker.BBCooker(featureset, server.register_idle_function)
+ cooker = bb.cooker.BBCooker(featureset, server)
+ cooker.configuration.profile = profile
except bb.BBHandledException:
return None
writer.send("r")
@@ -667,7 +793,7 @@ class BBUIEventQueue:
self.t.start()
def getEvent(self):
- with self.eventQueueLock:
+ with bb.utils.lock_timeout(self.eventQueueLock):
if len(self.eventQueue) == 0:
return None
@@ -682,7 +808,7 @@ class BBUIEventQueue:
return self.getEvent()
def queue_event(self, event):
- with self.eventQueueLock:
+ with bb.utils.lock_timeout(self.eventQueueLock):
self.eventQueue.append(event)
self.eventQueueNotify.set()
@@ -718,7 +844,7 @@ class ConnectionReader(object):
return self.reader.poll(timeout)
def get(self):
- with self.rlock:
+ with bb.utils.lock_timeout(self.rlock):
res = self.reader.recv_bytes()
return multiprocessing.reduction.ForkingPickler.loads(res)
@@ -739,7 +865,7 @@ class ConnectionWriter(object):
def _send(self, obj):
gc.disable()
- with self.wlock:
+ with bb.utils.lock_timeout(self.wlock):
self.writer.send_bytes(obj)
gc.enable()
@@ -752,15 +878,14 @@ class ConnectionWriter(object):
# pthread_sigmask block/unblock would be nice but doesn't work, https://bugs.python.org/issue47139
process = multiprocessing.current_process()
if process and hasattr(process, "queue_signals"):
- with process.signal_threadlock:
+ with bb.utils.lock_timeout(process.signal_threadlock):
process.queue_signals = True
self._send(obj)
process.queue_signals = False
- try:
- for sig in process.signal_received.pop():
- process.handle_sig(sig, None)
- except IndexError:
- pass
+
+ while len(process.signal_received) > 0:
+ sig = process.signal_received.pop()
+ process.handle_sig(sig, None)
else:
self._send(obj)
diff --git a/bitbake/lib/bb/server/xmlrpcserver.py b/bitbake/lib/bb/server/xmlrpcserver.py
index 01f55538ae..04b0b17db1 100644
--- a/bitbake/lib/bb/server/xmlrpcserver.py
+++ b/bitbake/lib/bb/server/xmlrpcserver.py
@@ -118,7 +118,7 @@ class BitBakeXMLRPCServerCommands():
"""
Run a cooker command on the server
"""
- return self.server.cooker.command.runCommand(command, self.server.readonly)
+ return self.server.cooker.command.runCommand(command, self.server.parent, self.server.readonly)
def getEventHandle(self):
return self.event_handle
diff --git a/bitbake/lib/bb/siggen.py b/bitbake/lib/bb/siggen.py
index 07bb529452..03dfda6f3c 100644
--- a/bitbake/lib/bb/siggen.py
+++ b/bitbake/lib/bb/siggen.py
@@ -14,6 +14,8 @@ import bb.data
import difflib
import simplediff
import json
+import types
+from contextlib import contextmanager
import bb.compress.zstd
from bb.checksum import FileChecksumCache
from bb import runqueue
@@ -23,15 +25,33 @@ import hashserv.client
logger = logging.getLogger('BitBake.SigGen')
hashequiv_logger = logging.getLogger('BitBake.SigGen.HashEquiv')
+#find_siginfo and find_siginfo_version are set by the metadata siggen
+# The minimum version of the find_siginfo function we need
+find_siginfo_minversion = 2
+
+HASHSERV_ENVVARS = [
+ "SSL_CERT_DIR",
+ "SSL_CERT_FILE",
+ "NO_PROXY",
+ "HTTPS_PROXY",
+ "HTTP_PROXY"
+]
+
+def check_siggen_version(siggen):
+ if not hasattr(siggen, "find_siginfo_version"):
+ bb.fatal("Siggen from metadata (OE-Core?) is too old, please update it (no version found)")
+ if siggen.find_siginfo_version < siggen.find_siginfo_minversion:
+ bb.fatal("Siggen from metadata (OE-Core?) is too old, please update it (%s vs %s)" % (siggen.find_siginfo_version, siggen.find_siginfo_minversion))
+
class SetEncoder(json.JSONEncoder):
def default(self, obj):
- if isinstance(obj, set):
+ if isinstance(obj, set) or isinstance(obj, frozenset):
return dict(_set_object=list(sorted(obj)))
return json.JSONEncoder.default(self, obj)
def SetDecoder(dct):
if '_set_object' in dct:
- return set(dct['_set_object'])
+ return frozenset(dct['_set_object'])
return dct
def init(d):
@@ -53,11 +73,6 @@ class SignatureGenerator(object):
"""
name = "noop"
- # If the derived class supports multiconfig datacaches, set this to True
- # The default is False for backward compatibility with derived signature
- # generators that do not understand multiconfig caches
- supports_multiconfig_datacaches = False
-
def __init__(self, data):
self.basehash = {}
self.taskhash = {}
@@ -75,9 +90,39 @@ class SignatureGenerator(object):
def postparsing_clean_cache(self):
return
+ def setup_datacache(self, datacaches):
+ self.datacaches = datacaches
+
+ def setup_datacache_from_datastore(self, mcfn, d):
+ # In task context we have no cache so setup internal data structures
+ # from the fully parsed data store provided
+
+ mc = d.getVar("__BBMULTICONFIG", False) or ""
+ tasks = d.getVar('__BBTASKS', False)
+
+ self.datacaches = {}
+ self.datacaches[mc] = types.SimpleNamespace()
+ setattr(self.datacaches[mc], "stamp", {})
+ self.datacaches[mc].stamp[mcfn] = d.getVar('STAMP')
+ setattr(self.datacaches[mc], "stamp_extrainfo", {})
+ self.datacaches[mc].stamp_extrainfo[mcfn] = {}
+ for t in tasks:
+ flag = d.getVarFlag(t, "stamp-extra-info")
+ if flag:
+ self.datacaches[mc].stamp_extrainfo[mcfn][t] = flag
+
+ def get_cached_unihash(self, tid):
+ return None
+
def get_unihash(self, tid):
+ unihash = self.get_cached_unihash(tid)
+ if unihash:
+ return unihash
return self.taskhash[tid]
+ def get_unihashes(self, tids):
+ return {tid: self.get_unihash(tid) for tid in tids}
+
def prep_taskhash(self, tid, deps, dataCaches):
return
@@ -89,17 +134,51 @@ class SignatureGenerator(object):
"""Write/update the file checksum cache onto disk"""
return
+ def stampfile_base(self, mcfn):
+ mc = bb.runqueue.mc_from_tid(mcfn)
+ return self.datacaches[mc].stamp[mcfn]
+
+ def stampfile_mcfn(self, taskname, mcfn, extrainfo=True):
+ mc = bb.runqueue.mc_from_tid(mcfn)
+ stamp = self.datacaches[mc].stamp[mcfn]
+ if not stamp:
+ return
+
+ stamp_extrainfo = ""
+ if extrainfo:
+ taskflagname = taskname
+ if taskname.endswith("_setscene"):
+ taskflagname = taskname.replace("_setscene", "")
+ stamp_extrainfo = self.datacaches[mc].stamp_extrainfo[mcfn].get(taskflagname) or ""
+
+ return self.stampfile(stamp, mcfn, taskname, stamp_extrainfo)
+
def stampfile(self, stampbase, file_name, taskname, extrainfo):
return ("%s.%s.%s" % (stampbase, taskname, extrainfo)).rstrip('.')
+ def stampcleanmask_mcfn(self, taskname, mcfn):
+ mc = bb.runqueue.mc_from_tid(mcfn)
+ stamp = self.datacaches[mc].stamp[mcfn]
+ if not stamp:
+ return []
+
+ taskflagname = taskname
+ if taskname.endswith("_setscene"):
+ taskflagname = taskname.replace("_setscene", "")
+ stamp_extrainfo = self.datacaches[mc].stamp_extrainfo[mcfn].get(taskflagname) or ""
+
+ return self.stampcleanmask(stamp, mcfn, taskname, stamp_extrainfo)
+
def stampcleanmask(self, stampbase, file_name, taskname, extrainfo):
return ("%s.%s.%s" % (stampbase, taskname, extrainfo)).rstrip('.')
- def dump_sigtask(self, fn, task, stampbase, runtime):
+ def dump_sigtask(self, mcfn, task, stampbase, runtime):
return
- def invalidate_task(self, task, d, fn):
- bb.build.del_stamp(task, d, fn)
+ def invalidate_task(self, task, mcfn):
+ mc = bb.runqueue.mc_from_tid(mcfn)
+ stamp = self.datacaches[mc].stamp[mcfn]
+ bb.utils.remove(stamp)
def dump_sigs(self, dataCache, options):
return
@@ -128,41 +207,14 @@ class SignatureGenerator(object):
def set_setscene_tasks(self, setscene_tasks):
return
- @classmethod
- def get_data_caches(cls, dataCaches, mc):
- """
- This function returns the datacaches that should be passed to signature
- generator functions. If the signature generator supports multiconfig
- caches, the entire dictionary of data caches is sent, otherwise a
- special proxy is sent that support both index access to all
- multiconfigs, and also direct access for the default multiconfig.
-
- The proxy class allows code in this class itself to always use
- multiconfig aware code (to ease maintenance), but derived classes that
- are unaware of multiconfig data caches can still access the default
- multiconfig as expected.
-
- Do not override this function in derived classes; it will be removed in
- the future when support for multiconfig data caches is mandatory
- """
- class DataCacheProxy(object):
- def __init__(self):
- pass
-
- def __getitem__(self, key):
- return dataCaches[key]
-
- def __getattr__(self, name):
- return getattr(dataCaches[mc], name)
-
- if cls.supports_multiconfig_datacaches:
- return dataCaches
-
- return DataCacheProxy()
-
def exit(self):
return
+def build_pnid(mc, pn, taskname):
+ if mc:
+ return "mc:" + mc + ":" + pn + ":" + taskname
+ return pn + ":" + taskname
+
class SignatureGeneratorBasic(SignatureGenerator):
"""
"""
@@ -172,12 +224,9 @@ class SignatureGeneratorBasic(SignatureGenerator):
self.basehash = {}
self.taskhash = {}
self.unihash = {}
- self.taskdeps = {}
self.runtaskdeps = {}
self.file_checksum_values = {}
self.taints = {}
- self.gendeps = {}
- self.lookupcache = {}
self.setscenetasks = set()
self.basehash_ignore_vars = set((data.getVar("BB_BASEHASH_IGNORE_VARS") or "").split())
self.taskhash_ignore_tasks = None
@@ -201,15 +250,15 @@ class SignatureGeneratorBasic(SignatureGenerator):
else:
self.twl = None
- def _build_data(self, fn, d):
+ def _build_data(self, mcfn, d):
ignore_mismatch = ((d.getVar("BB_HASH_IGNORE_MISMATCH") or '') == '1')
tasklist, gendeps, lookupcache = bb.data.generate_dependencies(d, self.basehash_ignore_vars)
- taskdeps, basehash = bb.data.generate_dependency_hash(tasklist, gendeps, lookupcache, self.basehash_ignore_vars, fn)
+ taskdeps, basehash = bb.data.generate_dependency_hash(tasklist, gendeps, lookupcache, self.basehash_ignore_vars, mcfn)
for task in tasklist:
- tid = fn + ":" + task
+ tid = mcfn + ":" + task
if not ignore_mismatch and tid in self.basehash and self.basehash[tid] != basehash[tid]:
bb.error("When reparsing %s, the basehash value changed from %s to %s. The metadata is not deterministic and this needs to be fixed." % (tid, self.basehash[tid], basehash[tid]))
bb.error("The following commands may help:")
@@ -220,11 +269,7 @@ class SignatureGeneratorBasic(SignatureGenerator):
bb.error("%s -Sprintdiff\n" % cmd)
self.basehash[tid] = basehash[tid]
- self.taskdeps[fn] = taskdeps
- self.gendeps[fn] = gendeps
- self.lookupcache[fn] = lookupcache
-
- return taskdeps
+ return taskdeps, gendeps, lookupcache
def set_setscene_tasks(self, setscene_tasks):
self.setscenetasks = set(setscene_tasks)
@@ -232,31 +277,42 @@ class SignatureGeneratorBasic(SignatureGenerator):
def finalise(self, fn, d, variant):
mc = d.getVar("__BBMULTICONFIG", False) or ""
+ mcfn = fn
if variant or mc:
- fn = bb.cache.realfn2virtual(fn, variant, mc)
+ mcfn = bb.cache.realfn2virtual(fn, variant, mc)
try:
- taskdeps = self._build_data(fn, d)
+ taskdeps, gendeps, lookupcache = self._build_data(mcfn, d)
except bb.parse.SkipRecipe:
raise
except:
- bb.warn("Error during finalise of %s" % fn)
+ bb.warn("Error during finalise of %s" % mcfn)
raise
+ basehashes = {}
+ for task in taskdeps:
+ basehashes[task] = self.basehash[mcfn + ":" + task]
+
+ d.setVar("__siggen_basehashes", basehashes)
+ d.setVar("__siggen_gendeps", gendeps)
+ d.setVar("__siggen_varvals", lookupcache)
+ d.setVar("__siggen_taskdeps", taskdeps)
+
#Slow but can be useful for debugging mismatched basehashes
- #for task in self.taskdeps[fn]:
- # self.dump_sigtask(fn, task, d.getVar("STAMP"), False)
+ #self.setup_datacache_from_datastore(mcfn, d)
+ #for task in taskdeps:
+ # self.dump_sigtask(mcfn, task, d.getVar("STAMP"), False)
- for task in taskdeps:
- d.setVar("BB_BASEHASH:task-%s" % task, self.basehash[fn + ":" + task])
+ def setup_datacache_from_datastore(self, mcfn, d):
+ super().setup_datacache_from_datastore(mcfn, d)
- def postparsing_clean_cache(self):
- #
- # After parsing we can remove some things from memory to reduce our memory footprint
- #
- self.gendeps = {}
- self.lookupcache = {}
- self.taskdeps = {}
+ mc = bb.runqueue.mc_from_tid(mcfn)
+ for attr in ["siggen_varvals", "siggen_taskdeps", "siggen_gendeps"]:
+ if not hasattr(self.datacaches[mc], attr):
+ setattr(self.datacaches[mc], attr, {})
+ self.datacaches[mc].siggen_varvals[mcfn] = d.getVar("__siggen_varvals")
+ self.datacaches[mc].siggen_taskdeps[mcfn] = d.getVar("__siggen_taskdeps")
+ self.datacaches[mc].siggen_gendeps[mcfn] = d.getVar("__siggen_gendeps")
def rundep_check(self, fn, recipename, task, dep, depname, dataCaches):
# Return True if we should keep the dependency, False to drop it
@@ -279,38 +335,37 @@ class SignatureGeneratorBasic(SignatureGenerator):
def prep_taskhash(self, tid, deps, dataCaches):
- (mc, _, task, fn) = bb.runqueue.split_tid_mcfn(tid)
+ (mc, _, task, mcfn) = bb.runqueue.split_tid_mcfn(tid)
self.basehash[tid] = dataCaches[mc].basetaskhash[tid]
self.runtaskdeps[tid] = []
self.file_checksum_values[tid] = []
- recipename = dataCaches[mc].pkg_fn[fn]
+ recipename = dataCaches[mc].pkg_fn[mcfn]
self.tidtopn[tid] = recipename
+ # save hashfn for deps into siginfo?
+ for dep in deps:
+ (depmc, _, deptask, depmcfn) = bb.runqueue.split_tid_mcfn(dep)
+ dep_pn = dataCaches[depmc].pkg_fn[depmcfn]
- for dep in sorted(deps, key=clean_basepath):
- (depmc, _, _, depmcfn) = bb.runqueue.split_tid_mcfn(dep)
- depname = dataCaches[depmc].pkg_fn[depmcfn]
- if not self.supports_multiconfig_datacaches and mc != depmc:
- # If the signature generator doesn't understand multiconfig
- # data caches, any dependency not in the same multiconfig must
- # be skipped for backward compatibility
- continue
- if not self.rundep_check(fn, recipename, task, dep, depname, dataCaches):
+ if not self.rundep_check(mcfn, recipename, task, dep, dep_pn, dataCaches):
continue
+
if dep not in self.taskhash:
bb.fatal("%s is not in taskhash, caller isn't calling in dependency order?" % dep)
- self.runtaskdeps[tid].append(dep)
- if task in dataCaches[mc].file_checksums[fn]:
+ dep_pnid = build_pnid(depmc, dep_pn, deptask)
+ self.runtaskdeps[tid].append((dep_pnid, dep))
+
+ if task in dataCaches[mc].file_checksums[mcfn]:
if self.checksum_cache:
- checksums = self.checksum_cache.get_checksums(dataCaches[mc].file_checksums[fn][task], recipename, self.localdirsexclude)
+ checksums = self.checksum_cache.get_checksums(dataCaches[mc].file_checksums[mcfn][task], recipename, self.localdirsexclude)
else:
- checksums = bb.fetch2.get_file_checksums(dataCaches[mc].file_checksums[fn][task], recipename, self.localdirsexclude)
+ checksums = bb.fetch2.get_file_checksums(dataCaches[mc].file_checksums[mcfn][task], recipename, self.localdirsexclude)
for (f,cs) in checksums:
self.file_checksum_values[tid].append((f,cs))
- taskdep = dataCaches[mc].task_deps[fn]
+ taskdep = dataCaches[mc].task_deps[mcfn]
if 'nostamp' in taskdep and task in taskdep['nostamp']:
# Nostamp tasks need an implicit taint so that they force any dependent tasks to run
if tid in self.taints and self.taints[tid].startswith("nostamp:"):
@@ -321,30 +376,30 @@ class SignatureGeneratorBasic(SignatureGenerator):
taint = str(uuid.uuid4())
self.taints[tid] = "nostamp:" + taint
- taint = self.read_taint(fn, task, dataCaches[mc].stamp[fn])
+ taint = self.read_taint(mcfn, task, dataCaches[mc].stamp[mcfn])
if taint:
self.taints[tid] = taint
logger.warning("%s is tainted from a forced run" % tid)
- return
+ return set(dep for _, dep in self.runtaskdeps[tid])
def get_taskhash(self, tid, deps, dataCaches):
data = self.basehash[tid]
- for dep in self.runtaskdeps[tid]:
- data = data + self.get_unihash(dep)
+ for dep in sorted(self.runtaskdeps[tid]):
+ data += self.get_unihash(dep[1])
- for (f, cs) in self.file_checksum_values[tid]:
+ for (f, cs) in sorted(self.file_checksum_values[tid], key=clean_checksum_file_path):
if cs:
if "/./" in f:
- data = data + "./" + f.split("/./")[1]
- data = data + cs
+ data += "./" + f.split("/./")[1]
+ data += cs
if tid in self.taints:
if self.taints[tid].startswith("nostamp:"):
- data = data + self.taints[tid][8:]
+ data += self.taints[tid][8:]
else:
- data = data + self.taints[tid]
+ data += self.taints[tid]
h = hashlib.sha256(data.encode("utf-8")).hexdigest()
self.taskhash[tid] = h
@@ -366,9 +421,9 @@ class SignatureGeneratorBasic(SignatureGenerator):
def copy_unitaskhashes(self, targetdir):
self.unihash_cache.copyfile(targetdir)
- def dump_sigtask(self, fn, task, stampbase, runtime):
-
- tid = fn + ":" + task
+ def dump_sigtask(self, mcfn, task, stampbase, runtime):
+ tid = mcfn + ":" + task
+ mc = bb.runqueue.mc_from_tid(mcfn)
referencestamp = stampbase
if isinstance(runtime, str) and runtime.startswith("customfile"):
sigfile = stampbase
@@ -385,32 +440,32 @@ class SignatureGeneratorBasic(SignatureGenerator):
data['task'] = task
data['basehash_ignore_vars'] = self.basehash_ignore_vars
data['taskhash_ignore_tasks'] = self.taskhash_ignore_tasks
- data['taskdeps'] = self.taskdeps[fn][task]
+ data['taskdeps'] = self.datacaches[mc].siggen_taskdeps[mcfn][task]
data['basehash'] = self.basehash[tid]
data['gendeps'] = {}
data['varvals'] = {}
- data['varvals'][task] = self.lookupcache[fn][task]
- for dep in self.taskdeps[fn][task]:
+ data['varvals'][task] = self.datacaches[mc].siggen_varvals[mcfn][task]
+ for dep in self.datacaches[mc].siggen_taskdeps[mcfn][task]:
if dep in self.basehash_ignore_vars:
continue
- data['gendeps'][dep] = self.gendeps[fn][dep]
- data['varvals'][dep] = self.lookupcache[fn][dep]
+ data['gendeps'][dep] = self.datacaches[mc].siggen_gendeps[mcfn][dep]
+ data['varvals'][dep] = self.datacaches[mc].siggen_varvals[mcfn][dep]
if runtime and tid in self.taskhash:
- data['runtaskdeps'] = self.runtaskdeps[tid]
+ data['runtaskdeps'] = [dep[0] for dep in sorted(self.runtaskdeps[tid])]
data['file_checksum_values'] = []
- for f,cs in self.file_checksum_values[tid]:
+ for f,cs in sorted(self.file_checksum_values[tid], key=clean_checksum_file_path):
if "/./" in f:
data['file_checksum_values'].append(("./" + f.split("/./")[1], cs))
else:
data['file_checksum_values'].append((os.path.basename(f), cs))
data['runtaskhashes'] = {}
- for dep in data['runtaskdeps']:
- data['runtaskhashes'][dep] = self.get_unihash(dep)
+ for dep in self.runtaskdeps[tid]:
+ data['runtaskhashes'][dep[0]] = self.get_unihash(dep[1])
data['taskhash'] = self.taskhash[tid]
data['unihash'] = self.get_unihash(tid)
- taint = self.read_taint(fn, task, referencestamp)
+ taint = self.read_taint(mcfn, task, referencestamp)
if taint:
data['taint'] = taint
@@ -441,18 +496,6 @@ class SignatureGeneratorBasic(SignatureGenerator):
pass
raise err
- def dump_sigfn(self, fn, dataCaches, options):
- if fn in self.taskdeps:
- for task in self.taskdeps[fn]:
- tid = fn + ":" + task
- mc = bb.runqueue.mc_from_tid(tid)
- if tid not in self.taskhash:
- continue
- if dataCaches[mc].basetaskhash[tid] != self.basehash[tid]:
- bb.error("Bitbake's cached basehash does not match the one we just generated (%s)!" % tid)
- bb.error("The mismatched hashes were %s and %s" % (dataCaches[mc].basetaskhash[tid], self.basehash[tid]))
- self.dump_sigtask(fn, task, dataCaches[mc].stamp[fn], True)
-
class SignatureGeneratorBasicHash(SignatureGeneratorBasic):
name = "basichash"
@@ -463,11 +506,11 @@ class SignatureGeneratorBasicHash(SignatureGeneratorBasic):
# If task is not in basehash, then error
return self.basehash[tid]
- def stampfile(self, stampbase, fn, taskname, extrainfo, clean=False):
- if taskname != "do_setscene" and taskname.endswith("_setscene"):
- tid = fn + ":" + taskname[:-9]
+ def stampfile(self, stampbase, mcfn, taskname, extrainfo, clean=False):
+ if taskname.endswith("_setscene"):
+ tid = mcfn + ":" + taskname[:-9]
else:
- tid = fn + ":" + taskname
+ tid = mcfn + ":" + taskname
if clean:
h = "*"
else:
@@ -475,42 +518,107 @@ class SignatureGeneratorBasicHash(SignatureGeneratorBasic):
return ("%s.%s.%s.%s" % (stampbase, taskname, h, extrainfo)).rstrip('.')
- def stampcleanmask(self, stampbase, fn, taskname, extrainfo):
- return self.stampfile(stampbase, fn, taskname, extrainfo, clean=True)
+ def stampcleanmask(self, stampbase, mcfn, taskname, extrainfo):
+ return self.stampfile(stampbase, mcfn, taskname, extrainfo, clean=True)
+
+ def invalidate_task(self, task, mcfn):
+ bb.note("Tainting hash to force rebuild of task %s, %s" % (mcfn, task))
+
+ mc = bb.runqueue.mc_from_tid(mcfn)
+ stamp = self.datacaches[mc].stamp[mcfn]
- def invalidate_task(self, task, d, fn):
- bb.note("Tainting hash to force rebuild of task %s, %s" % (fn, task))
- bb.build.write_taint(task, d, fn)
+ taintfn = stamp + '.' + task + '.taint'
+
+ import uuid
+ bb.utils.mkdirhier(os.path.dirname(taintfn))
+ # The specific content of the taint file is not really important,
+ # we just need it to be random, so a random UUID is used
+ with open(taintfn, 'w') as taintf:
+ taintf.write(str(uuid.uuid4()))
class SignatureGeneratorUniHashMixIn(object):
def __init__(self, data):
self.extramethod = {}
+ # NOTE: The cache only tracks hashes that exist. Hashes that don't
+ # exist are always queries from the server since it is possible for
+ # hashes to appear over time, but much less likely for them to
+ # disappear
+ self.unihash_exists_cache = set()
+ self.username = None
+ self.password = None
+ self.env = {}
+
+ origenv = data.getVar("BB_ORIGENV")
+ for e in HASHSERV_ENVVARS:
+ value = data.getVar(e)
+ if not value and origenv:
+ value = origenv.getVar(e)
+ if value:
+ self.env[e] = value
super().__init__(data)
def get_taskdata(self):
- return (self.server, self.method, self.extramethod) + super().get_taskdata()
+ return (self.server, self.method, self.extramethod, self.max_parallel, self.username, self.password, self.env) + super().get_taskdata()
def set_taskdata(self, data):
- self.server, self.method, self.extramethod = data[:3]
- super().set_taskdata(data[3:])
+ self.server, self.method, self.extramethod, self.max_parallel, self.username, self.password, self.env = data[:7]
+ super().set_taskdata(data[7:])
+
+ def get_hashserv_creds(self):
+ if self.username and self.password:
+ return {
+ "username": self.username,
+ "password": self.password,
+ }
+
+ return {}
+
+ @contextmanager
+ def _client_env(self):
+ orig_env = os.environ.copy()
+ try:
+ for k, v in self.env.items():
+ os.environ[k] = v
+ yield
+ finally:
+ for k, v in self.env.items():
+ if k in orig_env:
+ os.environ[k] = orig_env[k]
+ else:
+ del os.environ[k]
+
+ @contextmanager
def client(self):
- if getattr(self, '_client', None) is None:
- self._client = hashserv.create_client(self.server)
- return self._client
+ with self._client_env():
+ if getattr(self, '_client', None) is None:
+ self._client = hashserv.create_client(self.server, **self.get_hashserv_creds())
+ yield self._client
+
+ @contextmanager
+ def client_pool(self):
+ with self._client_env():
+ if getattr(self, '_client_pool', None) is None:
+ self._client_pool = hashserv.client.ClientPool(self.server, self.max_parallel, **self.get_hashserv_creds())
+ yield self._client_pool
def reset(self, data):
- if getattr(self, '_client', None) is not None:
- self._client.close()
- self._client = None
+ self.__close_clients()
return super().reset(data)
def exit(self):
- if getattr(self, '_client', None) is not None:
- self._client.close()
- self._client = None
+ self.__close_clients()
return super().exit()
+ def __close_clients(self):
+ with self._client_env():
+ if getattr(self, '_client', None) is not None:
+ self._client.close()
+ self._client = None
+ if getattr(self, '_client_pool', None) is not None:
+ self._client_pool.close()
+ self._client_pool = None
+
def get_stampfile_hash(self, tid):
if tid in self.taskhash:
# If a unique hash is reported, use it as the stampfile hash. This
@@ -542,7 +650,7 @@ class SignatureGeneratorUniHashMixIn(object):
return None
return unihash
- def get_unihash(self, tid):
+ def get_cached_unihash(self, tid):
taskhash = self.taskhash[tid]
# If its not a setscene task we can return
@@ -557,40 +665,105 @@ class SignatureGeneratorUniHashMixIn(object):
self.unihash[tid] = unihash
return unihash
- # In the absence of being able to discover a unique hash from the
- # server, make it be equivalent to the taskhash. The unique "hash" only
- # really needs to be a unique string (not even necessarily a hash), but
- # making it match the taskhash has a few advantages:
- #
- # 1) All of the sstate code that assumes hashes can be the same
- # 2) It provides maximal compatibility with builders that don't use
- # an equivalency server
- # 3) The value is easy for multiple independent builders to derive the
- # same unique hash from the same input. This means that if the
- # independent builders find the same taskhash, but it isn't reported
- # to the server, there is a better chance that they will agree on
- # the unique hash.
- unihash = taskhash
+ return None
- try:
- method = self.method
- if tid in self.extramethod:
- method = method + self.extramethod[tid]
- data = self.client().get_unihash(method, self.taskhash[tid])
- if data:
- unihash = data
+ def _get_method(self, tid):
+ method = self.method
+ if tid in self.extramethod:
+ method = method + self.extramethod[tid]
+
+ return method
+
+ def unihashes_exist(self, query):
+ if len(query) == 0:
+ return {}
+
+ uncached_query = {}
+ result = {}
+ for key, unihash in query.items():
+ if unihash in self.unihash_exists_cache:
+ result[key] = True
+ else:
+ uncached_query[key] = unihash
+
+ if self.max_parallel <= 1 or len(uncached_query) <= 1:
+ # No parallelism required. Make the query serially with the single client
+ with self.client() as client:
+ uncached_result = {
+ key: client.unihash_exists(value) for key, value in uncached_query.items()
+ }
+ else:
+ with self.client_pool() as client_pool:
+ uncached_result = client_pool.unihashes_exist(uncached_query)
+
+ for key, exists in uncached_result.items():
+ if exists:
+ self.unihash_exists_cache.add(query[key])
+ result[key] = exists
+
+ return result
+
+ def get_unihash(self, tid):
+ return self.get_unihashes([tid])[tid]
+
+ def get_unihashes(self, tids):
+ """
+ For a iterable of tids, returns a dictionary that maps each tid to a
+ unihash
+ """
+ result = {}
+ queries = {}
+ query_result = {}
+
+ for tid in tids:
+ unihash = self.get_cached_unihash(tid)
+ if unihash:
+ result[tid] = unihash
+ else:
+ queries[tid] = (self._get_method(tid), self.taskhash[tid])
+
+ if len(queries) == 0:
+ return result
+
+ if self.max_parallel <= 1 or len(queries) <= 1:
+ # No parallelism required. Make the query serially with the single client
+ with self.client() as client:
+ for tid, args in queries.items():
+ query_result[tid] = client.get_unihash(*args)
+ else:
+ with self.client_pool() as client_pool:
+ query_result = client_pool.get_unihashes(queries)
+
+ for tid, unihash in query_result.items():
+ # In the absence of being able to discover a unique hash from the
+ # server, make it be equivalent to the taskhash. The unique "hash" only
+ # really needs to be a unique string (not even necessarily a hash), but
+ # making it match the taskhash has a few advantages:
+ #
+ # 1) All of the sstate code that assumes hashes can be the same
+ # 2) It provides maximal compatibility with builders that don't use
+ # an equivalency server
+ # 3) The value is easy for multiple independent builders to derive the
+ # same unique hash from the same input. This means that if the
+ # independent builders find the same taskhash, but it isn't reported
+ # to the server, there is a better chance that they will agree on
+ # the unique hash.
+ taskhash = self.taskhash[tid]
+ if unihash:
# A unique hash equal to the taskhash is not very interesting,
# so it is reported it at debug level 2. If they differ, that
# is much more interesting, so it is reported at debug level 1
- hashequiv_logger.debug((1, 2)[unihash == taskhash], 'Found unihash %s in place of %s for %s from %s' % (unihash, taskhash, tid, self.server))
+ hashequiv_logger.bbdebug((1, 2)[unihash == taskhash], 'Found unihash %s in place of %s for %s from %s' % (unihash, taskhash, tid, self.server))
else:
hashequiv_logger.debug2('No reported unihash for %s:%s from %s' % (tid, taskhash, self.server))
- except ConnectionError as e:
- bb.warn('Error contacting Hash Equivalence Server %s: %s' % (self.server, str(e)))
+ unihash = taskhash
- self.set_unihash(tid, unihash)
- self.unihash[tid] = unihash
- return unihash
+
+ self.set_unihash(tid, unihash)
+ self.unihash[tid] = unihash
+ result[tid] = unihash
+
+ return result
def report_unihash(self, path, task, d):
import importlib
@@ -599,8 +772,8 @@ class SignatureGeneratorUniHashMixIn(object):
unihash = d.getVar('BB_UNIHASH')
report_taskdata = d.getVar('SSTATE_HASHEQUIV_REPORT_TASKDATA') == '1'
tempdir = d.getVar('T')
- fn = d.getVar('BB_FILENAME')
- tid = fn + ':do_' + task
+ mcfn = d.getVar('BB_FILENAME')
+ tid = mcfn + ':do_' + task
key = tid + ':' + taskhash
if self.setscenetasks and tid not in self.setscenetasks:
@@ -654,12 +827,14 @@ class SignatureGeneratorUniHashMixIn(object):
if tid in self.extramethod:
method = method + self.extramethod[tid]
- data = self.client().report_unihash(taskhash, method, outhash, unihash, extra_data)
+ with self.client() as client:
+ data = client.report_unihash(taskhash, method, outhash, unihash, extra_data)
+
new_unihash = data['unihash']
if new_unihash != unihash:
hashequiv_logger.debug('Task %s unihash changed %s -> %s by server %s' % (taskhash, unihash, new_unihash, self.server))
- bb.event.fire(bb.runqueue.taskUniHashUpdate(fn + ':do_' + task, new_unihash), d)
+ bb.event.fire(bb.runqueue.taskUniHashUpdate(mcfn + ':do_' + task, new_unihash), d)
self.set_unihash(tid, new_unihash)
d.setVar('BB_UNIHASH', new_unihash)
else:
@@ -685,7 +860,9 @@ class SignatureGeneratorUniHashMixIn(object):
if tid in self.extramethod:
method = method + self.extramethod[tid]
- data = self.client().report_unihash_equiv(taskhash, method, wanted_unihash, extra_data)
+ with self.client() as client:
+ data = client.report_unihash_equiv(taskhash, method, wanted_unihash, extra_data)
+
hashequiv_logger.verbose('Reported task %s as unihash %s to %s (%s)' % (tid, wanted_unihash, self.server, str(data)))
if data is None:
@@ -718,20 +895,20 @@ class SignatureGeneratorTestEquivHash(SignatureGeneratorUniHashMixIn, SignatureG
super().init_rundepcheck(data)
self.server = data.getVar('BB_HASHSERVE')
self.method = "sstate_output_hash"
+ self.max_parallel = 1
-#
-# Dummy class used for bitbake-selftest
-#
-class SignatureGeneratorTestMulticonfigDepends(SignatureGeneratorBasicHash):
- name = "TestMulticonfigDepends"
- supports_multiconfig_datacaches = True
+def clean_checksum_file_path(file_checksum_tuple):
+ f, cs = file_checksum_tuple
+ if "/./" in f:
+ return "./" + f.split("/./")[1]
+ return f
def dump_this_task(outfile, d):
import bb.parse
- fn = d.getVar("BB_FILENAME")
+ mcfn = d.getVar("BB_FILENAME")
task = "do_" + d.getVar("BB_CURRENTTASK")
- referencestamp = bb.build.stamp_internal(task, d, None, True)
- bb.parse.siggen.dump_sigtask(fn, task, outfile, "customfile:" + referencestamp)
+ referencestamp = bb.parse.siggen.stampfile_base(mcfn)
+ bb.parse.siggen.dump_sigtask(mcfn, task, outfile, "customfile:" + referencestamp)
def init_colors(enable_color):
"""Initialise colour dict for passing to compare_sigfiles()"""
@@ -784,39 +961,6 @@ def list_inline_diff(oldlist, newlist, colors=None):
ret.append(item)
return '[%s]' % (', '.join(ret))
-def clean_basepath(basepath):
- basepath, dir, recipe_task = basepath.rsplit("/", 2)
- cleaned = dir + '/' + recipe_task
-
- if basepath[0] == '/':
- return cleaned
-
- if basepath.startswith("mc:") and basepath.count(':') >= 2:
- mc, mc_name, basepath = basepath.split(":", 2)
- mc_suffix = ':mc:' + mc_name
- else:
- mc_suffix = ''
-
- # mc stuff now removed from basepath. Whatever was next, if present will be the first
- # suffix. ':/', recipe path start, marks the end of this. Something like
- # 'virtual:a[:b[:c]]:/path...' (b and c being optional)
- if basepath[0] != '/':
- cleaned += ':' + basepath.split(':/', 1)[0]
-
- return cleaned + mc_suffix
-
-def clean_basepaths(a):
- b = {}
- for x in a:
- b[clean_basepath(x)] = a[x]
- return b
-
-def clean_basepaths_list(a):
- b = []
- for x in a:
- b.append(clean_basepath(x))
- return b
-
# Handled renamed fields
def handle_renames(data):
if 'basewhitelist' in data:
@@ -847,10 +991,18 @@ def compare_sigfiles(a, b, recursecb=None, color=False, collapsed=False):
formatparams.update(values)
return formatstr.format(**formatparams)
- with bb.compress.zstd.open(a, "rt", encoding="utf-8", num_threads=1) as f:
- a_data = json.load(f, object_hook=SetDecoder)
- with bb.compress.zstd.open(b, "rt", encoding="utf-8", num_threads=1) as f:
- b_data = json.load(f, object_hook=SetDecoder)
+ try:
+ with bb.compress.zstd.open(a, "rt", encoding="utf-8", num_threads=1) as f:
+ a_data = json.load(f, object_hook=SetDecoder)
+ except (TypeError, OSError) as err:
+ bb.error("Failed to open sigdata file '%s': %s" % (a, str(err)))
+ raise err
+ try:
+ with bb.compress.zstd.open(b, "rt", encoding="utf-8", num_threads=1) as f:
+ b_data = json.load(f, object_hook=SetDecoder)
+ except (TypeError, OSError) as err:
+ bb.error("Failed to open sigdata file '%s': %s" % (b, str(err)))
+ raise err
for data in [a_data, b_data]:
handle_renames(data)
@@ -985,11 +1137,11 @@ def compare_sigfiles(a, b, recursecb=None, color=False, collapsed=False):
a = a_data['runtaskdeps'][idx]
b = b_data['runtaskdeps'][idx]
if a_data['runtaskhashes'][a] != b_data['runtaskhashes'][b] and not collapsed:
- changed.append("%s with hash %s\n changed to\n%s with hash %s" % (clean_basepath(a), a_data['runtaskhashes'][a], clean_basepath(b), b_data['runtaskhashes'][b]))
+ changed.append("%s with hash %s\n changed to\n%s with hash %s" % (a, a_data['runtaskhashes'][a], b, b_data['runtaskhashes'][b]))
if changed:
- clean_a = clean_basepaths_list(a_data['runtaskdeps'])
- clean_b = clean_basepaths_list(b_data['runtaskdeps'])
+ clean_a = a_data['runtaskdeps']
+ clean_b = b_data['runtaskdeps']
if clean_a != clean_b:
output.append(color_format("{color_title}runtaskdeps changed:{color_default}\n%s") % list_inline_diff(clean_a, clean_b, colors))
else:
@@ -998,8 +1150,8 @@ def compare_sigfiles(a, b, recursecb=None, color=False, collapsed=False):
if 'runtaskhashes' in a_data and 'runtaskhashes' in b_data:
- a = clean_basepaths(a_data['runtaskhashes'])
- b = clean_basepaths(b_data['runtaskhashes'])
+ a = a_data['runtaskhashes']
+ b = b_data['runtaskhashes']
changed, added, removed = dict_diff(a, b)
if added:
for dep in sorted(added):
@@ -1056,7 +1208,7 @@ def calc_basehash(sigdata):
basedata = ''
alldeps = sigdata['taskdeps']
- for dep in alldeps:
+ for dep in sorted(alldeps):
basedata = basedata + dep
val = sigdata['varvals'][dep]
if val is not None:
@@ -1088,8 +1240,12 @@ def calc_taskhash(sigdata):
def dump_sigfile(a):
output = []
- with bb.compress.zstd.open(a, "rt", encoding="utf-8", num_threads=1) as f:
- a_data = json.load(f, object_hook=SetDecoder)
+ try:
+ with bb.compress.zstd.open(a, "rt", encoding="utf-8", num_threads=1) as f:
+ a_data = json.load(f, object_hook=SetDecoder)
+ except (TypeError, OSError) as err:
+ bb.error("Failed to open sigdata file '%s': %s" % (a, str(err)))
+ raise err
handle_renames(a_data)
diff --git a/bitbake/lib/bb/tests/codeparser.py b/bitbake/lib/bb/tests/codeparser.py
index 71ed382ab8..c0d1362a0c 100644
--- a/bitbake/lib/bb/tests/codeparser.py
+++ b/bitbake/lib/bb/tests/codeparser.py
@@ -44,6 +44,7 @@ class VariableReferenceTest(ReferenceTest):
def parseExpression(self, exp):
parsedvar = self.d.expandWithRefs(exp, None)
self.references = parsedvar.references
+ self.execs = parsedvar.execs
def test_simple_reference(self):
self.setEmptyVars(["FOO"])
@@ -61,6 +62,11 @@ class VariableReferenceTest(ReferenceTest):
self.parseExpression("${@d.getVar('BAR') + 'foo'}")
self.assertReferences(set(["BAR"]))
+ def test_python_exec_reference(self):
+ self.parseExpression("${@eval('3 * 5')}")
+ self.assertReferences(set())
+ self.assertExecs(set(["eval"]))
+
class ShellReferenceTest(ReferenceTest):
def parseExpression(self, exp):
@@ -100,6 +106,46 @@ ${D}${libdir}/pkgconfig/*.pc
self.parseExpression("foo=$(echo bar)")
self.assertExecs(set(["echo"]))
+ def test_assign_subshell_expansion_quotes(self):
+ self.parseExpression('foo="$(echo bar)"')
+ self.assertExecs(set(["echo"]))
+
+ def test_assign_subshell_expansion_nested(self):
+ self.parseExpression('foo="$(func1 "$(func2 bar$(func3))")"')
+ self.assertExecs(set(["func1", "func2", "func3"]))
+
+ def test_assign_subshell_expansion_multiple(self):
+ self.parseExpression('foo="$(func1 "$(func2)") $(func3)"')
+ self.assertExecs(set(["func1", "func2", "func3"]))
+
+ def test_assign_subshell_expansion_escaped_quotes(self):
+ self.parseExpression('foo="\\"fo\\"o$(func1)"')
+ self.assertExecs(set(["func1"]))
+
+ def test_assign_subshell_expansion_empty(self):
+ self.parseExpression('foo="bar$()foo"')
+ self.assertExecs(set())
+
+ def test_assign_subshell_backticks(self):
+ self.parseExpression("foo=`echo bar`")
+ self.assertExecs(set(["echo"]))
+
+ def test_assign_subshell_backticks_quotes(self):
+ self.parseExpression('foo="`echo bar`"')
+ self.assertExecs(set(["echo"]))
+
+ def test_assign_subshell_backticks_multiple(self):
+ self.parseExpression('foo="`func1 bar` `func2`"')
+ self.assertExecs(set(["func1", "func2"]))
+
+ def test_assign_subshell_backticks_escaped_quotes(self):
+ self.parseExpression('foo="\\"fo\\"o`func1`"')
+ self.assertExecs(set(["func1"]))
+
+ def test_assign_subshell_backticks_empty(self):
+ self.parseExpression('foo="bar``foo"')
+ self.assertExecs(set())
+
def test_shell_unexpanded(self):
self.setEmptyVars(["QT_BASE_NAME"])
self.parseExpression('echo "${QT_BASE_NAME}"')
@@ -318,7 +364,7 @@ d.getVar(a(), False)
"filename": "example.bb",
})
- deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), set(), self.d)
+ deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), set(), set(), self.d, self.d)
self.assertEqual(deps, set(["somevar", "bar", "something", "inexpand", "test", "test2", "a"]))
@@ -365,7 +411,7 @@ esac
self.d.setVarFlags("FOO", {"func": True})
self.setEmptyVars(execs)
- deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), set(), self.d)
+ deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), set(), set(), self.d, self.d)
self.assertEqual(deps, set(["somevar", "inverted"] + execs))
@@ -375,7 +421,7 @@ esac
self.d.setVar("FOO", "foo=oe_libinstall; eval $foo")
self.d.setVarFlag("FOO", "vardeps", "oe_libinstall")
- deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), set(), self.d)
+ deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), set(), set(), self.d, self.d)
self.assertEqual(deps, set(["oe_libinstall"]))
@@ -384,7 +430,7 @@ esac
self.d.setVar("FOO", "foo=oe_libinstall; eval $foo")
self.d.setVarFlag("FOO", "vardeps", "${@'oe_libinstall'}")
- deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), set(), self.d)
+ deps, values = bb.data.build_dependencies("FOO", set(self.d.keys()), set(), set(), set(), set(), self.d, self.d)
self.assertEqual(deps, set(["oe_libinstall"]))
@@ -399,7 +445,7 @@ esac
# Check dependencies
self.d.setVar('ANOTHERVAR', expr)
self.d.setVar('TESTVAR', 'anothervalue testval testval2')
- deps, values = bb.data.build_dependencies("ANOTHERVAR", set(self.d.keys()), set(), set(), set(), self.d)
+ deps, values = bb.data.build_dependencies("ANOTHERVAR", set(self.d.keys()), set(), set(), set(), set(), self.d, self.d)
self.assertEqual(sorted(values.splitlines()),
sorted([expr,
'TESTVAR{anothervalue} = Set',
@@ -418,23 +464,49 @@ esac
self.d.setVar('ANOTHERVAR', varval)
self.d.setVar('TESTVAR', 'anothervalue testval testval2')
self.d.setVar('TESTVAR2', 'testval3')
- deps, values = bb.data.build_dependencies("ANOTHERVAR", set(self.d.keys()), set(), set(), set(["TESTVAR"]), self.d)
+ deps, values = bb.data.build_dependencies("ANOTHERVAR", set(self.d.keys()), set(), set(), set(), set(["TESTVAR"]), self.d, self.d)
self.assertEqual(sorted(values.splitlines()), sorted([varval]))
self.assertEqual(deps, set(["TESTVAR2"]))
self.assertEqual(self.d.getVar('ANOTHERVAR').split(), ['testval3', 'anothervalue'])
# Check the vardepsexclude flag is handled by contains functionality
self.d.setVarFlag('ANOTHERVAR', 'vardepsexclude', 'TESTVAR')
- deps, values = bb.data.build_dependencies("ANOTHERVAR", set(self.d.keys()), set(), set(), set(), self.d)
+ deps, values = bb.data.build_dependencies("ANOTHERVAR", set(self.d.keys()), set(), set(), set(), set(), self.d, self.d)
self.assertEqual(sorted(values.splitlines()), sorted([varval]))
self.assertEqual(deps, set(["TESTVAR2"]))
self.assertEqual(self.d.getVar('ANOTHERVAR').split(), ['testval3', 'anothervalue'])
+ def test_contains_vardeps_override_operators(self):
+ # Check override operators handle dependencies correctly with the contains functionality
+ expr_plain = 'testval'
+ expr_prepend = '${@bb.utils.filter("TESTVAR1", "testval1", d)} '
+ expr_append = ' ${@bb.utils.filter("TESTVAR2", "testval2", d)}'
+ expr_remove = '${@bb.utils.contains("TESTVAR3", "no-testval", "testval", "", d)}'
+ # Check dependencies
+ self.d.setVar('ANOTHERVAR', expr_plain)
+ self.d.prependVar('ANOTHERVAR', expr_prepend)
+ self.d.appendVar('ANOTHERVAR', expr_append)
+ self.d.setVar('ANOTHERVAR:remove', expr_remove)
+ self.d.setVar('TESTVAR1', 'blah')
+ self.d.setVar('TESTVAR2', 'testval2')
+ self.d.setVar('TESTVAR3', 'no-testval')
+ deps, values = bb.data.build_dependencies("ANOTHERVAR", set(self.d.keys()), set(), set(), set(), set(), self.d, self.d)
+ self.assertEqual(sorted(values.splitlines()),
+ sorted([
+ expr_prepend + expr_plain + expr_append,
+ '_remove of ' + expr_remove,
+ 'TESTVAR1{testval1} = Unset',
+ 'TESTVAR2{testval2} = Set',
+ 'TESTVAR3{no-testval} = Set',
+ ]))
+ # Check final value
+ self.assertEqual(self.d.getVar('ANOTHERVAR').split(), ['testval2'])
+
#Currently no wildcard support
#def test_vardeps_wildcards(self):
# self.d.setVar("oe_libinstall", "echo test")
# self.d.setVar("FOO", "foo=oe_libinstall; eval $foo")
# self.d.setVarFlag("FOO", "vardeps", "oe_*")
- # self.assertEquals(deps, set(["oe_libinstall"]))
+ # self.assertEqual(deps, set(["oe_libinstall"]))
diff --git a/bitbake/lib/bb/tests/color.py b/bitbake/lib/bb/tests/color.py
index 88dd278006..bb70cb393d 100644
--- a/bitbake/lib/bb/tests/color.py
+++ b/bitbake/lib/bb/tests/color.py
@@ -20,7 +20,7 @@ class ProgressWatcher:
def __init__(self):
self._reports = []
- def handle_event(self, event):
+ def handle_event(self, event, d):
self._reports.append((event.progress, event.rate))
def reports(self):
diff --git a/bitbake/lib/bb/tests/data.py b/bitbake/lib/bb/tests/data.py
index e667c7c7d3..cbc7c1ecd4 100644
--- a/bitbake/lib/bb/tests/data.py
+++ b/bitbake/lib/bb/tests/data.py
@@ -60,6 +60,15 @@ class DataExpansions(unittest.TestCase):
val = self.d.expand("${@5*12}")
self.assertEqual(str(val), "60")
+ def test_python_snippet_w_dict(self):
+ val = self.d.expand("${@{ 'green': 1, 'blue': 2 }['green']}")
+ self.assertEqual(str(val), "1")
+
+ def test_python_unexpanded_multi(self):
+ self.d.setVar("bar", "${unsetvar}")
+ val = self.d.expand("${@2*2},${foo},${@d.getVar('foo') + ' ${bar}'},${foo}")
+ self.assertEqual(str(val), "4,value_of_foo,${@d.getVar('foo') + ' ${unsetvar}'},value_of_foo")
+
def test_expand_in_python_snippet(self):
val = self.d.expand("${@'boo ' + '${foo}'}")
self.assertEqual(str(val), "boo value_of_foo")
@@ -68,6 +77,18 @@ class DataExpansions(unittest.TestCase):
val = self.d.expand("${@d.getVar('foo') + ' ${bar}'}")
self.assertEqual(str(val), "value_of_foo value_of_bar")
+ def test_python_snippet_function_reference(self):
+ self.d.setVar("TESTVAL", "testvalue")
+ self.d.setVar("testfunc", 'd.getVar("TESTVAL")')
+ context = bb.utils.get_context()
+ context["testfunc"] = lambda d: d.getVar("TESTVAL")
+ val = self.d.expand("${@testfunc(d)}")
+ self.assertEqual(str(val), "testvalue")
+
+ def test_python_snippet_builtin_metadata(self):
+ self.d.setVar("eval", "INVALID")
+ self.d.expand("${@eval('3')}")
+
def test_python_unexpanded(self):
self.d.setVar("bar", "${unsetvar}")
val = self.d.expand("${@d.getVar('foo') + ' ${bar}'}")
@@ -374,6 +395,16 @@ class TestOverrides(unittest.TestCase):
self.d.setVar("OVERRIDES", "foo:bar:some_val")
self.assertEqual(self.d.getVar("TEST"), "testvalue3")
+ # Test an override with _<numeric> in it based on a real world OE issue
+ def test_underscore_override_2(self):
+ self.d.setVar("TARGET_ARCH", "x86_64")
+ self.d.setVar("PN", "test-${TARGET_ARCH}")
+ self.d.setVar("VERSION", "1")
+ self.d.setVar("VERSION:pn-test-${TARGET_ARCH}", "2")
+ self.d.setVar("OVERRIDES", "pn-${PN}")
+ bb.data.expandKeys(self.d)
+ self.assertEqual(self.d.getVar("VERSION"), "2")
+
def test_remove_with_override(self):
self.d.setVar("TEST:bar", "testvalue2")
self.d.setVar("TEST:some_val", "testvalue3 testvalue5")
@@ -395,16 +426,6 @@ class TestOverrides(unittest.TestCase):
self.d.setVar("TEST:bar:append", "testvalue2")
self.assertEqual(self.d.getVar("TEST"), "testvalue2")
- # Test an override with _<numeric> in it based on a real world OE issue
- def test_underscore_override(self):
- self.d.setVar("TARGET_ARCH", "x86_64")
- self.d.setVar("PN", "test-${TARGET_ARCH}")
- self.d.setVar("VERSION", "1")
- self.d.setVar("VERSION:pn-test-${TARGET_ARCH}", "2")
- self.d.setVar("OVERRIDES", "pn-${PN}")
- bb.data.expandKeys(self.d)
- self.assertEqual(self.d.getVar("VERSION"), "2")
-
def test_append_and_unused_override(self):
# Had a bug where an unused override append could return "" instead of None
self.d.setVar("BAR:append:unusedoverride", "testvalue2")
diff --git a/bitbake/lib/bb/tests/event.py b/bitbake/lib/bb/tests/event.py
index 9ca7e9bc8e..ef61891d30 100644
--- a/bitbake/lib/bb/tests/event.py
+++ b/bitbake/lib/bb/tests/event.py
@@ -13,6 +13,7 @@ import pickle
import threading
import time
import unittest
+import tempfile
from unittest.mock import Mock
from unittest.mock import call
@@ -157,7 +158,7 @@ class EventHandlingTest(unittest.TestCase):
self._test_process.event_handler,
event,
None)
- self._test_process.event_handler.assert_called_once_with(event)
+ self._test_process.event_handler.assert_called_once_with(event, None)
def test_fire_class_handlers(self):
""" Test fire_class_handlers method """
@@ -175,10 +176,10 @@ class EventHandlingTest(unittest.TestCase):
bb.event.fire_class_handlers(event1, None)
bb.event.fire_class_handlers(event2, None)
bb.event.fire_class_handlers(event2, None)
- expected_event_handler1 = [call(event1)]
- expected_event_handler2 = [call(event1),
- call(event2),
- call(event2)]
+ expected_event_handler1 = [call(event1, None)]
+ expected_event_handler2 = [call(event1, None),
+ call(event2, None),
+ call(event2, None)]
self.assertEqual(self._test_process.event_handler1.call_args_list,
expected_event_handler1)
self.assertEqual(self._test_process.event_handler2.call_args_list,
@@ -205,7 +206,7 @@ class EventHandlingTest(unittest.TestCase):
bb.event.fire_class_handlers(event2, None)
bb.event.fire_class_handlers(event2, None)
expected_event_handler1 = []
- expected_event_handler2 = [call(event1)]
+ expected_event_handler2 = [call(event1, None)]
self.assertEqual(self._test_process.event_handler1.call_args_list,
expected_event_handler1)
self.assertEqual(self._test_process.event_handler2.call_args_list,
@@ -223,7 +224,7 @@ class EventHandlingTest(unittest.TestCase):
self.assertEqual(result, bb.event.Registered)
bb.event.fire_class_handlers(event1, None)
bb.event.fire_class_handlers(event2, None)
- expected = [call(event1), call(event2)]
+ expected = [call(event1, None), call(event2, None)]
self.assertEqual(self._test_process.event_handler1.call_args_list,
expected)
@@ -237,7 +238,7 @@ class EventHandlingTest(unittest.TestCase):
self.assertEqual(result, bb.event.Registered)
bb.event.fire_class_handlers(event1, None)
bb.event.fire_class_handlers(event2, None)
- expected = [call(event1), call(event2), call(event1)]
+ expected = [call(event1, None), call(event2, None), call(event1, None)]
self.assertEqual(self._test_process.event_handler1.call_args_list,
expected)
@@ -251,7 +252,7 @@ class EventHandlingTest(unittest.TestCase):
self.assertEqual(result, bb.event.Registered)
bb.event.fire_class_handlers(event1, None)
bb.event.fire_class_handlers(event2, None)
- expected = [call(event1), call(event2), call(event1), call(event2)]
+ expected = [call(event1,None), call(event2, None), call(event1, None), call(event2, None)]
self.assertEqual(self._test_process.event_handler1.call_args_list,
expected)
@@ -359,9 +360,10 @@ class EventHandlingTest(unittest.TestCase):
event1 = bb.event.ConfigParsed()
bb.event.fire(event1, None)
- expected = [call(event1)]
+ expected = [call(event1, None)]
self.assertEqual(self._test_process.event_handler1.call_args_list,
expected)
+ expected = [call(event1)]
self.assertEqual(self._test_ui1.event.send.call_args_list,
expected)
@@ -450,10 +452,9 @@ class EventHandlingTest(unittest.TestCase):
and disable threadlocks tests """
bb.event.fire(bb.event.OperationStarted(), None)
- def test_enable_threadlock(self):
+ def test_event_threadlock(self):
""" Test enable_threadlock method """
self._set_threadlock_test_mockups()
- bb.event.enable_threadlock()
self._set_and_run_threadlock_test_workers()
# Calls to UI handlers should be in order as all the registered
# handlers for the event coming from the first worker should be
@@ -461,20 +462,6 @@ class EventHandlingTest(unittest.TestCase):
self.assertEqual(self._threadlock_test_calls,
["w1_ui1", "w1_ui2", "w2_ui1", "w2_ui2"])
-
- def test_disable_threadlock(self):
- """ Test disable_threadlock method """
- self._set_threadlock_test_mockups()
- bb.event.disable_threadlock()
- self._set_and_run_threadlock_test_workers()
- # Calls to UI handlers should be intertwined together. Thanks to the
- # delay in the registered handlers for the event coming from the first
- # worker, the event coming from the second worker starts being
- # processed before finishing handling the first worker event.
- self.assertEqual(self._threadlock_test_calls,
- ["w1_ui1", "w2_ui1", "w1_ui2", "w2_ui2"])
-
-
class EventClassesTest(unittest.TestCase):
""" Event classes test class """
@@ -482,6 +469,8 @@ class EventClassesTest(unittest.TestCase):
def setUp(self):
bb.event.worker_pid = EventClassesTest._worker_pid
+ self.d = bb.data.init()
+ bb.parse.siggen = bb.siggen.init(self.d)
def test_Event(self):
""" Test the Event base class """
@@ -964,3 +953,24 @@ class EventClassesTest(unittest.TestCase):
event = bb.event.FindSigInfoResult(result)
self.assertEqual(event.result, result)
self.assertEqual(event.pid, EventClassesTest._worker_pid)
+
+ def test_lineno_in_eventhandler(self):
+ # The error lineno is 5, not 4 since the first line is '\n'
+ error_line = """
+# Comment line1
+# Comment line2
+python test_lineno_in_eventhandler() {
+ This is an error line
+}
+addhandler test_lineno_in_eventhandler
+test_lineno_in_eventhandler[eventmask] = "bb.event.ConfigParsed"
+"""
+
+ with self.assertLogs() as logs:
+ f = tempfile.NamedTemporaryFile(suffix = '.bb')
+ f.write(bytes(error_line, "utf-8"))
+ f.flush()
+ d = bb.parse.handle(f.name, self.d)['']
+
+ output = "".join(logs.output)
+ self.assertTrue(" line 5\n" in output)
diff --git a/bitbake/lib/bb/tests/fetch-testdata/software/libxml2/2.10/index.html b/bitbake/lib/bb/tests/fetch-testdata/software/libxml2/2.10/index.html
new file mode 100644
index 0000000000..4e41af6d6a
--- /dev/null
+++ b/bitbake/lib/bb/tests/fetch-testdata/software/libxml2/2.10/index.html
@@ -0,0 +1,20 @@
+<!DOCTYPE html><html><head><meta http-equiv="content-type" content="text/html; charset=utf-8"><meta name="viewport" content="width=device-width"><style type="text/css">body,html {background:#fff;font-family:"Bitstream Vera Sans","Lucida Grande","Lucida Sans Unicode",Lucidux,Verdana,Lucida,sans-serif;}tr:nth-child(even) {background:#f4f4f4;}th,td {padding:0.1em 0.5em;}th {text-align:left;font-weight:bold;background:#eee;border-bottom:1px solid #aaa;}#list {border:1px solid #aaa;width:100%;}a {color:#a33;}a:hover {color:#e33;}</style>
+
+<title>Index of /sources/libxml2/2.10/</title>
+</head><body><h1>Index of /sources/libxml2/2.10/</h1>
+<table id="list"><thead><tr><th style="width:55%"><a href="?C=N&amp;O=A">File Name</a>&nbsp;<a href="?C=N&amp;O=D">&nbsp;&darr;&nbsp;</a></th><th style="width:20%"><a href="?C=S&amp;O=A">File Size</a>&nbsp;<a href="?C=S&amp;O=D">&nbsp;&darr;&nbsp;</a></th><th style="width:25%"><a href="?C=M&amp;O=A">Date</a>&nbsp;<a href="?C=M&amp;O=D">&nbsp;&darr;&nbsp;</a></th></tr></thead>
+<tbody><tr><td class="link"><a href="../">Parent directory/</a></td><td class="size">-</td><td class="date">-</td></tr>
+<tr><td class="link"><a href="LATEST-IS-2.10.3" title="LATEST-IS-2.10.3">LATEST-IS-2.10.3</a></td><td class="size">2.5 MiB</td><td class="date">2022-Oct-14 12:55</td></tr>
+<tr><td class="link"><a href="libxml2-2.10.0.news" title="libxml2-2.10.0.news">libxml2-2.10.0.news</a></td><td class="size">7.1 KiB</td><td class="date">2022-Aug-17 11:55</td></tr>
+<tr><td class="link"><a href="libxml2-2.10.0.sha256sum" title="libxml2-2.10.0.sha256sum">libxml2-2.10.0.sha256sum</a></td><td class="size">174 B</td><td class="date">2022-Aug-17 11:55</td></tr>
+<tr><td class="link"><a href="libxml2-2.10.0.tar.xz" title="libxml2-2.10.0.tar.xz">libxml2-2.10.0.tar.xz</a></td><td class="size">2.6 MiB</td><td class="date">2022-Aug-17 11:55</td></tr>
+<tr><td class="link"><a href="libxml2-2.10.1.news" title="libxml2-2.10.1.news">libxml2-2.10.1.news</a></td><td class="size">455 B</td><td class="date">2022-Aug-25 11:33</td></tr>
+<tr><td class="link"><a href="libxml2-2.10.1.sha256sum" title="libxml2-2.10.1.sha256sum">libxml2-2.10.1.sha256sum</a></td><td class="size">174 B</td><td class="date">2022-Aug-25 11:33</td></tr>
+<tr><td class="link"><a href="libxml2-2.10.1.tar.xz" title="libxml2-2.10.1.tar.xz">libxml2-2.10.1.tar.xz</a></td><td class="size">2.6 MiB</td><td class="date">2022-Aug-25 11:33</td></tr>
+<tr><td class="link"><a href="libxml2-2.10.2.news" title="libxml2-2.10.2.news">libxml2-2.10.2.news</a></td><td class="size">309 B</td><td class="date">2022-Aug-29 14:56</td></tr>
+<tr><td class="link"><a href="libxml2-2.10.2.sha256sum" title="libxml2-2.10.2.sha256sum">libxml2-2.10.2.sha256sum</a></td><td class="size">174 B</td><td class="date">2022-Aug-29 14:56</td></tr>
+<tr><td class="link"><a href="libxml2-2.10.2.tar.xz" title="libxml2-2.10.2.tar.xz">libxml2-2.10.2.tar.xz</a></td><td class="size">2.5 MiB</td><td class="date">2022-Aug-29 14:56</td></tr>
+<tr><td class="link"><a href="libxml2-2.10.3.news" title="libxml2-2.10.3.news">libxml2-2.10.3.news</a></td><td class="size">294 B</td><td class="date">2022-Oct-14 12:55</td></tr>
+<tr><td class="link"><a href="libxml2-2.10.3.sha256sum" title="libxml2-2.10.3.sha256sum">libxml2-2.10.3.sha256sum</a></td><td class="size">174 B</td><td class="date">2022-Oct-14 12:55</td></tr>
+<tr><td class="link"><a href="libxml2-2.10.3.tar.xz" title="libxml2-2.10.3.tar.xz">libxml2-2.10.3.tar.xz</a></td><td class="size">2.5 MiB</td><td class="date">2022-Oct-14 12:55</td></tr>
+</tbody></table></body></html>
diff --git a/bitbake/lib/bb/tests/fetch-testdata/software/libxml2/2.9/index.html b/bitbake/lib/bb/tests/fetch-testdata/software/libxml2/2.9/index.html
new file mode 100644
index 0000000000..abdfdd0fa2
--- /dev/null
+++ b/bitbake/lib/bb/tests/fetch-testdata/software/libxml2/2.9/index.html
@@ -0,0 +1,40 @@
+<!DOCTYPE html><html><head><meta http-equiv="content-type" content="text/html; charset=utf-8"><meta name="viewport" content="width=device-width"><style type="text/css">body,html {background:#fff;font-family:"Bitstream Vera Sans","Lucida Grande","Lucida Sans Unicode",Lucidux,Verdana,Lucida,sans-serif;}tr:nth-child(even) {background:#f4f4f4;}th,td {padding:0.1em 0.5em;}th {text-align:left;font-weight:bold;background:#eee;border-bottom:1px solid #aaa;}#list {border:1px solid #aaa;width:100%;}a {color:#a33;}a:hover {color:#e33;}</style>
+
+<title>Index of /sources/libxml2/2.9/</title>
+</head><body><h1>Index of /sources/libxml2/2.9/</h1>
+<table id="list"><thead><tr><th style="width:55%"><a href="?C=N&amp;O=A">File Name</a>&nbsp;<a href="?C=N&amp;O=D">&nbsp;&darr;&nbsp;</a></th><th style="width:20%"><a href="?C=S&amp;O=A">File Size</a>&nbsp;<a href="?C=S&amp;O=D">&nbsp;&darr;&nbsp;</a></th><th style="width:25%"><a href="?C=M&amp;O=A">Date</a>&nbsp;<a href="?C=M&amp;O=D">&nbsp;&darr;&nbsp;</a></th></tr></thead>
+<tbody><tr><td class="link"><a href="../">Parent directory/</a></td><td class="size">-</td><td class="date">-</td></tr>
+<tr><td class="link"><a href="LATEST-IS-2.9.14" title="LATEST-IS-2.9.14">LATEST-IS-2.9.14</a></td><td class="size">3.0 MiB</td><td class="date">2022-May-02 12:03</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.0.sha256sum" title="libxml2-2.9.0.sha256sum">libxml2-2.9.0.sha256sum</a></td><td class="size">87 B</td><td class="date">2022-Feb-14 18:27</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.0.tar.xz" title="libxml2-2.9.0.tar.xz">libxml2-2.9.0.tar.xz</a></td><td class="size">3.0 MiB</td><td class="date">2022-Feb-14 18:27</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.1.sha256sum" title="libxml2-2.9.1.sha256sum">libxml2-2.9.1.sha256sum</a></td><td class="size">87 B</td><td class="date">2022-Feb-14 18:28</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.1.tar.xz" title="libxml2-2.9.1.tar.xz">libxml2-2.9.1.tar.xz</a></td><td class="size">3.0 MiB</td><td class="date">2022-Feb-14 18:28</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.10.sha256sum" title="libxml2-2.9.10.sha256sum">libxml2-2.9.10.sha256sum</a></td><td class="size">88 B</td><td class="date">2022-Feb-14 18:42</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.10.tar.xz" title="libxml2-2.9.10.tar.xz">libxml2-2.9.10.tar.xz</a></td><td class="size">3.2 MiB</td><td class="date">2022-Feb-14 18:42</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.11.sha256sum" title="libxml2-2.9.11.sha256sum">libxml2-2.9.11.sha256sum</a></td><td class="size">88 B</td><td class="date">2022-Feb-14 18:43</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.11.tar.xz" title="libxml2-2.9.11.tar.xz">libxml2-2.9.11.tar.xz</a></td><td class="size">3.2 MiB</td><td class="date">2022-Feb-14 18:43</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.12.sha256sum" title="libxml2-2.9.12.sha256sum">libxml2-2.9.12.sha256sum</a></td><td class="size">88 B</td><td class="date">2022-Feb-14 18:45</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.12.tar.xz" title="libxml2-2.9.12.tar.xz">libxml2-2.9.12.tar.xz</a></td><td class="size">3.2 MiB</td><td class="date">2022-Feb-14 18:45</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.13.news" title="libxml2-2.9.13.news">libxml2-2.9.13.news</a></td><td class="size">26.6 KiB</td><td class="date">2022-Feb-20 12:42</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.13.sha256sum" title="libxml2-2.9.13.sha256sum">libxml2-2.9.13.sha256sum</a></td><td class="size">174 B</td><td class="date">2022-Feb-20 12:42</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.13.tar.xz" title="libxml2-2.9.13.tar.xz">libxml2-2.9.13.tar.xz</a></td><td class="size">3.1 MiB</td><td class="date">2022-Feb-20 12:42</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.14.news" title="libxml2-2.9.14.news">libxml2-2.9.14.news</a></td><td class="size">1.0 KiB</td><td class="date">2022-May-02 12:03</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.14.sha256sum" title="libxml2-2.9.14.sha256sum">libxml2-2.9.14.sha256sum</a></td><td class="size">174 B</td><td class="date">2022-May-02 12:03</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.14.tar.xz" title="libxml2-2.9.14.tar.xz">libxml2-2.9.14.tar.xz</a></td><td class="size">3.0 MiB</td><td class="date">2022-May-02 12:03</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.2.sha256sum" title="libxml2-2.9.2.sha256sum">libxml2-2.9.2.sha256sum</a></td><td class="size">87 B</td><td class="date">2022-Feb-14 18:30</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.2.tar.xz" title="libxml2-2.9.2.tar.xz">libxml2-2.9.2.tar.xz</a></td><td class="size">3.2 MiB</td><td class="date">2022-Feb-14 18:30</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.3.sha256sum" title="libxml2-2.9.3.sha256sum">libxml2-2.9.3.sha256sum</a></td><td class="size">87 B</td><td class="date">2022-Feb-14 18:31</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.3.tar.xz" title="libxml2-2.9.3.tar.xz">libxml2-2.9.3.tar.xz</a></td><td class="size">3.2 MiB</td><td class="date">2022-Feb-14 18:31</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.4.sha256sum" title="libxml2-2.9.4.sha256sum">libxml2-2.9.4.sha256sum</a></td><td class="size">87 B</td><td class="date">2022-Feb-14 18:33</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.4.tar.xz" title="libxml2-2.9.4.tar.xz">libxml2-2.9.4.tar.xz</a></td><td class="size">2.9 MiB</td><td class="date">2022-Feb-14 18:33</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.5.sha256sum" title="libxml2-2.9.5.sha256sum">libxml2-2.9.5.sha256sum</a></td><td class="size">87 B</td><td class="date">2022-Feb-14 18:35</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.5.tar.xz" title="libxml2-2.9.5.tar.xz">libxml2-2.9.5.tar.xz</a></td><td class="size">3.0 MiB</td><td class="date">2022-Feb-14 18:35</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.6.sha256sum" title="libxml2-2.9.6.sha256sum">libxml2-2.9.6.sha256sum</a></td><td class="size">87 B</td><td class="date">2022-Feb-14 18:36</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.6.tar.xz" title="libxml2-2.9.6.tar.xz">libxml2-2.9.6.tar.xz</a></td><td class="size">3.0 MiB</td><td class="date">2022-Feb-14 18:36</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.7.sha256sum" title="libxml2-2.9.7.sha256sum">libxml2-2.9.7.sha256sum</a></td><td class="size">87 B</td><td class="date">2022-Feb-14 18:37</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.7.tar.xz" title="libxml2-2.9.7.tar.xz">libxml2-2.9.7.tar.xz</a></td><td class="size">3.0 MiB</td><td class="date">2022-Feb-14 18:37</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.8.sha256sum" title="libxml2-2.9.8.sha256sum">libxml2-2.9.8.sha256sum</a></td><td class="size">87 B</td><td class="date">2022-Feb-14 18:39</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.8.tar.xz" title="libxml2-2.9.8.tar.xz">libxml2-2.9.8.tar.xz</a></td><td class="size">3.0 MiB</td><td class="date">2022-Feb-14 18:39</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.9.sha256sum" title="libxml2-2.9.9.sha256sum">libxml2-2.9.9.sha256sum</a></td><td class="size">87 B</td><td class="date">2022-Feb-14 18:40</td></tr>
+<tr><td class="link"><a href="libxml2-2.9.9.tar.xz" title="libxml2-2.9.9.tar.xz">libxml2-2.9.9.tar.xz</a></td><td class="size">3.0 MiB</td><td class="date">2022-Feb-14 18:40</td></tr>
+</tbody></table></body></html>
diff --git a/bitbake/lib/bb/tests/fetch-testdata/software/libxml2/index.html b/bitbake/lib/bb/tests/fetch-testdata/software/libxml2/index.html
new file mode 100644
index 0000000000..c183e06a55
--- /dev/null
+++ b/bitbake/lib/bb/tests/fetch-testdata/software/libxml2/index.html
@@ -0,0 +1,19 @@
+<!DOCTYPE html><html><head><meta http-equiv="content-type" content="text/html; charset=utf-8"><meta name="viewport" content="width=device-width"><style type="text/css">body,html {background:#fff;font-family:"Bitstream Vera Sans","Lucida Grande","Lucida Sans Unicode",Lucidux,Verdana,Lucida,sans-serif;}tr:nth-child(even) {background:#f4f4f4;}th,td {padding:0.1em 0.5em;}th {text-align:left;font-weight:bold;background:#eee;border-bottom:1px solid #aaa;}#list {border:1px solid #aaa;width:100%;}a {color:#a33;}a:hover {color:#e33;}</style>
+
+<title>Index of /sources/libxml2/</title>
+</head><body><h1>Index of /sources/libxml2/</h1>
+<table id="list"><thead><tr><th style="width:55%"><a href="?C=N&amp;O=A">File Name</a>&nbsp;<a href="?C=N&amp;O=D">&nbsp;&darr;&nbsp;</a></th><th style="width:20%"><a href="?C=S&amp;O=A">File Size</a>&nbsp;<a href="?C=S&amp;O=D">&nbsp;&darr;&nbsp;</a></th><th style="width:25%"><a href="?C=M&amp;O=A">Date</a>&nbsp;<a href="?C=M&amp;O=D">&nbsp;&darr;&nbsp;</a></th></tr></thead>
+<tbody><tr><td class="link"><a href="../">Parent directory/</a></td><td class="size">-</td><td class="date">-</td></tr>
+<tr><td class="link"><a href="2.0/" title="2.0">2.0/</a></td><td class="size">-</td><td class="date">2009-Jul-14 13:04</td></tr>
+<tr><td class="link"><a href="2.1/" title="2.1">2.1/</a></td><td class="size">-</td><td class="date">2009-Jul-14 13:04</td></tr>
+<tr><td class="link"><a href="2.10/" title="2.10">2.10/</a></td><td class="size">-</td><td class="date">2022-Oct-14 12:55</td></tr>
+<tr><td class="link"><a href="2.2/" title="2.2">2.2/</a></td><td class="size">-</td><td class="date">2009-Jul-14 13:04</td></tr>
+<tr><td class="link"><a href="2.3/" title="2.3">2.3/</a></td><td class="size">-</td><td class="date">2009-Jul-14 13:05</td></tr>
+<tr><td class="link"><a href="2.4/" title="2.4">2.4/</a></td><td class="size">-</td><td class="date">2009-Jul-14 13:05</td></tr>
+<tr><td class="link"><a href="2.5/" title="2.5">2.5/</a></td><td class="size">-</td><td class="date">2009-Jul-14 13:05</td></tr>
+<tr><td class="link"><a href="2.6/" title="2.6">2.6/</a></td><td class="size">-</td><td class="date">2009-Jul-14 13:05</td></tr>
+<tr><td class="link"><a href="2.7/" title="2.7">2.7/</a></td><td class="size">-</td><td class="date">2022-Feb-14 18:24</td></tr>
+<tr><td class="link"><a href="2.8/" title="2.8">2.8/</a></td><td class="size">-</td><td class="date">2022-Feb-14 18:26</td></tr>
+<tr><td class="link"><a href="2.9/" title="2.9">2.9/</a></td><td class="size">-</td><td class="date">2022-May-02 12:04</td></tr>
+<tr><td class="link"><a href="cache.json" title="cache.json">cache.json</a></td><td class="size">22.8 KiB</td><td class="date">2022-Oct-14 12:55</td></tr>
+</tbody></table></body></html>
diff --git a/bitbake/lib/bb/tests/fetch.py b/bitbake/lib/bb/tests/fetch.py
index 7fcf57e7ea..ed7a39a723 100644
--- a/bitbake/lib/bb/tests/fetch.py
+++ b/bitbake/lib/bb/tests/fetch.py
@@ -6,11 +6,13 @@
# SPDX-License-Identifier: GPL-2.0-only
#
+import contextlib
import unittest
import hashlib
import tempfile
import collections
import os
+import signal
import tarfile
from bb.fetch2 import URI
from bb.fetch2 import FetchMethod
@@ -22,6 +24,25 @@ def skipIfNoNetwork():
return unittest.skip("network test")
return lambda f: f
+class TestTimeout(Exception):
+ # Indicate to pytest that this is not a test suite
+ __test__ = False
+
+class Timeout():
+
+ def __init__(self, seconds):
+ self.seconds = seconds
+
+ def handle_timeout(self, signum, frame):
+ raise TestTimeout("Test failed: timeout reached")
+
+ def __enter__(self):
+ signal.signal(signal.SIGALRM, self.handle_timeout)
+ signal.alarm(self.seconds)
+
+ def __exit__(self, exc_type, exc_val, exc_tb):
+ signal.alarm(0)
+
class URITest(unittest.TestCase):
test_uris = {
"http://www.google.com/index.html" : {
@@ -287,6 +308,21 @@ class URITest(unittest.TestCase):
'params': {"someparam" : "1"},
'query': {},
'relative': True
+ },
+ "https://www.innodisk.com/Download_file?9BE0BF6657;downloadfilename=EGPL-T101.zip": {
+ 'uri': 'https://www.innodisk.com/Download_file?9BE0BF6657;downloadfilename=EGPL-T101.zip',
+ 'scheme': 'https',
+ 'hostname': 'www.innodisk.com',
+ 'port': None,
+ 'hostport': 'www.innodisk.com',
+ 'path': '/Download_file',
+ 'userinfo': '',
+ 'userinfo': '',
+ 'username': '',
+ 'password': '',
+ 'params': {"downloadfilename" : "EGPL-T101.zip"},
+ 'query': {"9BE0BF6657": None},
+ 'relative': False
}
}
@@ -396,18 +432,28 @@ class FetcherTest(unittest.TestCase):
def git(self, cmd, cwd=None):
if isinstance(cmd, str):
- cmd = 'git ' + cmd
+ cmd = 'git -c safe.bareRepository=all ' + cmd
else:
- cmd = ['git'] + cmd
+ cmd = ['git', '-c', 'safe.bareRepository=all'] + cmd
if cwd is None:
cwd = self.gitdir
return bb.process.run(cmd, cwd=cwd)[0]
def git_init(self, cwd=None):
self.git('init', cwd=cwd)
- if not self.git(['config', 'user.email'], cwd=cwd):
+ # Explicitly set initial branch to master as
+ # a common setup is to use other default
+ # branch than master.
+ self.git(['checkout', '-b', 'master'], cwd=cwd)
+
+ try:
+ self.git(['config', 'user.email'], cwd=cwd)
+ except bb.process.ExecutionError:
self.git(['config', 'user.email', 'you@example.com'], cwd=cwd)
- if not self.git(['config', 'user.name'], cwd=cwd):
+
+ try:
+ self.git(['config', 'user.name'], cwd=cwd)
+ except bb.process.ExecutionError:
self.git(['config', 'user.name', 'Your Name'], cwd=cwd)
class MirrorUriTest(FetcherTest):
@@ -465,7 +511,8 @@ class MirrorUriTest(FetcherTest):
mirrorvar = "http://.*/.* file:///somepath/downloads/ " \
"git://someserver.org/bitbake git://git.openembedded.org/bitbake " \
"https://.*/.* file:///someotherpath/downloads/ " \
- "http://.*/.* file:///someotherpath/downloads/"
+ "http://.*/.* file:///someotherpath/downloads/ " \
+ "svn://svn.server1.com/ svn://svn.server2.com/"
def test_urireplace(self):
self.d.setVar("FILESPATH", ".")
@@ -489,6 +536,13 @@ class MirrorUriTest(FetcherTest):
uris, uds = bb.fetch2.build_mirroruris(fetcher, mirrors, self.d)
self.assertEqual(uris, ['file:///someotherpath/downloads/bitbake-1.0.tar.gz'])
+ def test_urilistsvn(self):
+ # Catch svn:// -> svn:// bug
+ fetcher = bb.fetch.FetchData("svn://svn.server1.com/isource/svnroot/reponame/tags/tagname;module=path_in_tagnamefolder;protocol=https;rev=2", self.d)
+ mirrors = bb.fetch2.mirror_from_string(self.mirrorvar)
+ uris, uds = bb.fetch2.build_mirroruris(fetcher, mirrors, self.d)
+ self.assertEqual(uris, ['svn://svn.server2.com/isource/svnroot/reponame/tags/tagname;module=path_in_tagnamefolder;protocol=https;rev=2'])
+
def test_mirror_of_mirror(self):
# Test if mirror of a mirror works
mirrorvar = self.mirrorvar + " http://.*/.* http://otherdownloads.yoctoproject.org/downloads/"
@@ -516,7 +570,7 @@ class MirrorUriTest(FetcherTest):
class GitDownloadDirectoryNamingTest(FetcherTest):
def setUp(self):
super(GitDownloadDirectoryNamingTest, self).setUp()
- self.recipe_url = "git://git.openembedded.org/bitbake;branch=master"
+ self.recipe_url = "git://git.openembedded.org/bitbake;branch=master;protocol=https"
self.recipe_dir = "git.openembedded.org.bitbake"
self.mirror_url = "git://github.com/openembedded/bitbake.git;protocol=https;branch=master"
self.mirror_dir = "github.com.openembedded.bitbake.git"
@@ -564,7 +618,7 @@ class GitDownloadDirectoryNamingTest(FetcherTest):
class TarballNamingTest(FetcherTest):
def setUp(self):
super(TarballNamingTest, self).setUp()
- self.recipe_url = "git://git.openembedded.org/bitbake;branch=master"
+ self.recipe_url = "git://git.openembedded.org/bitbake;branch=master;protocol=https"
self.recipe_tarball = "git2_git.openembedded.org.bitbake.tar.gz"
self.mirror_url = "git://github.com/openembedded/bitbake.git;protocol=https;branch=master"
self.mirror_tarball = "git2_github.com.openembedded.bitbake.git.tar.gz"
@@ -598,7 +652,7 @@ class TarballNamingTest(FetcherTest):
class GitShallowTarballNamingTest(FetcherTest):
def setUp(self):
super(GitShallowTarballNamingTest, self).setUp()
- self.recipe_url = "git://git.openembedded.org/bitbake;branch=master"
+ self.recipe_url = "git://git.openembedded.org/bitbake;branch=master;protocol=https"
self.recipe_tarball = "gitshallow_git.openembedded.org.bitbake_82ea737-1_master.tar.gz"
self.mirror_url = "git://github.com/openembedded/bitbake.git;protocol=https;branch=master"
self.mirror_tarball = "gitshallow_github.com.openembedded.bitbake.git_82ea737-1_master.tar.gz"
@@ -633,7 +687,7 @@ class GitShallowTarballNamingTest(FetcherTest):
class CleanTarballTest(FetcherTest):
def setUp(self):
super(CleanTarballTest, self).setUp()
- self.recipe_url = "git://git.openembedded.org/bitbake"
+ self.recipe_url = "git://git.openembedded.org/bitbake;protocol=https"
self.recipe_tarball = "git2_git.openembedded.org.bitbake.tar.gz"
self.d.setVar('BB_GENERATE_MIRROR_TARBALLS', '1')
@@ -654,11 +708,13 @@ class CleanTarballTest(FetcherTest):
archive = tarfile.open(os.path.join(self.dldir, self.recipe_tarball))
self.assertNotEqual(len(archive.members), 0)
for member in archive.members:
- self.assertEqual(member.uname, 'oe')
- self.assertEqual(member.uid, 0)
- self.assertEqual(member.gname, 'oe')
- self.assertEqual(member.gid, 0)
- self.assertEqual(member.mtime, mtime)
+ if member.name == ".":
+ continue
+ self.assertEqual(member.uname, 'oe', "user name for %s differs" % member.name)
+ self.assertEqual(member.uid, 0, "uid for %s differs" % member.name)
+ self.assertEqual(member.gname, 'oe', "group name for %s differs" % member.name)
+ self.assertEqual(member.gid, 0, "gid for %s differs" % member.name)
+ self.assertEqual(member.mtime, mtime, "mtime for %s differs" % member.name)
class FetcherLocalTest(FetcherTest):
@@ -766,7 +822,7 @@ class FetcherLocalTest(FetcherTest):
# Fetch and check revision
self.d.setVar("SRCREV", "AUTOINC")
- self.d.setVar("__BBSEENSRCREV", "1")
+ self.d.setVar("__BBSRCREV_SEEN", "1")
url = "git://" + self.gitdir + ";branch=master;protocol=file;" + suffix
fetcher = bb.fetch.Fetch([url], self.d)
fetcher.download()
@@ -992,25 +1048,25 @@ class FetcherNetworkTest(FetcherTest):
@skipIfNoNetwork()
def test_gitfetch(self):
- url1 = url2 = "git://git.openembedded.org/bitbake;branch=master"
+ url1 = url2 = "git://git.openembedded.org/bitbake;branch=master;protocol=https"
self.gitfetcher(url1, url2)
@skipIfNoNetwork()
def test_gitfetch_goodsrcrev(self):
# SRCREV is set but matches rev= parameter
- url1 = url2 = "git://git.openembedded.org/bitbake;rev=270a05b0b4ba0959fe0624d2a4885d7b70426da5;branch=master"
+ url1 = url2 = "git://git.openembedded.org/bitbake;rev=270a05b0b4ba0959fe0624d2a4885d7b70426da5;branch=master;protocol=https"
self.gitfetcher(url1, url2)
@skipIfNoNetwork()
def test_gitfetch_badsrcrev(self):
# SRCREV is set but does not match rev= parameter
- url1 = url2 = "git://git.openembedded.org/bitbake;rev=dead05b0b4ba0959fe0624d2a4885d7b70426da5;branch=master"
+ url1 = url2 = "git://git.openembedded.org/bitbake;rev=dead05b0b4ba0959fe0624d2a4885d7b70426da5;branch=master;protocol=https"
self.assertRaises(bb.fetch.FetchError, self.gitfetcher, url1, url2)
@skipIfNoNetwork()
def test_gitfetch_tagandrev(self):
# SRCREV is set but does not match rev= parameter
- url1 = url2 = "git://git.openembedded.org/bitbake;rev=270a05b0b4ba0959fe0624d2a4885d7b70426da5;tag=270a05b0b4ba0959fe0624d2a4885d7b70426da5"
+ url1 = url2 = "git://git.openembedded.org/bitbake;rev=270a05b0b4ba0959fe0624d2a4885d7b70426da5;tag=270a05b0b4ba0959fe0624d2a4885d7b70426da5;protocol=https"
self.assertRaises(bb.fetch.FetchError, self.gitfetcher, url1, url2)
@skipIfNoNetwork()
@@ -1019,7 +1075,7 @@ class FetcherNetworkTest(FetcherTest):
# `usehead=1' and instead fetch the specified SRCREV. See
# test_local_gitfetch_usehead() for a positive use of the usehead
# feature.
- url = "git://git.openembedded.org/bitbake;usehead=1;branch=master"
+ url = "git://git.openembedded.org/bitbake;usehead=1;branch=master;protocol=https"
self.assertRaises(bb.fetch.ParameterError, self.gitfetcher, url, url)
@skipIfNoNetwork()
@@ -1028,26 +1084,26 @@ class FetcherNetworkTest(FetcherTest):
# `usehead=1' and instead fetch the specified SRCREV. See
# test_local_gitfetch_usehead() for a positive use of the usehead
# feature.
- url = "git://git.openembedded.org/bitbake;usehead=1;name=newName;branch=master"
+ url = "git://git.openembedded.org/bitbake;usehead=1;name=newName;branch=master;protocol=https"
self.assertRaises(bb.fetch.ParameterError, self.gitfetcher, url, url)
@skipIfNoNetwork()
def test_gitfetch_finds_local_tarball_for_mirrored_url_when_previous_downloaded_by_the_recipe_url(self):
- recipeurl = "git://git.openembedded.org/bitbake;branch=master"
- mirrorurl = "git://someserver.org/bitbake;branch=master"
+ recipeurl = "git://git.openembedded.org/bitbake;branch=master;protocol=https"
+ mirrorurl = "git://someserver.org/bitbake;branch=master;protocol=https"
self.d.setVar("PREMIRRORS", "git://someserver.org/bitbake git://git.openembedded.org/bitbake")
self.gitfetcher(recipeurl, mirrorurl)
@skipIfNoNetwork()
def test_gitfetch_finds_local_tarball_when_previous_downloaded_from_a_premirror(self):
- recipeurl = "git://someserver.org/bitbake;branch=master"
+ recipeurl = "git://someserver.org/bitbake;branch=master;protocol=https"
self.d.setVar("PREMIRRORS", "git://someserver.org/bitbake git://git.openembedded.org/bitbake")
self.gitfetcher(recipeurl, recipeurl)
@skipIfNoNetwork()
def test_gitfetch_finds_local_repository_when_premirror_rewrites_the_recipe_url(self):
- realurl = "git://git.openembedded.org/bitbake"
- recipeurl = "git://someserver.org/bitbake"
+ realurl = "https://git.openembedded.org/bitbake"
+ recipeurl = "git://someserver.org/bitbake;protocol=https"
self.sourcedir = self.unpackdir.replace("unpacked", "sourcemirror.git")
os.chdir(self.tempdir)
self.git(['clone', realurl, self.sourcedir], cwd=self.tempdir)
@@ -1057,9 +1113,9 @@ class FetcherNetworkTest(FetcherTest):
@skipIfNoNetwork()
def test_git_submodule(self):
# URL with ssh submodules
- url = "gitsm://git.yoctoproject.org/git-submodule-test;branch=ssh-gitsm-tests;rev=049da4a6cb198d7c0302e9e8b243a1443cb809a7;branch=master"
+ url = "gitsm://git.yoctoproject.org/git-submodule-test;branch=ssh-gitsm-tests;rev=049da4a6cb198d7c0302e9e8b243a1443cb809a7;branch=master;protocol=https"
# Original URL (comment this if you have ssh access to git.yoctoproject.org)
- url = "gitsm://git.yoctoproject.org/git-submodule-test;branch=master;rev=a2885dd7d25380d23627e7544b7bbb55014b16ee;branch=master"
+ url = "gitsm://git.yoctoproject.org/git-submodule-test;branch=master;rev=a2885dd7d25380d23627e7544b7bbb55014b16ee;branch=master;protocol=https"
fetcher = bb.fetch.Fetch([url], self.d)
fetcher.download()
# Previous cwd has been deleted
@@ -1076,6 +1132,25 @@ class FetcherNetworkTest(FetcherTest):
self.assertTrue(os.path.exists(os.path.join(repo_path, 'bitbake-gitsm-test1', 'bitbake')), msg='submodule of submodule missing')
@skipIfNoNetwork()
+ def test_git_submodule_restricted_network_premirrors(self):
+ # this test is to ensure that premirrors will be tried in restricted network
+ # that is, BB_ALLOWED_NETWORKS does not contain the domain the url uses
+ url = "gitsm://github.com/grpc/grpc.git;protocol=https;name=grpc;branch=v1.60.x;rev=0ef13a7555dbaadd4633399242524129eef5e231"
+ # create a download directory to be used as premirror later
+ tempdir = tempfile.mkdtemp(prefix="bitbake-fetch-")
+ dl_premirror = os.path.join(tempdir, "download-premirror")
+ os.mkdir(dl_premirror)
+ self.d.setVar("DL_DIR", dl_premirror)
+ fetcher = bb.fetch.Fetch([url], self.d)
+ fetcher.download()
+ # now use the premirror in restricted network
+ self.d.setVar("DL_DIR", self.dldir)
+ self.d.setVar("PREMIRRORS", "gitsm://.*/.* gitsm://%s/git2/MIRRORNAME;protocol=file" % dl_premirror)
+ self.d.setVar("BB_ALLOWED_NETWORKS", "*.some.domain")
+ fetcher = bb.fetch.Fetch([url], self.d)
+ fetcher.download()
+
+ @skipIfNoNetwork()
def test_git_submodule_dbus_broker(self):
# The following external repositories have show failures in fetch and unpack operations
# We want to avoid regressions!
@@ -1172,6 +1247,15 @@ class FetcherNetworkTest(FetcherTest):
self.assertTrue(os.path.exists(os.path.join(repo_path, 'edgelet/hsm-sys/azure-iot-hsm-c/deps/utpm/deps/c-utility/testtools/umock-c/deps/ctest/README.md')), msg='Missing submodule checkout')
self.assertTrue(os.path.exists(os.path.join(repo_path, 'edgelet/hsm-sys/azure-iot-hsm-c/deps/utpm/deps/c-utility/testtools/umock-c/deps/testrunner/readme.md')), msg='Missing submodule checkout')
+ @skipIfNoNetwork()
+ def test_git_submodule_reference_to_parent(self):
+ self.recipe_url = "gitsm://github.com/gflags/gflags.git;protocol=https;branch=master"
+ self.d.setVar("SRCREV", "14e1138441bbbb584160cb1c0a0426ec1bac35f1")
+ with Timeout(60):
+ fetcher = bb.fetch.Fetch([self.recipe_url], self.d)
+ with self.assertRaises(bb.fetch2.FetchError):
+ fetcher.download()
+
class SVNTest(FetcherTest):
def skipIfNoSvn():
import shutil
@@ -1206,8 +1290,9 @@ class SVNTest(FetcherTest):
cwd=repo_dir)
bb.process.run("svn co %s svnfetch_co" % self.repo_url, cwd=self.tempdir)
- # Github will emulate SVN. Use this to check if we're downloding...
- bb.process.run("svn propset svn:externals 'bitbake https://github.com/PhilipHazel/pcre2.git' .",
+ # Github won't emulate SVN anymore (see https://github.blog/2023-01-20-sunsetting-subversion-support/)
+ # Use still accessible svn repo (only trunk to avoid longer downloads)
+ bb.process.run("svn propset svn:externals 'bitbake https://svn.apache.org/repos/asf/serf/trunk' .",
cwd=os.path.join(self.tempdir, 'svnfetch_co', 'trunk'))
bb.process.run("svn commit --non-interactive -m 'Add external'",
cwd=os.path.join(self.tempdir, 'svnfetch_co', 'trunk'))
@@ -1235,8 +1320,8 @@ class SVNTest(FetcherTest):
self.assertTrue(os.path.exists(os.path.join(self.unpackdir, 'trunk')), msg="Missing trunk")
self.assertTrue(os.path.exists(os.path.join(self.unpackdir, 'trunk', 'README.md')), msg="Missing contents")
- self.assertFalse(os.path.exists(os.path.join(self.unpackdir, 'trunk/bitbake/trunk')), msg="External dir should NOT exist")
- self.assertFalse(os.path.exists(os.path.join(self.unpackdir, 'trunk/bitbake/trunk', 'README')), msg="External README should NOT exit")
+ self.assertFalse(os.path.exists(os.path.join(self.unpackdir, 'trunk/bitbake/protocols')), msg="External dir should NOT exist")
+ self.assertFalse(os.path.exists(os.path.join(self.unpackdir, 'trunk/bitbake/protocols', 'fcgi_buckets.h')), msg="External fcgi_buckets.h should NOT exit")
@skipIfNoSvn()
def test_external_svn(self):
@@ -1249,8 +1334,8 @@ class SVNTest(FetcherTest):
self.assertTrue(os.path.exists(os.path.join(self.unpackdir, 'trunk')), msg="Missing trunk")
self.assertTrue(os.path.exists(os.path.join(self.unpackdir, 'trunk', 'README.md')), msg="Missing contents")
- self.assertTrue(os.path.exists(os.path.join(self.unpackdir, 'trunk/bitbake/trunk')), msg="External dir should exist")
- self.assertTrue(os.path.exists(os.path.join(self.unpackdir, 'trunk/bitbake/trunk', 'README')), msg="External README should exit")
+ self.assertTrue(os.path.exists(os.path.join(self.unpackdir, 'trunk/bitbake/protocols')), msg="External dir should exist")
+ self.assertTrue(os.path.exists(os.path.join(self.unpackdir, 'trunk/bitbake/protocols', 'fcgi_buckets.h')), msg="External fcgi_buckets.h should exit")
class TrustedNetworksTest(FetcherTest):
def test_trusted_network(self):
@@ -1301,14 +1386,17 @@ class URLHandle(unittest.TestCase):
"http://www.google.com/index.html" : ('http', 'www.google.com', '/index.html', '', '', {}),
"cvs://anoncvs@cvs.handhelds.org/cvs;module=familiar/dist/ipkg" : ('cvs', 'cvs.handhelds.org', '/cvs', 'anoncvs', '', {'module': 'familiar/dist/ipkg'}),
"cvs://anoncvs:anonymous@cvs.handhelds.org/cvs;tag=V0-99-81;module=familiar/dist/ipkg" : ('cvs', 'cvs.handhelds.org', '/cvs', 'anoncvs', 'anonymous', collections.OrderedDict([('tag', 'V0-99-81'), ('module', 'familiar/dist/ipkg')])),
- "git://git.openembedded.org/bitbake;branch=@foo" : ('git', 'git.openembedded.org', '/bitbake', '', '', {'branch': '@foo'}),
+ "git://git.openembedded.org/bitbake;branch=@foo;protocol=https" : ('git', 'git.openembedded.org', '/bitbake', '', '', {'branch': '@foo', 'protocol' : 'https'}),
"file://somelocation;someparam=1": ('file', '', 'somelocation', '', '', {'someparam': '1'}),
+ "https://somesite.com/somerepo.git;user=anyUser:idtoken=1234" : ('https', 'somesite.com', '/somerepo.git', '', '', {'user': 'anyUser:idtoken=1234'}),
+ r'git://s.o-me_ONE:!#$%^&*()-_={}[]\|:?,.<>~`@git.openembedded.org/bitbake;branch=main;protocol=https': ('git', 'git.openembedded.org', '/bitbake', 's.o-me_ONE', r'!#$%^&*()-_={}[]\|:?,.<>~`', {'branch': 'main', 'protocol' : 'https'}),
}
# we require a pathname to encodeurl but users can still pass such urls to
# decodeurl and we need to handle them
decodedata = datatable.copy()
decodedata.update({
"http://somesite.net;someparam=1": ('http', 'somesite.net', '/', '', '', {'someparam': '1'}),
+ "npmsw://some.registry.url;package=@pkg;version=latest": ('npmsw', 'some.registry.url', '/', '', '', {'package': '@pkg', 'version': 'latest'}),
})
def test_decodeurl(self):
@@ -1325,37 +1413,39 @@ class FetchLatestVersionTest(FetcherTest):
test_git_uris = {
# version pattern "X.Y.Z"
- ("mx-1.0", "git://github.com/clutter-project/mx.git;branch=mx-1.4;protocol=https", "9b1db6b8060bd00b121a692f942404a24ae2960f", "")
+ ("mx-1.0", "git://github.com/clutter-project/mx.git;branch=mx-1.4;protocol=https", "9b1db6b8060bd00b121a692f942404a24ae2960f", "", "")
: "1.99.4",
# version pattern "vX.Y"
# mirror of git.infradead.org since network issues interfered with testing
- ("mtd-utils", "git://git.yoctoproject.org/mtd-utils.git;branch=master", "ca39eb1d98e736109c64ff9c1aa2a6ecca222d8f", "")
+ ("mtd-utils", "git://git.yoctoproject.org/mtd-utils.git;branch=master;protocol=https", "ca39eb1d98e736109c64ff9c1aa2a6ecca222d8f", "", "")
: "1.5.0",
# version pattern "pkg_name-X.Y"
# mirror of git://anongit.freedesktop.org/git/xorg/proto/presentproto since network issues interfered with testing
- ("presentproto", "git://git.yoctoproject.org/bbfetchtests-presentproto;branch=master", "24f3a56e541b0a9e6c6ee76081f441221a120ef9", "")
+ ("presentproto", "git://git.yoctoproject.org/bbfetchtests-presentproto;branch=master;protocol=https", "24f3a56e541b0a9e6c6ee76081f441221a120ef9", "", "")
: "1.0",
# version pattern "pkg_name-vX.Y.Z"
- ("dtc", "git://git.yoctoproject.org/bbfetchtests-dtc.git;branch=master", "65cc4d2748a2c2e6f27f1cf39e07a5dbabd80ebf", "")
+ ("dtc", "git://git.yoctoproject.org/bbfetchtests-dtc.git;branch=master;protocol=https", "65cc4d2748a2c2e6f27f1cf39e07a5dbabd80ebf", "", "")
: "1.4.0",
# combination version pattern
- ("sysprof", "git://gitlab.gnome.org/GNOME/sysprof.git;protocol=https;branch=master", "cd44ee6644c3641507fb53b8a2a69137f2971219", "")
+ ("sysprof", "git://gitlab.gnome.org/GNOME/sysprof.git;protocol=https;branch=master", "cd44ee6644c3641507fb53b8a2a69137f2971219", "", "")
: "1.2.0",
- ("u-boot-mkimage", "git://git.denx.de/u-boot.git;branch=master;protocol=git", "62c175fbb8a0f9a926c88294ea9f7e88eb898f6c", "")
+ ("u-boot-mkimage", "git://git.denx.de/u-boot.git;branch=master;protocol=git", "62c175fbb8a0f9a926c88294ea9f7e88eb898f6c", "", "")
: "2014.01",
# version pattern "yyyymmdd"
- ("mobile-broadband-provider-info", "git://gitlab.gnome.org/GNOME/mobile-broadband-provider-info.git;protocol=https;branch=master", "4ed19e11c2975105b71b956440acdb25d46a347d", "")
+ ("mobile-broadband-provider-info", "git://gitlab.gnome.org/GNOME/mobile-broadband-provider-info.git;protocol=https;branch=master", "4ed19e11c2975105b71b956440acdb25d46a347d", "", "")
: "20120614",
# packages with a valid UPSTREAM_CHECK_GITTAGREGEX
# mirror of git://anongit.freedesktop.org/xorg/driver/xf86-video-omap since network issues interfered with testing
- ("xf86-video-omap", "git://git.yoctoproject.org/bbfetchtests-xf86-video-omap;branch=master", "ae0394e687f1a77e966cf72f895da91840dffb8f", r"(?P<pver>(\d+\.(\d\.?)*))")
+ ("xf86-video-omap", "git://git.yoctoproject.org/bbfetchtests-xf86-video-omap;branch=master;protocol=https", "ae0394e687f1a77e966cf72f895da91840dffb8f", r"(?P<pver>(\d+\.(\d\.?)*))", "")
: "0.4.3",
- ("build-appliance-image", "git://git.yoctoproject.org/poky;branch=master", "b37dd451a52622d5b570183a81583cc34c2ff555", r"(?P<pver>(([0-9][\.|_]?)+[0-9]))")
+ ("build-appliance-image", "git://git.yoctoproject.org/poky;branch=master;protocol=https", "b37dd451a52622d5b570183a81583cc34c2ff555", r"(?P<pver>(([0-9][\.|_]?)+[0-9]))", "")
: "11.0.0",
- ("chkconfig-alternatives-native", "git://github.com/kergoth/chkconfig;branch=sysroot;protocol=https", "cd437ecbd8986c894442f8fce1e0061e20f04dee", r"chkconfig\-(?P<pver>((\d+[\.\-_]*)+))")
+ ("chkconfig-alternatives-native", "git://github.com/kergoth/chkconfig;branch=sysroot;protocol=https", "cd437ecbd8986c894442f8fce1e0061e20f04dee", r"chkconfig\-(?P<pver>((\d+[\.\-_]*)+))", "")
: "1.3.59",
- ("remake", "git://github.com/rocky/remake.git;protocol=https;branch=master", "f05508e521987c8494c92d9c2871aec46307d51d", r"(?P<pver>(\d+\.(\d+\.)*\d*(\+dbg\d+(\.\d+)*)*))")
+ ("remake", "git://github.com/rocky/remake.git;protocol=https;branch=master", "f05508e521987c8494c92d9c2871aec46307d51d", r"(?P<pver>(\d+\.(\d+\.)*\d*(\+dbg\d+(\.\d+)*)*))", "")
: "3.82+dbg0.9",
+ ("sysdig", "git://github.com/draios/sysdig.git;branch=dev;protocol=https", "4fb6288275f567f63515df0ff0a6518043ecfa9b", r"^(?P<pver>\d+(\.\d+)+)", "10.0.0")
+ : "0.28.0",
}
test_wget_uris = {
@@ -1371,6 +1461,9 @@ class FetchLatestVersionTest(FetcherTest):
# http://www.cmake.org/files/v2.8/cmake-2.8.12.1.tar.gz
("cmake", "/files/v2.8/cmake-2.8.12.1.tar.gz", "", "")
: "2.8.12.1",
+ # https://download.gnome.org/sources/libxml2/2.9/libxml2-2.9.14.tar.xz
+ ("libxml2", "/software/libxml2/2.9/libxml2-2.9.14.tar.xz", "", "")
+ : "2.10.3",
#
# packages with versions only in current directory
#
@@ -1408,6 +1501,12 @@ class FetchLatestVersionTest(FetcherTest):
: "2.8",
}
+ test_crate_uris = {
+ # basic example; version pattern "A.B.C+cargo-D.E.F"
+ ("cargo-c", "crate://crates.io/cargo-c/0.9.18+cargo-0.69")
+ : "0.9.29"
+ }
+
@skipIfNoNetwork()
def test_git_latest_versionstring(self):
for k, v in self.test_git_uris.items():
@@ -1420,6 +1519,9 @@ class FetchLatestVersionTest(FetcherTest):
self.assertTrue(verstring, msg="Could not find upstream version for %s" % k[0])
r = bb.utils.vercmp_string(v, verstring)
self.assertTrue(r == -1 or r == 0, msg="Package %s, version: %s <= %s" % (k[0], v, verstring))
+ if k[4]:
+ r = bb.utils.vercmp_string(verstring, k[4])
+ self.assertTrue(r == -1 or r == 0, msg="Package %s, version: %s <= %s" % (k[0], verstring, k[4]))
def test_wget_latest_versionstring(self):
testdata = os.path.dirname(os.path.abspath(__file__)) + "/fetch-testdata"
@@ -1444,6 +1546,16 @@ class FetchLatestVersionTest(FetcherTest):
finally:
server.stop()
+ @skipIfNoNetwork()
+ def test_crate_latest_versionstring(self):
+ for k, v in self.test_crate_uris.items():
+ self.d.setVar("PN", k[0])
+ ud = bb.fetch2.FetchData(k[1], self.d)
+ pupver = ud.method.latest_versionstring(ud, self.d)
+ verstring = pupver[0]
+ self.assertTrue(verstring, msg="Could not find upstream version for %s" % k[0])
+ r = bb.utils.vercmp_string(v, verstring)
+ self.assertTrue(r == -1 or r == 0, msg="Package %s, version: %s <= %s" % (k[0], v, verstring))
class FetchCheckStatusTest(FetcherTest):
test_wget_uris = ["https://downloads.yoctoproject.org/releases/sato/sato-engine-0.1.tar.gz",
@@ -1621,7 +1733,7 @@ class GitShallowTest(FetcherTest):
self.d.setVar('BB_GIT_SHALLOW', '1')
self.d.setVar('BB_GENERATE_MIRROR_TARBALLS', '0')
self.d.setVar('BB_GENERATE_SHALLOW_TARBALLS', '1')
- self.d.setVar("__BBSEENSRCREV", "1")
+ self.d.setVar("__BBSRCREV_SEEN", "1")
def assertRefs(self, expected_refs, cwd=None):
if cwd is None:
@@ -1841,7 +1953,7 @@ class GitShallowTest(FetcherTest):
self.add_empty_file('bsub', cwd=smdir)
self.git('submodule init', cwd=self.srcdir)
- self.git('submodule add file://%s' % smdir, cwd=self.srcdir)
+ self.git('-c protocol.file.allow=always submodule add file://%s' % smdir, cwd=self.srcdir)
self.git('submodule update', cwd=self.srcdir)
self.git('commit -m submodule -a', cwd=self.srcdir)
@@ -1871,7 +1983,7 @@ class GitShallowTest(FetcherTest):
self.add_empty_file('bsub', cwd=smdir)
self.git('submodule init', cwd=self.srcdir)
- self.git('submodule add file://%s' % smdir, cwd=self.srcdir)
+ self.git('-c protocol.file.allow=always submodule add file://%s' % smdir, cwd=self.srcdir)
self.git('submodule update', cwd=self.srcdir)
self.git('commit -m submodule -a', cwd=self.srcdir)
@@ -2156,7 +2268,7 @@ class GitShallowTest(FetcherTest):
self.d.setVar('SRCREV', 'e5939ff608b95cdd4d0ab0e1935781ab9a276ac0')
self.d.setVar('BB_GIT_SHALLOW', '1')
self.d.setVar('BB_GENERATE_SHALLOW_TARBALLS', '1')
- fetcher = bb.fetch.Fetch(["git://git.yoctoproject.org/fstests;branch=master"], self.d)
+ fetcher = bb.fetch.Fetch(["git://git.yoctoproject.org/fstests;branch=master;protocol=https"], self.d)
fetcher.download()
bb.utils.remove(self.dldir + "/*.tar.gz")
@@ -2166,6 +2278,12 @@ class GitShallowTest(FetcherTest):
self.assertIn("fstests.doap", dir)
class GitLfsTest(FetcherTest):
+ def skipIfNoGitLFS():
+ import shutil
+ if not shutil.which('git-lfs'):
+ return unittest.skip('git-lfs not installed')
+ return lambda f: f
+
def setUp(self):
FetcherTest.setUp(self)
@@ -2179,14 +2297,18 @@ class GitLfsTest(FetcherTest):
self.d.setVar('SRCREV', '${AUTOREV}')
self.d.setVar('AUTOREV', '${@bb.fetch2.get_autorev(d)}')
- self.d.setVar("__BBSEENSRCREV", "1")
+ self.d.setVar("__BBSRCREV_SEEN", "1")
bb.utils.mkdirhier(self.srcdir)
self.git_init(cwd=self.srcdir)
- with open(os.path.join(self.srcdir, '.gitattributes'), 'wt') as attrs:
- attrs.write('*.mp3 filter=lfs -text')
- self.git(['add', '.gitattributes'], cwd=self.srcdir)
- self.git(['commit', '-m', "attributes", '.gitattributes'], cwd=self.srcdir)
+ self.commit_file('.gitattributes', '*.mp3 filter=lfs -text')
+
+ def commit_file(self, filename, content):
+ with open(os.path.join(self.srcdir, filename), "w") as f:
+ f.write(content)
+ self.git(["add", filename], cwd=self.srcdir)
+ self.git(["commit", "-m", "Change"], cwd=self.srcdir)
+ return self.git(["rev-parse", "HEAD"], cwd=self.srcdir).strip()
def fetch(self, uri=None, download=True):
uris = self.d.getVar('SRC_URI').split()
@@ -2199,55 +2321,148 @@ class GitLfsTest(FetcherTest):
ud = fetcher.ud[uri]
return fetcher, ud
+ def get_real_git_lfs_file(self):
+ self.d.setVar('PATH', os.environ.get('PATH'))
+ fetcher, ud = self.fetch()
+ fetcher.unpack(self.d.getVar('WORKDIR'))
+ unpacked_lfs_file = os.path.join(self.d.getVar('WORKDIR'), 'git', "Cat_poster_1.jpg")
+ return unpacked_lfs_file
+
+ @skipIfNoGitLFS()
+ def test_fetch_lfs_on_srcrev_change(self):
+ """Test if fetch downloads missing LFS objects when a different revision within an existing repository is requested"""
+ self.git(["lfs", "install", "--local"], cwd=self.srcdir)
+
+ @contextlib.contextmanager
+ def hide_upstream_repository():
+ """Hide the upstream repository to make sure that git lfs cannot pull from it"""
+ temp_name = self.srcdir + ".bak"
+ os.rename(self.srcdir, temp_name)
+ try:
+ yield
+ finally:
+ os.rename(temp_name, self.srcdir)
+
+ def fetch_and_verify(revision, filename, content):
+ self.d.setVar('SRCREV', revision)
+ fetcher, ud = self.fetch()
+
+ with hide_upstream_repository():
+ workdir = self.d.getVar('WORKDIR')
+ fetcher.unpack(workdir)
+
+ with open(os.path.join(workdir, "git", filename)) as f:
+ self.assertEqual(f.read(), content)
+
+ commit_1 = self.commit_file("a.mp3", "version 1")
+ commit_2 = self.commit_file("a.mp3", "version 2")
+
+ self.d.setVar('SRC_URI', "git://%s;protocol=file;lfs=1;branch=master" % self.srcdir)
+
+ # Seed the local download folder by fetching the latest commit and verifying that the LFS contents are
+ # available even when the upstream repository disappears.
+ fetch_and_verify(commit_2, "a.mp3", "version 2")
+ # Verify that even when an older revision is fetched, the needed LFS objects are fetched into the download
+ # folder.
+ fetch_and_verify(commit_1, "a.mp3", "version 1")
+
+ @skipIfNoGitLFS()
+ @skipIfNoNetwork()
+ def test_real_git_lfs_repo_succeeds_without_lfs_param(self):
+ self.d.setVar('SRC_URI', "git://gitlab.com/gitlab-examples/lfs.git;protocol=https;branch=master")
+ f = self.get_real_git_lfs_file()
+ self.assertTrue(os.path.exists(f))
+ self.assertEqual("c0baab607a97839c9a328b4310713307", bb.utils.md5_file(f))
+
+ @skipIfNoGitLFS()
+ @skipIfNoNetwork()
+ def test_real_git_lfs_repo_succeeds(self):
+ self.d.setVar('SRC_URI', "git://gitlab.com/gitlab-examples/lfs.git;protocol=https;branch=master;lfs=1")
+ f = self.get_real_git_lfs_file()
+ self.assertTrue(os.path.exists(f))
+ self.assertEqual("c0baab607a97839c9a328b4310713307", bb.utils.md5_file(f))
+
+ @skipIfNoGitLFS()
+ @skipIfNoNetwork()
+ def test_real_git_lfs_repo_skips(self):
+ self.d.setVar('SRC_URI', "git://gitlab.com/gitlab-examples/lfs.git;protocol=https;branch=master;lfs=0")
+ f = self.get_real_git_lfs_file()
+ # This is the actual non-smudged placeholder file on the repo if git-lfs does not run
+ lfs_file = (
+ 'version https://git-lfs.github.com/spec/v1\n'
+ 'oid sha256:34be66b1a39a1955b46a12588df9d5f6fc1da790e05cf01f3c7422f4bbbdc26b\n'
+ 'size 11423554\n'
+ )
+
+ with open(f) as fh:
+ self.assertEqual(lfs_file, fh.read())
+
+ @skipIfNoGitLFS()
def test_lfs_enabled(self):
import shutil
uri = 'git://%s;protocol=file;lfs=1;branch=master' % self.srcdir
self.d.setVar('SRC_URI', uri)
- # Careful: suppress initial attempt at downloading until
- # we know whether git-lfs is installed.
- fetcher, ud = self.fetch(uri=None, download=False)
- self.assertIsNotNone(ud.method._find_git_lfs)
-
- # If git-lfs can be found, the unpack should be successful. Only
- # attempt this with the real live copy of git-lfs installed.
- if ud.method._find_git_lfs(self.d):
- fetcher.download()
- shutil.rmtree(self.gitdir, ignore_errors=True)
- fetcher.unpack(self.d.getVar('WORKDIR'))
-
- # If git-lfs cannot be found, the unpack should throw an error
- with self.assertRaises(bb.fetch2.FetchError):
- fetcher.download()
- ud.method._find_git_lfs = lambda d: False
- shutil.rmtree(self.gitdir, ignore_errors=True)
- fetcher.unpack(self.d.getVar('WORKDIR'))
+ # With git-lfs installed, test that we can fetch and unpack
+ fetcher, ud = self.fetch()
+ shutil.rmtree(self.gitdir, ignore_errors=True)
+ fetcher.unpack(self.d.getVar('WORKDIR'))
+ @skipIfNoGitLFS()
def test_lfs_disabled(self):
import shutil
uri = 'git://%s;protocol=file;lfs=0;branch=master' % self.srcdir
self.d.setVar('SRC_URI', uri)
- # In contrast to test_lfs_enabled(), allow the implicit download
- # done by self.fetch() to occur here. The point of this test case
- # is to verify that the fetcher can survive even if the source
+ # Verify that the fetcher can survive even if the source
# repository has Git LFS usage configured.
fetcher, ud = self.fetch()
- self.assertIsNotNone(ud.method._find_git_lfs)
-
- # If git-lfs can be found, the unpack should be successful. A
- # live copy of git-lfs is not required for this case, so
- # unconditionally forge its presence.
- ud.method._find_git_lfs = lambda d: True
- shutil.rmtree(self.gitdir, ignore_errors=True)
fetcher.unpack(self.d.getVar('WORKDIR'))
- # If git-lfs cannot be found, the unpack should be successful
- ud.method._find_git_lfs = lambda d: False
- shutil.rmtree(self.gitdir, ignore_errors=True)
- fetcher.unpack(self.d.getVar('WORKDIR'))
+ def test_lfs_enabled_not_installed(self):
+ import shutil
+
+ uri = 'git://%s;protocol=file;lfs=1;branch=master' % self.srcdir
+ self.d.setVar('SRC_URI', uri)
+
+ # Careful: suppress initial attempt at downloading
+ fetcher, ud = self.fetch(uri=None, download=False)
+
+ # Artificially assert that git-lfs is not installed, so
+ # we can verify a failure to unpack in it's absence.
+ old_find_git_lfs = ud.method._find_git_lfs
+ try:
+ # If git-lfs cannot be found, the unpack should throw an error
+ with self.assertRaises(bb.fetch2.FetchError):
+ fetcher.download()
+ ud.method._find_git_lfs = lambda d: False
+ shutil.rmtree(self.gitdir, ignore_errors=True)
+ fetcher.unpack(self.d.getVar('WORKDIR'))
+ finally:
+ ud.method._find_git_lfs = old_find_git_lfs
+
+ def test_lfs_disabled_not_installed(self):
+ import shutil
+
+ uri = 'git://%s;protocol=file;lfs=0;branch=master' % self.srcdir
+ self.d.setVar('SRC_URI', uri)
+
+ # Careful: suppress initial attempt at downloading
+ fetcher, ud = self.fetch(uri=None, download=False)
+
+ # Artificially assert that git-lfs is not installed, so
+ # we can verify a failure to unpack in it's absence.
+ old_find_git_lfs = ud.method._find_git_lfs
+ try:
+ # Even if git-lfs cannot be found, the unpack should be successful
+ fetcher.download()
+ ud.method._find_git_lfs = lambda d: False
+ shutil.rmtree(self.gitdir, ignore_errors=True)
+ fetcher.unpack(self.d.getVar('WORKDIR'))
+ finally:
+ ud.method._find_git_lfs = old_find_git_lfs
class GitURLWithSpacesTest(FetcherTest):
test_git_urls = {
@@ -2292,6 +2507,13 @@ class CrateTest(FetcherTest):
d = self.d
fetcher = bb.fetch2.Fetch(uris, self.d)
+ ud = fetcher.ud[fetcher.urls[0]]
+
+ self.assertIn("name", ud.parm)
+ self.assertEqual(ud.parm["name"], "glob-0.2.11")
+ self.assertIn("downloadfilename", ud.parm)
+ self.assertEqual(ud.parm["downloadfilename"], "glob-0.2.11.crate")
+
fetcher.download()
fetcher.unpack(self.tempdir)
self.assertEqual(sorted(os.listdir(self.tempdir)), ['cargo_home', 'download' , 'unpacked'])
@@ -2300,6 +2522,55 @@ class CrateTest(FetcherTest):
self.assertTrue(os.path.exists(self.tempdir + "/cargo_home/bitbake/glob-0.2.11/src/lib.rs"))
@skipIfNoNetwork()
+ def test_crate_url_matching_recipe(self):
+
+ self.d.setVar('BP', 'glob-0.2.11')
+
+ uri = "crate://crates.io/glob/0.2.11"
+ self.d.setVar('SRC_URI', uri)
+
+ uris = self.d.getVar('SRC_URI').split()
+ d = self.d
+
+ fetcher = bb.fetch2.Fetch(uris, self.d)
+ ud = fetcher.ud[fetcher.urls[0]]
+
+ self.assertIn("name", ud.parm)
+ self.assertEqual(ud.parm["name"], "glob-0.2.11")
+ self.assertIn("downloadfilename", ud.parm)
+ self.assertEqual(ud.parm["downloadfilename"], "glob-0.2.11.crate")
+
+ fetcher.download()
+ fetcher.unpack(self.tempdir)
+ self.assertEqual(sorted(os.listdir(self.tempdir)), ['download', 'glob-0.2.11', 'unpacked'])
+ self.assertEqual(sorted(os.listdir(self.tempdir + "/download")), ['glob-0.2.11.crate', 'glob-0.2.11.crate.done'])
+ self.assertTrue(os.path.exists(self.tempdir + "/glob-0.2.11/src/lib.rs"))
+
+ @skipIfNoNetwork()
+ def test_crate_url_params(self):
+
+ uri = "crate://crates.io/aho-corasick/0.7.20;name=aho-corasick-renamed"
+ self.d.setVar('SRC_URI', uri)
+
+ uris = self.d.getVar('SRC_URI').split()
+ d = self.d
+
+ fetcher = bb.fetch2.Fetch(uris, self.d)
+ ud = fetcher.ud[fetcher.urls[0]]
+
+ self.assertIn("name", ud.parm)
+ self.assertEqual(ud.parm["name"], "aho-corasick-renamed")
+ self.assertIn("downloadfilename", ud.parm)
+ self.assertEqual(ud.parm["downloadfilename"], "aho-corasick-0.7.20.crate")
+
+ fetcher.download()
+ fetcher.unpack(self.tempdir)
+ self.assertEqual(sorted(os.listdir(self.tempdir)), ['cargo_home', 'download' , 'unpacked'])
+ self.assertEqual(sorted(os.listdir(self.tempdir + "/download")), ['aho-corasick-0.7.20.crate', 'aho-corasick-0.7.20.crate.done'])
+ self.assertTrue(os.path.exists(self.tempdir + "/cargo_home/bitbake/aho-corasick-0.7.20/.cargo-checksum.json"))
+ self.assertTrue(os.path.exists(self.tempdir + "/cargo_home/bitbake/aho-corasick-0.7.20/src/lib.rs"))
+
+ @skipIfNoNetwork()
def test_crate_url_multi(self):
uri = "crate://crates.io/glob/0.2.11 crate://crates.io/time/0.1.35"
@@ -2309,6 +2580,19 @@ class CrateTest(FetcherTest):
d = self.d
fetcher = bb.fetch2.Fetch(uris, self.d)
+ ud = fetcher.ud[fetcher.urls[0]]
+
+ self.assertIn("name", ud.parm)
+ self.assertEqual(ud.parm["name"], "glob-0.2.11")
+ self.assertIn("downloadfilename", ud.parm)
+ self.assertEqual(ud.parm["downloadfilename"], "glob-0.2.11.crate")
+
+ ud = fetcher.ud[fetcher.urls[1]]
+ self.assertIn("name", ud.parm)
+ self.assertEqual(ud.parm["name"], "time-0.1.35")
+ self.assertIn("downloadfilename", ud.parm)
+ self.assertEqual(ud.parm["downloadfilename"], "time-0.1.35.crate")
+
fetcher.download()
fetcher.unpack(self.tempdir)
self.assertEqual(sorted(os.listdir(self.tempdir)), ['cargo_home', 'download' , 'unpacked'])
@@ -2318,6 +2602,18 @@ class CrateTest(FetcherTest):
self.assertTrue(os.path.exists(self.tempdir + "/cargo_home/bitbake/time-0.1.35/.cargo-checksum.json"))
self.assertTrue(os.path.exists(self.tempdir + "/cargo_home/bitbake/time-0.1.35/src/lib.rs"))
+ @skipIfNoNetwork()
+ def test_crate_incorrect_cksum(self):
+ uri = "crate://crates.io/aho-corasick/0.7.20"
+ self.d.setVar('SRC_URI', uri)
+ self.d.setVarFlag("SRC_URI", "aho-corasick-0.7.20.sha256sum", hashlib.sha256("Invalid".encode("utf-8")).hexdigest())
+
+ uris = self.d.getVar('SRC_URI').split()
+
+ fetcher = bb.fetch2.Fetch(uris, self.d)
+ with self.assertRaisesRegex(bb.fetch2.FetchError, "Fetcher failure for URL"):
+ fetcher.download()
+
class NPMTest(FetcherTest):
def skipIfNoNpm():
import shutil
@@ -2581,6 +2877,45 @@ class NPMTest(FetcherTest):
@skipIfNoNpm()
@skipIfNoNetwork()
+ def test_npmsw_git(self):
+ swfile = self.create_shrinkwrap_file({
+ 'dependencies': {
+ 'cookie': {
+ 'version': 'github:jshttp/cookie.git#aec1177c7da67e3b3273df96cf476824dbc9ae09',
+ 'from': 'github:jshttp/cookie.git'
+ }
+ }
+ })
+ fetcher = bb.fetch.Fetch(['npmsw://' + swfile], self.d)
+ fetcher.download()
+ self.assertTrue(os.path.exists(os.path.join(self.dldir, 'git2', 'github.com.jshttp.cookie.git')))
+
+ swfile = self.create_shrinkwrap_file({
+ 'dependencies': {
+ 'cookie': {
+ 'version': 'jshttp/cookie.git#aec1177c7da67e3b3273df96cf476824dbc9ae09',
+ 'from': 'jshttp/cookie.git'
+ }
+ }
+ })
+ fetcher = bb.fetch.Fetch(['npmsw://' + swfile], self.d)
+ fetcher.download()
+ self.assertTrue(os.path.exists(os.path.join(self.dldir, 'git2', 'github.com.jshttp.cookie.git')))
+
+ swfile = self.create_shrinkwrap_file({
+ 'dependencies': {
+ 'nodejs': {
+ 'version': 'gitlab:gitlab-examples/nodejs.git#892a1f16725e56cc3a2cb0d677be42935c8fc262',
+ 'from': 'gitlab:gitlab-examples/nodejs'
+ }
+ }
+ })
+ fetcher = bb.fetch.Fetch(['npmsw://' + swfile], self.d)
+ fetcher.download()
+ self.assertTrue(os.path.exists(os.path.join(self.dldir, 'git2', 'gitlab.com.gitlab-examples.nodejs.git')))
+
+ @skipIfNoNpm()
+ @skipIfNoNetwork()
def test_npmsw_dev(self):
swfile = self.create_shrinkwrap_file({
'dependencies': {
@@ -2786,9 +3121,9 @@ class NPMTest(FetcherTest):
class GitSharedTest(FetcherTest):
def setUp(self):
super(GitSharedTest, self).setUp()
- self.recipe_url = "git://git.openembedded.org/bitbake;branch=master"
+ self.recipe_url = "git://git.openembedded.org/bitbake;branch=master;protocol=https"
self.d.setVar('SRCREV', '82ea737a0b42a8b53e11c9cde141e9e9c0bd8c40')
- self.d.setVar("__BBSEENSRCREV", "1")
+ self.d.setVar("__BBSRCREV_SEEN", "1")
@skipIfNoNetwork()
def test_shared_unpack(self):
@@ -2819,31 +3154,59 @@ class FetchPremirroronlyLocalTest(FetcherTest):
os.mkdir(self.mirrordir)
self.reponame = "bitbake"
self.gitdir = os.path.join(self.tempdir, "git", self.reponame)
- self.recipe_url = "git://git.fake.repo/bitbake"
+ self.recipe_url = "git://git.fake.repo/bitbake;branch=master;protocol=https"
self.d.setVar("BB_FETCH_PREMIRRORONLY", "1")
self.d.setVar("BB_NO_NETWORK", "1")
self.d.setVar("PREMIRRORS", self.recipe_url + " " + "file://{}".format(self.mirrordir) + " \n")
+ self.mirrorname = "git2_git.fake.repo.bitbake.tar.gz"
+ self.mirrorfile = os.path.join(self.mirrordir, self.mirrorname)
+ self.testfilename = "bitbake-fetch.test"
def make_git_repo(self):
- self.mirrorname = "git2_git.fake.repo.bitbake.tar.gz"
recipeurl = "git:/git.fake.repo/bitbake"
os.makedirs(self.gitdir)
- self.git("init", self.gitdir)
+ self.git_init(cwd=self.gitdir)
for i in range(0):
self.git_new_commit()
bb.process.run('tar -czvf {} .'.format(os.path.join(self.mirrordir, self.mirrorname)), cwd = self.gitdir)
def git_new_commit(self):
import random
- testfilename = "bibake-fetch.test"
os.unlink(os.path.join(self.mirrordir, self.mirrorname))
- with open(os.path.join(self.gitdir, testfilename), "w") as testfile:
- testfile.write("Useless random data {}".format(random.random()))
- self.git("add {}".format(testfilename), self.gitdir)
- self.git("commit -a -m \"This random commit {}. I'm useless.\"".format(random.random()), self.gitdir)
+ branch = self.git("branch --show-current", self.gitdir).split()
+ with open(os.path.join(self.gitdir, self.testfilename), "w") as testfile:
+ testfile.write("File {} from branch {}; Useless random data {}".format(self.testfilename, branch, random.random()))
+ self.git("add {}".format(self.testfilename), self.gitdir)
+ self.git("commit -a -m \"This random commit {} in branch {}. I'm useless.\"".format(random.random(), branch), self.gitdir)
bb.process.run('tar -czvf {} .'.format(os.path.join(self.mirrordir, self.mirrorname)), cwd = self.gitdir)
return self.git("rev-parse HEAD", self.gitdir).strip()
+ def git_new_branch(self, name):
+ self.git_new_commit()
+ head = self.git("rev-parse HEAD", self.gitdir).strip()
+ self.git("checkout -b {}".format(name), self.gitdir)
+ newrev = self.git_new_commit()
+ self.git("checkout {}".format(head), self.gitdir)
+ return newrev
+
+ def test_mirror_multiple_fetches(self):
+ self.make_git_repo()
+ self.d.setVar("SRCREV", self.git_new_commit())
+ fetcher = bb.fetch.Fetch([self.recipe_url], self.d)
+ fetcher.download()
+ fetcher.unpack(self.unpackdir)
+ ## New commit in premirror. it's not in the download_dir
+ self.d.setVar("SRCREV", self.git_new_commit())
+ fetcher2 = bb.fetch.Fetch([self.recipe_url], self.d)
+ fetcher2.download()
+ fetcher2.unpack(self.unpackdir)
+ ## New commit in premirror. it's not in the download_dir
+ self.d.setVar("SRCREV", self.git_new_commit())
+ fetcher3 = bb.fetch.Fetch([self.recipe_url], self.d)
+ fetcher3.download()
+ fetcher3.unpack(self.unpackdir)
+
+
def test_mirror_commit_nonexistent(self):
self.make_git_repo()
self.d.setVar("SRCREV", "0"*40)
@@ -2864,6 +3227,59 @@ class FetchPremirroronlyLocalTest(FetcherTest):
with self.assertRaises(bb.fetch2.NetworkAccess):
fetcher.download()
+ def test_mirror_tarball_multiple_branches(self):
+ """
+ test if PREMIRRORS can handle multiple name/branches correctly
+ both branches have required revisions
+ """
+ self.make_git_repo()
+ branch1rev = self.git_new_branch("testbranch1")
+ branch2rev = self.git_new_branch("testbranch2")
+ self.recipe_url = "git://git.fake.repo/bitbake;branch=testbranch1,testbranch2;protocol=https;name=branch1,branch2"
+ self.d.setVar("SRCREV_branch1", branch1rev)
+ self.d.setVar("SRCREV_branch2", branch2rev)
+ fetcher = bb.fetch.Fetch([self.recipe_url], self.d)
+ self.assertTrue(os.path.exists(self.mirrorfile), "Mirror file doesn't exist")
+ fetcher.download()
+ fetcher.unpack(os.path.join(self.tempdir, "unpacked"))
+ unpacked = os.path.join(self.tempdir, "unpacked", "git", self.testfilename)
+ self.assertTrue(os.path.exists(unpacked), "Repo has not been unpackaged properly!")
+ with open(unpacked, 'r') as f:
+ content = f.read()
+ ## We expect to see testbranch1 in the file, not master, not testbranch2
+ self.assertTrue(content.find("testbranch1") != -1, "Wrong branch has been checked out!")
+
+ def test_mirror_tarball_multiple_branches_nobranch(self):
+ """
+ test if PREMIRRORS can handle multiple name/branches correctly
+ Unbalanced name/branches raises ParameterError
+ """
+ self.make_git_repo()
+ branch1rev = self.git_new_branch("testbranch1")
+ branch2rev = self.git_new_branch("testbranch2")
+ self.recipe_url = "git://git.fake.repo/bitbake;branch=testbranch1;protocol=https;name=branch1,branch2"
+ self.d.setVar("SRCREV_branch1", branch1rev)
+ self.d.setVar("SRCREV_branch2", branch2rev)
+ with self.assertRaises(bb.fetch2.ParameterError):
+ fetcher = bb.fetch.Fetch([self.recipe_url], self.d)
+
+ def test_mirror_tarball_multiple_branches_norev(self):
+ """
+ test if PREMIRRORS can handle multiple name/branches correctly
+ one of the branches specifies non existing SRCREV
+ """
+ self.make_git_repo()
+ branch1rev = self.git_new_branch("testbranch1")
+ branch2rev = self.git_new_branch("testbranch2")
+ self.recipe_url = "git://git.fake.repo/bitbake;branch=testbranch1,testbranch2;protocol=https;name=branch1,branch2"
+ self.d.setVar("SRCREV_branch1", branch1rev)
+ self.d.setVar("SRCREV_branch2", "0"*40)
+ fetcher = bb.fetch.Fetch([self.recipe_url], self.d)
+ self.assertTrue(os.path.exists(self.mirrorfile), "Mirror file doesn't exist")
+ with self.assertRaises(bb.fetch2.NetworkAccess):
+ fetcher.download()
+
+
class FetchPremirroronlyNetworkTest(FetcherTest):
def setUp(self):
@@ -2873,7 +3289,7 @@ class FetchPremirroronlyNetworkTest(FetcherTest):
self.reponame = "fstests"
self.clonedir = os.path.join(self.tempdir, "git")
self.gitdir = os.path.join(self.tempdir, "git", "{}.git".format(self.reponame))
- self.recipe_url = "git://git.yoctoproject.org/fstests"
+ self.recipe_url = "git://git.yoctoproject.org/fstests;protocol=https"
self.d.setVar("BB_FETCH_PREMIRRORONLY", "1")
self.d.setVar("BB_NO_NETWORK", "0")
self.d.setVar("PREMIRRORS", self.recipe_url + " " + "file://{}".format(self.mirrordir) + " \n")
@@ -2903,6 +3319,50 @@ class FetchPremirroronlyNetworkTest(FetcherTest):
with self.assertRaises(bb.fetch2.NetworkAccess):
fetcher.download()
+class FetchPremirroronlyMercurialTest(FetcherTest):
+ """ Test for premirrors with mercurial repos
+ the test covers also basic hg:// clone (see fetch_and_create_tarball
+ """
+ def skipIfNoHg():
+ import shutil
+ if not shutil.which('hg'):
+ return unittest.skip('Mercurial not installed')
+ return lambda f: f
+
+ def setUp(self):
+ super(FetchPremirroronlyMercurialTest, self).setUp()
+ self.mirrordir = os.path.join(self.tempdir, "mirrors")
+ os.mkdir(self.mirrordir)
+ self.reponame = "libgnt"
+ self.clonedir = os.path.join(self.tempdir, "hg")
+ self.recipe_url = "hg://keep.imfreedom.org/libgnt;module=libgnt"
+ self.d.setVar("SRCREV", "53e8b422faaf")
+ self.mirrorname = "hg_libgnt_keep.imfreedom.org_.libgnt.tar.gz"
+
+ def fetch_and_create_tarball(self):
+ """
+ Ask bitbake to download repo and prepare mirror tarball for us
+ """
+ self.d.setVar("BB_GENERATE_MIRROR_TARBALLS", "1")
+ fetcher = bb.fetch.Fetch([self.recipe_url], self.d)
+ fetcher.download()
+ mirrorfile = os.path.join(self.d.getVar("DL_DIR"), self.mirrorname)
+ self.assertTrue(os.path.exists(mirrorfile), "Mirror tarball {} has not been created".format(mirrorfile))
+ ## moving tarball to mirror directory
+ os.rename(mirrorfile, os.path.join(self.mirrordir, self.mirrorname))
+ self.d.setVar("BB_GENERATE_MIRROR_TARBALLS", "0")
+
+
+ @skipIfNoNetwork()
+ @skipIfNoHg()
+ def test_premirror_mercurial(self):
+ self.fetch_and_create_tarball()
+ self.d.setVar("PREMIRRORS", self.recipe_url + " " + "file://{}".format(self.mirrordir) + " \n")
+ self.d.setVar("BB_FETCH_PREMIRRORONLY", "1")
+ self.d.setVar("BB_NO_NETWORK", "1")
+ fetcher = bb.fetch.Fetch([self.recipe_url], self.d)
+ fetcher.download()
+
class FetchPremirroronlyBrokenTarball(FetcherTest):
def setUp(self):
@@ -2911,7 +3371,7 @@ class FetchPremirroronlyBrokenTarball(FetcherTest):
os.mkdir(self.mirrordir)
self.reponame = "bitbake"
self.gitdir = os.path.join(self.tempdir, "git", self.reponame)
- self.recipe_url = "git://git.fake.repo/bitbake"
+ self.recipe_url = "git://git.fake.repo/bitbake;protocol=https"
self.d.setVar("BB_FETCH_PREMIRRORONLY", "1")
self.d.setVar("BB_NO_NETWORK", "1")
self.d.setVar("PREMIRRORS", self.recipe_url + " " + "file://{}".format(self.mirrordir) + " \n")
@@ -2923,7 +3383,7 @@ class FetchPremirroronlyBrokenTarball(FetcherTest):
import sys
self.d.setVar("SRCREV", "0"*40)
fetcher = bb.fetch.Fetch([self.recipe_url], self.d)
- with self.assertRaises(bb.fetch2.FetchError):
+ with self.assertRaises(bb.fetch2.FetchError), self.assertLogs() as logs:
fetcher.download()
- stdout = sys.stdout.getvalue()
- self.assertFalse(" not a git repository (or any parent up to mount point /)" in stdout)
+ output = "".join(logs.output)
+ self.assertFalse(" not a git repository (or any parent up to mount point /)" in output)
diff --git a/bitbake/lib/bb/tests/parse.py b/bitbake/lib/bb/tests/parse.py
index ee7f2534f1..72d1962e7e 100644
--- a/bitbake/lib/bb/tests/parse.py
+++ b/bitbake/lib/bb/tests/parse.py
@@ -186,14 +186,16 @@ deltask ${EMPTYVAR}
"""
def test_parse_addtask_deltask(self):
import sys
- f = self.parsehelper(self.addtask_deltask)
- d = bb.parse.handle(f.name, self.d)['']
- stdout = sys.stdout.getvalue()
- self.assertTrue("addtask contained multiple 'before' keywords" in stdout)
- self.assertTrue("addtask contained multiple 'after' keywords" in stdout)
- self.assertTrue('addtask ignored: " do_patch"' in stdout)
- #self.assertTrue('dependent task do_foo for do_patch does not exist' in stdout)
+ with self.assertLogs() as logs:
+ f = self.parsehelper(self.addtask_deltask)
+ d = bb.parse.handle(f.name, self.d)['']
+
+ output = "".join(logs.output)
+ self.assertTrue("addtask contained multiple 'before' keywords" in output)
+ self.assertTrue("addtask contained multiple 'after' keywords" in output)
+ self.assertTrue('addtask ignored: " do_patch"' in output)
+ #self.assertTrue('dependent task do_foo for do_patch does not exist' in output)
broken_multiline_comment = """
# First line of comment \\
@@ -218,3 +220,124 @@ VAR = " \\
with self.assertRaises(bb.BBHandledException):
d = bb.parse.handle(f.name, self.d)['']
+
+ at_sign_in_var_flag = """
+A[flag@.service] = "nonet"
+B[flag@.target] = "ntb"
+C[f] = "flag"
+
+unset A[flag@.service]
+"""
+ def test_parse_at_sign_in_var_flag(self):
+ f = self.parsehelper(self.at_sign_in_var_flag)
+ d = bb.parse.handle(f.name, self.d)['']
+ self.assertEqual(d.getVar("A"), None)
+ self.assertEqual(d.getVar("B"), None)
+ self.assertEqual(d.getVarFlag("A","flag@.service"), None)
+ self.assertEqual(d.getVarFlag("B","flag@.target"), "ntb")
+ self.assertEqual(d.getVarFlag("C","f"), "flag")
+
+ def test_parse_invalid_at_sign_in_var_flag(self):
+ invalid_at_sign = self.at_sign_in_var_flag.replace("B[f", "B[@f")
+ f = self.parsehelper(invalid_at_sign)
+ with self.assertRaises(bb.parse.ParseError):
+ d = bb.parse.handle(f.name, self.d)['']
+
+ export_function_recipe = """
+inherit someclass
+"""
+
+ export_function_recipe2 = """
+inherit someclass
+
+do_compile () {
+ false
+}
+
+python do_compilepython () {
+ bb.note("Something else")
+}
+
+"""
+ export_function_class = """
+someclass_do_compile() {
+ true
+}
+
+python someclass_do_compilepython () {
+ bb.note("Something")
+}
+
+EXPORT_FUNCTIONS do_compile do_compilepython
+"""
+
+ export_function_class2 = """
+secondclass_do_compile() {
+ true
+}
+
+python secondclass_do_compilepython () {
+ bb.note("Something")
+}
+
+EXPORT_FUNCTIONS do_compile do_compilepython
+"""
+
+ def test_parse_export_functions(self):
+ def check_function_flags(d):
+ self.assertEqual(d.getVarFlag("do_compile", "func"), 1)
+ self.assertEqual(d.getVarFlag("do_compilepython", "func"), 1)
+ self.assertEqual(d.getVarFlag("do_compile", "python"), None)
+ self.assertEqual(d.getVarFlag("do_compilepython", "python"), "1")
+
+ with tempfile.TemporaryDirectory() as tempdir:
+ self.d.setVar("__bbclasstype", "recipe")
+ recipename = tempdir + "/recipe.bb"
+ os.makedirs(tempdir + "/classes")
+ with open(tempdir + "/classes/someclass.bbclass", "w") as f:
+ f.write(self.export_function_class)
+ f.flush()
+ with open(tempdir + "/classes/secondclass.bbclass", "w") as f:
+ f.write(self.export_function_class2)
+ f.flush()
+
+ with open(recipename, "w") as f:
+ f.write(self.export_function_recipe)
+ f.flush()
+ os.chdir(tempdir)
+ d = bb.parse.handle(recipename, bb.data.createCopy(self.d))['']
+ self.assertIn("someclass_do_compile", d.getVar("do_compile"))
+ self.assertIn("someclass_do_compilepython", d.getVar("do_compilepython"))
+ check_function_flags(d)
+
+ recipename2 = tempdir + "/recipe2.bb"
+ with open(recipename2, "w") as f:
+ f.write(self.export_function_recipe2)
+ f.flush()
+
+ d = bb.parse.handle(recipename2, bb.data.createCopy(self.d))['']
+ self.assertNotIn("someclass_do_compile", d.getVar("do_compile"))
+ self.assertNotIn("someclass_do_compilepython", d.getVar("do_compilepython"))
+ self.assertIn("false", d.getVar("do_compile"))
+ self.assertIn("else", d.getVar("do_compilepython"))
+ check_function_flags(d)
+
+ with open(recipename, "a+") as f:
+ f.write("\ninherit secondclass\n")
+ f.flush()
+ with open(recipename2, "a+") as f:
+ f.write("\ninherit secondclass\n")
+ f.flush()
+
+ d = bb.parse.handle(recipename, bb.data.createCopy(self.d))['']
+ self.assertIn("secondclass_do_compile", d.getVar("do_compile"))
+ self.assertIn("secondclass_do_compilepython", d.getVar("do_compilepython"))
+ check_function_flags(d)
+
+ d = bb.parse.handle(recipename2, bb.data.createCopy(self.d))['']
+ self.assertNotIn("someclass_do_compile", d.getVar("do_compile"))
+ self.assertNotIn("someclass_do_compilepython", d.getVar("do_compilepython"))
+ self.assertIn("false", d.getVar("do_compile"))
+ self.assertIn("else", d.getVar("do_compilepython"))
+ check_function_flags(d)
+
diff --git a/bitbake/lib/bb/tests/runqueue.py b/bitbake/lib/bb/tests/runqueue.py
index 061a5a1f80..cc87e8d6a8 100644
--- a/bitbake/lib/bb/tests/runqueue.py
+++ b/bitbake/lib/bb/tests/runqueue.py
@@ -288,7 +288,7 @@ class RunQueueTests(unittest.TestCase):
with tempfile.TemporaryDirectory(prefix="runqueuetest") as tempdir:
extraenv = {
"BBMULTICONFIG" : "mc-1 mc_2",
- "BB_SIGNATURE_HANDLER" : "TestMulticonfigDepends",
+ "BB_SIGNATURE_HANDLER" : "basichash",
"EXTRA_BBFILES": "${COREBASE}/recipes/fails-mc/*.bb",
}
tasks = self.run_bitbakecmd(["bitbake", "mc:mc-1:f1"], tempdir, "", extraenv=extraenv, cleanup=True)
diff --git a/bitbake/lib/bb/tests/siggen.py b/bitbake/lib/bb/tests/siggen.py
index c21ab4e4fb..0dc67e6cc2 100644
--- a/bitbake/lib/bb/tests/siggen.py
+++ b/bitbake/lib/bb/tests/siggen.py
@@ -17,75 +17,12 @@ import bb.siggen
class SiggenTest(unittest.TestCase):
- def test_clean_basepath_simple_target_basepath(self):
- basepath = '/full/path/to/poky/meta/recipes-whatever/helloworld/helloworld_1.2.3.bb:do_sometask'
- expected_cleaned = 'helloworld/helloworld_1.2.3.bb:do_sometask'
+ def test_build_pnid(self):
+ tests = {
+ ('', 'helloworld', 'do_sometask') : 'helloworld:do_sometask',
+ ('XX', 'helloworld', 'do_sometask') : 'mc:XX:helloworld:do_sometask',
+ }
- actual_cleaned = bb.siggen.clean_basepath(basepath)
+ for t in tests:
+ self.assertEqual(bb.siggen.build_pnid(*t), tests[t])
- self.assertEqual(actual_cleaned, expected_cleaned)
-
- def test_clean_basepath_basic_virtual_basepath(self):
- basepath = 'virtual:something:/full/path/to/poky/meta/recipes-whatever/helloworld/helloworld_1.2.3.bb:do_sometask'
- expected_cleaned = 'helloworld/helloworld_1.2.3.bb:do_sometask:virtual:something'
-
- actual_cleaned = bb.siggen.clean_basepath(basepath)
-
- self.assertEqual(actual_cleaned, expected_cleaned)
-
- def test_clean_basepath_mc_basepath(self):
- basepath = 'mc:somemachine:/full/path/to/poky/meta/recipes-whatever/helloworld/helloworld_1.2.3.bb:do_sometask'
- expected_cleaned = 'helloworld/helloworld_1.2.3.bb:do_sometask:mc:somemachine'
-
- actual_cleaned = bb.siggen.clean_basepath(basepath)
-
- self.assertEqual(actual_cleaned, expected_cleaned)
-
- def test_clean_basepath_virtual_long_prefix_basepath(self):
- basepath = 'virtual:something:A:B:C:/full/path/to/poky/meta/recipes-whatever/helloworld/helloworld_1.2.3.bb:do_sometask'
- expected_cleaned = 'helloworld/helloworld_1.2.3.bb:do_sometask:virtual:something:A:B:C'
-
- actual_cleaned = bb.siggen.clean_basepath(basepath)
-
- self.assertEqual(actual_cleaned, expected_cleaned)
-
- def test_clean_basepath_mc_virtual_basepath(self):
- basepath = 'mc:somemachine:virtual:something:/full/path/to/poky/meta/recipes-whatever/helloworld/helloworld_1.2.3.bb:do_sometask'
- expected_cleaned = 'helloworld/helloworld_1.2.3.bb:do_sometask:virtual:something:mc:somemachine'
-
- actual_cleaned = bb.siggen.clean_basepath(basepath)
-
- self.assertEqual(actual_cleaned, expected_cleaned)
-
- def test_clean_basepath_mc_virtual_long_prefix_basepath(self):
- basepath = 'mc:X:virtual:something:C:B:A:/full/path/to/poky/meta/recipes-whatever/helloworld/helloworld_1.2.3.bb:do_sometask'
- expected_cleaned = 'helloworld/helloworld_1.2.3.bb:do_sometask:virtual:something:C:B:A:mc:X'
-
- actual_cleaned = bb.siggen.clean_basepath(basepath)
-
- self.assertEqual(actual_cleaned, expected_cleaned)
-
-
- # def test_clean_basepath_performance(self):
- # input_basepaths = [
- # 'mc:X:/full/path/to/poky/meta/recipes-whatever/helloworld/helloworld_1.2.3.bb:do_sometask',
- # 'mc:X:virtual:something:C:B:A:/full/path/to/poky/meta/recipes-whatever/helloworld/helloworld_1.2.3.bb:do_sometask',
- # 'virtual:something:C:B:A:/different/path/to/poky/meta/recipes-whatever/helloworld/helloworld_1.2.3.bb:do_sometask',
- # 'virtual:something:A:/full/path/to/poky/meta/recipes-whatever/helloworld/helloworld_1.2.3.bb:do_sometask',
- # '/this/is/most/common/input/recipes-whatever/helloworld/helloworld_1.2.3.bb:do_sometask',
- # '/and/should/be/tested/with/recipes-whatever/helloworld/helloworld_1.2.3.bb:do_sometask',
- # '/more/weight/recipes-whatever/helloworld/helloworld_1.2.3.bb:do_sometask',
- # ]
-
- # time_start = time.time()
-
- # i = 2000000
- # while i >= 0:
- # for basepath in input_basepaths:
- # bb.siggen.clean_basepath(basepath)
- # i -= 1
-
- # elapsed = time.time() - time_start
- # print('{} ({}s)'.format(self.id(), round(elapsed, 3)))
-
- # self.assertTrue(False)
diff --git a/bitbake/lib/bb/tinfoil.py b/bitbake/lib/bb/tinfoil.py
index e68a3b879a..dcd3910cc4 100644
--- a/bitbake/lib/bb/tinfoil.py
+++ b/bitbake/lib/bb/tinfoil.py
@@ -10,6 +10,7 @@
import logging
import os
import sys
+import time
import atexit
import re
from collections import OrderedDict, defaultdict
@@ -324,11 +325,11 @@ class Tinfoil:
self.recipes_parsed = False
self.quiet = 0
self.oldhandlers = self.logger.handlers[:]
+ self.localhandlers = []
if setup_logging:
# This is the *client-side* logger, nothing to do with
# logging messages from the server
bb.msg.logger_create('BitBake', output)
- self.localhandlers = []
for handler in self.logger.handlers:
if handler not in self.oldhandlers:
self.localhandlers.append(handler)
@@ -448,6 +449,12 @@ class Tinfoil:
self.run_actions(config_params)
self.recipes_parsed = True
+ def modified_files(self):
+ """
+ Notify the server it needs to revalidate it's caches since the client has modified files
+ """
+ self.run_command("revalidateCaches")
+
def run_command(self, command, *params, handle_events=True):
"""
Run a command on the server (as implemented in bb.command).
@@ -729,6 +736,7 @@ class Tinfoil:
ret = self.run_command('buildTargets', targets, task)
if handle_events:
+ lastevent = time.time()
result = False
# Borrowed from knotty, instead somewhat hackily we use the helper
# as the object to store "shutdown" on
@@ -741,6 +749,7 @@ class Tinfoil:
try:
event = self.wait_event(0.25)
if event:
+ lastevent = time.time()
if event_callback and event_callback(event):
continue
if helper.eventHandler(event):
@@ -773,7 +782,7 @@ class Tinfoil:
if isinstance(event, bb.command.CommandCompleted):
result = True
break
- if isinstance(event, bb.command.CommandFailed):
+ if isinstance(event, (bb.command.CommandFailed, bb.command.CommandExit)):
self.logger.error(str(event))
result = False
break
@@ -785,10 +794,13 @@ class Tinfoil:
self.logger.error(str(event))
result = False
break
-
elif helper.shutdown > 1:
break
termfilter.updateFooter()
+ if time.time() > (lastevent + (3*60)):
+ if not self.run_command('ping', handle_events=False):
+ print("\nUnable to ping server and no events, closing down...\n")
+ return False
except KeyboardInterrupt:
termfilter.clearFooter()
if helper.shutdown == 1:
diff --git a/bitbake/lib/bb/ui/buildinfohelper.py b/bitbake/lib/bb/ui/buildinfohelper.py
index 129bb329c3..4ee45d67a2 100644
--- a/bitbake/lib/bb/ui/buildinfohelper.py
+++ b/bitbake/lib/bb/ui/buildinfohelper.py
@@ -559,7 +559,10 @@ class ORMWrapper(object):
# we might have an invalid link; no way to detect this. just set it to None
filetarget_obj = None
- parent_obj = Target_File.objects.get(target = target_obj, path = parent_path, inodetype = Target_File.ITYPE_DIRECTORY)
+ try:
+ parent_obj = Target_File.objects.get(target = target_obj, path = parent_path, inodetype = Target_File.ITYPE_DIRECTORY)
+ except Target_File.DoesNotExist:
+ parent_obj = None
Target_File.objects.create(
target = target_obj,
@@ -1746,7 +1749,6 @@ class BuildInfoHelper(object):
buildname = self.server.runCommand(['getVariable', 'BUILDNAME'])[0]
machine = self.server.runCommand(['getVariable', 'MACHINE'])[0]
- image_name = self.server.runCommand(['getVariable', 'IMAGE_NAME'])[0]
# location of the manifest files for this build;
# note that this file is only produced if an image is produced
@@ -1767,6 +1769,18 @@ class BuildInfoHelper(object):
# filter out anything which isn't an image target
image_targets = [target for target in targets if target.is_image]
+ if len(image_targets) > 0:
+ #if there are image targets retrieve image_name
+ image_name = self.server.runCommand(['getVariable', 'IMAGE_NAME'])[0]
+ if not image_name:
+ #When build target is an image and image_name is not found as an environment variable
+ logger.info("IMAGE_NAME not found, extracting from bitbake command")
+ cmd = self.server.runCommand(['getVariable','BB_CMDLINE'])[0]
+ #filter out tokens that are command line options
+ cmd = [token for token in cmd if not token.startswith('-')]
+ image_name = cmd[1].split(':', 1)[0] # remove everything after : in image name
+ logger.info("IMAGE_NAME found as : %s " % image_name)
+
for image_target in image_targets:
# this is set to True if we find at least one file relating to
# this target; if this remains False after the scan, we copy the
diff --git a/bitbake/lib/bb/ui/eventreplay.py b/bitbake/lib/bb/ui/eventreplay.py
new file mode 100644
index 0000000000..d62ecbfa56
--- /dev/null
+++ b/bitbake/lib/bb/ui/eventreplay.py
@@ -0,0 +1,86 @@
+#!/usr/bin/env python3
+#
+# SPDX-License-Identifier: GPL-2.0-only
+#
+# This file re-uses code spread throughout other Bitbake source files.
+# As such, all other copyrights belong to their own right holders.
+#
+
+
+import os
+import sys
+import json
+import pickle
+import codecs
+
+
+class EventPlayer:
+ """Emulate a connection to a bitbake server."""
+
+ def __init__(self, eventfile, variables):
+ self.eventfile = eventfile
+ self.variables = variables
+ self.eventmask = []
+
+ def waitEvent(self, _timeout):
+ """Read event from the file."""
+ line = self.eventfile.readline().strip()
+ if not line:
+ return
+ try:
+ decodedline = json.loads(line)
+ if 'allvariables' in decodedline:
+ self.variables = decodedline['allvariables']
+ return
+ if not 'vars' in decodedline:
+ raise ValueError
+ event_str = decodedline['vars'].encode('utf-8')
+ event = pickle.loads(codecs.decode(event_str, 'base64'))
+ event_name = "%s.%s" % (event.__module__, event.__class__.__name__)
+ if event_name not in self.eventmask:
+ return
+ return event
+ except ValueError as err:
+ print("Failed loading ", line)
+ raise err
+
+ def runCommand(self, command_line):
+ """Emulate running a command on the server."""
+ name = command_line[0]
+
+ if name == "getVariable":
+ var_name = command_line[1]
+ variable = self.variables.get(var_name)
+ if variable:
+ return variable['v'], None
+ return None, "Missing variable %s" % var_name
+
+ elif name == "getAllKeysWithFlags":
+ dump = {}
+ flaglist = command_line[1]
+ for key, val in self.variables.items():
+ try:
+ if not key.startswith("__"):
+ dump[key] = {
+ 'v': val['v'],
+ 'history' : val['history'],
+ }
+ for flag in flaglist:
+ dump[key][flag] = val[flag]
+ except Exception as err:
+ print(err)
+ return (dump, None)
+
+ elif name == 'setEventMask':
+ self.eventmask = command_line[-1]
+ return True, None
+
+ else:
+ raise Exception("Command %s not implemented" % command_line[0])
+
+ def getEventHandle(self):
+ """
+ This method is called by toasterui.
+ The return value is passed to self.runCommand but not used there.
+ """
+ pass
diff --git a/bitbake/lib/bb/ui/knotty.py b/bitbake/lib/bb/ui/knotty.py
index 61cf0a37f4..f86999bb09 100644
--- a/bitbake/lib/bb/ui/knotty.py
+++ b/bitbake/lib/bb/ui/knotty.py
@@ -179,7 +179,7 @@ class TerminalFilter(object):
new[3] = new[3] & ~termios.ECHO
termios.tcsetattr(fd, termios.TCSADRAIN, new)
curses.setupterm()
- if curses.tigetnum("colors") > 2:
+ if curses.tigetnum("colors") > 2 and os.environ.get('NO_COLOR', '') == '':
for h in handlers:
try:
h.formatter.enable_color()
@@ -420,6 +420,11 @@ def main(server, eventHandler, params, tf = TerminalFilter):
except bb.BBHandledException:
drain_events_errorhandling(eventHandler)
return 1
+ except Exception as e:
+ # bitbake-server comms failure
+ early_logger = bb.msg.logger_create('bitbake', sys.stdout)
+ early_logger.fatal("Attempting to set server environment: %s", e)
+ return 1
if params.options.quiet == 0:
console_loglevel = loglevel
@@ -585,7 +590,12 @@ def main(server, eventHandler, params, tf = TerminalFilter):
return
llevel, debug_domains = bb.msg.constructLogOptions()
- server.runCommand(["setEventMask", server.getEventHandle(), llevel, debug_domains, _evt_list])
+ try:
+ server.runCommand(["setEventMask", server.getEventHandle(), llevel, debug_domains, _evt_list])
+ except (BrokenPipeError, EOFError) as e:
+ # bitbake-server comms failure
+ logger.fatal("Attempting to set event mask: %s", e)
+ return 1
# The logging_tree module is *extremely* helpful in debugging logging
# domains. Uncomment here to dump the logging tree when bitbake starts
@@ -594,7 +604,11 @@ def main(server, eventHandler, params, tf = TerminalFilter):
universe = False
if not params.observe_only:
- params.updateFromServer(server)
+ try:
+ params.updateFromServer(server)
+ except Exception as e:
+ logger.fatal("Fetching command line: %s", e)
+ return 1
cmdline = params.parseActions()
if not cmdline:
print("Nothing to do. Use 'bitbake world' to build everything, or run 'bitbake --help' for usage information.")
@@ -605,7 +619,12 @@ def main(server, eventHandler, params, tf = TerminalFilter):
if cmdline['action'][0] == "buildTargets" and "universe" in cmdline['action'][1]:
universe = True
- ret, error = server.runCommand(cmdline['action'])
+ try:
+ ret, error = server.runCommand(cmdline['action'])
+ except (BrokenPipeError, EOFError) as e:
+ # bitbake-server comms failure
+ logger.fatal("Command '{}' failed: %s".format(cmdline), e)
+ return 1
if error:
logger.error("Command '%s' failed: %s" % (cmdline, error))
return 1
@@ -625,25 +644,38 @@ def main(server, eventHandler, params, tf = TerminalFilter):
printintervaldelta = 10 * 60 # 10 minutes
printinterval = printintervaldelta
- lastprint = time.time()
+ pinginterval = 1 * 60 # 1 minute
+ lastevent = lastprint = time.time()
termfilter = tf(main, helper, console_handlers, params.options.quiet)
atexit.register(termfilter.finish)
- while True:
+ # shutdown levels
+ # 0 - normal operation
+ # 1 - no new task execution, let current running tasks finish
+ # 2 - interrupting currently executing tasks
+ # 3 - we're done, exit
+ while main.shutdown < 3:
try:
if (lastprint + printinterval) <= time.time():
termfilter.keepAlive(printinterval)
printinterval += printintervaldelta
event = eventHandler.waitEvent(0)
if event is None:
- if main.shutdown > 1:
- break
+ if (lastevent + pinginterval) <= time.time():
+ ret, error = server.runCommand(["ping"])
+ if error or not ret:
+ termfilter.clearFooter()
+ print("No reply after pinging server (%s, %s), exiting." % (str(error), str(ret)))
+ return_value = 3
+ main.shutdown = 3
+ lastevent = time.time()
if not parseprogress:
termfilter.updateFooter()
event = eventHandler.waitEvent(0.25)
if event is None:
continue
+ lastevent = time.time()
helper.eventHandler(event)
if isinstance(event, bb.runqueue.runQueueExitWait):
if not main.shutdown:
@@ -748,15 +780,15 @@ def main(server, eventHandler, params, tf = TerminalFilter):
if event.error:
errors = errors + 1
logger.error(str(event))
- main.shutdown = 2
+ main.shutdown = 3
continue
if isinstance(event, bb.command.CommandExit):
if not return_value:
return_value = event.exitcode
- main.shutdown = 2
+ main.shutdown = 3
continue
if isinstance(event, (bb.command.CommandCompleted, bb.cooker.CookerExit)):
- main.shutdown = 2
+ main.shutdown = 3
continue
if isinstance(event, bb.event.MultipleProviders):
logger.info(str(event))
@@ -841,15 +873,26 @@ def main(server, eventHandler, params, tf = TerminalFilter):
logger.error("Unknown event: %s", event)
+ except (BrokenPipeError, EOFError) as e:
+ # bitbake-server comms failure, don't attempt further comms and exit
+ logger.fatal("Executing event: %s", e)
+ return_value = 1
+ errors = errors + 1
+ main.shutdown = 3
except EnvironmentError as ioerror:
termfilter.clearFooter()
# ignore interrupted io
if ioerror.args[0] == 4:
continue
sys.stderr.write(str(ioerror))
- if not params.observe_only:
- _, error = server.runCommand(["stateForceShutdown"])
main.shutdown = 2
+ if not params.observe_only:
+ try:
+ _, error = server.runCommand(["stateForceShutdown"])
+ except (BrokenPipeError, EOFError) as e:
+ # bitbake-server comms failure, don't attempt further comms and exit
+ logger.fatal("Unable to force shutdown: %s", e)
+ main.shutdown = 3
except KeyboardInterrupt:
termfilter.clearFooter()
if params.observe_only:
@@ -858,9 +901,13 @@ def main(server, eventHandler, params, tf = TerminalFilter):
def state_force_shutdown():
print("\nSecond Keyboard Interrupt, stopping...\n")
- _, error = server.runCommand(["stateForceShutdown"])
- if error:
- logger.error("Unable to cleanly stop: %s" % error)
+ try:
+ _, error = server.runCommand(["stateForceShutdown"])
+ if error:
+ logger.error("Unable to cleanly stop: %s" % error)
+ except (BrokenPipeError, EOFError) as e:
+ # bitbake-server comms failure
+ logger.fatal("Unable to cleanly stop: %s", e)
if not params.observe_only and main.shutdown == 1:
state_force_shutdown()
@@ -873,6 +920,9 @@ def main(server, eventHandler, params, tf = TerminalFilter):
_, error = server.runCommand(["stateShutdown"])
if error:
logger.error("Unable to cleanly shutdown: %s" % error)
+ except (BrokenPipeError, EOFError) as e:
+ # bitbake-server comms failure
+ logger.fatal("Unable to cleanly shutdown: %s", e)
except KeyboardInterrupt:
state_force_shutdown()
@@ -880,9 +930,14 @@ def main(server, eventHandler, params, tf = TerminalFilter):
except Exception as e:
import traceback
sys.stderr.write(traceback.format_exc())
- if not params.observe_only:
- _, error = server.runCommand(["stateForceShutdown"])
main.shutdown = 2
+ if not params.observe_only:
+ try:
+ _, error = server.runCommand(["stateForceShutdown"])
+ except (BrokenPipeError, EOFError) as e:
+ # bitbake-server comms failure, don't attempt further comms and exit
+ logger.fatal("Unable to force shutdown: %s", e)
+ main.shudown = 3
return_value = 1
try:
termfilter.clearFooter()
diff --git a/bitbake/lib/bb/ui/ncurses.py b/bitbake/lib/bb/ui/ncurses.py
index cf1c876a51..18a706547a 100644
--- a/bitbake/lib/bb/ui/ncurses.py
+++ b/bitbake/lib/bb/ui/ncurses.py
@@ -227,6 +227,9 @@ class NCursesUI:
shutdown = 0
try:
+ if not params.observe_only:
+ params.updateToServer(server, os.environ.copy())
+
params.updateFromServer(server)
cmdline = params.parseActions()
if not cmdline:
diff --git a/bitbake/lib/bb/ui/taskexp.py b/bitbake/lib/bb/ui/taskexp.py
index c00eaf6638..bedfd69b09 100644
--- a/bitbake/lib/bb/ui/taskexp.py
+++ b/bitbake/lib/bb/ui/taskexp.py
@@ -177,7 +177,7 @@ class gtkthread(threading.Thread):
quit = threading.Event()
def __init__(self, shutdown):
threading.Thread.__init__(self)
- self.setDaemon(True)
+ self.daemon = True
self.shutdown = shutdown
if not Gtk.init_check()[0]:
sys.stderr.write("Gtk+ init failed. Make sure DISPLAY variable is set.\n")
diff --git a/bitbake/lib/bb/ui/taskexp_ncurses.py b/bitbake/lib/bb/ui/taskexp_ncurses.py
new file mode 100755
index 0000000000..ea94a4987f
--- /dev/null
+++ b/bitbake/lib/bb/ui/taskexp_ncurses.py
@@ -0,0 +1,1511 @@
+#
+# BitBake Graphical ncurses-based Dependency Explorer
+# * Based on the GTK implementation
+# * Intended to run on any Linux host
+#
+# Copyright (C) 2007 Ross Burton
+# Copyright (C) 2007 - 2008 Richard Purdie
+# Copyright (C) 2022 - 2024 David Reyna
+#
+# SPDX-License-Identifier: GPL-2.0-only
+#
+
+#
+# Execution example:
+# $ bitbake -g -u taskexp_ncurses zlib acl
+#
+# Self-test example (executes a script of GUI actions):
+# $ TASK_EXP_UNIT_TEST=1 bitbake -g -u taskexp_ncurses zlib acl
+# ...
+# $ echo $?
+# 0
+# $ TASK_EXP_UNIT_TEST=1 bitbake -g -u taskexp_ncurses zlib acl foo
+# ERROR: Nothing PROVIDES 'foo'. Close matches:
+# ofono
+# $ echo $?
+# 1
+#
+# Self-test with no terminal example (only tests dependency fetch from bitbake):
+# $ TASK_EXP_UNIT_TEST_NOTERM=1 bitbake -g -u taskexp_ncurses quilt
+# $ echo $?
+# 0
+#
+# Features:
+# * Ncurses is used for the presentation layer. Only the 'curses'
+# library is used (none of the extension libraries), plus only
+# one main screen is used (no sub-windows)
+# * Uses the 'generateDepTreeEvent' bitbake event to fetch the
+# dynamic dependency data based on passed recipes
+# * Computes and provides reverse dependencies
+# * Supports task sorting on:
+# (a) Task dependency order within each recipe
+# (b) Pure alphabetical order
+# (c) Provisions for third sort order (bitbake order?)
+# * The 'Filter' does a "*string*" wildcard filter on tasks in the
+# main window, dynamically re-ordering and re-centering the content
+# * A 'Print' function exports the selected task or its whole recipe
+# task set to the default file "taskdep.txt"
+# * Supports a progress bar for bitbake loads and file printing
+# * Line art for box drawing supported, ASCII art an alernative
+# * No horizontal scrolling support. Selected task's full name
+# shown in bottom bar
+# * Dynamically catches terminals that are (or become) too small
+# * Exception to insure return to normal terminal on errors
+# * Debugging support, self test option
+#
+
+import sys
+import traceback
+import curses
+import re
+import time
+
+# Bitbake server support
+import threading
+from xmlrpc import client
+import bb
+import bb.event
+
+# Dependency indexes (depends_model)
+(TYPE_DEP, TYPE_RDEP) = (0, 1)
+DEPENDS_TYPE = 0
+DEPENDS_TASK = 1
+DEPENDS_DEPS = 2
+# Task indexes (task_list)
+TASK_NAME = 0
+TASK_PRIMARY = 1
+TASK_SORT_ALPHA = 2
+TASK_SORT_DEPS = 3
+TASK_SORT_BITBAKE = 4
+# Sort options (default is SORT_DEPS)
+SORT_ALPHA = 0
+SORT_DEPS = 1
+SORT_BITBAKE_ENABLE = False # NOTE: future sort
+SORT_BITBAKE = 2
+sort_model = SORT_DEPS
+# Print options
+PRINT_MODEL_1 = 0
+PRINT_MODEL_2 = 1
+print_model = PRINT_MODEL_2
+print_file_name = "taskdep_print.log"
+print_file_backup_name = "taskdep_print_backup.log"
+is_printed = False
+is_filter = False
+
+# Standard (and backup) key mappings
+CHAR_NUL = 0 # Used as self-test nop char
+CHAR_BS_H = 8 # Alternate backspace key
+CHAR_TAB = 9
+CHAR_RETURN = 10
+CHAR_ESCAPE = 27
+CHAR_UP = ord('{') # Used as self-test ASCII char
+CHAR_DOWN = ord('}') # Used as self-test ASCII char
+
+# Color_pair IDs
+CURSES_NORMAL = 0
+CURSES_HIGHLIGHT = 1
+CURSES_WARNING = 2
+
+
+#################################################
+### Debugging support
+###
+
+verbose = False
+
+# Debug: message display slow-step through display update issues
+def alert(msg,screen):
+ if msg:
+ screen.addstr(0, 10, '[%-4s]' % msg)
+ screen.refresh();
+ curses.napms(2000)
+ else:
+ if do_line_art:
+ for i in range(10, 24):
+ screen.addch(0, i, curses.ACS_HLINE)
+ else:
+ screen.addstr(0, 10, '-' * 14)
+ screen.refresh();
+
+# Debug: display edge conditions on frame movements
+def debug_frame(nbox_ojb):
+ if verbose:
+ nbox_ojb.screen.addstr(0, 50, '[I=%2d,O=%2d,S=%3s,H=%2d,M=%4d]' % (
+ nbox_ojb.cursor_index,
+ nbox_ojb.cursor_offset,
+ nbox_ojb.scroll_offset,
+ nbox_ojb.inside_height,
+ len(nbox_ojb.task_list),
+ ))
+ nbox_ojb.screen.refresh();
+
+#
+# Unit test (assumes that 'quilt-native' is always present)
+#
+
+unit_test = os.environ.get('TASK_EXP_UNIT_TEST')
+unit_test_cmnds=[
+ '# Default selected task in primary box',
+ 'tst_selected=<TASK>.do_recipe_qa',
+ '# Default selected task in deps',
+ 'tst_entry=<TAB>',
+ 'tst_selected=',
+ '# Default selected task in rdeps',
+ 'tst_entry=<TAB>',
+ 'tst_selected=<TASK>.do_fetch',
+ "# Test 'select' back to primary box",
+ 'tst_entry=<CR>',
+ '#tst_entry=<DOWN>', # optional injected error
+ 'tst_selected=<TASK>.do_fetch',
+ '# Check filter',
+ 'tst_entry=/uilt-nativ/',
+ 'tst_selected=quilt-native.do_recipe_qa',
+ '# Check print',
+ 'tst_entry=p',
+ 'tst_printed=quilt-native.do_fetch',
+ '#tst_printed=quilt-foo.do_nothing', # optional injected error
+ '# Done!',
+ 'tst_entry=q',
+]
+unit_test_idx=0
+unit_test_command_chars=''
+unit_test_results=[]
+def unit_test_action(active_package):
+ global unit_test_idx
+ global unit_test_command_chars
+ global unit_test_results
+ ret = CHAR_NUL
+ if unit_test_command_chars:
+ ch = unit_test_command_chars[0]
+ unit_test_command_chars = unit_test_command_chars[1:]
+ time.sleep(0.5)
+ ret = ord(ch)
+ else:
+ line = unit_test_cmnds[unit_test_idx]
+ unit_test_idx += 1
+ line = re.sub('#.*', '', line).strip()
+ line = line.replace('<TASK>',active_package.primary[0])
+ line = line.replace('<TAB>','\t').replace('<CR>','\n')
+ line = line.replace('<UP>','{').replace('<DOWN>','}')
+ if not line: line = 'nop=nop'
+ cmnd,value = line.split('=')
+ if cmnd == 'tst_entry':
+ unit_test_command_chars = value
+ elif cmnd == 'tst_selected':
+ active_selected = active_package.get_selected()
+ if active_selected != value:
+ unit_test_results.append("ERROR:SELFTEST:expected '%s' but got '%s' (NOTE:bitbake may have changed)" % (value,active_selected))
+ ret = ord('Q')
+ else:
+ unit_test_results.append("Pass:SELFTEST:found '%s'" % (value))
+ elif cmnd == 'tst_printed':
+ result = os.system('grep %s %s' % (value,print_file_name))
+ if result:
+ unit_test_results.append("ERROR:PRINTTEST:expected '%s' in '%s'" % (value,print_file_name))
+ ret = ord('Q')
+ else:
+ unit_test_results.append("Pass:PRINTTEST:found '%s'" % (value))
+ # Return the action (CHAR_NUL for no action til next round)
+ return(ret)
+
+# Unit test without an interative terminal (e.g. ptest)
+unit_test_noterm = os.environ.get('TASK_EXP_UNIT_TEST_NOTERM')
+
+
+#################################################
+### Window frame rendering
+###
+### By default, use the normal line art. Since
+### these extended characters are not ASCII, one
+### must use the ncursus API to render them
+### The alternate ASCII line art set is optionally
+### available via the 'do_line_art' flag
+
+# By default, render frames using line art
+do_line_art = True
+
+# ASCII render set option
+CHAR_HBAR = '-'
+CHAR_VBAR = '|'
+CHAR_UL_CORNER = '/'
+CHAR_UR_CORNER = '\\'
+CHAR_LL_CORNER = '\\'
+CHAR_LR_CORNER = '/'
+
+# Box frame drawing with line-art
+def line_art_frame(box):
+ x = box.base_x
+ y = box.base_y
+ w = box.width
+ h = box.height + 1
+
+ if do_line_art:
+ for i in range(1, w - 1):
+ box.screen.addch(y, x + i, curses.ACS_HLINE, box.color)
+ box.screen.addch(y + h - 1, x + i, curses.ACS_HLINE, box.color)
+ body_line = "%s" % (' ' * (w - 2))
+ for i in range(1, h - 1):
+ box.screen.addch(y + i, x, curses.ACS_VLINE, box.color)
+ box.screen.addstr(y + i, x + 1, body_line, box.color)
+ box.screen.addch(y + i, x + w - 1, curses.ACS_VLINE, box.color)
+ box.screen.addch(y, x, curses.ACS_ULCORNER, box.color)
+ box.screen.addch(y, x + w - 1, curses.ACS_URCORNER, box.color)
+ box.screen.addch(y + h - 1, x, curses.ACS_LLCORNER, box.color)
+ box.screen.addch(y + h - 1, x + w - 1, curses.ACS_LRCORNER, box.color)
+ else:
+ top_line = "%s%s%s" % (CHAR_UL_CORNER,CHAR_HBAR * (w - 2),CHAR_UR_CORNER)
+ body_line = "%s%s%s" % (CHAR_VBAR,' ' * (w - 2),CHAR_VBAR)
+ bot_line = "%s%s%s" % (CHAR_UR_CORNER,CHAR_HBAR * (w - 2),CHAR_UL_CORNER)
+ tag_line = "%s%s%s" % ('[',CHAR_HBAR * (w - 2),']')
+ # Top bar
+ box.screen.addstr(y, x, top_line)
+ # Middle frame
+ for i in range(1, (h - 1)):
+ box.screen.addstr(y+i, x, body_line)
+ # Bottom bar
+ box.screen.addstr(y + (h - 1), x, bot_line)
+
+# Connect the separate boxes
+def line_art_fixup(box):
+ if do_line_art:
+ box.screen.addch(box.base_y+2, box.base_x, curses.ACS_LTEE, box.color)
+ box.screen.addch(box.base_y+2, box.base_x+box.width-1, curses.ACS_RTEE, box.color)
+
+
+#################################################
+### Ncurses box object : box frame object to display
+### and manage a sub-window's display elements
+### using basic ncurses
+###
+### Supports:
+### * Frame drawing, content (re)drawing
+### * Content scrolling via ArrowUp, ArrowDn, PgUp, PgDN,
+### * Highlighting for active selected item
+### * Content sorting based on selected sort model
+###
+
+class NBox():
+ def __init__(self, screen, label, primary, base_x, base_y, width, height):
+ # Box description
+ self.screen = screen
+ self.label = label
+ self.primary = primary
+ self.color = curses.color_pair(CURSES_NORMAL) if screen else None
+ # Box boundaries
+ self.base_x = base_x
+ self.base_y = base_y
+ self.width = width
+ self.height = height
+ # Cursor/scroll management
+ self.cursor_enable = False
+ self.cursor_index = 0 # Absolute offset
+ self.cursor_offset = 0 # Frame centric offset
+ self.scroll_offset = 0 # Frame centric offset
+ # Box specific content
+ # Format of each entry is [package_name,is_primary_recipe,alpha_sort_key,deps_sort_key]
+ self.task_list = []
+
+ @property
+ def inside_width(self):
+ return(self.width-2)
+
+ @property
+ def inside_height(self):
+ return(self.height-2)
+
+ # Populate the box's content, include the sort mappings and is_primary flag
+ def task_list_append(self,task_name,dep):
+ task_sort_alpha = task_name
+ task_sort_deps = dep.get_dep_sort(task_name)
+ is_primary = False
+ for primary in self.primary:
+ if task_name.startswith(primary+'.'):
+ is_primary = True
+ if SORT_BITBAKE_ENABLE:
+ task_sort_bitbake = dep.get_bb_sort(task_name)
+ self.task_list.append([task_name,is_primary,task_sort_alpha,task_sort_deps,task_sort_bitbake])
+ else:
+ self.task_list.append([task_name,is_primary,task_sort_alpha,task_sort_deps])
+
+ def reset(self):
+ self.task_list = []
+ self.cursor_index = 0 # Absolute offset
+ self.cursor_offset = 0 # Frame centric offset
+ self.scroll_offset = 0 # Frame centric offset
+
+ # Sort the box's content based on the current sort model
+ def sort(self):
+ if SORT_ALPHA == sort_model:
+ self.task_list.sort(key = lambda x: x[TASK_SORT_ALPHA])
+ elif SORT_DEPS == sort_model:
+ self.task_list.sort(key = lambda x: x[TASK_SORT_DEPS])
+ elif SORT_BITBAKE == sort_model:
+ self.task_list.sort(key = lambda x: x[TASK_SORT_BITBAKE])
+
+ # The target package list (to hightlight), from the command line
+ def set_primary(self,primary):
+ self.primary = primary
+
+ # Draw the box's outside frame
+ def draw_frame(self):
+ line_art_frame(self)
+ # Title
+ self.screen.addstr(self.base_y,
+ (self.base_x + (self.width//2))-((len(self.label)+2)//2),
+ '['+self.label+']')
+ self.screen.refresh()
+
+ # Draw the box's inside text content
+ def redraw(self):
+ task_list_len = len(self.task_list)
+ # Middle frame
+ body_line = "%s" % (' ' * (self.inside_width-1) )
+ for i in range(0,self.inside_height+1):
+ if i < (task_list_len + self.scroll_offset):
+ str_ctl = "%%-%ss" % (self.width-3)
+ # Safety assert
+ if (i + self.scroll_offset) >= task_list_len:
+ alert("REDRAW:%2d,%4d,%4d" % (i,self.scroll_offset,task_list_len),self.screen)
+ break
+
+ task_obj = self.task_list[i + self.scroll_offset]
+ task = task_obj[TASK_NAME][:self.inside_width-1]
+ task_primary = task_obj[TASK_PRIMARY]
+
+ if task_primary:
+ line = str_ctl % task[:self.inside_width-1]
+ self.screen.addstr(self.base_y+1+i, self.base_x+2, line, curses.A_BOLD)
+ else:
+ line = str_ctl % task[:self.inside_width-1]
+ self.screen.addstr(self.base_y+1+i, self.base_x+2, line)
+ else:
+ line = "%s" % (' ' * (self.inside_width-1) )
+ self.screen.addstr(self.base_y+1+i, self.base_x+2, line)
+ self.screen.refresh()
+
+ # Show the current selected task over the bottom of the frame
+ def show_selected(self,selected_task):
+ if not selected_task:
+ selected_task = self.get_selected()
+ tag_line = "%s%s%s" % ('[',CHAR_HBAR * (self.width-2),']')
+ self.screen.addstr(self.base_y + self.height, self.base_x, tag_line)
+ self.screen.addstr(self.base_y + self.height,
+ (self.base_x + (self.width//2))-((len(selected_task)+2)//2),
+ '['+selected_task+']')
+ self.screen.refresh()
+
+ # Load box with new table of content
+ def update_content(self,task_list):
+ self.task_list = task_list
+ if self.cursor_enable:
+ cursor_update(turn_on=False)
+ self.cursor_index = 0
+ self.cursor_offset = 0
+ self.scroll_offset = 0
+ self.redraw()
+ if self.cursor_enable:
+ cursor_update(turn_on=True)
+
+ # Manage the box's highlighted task and blinking cursor character
+ def cursor_on(self,is_on):
+ self.cursor_enable = is_on
+ self.cursor_update(is_on)
+
+ # High-light the current pointed package, normal for released packages
+ def cursor_update(self,turn_on=True):
+ str_ctl = "%%-%ss" % (self.inside_width-1)
+ try:
+ if len(self.task_list):
+ task_obj = self.task_list[self.cursor_index]
+ task = task_obj[TASK_NAME][:self.inside_width-1]
+ task_primary = task_obj[TASK_PRIMARY]
+ task_font = curses.A_BOLD if task_primary else 0
+ else:
+ task = ''
+ task_font = 0
+ except Exception as e:
+ alert("CURSOR_UPDATE:%s" % (e),self.screen)
+ return
+ if turn_on:
+ self.screen.addstr(self.base_y+1+self.cursor_offset,self.base_x+1,">", curses.color_pair(CURSES_HIGHLIGHT) | curses.A_BLINK)
+ self.screen.addstr(self.base_y+1+self.cursor_offset,self.base_x+2,str_ctl % task, curses.color_pair(CURSES_HIGHLIGHT) | task_font)
+ else:
+ self.screen.addstr(self.base_y+1+self.cursor_offset,self.base_x+1," ")
+ self.screen.addstr(self.base_y+1+self.cursor_offset,self.base_x+2,str_ctl % task, task_font)
+
+ # Down arrow
+ def line_down(self):
+ if len(self.task_list) <= (self.cursor_index+1):
+ return
+ self.cursor_update(turn_on=False)
+ self.cursor_index += 1
+ self.cursor_offset += 1
+ if self.cursor_offset > (self.inside_height):
+ self.cursor_offset -= 1
+ self.scroll_offset += 1
+ self.redraw()
+ self.cursor_update(turn_on=True)
+ debug_frame(self)
+
+ # Up arrow
+ def line_up(self):
+ if 0 > (self.cursor_index-1):
+ return
+ self.cursor_update(turn_on=False)
+ self.cursor_index -= 1
+ self.cursor_offset -= 1
+ if self.cursor_offset < 0:
+ self.cursor_offset += 1
+ self.scroll_offset -= 1
+ self.redraw()
+ self.cursor_update(turn_on=True)
+ debug_frame(self)
+
+ # Page down
+ def page_down(self):
+ max_task = len(self.task_list)-1
+ if max_task < self.inside_height:
+ return
+ self.cursor_update(turn_on=False)
+ self.cursor_index += 10
+ self.cursor_index = min(self.cursor_index,max_task)
+ self.cursor_offset = min(self.inside_height,self.cursor_index)
+ self.scroll_offset = self.cursor_index - self.cursor_offset
+ self.redraw()
+ self.cursor_update(turn_on=True)
+ debug_frame(self)
+
+ # Page up
+ def page_up(self):
+ max_task = len(self.task_list)-1
+ if max_task < self.inside_height:
+ return
+ self.cursor_update(turn_on=False)
+ self.cursor_index -= 10
+ self.cursor_index = max(self.cursor_index,0)
+ self.cursor_offset = max(0, self.inside_height - (max_task - self.cursor_index))
+ self.scroll_offset = self.cursor_index - self.cursor_offset
+ self.redraw()
+ self.cursor_update(turn_on=True)
+ debug_frame(self)
+
+ # Return the currently selected task name for this box
+ def get_selected(self):
+ if self.task_list:
+ return(self.task_list[self.cursor_index][TASK_NAME])
+ else:
+ return('')
+
+#################################################
+### The helper sub-windows
+###
+
+# Show persistent help at the top of the screen
+class HelpBarView(NBox):
+ def __init__(self, screen, label, primary, base_x, base_y, width, height):
+ super(HelpBarView, self).__init__(screen, label, primary, base_x, base_y, width, height)
+
+ def show_help(self,show):
+ self.screen.addstr(self.base_y,self.base_x, "%s" % (' ' * self.inside_width))
+ if show:
+ help = "Help='?' Filter='/' NextBox=<Tab> Select=<Enter> Print='p','P' Quit='q'"
+ bar_size = self.inside_width - 5 - len(help)
+ self.screen.addstr(self.base_y,self.base_x+((self.inside_width-len(help))//2), help)
+ self.screen.refresh()
+
+# Pop up a detailed Help box
+class HelpBoxView(NBox):
+ def __init__(self, screen, label, primary, base_x, base_y, width, height, dep):
+ super(HelpBoxView, self).__init__(screen, label, primary, base_x, base_y, width, height)
+ self.x_pos = 0
+ self.y_pos = 0
+ self.dep = dep
+
+ # Instantial the pop-up help box
+ def show_help(self,show):
+ self.x_pos = self.base_x + 4
+ self.y_pos = self.base_y + 2
+
+ def add_line(line):
+ if line:
+ self.screen.addstr(self.y_pos,self.x_pos,line)
+ self.y_pos += 1
+
+ # Gather some statisics
+ dep_count = 0
+ rdep_count = 0
+ for task_obj in self.dep.depends_model:
+ if TYPE_DEP == task_obj[DEPENDS_TYPE]:
+ dep_count += 1
+ elif TYPE_RDEP == task_obj[DEPENDS_TYPE]:
+ rdep_count += 1
+
+ self.draw_frame()
+ line_art_fixup(self.dep)
+ add_line("Quit : 'q' ")
+ add_line("Filter task names : '/'")
+ add_line("Tab to next box : <Tab>")
+ add_line("Select a task : <Enter>")
+ add_line("Print task's deps : 'p'")
+ add_line("Print recipe's deps : 'P'")
+ add_line(" -> '%s'" % print_file_name)
+ add_line("Sort toggle : 's'")
+ add_line(" %s Recipe inner-depends order" % ('->' if (SORT_DEPS == sort_model) else '- '))
+ add_line(" %s Alpha-numeric order" % ('->' if (SORT_ALPHA == sort_model) else '- '))
+ if SORT_BITBAKE_ENABLE:
+ add_line(" %s Bitbake order" % ('->' if (TASK_SORT_BITBAKE == sort_model) else '- '))
+ add_line("Alternate backspace : <CTRL-H>")
+ add_line("")
+ add_line("Primary recipes = %s" % ','.join(self.primary))
+ add_line("Task count = %4d" % len(self.dep.pkg_model))
+ add_line("Deps count = %4d" % dep_count)
+ add_line("RDeps count = %4d" % rdep_count)
+ add_line("")
+ self.screen.addstr(self.y_pos,self.x_pos+7,"<Press any key>", curses.color_pair(CURSES_HIGHLIGHT))
+ self.screen.refresh()
+ c = self.screen.getch()
+
+# Show a progress bar
+class ProgressView(NBox):
+ def __init__(self, screen, label, primary, base_x, base_y, width, height):
+ super(ProgressView, self).__init__(screen, label, primary, base_x, base_y, width, height)
+
+ def progress(self,title,current,max):
+ if title:
+ self.label = title
+ else:
+ title = self.label
+ if max <=0: max = 10
+ bar_size = self.width - 7 - len(title)
+ bar_done = int( (float(current)/float(max)) * float(bar_size) )
+ self.screen.addstr(self.base_y,self.base_x, " %s:[%s%s]" % (title,'*' * bar_done,' ' * (bar_size-bar_done)))
+ self.screen.refresh()
+ return(current+1)
+
+ def clear(self):
+ self.screen.addstr(self.base_y,self.base_x, "%s" % (' ' * self.width))
+ self.screen.refresh()
+
+# Implement a task filter bar
+class FilterView(NBox):
+ SEARCH_NOP = 0
+ SEARCH_GO = 1
+ SEARCH_CANCEL = 2
+
+ def __init__(self, screen, label, primary, base_x, base_y, width, height):
+ super(FilterView, self).__init__(screen, label, primary, base_x, base_y, width, height)
+ self.do_show = False
+ self.filter_str = ""
+
+ def clear(self,enable_show=True):
+ self.filter_str = ""
+
+ def show(self,enable_show=True):
+ self.do_show = enable_show
+ if self.do_show:
+ self.screen.addstr(self.base_y,self.base_x, "[ Filter: %-25s ] '/'=cancel, format='abc' " % self.filter_str[0:25])
+ else:
+ self.screen.addstr(self.base_y,self.base_x, "%s" % (' ' * self.width))
+ self.screen.refresh()
+
+ def show_prompt(self):
+ self.screen.addstr(self.base_y,self.base_x + 10 + len(self.filter_str), " ")
+ self.screen.addstr(self.base_y,self.base_x + 10 + len(self.filter_str), "")
+
+ # Keys specific to the filter box (start/stop filter keys are in the main loop)
+ def input(self,c,ch):
+ ret = self.SEARCH_GO
+ if c in (curses.KEY_BACKSPACE,CHAR_BS_H):
+ # Backspace
+ if self.filter_str:
+ self.filter_str = self.filter_str[0:-1]
+ self.show()
+ elif ((ch >= 'a') and (ch <= 'z')) or ((ch >= 'A') and (ch <= 'Z')) or ((ch >= '0') and (ch <= '9')) or (ch in (' ','_','.','-')):
+ # The isalnum() acts strangly with keypad(True), so explicit bounds
+ self.filter_str += ch
+ self.show()
+ else:
+ ret = self.SEARCH_NOP
+ return(ret)
+
+
+#################################################
+### The primary dependency windows
+###
+
+# The main list of package tasks
+class PackageView(NBox):
+ def __init__(self, screen, label, primary, base_x, base_y, width, height):
+ super(PackageView, self).__init__(screen, label, primary, base_x, base_y, width, height)
+
+ # Find and verticaly center a selected task (from filter or from dependent box)
+ # The 'task_filter_str' can be a full or a partial (filter) task name
+ def find(self,task_filter_str):
+ found = False
+ max = self.height-2
+ if not task_filter_str:
+ return(found)
+ for i,task_obj in enumerate(self.task_list):
+ task = task_obj[TASK_NAME]
+ if task.startswith(task_filter_str):
+ self.cursor_on(False)
+ self.cursor_index = i
+
+ # Position selected at vertical center
+ vcenter = self.inside_height // 2
+ if self.cursor_index <= vcenter:
+ self.scroll_offset = 0
+ self.cursor_offset = self.cursor_index
+ elif self.cursor_index >= (len(self.task_list) - vcenter - 1):
+ self.cursor_offset = self.inside_height-1
+ self.scroll_offset = self.cursor_index - self.cursor_offset
+ else:
+ self.cursor_offset = vcenter
+ self.scroll_offset = self.cursor_index - self.cursor_offset
+
+ self.redraw()
+ self.cursor_on(True)
+ found = True
+ break
+ return(found)
+
+# The view of dependent packages
+class PackageDepView(NBox):
+ def __init__(self, screen, label, primary, base_x, base_y, width, height):
+ super(PackageDepView, self).__init__(screen, label, primary, base_x, base_y, width, height)
+
+# The view of reverse-dependent packages
+class PackageReverseDepView(NBox):
+ def __init__(self, screen, label, primary, base_x, base_y, width, height):
+ super(PackageReverseDepView, self).__init__(screen, label, primary, base_x, base_y, width, height)
+
+
+#################################################
+### DepExplorer : The parent frame and object
+###
+
+class DepExplorer(NBox):
+ def __init__(self,screen):
+ title = "Task Dependency Explorer"
+ super(DepExplorer, self).__init__(screen, 'Task Dependency Explorer','',0,0,80,23)
+
+ self.screen = screen
+ self.pkg_model = []
+ self.depends_model = []
+ self.dep_sort_map = {}
+ self.bb_sort_map = {}
+ self.filter_str = ''
+ self.filter_prev = 'deadbeef'
+
+ if self.screen:
+ self.help_bar_view = HelpBarView(screen, "Help",'',1,1,79,1)
+ self.help_box_view = HelpBoxView(screen, "Help",'',0,2,40,20,self)
+ self.progress_view = ProgressView(screen, "Progress",'',2,1,76,1)
+ self.filter_view = FilterView(screen, "Filter",'',2,1,76,1)
+ self.package_view = PackageView(screen, "Package",'alpha', 0,2,40,20)
+ self.dep_view = PackageDepView(screen, "Dependencies",'beta',40,2,40,10)
+ self.reverse_view = PackageReverseDepView(screen, "Dependent Tasks",'gamma',40,13,40,9)
+ self.draw_frames()
+
+ # Draw this main window's frame and all sub-windows
+ def draw_frames(self):
+ self.draw_frame()
+ self.package_view.draw_frame()
+ self.dep_view.draw_frame()
+ self.reverse_view.draw_frame()
+ if is_filter:
+ self.filter_view.show(True)
+ self.filter_view.show_prompt()
+ else:
+ self.help_bar_view.show_help(True)
+ self.package_view.redraw()
+ self.dep_view.redraw()
+ self.reverse_view.redraw()
+ self.show_selected(self.package_view.get_selected())
+ line_art_fixup(self)
+
+ # Parse the bitbake dependency event object
+ def parse(self, depgraph):
+ for task in depgraph["tdepends"]:
+ self.pkg_model.insert(0, task)
+ for depend in depgraph["tdepends"][task]:
+ self.depends_model.insert (0, (TYPE_DEP, task, depend))
+ self.depends_model.insert (0, (TYPE_RDEP, depend, task))
+ if self.screen:
+ self.dep_sort_prep()
+
+ # Prepare the dependency sort order keys
+ # This method creates sort keys per recipe tasks in
+ # the order of each recipe's internal dependecies
+ # Method:
+ # Filter the tasks in dep order in dep_sort_map = {}
+ # (a) Find a task that has no dependecies
+ # Ignore non-recipe specific tasks
+ # (b) Add it to the sort mapping dict with
+ # key of "<task_group>_<order>"
+ # (c) Remove it as a dependency from the other tasks
+ # (d) Repeat till all tasks are mapped
+ # Use placeholders to insure each sub-dict is instantiated
+ def dep_sort_prep(self):
+ self.progress_view.progress('DepSort',0,4)
+ # Init the task base entries
+ self.progress_view.progress('DepSort',1,4)
+ dep_table = {}
+ bb_index = 0
+ for task in self.pkg_model:
+ # First define the incoming bitbake sort order
+ self.bb_sort_map[task] = "%04d" % (bb_index)
+ bb_index += 1
+ task_group = task[0:task.find('.')]
+ if task_group not in dep_table:
+ dep_table[task_group] = {}
+ dep_table[task_group]['-'] = {} # Placeholder
+ if task not in dep_table[task_group]:
+ dep_table[task_group][task] = {}
+ dep_table[task_group][task]['-'] = {} # Placeholder
+ # Add the task dependecy entries
+ self.progress_view.progress('DepSort',2,4)
+ for task_obj in self.depends_model:
+ if task_obj[DEPENDS_TYPE] != TYPE_DEP:
+ continue
+ task = task_obj[DEPENDS_TASK]
+ task_dep = task_obj[DEPENDS_DEPS]
+ task_group = task[0:task.find('.')]
+ # Only track depends within same group
+ if task_dep.startswith(task_group+'.'):
+ dep_table[task_group][task][task_dep] = 1
+ self.progress_view.progress('DepSort',3,4)
+ for task_group in dep_table:
+ dep_index = 0
+ # Whittle down the tasks of each group
+ this_pass = 1
+ do_loop = True
+ while (len(dep_table[task_group]) > 1) and do_loop:
+ this_pass += 1
+ is_change = False
+ delete_list = []
+ for task in dep_table[task_group]:
+ if '-' == task:
+ continue
+ if 1 == len(dep_table[task_group][task]):
+ is_change = True
+ # No more deps, so collect this task...
+ self.dep_sort_map[task] = "%s_%04d" % (task_group,dep_index)
+ dep_index += 1
+ # ... remove it from other lists as resolved ...
+ for dep_task in dep_table[task_group]:
+ if task in dep_table[task_group][dep_task]:
+ del dep_table[task_group][dep_task][task]
+ # ... and remove it from from the task group
+ delete_list.append(task)
+ for task in delete_list:
+ del dep_table[task_group][task]
+ if not is_change:
+ alert("ERROR:DEP_SIEVE_NO_CHANGE:%s" % task_group,self.screen)
+ do_loop = False
+ continue
+ self.progress_view.progress('',4,4)
+ self.progress_view.clear()
+ self.help_bar_view.show_help(True)
+ if len(self.dep_sort_map) != len(self.pkg_model):
+ alert("ErrorDepSort:%d/%d" % (len(self.dep_sort_map),len(self.pkg_model)),self.screen)
+
+ # Look up a dep sort order key
+ def get_dep_sort(self,key):
+ if key in self.dep_sort_map:
+ return(self.dep_sort_map[key])
+ else:
+ return(key)
+
+ # Look up a bitbake sort order key
+ def get_bb_sort(self,key):
+ if key in self.bb_sort_map:
+ return(self.bb_sort_map[key])
+ else:
+ return(key)
+
+ # Find the selected package in the main frame, update the dependency frames content accordingly
+ def select(self, package_name, only_update_dependents=False):
+ if not package_name:
+ package_name = self.package_view.get_selected()
+ # alert("SELECT:%s:" % package_name,self.screen)
+
+ if self.filter_str != self.filter_prev:
+ self.package_view.cursor_on(False)
+ # Fill of the main package task list using new filter
+ self.package_view.task_list = []
+ for package in self.pkg_model:
+ if self.filter_str:
+ if self.filter_str in package:
+ self.package_view.task_list_append(package,self)
+ else:
+ self.package_view.task_list_append(package,self)
+ self.package_view.sort()
+ self.filter_prev = self.filter_str
+
+ # Old position is lost, assert new position of previous task (if still filtered in)
+ self.package_view.cursor_index = 0
+ self.package_view.cursor_offset = 0
+ self.package_view.scroll_offset = 0
+ self.package_view.redraw()
+ self.package_view.cursor_on(True)
+
+ # Make sure the selected package is in view, with implicit redraw()
+ if (not only_update_dependents):
+ self.package_view.find(package_name)
+ # In case selected name change (i.e. filter removed previous)
+ package_name = self.package_view.get_selected()
+
+ # Filter the package's dependent list to the dependent view
+ self.dep_view.reset()
+ for package_def in self.depends_model:
+ if (package_def[DEPENDS_TYPE] == TYPE_DEP) and (package_def[DEPENDS_TASK] == package_name):
+ self.dep_view.task_list_append(package_def[DEPENDS_DEPS],self)
+ self.dep_view.sort()
+ self.dep_view.redraw()
+ # Filter the package's dependent list to the reverse dependent view
+ self.reverse_view.reset()
+ for package_def in self.depends_model:
+ if (package_def[DEPENDS_TYPE] == TYPE_RDEP) and (package_def[DEPENDS_TASK] == package_name):
+ self.reverse_view.task_list_append(package_def[DEPENDS_DEPS],self)
+ self.reverse_view.sort()
+ self.reverse_view.redraw()
+ self.show_selected(package_name)
+ self.screen.refresh()
+
+ # The print-to-file method
+ def print_deps(self,whole_group=False):
+ global is_printed
+ # Print the selected deptree(s) to a file
+ if not is_printed:
+ try:
+ # Move to backup any exiting file before first write
+ if os.path.isfile(print_file_name):
+ os.system('mv -f %s %s' % (print_file_name,print_file_backup_name))
+ except Exception as e:
+ alert(e,self.screen)
+ alert('',self.screen)
+ print_list = []
+ selected_task = self.package_view.get_selected()
+ if not selected_task:
+ return
+ if not whole_group:
+ print_list.append(selected_task)
+ else:
+ # Use the presorted task_group order from 'package_view'
+ task_group = selected_task[0:selected_task.find('.')+1]
+ for task_obj in self.package_view.task_list:
+ task = task_obj[TASK_NAME]
+ if task.startswith(task_group):
+ print_list.append(task)
+ with open(print_file_name, "a") as fd:
+ print_max = len(print_list)
+ print_count = 1
+ self.progress_view.progress('Write "%s"' % print_file_name,0,print_max)
+ for task in print_list:
+ print_count = self.progress_view.progress('',print_count,print_max)
+ self.select(task)
+ self.screen.refresh();
+ # Utilize the current print output model
+ if print_model == PRINT_MODEL_1:
+ print("=== Dependendency Snapshot ===",file=fd)
+ print(" = Package =",file=fd)
+ print(' '+task,file=fd)
+ # Fill in the matching dependencies
+ print(" = Dependencies =",file=fd)
+ for task_obj in self.dep_view.task_list:
+ print(' '+ task_obj[TASK_NAME],file=fd)
+ print(" = Dependent Tasks =",file=fd)
+ for task_obj in self.reverse_view.task_list:
+ print(' '+ task_obj[TASK_NAME],file=fd)
+ if print_model == PRINT_MODEL_2:
+ print("=== Dependendency Snapshot ===",file=fd)
+ dep_count = len(self.dep_view.task_list) - 1
+ for i,task_obj in enumerate(self.dep_view.task_list):
+ print('%s%s' % ("Dep =" if (i==dep_count) else " ",task_obj[TASK_NAME]),file=fd)
+ if not self.dep_view.task_list:
+ print('Dep =',file=fd)
+ print("Package=%s" % task,file=fd)
+ for i,task_obj in enumerate(self.reverse_view.task_list):
+ print('%s%s' % ("RDep =" if (i==0) else " ",task_obj[TASK_NAME]),file=fd)
+ if not self.reverse_view.task_list:
+ print('RDep =',file=fd)
+ curses.napms(2000)
+ self.progress_view.clear()
+ self.help_bar_view.show_help(True)
+ print('',file=fd)
+ # Restore display to original selected task
+ self.select(selected_task)
+ is_printed = True
+
+#################################################
+### Load bitbake data
+###
+
+def bitbake_load(server, eventHandler, params, dep, curses_off, screen):
+ global bar_len_old
+ bar_len_old = 0
+
+ # Support no screen
+ def progress(msg,count,max):
+ global bar_len_old
+ if screen:
+ dep.progress_view.progress(msg,count,max)
+ else:
+ if msg:
+ if bar_len_old:
+ bar_len_old = 0
+ print("\n")
+ print(f"{msg}: ({count} of {max})")
+ else:
+ bar_len = int((count*40)/max)
+ if bar_len_old != bar_len:
+ print(f"{'*' * (bar_len-bar_len_old)}",end='',flush=True)
+ bar_len_old = bar_len
+ def clear():
+ if screen:
+ dep.progress_view.clear()
+ def clear_curses(screen):
+ if screen:
+ curses_off(screen)
+
+ #
+ # Trigger bitbake "generateDepTreeEvent"
+ #
+
+ cmdline = ''
+ try:
+ params.updateToServer(server, os.environ.copy())
+ params.updateFromServer(server)
+ cmdline = params.parseActions()
+ if not cmdline:
+ clear_curses(screen)
+ print("ERROR: nothing to do. Use 'bitbake world' to build everything, or run 'bitbake --help' for usage information.")
+ return 1,cmdline
+ if 'msg' in cmdline and cmdline['msg']:
+ clear_curses(screen)
+ print('ERROR: ' + cmdline['msg'])
+ return 1,cmdline
+ cmdline = cmdline['action']
+ if not cmdline or cmdline[0] != "generateDotGraph":
+ clear_curses(screen)
+ print("ERROR: This UI requires the -g option")
+ return 1,cmdline
+ ret, error = server.runCommand(["generateDepTreeEvent", cmdline[1], cmdline[2]])
+ if error:
+ clear_curses(screen)
+ print("ERROR: running command '%s': %s" % (cmdline, error))
+ return 1,cmdline
+ elif not ret:
+ clear_curses(screen)
+ print("ERROR: running command '%s': returned %s" % (cmdline, ret))
+ return 1,cmdline
+ except client.Fault as x:
+ clear_curses(screen)
+ print("ERROR: XMLRPC Fault getting commandline:\n %s" % x)
+ return 1,cmdline
+ except Exception as e:
+ clear_curses(screen)
+ print("ERROR: in startup:\n %s" % traceback.format_exc())
+ return 1,cmdline
+
+ #
+ # Receive data from bitbake
+ #
+
+ progress_total = 0
+ load_bitbake = True
+ quit = False
+ try:
+ while load_bitbake:
+ try:
+ event = eventHandler.waitEvent(0.25)
+ if quit:
+ _, error = server.runCommand(["stateForceShutdown"])
+ clear_curses(screen)
+ if error:
+ print('Unable to cleanly stop: %s' % error)
+ break
+
+ if event is None:
+ continue
+
+ if isinstance(event, bb.event.CacheLoadStarted):
+ progress_total = event.total
+ progress('Loading Cache',0,progress_total)
+ continue
+
+ if isinstance(event, bb.event.CacheLoadProgress):
+ x = event.current
+ progress('',x,progress_total)
+ continue
+
+ if isinstance(event, bb.event.CacheLoadCompleted):
+ clear()
+ progress('Bitbake... ',1,2)
+ continue
+
+ if isinstance(event, bb.event.ParseStarted):
+ progress_total = event.total
+ progress('Processing recipes',0,progress_total)
+ if progress_total == 0:
+ continue
+
+ if isinstance(event, bb.event.ParseProgress):
+ x = event.current
+ progress('',x,progress_total)
+ continue
+
+ if isinstance(event, bb.event.ParseCompleted):
+ progress('Generating dependency tree',0,3)
+ continue
+
+ if isinstance(event, bb.event.DepTreeGenerated):
+ progress('Generating dependency tree',1,3)
+ dep.parse(event._depgraph)
+ progress('Generating dependency tree',2,3)
+
+ if isinstance(event, bb.command.CommandCompleted):
+ load_bitbake = False
+ progress('Generating dependency tree',3,3)
+ clear()
+ if screen:
+ dep.help_bar_view.show_help(True)
+ continue
+
+ if isinstance(event, bb.event.NoProvider):
+ clear_curses(screen)
+ print('ERROR: %s' % event)
+
+ _, error = server.runCommand(["stateShutdown"])
+ if error:
+ print('ERROR: Unable to cleanly shutdown: %s' % error)
+ return 1,cmdline
+
+ if isinstance(event, bb.command.CommandFailed):
+ clear_curses(screen)
+ print('ERROR: ' + str(event))
+ return event.exitcode,cmdline
+
+ if isinstance(event, bb.command.CommandExit):
+ clear_curses(screen)
+ return event.exitcode,cmdline
+
+ if isinstance(event, bb.cooker.CookerExit):
+ break
+
+ continue
+ except EnvironmentError as ioerror:
+ # ignore interrupted io
+ if ioerror.args[0] == 4:
+ pass
+ except KeyboardInterrupt:
+ if shutdown == 2:
+ clear_curses(screen)
+ print("\nThird Keyboard Interrupt, exit.\n")
+ break
+ if shutdown == 1:
+ clear_curses(screen)
+ print("\nSecond Keyboard Interrupt, stopping...\n")
+ _, error = server.runCommand(["stateForceShutdown"])
+ if error:
+ print('Unable to cleanly stop: %s' % error)
+ if shutdown == 0:
+ clear_curses(screen)
+ print("\nKeyboard Interrupt, closing down...\n")
+ _, error = server.runCommand(["stateShutdown"])
+ if error:
+ print('Unable to cleanly shutdown: %s' % error)
+ shutdown = shutdown + 1
+ pass
+ except Exception as e:
+ # Safe exit on error
+ clear_curses(screen)
+ print("Exception : %s" % e)
+ print("Exception in startup:\n %s" % traceback.format_exc())
+
+ return 0,cmdline
+
+#################################################
+### main
+###
+
+SCREEN_COL_MIN = 83
+SCREEN_ROW_MIN = 26
+
+def main(server, eventHandler, params):
+ global verbose
+ global sort_model
+ global print_model
+ global is_printed
+ global is_filter
+ global screen_too_small
+
+ shutdown = 0
+ screen_too_small = False
+ quit = False
+
+ # Unit test with no terminal?
+ if unit_test_noterm:
+ # Load bitbake, test that there is valid dependency data, then exit
+ screen = None
+ print("* UNIT TEST:START")
+ dep = DepExplorer(screen)
+ print("* UNIT TEST:BITBAKE FETCH")
+ ret,cmdline = bitbake_load(server, eventHandler, params, dep, None, screen)
+ if ret:
+ print("* UNIT TEST: BITBAKE FAILED")
+ return ret
+ # Test the acquired dependency data
+ quilt_native_deps = 0
+ quilt_native_rdeps = 0
+ quilt_deps = 0
+ quilt_rdeps = 0
+ for i,task_obj in enumerate(dep.depends_model):
+ if TYPE_DEP == task_obj[0]:
+ task = task_obj[1]
+ if task.startswith('quilt-native'):
+ quilt_native_deps += 1
+ elif task.startswith('quilt'):
+ quilt_deps += 1
+ elif TYPE_RDEP == task_obj[0]:
+ task = task_obj[1]
+ if task.startswith('quilt-native'):
+ quilt_native_rdeps += 1
+ elif task.startswith('quilt'):
+ quilt_rdeps += 1
+ # Print results
+ failed = False
+ if 0 < len(dep.depends_model):
+ print(f"Pass:Bitbake dependency count = {len(dep.depends_model)}")
+ else:
+ failed = True
+ print(f"FAIL:Bitbake dependency count = 0")
+ if quilt_native_deps:
+ print(f"Pass:Quilt-native depends count = {quilt_native_deps}")
+ else:
+ failed = True
+ print(f"FAIL:Quilt-native depends count = 0")
+ if quilt_native_rdeps:
+ print(f"Pass:Quilt-native rdepends count = {quilt_native_rdeps}")
+ else:
+ failed = True
+ print(f"FAIL:Quilt-native rdepends count = 0")
+ if quilt_deps:
+ print(f"Pass:Quilt depends count = {quilt_deps}")
+ else:
+ failed = True
+ print(f"FAIL:Quilt depends count = 0")
+ if quilt_rdeps:
+ print(f"Pass:Quilt rdepends count = {quilt_rdeps}")
+ else:
+ failed = True
+ print(f"FAIL:Quilt rdepends count = 0")
+ print("* UNIT TEST:STOP")
+ return failed
+
+ # Help method to dynamically test parent window too small
+ def check_screen_size(dep, active_package):
+ global screen_too_small
+ rows, cols = screen.getmaxyx()
+ if (rows >= SCREEN_ROW_MIN) and (cols >= SCREEN_COL_MIN):
+ if screen_too_small:
+ # Now big enough, remove error message and redraw screen
+ dep.draw_frames()
+ active_package.cursor_on(True)
+ screen_too_small = False
+ return True
+ # Test on App init
+ if not dep:
+ # Do not start this app if screen not big enough
+ curses.endwin()
+ print("")
+ print("ERROR(Taskexp_cli): Mininal screen size is %dx%d" % (SCREEN_COL_MIN,SCREEN_ROW_MIN))
+ print("Current screen is Cols=%s,Rows=%d" % (cols,rows))
+ return False
+ # First time window too small
+ if not screen_too_small:
+ active_package.cursor_on(False)
+ dep.screen.addstr(0,2,'[BIGGER WINDOW PLEASE]', curses.color_pair(CURSES_WARNING) | curses.A_BLINK)
+ screen_too_small = True
+ return False
+
+ # Helper method to turn off curses mode
+ def curses_off(screen):
+ if not screen: return
+ # Safe error exit
+ screen.keypad(False)
+ curses.echo()
+ curses.curs_set(1)
+ curses.endwin()
+
+ if unit_test_results:
+ print('\nUnit Test Results:')
+ for line in unit_test_results:
+ print(" %s" % line)
+
+ #
+ # Initialize the ncurse environment
+ #
+
+ screen = curses.initscr()
+ try:
+ if not check_screen_size(None, None):
+ exit(1)
+ try:
+ curses.start_color()
+ curses.use_default_colors();
+ curses.init_pair(0xFF, curses.COLOR_BLACK, curses.COLOR_WHITE);
+ curses.init_pair(CURSES_NORMAL, curses.COLOR_WHITE, curses.COLOR_BLACK)
+ curses.init_pair(CURSES_HIGHLIGHT, curses.COLOR_WHITE, curses.COLOR_BLUE)
+ curses.init_pair(CURSES_WARNING, curses.COLOR_WHITE, curses.COLOR_RED)
+ except:
+ curses.endwin()
+ print("")
+ print("ERROR(Taskexp_cli): Requires 256 colors. Please use this or the equivalent:")
+ print(" $ export TERM='xterm-256color'")
+ exit(1)
+
+ screen.keypad(True)
+ curses.noecho()
+ curses.curs_set(0)
+ screen.refresh();
+ except Exception as e:
+ # Safe error exit
+ curses_off(screen)
+ print("Exception : %s" % e)
+ print("Exception in startup:\n %s" % traceback.format_exc())
+ exit(1)
+
+ try:
+ #
+ # Instantiate the presentation layers
+ #
+
+ dep = DepExplorer(screen)
+
+ #
+ # Prepare bitbake
+ #
+
+ # Fetch bitbake dependecy data
+ ret,cmdline = bitbake_load(server, eventHandler, params, dep, curses_off, screen)
+ if ret: return ret
+
+ #
+ # Preset the views
+ #
+
+ # Cmdline example = ['generateDotGraph', ['acl', 'zlib'], 'build']
+ primary_packages = cmdline[1]
+ dep.package_view.set_primary(primary_packages)
+ dep.dep_view.set_primary(primary_packages)
+ dep.reverse_view.set_primary(primary_packages)
+ dep.help_box_view.set_primary(primary_packages)
+ dep.help_bar_view.show_help(True)
+ active_package = dep.package_view
+ active_package.cursor_on(True)
+ dep.select(primary_packages[0]+'.')
+ if unit_test:
+ alert('UNIT_TEST',screen)
+
+ # Help method to start/stop the filter feature
+ def filter_mode(new_filter_status):
+ global is_filter
+ if is_filter == new_filter_status:
+ # Ignore no changes
+ return
+ if not new_filter_status:
+ # Turn off
+ curses.curs_set(0)
+ #active_package.cursor_on(False)
+ active_package = dep.package_view
+ active_package.cursor_on(True)
+ is_filter = False
+ dep.help_bar_view.show_help(True)
+ dep.filter_str = ''
+ dep.select('')
+ else:
+ # Turn on
+ curses.curs_set(1)
+ dep.help_bar_view.show_help(False)
+ dep.filter_view.clear()
+ dep.filter_view.show(True)
+ dep.filter_view.show_prompt()
+ is_filter = True
+
+ #
+ # Main user loop
+ #
+
+ while not quit:
+ if is_filter:
+ dep.filter_view.show_prompt()
+ if unit_test:
+ c = unit_test_action(active_package)
+ else:
+ c = screen.getch()
+ ch = chr(c)
+
+ # Do not draw if window now too small
+ if not check_screen_size(dep,active_package):
+ continue
+
+ if verbose:
+ if c == CHAR_RETURN:
+ screen.addstr(0, 4, "|%3d,CR |" % (c))
+ else:
+ screen.addstr(0, 4, "|%3d,%3s|" % (c,chr(c)))
+
+ # pre-map alternate filter close keys
+ if is_filter and (c == CHAR_ESCAPE):
+ # Alternate exit from filter
+ ch = '/'
+ c = ord(ch)
+
+ # Filter and non-filter mode command keys
+ # https://docs.python.org/3/library/curses.html
+ if c in (curses.KEY_UP,CHAR_UP):
+ active_package.line_up()
+ if active_package == dep.package_view:
+ dep.select('',only_update_dependents=True)
+ elif c in (curses.KEY_DOWN,CHAR_DOWN):
+ active_package.line_down()
+ if active_package == dep.package_view:
+ dep.select('',only_update_dependents=True)
+ elif curses.KEY_PPAGE == c:
+ active_package.page_up()
+ if active_package == dep.package_view:
+ dep.select('',only_update_dependents=True)
+ elif curses.KEY_NPAGE == c:
+ active_package.page_down()
+ if active_package == dep.package_view:
+ dep.select('',only_update_dependents=True)
+ elif CHAR_TAB == c:
+ # Tab between boxes
+ active_package.cursor_on(False)
+ if active_package == dep.package_view:
+ active_package = dep.dep_view
+ elif active_package == dep.dep_view:
+ active_package = dep.reverse_view
+ else:
+ active_package = dep.package_view
+ active_package.cursor_on(True)
+ elif curses.KEY_BTAB == c:
+ # Shift-Tab reverse between boxes
+ active_package.cursor_on(False)
+ if active_package == dep.package_view:
+ active_package = dep.reverse_view
+ elif active_package == dep.reverse_view:
+ active_package = dep.dep_view
+ else:
+ active_package = dep.package_view
+ active_package.cursor_on(True)
+ elif (CHAR_RETURN == c):
+ # CR to select
+ selected = active_package.get_selected()
+ if selected:
+ active_package.cursor_on(False)
+ active_package = dep.package_view
+ filter_mode(False)
+ dep.select(selected)
+ else:
+ filter_mode(False)
+ dep.select(primary_packages[0]+'.')
+
+ elif '/' == ch: # Enter/exit dep.filter_view
+ if is_filter:
+ filter_mode(False)
+ else:
+ filter_mode(True)
+ elif is_filter:
+ # If in filter mode, re-direct all these other keys to the filter box
+ result = dep.filter_view.input(c,ch)
+ dep.filter_str = dep.filter_view.filter_str
+ dep.select('')
+
+ # Non-filter mode command keys
+ elif 'p' == ch:
+ dep.print_deps(whole_group=False)
+ elif 'P' == ch:
+ dep.print_deps(whole_group=True)
+ elif 'w' == ch:
+ # Toggle the print model
+ if print_model == PRINT_MODEL_1:
+ print_model = PRINT_MODEL_2
+ else:
+ print_model = PRINT_MODEL_1
+ elif 's' == ch:
+ # Toggle the sort model
+ if sort_model == SORT_DEPS:
+ sort_model = SORT_ALPHA
+ elif sort_model == SORT_ALPHA:
+ if SORT_BITBAKE_ENABLE:
+ sort_model = TASK_SORT_BITBAKE
+ else:
+ sort_model = SORT_DEPS
+ else:
+ sort_model = SORT_DEPS
+ active_package.cursor_on(False)
+ current_task = active_package.get_selected()
+ dep.package_view.sort()
+ dep.dep_view.sort()
+ dep.reverse_view.sort()
+ active_package = dep.package_view
+ active_package.cursor_on(True)
+ dep.select(current_task)
+ # Announce the new sort model
+ alert("SORT=%s" % ("ALPHA" if (sort_model == SORT_ALPHA) else "DEPS"),screen)
+ alert('',screen)
+
+ elif 'q' == ch:
+ quit = True
+ elif ch in ('h','?'):
+ dep.help_box_view.show_help(True)
+ dep.select(active_package.get_selected())
+
+ #
+ # Debugging commands
+ #
+
+ elif 'V' == ch:
+ verbose = not verbose
+ alert('Verbose=%s' % str(verbose),screen)
+ alert('',screen)
+ elif 'R' == ch:
+ screen.refresh()
+ elif 'B' == ch:
+ # Progress bar unit test
+ dep.progress_view.progress('Test',0,40)
+ curses.napms(1000)
+ dep.progress_view.progress('',10,40)
+ curses.napms(1000)
+ dep.progress_view.progress('',20,40)
+ curses.napms(1000)
+ dep.progress_view.progress('',30,40)
+ curses.napms(1000)
+ dep.progress_view.progress('',40,40)
+ curses.napms(1000)
+ dep.progress_view.clear()
+ dep.help_bar_view.show_help(True)
+ elif 'Q' == ch:
+ # Simulated error
+ curses_off(screen)
+ print('ERROR: simulated error exit')
+ return 1
+
+ # Safe exit
+ curses_off(screen)
+ except Exception as e:
+ # Safe exit on error
+ curses_off(screen)
+ print("Exception : %s" % e)
+ print("Exception in startup:\n %s" % traceback.format_exc())
+
+ # Reminder to pick up your printed results
+ if is_printed:
+ print("")
+ print("You have output ready!")
+ print(" * Your printed dependency file is: %s" % print_file_name)
+ print(" * Your previous results saved in: %s" % print_file_backup_name)
+ print("")
diff --git a/bitbake/lib/bb/ui/toasterui.py b/bitbake/lib/bb/ui/toasterui.py
index ec5bd4f105..6bd21f1844 100644
--- a/bitbake/lib/bb/ui/toasterui.py
+++ b/bitbake/lib/bb/ui/toasterui.py
@@ -385,7 +385,7 @@ def main(server, eventHandler, params):
main.shutdown = 1
logger.info("ToasterUI build done, brbe: %s", brbe)
- continue
+ break
if isinstance(event, (bb.command.CommandCompleted,
bb.command.CommandFailed,
diff --git a/bitbake/lib/bb/ui/uievent.py b/bitbake/lib/bb/ui/uievent.py
index d595f172ac..c2f830d530 100644
--- a/bitbake/lib/bb/ui/uievent.py
+++ b/bitbake/lib/bb/ui/uievent.py
@@ -65,35 +65,27 @@ class BBUIEventQueue:
self.server = server
self.t = threading.Thread()
- self.t.setDaemon(True)
+ self.t.daemon = True
self.t.run = self.startCallbackHandler
self.t.start()
def getEvent(self):
-
- self.eventQueueLock.acquire()
-
- if not self.eventQueue:
- self.eventQueueLock.release()
- return None
-
- item = self.eventQueue.pop(0)
-
- if not self.eventQueue:
- self.eventQueueNotify.clear()
-
- self.eventQueueLock.release()
- return item
+ with bb.utils.lock_timeout(self.eventQueueLock):
+ if not self.eventQueue:
+ return None
+ item = self.eventQueue.pop(0)
+ if not self.eventQueue:
+ self.eventQueueNotify.clear()
+ return item
def waitEvent(self, delay):
self.eventQueueNotify.wait(delay)
return self.getEvent()
def queue_event(self, event):
- self.eventQueueLock.acquire()
- self.eventQueue.append(event)
- self.eventQueueNotify.set()
- self.eventQueueLock.release()
+ with bb.utils.lock_timeout(self.eventQueueLock):
+ self.eventQueue.append(event)
+ self.eventQueueNotify.set()
def send_event(self, event):
self.queue_event(pickle.loads(event))
diff --git a/bitbake/lib/bb/utils.py b/bitbake/lib/bb/utils.py
index b8b90df8d3..ebee65d3dd 100644
--- a/bitbake/lib/bb/utils.py
+++ b/bitbake/lib/bb/utils.py
@@ -13,6 +13,7 @@ import errno
import logging
import bb
import bb.msg
+import locale
import multiprocessing
import fcntl
import importlib
@@ -29,6 +30,8 @@ import collections
import copy
import ctypes
import random
+import socket
+import struct
import tempfile
from subprocess import getstatusoutput
from contextlib import contextmanager
@@ -47,7 +50,7 @@ def clean_context():
def get_context():
return _context
-
+
def set_context(ctx):
_context = ctx
@@ -209,8 +212,8 @@ def explode_dep_versions2(s, *, sort=True):
inversion = True
# This list is based on behavior and supported comparisons from deb, opkg and rpm.
#
- # Even though =<, <<, ==, !=, =>, and >> may not be supported,
- # we list each possibly valid item.
+ # Even though =<, <<, ==, !=, =>, and >> may not be supported,
+ # we list each possibly valid item.
# The build system is responsible for validation of what it supports.
if i.startswith(('<=', '=<', '<<', '==', '!=', '>=', '=>', '>>')):
lastcmp = i[0:2]
@@ -344,7 +347,7 @@ def _print_exception(t, value, tb, realfile, text, context):
exception = traceback.format_exception_only(t, value)
error.append('Error executing a python function in %s:\n' % realfile)
- # Strip 'us' from the stack (better_exec call) unless that was where the
+ # Strip 'us' from the stack (better_exec call) unless that was where the
# error came from
if tb.tb_next is not None:
tb = tb.tb_next
@@ -431,12 +434,14 @@ def better_eval(source, locals, extraglobals = None):
return eval(source, ctx, locals)
@contextmanager
-def fileslocked(files):
+def fileslocked(files, *args, **kwargs):
"""Context manager for locking and unlocking file locks."""
locks = []
if files:
for lockfile in files:
- locks.append(bb.utils.lockfile(lockfile))
+ l = bb.utils.lockfile(lockfile, *args, **kwargs)
+ if l is not None:
+ locks.append(l)
try:
yield
@@ -543,7 +548,12 @@ def md5_file(filename):
Return the hex string representation of the MD5 checksum of filename.
"""
import hashlib
- return _hasher(hashlib.new('MD5', usedforsecurity=False), filename)
+ try:
+ sig = hashlib.new('MD5', usedforsecurity=False)
+ except TypeError:
+ # Some configurations don't appear to support two arguments
+ sig = hashlib.new('MD5')
+ return _hasher(sig, filename)
def sha256_file(filename):
"""
@@ -594,11 +604,25 @@ def preserved_envvars():
v = [
'BBPATH',
'BB_PRESERVE_ENV',
- 'BB_ENV_PASSTHROUGH',
'BB_ENV_PASSTHROUGH_ADDITIONS',
]
return v + preserved_envvars_exported()
+def check_system_locale():
+ """Make sure the required system locale are available and configured"""
+ default_locale = locale.getlocale(locale.LC_CTYPE)
+
+ try:
+ locale.setlocale(locale.LC_CTYPE, ("en_US", "UTF-8"))
+ except:
+ sys.exit("Please make sure locale 'en_US.UTF-8' is available on your system")
+ else:
+ locale.setlocale(locale.LC_CTYPE, default_locale)
+
+ if sys.getfilesystemencoding() != "utf-8":
+ sys.exit("Please use a locale setting which supports UTF-8 (such as LANG=en_US.UTF-8).\n"
+ "Python can't change the filesystem locale after loading so we need a UTF-8 when Python starts or things won't work.")
+
def filter_environment(good_vars):
"""
Create a pristine environment for bitbake. This will remove variables that
@@ -721,9 +745,9 @@ def prunedir(topdir, ionice=False):
# but thats possibly insane and suffixes is probably going to be small
#
def prune_suffix(var, suffixes, d):
- """
+ """
See if var ends with any of the suffixes listed and
- remove it if found
+ remove it if found
"""
for suffix in suffixes:
if suffix and var.endswith(suffix):
@@ -734,7 +758,8 @@ def mkdirhier(directory):
"""Create a directory like 'mkdir -p', but does not complain if
directory already exists like os.makedirs
"""
-
+ if '${' in str(directory):
+ bb.fatal("Directory name {} contains unexpanded bitbake variable. This may cause build failures and WORKDIR polution.".format(directory))
try:
os.makedirs(directory)
except OSError as e:
@@ -976,13 +1001,16 @@ def umask(new_mask):
os.umask(current_mask)
def to_boolean(string, default=None):
- """
+ """
Check input string and return boolean value True/False/None
- depending upon the checks
+ depending upon the checks
"""
if not string:
return default
+ if isinstance(string, int):
+ return string != 0
+
normalized = string.lower()
if normalized in ("y", "yes", "1", "true"):
return True
@@ -1114,7 +1142,10 @@ def get_referenced_vars(start_expr, d):
def cpu_count():
- return multiprocessing.cpu_count()
+ try:
+ return len(os.sched_getaffinity(0))
+ except OSError:
+ return multiprocessing.cpu_count()
def nonblockingfd(fd):
fcntl.fcntl(fd, fcntl.F_SETFL, fcntl.fcntl(fd, fcntl.F_GETFL) | os.O_NONBLOCK)
@@ -1601,6 +1632,44 @@ def set_process_name(name):
except:
pass
+def enable_loopback_networking():
+ # From bits/ioctls.h
+ SIOCGIFFLAGS = 0x8913
+ SIOCSIFFLAGS = 0x8914
+ SIOCSIFADDR = 0x8916
+ SIOCSIFNETMASK = 0x891C
+
+ # if.h
+ IFF_UP = 0x1
+ IFF_RUNNING = 0x40
+
+ # bits/socket.h
+ AF_INET = 2
+
+ # char ifr_name[IFNAMSIZ=16]
+ ifr_name = struct.pack("@16s", b"lo")
+ def netdev_req(fd, req, data = b""):
+ # Pad and add interface name
+ data = ifr_name + data + (b'\x00' * (16 - len(data)))
+ # Return all data after interface name
+ return fcntl.ioctl(fd, req, data)[16:]
+
+ with socket.socket(socket.AF_INET, socket.SOCK_DGRAM, socket.IPPROTO_IP) as sock:
+ fd = sock.fileno()
+
+ # struct sockaddr_in ifr_addr { unsigned short family; uint16_t sin_port ; uint32_t in_addr; }
+ req = struct.pack("@H", AF_INET) + struct.pack("=H4B", 0, 127, 0, 0, 1)
+ netdev_req(fd, SIOCSIFADDR, req)
+
+ # short ifr_flags
+ flags = struct.unpack_from('@h', netdev_req(fd, SIOCGIFFLAGS))[0]
+ flags |= IFF_UP | IFF_RUNNING
+ netdev_req(fd, SIOCSIFFLAGS, struct.pack('@h', flags))
+
+ # struct sockaddr_in ifr_netmask
+ req = struct.pack("@H", AF_INET) + struct.pack("=H4B", 0, 255, 0, 0, 0)
+ netdev_req(fd, SIOCSIFNETMASK, req)
+
def disable_network(uid=None, gid=None):
"""
Disable networking in the current process if the kernel supports it, else
@@ -1622,7 +1691,7 @@ def disable_network(uid=None, gid=None):
ret = libc.unshare(CLONE_NEWNET | CLONE_NEWUSER)
if ret != 0:
- logger.debug("System doesn't suport disabling network without admin privs")
+ logger.debug("System doesn't support disabling network without admin privs")
return
with open("/proc/self/uid_map", "w") as f:
f.write("%s %s 1" % (uid, uid))
@@ -1632,25 +1701,11 @@ def disable_network(uid=None, gid=None):
f.write("%s %s 1" % (gid, gid))
def export_proxies(d):
+ from bb.fetch2 import get_fetcher_environment
""" export common proxies variables from datastore to environment """
- import os
-
- variables = ['http_proxy', 'HTTP_PROXY', 'https_proxy', 'HTTPS_PROXY',
- 'ftp_proxy', 'FTP_PROXY', 'no_proxy', 'NO_PROXY',
- 'GIT_PROXY_COMMAND']
- exported = False
-
- for v in variables:
- if v in os.environ.keys():
- exported = True
- else:
- v_proxy = d.getVar(v)
- if v_proxy is not None:
- os.environ[v] = v_proxy
- exported = True
-
- return exported
-
+ newenv = get_fetcher_environment(d)
+ for v in newenv:
+ os.environ[v] = newenv[v]
def load_plugins(logger, plugins, pluginpath):
def load_plugin(name):
@@ -1775,3 +1830,39 @@ def mkstemp(suffix=None, prefix=None, dir=None, text=False):
else:
prefix = tempfile.gettempprefix() + entropy
return tempfile.mkstemp(suffix=suffix, prefix=prefix, dir=dir, text=text)
+
+def path_is_descendant(descendant, ancestor):
+ """
+ Returns True if the path `descendant` is a descendant of `ancestor`
+ (including being equivalent to `ancestor` itself). Otherwise returns False.
+ Correctly accounts for symlinks, bind mounts, etc. by using
+ os.path.samestat() to compare paths
+
+ May raise any exception that os.stat() raises
+ """
+
+ ancestor_stat = os.stat(ancestor)
+
+ # Recurse up each directory component of the descendant to see if it is
+ # equivalent to the ancestor
+ check_dir = os.path.abspath(descendant).rstrip("/")
+ while check_dir:
+ check_stat = os.stat(check_dir)
+ if os.path.samestat(check_stat, ancestor_stat):
+ return True
+ check_dir = os.path.dirname(check_dir).rstrip("/")
+
+ return False
+
+# If we don't have a timeout of some kind and a process/thread exits badly (for example
+# OOM killed) and held a lock, we'd just hang in the lock futex forever. It is better
+# we exit at some point than hang. 5 minutes with no progress means we're probably deadlocked.
+@contextmanager
+def lock_timeout(lock):
+ held = lock.acquire(timeout=5*60)
+ try:
+ if not held:
+ os._exit(1)
+ yield held
+ finally:
+ lock.release()
diff --git a/bitbake/lib/bb/xattr.py b/bitbake/lib/bb/xattr.py
new file mode 100755
index 0000000000..7b634944a4
--- /dev/null
+++ b/bitbake/lib/bb/xattr.py
@@ -0,0 +1,126 @@
+#! /usr/bin/env python3
+#
+# Copyright 2023 by Garmin Ltd. or its subsidiaries
+#
+# SPDX-License-Identifier: MIT
+
+import sys
+import ctypes
+import os
+import errno
+
+libc = ctypes.CDLL("libc.so.6", use_errno=True)
+fsencoding = sys.getfilesystemencoding()
+
+
+libc.listxattr.argtypes = [ctypes.c_char_p, ctypes.c_char_p, ctypes.c_size_t]
+libc.llistxattr.argtypes = [ctypes.c_char_p, ctypes.c_char_p, ctypes.c_size_t]
+
+
+def listxattr(path, follow=True):
+ func = libc.listxattr if follow else libc.llistxattr
+
+ os_path = os.fsencode(path)
+
+ while True:
+ length = func(os_path, None, 0)
+
+ if length < 0:
+ err = ctypes.get_errno()
+ raise OSError(err, os.strerror(err), str(path))
+
+ if length == 0:
+ return []
+
+ arr = ctypes.create_string_buffer(length)
+
+ read_length = func(os_path, arr, length)
+ if read_length != length:
+ # Race!
+ continue
+
+ return [a.decode(fsencoding) for a in arr.raw.split(b"\x00") if a]
+
+
+libc.getxattr.argtypes = [
+ ctypes.c_char_p,
+ ctypes.c_char_p,
+ ctypes.c_char_p,
+ ctypes.c_size_t,
+]
+libc.lgetxattr.argtypes = [
+ ctypes.c_char_p,
+ ctypes.c_char_p,
+ ctypes.c_char_p,
+ ctypes.c_size_t,
+]
+
+
+def getxattr(path, name, follow=True):
+ func = libc.getxattr if follow else libc.lgetxattr
+
+ os_path = os.fsencode(path)
+ os_name = os.fsencode(name)
+
+ while True:
+ length = func(os_path, os_name, None, 0)
+
+ if length < 0:
+ err = ctypes.get_errno()
+ if err == errno.ENODATA:
+ return None
+ raise OSError(err, os.strerror(err), str(path))
+
+ if length == 0:
+ return ""
+
+ arr = ctypes.create_string_buffer(length)
+
+ read_length = func(os_path, os_name, arr, length)
+ if read_length != length:
+ # Race!
+ continue
+
+ return arr.raw
+
+
+def get_all_xattr(path, follow=True):
+ attrs = {}
+
+ names = listxattr(path, follow)
+
+ for name in names:
+ value = getxattr(path, name, follow)
+ if value is None:
+ # This can happen if a value is erased after listxattr is called,
+ # so ignore it
+ continue
+ attrs[name] = value
+
+ return attrs
+
+
+def main():
+ import argparse
+ from pathlib import Path
+
+ parser = argparse.ArgumentParser()
+ parser.add_argument("path", help="File Path", type=Path)
+
+ args = parser.parse_args()
+
+ attrs = get_all_xattr(args.path)
+
+ for name, value in attrs.items():
+ try:
+ value = value.decode(fsencoding)
+ except UnicodeDecodeError:
+ pass
+
+ print(f"{name} = {value}")
+
+ return 0
+
+
+if __name__ == "__main__":
+ sys.exit(main())
diff --git a/bitbake/lib/bblayers/action.py b/bitbake/lib/bblayers/action.py
index 454c251410..a14f19948e 100644
--- a/bitbake/lib/bblayers/action.py
+++ b/bitbake/lib/bblayers/action.py
@@ -11,6 +11,7 @@ import shutil
import sys
import tempfile
+from bb.cookerdata import findTopdir
import bb.utils
from bblayers.common import LayerPlugin
@@ -37,7 +38,7 @@ class ActionPlugin(LayerPlugin):
sys.stderr.write("Specified layer directory %s doesn't contain a conf/layer.conf file\n" % layerdir)
return 1
- bblayers_conf = os.path.join('conf', 'bblayers.conf')
+ bblayers_conf = os.path.join(findTopdir(),'conf', 'bblayers.conf')
if not os.path.exists(bblayers_conf):
sys.stderr.write("Unable to find bblayers.conf\n")
return 1
@@ -50,11 +51,13 @@ class ActionPlugin(LayerPlugin):
try:
notadded, _ = bb.utils.edit_bblayers_conf(bblayers_conf, layerdirs, None)
if not (args.force or notadded):
+ self.tinfoil.modified_files()
try:
self.tinfoil.run_command('parseConfiguration')
except (bb.tinfoil.TinfoilUIException, bb.BBHandledException):
# Restore the back up copy of bblayers.conf
shutil.copy2(backup, bblayers_conf)
+ self.tinfoil.modified_files()
bb.fatal("Parse failure with the specified layer added, exiting.")
else:
for item in notadded:
@@ -65,7 +68,7 @@ class ActionPlugin(LayerPlugin):
def do_remove_layer(self, args):
"""Remove one or more layers from bblayers.conf."""
- bblayers_conf = os.path.join('conf', 'bblayers.conf')
+ bblayers_conf = os.path.join(findTopdir() ,'conf', 'bblayers.conf')
if not os.path.exists(bblayers_conf):
sys.stderr.write("Unable to find bblayers.conf\n")
return 1
@@ -80,6 +83,9 @@ class ActionPlugin(LayerPlugin):
layerdir = os.path.abspath(item)
layerdirs.append(layerdir)
(_, notremoved) = bb.utils.edit_bblayers_conf(bblayers_conf, None, layerdirs)
+ if args.force > 1:
+ return 0
+ self.tinfoil.modified_files()
if notremoved:
for item in notremoved:
sys.stderr.write("No layers matching %s found in BBLAYERS\n" % item)
@@ -239,6 +245,9 @@ build results (as the layer priority order has effectively changed).
if not entry_found:
logger.warning("File %s does not match the flattened layer's BBFILES setting, you may need to edit conf/layer.conf or move the file elsewhere" % f1full)
+ self.tinfoil.modified_files()
+
+
def get_file_layer(self, filename):
layerdir = self.get_file_layerdir(filename)
if layerdir:
diff --git a/bitbake/lib/bblayers/layerindex.py b/bitbake/lib/bblayers/layerindex.py
index 0ac8fd2ec7..ba91fac669 100644
--- a/bitbake/lib/bblayers/layerindex.py
+++ b/bitbake/lib/bblayers/layerindex.py
@@ -49,6 +49,31 @@ class LayerIndexPlugin(ActionPlugin):
else:
logger.plain("Repository %s needs to be fetched" % url)
return subdir, layername, layerdir
+ elif os.path.exists(repodir) and branch:
+ """
+ If the repo is already cloned, ensure it is on the correct branch,
+ switching branches if necessary and possible.
+ """
+ base_cmd = ['git', '--git-dir=%s/.git' % repodir, '--work-tree=%s' % repodir]
+ cmd = base_cmd + ['branch']
+ completed_proc = subprocess.run(cmd, text=True, capture_output=True)
+ if completed_proc.returncode:
+ logger.error("Unable to validate repo %s (%s)" % (repodir, stderr))
+ return None, None, None
+ else:
+ if branch != completed_proc.stdout[2:-1]:
+ cmd = base_cmd + ['status', '--short']
+ completed_proc = subprocess.run(cmd, text=True, capture_output=True)
+ if completed_proc.stdout.count('\n') != 0:
+ logger.warning("There are uncommitted changes in repo %s" % repodir)
+ cmd = base_cmd + ['checkout', branch]
+ completed_proc = subprocess.run(cmd, text=True, capture_output=True)
+ if completed_proc.returncode:
+ # Could be due to original shallow clone on a different branch for example
+ logger.error("Unable to automatically switch %s to desired branch '%s' (%s)"
+ % (repodir, branch, completed_proc.stderr))
+ return None, None, None
+ return subdir, layername, layerdir
elif os.path.exists(layerdir):
return subdir, layername, layerdir
else:
diff --git a/bitbake/lib/bblayers/query.py b/bitbake/lib/bblayers/query.py
index afd39518e5..bfc18a7593 100644
--- a/bitbake/lib/bblayers/query.py
+++ b/bitbake/lib/bblayers/query.py
@@ -29,12 +29,12 @@ class QueryPlugin(LayerPlugin):
def do_show_layers(self, args):
"""show current configured layers."""
- logger.plain("%s %s %s" % ("layer".ljust(20), "path".ljust(40), "priority"))
- logger.plain('=' * 74)
+ logger.plain("%s %s %s" % ("layer".ljust(20), "path".ljust(70), "priority"))
+ logger.plain('=' * 104)
for layer, _, regex, pri in self.tinfoil.cooker.bbfile_config_priorities:
layerdir = self.bbfile_collections.get(layer, None)
- layername = self.get_layer_name(layerdir)
- logger.plain("%s %s %d" % (layername.ljust(20), layerdir.ljust(40), pri))
+ layername = layer
+ logger.plain("%s %s %s" % (layername.ljust(20), layerdir.ljust(70), pri))
def version_str(self, pe, pv, pr = None):
verstr = "%s" % pv
@@ -282,7 +282,10 @@ Lists recipes with the bbappends that apply to them as subitems.
else:
logger.plain('=== Appended recipes ===')
- pnlist = list(self.tinfoil.cooker_data.pkg_pn.keys())
+
+ cooker_data = self.tinfoil.cooker.recipecaches[args.mc]
+
+ pnlist = list(cooker_data.pkg_pn.keys())
pnlist.sort()
appends = False
for pn in pnlist:
@@ -295,7 +298,7 @@ Lists recipes with the bbappends that apply to them as subitems.
if not found:
continue
- if self.show_appends_for_pn(pn):
+ if self.show_appends_for_pn(pn, cooker_data, args.mc):
appends = True
if not args.pnspec and self.show_appends_for_skipped():
@@ -304,8 +307,10 @@ Lists recipes with the bbappends that apply to them as subitems.
if not appends:
logger.plain('No append files found')
- def show_appends_for_pn(self, pn):
- filenames = self.tinfoil.cooker_data.pkg_pn[pn]
+ def show_appends_for_pn(self, pn, cooker_data, mc):
+ filenames = cooker_data.pkg_pn[pn]
+ if mc:
+ pn = "mc:%s:%s" % (mc, pn)
best = self.tinfoil.find_best_provider(pn)
best_filename = os.path.basename(best[3])
@@ -530,6 +535,7 @@ NOTE: .bbappend files can impact the dependencies.
parser_show_appends = self.add_command(sp, 'show-appends', self.do_show_appends)
parser_show_appends.add_argument('pnspec', nargs='*', help='optional recipe name specification (wildcards allowed, enclose in quotes to avoid shell expansion)')
+ parser_show_appends.add_argument('--mc', help='use specified multiconfig', default='')
parser_show_cross_depends = self.add_command(sp, 'show-cross-depends', self.do_show_cross_depends)
parser_show_cross_depends.add_argument('-f', '--filenames', help='show full file path', action='store_true')
diff --git a/bitbake/lib/bs4/tests/test_tree.py b/bitbake/lib/bs4/tests/test_tree.py
index 8e5c66426e..cf0f1abe0c 100644
--- a/bitbake/lib/bs4/tests/test_tree.py
+++ b/bitbake/lib/bs4/tests/test_tree.py
@@ -585,7 +585,7 @@ class SiblingTest(TreeTest):
</html>'''
# All that whitespace looks good but makes the tests more
# difficult. Get rid of it.
- markup = re.compile("\n\s*").sub("", markup)
+ markup = re.compile(r"\n\s*").sub("", markup)
self.tree = self.soup(markup)
diff --git a/bitbake/lib/codegen.py b/bitbake/lib/codegen.py
index 6955a7ada5..018b283177 100644
--- a/bitbake/lib/codegen.py
+++ b/bitbake/lib/codegen.py
@@ -392,19 +392,7 @@ class SourceGenerator(NodeVisitor):
def visit_Name(self, node):
self.write(node.id)
- def visit_Str(self, node):
- self.write(repr(node.s))
-
- def visit_Bytes(self, node):
- self.write(repr(node.s))
-
- def visit_Num(self, node):
- self.write(repr(node.n))
-
def visit_Constant(self, node):
- # Python 3.8 deprecated visit_Num(), visit_Str(), visit_Bytes(),
- # visit_NameConstant() and visit_Ellipsis(). They can be removed once we
- # require 3.8+.
self.write(repr(node.value))
def visit_Tuple(self, node):
diff --git a/bitbake/lib/hashserv/__init__.py b/bitbake/lib/hashserv/__init__.py
index 9cb3fd57a5..74367eb6b4 100644
--- a/bitbake/lib/hashserv/__init__.py
+++ b/bitbake/lib/hashserv/__init__.py
@@ -5,151 +5,102 @@
import asyncio
from contextlib import closing
-import re
-import sqlite3
import itertools
import json
+from collections import namedtuple
+from urllib.parse import urlparse
+from bb.asyncrpc.client import parse_address, ADDR_TYPE_UNIX, ADDR_TYPE_WS
+
+User = namedtuple("User", ("username", "permissions"))
+
+def create_server(
+ addr,
+ dbname,
+ *,
+ sync=True,
+ upstream=None,
+ read_only=False,
+ db_username=None,
+ db_password=None,
+ anon_perms=None,
+ admin_username=None,
+ admin_password=None,
+):
+ def sqlite_engine():
+ from .sqlite import DatabaseEngine
+
+ return DatabaseEngine(dbname, sync)
+
+ def sqlalchemy_engine():
+ from .sqlalchemy import DatabaseEngine
+
+ return DatabaseEngine(dbname, db_username, db_password)
-UNIX_PREFIX = "unix://"
-
-ADDR_TYPE_UNIX = 0
-ADDR_TYPE_TCP = 1
-
-# The Python async server defaults to a 64K receive buffer, so we hardcode our
-# maximum chunk size. It would be better if the client and server reported to
-# each other what the maximum chunk sizes were, but that will slow down the
-# connection setup with a round trip delay so I'd rather not do that unless it
-# is necessary
-DEFAULT_MAX_CHUNK = 32 * 1024
-
-UNIHASH_TABLE_DEFINITION = (
- ("method", "TEXT NOT NULL", "UNIQUE"),
- ("taskhash", "TEXT NOT NULL", "UNIQUE"),
- ("unihash", "TEXT NOT NULL", ""),
-)
-
-UNIHASH_TABLE_COLUMNS = tuple(name for name, _, _ in UNIHASH_TABLE_DEFINITION)
-
-OUTHASH_TABLE_DEFINITION = (
- ("method", "TEXT NOT NULL", "UNIQUE"),
- ("taskhash", "TEXT NOT NULL", "UNIQUE"),
- ("outhash", "TEXT NOT NULL", "UNIQUE"),
- ("created", "DATETIME", ""),
-
- # Optional fields
- ("owner", "TEXT", ""),
- ("PN", "TEXT", ""),
- ("PV", "TEXT", ""),
- ("PR", "TEXT", ""),
- ("task", "TEXT", ""),
- ("outhash_siginfo", "TEXT", ""),
-)
-
-OUTHASH_TABLE_COLUMNS = tuple(name for name, _, _ in OUTHASH_TABLE_DEFINITION)
-
-def _make_table(cursor, name, definition):
- cursor.execute('''
- CREATE TABLE IF NOT EXISTS {name} (
- id INTEGER PRIMARY KEY AUTOINCREMENT,
- {fields}
- UNIQUE({unique})
- )
- '''.format(
- name=name,
- fields=" ".join("%s %s," % (name, typ) for name, typ, _ in definition),
- unique=", ".join(name for name, _, flags in definition if "UNIQUE" in flags)
- ))
-
-
-def setup_database(database, sync=True):
- db = sqlite3.connect(database)
- db.row_factory = sqlite3.Row
-
- with closing(db.cursor()) as cursor:
- _make_table(cursor, "unihashes_v2", UNIHASH_TABLE_DEFINITION)
- _make_table(cursor, "outhashes_v2", OUTHASH_TABLE_DEFINITION)
-
- cursor.execute('PRAGMA journal_mode = WAL')
- cursor.execute('PRAGMA synchronous = %s' % ('NORMAL' if sync else 'OFF'))
-
- # Drop old indexes
- cursor.execute('DROP INDEX IF EXISTS taskhash_lookup')
- cursor.execute('DROP INDEX IF EXISTS outhash_lookup')
- cursor.execute('DROP INDEX IF EXISTS taskhash_lookup_v2')
- cursor.execute('DROP INDEX IF EXISTS outhash_lookup_v2')
-
- # TODO: Upgrade from tasks_v2?
- cursor.execute('DROP TABLE IF EXISTS tasks_v2')
-
- # Create new indexes
- cursor.execute('CREATE INDEX IF NOT EXISTS taskhash_lookup_v3 ON unihashes_v2 (method, taskhash)')
- cursor.execute('CREATE INDEX IF NOT EXISTS outhash_lookup_v3 ON outhashes_v2 (method, outhash)')
-
- return db
-
-
-def parse_address(addr):
- if addr.startswith(UNIX_PREFIX):
- return (ADDR_TYPE_UNIX, (addr[len(UNIX_PREFIX):],))
- else:
- m = re.match(r'\[(?P<host>[^\]]*)\]:(?P<port>\d+)$', addr)
- if m is not None:
- host = m.group('host')
- port = m.group('port')
- else:
- host, port = addr.split(':')
-
- return (ADDR_TYPE_TCP, (host, int(port)))
-
+ from . import server
-def chunkify(msg, max_chunk):
- if len(msg) < max_chunk - 1:
- yield ''.join((msg, "\n"))
+ if "://" in dbname:
+ db_engine = sqlalchemy_engine()
else:
- yield ''.join((json.dumps({
- 'chunk-stream': None
- }), "\n"))
+ db_engine = sqlite_engine()
- args = [iter(msg)] * (max_chunk - 1)
- for m in map(''.join, itertools.zip_longest(*args, fillvalue='')):
- yield ''.join(itertools.chain(m, "\n"))
- yield "\n"
+ if anon_perms is None:
+ anon_perms = server.DEFAULT_ANON_PERMS
-
-def create_server(addr, dbname, *, sync=True, upstream=None, read_only=False):
- from . import server
- db = setup_database(dbname, sync=sync)
- s = server.Server(db, upstream=upstream, read_only=read_only)
+ s = server.Server(
+ db_engine,
+ upstream=upstream,
+ read_only=read_only,
+ anon_perms=anon_perms,
+ admin_username=admin_username,
+ admin_password=admin_password,
+ )
(typ, a) = parse_address(addr)
if typ == ADDR_TYPE_UNIX:
s.start_unix_server(*a)
+ elif typ == ADDR_TYPE_WS:
+ url = urlparse(a[0])
+ s.start_websocket_server(url.hostname, url.port)
else:
s.start_tcp_server(*a)
return s
-def create_client(addr):
+def create_client(addr, username=None, password=None):
from . import client
- c = client.Client()
- (typ, a) = parse_address(addr)
- if typ == ADDR_TYPE_UNIX:
- c.connect_unix(*a)
- else:
- c.connect_tcp(*a)
+ c = client.Client(username, password)
+
+ try:
+ (typ, a) = parse_address(addr)
+ if typ == ADDR_TYPE_UNIX:
+ c.connect_unix(*a)
+ elif typ == ADDR_TYPE_WS:
+ c.connect_websocket(*a)
+ else:
+ c.connect_tcp(*a)
+ return c
+ except Exception as e:
+ c.close()
+ raise e
- return c
-async def create_async_client(addr):
+async def create_async_client(addr, username=None, password=None):
from . import client
- c = client.AsyncClient()
- (typ, a) = parse_address(addr)
- if typ == ADDR_TYPE_UNIX:
- await c.connect_unix(*a)
- else:
- await c.connect_tcp(*a)
+ c = client.AsyncClient(username, password)
+
+ try:
+ (typ, a) = parse_address(addr)
+ if typ == ADDR_TYPE_UNIX:
+ await c.connect_unix(*a)
+ elif typ == ADDR_TYPE_WS:
+ await c.connect_websocket(*a)
+ else:
+ await c.connect_tcp(*a)
- return c
+ return c
+ except Exception as e:
+ await c.close()
+ raise e
diff --git a/bitbake/lib/hashserv/client.py b/bitbake/lib/hashserv/client.py
index b2aa1026ac..0b254beddd 100644
--- a/bitbake/lib/hashserv/client.py
+++ b/bitbake/lib/hashserv/client.py
@@ -6,6 +6,7 @@
import logging
import socket
import bb.asyncrpc
+import json
from . import create_async_client
@@ -15,107 +16,331 @@ logger = logging.getLogger("hashserv.client")
class AsyncClient(bb.asyncrpc.AsyncClient):
MODE_NORMAL = 0
MODE_GET_STREAM = 1
+ MODE_EXIST_STREAM = 2
- def __init__(self):
- super().__init__('OEHASHEQUIV', '1.1', logger)
+ def __init__(self, username=None, password=None):
+ super().__init__("OEHASHEQUIV", "1.1", logger)
self.mode = self.MODE_NORMAL
+ self.username = username
+ self.password = password
+ self.saved_become_user = None
async def setup_connection(self):
await super().setup_connection()
- cur_mode = self.mode
self.mode = self.MODE_NORMAL
- await self._set_mode(cur_mode)
+ if self.username:
+ # Save off become user temporarily because auth() resets it
+ become = self.saved_become_user
+ await self.auth(self.username, self.password)
- async def send_stream(self, msg):
+ if become:
+ await self.become_user(become)
+
+ async def send_stream(self, mode, msg):
async def proc():
- self.writer.write(("%s\n" % msg).encode("utf-8"))
- await self.writer.drain()
- l = await self.reader.readline()
- if not l:
- raise ConnectionError("Connection closed")
- return l.decode("utf-8").rstrip()
+ await self._set_mode(mode)
+ await self.socket.send(msg)
+ return await self.socket.recv()
return await self._send_wrapper(proc)
+ async def invoke(self, *args, **kwargs):
+ # It's OK if connection errors cause a failure here, because the mode
+ # is also reset to normal on a new connection
+ await self._set_mode(self.MODE_NORMAL)
+ return await super().invoke(*args, **kwargs)
+
async def _set_mode(self, new_mode):
- if new_mode == self.MODE_NORMAL and self.mode == self.MODE_GET_STREAM:
- r = await self.send_stream("END")
+ async def stream_to_normal():
+ await self.socket.send("END")
+ return await self.socket.recv()
+
+ async def normal_to_stream(command):
+ r = await self.invoke({command: None})
if r != "ok":
- raise ConnectionError("Bad response from server %r" % r)
- elif new_mode == self.MODE_GET_STREAM and self.mode == self.MODE_NORMAL:
- r = await self.send_message({"get-stream": None})
+ raise ConnectionError(
+ f"Unable to transition to stream mode: Bad response from server {r!r}"
+ )
+
+ self.logger.debug("Mode is now %s", command)
+
+ if new_mode == self.mode:
+ return
+
+ self.logger.debug("Transitioning mode %s -> %s", self.mode, new_mode)
+
+ # Always transition to normal mode before switching to any other mode
+ if self.mode != self.MODE_NORMAL:
+ r = await self._send_wrapper(stream_to_normal)
if r != "ok":
- raise ConnectionError("Bad response from server %r" % r)
- elif new_mode != self.mode:
- raise Exception(
- "Undefined mode transition %r -> %r" % (self.mode, new_mode)
- )
+ self.check_invoke_error(r)
+ raise ConnectionError(
+ f"Unable to transition to normal mode: Bad response from server {r!r}"
+ )
+ self.logger.debug("Mode is now normal")
+
+ if new_mode == self.MODE_GET_STREAM:
+ await normal_to_stream("get-stream")
+ elif new_mode == self.MODE_EXIST_STREAM:
+ await normal_to_stream("exists-stream")
+ elif new_mode != self.MODE_NORMAL:
+ raise Exception("Undefined mode transition {self.mode!r} -> {new_mode!r}")
self.mode = new_mode
async def get_unihash(self, method, taskhash):
- await self._set_mode(self.MODE_GET_STREAM)
- r = await self.send_stream("%s %s" % (method, taskhash))
+ r = await self.send_stream(self.MODE_GET_STREAM, "%s %s" % (method, taskhash))
if not r:
return None
return r
async def report_unihash(self, taskhash, method, outhash, unihash, extra={}):
- await self._set_mode(self.MODE_NORMAL)
m = extra.copy()
m["taskhash"] = taskhash
m["method"] = method
m["outhash"] = outhash
m["unihash"] = unihash
- return await self.send_message({"report": m})
+ return await self.invoke({"report": m})
async def report_unihash_equiv(self, taskhash, method, unihash, extra={}):
- await self._set_mode(self.MODE_NORMAL)
m = extra.copy()
m["taskhash"] = taskhash
m["method"] = method
m["unihash"] = unihash
- return await self.send_message({"report-equiv": m})
+ return await self.invoke({"report-equiv": m})
async def get_taskhash(self, method, taskhash, all_properties=False):
- await self._set_mode(self.MODE_NORMAL)
- return await self.send_message(
+ return await self.invoke(
{"get": {"taskhash": taskhash, "method": method, "all": all_properties}}
)
- async def get_outhash(self, method, outhash, taskhash):
- await self._set_mode(self.MODE_NORMAL)
- return await self.send_message(
- {"get-outhash": {"outhash": outhash, "taskhash": taskhash, "method": method}}
+ async def unihash_exists(self, unihash):
+ r = await self.send_stream(self.MODE_EXIST_STREAM, unihash)
+ return r == "true"
+
+ async def get_outhash(self, method, outhash, taskhash, with_unihash=True):
+ return await self.invoke(
+ {
+ "get-outhash": {
+ "outhash": outhash,
+ "taskhash": taskhash,
+ "method": method,
+ "with_unihash": with_unihash,
+ }
+ }
)
async def get_stats(self):
- await self._set_mode(self.MODE_NORMAL)
- return await self.send_message({"get-stats": None})
+ return await self.invoke({"get-stats": None})
async def reset_stats(self):
- await self._set_mode(self.MODE_NORMAL)
- return await self.send_message({"reset-stats": None})
+ return await self.invoke({"reset-stats": None})
async def backfill_wait(self):
- await self._set_mode(self.MODE_NORMAL)
- return (await self.send_message({"backfill-wait": None}))["tasks"]
+ return (await self.invoke({"backfill-wait": None}))["tasks"]
+
+ async def remove(self, where):
+ return await self.invoke({"remove": {"where": where}})
+
+ async def clean_unused(self, max_age):
+ return await self.invoke({"clean-unused": {"max_age_seconds": max_age}})
+
+ async def auth(self, username, token):
+ result = await self.invoke({"auth": {"username": username, "token": token}})
+ self.username = username
+ self.password = token
+ self.saved_become_user = None
+ return result
+
+ async def refresh_token(self, username=None):
+ m = {}
+ if username:
+ m["username"] = username
+ result = await self.invoke({"refresh-token": m})
+ if (
+ self.username
+ and not self.saved_become_user
+ and result["username"] == self.username
+ ):
+ self.password = result["token"]
+ return result
+
+ async def set_user_perms(self, username, permissions):
+ return await self.invoke(
+ {"set-user-perms": {"username": username, "permissions": permissions}}
+ )
+
+ async def get_user(self, username=None):
+ m = {}
+ if username:
+ m["username"] = username
+ return await self.invoke({"get-user": m})
+
+ async def get_all_users(self):
+ return (await self.invoke({"get-all-users": {}}))["users"]
+
+ async def new_user(self, username, permissions):
+ return await self.invoke(
+ {"new-user": {"username": username, "permissions": permissions}}
+ )
+
+ async def delete_user(self, username):
+ return await self.invoke({"delete-user": {"username": username}})
+
+ async def become_user(self, username):
+ result = await self.invoke({"become-user": {"username": username}})
+ if username == self.username:
+ self.saved_become_user = None
+ else:
+ self.saved_become_user = username
+ return result
+
+ async def get_db_usage(self):
+ return (await self.invoke({"get-db-usage": {}}))["usage"]
+
+ async def get_db_query_columns(self):
+ return (await self.invoke({"get-db-query-columns": {}}))["columns"]
+
+ async def gc_status(self):
+ return await self.invoke({"gc-status": {}})
+
+ async def gc_mark(self, mark, where):
+ """
+ Starts a new garbage collection operation identified by "mark". If
+ garbage collection is already in progress with "mark", the collection
+ is continued.
+
+ All unihash entries that match the "where" clause are marked to be
+ kept. In addition, any new entries added to the database after this
+ command will be automatically marked with "mark"
+ """
+ return await self.invoke({"gc-mark": {"mark": mark, "where": where}})
+
+ async def gc_sweep(self, mark):
+ """
+ Finishes garbage collection for "mark". All unihash entries that have
+ not been marked will be deleted.
+
+ It is recommended to clean unused outhash entries after running this to
+ cleanup any dangling outhashes
+ """
+ return await self.invoke({"gc-sweep": {"mark": mark}})
class Client(bb.asyncrpc.Client):
- def __init__(self):
+ def __init__(self, username=None, password=None):
+ self.username = username
+ self.password = password
+
super().__init__()
self._add_methods(
"connect_tcp",
+ "connect_websocket",
"get_unihash",
"report_unihash",
"report_unihash_equiv",
"get_taskhash",
+ "unihash_exists",
"get_outhash",
"get_stats",
"reset_stats",
"backfill_wait",
+ "remove",
+ "clean_unused",
+ "auth",
+ "refresh_token",
+ "set_user_perms",
+ "get_user",
+ "get_all_users",
+ "new_user",
+ "delete_user",
+ "become_user",
+ "get_db_usage",
+ "get_db_query_columns",
+ "gc_status",
+ "gc_mark",
+ "gc_sweep",
)
def _get_async_client(self):
- return AsyncClient()
+ return AsyncClient(self.username, self.password)
+
+
+class ClientPool(bb.asyncrpc.ClientPool):
+ def __init__(
+ self,
+ address,
+ max_clients,
+ *,
+ username=None,
+ password=None,
+ become=None,
+ ):
+ super().__init__(max_clients)
+ self.address = address
+ self.username = username
+ self.password = password
+ self.become = become
+
+ async def _new_client(self):
+ client = await create_async_client(
+ self.address,
+ username=self.username,
+ password=self.password,
+ )
+ if self.become:
+ await client.become_user(self.become)
+ return client
+
+ def _run_key_tasks(self, queries, call):
+ results = {key: None for key in queries.keys()}
+
+ def make_task(key, args):
+ async def task(client):
+ nonlocal results
+ unihash = await call(client, args)
+ results[key] = unihash
+
+ return task
+
+ def gen_tasks():
+ for key, args in queries.items():
+ yield make_task(key, args)
+
+ self.run_tasks(gen_tasks())
+ return results
+
+ def get_unihashes(self, queries):
+ """
+ Query multiple unihashes in parallel.
+
+ The queries argument is a dictionary with arbitrary key. The values
+ must be a tuple of (method, taskhash).
+
+ Returns a dictionary with a corresponding key for each input key, and
+ the value is the queried unihash (which might be none if the query
+ failed)
+ """
+
+ async def call(client, args):
+ method, taskhash = args
+ return await client.get_unihash(method, taskhash)
+
+ return self._run_key_tasks(queries, call)
+
+ def unihashes_exist(self, queries):
+ """
+ Query multiple unihash existence checks in parallel.
+
+ The queries argument is a dictionary with arbitrary key. The values
+ must be a unihash.
+
+ Returns a dictionary with a corresponding key for each input key, and
+ the value is True or False if the unihash is known by the server (or
+ None if there was a failure)
+ """
+
+ async def call(client, unihash):
+ return await client.unihash_exists(unihash)
+
+ return self._run_key_tasks(queries, call)
diff --git a/bitbake/lib/hashserv/server.py b/bitbake/lib/hashserv/server.py
index d40a2ab8f8..68f64f983b 100644
--- a/bitbake/lib/hashserv/server.py
+++ b/bitbake/lib/hashserv/server.py
@@ -3,18 +3,51 @@
# SPDX-License-Identifier: GPL-2.0-only
#
-from contextlib import closing, contextmanager
-from datetime import datetime
-import enum
+from datetime import datetime, timedelta
import asyncio
import logging
import math
import time
-from . import create_async_client, UNIHASH_TABLE_COLUMNS, OUTHASH_TABLE_COLUMNS
+import os
+import base64
+import hashlib
+from . import create_async_client
import bb.asyncrpc
+logger = logging.getLogger("hashserv.server")
-logger = logging.getLogger('hashserv.server')
+
+# This permission only exists to match nothing
+NONE_PERM = "@none"
+
+READ_PERM = "@read"
+REPORT_PERM = "@report"
+DB_ADMIN_PERM = "@db-admin"
+USER_ADMIN_PERM = "@user-admin"
+ALL_PERM = "@all"
+
+ALL_PERMISSIONS = {
+ READ_PERM,
+ REPORT_PERM,
+ DB_ADMIN_PERM,
+ USER_ADMIN_PERM,
+ ALL_PERM,
+}
+
+DEFAULT_ANON_PERMS = (
+ READ_PERM,
+ REPORT_PERM,
+ DB_ADMIN_PERM,
+)
+
+TOKEN_ALGORITHM = "sha256"
+
+# 48 bytes of random data will result in 64 characters when base64
+# encoded. This number also ensures that the base64 encoding won't have any
+# trailing '=' characters.
+TOKEN_SIZE = 48
+
+SALT_SIZE = 8
class Measurement(object):
@@ -104,459 +137,745 @@ class Stats(object):
return math.sqrt(self.s / (self.num - 1))
def todict(self):
- return {k: getattr(self, k) for k in ('num', 'total_time', 'max_time', 'average', 'stdev')}
-
-
-@enum.unique
-class Resolve(enum.Enum):
- FAIL = enum.auto()
- IGNORE = enum.auto()
- REPLACE = enum.auto()
-
-
-def insert_table(cursor, table, data, on_conflict):
- resolve = {
- Resolve.FAIL: "",
- Resolve.IGNORE: " OR IGNORE",
- Resolve.REPLACE: " OR REPLACE",
- }[on_conflict]
-
- keys = sorted(data.keys())
- query = 'INSERT{resolve} INTO {table} ({fields}) VALUES({values})'.format(
- resolve=resolve,
- table=table,
- fields=", ".join(keys),
- values=", ".join(":" + k for k in keys),
- )
- prevrowid = cursor.lastrowid
- cursor.execute(query, data)
- logging.debug(
- "Inserting %r into %s, %s",
- data,
- table,
- on_conflict
- )
- return (cursor.lastrowid, cursor.lastrowid != prevrowid)
-
-def insert_unihash(cursor, data, on_conflict):
- return insert_table(cursor, "unihashes_v2", data, on_conflict)
-
-def insert_outhash(cursor, data, on_conflict):
- return insert_table(cursor, "outhashes_v2", data, on_conflict)
-
-async def copy_unihash_from_upstream(client, db, method, taskhash):
- d = await client.get_taskhash(method, taskhash)
- if d is not None:
- with closing(db.cursor()) as cursor:
- insert_unihash(
- cursor,
- {k: v for k, v in d.items() if k in UNIHASH_TABLE_COLUMNS},
- Resolve.IGNORE,
- )
- db.commit()
- return d
+ return {
+ k: getattr(self, k)
+ for k in ("num", "total_time", "max_time", "average", "stdev")
+ }
-class ServerCursor(object):
- def __init__(self, db, cursor, upstream):
- self.db = db
- self.cursor = cursor
- self.upstream = upstream
+token_refresh_semaphore = asyncio.Lock()
+
+
+async def new_token():
+ # Prevent malicious users from using this API to deduce the entropy
+ # pool on the server and thus be able to guess a token. *All* token
+ # refresh requests lock the same global semaphore and then sleep for a
+ # short time. The effectively rate limits the total number of requests
+ # than can be made across all clients to 10/second, which should be enough
+ # since you have to be an authenticated users to make the request in the
+ # first place
+ async with token_refresh_semaphore:
+ await asyncio.sleep(0.1)
+ raw = os.getrandom(TOKEN_SIZE, os.GRND_NONBLOCK)
+
+ return base64.b64encode(raw, b"._").decode("utf-8")
+
+
+def new_salt():
+ return os.getrandom(SALT_SIZE, os.GRND_NONBLOCK).hex()
+
+
+def hash_token(algo, salt, token):
+ h = hashlib.new(algo)
+ h.update(salt.encode("utf-8"))
+ h.update(token.encode("utf-8"))
+ return ":".join([algo, salt, h.hexdigest()])
+
+
+def permissions(*permissions, allow_anon=True, allow_self_service=False):
+ """
+ Function decorator that can be used to decorate an RPC function call and
+ check that the current users permissions match the require permissions.
+
+ If allow_anon is True, the user will also be allowed to make the RPC call
+ if the anonymous user permissions match the permissions.
+
+ If allow_self_service is True, and the "username" property in the request
+ is the currently logged in user, or not specified, the user will also be
+ allowed to make the request. This allows users to access normal privileged
+ API, as long as they are only modifying their own user properties (e.g.
+ users can be allowed to reset their own token without @user-admin
+ permissions, but not the token for any other user.
+ """
+
+ def wrapper(func):
+ async def wrap(self, request):
+ if allow_self_service and self.user is not None:
+ username = request.get("username", self.user.username)
+ if username == self.user.username:
+ request["username"] = self.user.username
+ return await func(self, request)
+
+ if not self.user_has_permissions(*permissions, allow_anon=allow_anon):
+ if not self.user:
+ username = "Anonymous user"
+ user_perms = self.server.anon_perms
+ else:
+ username = self.user.username
+ user_perms = self.user.permissions
+
+ self.logger.info(
+ "User %s with permissions %r denied from calling %s. Missing permissions(s) %r",
+ username,
+ ", ".join(user_perms),
+ func.__name__,
+ ", ".join(permissions),
+ )
+ raise bb.asyncrpc.InvokeError(
+ f"{username} is not allowed to access permissions(s) {', '.join(permissions)}"
+ )
+
+ return await func(self, request)
+
+ return wrap
+
+ return wrapper
class ServerClient(bb.asyncrpc.AsyncServerConnection):
- def __init__(self, reader, writer, db, request_stats, backfill_queue, upstream, read_only):
- super().__init__(reader, writer, 'OEHASHEQUIV', logger)
- self.db = db
- self.request_stats = request_stats
+ def __init__(self, socket, server):
+ super().__init__(socket, "OEHASHEQUIV", server.logger)
+ self.server = server
self.max_chunk = bb.asyncrpc.DEFAULT_MAX_CHUNK
- self.backfill_queue = backfill_queue
- self.upstream = upstream
+ self.user = None
- self.handlers.update({
- 'get': self.handle_get,
- 'get-outhash': self.handle_get_outhash,
- 'get-stream': self.handle_get_stream,
- 'get-stats': self.handle_get_stats,
- })
-
- if not read_only:
- self.handlers.update({
- 'report': self.handle_report,
- 'report-equiv': self.handle_equivreport,
- 'reset-stats': self.handle_reset_stats,
- 'backfill-wait': self.handle_backfill_wait,
- })
+ self.handlers.update(
+ {
+ "get": self.handle_get,
+ "get-outhash": self.handle_get_outhash,
+ "get-stream": self.handle_get_stream,
+ "exists-stream": self.handle_exists_stream,
+ "get-stats": self.handle_get_stats,
+ "get-db-usage": self.handle_get_db_usage,
+ "get-db-query-columns": self.handle_get_db_query_columns,
+ # Not always read-only, but internally checks if the server is
+ # read-only
+ "report": self.handle_report,
+ "auth": self.handle_auth,
+ "get-user": self.handle_get_user,
+ "get-all-users": self.handle_get_all_users,
+ "become-user": self.handle_become_user,
+ }
+ )
+
+ if not self.server.read_only:
+ self.handlers.update(
+ {
+ "report-equiv": self.handle_equivreport,
+ "reset-stats": self.handle_reset_stats,
+ "backfill-wait": self.handle_backfill_wait,
+ "remove": self.handle_remove,
+ "gc-mark": self.handle_gc_mark,
+ "gc-sweep": self.handle_gc_sweep,
+ "gc-status": self.handle_gc_status,
+ "clean-unused": self.handle_clean_unused,
+ "refresh-token": self.handle_refresh_token,
+ "set-user-perms": self.handle_set_perms,
+ "new-user": self.handle_new_user,
+ "delete-user": self.handle_delete_user,
+ }
+ )
+
+ def raise_no_user_error(self, username):
+ raise bb.asyncrpc.InvokeError(f"No user named '{username}' exists")
+
+ def user_has_permissions(self, *permissions, allow_anon=True):
+ permissions = set(permissions)
+ if allow_anon:
+ if ALL_PERM in self.server.anon_perms:
+ return True
+
+ if not permissions - self.server.anon_perms:
+ return True
+
+ if self.user is None:
+ return False
+
+ if ALL_PERM in self.user.permissions:
+ return True
+
+ if not permissions - self.user.permissions:
+ return True
+
+ return False
def validate_proto_version(self):
- return (self.proto_version > (1, 0) and self.proto_version <= (1, 1))
+ return self.proto_version > (1, 0) and self.proto_version <= (1, 1)
async def process_requests(self):
- if self.upstream is not None:
- self.upstream_client = await create_async_client(self.upstream)
- else:
- self.upstream_client = None
-
- await super().process_requests()
+ async with self.server.db_engine.connect(self.logger) as db:
+ self.db = db
+ if self.server.upstream is not None:
+ self.upstream_client = await create_async_client(self.server.upstream)
+ else:
+ self.upstream_client = None
- if self.upstream_client is not None:
- await self.upstream_client.close()
+ try:
+ await super().process_requests()
+ finally:
+ if self.upstream_client is not None:
+ await self.upstream_client.close()
async def dispatch_message(self, msg):
for k in self.handlers.keys():
if k in msg:
- logger.debug('Handling %s' % k)
- if 'stream' in k:
- await self.handlers[k](msg[k])
+ self.logger.debug("Handling %s" % k)
+ if "stream" in k:
+ return await self.handlers[k](msg[k])
else:
- with self.request_stats.start_sample() as self.request_sample, \
- self.request_sample.measure():
- await self.handlers[k](msg[k])
- return
+ with self.server.request_stats.start_sample() as self.request_sample, self.request_sample.measure():
+ return await self.handlers[k](msg[k])
raise bb.asyncrpc.ClientError("Unrecognized command %r" % msg)
+ @permissions(READ_PERM)
async def handle_get(self, request):
- method = request['method']
- taskhash = request['taskhash']
- fetch_all = request.get('all', False)
+ method = request["method"]
+ taskhash = request["taskhash"]
+ fetch_all = request.get("all", False)
- with closing(self.db.cursor()) as cursor:
- d = await self.get_unihash(cursor, method, taskhash, fetch_all)
+ return await self.get_unihash(method, taskhash, fetch_all)
- self.write_message(d)
-
- async def get_unihash(self, cursor, method, taskhash, fetch_all=False):
+ async def get_unihash(self, method, taskhash, fetch_all=False):
d = None
if fetch_all:
- cursor.execute(
- '''
- SELECT *, unihashes_v2.unihash AS unihash FROM outhashes_v2
- INNER JOIN unihashes_v2 ON unihashes_v2.method=outhashes_v2.method AND unihashes_v2.taskhash=outhashes_v2.taskhash
- WHERE outhashes_v2.method=:method AND outhashes_v2.taskhash=:taskhash
- ORDER BY outhashes_v2.created ASC
- LIMIT 1
- ''',
- {
- 'method': method,
- 'taskhash': taskhash,
- }
-
- )
- row = cursor.fetchone()
-
+ row = await self.db.get_unihash_by_taskhash_full(method, taskhash)
if row is not None:
d = {k: row[k] for k in row.keys()}
elif self.upstream_client is not None:
d = await self.upstream_client.get_taskhash(method, taskhash, True)
- self.update_unified(cursor, d)
- self.db.commit()
+ await self.update_unified(d)
else:
- row = self.query_equivalent(cursor, method, taskhash)
+ row = await self.db.get_equivalent(method, taskhash)
if row is not None:
d = {k: row[k] for k in row.keys()}
elif self.upstream_client is not None:
d = await self.upstream_client.get_taskhash(method, taskhash)
- d = {k: v for k, v in d.items() if k in UNIHASH_TABLE_COLUMNS}
- insert_unihash(cursor, d, Resolve.IGNORE)
- self.db.commit()
+ await self.db.insert_unihash(d["method"], d["taskhash"], d["unihash"])
return d
+ @permissions(READ_PERM)
async def handle_get_outhash(self, request):
- method = request['method']
- outhash = request['outhash']
- taskhash = request['taskhash']
+ method = request["method"]
+ outhash = request["outhash"]
+ taskhash = request["taskhash"]
+ with_unihash = request.get("with_unihash", True)
- with closing(self.db.cursor()) as cursor:
- d = await self.get_outhash(cursor, method, outhash, taskhash)
+ return await self.get_outhash(method, outhash, taskhash, with_unihash)
- self.write_message(d)
-
- async def get_outhash(self, cursor, method, outhash, taskhash):
+ async def get_outhash(self, method, outhash, taskhash, with_unihash=True):
d = None
- cursor.execute(
- '''
- SELECT *, unihashes_v2.unihash AS unihash FROM outhashes_v2
- INNER JOIN unihashes_v2 ON unihashes_v2.method=outhashes_v2.method AND unihashes_v2.taskhash=outhashes_v2.taskhash
- WHERE outhashes_v2.method=:method AND outhashes_v2.outhash=:outhash
- ORDER BY outhashes_v2.created ASC
- LIMIT 1
- ''',
- {
- 'method': method,
- 'outhash': outhash,
- }
- )
- row = cursor.fetchone()
+ if with_unihash:
+ row = await self.db.get_unihash_by_outhash(method, outhash)
+ else:
+ row = await self.db.get_outhash(method, outhash)
if row is not None:
d = {k: row[k] for k in row.keys()}
elif self.upstream_client is not None:
d = await self.upstream_client.get_outhash(method, outhash, taskhash)
- self.update_unified(cursor, d)
- self.db.commit()
+ await self.update_unified(d)
return d
- def update_unified(self, cursor, data):
+ async def update_unified(self, data):
if data is None:
return
- insert_unihash(
- cursor,
- {k: v for k, v in data.items() if k in UNIHASH_TABLE_COLUMNS},
- Resolve.IGNORE
- )
- insert_outhash(
- cursor,
- {k: v for k, v in data.items() if k in OUTHASH_TABLE_COLUMNS},
- Resolve.IGNORE
- )
+ await self.db.insert_unihash(data["method"], data["taskhash"], data["unihash"])
+ await self.db.insert_outhash(data)
- async def handle_get_stream(self, request):
- self.write_message('ok')
+ async def _stream_handler(self, handler):
+ await self.socket.send_message("ok")
while True:
upstream = None
- l = await self.reader.readline()
+ l = await self.socket.recv()
if not l:
- return
+ break
try:
# This inner loop is very sensitive and must be as fast as
# possible (which is why the request sample is handled manually
# instead of using 'with', and also why logging statements are
# commented out.
- self.request_sample = self.request_stats.start_sample()
+ self.request_sample = self.server.request_stats.start_sample()
request_measure = self.request_sample.measure()
request_measure.start()
- l = l.decode('utf-8').rstrip()
- if l == 'END':
- self.writer.write('ok\n'.encode('utf-8'))
- return
-
- (method, taskhash) = l.split()
- #logger.debug('Looking up %s %s' % (method, taskhash))
- cursor = self.db.cursor()
- try:
- row = self.query_equivalent(cursor, method, taskhash)
- finally:
- cursor.close()
-
- if row is not None:
- msg = ('%s\n' % row['unihash']).encode('utf-8')
- #logger.debug('Found equivalent task %s -> %s', (row['taskhash'], row['unihash']))
- elif self.upstream_client is not None:
- upstream = await self.upstream_client.get_unihash(method, taskhash)
- if upstream:
- msg = ("%s\n" % upstream).encode("utf-8")
- else:
- msg = "\n".encode("utf-8")
- else:
- msg = '\n'.encode('utf-8')
+ if l == "END":
+ break
- self.writer.write(msg)
+ msg = await handler(l)
+ await self.socket.send(msg)
finally:
request_measure.end()
self.request_sample.end()
- await self.writer.drain()
+ await self.socket.send("ok")
+ return self.NO_RESPONSE
- # Post to the backfill queue after writing the result to minimize
- # the turn around time on a request
- if upstream is not None:
- await self.backfill_queue.put((method, taskhash))
+ @permissions(READ_PERM)
+ async def handle_get_stream(self, request):
+ async def handler(l):
+ (method, taskhash) = l.split()
+ # self.logger.debug('Looking up %s %s' % (method, taskhash))
+ row = await self.db.get_equivalent(method, taskhash)
- async def handle_report(self, data):
- with closing(self.db.cursor()) as cursor:
- outhash_data = {
- 'method': data['method'],
- 'outhash': data['outhash'],
- 'taskhash': data['taskhash'],
- 'created': datetime.now()
- }
+ if row is not None:
+ # self.logger.debug('Found equivalent task %s -> %s', (row['taskhash'], row['unihash']))
+ return row["unihash"]
- for k in ('owner', 'PN', 'PV', 'PR', 'task', 'outhash_siginfo'):
- if k in data:
- outhash_data[k] = data[k]
-
- # Insert the new entry, unless it already exists
- (rowid, inserted) = insert_outhash(cursor, outhash_data, Resolve.IGNORE)
-
- if inserted:
- # If this row is new, check if it is equivalent to another
- # output hash
- cursor.execute(
- '''
- SELECT outhashes_v2.taskhash AS taskhash, unihashes_v2.unihash AS unihash FROM outhashes_v2
- INNER JOIN unihashes_v2 ON unihashes_v2.method=outhashes_v2.method AND unihashes_v2.taskhash=outhashes_v2.taskhash
- -- Select any matching output hash except the one we just inserted
- WHERE outhashes_v2.method=:method AND outhashes_v2.outhash=:outhash AND outhashes_v2.taskhash!=:taskhash
- -- Pick the oldest hash
- ORDER BY outhashes_v2.created ASC
- LIMIT 1
- ''',
- {
- 'method': data['method'],
- 'outhash': data['outhash'],
- 'taskhash': data['taskhash'],
- }
- )
- row = cursor.fetchone()
+ if self.upstream_client is not None:
+ upstream = await self.upstream_client.get_unihash(method, taskhash)
+ if upstream:
+ await self.server.backfill_queue.put((method, taskhash))
+ return upstream
- if row is not None:
- # A matching output hash was found. Set our taskhash to the
- # same unihash since they are equivalent
- unihash = row['unihash']
- resolve = Resolve.IGNORE
- else:
- # No matching output hash was found. This is probably the
- # first outhash to be added.
- unihash = data['unihash']
- resolve = Resolve.IGNORE
-
- # Query upstream to see if it has a unihash we can use
- if self.upstream_client is not None:
- upstream_data = await self.upstream_client.get_outhash(data['method'], data['outhash'], data['taskhash'])
- if upstream_data is not None:
- unihash = upstream_data['unihash']
-
-
- insert_unihash(
- cursor,
- {
- 'method': data['method'],
- 'taskhash': data['taskhash'],
- 'unihash': unihash,
- },
- resolve
- )
+ return ""
- unihash_data = await self.get_unihash(cursor, data['method'], data['taskhash'])
- if unihash_data is not None:
- unihash = unihash_data['unihash']
- else:
- unihash = data['unihash']
+ return await self._stream_handler(handler)
- self.db.commit()
+ @permissions(READ_PERM)
+ async def handle_exists_stream(self, request):
+ async def handler(l):
+ if await self.db.unihash_exists(l):
+ return "true"
- d = {
- 'taskhash': data['taskhash'],
- 'method': data['method'],
- 'unihash': unihash,
- }
+ if self.upstream_client is not None:
+ if await self.upstream_client.unihash_exists(l):
+ return "true"
- self.write_message(d)
+ return "false"
- async def handle_equivreport(self, data):
- with closing(self.db.cursor()) as cursor:
- insert_data = {
- 'method': data['method'],
- 'taskhash': data['taskhash'],
- 'unihash': data['unihash'],
- }
- insert_unihash(cursor, insert_data, Resolve.IGNORE)
- self.db.commit()
+ return await self._stream_handler(handler)
- # Fetch the unihash that will be reported for the taskhash. If the
- # unihash matches, it means this row was inserted (or the mapping
- # was already valid)
- row = self.query_equivalent(cursor, data['method'], data['taskhash'])
+ async def report_readonly(self, data):
+ method = data["method"]
+ outhash = data["outhash"]
+ taskhash = data["taskhash"]
- if row['unihash'] == data['unihash']:
- logger.info('Adding taskhash equivalence for %s with unihash %s',
- data['taskhash'], row['unihash'])
+ info = await self.get_outhash(method, outhash, taskhash)
+ if info:
+ unihash = info["unihash"]
+ else:
+ unihash = data["unihash"]
- d = {k: row[k] for k in ('taskhash', 'method', 'unihash')}
+ return {
+ "taskhash": taskhash,
+ "method": method,
+ "unihash": unihash,
+ }
- self.write_message(d)
+ # Since this can be called either read only or to report, the check to
+ # report is made inside the function
+ @permissions(READ_PERM)
+ async def handle_report(self, data):
+ if self.server.read_only or not self.user_has_permissions(REPORT_PERM):
+ return await self.report_readonly(data)
+
+ outhash_data = {
+ "method": data["method"],
+ "outhash": data["outhash"],
+ "taskhash": data["taskhash"],
+ "created": datetime.now(),
+ }
+ for k in ("owner", "PN", "PV", "PR", "task", "outhash_siginfo"):
+ if k in data:
+ outhash_data[k] = data[k]
- async def handle_get_stats(self, request):
- d = {
- 'requests': self.request_stats.todict(),
+ if self.user:
+ outhash_data["owner"] = self.user.username
+
+ # Insert the new entry, unless it already exists
+ if await self.db.insert_outhash(outhash_data):
+ # If this row is new, check if it is equivalent to another
+ # output hash
+ row = await self.db.get_equivalent_for_outhash(
+ data["method"], data["outhash"], data["taskhash"]
+ )
+
+ if row is not None:
+ # A matching output hash was found. Set our taskhash to the
+ # same unihash since they are equivalent
+ unihash = row["unihash"]
+ else:
+ # No matching output hash was found. This is probably the
+ # first outhash to be added.
+ unihash = data["unihash"]
+
+ # Query upstream to see if it has a unihash we can use
+ if self.upstream_client is not None:
+ upstream_data = await self.upstream_client.get_outhash(
+ data["method"], data["outhash"], data["taskhash"]
+ )
+ if upstream_data is not None:
+ unihash = upstream_data["unihash"]
+
+ await self.db.insert_unihash(data["method"], data["taskhash"], unihash)
+
+ unihash_data = await self.get_unihash(data["method"], data["taskhash"])
+ if unihash_data is not None:
+ unihash = unihash_data["unihash"]
+ else:
+ unihash = data["unihash"]
+
+ return {
+ "taskhash": data["taskhash"],
+ "method": data["method"],
+ "unihash": unihash,
}
- self.write_message(d)
+ @permissions(READ_PERM, REPORT_PERM)
+ async def handle_equivreport(self, data):
+ await self.db.insert_unihash(data["method"], data["taskhash"], data["unihash"])
+
+ # Fetch the unihash that will be reported for the taskhash. If the
+ # unihash matches, it means this row was inserted (or the mapping
+ # was already valid)
+ row = await self.db.get_equivalent(data["method"], data["taskhash"])
+
+ if row["unihash"] == data["unihash"]:
+ self.logger.info(
+ "Adding taskhash equivalence for %s with unihash %s",
+ data["taskhash"],
+ row["unihash"],
+ )
+ return {k: row[k] for k in ("taskhash", "method", "unihash")}
+
+ @permissions(READ_PERM)
+ async def handle_get_stats(self, request):
+ return {
+ "requests": self.server.request_stats.todict(),
+ }
+
+ @permissions(DB_ADMIN_PERM)
async def handle_reset_stats(self, request):
d = {
- 'requests': self.request_stats.todict(),
+ "requests": self.server.request_stats.todict(),
}
- self.request_stats.reset()
- self.write_message(d)
+ self.server.request_stats.reset()
+ return d
+ @permissions(READ_PERM)
async def handle_backfill_wait(self, request):
d = {
- 'tasks': self.backfill_queue.qsize(),
+ "tasks": self.server.backfill_queue.qsize(),
}
- await self.backfill_queue.join()
- self.write_message(d)
+ await self.server.backfill_queue.join()
+ return d
- def query_equivalent(self, cursor, method, taskhash):
- # This is part of the inner loop and must be as fast as possible
- cursor.execute(
- 'SELECT taskhash, method, unihash FROM unihashes_v2 WHERE method=:method AND taskhash=:taskhash',
- {
- 'method': method,
- 'taskhash': taskhash,
- }
+ @permissions(DB_ADMIN_PERM)
+ async def handle_remove(self, request):
+ condition = request["where"]
+ if not isinstance(condition, dict):
+ raise TypeError("Bad condition type %s" % type(condition))
+
+ return {"count": await self.db.remove(condition)}
+
+ @permissions(DB_ADMIN_PERM)
+ async def handle_gc_mark(self, request):
+ condition = request["where"]
+ mark = request["mark"]
+
+ if not isinstance(condition, dict):
+ raise TypeError("Bad condition type %s" % type(condition))
+
+ if not isinstance(mark, str):
+ raise TypeError("Bad mark type %s" % type(mark))
+
+ return {"count": await self.db.gc_mark(mark, condition)}
+
+ @permissions(DB_ADMIN_PERM)
+ async def handle_gc_sweep(self, request):
+ mark = request["mark"]
+
+ if not isinstance(mark, str):
+ raise TypeError("Bad mark type %s" % type(mark))
+
+ current_mark = await self.db.get_current_gc_mark()
+
+ if not current_mark or mark != current_mark:
+ raise bb.asyncrpc.InvokeError(
+ f"'{mark}' is not the current mark. Refusing to sweep"
+ )
+
+ count = await self.db.gc_sweep()
+
+ return {"count": count}
+
+ @permissions(DB_ADMIN_PERM)
+ async def handle_gc_status(self, request):
+ (keep_rows, remove_rows, current_mark) = await self.db.gc_status()
+ return {
+ "keep": keep_rows,
+ "remove": remove_rows,
+ "mark": current_mark,
+ }
+
+ @permissions(DB_ADMIN_PERM)
+ async def handle_clean_unused(self, request):
+ max_age = request["max_age_seconds"]
+ oldest = datetime.now() - timedelta(seconds=-max_age)
+ return {"count": await self.db.clean_unused(oldest)}
+
+ @permissions(DB_ADMIN_PERM)
+ async def handle_get_db_usage(self, request):
+ return {"usage": await self.db.get_usage()}
+
+ @permissions(DB_ADMIN_PERM)
+ async def handle_get_db_query_columns(self, request):
+ return {"columns": await self.db.get_query_columns()}
+
+ # The authentication API is always allowed
+ async def handle_auth(self, request):
+ username = str(request["username"])
+ token = str(request["token"])
+
+ async def fail_auth():
+ nonlocal username
+ # Rate limit bad login attempts
+ await asyncio.sleep(1)
+ raise bb.asyncrpc.InvokeError(f"Unable to authenticate as {username}")
+
+ user, db_token = await self.db.lookup_user_token(username)
+
+ if not user or not db_token:
+ await fail_auth()
+
+ try:
+ algo, salt, _ = db_token.split(":")
+ except ValueError:
+ await fail_auth()
+
+ if hash_token(algo, salt, token) != db_token:
+ await fail_auth()
+
+ self.user = user
+
+ self.logger.info("Authenticated as %s", username)
+
+ return {
+ "result": True,
+ "username": self.user.username,
+ "permissions": sorted(list(self.user.permissions)),
+ }
+
+ @permissions(USER_ADMIN_PERM, allow_self_service=True, allow_anon=False)
+ async def handle_refresh_token(self, request):
+ username = str(request["username"])
+
+ token = await new_token()
+
+ updated = await self.db.set_user_token(
+ username,
+ hash_token(TOKEN_ALGORITHM, new_salt(), token),
)
- return cursor.fetchone()
+ if not updated:
+ self.raise_no_user_error(username)
+
+ return {"username": username, "token": token}
+
+ def get_perm_arg(self, arg):
+ if not isinstance(arg, list):
+ raise bb.asyncrpc.InvokeError("Unexpected type for permissions")
+
+ arg = set(arg)
+ try:
+ arg.remove(NONE_PERM)
+ except KeyError:
+ pass
+
+ unknown_perms = arg - ALL_PERMISSIONS
+ if unknown_perms:
+ raise bb.asyncrpc.InvokeError(
+ "Unknown permissions %s" % ", ".join(sorted(list(unknown_perms)))
+ )
+
+ return sorted(list(arg))
+
+ def return_perms(self, permissions):
+ if ALL_PERM in permissions:
+ return sorted(list(ALL_PERMISSIONS))
+ return sorted(list(permissions))
+
+ @permissions(USER_ADMIN_PERM, allow_anon=False)
+ async def handle_set_perms(self, request):
+ username = str(request["username"])
+ permissions = self.get_perm_arg(request["permissions"])
+
+ if not await self.db.set_user_perms(username, permissions):
+ self.raise_no_user_error(username)
+
+ return {
+ "username": username,
+ "permissions": self.return_perms(permissions),
+ }
+
+ @permissions(USER_ADMIN_PERM, allow_self_service=True, allow_anon=False)
+ async def handle_get_user(self, request):
+ username = str(request["username"])
+
+ user = await self.db.lookup_user(username)
+ if user is None:
+ return None
+
+ return {
+ "username": user.username,
+ "permissions": self.return_perms(user.permissions),
+ }
+
+ @permissions(USER_ADMIN_PERM, allow_anon=False)
+ async def handle_get_all_users(self, request):
+ users = await self.db.get_all_users()
+ return {
+ "users": [
+ {
+ "username": u.username,
+ "permissions": self.return_perms(u.permissions),
+ }
+ for u in users
+ ]
+ }
+
+ @permissions(USER_ADMIN_PERM, allow_anon=False)
+ async def handle_new_user(self, request):
+ username = str(request["username"])
+ permissions = self.get_perm_arg(request["permissions"])
+
+ token = await new_token()
+
+ inserted = await self.db.new_user(
+ username,
+ permissions,
+ hash_token(TOKEN_ALGORITHM, new_salt(), token),
+ )
+ if not inserted:
+ raise bb.asyncrpc.InvokeError(f"Cannot create new user '{username}'")
+
+ return {
+ "username": username,
+ "permissions": self.return_perms(permissions),
+ "token": token,
+ }
+
+ @permissions(USER_ADMIN_PERM, allow_self_service=True, allow_anon=False)
+ async def handle_delete_user(self, request):
+ username = str(request["username"])
+
+ if not await self.db.delete_user(username):
+ self.raise_no_user_error(username)
+
+ return {"username": username}
+
+ @permissions(USER_ADMIN_PERM, allow_anon=False)
+ async def handle_become_user(self, request):
+ username = str(request["username"])
+
+ user = await self.db.lookup_user(username)
+ if user is None:
+ raise bb.asyncrpc.InvokeError(f"User {username} doesn't exist")
+
+ self.user = user
+
+ self.logger.info("Became user %s", username)
+
+ return {
+ "username": self.user.username,
+ "permissions": self.return_perms(self.user.permissions),
+ }
class Server(bb.asyncrpc.AsyncServer):
- def __init__(self, db, upstream=None, read_only=False):
+ def __init__(
+ self,
+ db_engine,
+ upstream=None,
+ read_only=False,
+ anon_perms=DEFAULT_ANON_PERMS,
+ admin_username=None,
+ admin_password=None,
+ ):
if upstream and read_only:
- raise bb.asyncrpc.ServerError("Read-only hashserv cannot pull from an upstream server")
+ raise bb.asyncrpc.ServerError(
+ "Read-only hashserv cannot pull from an upstream server"
+ )
+
+ disallowed_perms = set(anon_perms) - set(
+ [NONE_PERM, READ_PERM, REPORT_PERM, DB_ADMIN_PERM]
+ )
+
+ if disallowed_perms:
+ raise bb.asyncrpc.ServerError(
+ f"Permission(s) {' '.join(disallowed_perms)} are not allowed for anonymous users"
+ )
super().__init__(logger)
self.request_stats = Stats()
- self.db = db
+ self.db_engine = db_engine
self.upstream = upstream
self.read_only = read_only
+ self.backfill_queue = None
+ self.anon_perms = set(anon_perms)
+ self.admin_username = admin_username
+ self.admin_password = admin_password
- def accept_client(self, reader, writer):
- return ServerClient(reader, writer, self.db, self.request_stats, self.backfill_queue, self.upstream, self.read_only)
+ self.logger.info(
+ "Anonymous user permissions are: %s", ", ".join(self.anon_perms)
+ )
- @contextmanager
- def _backfill_worker(self):
- async def backfill_worker_task():
- client = await create_async_client(self.upstream)
- try:
- while True:
- item = await self.backfill_queue.get()
- if item is None:
- self.backfill_queue.task_done()
- break
- method, taskhash = item
- await copy_unihash_from_upstream(client, self.db, method, taskhash)
+ def accept_client(self, socket):
+ return ServerClient(socket, self)
+
+ async def create_admin_user(self):
+ admin_permissions = (ALL_PERM,)
+ async with self.db_engine.connect(self.logger) as db:
+ added = await db.new_user(
+ self.admin_username,
+ admin_permissions,
+ hash_token(TOKEN_ALGORITHM, new_salt(), self.admin_password),
+ )
+ if added:
+ self.logger.info("Created admin user '%s'", self.admin_username)
+ else:
+ await db.set_user_perms(
+ self.admin_username,
+ admin_permissions,
+ )
+ await db.set_user_token(
+ self.admin_username,
+ hash_token(TOKEN_ALGORITHM, new_salt(), self.admin_password),
+ )
+ self.logger.info("Admin user '%s' updated", self.admin_username)
+
+ async def backfill_worker_task(self):
+ async with await create_async_client(
+ self.upstream
+ ) as client, self.db_engine.connect(self.logger) as db:
+ while True:
+ item = await self.backfill_queue.get()
+ if item is None:
self.backfill_queue.task_done()
- finally:
- await client.close()
+ break
- async def join_worker(worker):
- await self.backfill_queue.put(None)
- await worker
+ method, taskhash = item
+ d = await client.get_taskhash(method, taskhash)
+ if d is not None:
+ await db.insert_unihash(d["method"], d["taskhash"], d["unihash"])
+ self.backfill_queue.task_done()
- if self.upstream is not None:
- worker = asyncio.ensure_future(backfill_worker_task())
- try:
- yield
- finally:
- self.loop.run_until_complete(join_worker(worker))
- else:
- yield
+ def start(self):
+ tasks = super().start()
+ if self.upstream:
+ self.backfill_queue = asyncio.Queue()
+ tasks += [self.backfill_worker_task()]
+
+ self.loop.run_until_complete(self.db_engine.create())
- def run_loop_forever(self):
- self.backfill_queue = asyncio.Queue()
+ if self.admin_username:
+ self.loop.run_until_complete(self.create_admin_user())
- with self._backfill_worker():
- super().run_loop_forever()
+ return tasks
+
+ async def stop(self):
+ if self.backfill_queue is not None:
+ await self.backfill_queue.put(None)
+ await super().stop()
diff --git a/bitbake/lib/hashserv/sqlalchemy.py b/bitbake/lib/hashserv/sqlalchemy.py
new file mode 100644
index 0000000000..f7b0226a7a
--- /dev/null
+++ b/bitbake/lib/hashserv/sqlalchemy.py
@@ -0,0 +1,598 @@
+#! /usr/bin/env python3
+#
+# Copyright (C) 2023 Garmin Ltd.
+#
+# SPDX-License-Identifier: GPL-2.0-only
+#
+
+import logging
+from datetime import datetime
+from . import User
+
+from sqlalchemy.ext.asyncio import create_async_engine
+from sqlalchemy.pool import NullPool
+from sqlalchemy import (
+ MetaData,
+ Column,
+ Table,
+ Text,
+ Integer,
+ UniqueConstraint,
+ DateTime,
+ Index,
+ select,
+ insert,
+ exists,
+ literal,
+ and_,
+ delete,
+ update,
+ func,
+ inspect,
+)
+import sqlalchemy.engine
+from sqlalchemy.orm import declarative_base
+from sqlalchemy.exc import IntegrityError
+from sqlalchemy.dialects.postgresql import insert as postgres_insert
+
+Base = declarative_base()
+
+
+class UnihashesV3(Base):
+ __tablename__ = "unihashes_v3"
+ id = Column(Integer, primary_key=True, autoincrement=True)
+ method = Column(Text, nullable=False)
+ taskhash = Column(Text, nullable=False)
+ unihash = Column(Text, nullable=False)
+ gc_mark = Column(Text, nullable=False)
+
+ __table_args__ = (
+ UniqueConstraint("method", "taskhash"),
+ Index("taskhash_lookup_v4", "method", "taskhash"),
+ Index("unihash_lookup_v1", "unihash"),
+ )
+
+
+class OuthashesV2(Base):
+ __tablename__ = "outhashes_v2"
+ id = Column(Integer, primary_key=True, autoincrement=True)
+ method = Column(Text, nullable=False)
+ taskhash = Column(Text, nullable=False)
+ outhash = Column(Text, nullable=False)
+ created = Column(DateTime)
+ owner = Column(Text)
+ PN = Column(Text)
+ PV = Column(Text)
+ PR = Column(Text)
+ task = Column(Text)
+ outhash_siginfo = Column(Text)
+
+ __table_args__ = (
+ UniqueConstraint("method", "taskhash", "outhash"),
+ Index("outhash_lookup_v3", "method", "outhash"),
+ )
+
+
+class Users(Base):
+ __tablename__ = "users"
+ id = Column(Integer, primary_key=True, autoincrement=True)
+ username = Column(Text, nullable=False)
+ token = Column(Text, nullable=False)
+ permissions = Column(Text)
+
+ __table_args__ = (UniqueConstraint("username"),)
+
+
+class Config(Base):
+ __tablename__ = "config"
+ id = Column(Integer, primary_key=True, autoincrement=True)
+ name = Column(Text, nullable=False)
+ value = Column(Text)
+ __table_args__ = (
+ UniqueConstraint("name"),
+ Index("config_lookup", "name"),
+ )
+
+
+#
+# Old table versions
+#
+DeprecatedBase = declarative_base()
+
+
+class UnihashesV2(DeprecatedBase):
+ __tablename__ = "unihashes_v2"
+ id = Column(Integer, primary_key=True, autoincrement=True)
+ method = Column(Text, nullable=False)
+ taskhash = Column(Text, nullable=False)
+ unihash = Column(Text, nullable=False)
+
+ __table_args__ = (
+ UniqueConstraint("method", "taskhash"),
+ Index("taskhash_lookup_v3", "method", "taskhash"),
+ )
+
+
+class DatabaseEngine(object):
+ def __init__(self, url, username=None, password=None):
+ self.logger = logging.getLogger("hashserv.sqlalchemy")
+ self.url = sqlalchemy.engine.make_url(url)
+
+ if username is not None:
+ self.url = self.url.set(username=username)
+
+ if password is not None:
+ self.url = self.url.set(password=password)
+
+ async def create(self):
+ def check_table_exists(conn, name):
+ return inspect(conn).has_table(name)
+
+ self.logger.info("Using database %s", self.url)
+ if self.url.drivername == 'postgresql+psycopg':
+ # Psygopg 3 (psygopg) driver can handle async connection pooling
+ self.engine = create_async_engine(self.url, max_overflow=-1)
+ else:
+ self.engine = create_async_engine(self.url, poolclass=NullPool)
+
+ async with self.engine.begin() as conn:
+ # Create tables
+ self.logger.info("Creating tables...")
+ await conn.run_sync(Base.metadata.create_all)
+
+ if await conn.run_sync(check_table_exists, UnihashesV2.__tablename__):
+ self.logger.info("Upgrading Unihashes V2 -> V3...")
+ statement = insert(UnihashesV3).from_select(
+ ["id", "method", "unihash", "taskhash", "gc_mark"],
+ select(
+ UnihashesV2.id,
+ UnihashesV2.method,
+ UnihashesV2.unihash,
+ UnihashesV2.taskhash,
+ literal("").label("gc_mark"),
+ ),
+ )
+ self.logger.debug("%s", statement)
+ await conn.execute(statement)
+
+ await conn.run_sync(Base.metadata.drop_all, [UnihashesV2.__table__])
+ self.logger.info("Upgrade complete")
+
+ def connect(self, logger):
+ return Database(self.engine, logger)
+
+
+def map_row(row):
+ if row is None:
+ return None
+ return dict(**row._mapping)
+
+
+def map_user(row):
+ if row is None:
+ return None
+ return User(
+ username=row.username,
+ permissions=set(row.permissions.split()),
+ )
+
+
+def _make_condition_statement(table, condition):
+ where = {}
+ for c in table.__table__.columns:
+ if c.key in condition and condition[c.key] is not None:
+ where[c] = condition[c.key]
+
+ return [(k == v) for k, v in where.items()]
+
+
+class Database(object):
+ def __init__(self, engine, logger):
+ self.engine = engine
+ self.db = None
+ self.logger = logger
+
+ async def __aenter__(self):
+ self.db = await self.engine.connect()
+ return self
+
+ async def __aexit__(self, exc_type, exc_value, traceback):
+ await self.close()
+
+ async def close(self):
+ await self.db.close()
+ self.db = None
+
+ async def _execute(self, statement):
+ self.logger.debug("%s", statement)
+ return await self.db.execute(statement)
+
+ async def _set_config(self, name, value):
+ while True:
+ result = await self._execute(
+ update(Config).where(Config.name == name).values(value=value)
+ )
+
+ if result.rowcount == 0:
+ self.logger.debug("Config '%s' not found. Adding it", name)
+ try:
+ await self._execute(insert(Config).values(name=name, value=value))
+ except IntegrityError:
+ # Race. Try again
+ continue
+
+ break
+
+ def _get_config_subquery(self, name, default=None):
+ if default is not None:
+ return func.coalesce(
+ select(Config.value).where(Config.name == name).scalar_subquery(),
+ default,
+ )
+ return select(Config.value).where(Config.name == name).scalar_subquery()
+
+ async def _get_config(self, name):
+ result = await self._execute(select(Config.value).where(Config.name == name))
+ row = result.first()
+ if row is None:
+ return None
+ return row.value
+
+ async def get_unihash_by_taskhash_full(self, method, taskhash):
+ async with self.db.begin():
+ result = await self._execute(
+ select(
+ OuthashesV2,
+ UnihashesV3.unihash.label("unihash"),
+ )
+ .join(
+ UnihashesV3,
+ and_(
+ UnihashesV3.method == OuthashesV2.method,
+ UnihashesV3.taskhash == OuthashesV2.taskhash,
+ ),
+ )
+ .where(
+ OuthashesV2.method == method,
+ OuthashesV2.taskhash == taskhash,
+ )
+ .order_by(
+ OuthashesV2.created.asc(),
+ )
+ .limit(1)
+ )
+ return map_row(result.first())
+
+ async def get_unihash_by_outhash(self, method, outhash):
+ async with self.db.begin():
+ result = await self._execute(
+ select(OuthashesV2, UnihashesV3.unihash.label("unihash"))
+ .join(
+ UnihashesV3,
+ and_(
+ UnihashesV3.method == OuthashesV2.method,
+ UnihashesV3.taskhash == OuthashesV2.taskhash,
+ ),
+ )
+ .where(
+ OuthashesV2.method == method,
+ OuthashesV2.outhash == outhash,
+ )
+ .order_by(
+ OuthashesV2.created.asc(),
+ )
+ .limit(1)
+ )
+ return map_row(result.first())
+
+ async def unihash_exists(self, unihash):
+ async with self.db.begin():
+ result = await self._execute(
+ select(UnihashesV3).where(UnihashesV3.unihash == unihash).limit(1)
+ )
+
+ return result.first() is not None
+
+ async def get_outhash(self, method, outhash):
+ async with self.db.begin():
+ result = await self._execute(
+ select(OuthashesV2)
+ .where(
+ OuthashesV2.method == method,
+ OuthashesV2.outhash == outhash,
+ )
+ .order_by(
+ OuthashesV2.created.asc(),
+ )
+ .limit(1)
+ )
+ return map_row(result.first())
+
+ async def get_equivalent_for_outhash(self, method, outhash, taskhash):
+ async with self.db.begin():
+ result = await self._execute(
+ select(
+ OuthashesV2.taskhash.label("taskhash"),
+ UnihashesV3.unihash.label("unihash"),
+ )
+ .join(
+ UnihashesV3,
+ and_(
+ UnihashesV3.method == OuthashesV2.method,
+ UnihashesV3.taskhash == OuthashesV2.taskhash,
+ ),
+ )
+ .where(
+ OuthashesV2.method == method,
+ OuthashesV2.outhash == outhash,
+ OuthashesV2.taskhash != taskhash,
+ )
+ .order_by(
+ OuthashesV2.created.asc(),
+ )
+ .limit(1)
+ )
+ return map_row(result.first())
+
+ async def get_equivalent(self, method, taskhash):
+ async with self.db.begin():
+ result = await self._execute(
+ select(
+ UnihashesV3.unihash,
+ UnihashesV3.method,
+ UnihashesV3.taskhash,
+ ).where(
+ UnihashesV3.method == method,
+ UnihashesV3.taskhash == taskhash,
+ )
+ )
+ return map_row(result.first())
+
+ async def remove(self, condition):
+ async def do_remove(table):
+ where = _make_condition_statement(table, condition)
+ if where:
+ async with self.db.begin():
+ result = await self._execute(delete(table).where(*where))
+ return result.rowcount
+
+ return 0
+
+ count = 0
+ count += await do_remove(UnihashesV3)
+ count += await do_remove(OuthashesV2)
+
+ return count
+
+ async def get_current_gc_mark(self):
+ async with self.db.begin():
+ return await self._get_config("gc-mark")
+
+ async def gc_status(self):
+ async with self.db.begin():
+ gc_mark_subquery = self._get_config_subquery("gc-mark", "")
+
+ result = await self._execute(
+ select(func.count())
+ .select_from(UnihashesV3)
+ .where(UnihashesV3.gc_mark == gc_mark_subquery)
+ )
+ keep_rows = result.scalar()
+
+ result = await self._execute(
+ select(func.count())
+ .select_from(UnihashesV3)
+ .where(UnihashesV3.gc_mark != gc_mark_subquery)
+ )
+ remove_rows = result.scalar()
+
+ return (keep_rows, remove_rows, await self._get_config("gc-mark"))
+
+ async def gc_mark(self, mark, condition):
+ async with self.db.begin():
+ await self._set_config("gc-mark", mark)
+
+ where = _make_condition_statement(UnihashesV3, condition)
+ if not where:
+ return 0
+
+ result = await self._execute(
+ update(UnihashesV3)
+ .values(gc_mark=self._get_config_subquery("gc-mark", ""))
+ .where(*where)
+ )
+ return result.rowcount
+
+ async def gc_sweep(self):
+ async with self.db.begin():
+ result = await self._execute(
+ delete(UnihashesV3).where(
+ # A sneaky conditional that provides some errant use
+ # protection: If the config mark is NULL, this will not
+ # match any rows because No default is specified in the
+ # select statement
+ UnihashesV3.gc_mark
+ != self._get_config_subquery("gc-mark")
+ )
+ )
+ await self._set_config("gc-mark", None)
+
+ return result.rowcount
+
+ async def clean_unused(self, oldest):
+ async with self.db.begin():
+ result = await self._execute(
+ delete(OuthashesV2).where(
+ OuthashesV2.created < oldest,
+ ~(
+ select(UnihashesV3.id)
+ .where(
+ UnihashesV3.method == OuthashesV2.method,
+ UnihashesV3.taskhash == OuthashesV2.taskhash,
+ )
+ .limit(1)
+ .exists()
+ ),
+ )
+ )
+ return result.rowcount
+
+ async def insert_unihash(self, method, taskhash, unihash):
+ # Postgres specific ignore on insert duplicate
+ if self.engine.name == "postgresql":
+ statement = (
+ postgres_insert(UnihashesV3)
+ .values(
+ method=method,
+ taskhash=taskhash,
+ unihash=unihash,
+ gc_mark=self._get_config_subquery("gc-mark", ""),
+ )
+ .on_conflict_do_nothing(index_elements=("method", "taskhash"))
+ )
+ else:
+ statement = insert(UnihashesV3).values(
+ method=method,
+ taskhash=taskhash,
+ unihash=unihash,
+ gc_mark=self._get_config_subquery("gc-mark", ""),
+ )
+
+ try:
+ async with self.db.begin():
+ result = await self._execute(statement)
+ return result.rowcount != 0
+ except IntegrityError:
+ self.logger.debug(
+ "%s, %s, %s already in unihash database", method, taskhash, unihash
+ )
+ return False
+
+ async def insert_outhash(self, data):
+ outhash_columns = set(c.key for c in OuthashesV2.__table__.columns)
+
+ data = {k: v for k, v in data.items() if k in outhash_columns}
+
+ if "created" in data and not isinstance(data["created"], datetime):
+ data["created"] = datetime.fromisoformat(data["created"])
+
+ # Postgres specific ignore on insert duplicate
+ if self.engine.name == "postgresql":
+ statement = (
+ postgres_insert(OuthashesV2)
+ .values(**data)
+ .on_conflict_do_nothing(
+ index_elements=("method", "taskhash", "outhash")
+ )
+ )
+ else:
+ statement = insert(OuthashesV2).values(**data)
+
+ try:
+ async with self.db.begin():
+ result = await self._execute(statement)
+ return result.rowcount != 0
+ except IntegrityError:
+ self.logger.debug(
+ "%s, %s already in outhash database", data["method"], data["outhash"]
+ )
+ return False
+
+ async def _get_user(self, username):
+ async with self.db.begin():
+ result = await self._execute(
+ select(
+ Users.username,
+ Users.permissions,
+ Users.token,
+ ).where(
+ Users.username == username,
+ )
+ )
+ return result.first()
+
+ async def lookup_user_token(self, username):
+ row = await self._get_user(username)
+ if not row:
+ return None, None
+ return map_user(row), row.token
+
+ async def lookup_user(self, username):
+ return map_user(await self._get_user(username))
+
+ async def set_user_token(self, username, token):
+ async with self.db.begin():
+ result = await self._execute(
+ update(Users)
+ .where(
+ Users.username == username,
+ )
+ .values(
+ token=token,
+ )
+ )
+ return result.rowcount != 0
+
+ async def set_user_perms(self, username, permissions):
+ async with self.db.begin():
+ result = await self._execute(
+ update(Users)
+ .where(Users.username == username)
+ .values(permissions=" ".join(permissions))
+ )
+ return result.rowcount != 0
+
+ async def get_all_users(self):
+ async with self.db.begin():
+ result = await self._execute(
+ select(
+ Users.username,
+ Users.permissions,
+ )
+ )
+ return [map_user(row) for row in result]
+
+ async def new_user(self, username, permissions, token):
+ try:
+ async with self.db.begin():
+ await self._execute(
+ insert(Users).values(
+ username=username,
+ permissions=" ".join(permissions),
+ token=token,
+ )
+ )
+ return True
+ except IntegrityError as e:
+ self.logger.debug("Cannot create new user %s: %s", username, e)
+ return False
+
+ async def delete_user(self, username):
+ async with self.db.begin():
+ result = await self._execute(
+ delete(Users).where(Users.username == username)
+ )
+ return result.rowcount != 0
+
+ async def get_usage(self):
+ usage = {}
+ async with self.db.begin() as session:
+ for name, table in Base.metadata.tables.items():
+ result = await self._execute(
+ statement=select(func.count()).select_from(table)
+ )
+ usage[name] = {
+ "rows": result.scalar(),
+ }
+
+ return usage
+
+ async def get_query_columns(self):
+ columns = set()
+ for table in (UnihashesV3, OuthashesV2):
+ for c in table.__table__.columns:
+ if not isinstance(c.type, Text):
+ continue
+ columns.add(c.key)
+
+ return list(columns)
diff --git a/bitbake/lib/hashserv/sqlite.py b/bitbake/lib/hashserv/sqlite.py
new file mode 100644
index 0000000000..da2e844a03
--- /dev/null
+++ b/bitbake/lib/hashserv/sqlite.py
@@ -0,0 +1,562 @@
+#! /usr/bin/env python3
+#
+# Copyright (C) 2023 Garmin Ltd.
+#
+# SPDX-License-Identifier: GPL-2.0-only
+#
+import sqlite3
+import logging
+from contextlib import closing
+from . import User
+
+logger = logging.getLogger("hashserv.sqlite")
+
+UNIHASH_TABLE_DEFINITION = (
+ ("method", "TEXT NOT NULL", "UNIQUE"),
+ ("taskhash", "TEXT NOT NULL", "UNIQUE"),
+ ("unihash", "TEXT NOT NULL", ""),
+ ("gc_mark", "TEXT NOT NULL", ""),
+)
+
+UNIHASH_TABLE_COLUMNS = tuple(name for name, _, _ in UNIHASH_TABLE_DEFINITION)
+
+OUTHASH_TABLE_DEFINITION = (
+ ("method", "TEXT NOT NULL", "UNIQUE"),
+ ("taskhash", "TEXT NOT NULL", "UNIQUE"),
+ ("outhash", "TEXT NOT NULL", "UNIQUE"),
+ ("created", "DATETIME", ""),
+ # Optional fields
+ ("owner", "TEXT", ""),
+ ("PN", "TEXT", ""),
+ ("PV", "TEXT", ""),
+ ("PR", "TEXT", ""),
+ ("task", "TEXT", ""),
+ ("outhash_siginfo", "TEXT", ""),
+)
+
+OUTHASH_TABLE_COLUMNS = tuple(name for name, _, _ in OUTHASH_TABLE_DEFINITION)
+
+USERS_TABLE_DEFINITION = (
+ ("username", "TEXT NOT NULL", "UNIQUE"),
+ ("token", "TEXT NOT NULL", ""),
+ ("permissions", "TEXT NOT NULL", ""),
+)
+
+USERS_TABLE_COLUMNS = tuple(name for name, _, _ in USERS_TABLE_DEFINITION)
+
+
+CONFIG_TABLE_DEFINITION = (
+ ("name", "TEXT NOT NULL", "UNIQUE"),
+ ("value", "TEXT", ""),
+)
+
+CONFIG_TABLE_COLUMNS = tuple(name for name, _, _ in CONFIG_TABLE_DEFINITION)
+
+
+def _make_table(cursor, name, definition):
+ cursor.execute(
+ """
+ CREATE TABLE IF NOT EXISTS {name} (
+ id INTEGER PRIMARY KEY AUTOINCREMENT,
+ {fields}
+ UNIQUE({unique})
+ )
+ """.format(
+ name=name,
+ fields=" ".join("%s %s," % (name, typ) for name, typ, _ in definition),
+ unique=", ".join(
+ name for name, _, flags in definition if "UNIQUE" in flags
+ ),
+ )
+ )
+
+
+def map_user(row):
+ if row is None:
+ return None
+ return User(
+ username=row["username"],
+ permissions=set(row["permissions"].split()),
+ )
+
+
+def _make_condition_statement(columns, condition):
+ where = {}
+ for c in columns:
+ if c in condition and condition[c] is not None:
+ where[c] = condition[c]
+
+ return where, " AND ".join("%s=:%s" % (k, k) for k in where.keys())
+
+
+def _get_sqlite_version(cursor):
+ cursor.execute("SELECT sqlite_version()")
+
+ version = []
+ for v in cursor.fetchone()[0].split("."):
+ try:
+ version.append(int(v))
+ except ValueError:
+ version.append(v)
+
+ return tuple(version)
+
+
+def _schema_table_name(version):
+ if version >= (3, 33):
+ return "sqlite_schema"
+
+ return "sqlite_master"
+
+
+class DatabaseEngine(object):
+ def __init__(self, dbname, sync):
+ self.dbname = dbname
+ self.logger = logger
+ self.sync = sync
+
+ async def create(self):
+ db = sqlite3.connect(self.dbname)
+ db.row_factory = sqlite3.Row
+
+ with closing(db.cursor()) as cursor:
+ _make_table(cursor, "unihashes_v3", UNIHASH_TABLE_DEFINITION)
+ _make_table(cursor, "outhashes_v2", OUTHASH_TABLE_DEFINITION)
+ _make_table(cursor, "users", USERS_TABLE_DEFINITION)
+ _make_table(cursor, "config", CONFIG_TABLE_DEFINITION)
+
+ cursor.execute("PRAGMA journal_mode = WAL")
+ cursor.execute(
+ "PRAGMA synchronous = %s" % ("NORMAL" if self.sync else "OFF")
+ )
+
+ # Drop old indexes
+ cursor.execute("DROP INDEX IF EXISTS taskhash_lookup")
+ cursor.execute("DROP INDEX IF EXISTS outhash_lookup")
+ cursor.execute("DROP INDEX IF EXISTS taskhash_lookup_v2")
+ cursor.execute("DROP INDEX IF EXISTS outhash_lookup_v2")
+ cursor.execute("DROP INDEX IF EXISTS taskhash_lookup_v3")
+
+ # TODO: Upgrade from tasks_v2?
+ cursor.execute("DROP TABLE IF EXISTS tasks_v2")
+
+ # Create new indexes
+ cursor.execute(
+ "CREATE INDEX IF NOT EXISTS taskhash_lookup_v4 ON unihashes_v3 (method, taskhash)"
+ )
+ cursor.execute(
+ "CREATE INDEX IF NOT EXISTS unihash_lookup_v1 ON unihashes_v3 (unihash)"
+ )
+ cursor.execute(
+ "CREATE INDEX IF NOT EXISTS outhash_lookup_v3 ON outhashes_v2 (method, outhash)"
+ )
+ cursor.execute("CREATE INDEX IF NOT EXISTS config_lookup ON config (name)")
+
+ sqlite_version = _get_sqlite_version(cursor)
+
+ cursor.execute(
+ f"""
+ SELECT name FROM {_schema_table_name(sqlite_version)} WHERE type = 'table' AND name = 'unihashes_v2'
+ """
+ )
+ if cursor.fetchone():
+ self.logger.info("Upgrading Unihashes V2 -> V3...")
+ cursor.execute(
+ """
+ INSERT INTO unihashes_v3 (id, method, unihash, taskhash, gc_mark)
+ SELECT id, method, unihash, taskhash, '' FROM unihashes_v2
+ """
+ )
+ cursor.execute("DROP TABLE unihashes_v2")
+ db.commit()
+ self.logger.info("Upgrade complete")
+
+ def connect(self, logger):
+ return Database(logger, self.dbname, self.sync)
+
+
+class Database(object):
+ def __init__(self, logger, dbname, sync):
+ self.dbname = dbname
+ self.logger = logger
+
+ self.db = sqlite3.connect(self.dbname)
+ self.db.row_factory = sqlite3.Row
+
+ with closing(self.db.cursor()) as cursor:
+ cursor.execute("PRAGMA journal_mode = WAL")
+ cursor.execute(
+ "PRAGMA synchronous = %s" % ("NORMAL" if sync else "OFF")
+ )
+
+ self.sqlite_version = _get_sqlite_version(cursor)
+
+ async def __aenter__(self):
+ return self
+
+ async def __aexit__(self, exc_type, exc_value, traceback):
+ await self.close()
+
+ async def _set_config(self, cursor, name, value):
+ cursor.execute(
+ """
+ INSERT OR REPLACE INTO config (id, name, value) VALUES
+ ((SELECT id FROM config WHERE name=:name), :name, :value)
+ """,
+ {
+ "name": name,
+ "value": value,
+ },
+ )
+
+ async def _get_config(self, cursor, name):
+ cursor.execute(
+ "SELECT value FROM config WHERE name=:name",
+ {
+ "name": name,
+ },
+ )
+ row = cursor.fetchone()
+ if row is None:
+ return None
+ return row["value"]
+
+ async def close(self):
+ self.db.close()
+
+ async def get_unihash_by_taskhash_full(self, method, taskhash):
+ with closing(self.db.cursor()) as cursor:
+ cursor.execute(
+ """
+ SELECT *, unihashes_v3.unihash AS unihash FROM outhashes_v2
+ INNER JOIN unihashes_v3 ON unihashes_v3.method=outhashes_v2.method AND unihashes_v3.taskhash=outhashes_v2.taskhash
+ WHERE outhashes_v2.method=:method AND outhashes_v2.taskhash=:taskhash
+ ORDER BY outhashes_v2.created ASC
+ LIMIT 1
+ """,
+ {
+ "method": method,
+ "taskhash": taskhash,
+ },
+ )
+ return cursor.fetchone()
+
+ async def get_unihash_by_outhash(self, method, outhash):
+ with closing(self.db.cursor()) as cursor:
+ cursor.execute(
+ """
+ SELECT *, unihashes_v3.unihash AS unihash FROM outhashes_v2
+ INNER JOIN unihashes_v3 ON unihashes_v3.method=outhashes_v2.method AND unihashes_v3.taskhash=outhashes_v2.taskhash
+ WHERE outhashes_v2.method=:method AND outhashes_v2.outhash=:outhash
+ ORDER BY outhashes_v2.created ASC
+ LIMIT 1
+ """,
+ {
+ "method": method,
+ "outhash": outhash,
+ },
+ )
+ return cursor.fetchone()
+
+ async def unihash_exists(self, unihash):
+ with closing(self.db.cursor()) as cursor:
+ cursor.execute(
+ """
+ SELECT * FROM unihashes_v3 WHERE unihash=:unihash
+ LIMIT 1
+ """,
+ {
+ "unihash": unihash,
+ },
+ )
+ return cursor.fetchone() is not None
+
+ async def get_outhash(self, method, outhash):
+ with closing(self.db.cursor()) as cursor:
+ cursor.execute(
+ """
+ SELECT * FROM outhashes_v2
+ WHERE outhashes_v2.method=:method AND outhashes_v2.outhash=:outhash
+ ORDER BY outhashes_v2.created ASC
+ LIMIT 1
+ """,
+ {
+ "method": method,
+ "outhash": outhash,
+ },
+ )
+ return cursor.fetchone()
+
+ async def get_equivalent_for_outhash(self, method, outhash, taskhash):
+ with closing(self.db.cursor()) as cursor:
+ cursor.execute(
+ """
+ SELECT outhashes_v2.taskhash AS taskhash, unihashes_v3.unihash AS unihash FROM outhashes_v2
+ INNER JOIN unihashes_v3 ON unihashes_v3.method=outhashes_v2.method AND unihashes_v3.taskhash=outhashes_v2.taskhash
+ -- Select any matching output hash except the one we just inserted
+ WHERE outhashes_v2.method=:method AND outhashes_v2.outhash=:outhash AND outhashes_v2.taskhash!=:taskhash
+ -- Pick the oldest hash
+ ORDER BY outhashes_v2.created ASC
+ LIMIT 1
+ """,
+ {
+ "method": method,
+ "outhash": outhash,
+ "taskhash": taskhash,
+ },
+ )
+ return cursor.fetchone()
+
+ async def get_equivalent(self, method, taskhash):
+ with closing(self.db.cursor()) as cursor:
+ cursor.execute(
+ "SELECT taskhash, method, unihash FROM unihashes_v3 WHERE method=:method AND taskhash=:taskhash",
+ {
+ "method": method,
+ "taskhash": taskhash,
+ },
+ )
+ return cursor.fetchone()
+
+ async def remove(self, condition):
+ def do_remove(columns, table_name, cursor):
+ where, clause = _make_condition_statement(columns, condition)
+ if where:
+ query = f"DELETE FROM {table_name} WHERE {clause}"
+ cursor.execute(query, where)
+ return cursor.rowcount
+
+ return 0
+
+ count = 0
+ with closing(self.db.cursor()) as cursor:
+ count += do_remove(OUTHASH_TABLE_COLUMNS, "outhashes_v2", cursor)
+ count += do_remove(UNIHASH_TABLE_COLUMNS, "unihashes_v3", cursor)
+ self.db.commit()
+
+ return count
+
+ async def get_current_gc_mark(self):
+ with closing(self.db.cursor()) as cursor:
+ return await self._get_config(cursor, "gc-mark")
+
+ async def gc_status(self):
+ with closing(self.db.cursor()) as cursor:
+ cursor.execute(
+ """
+ SELECT COUNT() FROM unihashes_v3 WHERE
+ gc_mark=COALESCE((SELECT value FROM config WHERE name='gc-mark'), '')
+ """
+ )
+ keep_rows = cursor.fetchone()[0]
+
+ cursor.execute(
+ """
+ SELECT COUNT() FROM unihashes_v3 WHERE
+ gc_mark!=COALESCE((SELECT value FROM config WHERE name='gc-mark'), '')
+ """
+ )
+ remove_rows = cursor.fetchone()[0]
+
+ current_mark = await self._get_config(cursor, "gc-mark")
+
+ return (keep_rows, remove_rows, current_mark)
+
+ async def gc_mark(self, mark, condition):
+ with closing(self.db.cursor()) as cursor:
+ await self._set_config(cursor, "gc-mark", mark)
+
+ where, clause = _make_condition_statement(UNIHASH_TABLE_COLUMNS, condition)
+
+ new_rows = 0
+ if where:
+ cursor.execute(
+ f"""
+ UPDATE unihashes_v3 SET
+ gc_mark=COALESCE((SELECT value FROM config WHERE name='gc-mark'), '')
+ WHERE {clause}
+ """,
+ where,
+ )
+ new_rows = cursor.rowcount
+
+ self.db.commit()
+ return new_rows
+
+ async def gc_sweep(self):
+ with closing(self.db.cursor()) as cursor:
+ # NOTE: COALESCE is not used in this query so that if the current
+ # mark is NULL, nothing will happen
+ cursor.execute(
+ """
+ DELETE FROM unihashes_v3 WHERE
+ gc_mark!=(SELECT value FROM config WHERE name='gc-mark')
+ """
+ )
+ count = cursor.rowcount
+ await self._set_config(cursor, "gc-mark", None)
+
+ self.db.commit()
+ return count
+
+ async def clean_unused(self, oldest):
+ with closing(self.db.cursor()) as cursor:
+ cursor.execute(
+ """
+ DELETE FROM outhashes_v2 WHERE created<:oldest AND NOT EXISTS (
+ SELECT unihashes_v3.id FROM unihashes_v3 WHERE unihashes_v3.method=outhashes_v2.method AND unihashes_v3.taskhash=outhashes_v2.taskhash LIMIT 1
+ )
+ """,
+ {
+ "oldest": oldest,
+ },
+ )
+ self.db.commit()
+ return cursor.rowcount
+
+ async def insert_unihash(self, method, taskhash, unihash):
+ with closing(self.db.cursor()) as cursor:
+ prevrowid = cursor.lastrowid
+ cursor.execute(
+ """
+ INSERT OR IGNORE INTO unihashes_v3 (method, taskhash, unihash, gc_mark) VALUES
+ (
+ :method,
+ :taskhash,
+ :unihash,
+ COALESCE((SELECT value FROM config WHERE name='gc-mark'), '')
+ )
+ """,
+ {
+ "method": method,
+ "taskhash": taskhash,
+ "unihash": unihash,
+ },
+ )
+ self.db.commit()
+ return cursor.lastrowid != prevrowid
+
+ async def insert_outhash(self, data):
+ data = {k: v for k, v in data.items() if k in OUTHASH_TABLE_COLUMNS}
+ keys = sorted(data.keys())
+ query = "INSERT OR IGNORE INTO outhashes_v2 ({fields}) VALUES({values})".format(
+ fields=", ".join(keys),
+ values=", ".join(":" + k for k in keys),
+ )
+ with closing(self.db.cursor()) as cursor:
+ prevrowid = cursor.lastrowid
+ cursor.execute(query, data)
+ self.db.commit()
+ return cursor.lastrowid != prevrowid
+
+ def _get_user(self, username):
+ with closing(self.db.cursor()) as cursor:
+ cursor.execute(
+ """
+ SELECT username, permissions, token FROM users WHERE username=:username
+ """,
+ {
+ "username": username,
+ },
+ )
+ return cursor.fetchone()
+
+ async def lookup_user_token(self, username):
+ row = self._get_user(username)
+ if row is None:
+ return None, None
+ return map_user(row), row["token"]
+
+ async def lookup_user(self, username):
+ return map_user(self._get_user(username))
+
+ async def set_user_token(self, username, token):
+ with closing(self.db.cursor()) as cursor:
+ cursor.execute(
+ """
+ UPDATE users SET token=:token WHERE username=:username
+ """,
+ {
+ "username": username,
+ "token": token,
+ },
+ )
+ self.db.commit()
+ return cursor.rowcount != 0
+
+ async def set_user_perms(self, username, permissions):
+ with closing(self.db.cursor()) as cursor:
+ cursor.execute(
+ """
+ UPDATE users SET permissions=:permissions WHERE username=:username
+ """,
+ {
+ "username": username,
+ "permissions": " ".join(permissions),
+ },
+ )
+ self.db.commit()
+ return cursor.rowcount != 0
+
+ async def get_all_users(self):
+ with closing(self.db.cursor()) as cursor:
+ cursor.execute("SELECT username, permissions FROM users")
+ return [map_user(r) for r in cursor.fetchall()]
+
+ async def new_user(self, username, permissions, token):
+ with closing(self.db.cursor()) as cursor:
+ try:
+ cursor.execute(
+ """
+ INSERT INTO users (username, token, permissions) VALUES (:username, :token, :permissions)
+ """,
+ {
+ "username": username,
+ "token": token,
+ "permissions": " ".join(permissions),
+ },
+ )
+ self.db.commit()
+ return True
+ except sqlite3.IntegrityError:
+ return False
+
+ async def delete_user(self, username):
+ with closing(self.db.cursor()) as cursor:
+ cursor.execute(
+ """
+ DELETE FROM users WHERE username=:username
+ """,
+ {
+ "username": username,
+ },
+ )
+ self.db.commit()
+ return cursor.rowcount != 0
+
+ async def get_usage(self):
+ usage = {}
+ with closing(self.db.cursor()) as cursor:
+ cursor.execute(
+ f"""
+ SELECT name FROM {_schema_table_name(self.sqlite_version)} WHERE type = 'table' AND name NOT LIKE 'sqlite_%'
+ """
+ )
+ for row in cursor.fetchall():
+ cursor.execute(
+ """
+ SELECT COUNT() FROM %s
+ """
+ % row["name"],
+ )
+ usage[row["name"]] = {
+ "rows": cursor.fetchone()[0],
+ }
+ return usage
+
+ async def get_query_columns(self):
+ columns = set()
+ for name, typ, _ in UNIHASH_TABLE_DEFINITION + OUTHASH_TABLE_DEFINITION:
+ if typ.startswith("TEXT"):
+ columns.add(name)
+ return list(columns)
diff --git a/bitbake/lib/hashserv/tests.py b/bitbake/lib/hashserv/tests.py
index f6b85aed85..0809453cf8 100644
--- a/bitbake/lib/hashserv/tests.py
+++ b/bitbake/lib/hashserv/tests.py
@@ -6,6 +6,9 @@
#
from . import create_server, create_client
+from .server import DEFAULT_ANON_PERMS, ALL_PERMISSIONS
+from bb.asyncrpc import InvokeError
+from .client import ClientPool
import hashlib
import logging
import multiprocessing
@@ -17,6 +20,14 @@ import unittest
import socket
import time
import signal
+import subprocess
+import json
+import re
+from pathlib import Path
+
+
+THIS_DIR = Path(__file__).parent
+BIN_DIR = THIS_DIR.parent.parent / "bin"
def server_prefunc(server, idx):
logging.basicConfig(level=logging.DEBUG, filename='bbhashserv-%d.log' % idx, filemode='w',
@@ -29,11 +40,12 @@ class HashEquivalenceTestSetup(object):
METHOD = 'TestMethod'
server_index = 0
+ client_index = 0
- def start_server(self, dbpath=None, upstream=None, read_only=False, prefunc=server_prefunc):
+ def start_server(self, dbpath=None, upstream=None, read_only=False, prefunc=server_prefunc, anon_perms=DEFAULT_ANON_PERMS, admin_username=None, admin_password=None):
self.server_index += 1
if dbpath is None:
- dbpath = os.path.join(self.temp_dir.name, "db%d.sqlite" % self.server_index)
+ dbpath = self.make_dbpath()
def cleanup_server(server):
if server.process.exitcode is not None:
@@ -45,19 +57,41 @@ class HashEquivalenceTestSetup(object):
server = create_server(self.get_server_addr(self.server_index),
dbpath,
upstream=upstream,
- read_only=read_only)
+ read_only=read_only,
+ anon_perms=anon_perms,
+ admin_username=admin_username,
+ admin_password=admin_password)
server.dbpath = dbpath
server.serve_as_process(prefunc=prefunc, args=(self.server_index,))
self.addCleanup(cleanup_server, server)
+ return server
+
+ def make_dbpath(self):
+ return os.path.join(self.temp_dir.name, "db%d.sqlite" % self.server_index)
+
+ def start_client(self, server_address, username=None, password=None):
def cleanup_client(client):
client.close()
- client = create_client(server.address)
+ client = create_client(server_address, username=username, password=password)
self.addCleanup(cleanup_client, client)
- return (client, server)
+ return client
+
+ def start_test_server(self):
+ self.server = self.start_server()
+ return self.server.address
+
+ def start_auth_server(self):
+ auth_server = self.start_server(self.server.dbpath, anon_perms=[], admin_username="admin", admin_password="password")
+ self.auth_server_address = auth_server.address
+ self.admin_client = self.start_client(auth_server.address, username="admin", password="password")
+ return self.admin_client
+
+ def auth_client(self, user):
+ return self.start_client(self.auth_server_address, user["username"], user["token"])
def setUp(self):
if sys.version_info < (3, 5, 0):
@@ -66,24 +100,82 @@ class HashEquivalenceTestSetup(object):
self.temp_dir = tempfile.TemporaryDirectory(prefix='bb-hashserv')
self.addCleanup(self.temp_dir.cleanup)
- (self.client, self.server) = self.start_server()
+ self.server_address = self.start_test_server()
+
+ self.client = self.start_client(self.server_address)
def assertClientGetHash(self, client, taskhash, unihash):
result = client.get_unihash(self.METHOD, taskhash)
self.assertEqual(result, unihash)
+ def assertUserPerms(self, user, permissions):
+ with self.auth_client(user) as client:
+ info = client.get_user()
+ self.assertEqual(info, {
+ "username": user["username"],
+ "permissions": permissions,
+ })
-class HashEquivalenceCommonTests(object):
- def test_create_hash(self):
+ def assertUserCanAuth(self, user):
+ with self.start_client(self.auth_server_address) as client:
+ client.auth(user["username"], user["token"])
+
+ def assertUserCannotAuth(self, user):
+ with self.start_client(self.auth_server_address) as client, self.assertRaises(InvokeError):
+ client.auth(user["username"], user["token"])
+
+ def create_test_hash(self, client):
# Simple test that hashes can be created
taskhash = '35788efcb8dfb0a02659d81cf2bfd695fb30faf9'
outhash = '2765d4a5884be49b28601445c2760c5f21e7e5c0ee2b7e3fce98fd7e5970796f'
unihash = 'f46d3fbb439bd9b921095da657a4de906510d2cd'
- self.assertClientGetHash(self.client, taskhash, None)
+ self.assertClientGetHash(client, taskhash, None)
- result = self.client.report_unihash(taskhash, self.METHOD, outhash, unihash)
+ result = client.report_unihash(taskhash, self.METHOD, outhash, unihash)
self.assertEqual(result['unihash'], unihash, 'Server returned bad unihash')
+ return taskhash, outhash, unihash
+
+ def run_hashclient(self, args, **kwargs):
+ try:
+ p = subprocess.run(
+ [BIN_DIR / "bitbake-hashclient"] + args,
+ stdout=subprocess.PIPE,
+ stderr=subprocess.STDOUT,
+ encoding="utf-8",
+ **kwargs
+ )
+ except subprocess.CalledProcessError as e:
+ print(e.output)
+ raise e
+
+ print(p.stdout)
+ return p
+
+
+class HashEquivalenceCommonTests(object):
+ def auth_perms(self, *permissions):
+ self.client_index += 1
+ user = self.create_user(f"user-{self.client_index}", permissions)
+ return self.auth_client(user)
+
+ def create_user(self, username, permissions, *, client=None):
+ def remove_user(username):
+ try:
+ self.admin_client.delete_user(username)
+ except bb.asyncrpc.InvokeError:
+ pass
+
+ if client is None:
+ client = self.admin_client
+
+ user = client.new_user(username, permissions)
+ self.addCleanup(remove_user, username)
+
+ return user
+
+ def test_create_hash(self):
+ return self.create_test_hash(self.client)
def test_create_equivalent(self):
# Tests that a second reported task with the same outhash will be
@@ -125,6 +217,57 @@ class HashEquivalenceCommonTests(object):
self.assertClientGetHash(self.client, taskhash, unihash)
+ def test_remove_taskhash(self):
+ taskhash, outhash, unihash = self.create_test_hash(self.client)
+ result = self.client.remove({"taskhash": taskhash})
+ self.assertGreater(result["count"], 0)
+ self.assertClientGetHash(self.client, taskhash, None)
+
+ result_outhash = self.client.get_outhash(self.METHOD, outhash, taskhash)
+ self.assertIsNone(result_outhash)
+
+ def test_remove_unihash(self):
+ taskhash, outhash, unihash = self.create_test_hash(self.client)
+ result = self.client.remove({"unihash": unihash})
+ self.assertGreater(result["count"], 0)
+ self.assertClientGetHash(self.client, taskhash, None)
+
+ def test_remove_outhash(self):
+ taskhash, outhash, unihash = self.create_test_hash(self.client)
+ result = self.client.remove({"outhash": outhash})
+ self.assertGreater(result["count"], 0)
+
+ result_outhash = self.client.get_outhash(self.METHOD, outhash, taskhash)
+ self.assertIsNone(result_outhash)
+
+ def test_remove_method(self):
+ taskhash, outhash, unihash = self.create_test_hash(self.client)
+ result = self.client.remove({"method": self.METHOD})
+ self.assertGreater(result["count"], 0)
+ self.assertClientGetHash(self.client, taskhash, None)
+
+ result_outhash = self.client.get_outhash(self.METHOD, outhash, taskhash)
+ self.assertIsNone(result_outhash)
+
+ def test_clean_unused(self):
+ taskhash, outhash, unihash = self.create_test_hash(self.client)
+
+ # Clean the database, which should not remove anything because all hashes an in-use
+ result = self.client.clean_unused(0)
+ self.assertEqual(result["count"], 0)
+ self.assertClientGetHash(self.client, taskhash, unihash)
+
+ # Remove the unihash. The row in the outhash table should still be present
+ self.client.remove({"unihash": unihash})
+ result_outhash = self.client.get_outhash(self.METHOD, outhash, taskhash, False)
+ self.assertIsNotNone(result_outhash)
+
+ # Now clean with no minimum age which will remove the outhash
+ result = self.client.clean_unused(0)
+ self.assertEqual(result["count"], 1)
+ result_outhash = self.client.get_outhash(self.METHOD, outhash, taskhash, False)
+ self.assertIsNone(result_outhash)
+
def test_huge_message(self):
# Simple test that hashes can be created
taskhash = 'c665584ee6817aa99edfc77a44dd853828279370'
@@ -154,7 +297,7 @@ class HashEquivalenceCommonTests(object):
def test_stress(self):
def query_server(failures):
- client = Client(self.server.address)
+ client = Client(self.server_address)
try:
for i in range(1000):
taskhash = hashlib.sha256()
@@ -193,8 +336,10 @@ class HashEquivalenceCommonTests(object):
# the side client. It also verifies that the results are pulled into
# the downstream database by checking that the downstream and side servers
# match after the downstream is done waiting for all backfill tasks
- (down_client, down_server) = self.start_server(upstream=self.server.address)
- (side_client, side_server) = self.start_server(dbpath=down_server.dbpath)
+ down_server = self.start_server(upstream=self.server_address)
+ down_client = self.start_client(down_server.address)
+ side_server = self.start_server(dbpath=down_server.dbpath)
+ side_client = self.start_client(side_server.address)
def check_hash(taskhash, unihash, old_sidehash):
nonlocal down_client
@@ -298,15 +443,24 @@ class HashEquivalenceCommonTests(object):
self.assertEqual(result['taskhash'], taskhash9, 'Server failed to copy unihash from upstream')
self.assertEqual(result['method'], self.METHOD)
+ def test_unihash_exsits(self):
+ taskhash, outhash, unihash = self.create_test_hash(self.client)
+ self.assertTrue(self.client.unihash_exists(unihash))
+ self.assertFalse(self.client.unihash_exists('6662e699d6e3d894b24408ff9a4031ef9b038ee8'))
+
def test_ro_server(self):
- (ro_client, ro_server) = self.start_server(dbpath=self.server.dbpath, read_only=True)
+ rw_server = self.start_server()
+ rw_client = self.start_client(rw_server.address)
+
+ ro_server = self.start_server(dbpath=rw_server.dbpath, read_only=True)
+ ro_client = self.start_client(ro_server.address)
# Report a hash via the read-write server
taskhash = '35788efcb8dfb0a02659d81cf2bfd695fb30faf9'
outhash = '2765d4a5884be49b28601445c2760c5f21e7e5c0ee2b7e3fce98fd7e5970796f'
unihash = 'f46d3fbb439bd9b921095da657a4de906510d2cd'
- result = self.client.report_unihash(taskhash, self.METHOD, outhash, unihash)
+ result = rw_client.report_unihash(taskhash, self.METHOD, outhash, unihash)
self.assertEqual(result['unihash'], unihash, 'Server returned bad unihash')
# Check the hash via the read-only server
@@ -317,11 +471,11 @@ class HashEquivalenceCommonTests(object):
outhash2 = '3c979c3db45c569f51ab7626a4651074be3a9d11a84b1db076f5b14f7d39db44'
unihash2 = '90e9bc1d1f094c51824adca7f8ea79a048d68824'
- with self.assertRaises(ConnectionError):
- ro_client.report_unihash(taskhash2, self.METHOD, outhash2, unihash2)
+ result = ro_client.report_unihash(taskhash2, self.METHOD, outhash2, unihash2)
+ self.assertEqual(result['unihash'], unihash2)
# Ensure that the database was not modified
- self.assertClientGetHash(self.client, taskhash2, None)
+ self.assertClientGetHash(rw_client, taskhash2, None)
def test_slow_server_start(self):
@@ -341,7 +495,7 @@ class HashEquivalenceCommonTests(object):
old_signal = signal.signal(signal.SIGTERM, do_nothing)
self.addCleanup(signal.signal, signal.SIGTERM, old_signal)
- _, server = self.start_server(prefunc=prefunc)
+ server = self.start_server(prefunc=prefunc)
server.process.terminate()
time.sleep(30)
event.set()
@@ -401,6 +555,858 @@ class HashEquivalenceCommonTests(object):
# shares a taskhash with Task 2
self.assertClientGetHash(self.client, taskhash2, unihash2)
+
+ def test_client_pool_get_unihashes(self):
+ TEST_INPUT = (
+ # taskhash outhash unihash
+ ('8aa96fcffb5831b3c2c0cb75f0431e3f8b20554a', 'afe240a439959ce86f5e322f8c208e1fedefea9e813f2140c81af866cc9edf7e','218e57509998197d570e2c98512d0105985dffc9'),
+ # Duplicated taskhash with multiple output hashes and unihashes.
+ ('8aa96fcffb5831b3c2c0cb75f0431e3f8b20554a', '0904a7fe3dc712d9fd8a74a616ddca2a825a8ee97adf0bd3fc86082c7639914d', 'ae9a7d252735f0dafcdb10e2e02561ca3a47314c'),
+ # Equivalent hash
+ ("044c2ec8aaf480685a00ff6ff49e6162e6ad34e1", '0904a7fe3dc712d9fd8a74a616ddca2a825a8ee97adf0bd3fc86082c7639914d', "def64766090d28f627e816454ed46894bb3aab36"),
+ ("e3da00593d6a7fb435c7e2114976c59c5fd6d561", "1cf8713e645f491eb9c959d20b5cae1c47133a292626dda9b10709857cbe688a", "3b5d3d83f07f259e9086fcb422c855286e18a57d"),
+ ('35788efcb8dfb0a02659d81cf2bfd695fb30faf9', '2765d4a5884be49b28601445c2760c5f21e7e5c0ee2b7e3fce98fd7e5970796f', 'f46d3fbb439bd9b921095da657a4de906510d2cd'),
+ ('35788efcb8dfb0a02659d81cf2bfd695fb30fafa', '2765d4a5884be49b28601445c2760c5f21e7e5c0ee2b7e3fce98fd7e5970796f', 'f46d3fbb439bd9b921095da657a4de906510d2ce'),
+ ('9d81d76242cc7cfaf7bf74b94b9cd2e29324ed74', '8470d56547eea6236d7c81a644ce74670ca0bbda998e13c629ef6bb3f0d60b69', '05d2a63c81e32f0a36542ca677e8ad852365c538'),
+ )
+ EXTRA_QUERIES = (
+ "6b6be7a84ab179b4240c4302518dc3f6",
+ )
+
+ with ClientPool(self.server_address, 10) as client_pool:
+ for taskhash, outhash, unihash in TEST_INPUT:
+ self.client.report_unihash(taskhash, self.METHOD, outhash, unihash)
+
+ query = {idx: (self.METHOD, data[0]) for idx, data in enumerate(TEST_INPUT)}
+ for idx, taskhash in enumerate(EXTRA_QUERIES):
+ query[idx + len(TEST_INPUT)] = (self.METHOD, taskhash)
+
+ result = client_pool.get_unihashes(query)
+
+ self.assertDictEqual(result, {
+ 0: "218e57509998197d570e2c98512d0105985dffc9",
+ 1: "218e57509998197d570e2c98512d0105985dffc9",
+ 2: "218e57509998197d570e2c98512d0105985dffc9",
+ 3: "3b5d3d83f07f259e9086fcb422c855286e18a57d",
+ 4: "f46d3fbb439bd9b921095da657a4de906510d2cd",
+ 5: "f46d3fbb439bd9b921095da657a4de906510d2cd",
+ 6: "05d2a63c81e32f0a36542ca677e8ad852365c538",
+ 7: None,
+ })
+
+ def test_client_pool_unihash_exists(self):
+ TEST_INPUT = (
+ # taskhash outhash unihash
+ ('8aa96fcffb5831b3c2c0cb75f0431e3f8b20554a', 'afe240a439959ce86f5e322f8c208e1fedefea9e813f2140c81af866cc9edf7e','218e57509998197d570e2c98512d0105985dffc9'),
+ # Duplicated taskhash with multiple output hashes and unihashes.
+ ('8aa96fcffb5831b3c2c0cb75f0431e3f8b20554a', '0904a7fe3dc712d9fd8a74a616ddca2a825a8ee97adf0bd3fc86082c7639914d', 'ae9a7d252735f0dafcdb10e2e02561ca3a47314c'),
+ # Equivalent hash
+ ("044c2ec8aaf480685a00ff6ff49e6162e6ad34e1", '0904a7fe3dc712d9fd8a74a616ddca2a825a8ee97adf0bd3fc86082c7639914d', "def64766090d28f627e816454ed46894bb3aab36"),
+ ("e3da00593d6a7fb435c7e2114976c59c5fd6d561", "1cf8713e645f491eb9c959d20b5cae1c47133a292626dda9b10709857cbe688a", "3b5d3d83f07f259e9086fcb422c855286e18a57d"),
+ ('35788efcb8dfb0a02659d81cf2bfd695fb30faf9', '2765d4a5884be49b28601445c2760c5f21e7e5c0ee2b7e3fce98fd7e5970796f', 'f46d3fbb439bd9b921095da657a4de906510d2cd'),
+ ('35788efcb8dfb0a02659d81cf2bfd695fb30fafa', '2765d4a5884be49b28601445c2760c5f21e7e5c0ee2b7e3fce98fd7e5970796f', 'f46d3fbb439bd9b921095da657a4de906510d2ce'),
+ ('9d81d76242cc7cfaf7bf74b94b9cd2e29324ed74', '8470d56547eea6236d7c81a644ce74670ca0bbda998e13c629ef6bb3f0d60b69', '05d2a63c81e32f0a36542ca677e8ad852365c538'),
+ )
+ EXTRA_QUERIES = (
+ "6b6be7a84ab179b4240c4302518dc3f6",
+ )
+
+ result_unihashes = set()
+
+
+ with ClientPool(self.server_address, 10) as client_pool:
+ for taskhash, outhash, unihash in TEST_INPUT:
+ result = self.client.report_unihash(taskhash, self.METHOD, outhash, unihash)
+ result_unihashes.add(result["unihash"])
+
+ query = {}
+ expected = {}
+
+ for _, _, unihash in TEST_INPUT:
+ idx = len(query)
+ query[idx] = unihash
+ expected[idx] = unihash in result_unihashes
+
+
+ for unihash in EXTRA_QUERIES:
+ idx = len(query)
+ query[idx] = unihash
+ expected[idx] = False
+
+ result = client_pool.unihashes_exist(query)
+ self.assertDictEqual(result, expected)
+
+
+ def test_auth_read_perms(self):
+ admin_client = self.start_auth_server()
+
+ # Create hashes with non-authenticated server
+ taskhash, outhash, unihash = self.create_test_hash(self.client)
+
+ # Validate hash can be retrieved using authenticated client
+ with self.auth_perms("@read") as client:
+ self.assertClientGetHash(client, taskhash, unihash)
+
+ with self.auth_perms() as client, self.assertRaises(InvokeError):
+ self.assertClientGetHash(client, taskhash, unihash)
+
+ def test_auth_report_perms(self):
+ admin_client = self.start_auth_server()
+
+ # Without read permission, the user is completely denied
+ with self.auth_perms() as client, self.assertRaises(InvokeError):
+ self.create_test_hash(client)
+
+ # Read permission allows the call to succeed, but it doesn't record
+ # anythin in the database
+ with self.auth_perms("@read") as client:
+ taskhash, outhash, unihash = self.create_test_hash(client)
+ self.assertClientGetHash(client, taskhash, None)
+
+ # Report permission alone is insufficient
+ with self.auth_perms("@report") as client, self.assertRaises(InvokeError):
+ self.create_test_hash(client)
+
+ # Read and report permission actually modify the database
+ with self.auth_perms("@read", "@report") as client:
+ taskhash, outhash, unihash = self.create_test_hash(client)
+ self.assertClientGetHash(client, taskhash, unihash)
+
+ def test_auth_no_token_refresh_from_anon_user(self):
+ self.start_auth_server()
+
+ with self.start_client(self.auth_server_address) as client, self.assertRaises(InvokeError):
+ client.refresh_token()
+
+ def test_auth_self_token_refresh(self):
+ admin_client = self.start_auth_server()
+
+ # Create a new user with no permissions
+ user = self.create_user("test-user", [])
+
+ with self.auth_client(user) as client:
+ new_user = client.refresh_token()
+
+ self.assertEqual(user["username"], new_user["username"])
+ self.assertNotEqual(user["token"], new_user["token"])
+ self.assertUserCanAuth(new_user)
+ self.assertUserCannotAuth(user)
+
+ # Explicitly specifying with your own username is fine also
+ with self.auth_client(new_user) as client:
+ new_user2 = client.refresh_token(user["username"])
+
+ self.assertEqual(user["username"], new_user2["username"])
+ self.assertNotEqual(user["token"], new_user2["token"])
+ self.assertUserCanAuth(new_user2)
+ self.assertUserCannotAuth(new_user)
+ self.assertUserCannotAuth(user)
+
+ def test_auth_token_refresh(self):
+ admin_client = self.start_auth_server()
+
+ user = self.create_user("test-user", [])
+
+ with self.auth_perms() as client, self.assertRaises(InvokeError):
+ client.refresh_token(user["username"])
+
+ with self.auth_perms("@user-admin") as client:
+ new_user = client.refresh_token(user["username"])
+
+ self.assertEqual(user["username"], new_user["username"])
+ self.assertNotEqual(user["token"], new_user["token"])
+ self.assertUserCanAuth(new_user)
+ self.assertUserCannotAuth(user)
+
+ def test_auth_self_get_user(self):
+ admin_client = self.start_auth_server()
+
+ user = self.create_user("test-user", [])
+ user_info = user.copy()
+ del user_info["token"]
+
+ with self.auth_client(user) as client:
+ info = client.get_user()
+ self.assertEqual(info, user_info)
+
+ # Explicitly asking for your own username is fine also
+ info = client.get_user(user["username"])
+ self.assertEqual(info, user_info)
+
+ def test_auth_get_user(self):
+ admin_client = self.start_auth_server()
+
+ user = self.create_user("test-user", [])
+ user_info = user.copy()
+ del user_info["token"]
+
+ with self.auth_perms() as client, self.assertRaises(InvokeError):
+ client.get_user(user["username"])
+
+ with self.auth_perms("@user-admin") as client:
+ info = client.get_user(user["username"])
+ self.assertEqual(info, user_info)
+
+ info = client.get_user("nonexist-user")
+ self.assertIsNone(info)
+
+ def test_auth_reconnect(self):
+ admin_client = self.start_auth_server()
+
+ user = self.create_user("test-user", [])
+ user_info = user.copy()
+ del user_info["token"]
+
+ with self.auth_client(user) as client:
+ info = client.get_user()
+ self.assertEqual(info, user_info)
+
+ client.disconnect()
+
+ info = client.get_user()
+ self.assertEqual(info, user_info)
+
+ def test_auth_delete_user(self):
+ admin_client = self.start_auth_server()
+
+ user = self.create_user("test-user", [])
+
+ # self service
+ with self.auth_client(user) as client:
+ client.delete_user(user["username"])
+
+ self.assertIsNone(admin_client.get_user(user["username"]))
+ user = self.create_user("test-user", [])
+
+ with self.auth_perms() as client, self.assertRaises(InvokeError):
+ client.delete_user(user["username"])
+
+ with self.auth_perms("@user-admin") as client:
+ client.delete_user(user["username"])
+
+ # User doesn't exist, so even though the permission is correct, it's an
+ # error
+ with self.auth_perms("@user-admin") as client, self.assertRaises(InvokeError):
+ client.delete_user(user["username"])
+
+ def test_auth_set_user_perms(self):
+ admin_client = self.start_auth_server()
+
+ user = self.create_user("test-user", [])
+
+ self.assertUserPerms(user, [])
+
+ # No self service to change permissions
+ with self.auth_client(user) as client, self.assertRaises(InvokeError):
+ client.set_user_perms(user["username"], ["@all"])
+ self.assertUserPerms(user, [])
+
+ with self.auth_perms() as client, self.assertRaises(InvokeError):
+ client.set_user_perms(user["username"], ["@all"])
+ self.assertUserPerms(user, [])
+
+ with self.auth_perms("@user-admin") as client:
+ client.set_user_perms(user["username"], ["@all"])
+ self.assertUserPerms(user, sorted(list(ALL_PERMISSIONS)))
+
+ # Bad permissions
+ with self.auth_perms("@user-admin") as client, self.assertRaises(InvokeError):
+ client.set_user_perms(user["username"], ["@this-is-not-a-permission"])
+ self.assertUserPerms(user, sorted(list(ALL_PERMISSIONS)))
+
+ def test_auth_get_all_users(self):
+ admin_client = self.start_auth_server()
+
+ user = self.create_user("test-user", [])
+
+ with self.auth_client(user) as client, self.assertRaises(InvokeError):
+ client.get_all_users()
+
+ # Give the test user the correct permission
+ admin_client.set_user_perms(user["username"], ["@user-admin"])
+
+ with self.auth_client(user) as client:
+ all_users = client.get_all_users()
+
+ # Convert to a dictionary for easier comparison
+ all_users = {u["username"]: u for u in all_users}
+
+ self.assertEqual(all_users,
+ {
+ "admin": {
+ "username": "admin",
+ "permissions": sorted(list(ALL_PERMISSIONS)),
+ },
+ "test-user": {
+ "username": "test-user",
+ "permissions": ["@user-admin"],
+ }
+ }
+ )
+
+ def test_auth_new_user(self):
+ self.start_auth_server()
+
+ permissions = ["@read", "@report", "@db-admin", "@user-admin"]
+ permissions.sort()
+
+ with self.auth_perms() as client, self.assertRaises(InvokeError):
+ self.create_user("test-user", permissions, client=client)
+
+ with self.auth_perms("@user-admin") as client:
+ user = self.create_user("test-user", permissions, client=client)
+ self.assertIn("token", user)
+ self.assertEqual(user["username"], "test-user")
+ self.assertEqual(user["permissions"], permissions)
+
+ def test_auth_become_user(self):
+ admin_client = self.start_auth_server()
+
+ user = self.create_user("test-user", ["@read", "@report"])
+ user_info = user.copy()
+ del user_info["token"]
+
+ with self.auth_perms() as client, self.assertRaises(InvokeError):
+ client.become_user(user["username"])
+
+ with self.auth_perms("@user-admin") as client:
+ become = client.become_user(user["username"])
+ self.assertEqual(become, user_info)
+
+ info = client.get_user()
+ self.assertEqual(info, user_info)
+
+ # Verify become user is preserved across disconnect
+ client.disconnect()
+
+ info = client.get_user()
+ self.assertEqual(info, user_info)
+
+ # test-user doesn't have become_user permissions, so this should
+ # not work
+ with self.assertRaises(InvokeError):
+ client.become_user(user["username"])
+
+ # No self-service of become
+ with self.auth_client(user) as client, self.assertRaises(InvokeError):
+ client.become_user(user["username"])
+
+ # Give test user permissions to become
+ admin_client.set_user_perms(user["username"], ["@user-admin"])
+
+ # It's possible to become yourself (effectively a noop)
+ with self.auth_perms("@user-admin") as client:
+ become = client.become_user(client.username)
+
+ def test_auth_gc(self):
+ admin_client = self.start_auth_server()
+
+ with self.auth_perms() as client, self.assertRaises(InvokeError):
+ client.gc_mark("ABC", {"unihash": "123"})
+
+ with self.auth_perms() as client, self.assertRaises(InvokeError):
+ client.gc_status()
+
+ with self.auth_perms() as client, self.assertRaises(InvokeError):
+ client.gc_sweep("ABC")
+
+ with self.auth_perms("@db-admin") as client:
+ client.gc_mark("ABC", {"unihash": "123"})
+
+ with self.auth_perms("@db-admin") as client:
+ client.gc_status()
+
+ with self.auth_perms("@db-admin") as client:
+ client.gc_sweep("ABC")
+
+ def test_get_db_usage(self):
+ usage = self.client.get_db_usage()
+
+ self.assertTrue(isinstance(usage, dict))
+ for name in usage.keys():
+ self.assertTrue(isinstance(usage[name], dict))
+ self.assertIn("rows", usage[name])
+ self.assertTrue(isinstance(usage[name]["rows"], int))
+
+ def test_get_db_query_columns(self):
+ columns = self.client.get_db_query_columns()
+
+ self.assertTrue(isinstance(columns, list))
+ self.assertTrue(len(columns) > 0)
+
+ for col in columns:
+ self.client.remove({col: ""})
+
+ def test_auth_is_owner(self):
+ admin_client = self.start_auth_server()
+
+ user = self.create_user("test-user", ["@read", "@report"])
+ with self.auth_client(user) as client:
+ taskhash, outhash, unihash = self.create_test_hash(client)
+ data = client.get_taskhash(self.METHOD, taskhash, True)
+ self.assertEqual(data["owner"], user["username"])
+
+ def test_gc(self):
+ taskhash = '53b8dce672cb6d0c73170be43f540460bfc347b4'
+ outhash = '5a9cb1649625f0bf41fc7791b635cd9c2d7118c7f021ba87dcd03f72b67ce7a8'
+ unihash = 'f37918cc02eb5a520b1aff86faacbc0a38124646'
+
+ result = self.client.report_unihash(taskhash, self.METHOD, outhash, unihash)
+ self.assertEqual(result['unihash'], unihash, 'Server returned bad unihash')
+
+ taskhash2 = '3bf6f1e89d26205aec90da04854fbdbf73afe6b4'
+ outhash2 = '77623a549b5b1a31e3732dfa8fe61d7ce5d44b3370f253c5360e136b852967b4'
+ unihash2 = 'af36b199320e611fbb16f1f277d3ee1d619ca58b'
+
+ result = self.client.report_unihash(taskhash2, self.METHOD, outhash2, unihash2)
+ self.assertClientGetHash(self.client, taskhash2, unihash2)
+
+ # Mark the first unihash to be kept
+ ret = self.client.gc_mark("ABC", {"unihash": unihash, "method": self.METHOD})
+ self.assertEqual(ret, {"count": 1})
+
+ ret = self.client.gc_status()
+ self.assertEqual(ret, {"mark": "ABC", "keep": 1, "remove": 1})
+
+ # Second hash is still there; mark doesn't delete hashes
+ self.assertClientGetHash(self.client, taskhash2, unihash2)
+
+ ret = self.client.gc_sweep("ABC")
+ self.assertEqual(ret, {"count": 1})
+
+ # Hash is gone. Taskhash is returned for second hash
+ self.assertClientGetHash(self.client, taskhash2, None)
+ # First hash is still present
+ self.assertClientGetHash(self.client, taskhash, unihash)
+
+ def test_gc_switch_mark(self):
+ taskhash = '53b8dce672cb6d0c73170be43f540460bfc347b4'
+ outhash = '5a9cb1649625f0bf41fc7791b635cd9c2d7118c7f021ba87dcd03f72b67ce7a8'
+ unihash = 'f37918cc02eb5a520b1aff86faacbc0a38124646'
+
+ result = self.client.report_unihash(taskhash, self.METHOD, outhash, unihash)
+ self.assertEqual(result['unihash'], unihash, 'Server returned bad unihash')
+
+ taskhash2 = '3bf6f1e89d26205aec90da04854fbdbf73afe6b4'
+ outhash2 = '77623a549b5b1a31e3732dfa8fe61d7ce5d44b3370f253c5360e136b852967b4'
+ unihash2 = 'af36b199320e611fbb16f1f277d3ee1d619ca58b'
+
+ result = self.client.report_unihash(taskhash2, self.METHOD, outhash2, unihash2)
+ self.assertClientGetHash(self.client, taskhash2, unihash2)
+
+ # Mark the first unihash to be kept
+ ret = self.client.gc_mark("ABC", {"unihash": unihash, "method": self.METHOD})
+ self.assertEqual(ret, {"count": 1})
+
+ ret = self.client.gc_status()
+ self.assertEqual(ret, {"mark": "ABC", "keep": 1, "remove": 1})
+
+ # Second hash is still there; mark doesn't delete hashes
+ self.assertClientGetHash(self.client, taskhash2, unihash2)
+
+ # Switch to a different mark and mark the second hash. This will start
+ # a new collection cycle
+ ret = self.client.gc_mark("DEF", {"unihash": unihash2, "method": self.METHOD})
+ self.assertEqual(ret, {"count": 1})
+
+ ret = self.client.gc_status()
+ self.assertEqual(ret, {"mark": "DEF", "keep": 1, "remove": 1})
+
+ # Both hashes are still present
+ self.assertClientGetHash(self.client, taskhash2, unihash2)
+ self.assertClientGetHash(self.client, taskhash, unihash)
+
+ # Sweep with the new mark
+ ret = self.client.gc_sweep("DEF")
+ self.assertEqual(ret, {"count": 1})
+
+ # First hash is gone, second is kept
+ self.assertClientGetHash(self.client, taskhash2, unihash2)
+ self.assertClientGetHash(self.client, taskhash, None)
+
+ def test_gc_switch_sweep_mark(self):
+ taskhash = '53b8dce672cb6d0c73170be43f540460bfc347b4'
+ outhash = '5a9cb1649625f0bf41fc7791b635cd9c2d7118c7f021ba87dcd03f72b67ce7a8'
+ unihash = 'f37918cc02eb5a520b1aff86faacbc0a38124646'
+
+ result = self.client.report_unihash(taskhash, self.METHOD, outhash, unihash)
+ self.assertEqual(result['unihash'], unihash, 'Server returned bad unihash')
+
+ taskhash2 = '3bf6f1e89d26205aec90da04854fbdbf73afe6b4'
+ outhash2 = '77623a549b5b1a31e3732dfa8fe61d7ce5d44b3370f253c5360e136b852967b4'
+ unihash2 = 'af36b199320e611fbb16f1f277d3ee1d619ca58b'
+
+ result = self.client.report_unihash(taskhash2, self.METHOD, outhash2, unihash2)
+ self.assertClientGetHash(self.client, taskhash2, unihash2)
+
+ # Mark the first unihash to be kept
+ ret = self.client.gc_mark("ABC", {"unihash": unihash, "method": self.METHOD})
+ self.assertEqual(ret, {"count": 1})
+
+ ret = self.client.gc_status()
+ self.assertEqual(ret, {"mark": "ABC", "keep": 1, "remove": 1})
+
+ # Sweeping with a different mark raises an error
+ with self.assertRaises(InvokeError):
+ self.client.gc_sweep("DEF")
+
+ # Both hashes are present
+ self.assertClientGetHash(self.client, taskhash2, unihash2)
+ self.assertClientGetHash(self.client, taskhash, unihash)
+
+ def test_gc_new_hashes(self):
+ taskhash = '53b8dce672cb6d0c73170be43f540460bfc347b4'
+ outhash = '5a9cb1649625f0bf41fc7791b635cd9c2d7118c7f021ba87dcd03f72b67ce7a8'
+ unihash = 'f37918cc02eb5a520b1aff86faacbc0a38124646'
+
+ result = self.client.report_unihash(taskhash, self.METHOD, outhash, unihash)
+ self.assertEqual(result['unihash'], unihash, 'Server returned bad unihash')
+
+ # Start a new garbage collection
+ ret = self.client.gc_mark("ABC", {"unihash": unihash, "method": self.METHOD})
+ self.assertEqual(ret, {"count": 1})
+
+ ret = self.client.gc_status()
+ self.assertEqual(ret, {"mark": "ABC", "keep": 1, "remove": 0})
+
+ # Add second hash. It should inherit the mark from the current garbage
+ # collection operation
+
+ taskhash2 = '3bf6f1e89d26205aec90da04854fbdbf73afe6b4'
+ outhash2 = '77623a549b5b1a31e3732dfa8fe61d7ce5d44b3370f253c5360e136b852967b4'
+ unihash2 = 'af36b199320e611fbb16f1f277d3ee1d619ca58b'
+
+ result = self.client.report_unihash(taskhash2, self.METHOD, outhash2, unihash2)
+ self.assertClientGetHash(self.client, taskhash2, unihash2)
+
+ # Sweep should remove nothing
+ ret = self.client.gc_sweep("ABC")
+ self.assertEqual(ret, {"count": 0})
+
+ # Both hashes are present
+ self.assertClientGetHash(self.client, taskhash2, unihash2)
+ self.assertClientGetHash(self.client, taskhash, unihash)
+
+
+class TestHashEquivalenceClient(HashEquivalenceTestSetup, unittest.TestCase):
+ def get_server_addr(self, server_idx):
+ return "unix://" + os.path.join(self.temp_dir.name, 'sock%d' % server_idx)
+
+ def test_get(self):
+ taskhash, outhash, unihash = self.create_test_hash(self.client)
+
+ p = self.run_hashclient(["--address", self.server_address, "get", self.METHOD, taskhash])
+ data = json.loads(p.stdout)
+ self.assertEqual(data["unihash"], unihash)
+ self.assertEqual(data["outhash"], outhash)
+ self.assertEqual(data["taskhash"], taskhash)
+ self.assertEqual(data["method"], self.METHOD)
+
+ def test_get_outhash(self):
+ taskhash, outhash, unihash = self.create_test_hash(self.client)
+
+ p = self.run_hashclient(["--address", self.server_address, "get-outhash", self.METHOD, outhash, taskhash])
+ data = json.loads(p.stdout)
+ self.assertEqual(data["unihash"], unihash)
+ self.assertEqual(data["outhash"], outhash)
+ self.assertEqual(data["taskhash"], taskhash)
+ self.assertEqual(data["method"], self.METHOD)
+
+ def test_stats(self):
+ p = self.run_hashclient(["--address", self.server_address, "stats"], check=True)
+ json.loads(p.stdout)
+
+ def test_stress(self):
+ self.run_hashclient(["--address", self.server_address, "stress"], check=True)
+
+ def test_unihash_exsits(self):
+ taskhash, outhash, unihash = self.create_test_hash(self.client)
+
+ p = self.run_hashclient([
+ "--address", self.server_address,
+ "unihash-exists", unihash,
+ ], check=True)
+ self.assertEqual(p.stdout.strip(), "true")
+
+ p = self.run_hashclient([
+ "--address", self.server_address,
+ "unihash-exists", '6662e699d6e3d894b24408ff9a4031ef9b038ee8',
+ ], check=True)
+ self.assertEqual(p.stdout.strip(), "false")
+
+ def test_unihash_exsits_quiet(self):
+ taskhash, outhash, unihash = self.create_test_hash(self.client)
+
+ p = self.run_hashclient([
+ "--address", self.server_address,
+ "unihash-exists", unihash,
+ "--quiet",
+ ])
+ self.assertEqual(p.returncode, 0)
+ self.assertEqual(p.stdout.strip(), "")
+
+ p = self.run_hashclient([
+ "--address", self.server_address,
+ "unihash-exists", '6662e699d6e3d894b24408ff9a4031ef9b038ee8',
+ "--quiet",
+ ])
+ self.assertEqual(p.returncode, 1)
+ self.assertEqual(p.stdout.strip(), "")
+
+ def test_remove_taskhash(self):
+ taskhash, outhash, unihash = self.create_test_hash(self.client)
+ self.run_hashclient([
+ "--address", self.server_address,
+ "remove",
+ "--where", "taskhash", taskhash,
+ ], check=True)
+ self.assertClientGetHash(self.client, taskhash, None)
+
+ result_outhash = self.client.get_outhash(self.METHOD, outhash, taskhash)
+ self.assertIsNone(result_outhash)
+
+ def test_remove_unihash(self):
+ taskhash, outhash, unihash = self.create_test_hash(self.client)
+ self.run_hashclient([
+ "--address", self.server_address,
+ "remove",
+ "--where", "unihash", unihash,
+ ], check=True)
+ self.assertClientGetHash(self.client, taskhash, None)
+
+ def test_remove_outhash(self):
+ taskhash, outhash, unihash = self.create_test_hash(self.client)
+ self.run_hashclient([
+ "--address", self.server_address,
+ "remove",
+ "--where", "outhash", outhash,
+ ], check=True)
+
+ result_outhash = self.client.get_outhash(self.METHOD, outhash, taskhash)
+ self.assertIsNone(result_outhash)
+
+ def test_remove_method(self):
+ taskhash, outhash, unihash = self.create_test_hash(self.client)
+ self.run_hashclient([
+ "--address", self.server_address,
+ "remove",
+ "--where", "method", self.METHOD,
+ ], check=True)
+ self.assertClientGetHash(self.client, taskhash, None)
+
+ result_outhash = self.client.get_outhash(self.METHOD, outhash, taskhash)
+ self.assertIsNone(result_outhash)
+
+ def test_clean_unused(self):
+ taskhash, outhash, unihash = self.create_test_hash(self.client)
+
+ # Clean the database, which should not remove anything because all hashes an in-use
+ self.run_hashclient([
+ "--address", self.server_address,
+ "clean-unused", "0",
+ ], check=True)
+ self.assertClientGetHash(self.client, taskhash, unihash)
+
+ # Remove the unihash. The row in the outhash table should still be present
+ self.run_hashclient([
+ "--address", self.server_address,
+ "remove",
+ "--where", "unihash", unihash,
+ ], check=True)
+ result_outhash = self.client.get_outhash(self.METHOD, outhash, taskhash, False)
+ self.assertIsNotNone(result_outhash)
+
+ # Now clean with no minimum age which will remove the outhash
+ self.run_hashclient([
+ "--address", self.server_address,
+ "clean-unused", "0",
+ ], check=True)
+ result_outhash = self.client.get_outhash(self.METHOD, outhash, taskhash, False)
+ self.assertIsNone(result_outhash)
+
+ def test_refresh_token(self):
+ admin_client = self.start_auth_server()
+
+ user = admin_client.new_user("test-user", ["@read", "@report"])
+
+ p = self.run_hashclient([
+ "--address", self.auth_server_address,
+ "--login", user["username"],
+ "--password", user["token"],
+ "refresh-token"
+ ], check=True)
+
+ new_token = None
+ for l in p.stdout.splitlines():
+ l = l.rstrip()
+ m = re.match(r'Token: +(.*)$', l)
+ if m is not None:
+ new_token = m.group(1)
+
+ self.assertTrue(new_token)
+
+ print("New token is %r" % new_token)
+
+ self.run_hashclient([
+ "--address", self.auth_server_address,
+ "--login", user["username"],
+ "--password", new_token,
+ "get-user"
+ ], check=True)
+
+ def test_set_user_perms(self):
+ admin_client = self.start_auth_server()
+
+ user = admin_client.new_user("test-user", ["@read"])
+
+ self.run_hashclient([
+ "--address", self.auth_server_address,
+ "--login", admin_client.username,
+ "--password", admin_client.password,
+ "set-user-perms",
+ "-u", user["username"],
+ "@read", "@report",
+ ], check=True)
+
+ new_user = admin_client.get_user(user["username"])
+
+ self.assertEqual(set(new_user["permissions"]), {"@read", "@report"})
+
+ def test_get_user(self):
+ admin_client = self.start_auth_server()
+
+ user = admin_client.new_user("test-user", ["@read"])
+
+ p = self.run_hashclient([
+ "--address", self.auth_server_address,
+ "--login", admin_client.username,
+ "--password", admin_client.password,
+ "get-user",
+ "-u", user["username"],
+ ], check=True)
+
+ self.assertIn("Username:", p.stdout)
+ self.assertIn("Permissions:", p.stdout)
+
+ p = self.run_hashclient([
+ "--address", self.auth_server_address,
+ "--login", user["username"],
+ "--password", user["token"],
+ "get-user",
+ ], check=True)
+
+ self.assertIn("Username:", p.stdout)
+ self.assertIn("Permissions:", p.stdout)
+
+ def test_get_all_users(self):
+ admin_client = self.start_auth_server()
+
+ admin_client.new_user("test-user1", ["@read"])
+ admin_client.new_user("test-user2", ["@read"])
+
+ p = self.run_hashclient([
+ "--address", self.auth_server_address,
+ "--login", admin_client.username,
+ "--password", admin_client.password,
+ "get-all-users",
+ ], check=True)
+
+ self.assertIn("admin", p.stdout)
+ self.assertIn("test-user1", p.stdout)
+ self.assertIn("test-user2", p.stdout)
+
+ def test_new_user(self):
+ admin_client = self.start_auth_server()
+
+ p = self.run_hashclient([
+ "--address", self.auth_server_address,
+ "--login", admin_client.username,
+ "--password", admin_client.password,
+ "new-user",
+ "-u", "test-user",
+ "@read", "@report",
+ ], check=True)
+
+ new_token = None
+ for l in p.stdout.splitlines():
+ l = l.rstrip()
+ m = re.match(r'Token: +(.*)$', l)
+ if m is not None:
+ new_token = m.group(1)
+
+ self.assertTrue(new_token)
+
+ user = {
+ "username": "test-user",
+ "token": new_token,
+ }
+
+ self.assertUserPerms(user, ["@read", "@report"])
+
+ def test_delete_user(self):
+ admin_client = self.start_auth_server()
+
+ user = admin_client.new_user("test-user", ["@read"])
+
+ p = self.run_hashclient([
+ "--address", self.auth_server_address,
+ "--login", admin_client.username,
+ "--password", admin_client.password,
+ "delete-user",
+ "-u", user["username"],
+ ], check=True)
+
+ self.assertIsNone(admin_client.get_user(user["username"]))
+
+ def test_get_db_usage(self):
+ p = self.run_hashclient([
+ "--address", self.server_address,
+ "get-db-usage",
+ ], check=True)
+
+ def test_get_db_query_columns(self):
+ p = self.run_hashclient([
+ "--address", self.server_address,
+ "get-db-query-columns",
+ ], check=True)
+
+ def test_gc(self):
+ taskhash = '53b8dce672cb6d0c73170be43f540460bfc347b4'
+ outhash = '5a9cb1649625f0bf41fc7791b635cd9c2d7118c7f021ba87dcd03f72b67ce7a8'
+ unihash = 'f37918cc02eb5a520b1aff86faacbc0a38124646'
+
+ result = self.client.report_unihash(taskhash, self.METHOD, outhash, unihash)
+ self.assertEqual(result['unihash'], unihash, 'Server returned bad unihash')
+
+ taskhash2 = '3bf6f1e89d26205aec90da04854fbdbf73afe6b4'
+ outhash2 = '77623a549b5b1a31e3732dfa8fe61d7ce5d44b3370f253c5360e136b852967b4'
+ unihash2 = 'af36b199320e611fbb16f1f277d3ee1d619ca58b'
+
+ result = self.client.report_unihash(taskhash2, self.METHOD, outhash2, unihash2)
+ self.assertClientGetHash(self.client, taskhash2, unihash2)
+
+ # Mark the first unihash to be kept
+ self.run_hashclient([
+ "--address", self.server_address,
+ "gc-mark", "ABC",
+ "--where", "unihash", unihash,
+ "--where", "method", self.METHOD
+ ], check=True)
+
+ # Second hash is still there; mark doesn't delete hashes
+ self.assertClientGetHash(self.client, taskhash2, unihash2)
+
+ self.run_hashclient([
+ "--address", self.server_address,
+ "gc-sweep", "ABC",
+ ], check=True)
+
+ # Hash is gone. Taskhash is returned for second hash
+ self.assertClientGetHash(self.client, taskhash2, None)
+ # First hash is still present
+ self.assertClientGetHash(self.client, taskhash, unihash)
+
+
class TestHashEquivalenceUnixServer(HashEquivalenceTestSetup, HashEquivalenceCommonTests, unittest.TestCase):
def get_server_addr(self, server_idx):
return "unix://" + os.path.join(self.temp_dir.name, 'sock%d' % server_idx)
@@ -431,3 +1437,77 @@ class TestHashEquivalenceTCPServer(HashEquivalenceTestSetup, HashEquivalenceComm
# If IPv6 is enabled, it should be safe to use localhost directly, in general
# case it is more reliable to resolve the IP address explicitly.
return socket.gethostbyname("localhost") + ":0"
+
+
+class TestHashEquivalenceWebsocketServer(HashEquivalenceTestSetup, HashEquivalenceCommonTests, unittest.TestCase):
+ def setUp(self):
+ try:
+ import websockets
+ except ImportError as e:
+ self.skipTest(str(e))
+
+ super().setUp()
+
+ def get_server_addr(self, server_idx):
+ # Some hosts cause asyncio module to misbehave, when IPv6 is not enabled.
+ # If IPv6 is enabled, it should be safe to use localhost directly, in general
+ # case it is more reliable to resolve the IP address explicitly.
+ host = socket.gethostbyname("localhost")
+ return "ws://%s:0" % host
+
+
+class TestHashEquivalenceWebsocketsSQLAlchemyServer(TestHashEquivalenceWebsocketServer):
+ def setUp(self):
+ try:
+ import sqlalchemy
+ import aiosqlite
+ except ImportError as e:
+ self.skipTest(str(e))
+
+ super().setUp()
+
+ def make_dbpath(self):
+ return "sqlite+aiosqlite:///%s" % os.path.join(self.temp_dir.name, "db%d.sqlite" % self.server_index)
+
+
+class TestHashEquivalenceExternalServer(HashEquivalenceTestSetup, HashEquivalenceCommonTests, unittest.TestCase):
+ def get_env(self, name):
+ v = os.environ.get(name)
+ if not v:
+ self.skipTest(f'{name} not defined to test an external server')
+ return v
+
+ def start_test_server(self):
+ return self.get_env('BB_TEST_HASHSERV')
+
+ def start_server(self, *args, **kwargs):
+ self.skipTest('Cannot start local server when testing external servers')
+
+ def start_auth_server(self):
+
+ self.auth_server_address = self.server_address
+ self.admin_client = self.start_client(
+ self.server_address,
+ username=self.get_env('BB_TEST_HASHSERV_USERNAME'),
+ password=self.get_env('BB_TEST_HASHSERV_PASSWORD'),
+ )
+ return self.admin_client
+
+ def setUp(self):
+ super().setUp()
+ if "BB_TEST_HASHSERV_USERNAME" in os.environ:
+ self.client = self.start_client(
+ self.server_address,
+ username=os.environ["BB_TEST_HASHSERV_USERNAME"],
+ password=os.environ["BB_TEST_HASHSERV_PASSWORD"],
+ )
+ self.client.remove({"method": self.METHOD})
+
+ def tearDown(self):
+ self.client.remove({"method": self.METHOD})
+ super().tearDown()
+
+
+ def test_auth_get_all_users(self):
+ self.skipTest("Cannot test all users with external server")
+
diff --git a/bitbake/lib/layerindexlib/__init__.py b/bitbake/lib/layerindexlib/__init__.py
index ac03d89876..c3265ddaa1 100644
--- a/bitbake/lib/layerindexlib/__init__.py
+++ b/bitbake/lib/layerindexlib/__init__.py
@@ -178,9 +178,9 @@ class LayerIndex():
'''Load the layerindex.
indexURI - An index to load. (Use multiple calls to load multiple indexes)
-
+
reload - If reload is True, then any previously loaded indexes will be forgotten.
-
+
load - List of elements to load. Default loads all items.
Note: plugs may ignore this.
@@ -383,7 +383,14 @@ layerBranches set. If not, they are effectively blank.'''
# Get a list of dependencies and then recursively process them
for layerdependency in layerbranch.index.layerDependencies_layerBranchId[layerbranch.id]:
- deplayerbranch = layerdependency.dependency_layerBranch
+ try:
+ deplayerbranch = layerdependency.dependency_layerBranch
+ except AttributeError as e:
+ logger.error('LayerBranch does not exist for dependent layer {}:{}\n' \
+ ' Cannot continue successfully.\n' \
+ ' You might be able to resolve this by checking out the layer locally.\n' \
+ ' Consider reaching out the to the layer maintainers or the layerindex admins' \
+ .format(layerdependency.dependency.name, layerbranch.branch.name))
if ignores and deplayerbranch.layer.name in ignores:
continue
@@ -846,7 +853,7 @@ class LayerIndexObj():
continue
for layerdependency in layerbranch.index.layerDependencies_layerBranchId[layerbranch.id]:
- deplayerbranch = layerdependency.dependency_layerBranch
+ deplayerbranch = layerdependency.dependency_layerBranch or None
if ignores and deplayerbranch.layer.name in ignores:
continue
diff --git a/bitbake/lib/ply/yacc.py b/bitbake/lib/ply/yacc.py
index 767c4e4674..381b50cf0b 100644
--- a/bitbake/lib/ply/yacc.py
+++ b/bitbake/lib/ply/yacc.py
@@ -2798,7 +2798,14 @@ class ParserReflect(object):
def signature(self):
try:
import hashlib
+ except ImportError:
+ raise RuntimeError("Unable to import hashlib")
+ try:
sig = hashlib.new('MD5', usedforsecurity=False)
+ except TypeError:
+ # Some configurations don't appear to support two arguments
+ sig = hashlib.new('MD5')
+ try:
if self.start:
sig.update(self.start.encode('latin-1'))
if self.prec:
diff --git a/bitbake/lib/progressbar/progressbar.py b/bitbake/lib/progressbar/progressbar.py
index e2b6ba1083..d4da10ab75 100644
--- a/bitbake/lib/progressbar/progressbar.py
+++ b/bitbake/lib/progressbar/progressbar.py
@@ -253,7 +253,7 @@ class ProgressBar(object):
if (self.maxval is not UnknownLength
and not 0 <= value <= self.maxval):
- raise ValueError('Value out of range')
+ self.maxval = value
self.currval = value
diff --git a/bitbake/lib/prserv/__init__.py b/bitbake/lib/prserv/__init__.py
index 38ced818ad..a817b03c1e 100644
--- a/bitbake/lib/prserv/__init__.py
+++ b/bitbake/lib/prserv/__init__.py
@@ -4,17 +4,92 @@
# SPDX-License-Identifier: GPL-2.0-only
#
-__version__ = "1.0.0"
-import os, time
-import sys,logging
+__version__ = "2.0.0"
-def init_logger(logfile, loglevel):
- numeric_level = getattr(logging, loglevel.upper(), None)
- if not isinstance(numeric_level, int):
- raise ValueError('Invalid log level: %s' % loglevel)
- FORMAT = '%(asctime)-15s %(message)s'
- logging.basicConfig(level=numeric_level, filename=logfile, format=FORMAT)
+import logging
+logger = logging.getLogger("BitBake.PRserv")
-class NotFoundError(Exception):
- pass
+from bb.asyncrpc.client import parse_address, ADDR_TYPE_UNIX, ADDR_TYPE_WS
+
+def create_server(addr, dbpath, upstream=None, read_only=False):
+ from . import serv
+
+ s = serv.PRServer(dbpath, upstream=upstream, read_only=read_only)
+ host, port = addr.split(":")
+ s.start_tcp_server(host, int(port))
+
+ return s
+
+def increase_revision(ver):
+ """Take a revision string such as "1" or "1.2.3" or even a number and increase its last number
+ This fails if the last number is not an integer"""
+
+ fields=str(ver).split('.')
+ last = fields[-1]
+
+ try:
+ val = int(last)
+ except Exception as e:
+ logger.critical("Unable to increase revision value %s: %s" % (ver, e))
+ raise e
+
+ return ".".join(fields[0:-1] + list(str(val + 1)))
+
+def _revision_greater_or_equal(rev1, rev2):
+ """Compares x.y.z revision numbers, using integer comparison
+ Returns True if rev1 is greater or equal to rev2"""
+
+ fields1 = rev1.split(".")
+ fields2 = rev2.split(".")
+ l1 = len(fields1)
+ l2 = len(fields2)
+
+ for i in range(l1):
+ val1 = int(fields1[i])
+ if i < l2:
+ val2 = int(fields2[i])
+ if val2 < val1:
+ return True
+ elif val2 > val1:
+ return False
+ else:
+ return True
+ return True
+
+def revision_smaller(rev1, rev2):
+ """Compares x.y.z revision numbers, using integer comparison
+ Returns True if rev1 is strictly smaller than rev2"""
+ return not(_revision_greater_or_equal(rev1, rev2))
+
+def revision_greater(rev1, rev2):
+ """Compares x.y.z revision numbers, using integer comparison
+ Returns True if rev1 is strictly greater than rev2"""
+ return _revision_greater_or_equal(rev1, rev2) and (rev1 != rev2)
+
+def create_client(addr):
+ from . import client
+
+ c = client.PRClient()
+
+ try:
+ (typ, a) = parse_address(addr)
+ c.connect_tcp(*a)
+ return c
+ except Exception as e:
+ c.close()
+ raise e
+
+async def create_async_client(addr):
+ from . import client
+
+ c = client.PRAsyncClient()
+
+ try:
+ (typ, a) = parse_address(addr)
+ await c.connect_tcp(*a)
+ return c
+
+ except Exception as e:
+ await c.close()
+ raise e
diff --git a/bitbake/lib/prserv/client.py b/bitbake/lib/prserv/client.py
index 69ab7a4ac9..9f5794c433 100644
--- a/bitbake/lib/prserv/client.py
+++ b/bitbake/lib/prserv/client.py
@@ -6,45 +6,67 @@
import logging
import bb.asyncrpc
+from . import create_async_client
logger = logging.getLogger("BitBake.PRserv")
class PRAsyncClient(bb.asyncrpc.AsyncClient):
def __init__(self):
- super().__init__('PRSERVICE', '1.0', logger)
+ super().__init__("PRSERVICE", "1.0", logger)
- async def getPR(self, version, pkgarch, checksum):
- response = await self.send_message(
- {'get-pr': {'version': version, 'pkgarch': pkgarch, 'checksum': checksum}}
+ async def getPR(self, version, pkgarch, checksum, history=False):
+ response = await self.invoke(
+ {"get-pr": {"version": version, "pkgarch": pkgarch, "checksum": checksum, "history": history}}
)
if response:
- return response['value']
+ return response["value"]
+
+ async def test_pr(self, version, pkgarch, checksum, history=False):
+ response = await self.invoke(
+ {"test-pr": {"version": version, "pkgarch": pkgarch, "checksum": checksum, "history": history}}
+ )
+ if response:
+ return response["value"]
+
+ async def test_package(self, version, pkgarch):
+ response = await self.invoke(
+ {"test-package": {"version": version, "pkgarch": pkgarch}}
+ )
+ if response:
+ return response["value"]
+
+ async def max_package_pr(self, version, pkgarch):
+ response = await self.invoke(
+ {"max-package-pr": {"version": version, "pkgarch": pkgarch}}
+ )
+ if response:
+ return response["value"]
async def importone(self, version, pkgarch, checksum, value):
- response = await self.send_message(
- {'import-one': {'version': version, 'pkgarch': pkgarch, 'checksum': checksum, 'value': value}}
+ response = await self.invoke(
+ {"import-one": {"version": version, "pkgarch": pkgarch, "checksum": checksum, "value": value}}
)
if response:
- return response['value']
+ return response["value"]
- async def export(self, version, pkgarch, checksum, colinfo):
- response = await self.send_message(
- {'export': {'version': version, 'pkgarch': pkgarch, 'checksum': checksum, 'colinfo': colinfo}}
+ async def export(self, version, pkgarch, checksum, colinfo, history=False):
+ response = await self.invoke(
+ {"export": {"version": version, "pkgarch": pkgarch, "checksum": checksum, "colinfo": colinfo, "history": history}}
)
if response:
- return (response['metainfo'], response['datainfo'])
+ return (response["metainfo"], response["datainfo"])
async def is_readonly(self):
- response = await self.send_message(
- {'is-readonly': {}}
+ response = await self.invoke(
+ {"is-readonly": {}}
)
if response:
- return response['readonly']
+ return response["readonly"]
class PRClient(bb.asyncrpc.Client):
def __init__(self):
super().__init__()
- self._add_methods('getPR', 'importone', 'export', 'is_readonly')
+ self._add_methods("getPR", "test_pr", "test_package", "max_package_pr", "importone", "export", "is_readonly")
def _get_async_client(self):
return PRAsyncClient()
diff --git a/bitbake/lib/prserv/db.py b/bitbake/lib/prserv/db.py
index b4bda7078c..2da493ddf5 100644
--- a/bitbake/lib/prserv/db.py
+++ b/bitbake/lib/prserv/db.py
@@ -8,19 +8,13 @@ import logging
import os.path
import errno
import prserv
-import time
+import sqlite3
-try:
- import sqlite3
-except ImportError:
- from pysqlite2 import dbapi2 as sqlite3
+from contextlib import closing
+from . import increase_revision, revision_greater, revision_smaller
logger = logging.getLogger("BitBake.PRserv")
-sqlversion = sqlite3.sqlite_version_info
-if sqlversion[0] < 3 or (sqlversion[0] == 3 and sqlversion[1] < 3):
- raise Exception("sqlite3 version 3.3.0 or later is required.")
-
#
# "No History" mode - for a given query tuple (version, pkgarch, checksum),
# the returned value will be the largest among all the values of the same
@@ -29,245 +23,232 @@ if sqlversion[0] < 3 or (sqlversion[0] == 3 and sqlversion[1] < 3):
# "History" mode - Return a new higher value for previously unseen query
# tuple (version, pkgarch, checksum), otherwise return historical value.
# Value can decrement if returning to a previous build.
-#
class PRTable(object):
- def __init__(self, conn, table, nohist, read_only):
+ def __init__(self, conn, table, read_only):
self.conn = conn
- self.nohist = nohist
self.read_only = read_only
- self.dirty = False
- if nohist:
- self.table = "%s_nohist" % table
- else:
- self.table = "%s_hist" % table
-
- if self.read_only:
- table_exists = self._execute(
- "SELECT count(*) FROM sqlite_master \
- WHERE type='table' AND name='%s'" % (self.table))
- if not table_exists:
- raise prserv.NotFoundError
- else:
- self._execute("CREATE TABLE IF NOT EXISTS %s \
+ self.table = table
+
+ # Creating the table even if the server is read-only.
+ # This avoids a race condition if a shared database
+ # is accessed by a read-only server first.
+
+ with closing(self.conn.cursor()) as cursor:
+ cursor.execute("CREATE TABLE IF NOT EXISTS %s \
(version TEXT NOT NULL, \
pkgarch TEXT NOT NULL, \
checksum TEXT NOT NULL, \
- value INTEGER, \
- PRIMARY KEY (version, pkgarch, checksum));" % self.table)
-
- def _execute(self, *query):
- """Execute a query, waiting to acquire a lock if necessary"""
- start = time.time()
- end = start + 20
- while True:
- try:
- return self.conn.execute(*query)
- except sqlite3.OperationalError as exc:
- if 'is locked' in str(exc) and end > time.time():
- continue
- raise exc
-
- def sync(self):
- if not self.read_only:
+ value TEXT, \
+ PRIMARY KEY (version, pkgarch, checksum, value));" % self.table)
self.conn.commit()
- self._execute("BEGIN EXCLUSIVE TRANSACTION")
-
- def sync_if_dirty(self):
- if self.dirty:
- self.sync()
- self.dirty = False
-
- def _getValueHist(self, version, pkgarch, checksum):
- data=self._execute("SELECT value FROM %s WHERE version=? AND pkgarch=? AND checksum=?;" % self.table,
- (version, pkgarch, checksum))
- row=data.fetchone()
- if row is not None:
- return row[0]
- else:
- #no value found, try to insert
- if self.read_only:
- data = self._execute("SELECT ifnull(max(value)+1,0) FROM %s where version=? AND pkgarch=?;" % (self.table),
- (version, pkgarch))
- row = data.fetchone()
- if row is not None:
- return row[0]
+
+ def _extremum_value(self, rows, is_max):
+ value = None
+
+ for row in rows:
+ current_value = row[0]
+ if value is None:
+ value = current_value
+ else:
+ if is_max:
+ is_new_extremum = revision_greater(current_value, value)
else:
- return 0
+ is_new_extremum = revision_smaller(current_value, value)
+ if is_new_extremum:
+ value = current_value
+ return value
+
+ def _max_value(self, rows):
+ return self._extremum_value(rows, True)
- try:
- self._execute("INSERT INTO %s VALUES (?, ?, ?, (select ifnull(max(value)+1,0) from %s where version=? AND pkgarch=?));"
- % (self.table,self.table),
- (version,pkgarch, checksum,version, pkgarch))
- except sqlite3.IntegrityError as exc:
- logger.error(str(exc))
+ def _min_value(self, rows):
+ return self._extremum_value(rows, False)
- self.dirty = True
+ def test_package(self, version, pkgarch):
+ """Returns whether the specified package version is found in the database for the specified architecture"""
- data=self._execute("SELECT value FROM %s WHERE version=? AND pkgarch=? AND checksum=?;" % self.table,
- (version, pkgarch, checksum))
+ # Just returns the value if found or None otherwise
+ with closing(self.conn.cursor()) as cursor:
+ data=cursor.execute("SELECT value FROM %s WHERE version=? AND pkgarch=?;" % self.table,
+ (version, pkgarch))
row=data.fetchone()
if row is not None:
- return row[0]
+ return True
else:
- raise prserv.NotFoundError
-
- def _getValueNohist(self, version, pkgarch, checksum):
- data=self._execute("SELECT value FROM %s \
- WHERE version=? AND pkgarch=? AND checksum=? AND \
- value >= (select max(value) from %s where version=? AND pkgarch=?);"
- % (self.table, self.table),
- (version, pkgarch, checksum, version, pkgarch))
- row=data.fetchone()
- if row is not None:
- return row[0]
- else:
- #no value found, try to insert
- if self.read_only:
- data = self._execute("SELECT ifnull(max(value)+1,0) FROM %s where version=? AND pkgarch=?;" % (self.table),
- (version, pkgarch))
- row = data.fetchone()
- if row is not None:
- return row[0]
- else:
- return 0
+ return False
+
+ def test_checksum_value(self, version, pkgarch, checksum, value):
+ """Returns whether the specified value is found in the database for the specified package, architecture and checksum"""
- try:
- self._execute("INSERT OR REPLACE INTO %s VALUES (?, ?, ?, (select ifnull(max(value)+1,0) from %s where version=? AND pkgarch=?));"
- % (self.table,self.table),
- (version, pkgarch, checksum, version, pkgarch))
- except sqlite3.IntegrityError as exc:
- logger.error(str(exc))
- self.conn.rollback()
+ with closing(self.conn.cursor()) as cursor:
+ data=cursor.execute("SELECT value FROM %s WHERE version=? AND pkgarch=? and checksum=? and value=?;" % self.table,
+ (version, pkgarch, checksum, value))
+ row=data.fetchone()
+ if row is not None:
+ return True
+ else:
+ return False
- self.dirty = True
+ def test_value(self, version, pkgarch, value):
+ """Returns whether the specified value is found in the database for the specified package and architecture"""
- data=self._execute("SELECT value FROM %s WHERE version=? AND pkgarch=? AND checksum=?;" % self.table,
- (version, pkgarch, checksum))
+ # Just returns the value if found or None otherwise
+ with closing(self.conn.cursor()) as cursor:
+ data=cursor.execute("SELECT value FROM %s WHERE version=? AND pkgarch=? and value=?;" % self.table,
+ (version, pkgarch, value))
row=data.fetchone()
if row is not None:
- return row[0]
+ return True
else:
- raise prserv.NotFoundError
+ return False
- def getValue(self, version, pkgarch, checksum):
- if self.nohist:
- return self._getValueNohist(version, pkgarch, checksum)
- else:
- return self._getValueHist(version, pkgarch, checksum)
-
- def _importHist(self, version, pkgarch, checksum, value):
- if self.read_only:
- return None
-
- val = None
- data = self._execute("SELECT value FROM %s WHERE version=? AND pkgarch=? AND checksum=?;" % self.table,
- (version, pkgarch, checksum))
- row = data.fetchone()
- if row is not None:
- val=row[0]
+
+ def find_package_max_value(self, version, pkgarch):
+ """Returns the greatest value for (version, pkgarch), or None if not found. Doesn't create a new value"""
+
+ with closing(self.conn.cursor()) as cursor:
+ data = cursor.execute("SELECT value FROM %s where version=? AND pkgarch=?;" % (self.table),
+ (version, pkgarch))
+ rows = data.fetchall()
+ value = self._max_value(rows)
+ return value
+
+ def find_value(self, version, pkgarch, checksum, history=False):
+ """Returns the value for the specified checksum if found or None otherwise."""
+
+ if history:
+ return self.find_min_value(version, pkgarch, checksum)
else:
- #no value found, try to insert
- try:
- self._execute("INSERT INTO %s VALUES (?, ?, ?, ?);" % (self.table),
+ return self.find_max_value(version, pkgarch, checksum)
+
+
+ def _find_extremum_value(self, version, pkgarch, checksum, is_max):
+ """Returns the maximum (if is_max is True) or minimum (if is_max is False) value
+ for (version, pkgarch, checksum), or None if not found. Doesn't create a new value"""
+
+ with closing(self.conn.cursor()) as cursor:
+ data = cursor.execute("SELECT value FROM %s where version=? AND pkgarch=? AND checksum=?;" % (self.table),
+ (version, pkgarch, checksum))
+ rows = data.fetchall()
+ return self._extremum_value(rows, is_max)
+
+ def find_max_value(self, version, pkgarch, checksum):
+ return self._find_extremum_value(version, pkgarch, checksum, True)
+
+ def find_min_value(self, version, pkgarch, checksum):
+ return self._find_extremum_value(version, pkgarch, checksum, False)
+
+ def find_new_subvalue(self, version, pkgarch, base):
+ """Take and increase the greatest "<base>.y" value for (version, pkgarch), or return "<base>.0" if not found.
+ This doesn't store a new value."""
+
+ with closing(self.conn.cursor()) as cursor:
+ data = cursor.execute("SELECT value FROM %s where version=? AND pkgarch=? AND value LIKE '%s.%%';" % (self.table, base),
+ (version, pkgarch))
+ rows = data.fetchall()
+ value = self._max_value(rows)
+
+ if value is not None:
+ return increase_revision(value)
+ else:
+ return base + ".0"
+
+ def store_value(self, version, pkgarch, checksum, value):
+ """Store value in the database"""
+
+ if not self.read_only and not self.test_checksum_value(version, pkgarch, checksum, value):
+ with closing(self.conn.cursor()) as cursor:
+ cursor.execute("INSERT INTO %s VALUES (?, ?, ?, ?);" % (self.table),
(version, pkgarch, checksum, value))
- except sqlite3.IntegrityError as exc:
- logger.error(str(exc))
+ self.conn.commit()
- self.dirty = True
+ def _get_value(self, version, pkgarch, checksum, history):
- data = self._execute("SELECT value FROM %s WHERE version=? AND pkgarch=? AND checksum=?;" % self.table,
- (version, pkgarch, checksum))
- row = data.fetchone()
- if row is not None:
- val = row[0]
- return val
+ max_value = self.find_package_max_value(version, pkgarch)
- def _importNohist(self, version, pkgarch, checksum, value):
- if self.read_only:
- return None
+ if max_value is None:
+ # version, pkgarch completely unknown. Return initial value.
+ return "0"
- try:
- #try to insert
- self._execute("INSERT INTO %s VALUES (?, ?, ?, ?);" % (self.table),
- (version, pkgarch, checksum,value))
- except sqlite3.IntegrityError as exc:
- #already have the record, try to update
- try:
- self._execute("UPDATE %s SET value=? WHERE version=? AND pkgarch=? AND checksum=? AND value<?"
- % (self.table),
- (value,version,pkgarch,checksum,value))
- except sqlite3.IntegrityError as exc:
- logger.error(str(exc))
-
- self.dirty = True
-
- data = self._execute("SELECT value FROM %s WHERE version=? AND pkgarch=? AND checksum=? AND value>=?;" % self.table,
- (version,pkgarch,checksum,value))
- row=data.fetchone()
- if row is not None:
- return row[0]
+ value = self.find_value(version, pkgarch, checksum, history)
+
+ if value is None:
+ # version, pkgarch found but not checksum. Create a new value from the maximum one
+ return increase_revision(max_value)
+
+ if history:
+ return value
+
+ # "no history" mode - If the value is not the maximum value for the package, need to increase it.
+ if max_value > value:
+ return increase_revision(max_value)
else:
- return None
+ return value
+
+ def get_value(self, version, pkgarch, checksum, history):
+ value = self._get_value(version, pkgarch, checksum, history)
+ if not self.read_only:
+ self.store_value(version, pkgarch, checksum, value)
+ return value
def importone(self, version, pkgarch, checksum, value):
- if self.nohist:
- return self._importNohist(version, pkgarch, checksum, value)
- else:
- return self._importHist(version, pkgarch, checksum, value)
+ self.store_value(version, pkgarch, checksum, value)
+ return value
- def export(self, version, pkgarch, checksum, colinfo):
+ def export(self, version, pkgarch, checksum, colinfo, history=False):
metainfo = {}
- #column info
- if colinfo:
- metainfo['tbl_name'] = self.table
- metainfo['core_ver'] = prserv.__version__
- metainfo['col_info'] = []
- data = self._execute("PRAGMA table_info(%s);" % self.table)
+ with closing(self.conn.cursor()) as cursor:
+ #column info
+ if colinfo:
+ metainfo["tbl_name"] = self.table
+ metainfo["core_ver"] = prserv.__version__
+ metainfo["col_info"] = []
+ data = cursor.execute("PRAGMA table_info(%s);" % self.table)
+ for row in data:
+ col = {}
+ col["name"] = row["name"]
+ col["type"] = row["type"]
+ col["notnull"] = row["notnull"]
+ col["dflt_value"] = row["dflt_value"]
+ col["pk"] = row["pk"]
+ metainfo["col_info"].append(col)
+
+ #data info
+ datainfo = []
+
+ if history:
+ sqlstmt = "SELECT * FROM %s as T1 WHERE 1=1 " % self.table
+ else:
+ sqlstmt = "SELECT T1.version, T1.pkgarch, T1.checksum, T1.value FROM %s as T1, \
+ (SELECT version, pkgarch, max(value) as maxvalue FROM %s GROUP BY version, pkgarch) as T2 \
+ WHERE T1.version=T2.version AND T1.pkgarch=T2.pkgarch AND T1.value=T2.maxvalue " % (self.table, self.table)
+ sqlarg = []
+ where = ""
+ if version:
+ where += "AND T1.version=? "
+ sqlarg.append(str(version))
+ if pkgarch:
+ where += "AND T1.pkgarch=? "
+ sqlarg.append(str(pkgarch))
+ if checksum:
+ where += "AND T1.checksum=? "
+ sqlarg.append(str(checksum))
+
+ sqlstmt += where + ";"
+
+ if len(sqlarg):
+ data = cursor.execute(sqlstmt, tuple(sqlarg))
+ else:
+ data = cursor.execute(sqlstmt)
for row in data:
- col = {}
- col['name'] = row['name']
- col['type'] = row['type']
- col['notnull'] = row['notnull']
- col['dflt_value'] = row['dflt_value']
- col['pk'] = row['pk']
- metainfo['col_info'].append(col)
-
- #data info
- datainfo = []
-
- if self.nohist:
- sqlstmt = "SELECT T1.version, T1.pkgarch, T1.checksum, T1.value FROM %s as T1, \
- (SELECT version,pkgarch,max(value) as maxvalue FROM %s GROUP BY version,pkgarch) as T2 \
- WHERE T1.version=T2.version AND T1.pkgarch=T2.pkgarch AND T1.value=T2.maxvalue " % (self.table, self.table)
- else:
- sqlstmt = "SELECT * FROM %s as T1 WHERE 1=1 " % self.table
- sqlarg = []
- where = ""
- if version:
- where += "AND T1.version=? "
- sqlarg.append(str(version))
- if pkgarch:
- where += "AND T1.pkgarch=? "
- sqlarg.append(str(pkgarch))
- if checksum:
- where += "AND T1.checksum=? "
- sqlarg.append(str(checksum))
-
- sqlstmt += where + ";"
-
- if len(sqlarg):
- data = self._execute(sqlstmt, tuple(sqlarg))
- else:
- data = self._execute(sqlstmt)
- for row in data:
- if row['version']:
- col = {}
- col['version'] = row['version']
- col['pkgarch'] = row['pkgarch']
- col['checksum'] = row['checksum']
- col['value'] = row['value']
- datainfo.append(col)
+ if row["version"]:
+ col = {}
+ col["version"] = row["version"]
+ col["pkgarch"] = row["pkgarch"]
+ col["checksum"] = row["checksum"]
+ col["value"] = row["value"]
+ datainfo.append(col)
return (metainfo, datainfo)
def dump_db(self, fd):
@@ -275,14 +256,13 @@ class PRTable(object):
for line in self.conn.iterdump():
writeCount = writeCount + len(line) + 1
fd.write(line)
- fd.write('\n')
+ fd.write("\n")
return writeCount
class PRData(object):
"""Object representing the PR database"""
- def __init__(self, filename, nohist=True, read_only=False):
+ def __init__(self, filename, read_only=False):
self.filename=os.path.abspath(filename)
- self.nohist=nohist
self.read_only = read_only
#build directory hierarchy
try:
@@ -292,28 +272,30 @@ class PRData(object):
raise e
uri = "file:%s%s" % (self.filename, "?mode=ro" if self.read_only else "")
logger.debug("Opening PRServ database '%s'" % (uri))
- self.connection=sqlite3.connect(uri, uri=True, isolation_level="EXCLUSIVE", check_same_thread = False)
+ self.connection=sqlite3.connect(uri, uri=True)
self.connection.row_factory=sqlite3.Row
- if not self.read_only:
- self.connection.execute("pragma synchronous = off;")
- self.connection.execute("PRAGMA journal_mode = MEMORY;")
+ self.connection.execute("PRAGMA synchronous = OFF;")
+ self.connection.execute("PRAGMA journal_mode = WAL;")
+ self.connection.commit()
self._tables={}
def disconnect(self):
+ self.connection.commit()
self.connection.close()
- def __getitem__(self,tblname):
+ def __getitem__(self, tblname):
if not isinstance(tblname, str):
raise TypeError("tblname argument must be a string, not '%s'" %
type(tblname))
if tblname in self._tables:
return self._tables[tblname]
else:
- tableobj = self._tables[tblname] = PRTable(self.connection, tblname, self.nohist, self.read_only)
+ tableobj = self._tables[tblname] = PRTable(self.connection, tblname, self.read_only)
return tableobj
def __delitem__(self, tblname):
if tblname in self._tables:
del self._tables[tblname]
logger.info("drop table %s" % (tblname))
- self.connection.execute("DROP TABLE IF EXISTS %s;" % tblname)
+ self.connection.execute("DROP TABLE IF EXISTS %s;" % tblname)
+ self.connection.commit()
diff --git a/bitbake/lib/prserv/serv.py b/bitbake/lib/prserv/serv.py
index c686b2065c..e175886308 100644
--- a/bitbake/lib/prserv/serv.py
+++ b/bitbake/lib/prserv/serv.py
@@ -12,6 +12,7 @@ import sqlite3
import prserv
import prserv.db
import errno
+from . import create_async_client, revision_smaller, increase_revision
import bb.asyncrpc
logger = logging.getLogger("BitBake.PRserv")
@@ -20,121 +21,234 @@ PIDPREFIX = "/tmp/PRServer_%s_%s.pid"
singleton = None
class PRServerClient(bb.asyncrpc.AsyncServerConnection):
- def __init__(self, reader, writer, table, read_only):
- super().__init__(reader, writer, 'PRSERVICE', logger)
+ def __init__(self, socket, server):
+ super().__init__(socket, "PRSERVICE", server.logger)
+ self.server = server
+
self.handlers.update({
- 'get-pr': self.handle_get_pr,
- 'import-one': self.handle_import_one,
- 'export': self.handle_export,
- 'is-readonly': self.handle_is_readonly,
+ "get-pr": self.handle_get_pr,
+ "test-pr": self.handle_test_pr,
+ "test-package": self.handle_test_package,
+ "max-package-pr": self.handle_max_package_pr,
+ "import-one": self.handle_import_one,
+ "export": self.handle_export,
+ "is-readonly": self.handle_is_readonly,
})
- self.table = table
- self.read_only = read_only
def validate_proto_version(self):
return (self.proto_version == (1, 0))
async def dispatch_message(self, msg):
try:
- await super().dispatch_message(msg)
+ return await super().dispatch_message(msg)
except:
- self.table.sync()
raise
- self.table.sync_if_dirty()
+ async def handle_test_pr(self, request):
+ '''Finds the PR value corresponding to the request. If not found, returns None and doesn't insert a new value'''
+ version = request["version"]
+ pkgarch = request["pkgarch"]
+ checksum = request["checksum"]
+ history = request["history"]
+
+ value = self.server.table.find_value(version, pkgarch, checksum, history)
+ return {"value": value}
+
+ async def handle_test_package(self, request):
+ '''Tells whether there are entries for (version, pkgarch) in the db. Returns True or False'''
+ version = request["version"]
+ pkgarch = request["pkgarch"]
+
+ value = self.server.table.test_package(version, pkgarch)
+ return {"value": value}
+
+ async def handle_max_package_pr(self, request):
+ '''Finds the greatest PR value for (version, pkgarch) in the db. Returns None if no entry was found'''
+ version = request["version"]
+ pkgarch = request["pkgarch"]
+
+ value = self.server.table.find_package_max_value(version, pkgarch)
+ return {"value": value}
async def handle_get_pr(self, request):
- version = request['version']
- pkgarch = request['pkgarch']
- checksum = request['checksum']
+ version = request["version"]
+ pkgarch = request["pkgarch"]
+ checksum = request["checksum"]
+ history = request["history"]
- response = None
- try:
- value = self.table.getValue(version, pkgarch, checksum)
- response = {'value': value}
- except prserv.NotFoundError:
- logger.error("can not find value for (%s, %s)",version, checksum)
- except sqlite3.Error as exc:
- logger.error(str(exc))
+ if self.upstream_client is None:
+ value = self.server.table.get_value(version, pkgarch, checksum, history)
+ return {"value": value}
+
+ # We have an upstream server.
+ # Check whether the local server already knows the requested configuration.
+ # If the configuration is a new one, the generated value we will add will
+ # depend on what's on the upstream server. That's why we're calling find_value()
+ # instead of get_value() directly.
+
+ value = self.server.table.find_value(version, pkgarch, checksum, history)
+ upstream_max = await self.upstream_client.max_package_pr(version, pkgarch)
+
+ if value is not None:
+
+ # The configuration is already known locally.
+
+ if history:
+ value = self.server.table.get_value(version, pkgarch, checksum, history)
+ else:
+ existing_value = value
+ # In "no history", we need to make sure the value doesn't decrease
+ # and is at least greater than the maximum upstream value
+ # and the maximum local value
+
+ local_max = self.server.table.find_package_max_value(version, pkgarch)
+ if revision_smaller(value, local_max):
+ value = increase_revision(local_max)
+
+ if revision_smaller(value, upstream_max):
+ # Ask upstream whether it knows the checksum
+ upstream_value = await self.upstream_client.test_pr(version, pkgarch, checksum)
+ if upstream_value is None:
+ # Upstream doesn't have our checksum, let create a new one
+ value = upstream_max + ".0"
+ else:
+ # Fine to take the same value as upstream
+ value = upstream_max
+
+ if not value == existing_value and not self.server.read_only:
+ self.server.table.store_value(version, pkgarch, checksum, value)
+
+ return {"value": value}
+
+ # The configuration is a new one for the local server
+ # Let's ask the upstream server whether it knows it
+
+ known_upstream = await self.upstream_client.test_package(version, pkgarch)
+
+ if not known_upstream:
- self.write_message(response)
+ # The package is not known upstream, must be a local-only package
+ # Let's compute the PR number using the local-only method
+
+ value = self.server.table.get_value(version, pkgarch, checksum, history)
+ return {"value": value}
+
+ # The package is known upstream, let's ask the upstream server
+ # whether it knows our new output hash
+
+ value = await self.upstream_client.test_pr(version, pkgarch, checksum)
+
+ if value is not None:
+
+ # Upstream knows this output hash, let's store it and use it too.
+
+ if not self.server.read_only:
+ self.server.table.store_value(version, pkgarch, checksum, value)
+ # If the local server is read only, won't be able to store the new
+ # value in the database and will have to keep asking the upstream server
+ return {"value": value}
+
+ # The output hash doesn't exist upstream, get the most recent number from upstream (x)
+ # Then, we want to have a new PR value for the local server: x.y
+
+ upstream_max = await self.upstream_client.max_package_pr(version, pkgarch)
+ # Here we know that the package is known upstream, so upstream_max can't be None
+ subvalue = self.server.table.find_new_subvalue(version, pkgarch, upstream_max)
+
+ if not self.server.read_only:
+ self.server.table.store_value(version, pkgarch, checksum, subvalue)
+
+ return {"value": subvalue}
+
+ async def process_requests(self):
+ if self.server.upstream is not None:
+ self.upstream_client = await create_async_client(self.server.upstream)
+ else:
+ self.upstream_client = None
+
+ try:
+ await super().process_requests()
+ finally:
+ if self.upstream_client is not None:
+ await self.upstream_client.close()
async def handle_import_one(self, request):
response = None
- if not self.read_only:
- version = request['version']
- pkgarch = request['pkgarch']
- checksum = request['checksum']
- value = request['value']
+ if not self.server.read_only:
+ version = request["version"]
+ pkgarch = request["pkgarch"]
+ checksum = request["checksum"]
+ value = request["value"]
- value = self.table.importone(version, pkgarch, checksum, value)
+ value = self.server.table.importone(version, pkgarch, checksum, value)
if value is not None:
- response = {'value': value}
+ response = {"value": value}
- self.write_message(response)
+ return response
async def handle_export(self, request):
- version = request['version']
- pkgarch = request['pkgarch']
- checksum = request['checksum']
- colinfo = request['colinfo']
+ version = request["version"]
+ pkgarch = request["pkgarch"]
+ checksum = request["checksum"]
+ colinfo = request["colinfo"]
+ history = request["history"]
try:
- (metainfo, datainfo) = self.table.export(version, pkgarch, checksum, colinfo)
+ (metainfo, datainfo) = self.server.table.export(version, pkgarch, checksum, colinfo, history)
except sqlite3.Error as exc:
- logger.error(str(exc))
+ self.logger.error(str(exc))
metainfo = datainfo = None
- response = {'metainfo': metainfo, 'datainfo': datainfo}
- self.write_message(response)
+ return {"metainfo": metainfo, "datainfo": datainfo}
async def handle_is_readonly(self, request):
- response = {'readonly': self.read_only}
- self.write_message(response)
+ return {"readonly": self.server.read_only}
class PRServer(bb.asyncrpc.AsyncServer):
- def __init__(self, dbfile, read_only=False):
+ def __init__(self, dbfile, read_only=False, upstream=None):
super().__init__(logger)
self.dbfile = dbfile
self.table = None
self.read_only = read_only
+ self.upstream = upstream
- def accept_client(self, reader, writer):
- return PRServerClient(reader, writer, self.table, self.read_only)
+ def accept_client(self, socket):
+ return PRServerClient(socket, self)
- def _serve_forever(self):
+ def start(self):
+ tasks = super().start()
self.db = prserv.db.PRData(self.dbfile, read_only=self.read_only)
self.table = self.db["PRMAIN"]
- logger.info("Started PRServer with DBfile: %s, Address: %s, PID: %s" %
+ self.logger.info("Started PRServer with DBfile: %s, Address: %s, PID: %s" %
(self.dbfile, self.address, str(os.getpid())))
- super()._serve_forever()
+ if self.upstream is not None:
+ self.logger.info("And upstream PRServer: %s " % (self.upstream))
- self.table.sync_if_dirty()
- self.db.disconnect()
+ return tasks
- def signal_handler(self):
- super().signal_handler()
- if self.table:
- self.table.sync()
+ async def stop(self):
+ self.db.disconnect()
+ await super().stop()
class PRServSingleton(object):
- def __init__(self, dbfile, logfile, host, port):
+ def __init__(self, dbfile, logfile, host, port, upstream):
self.dbfile = dbfile
self.logfile = logfile
self.host = host
self.port = port
+ self.upstream = upstream
def start(self):
- self.prserv = PRServer(self.dbfile)
+ self.prserv = PRServer(self.dbfile, upstream=self.upstream)
self.prserv.start_tcp_server(socket.gethostbyname(self.host), self.port)
- self.process = self.prserv.serve_as_process()
+ self.process = self.prserv.serve_as_process(log_level=logging.WARNING)
if not self.prserv.address:
raise PRServiceConfigError
if not self.port:
- self.port = int(self.prserv.address.rsplit(':', 1)[1])
+ self.port = int(self.prserv.address.rsplit(":", 1)[1])
def run_as_daemon(func, pidfile, logfile):
"""
@@ -170,18 +284,18 @@ def run_as_daemon(func, pidfile, logfile):
# stdout/stderr or it could be 'real' unix fd forking where we need
# to physically close the fds to prevent the program launching us from
# potentially hanging on a pipe. Handle both cases.
- si = open('/dev/null', 'r')
+ si = open("/dev/null", "r")
try:
- os.dup2(si.fileno(),sys.stdin.fileno())
+ os.dup2(si.fileno(), sys.stdin.fileno())
except (AttributeError, io.UnsupportedOperation):
sys.stdin = si
- so = open(logfile, 'a+')
+ so = open(logfile, "a+")
try:
- os.dup2(so.fileno(),sys.stdout.fileno())
+ os.dup2(so.fileno(), sys.stdout.fileno())
except (AttributeError, io.UnsupportedOperation):
sys.stdout = so
try:
- os.dup2(so.fileno(),sys.stderr.fileno())
+ os.dup2(so.fileno(), sys.stderr.fileno())
except (AttributeError, io.UnsupportedOperation):
sys.stderr = so
@@ -199,14 +313,14 @@ def run_as_daemon(func, pidfile, logfile):
# write pidfile
pid = str(os.getpid())
- with open(pidfile, 'w') as pf:
+ with open(pidfile, "w") as pf:
pf.write("%s\n" % pid)
func()
os.remove(pidfile)
os._exit(0)
-def start_daemon(dbfile, host, port, logfile, read_only=False):
+def start_daemon(dbfile, host, port, logfile, read_only=False, upstream=None):
ip = socket.gethostbyname(host)
pidfile = PIDPREFIX % (ip, port)
try:
@@ -222,7 +336,7 @@ def start_daemon(dbfile, host, port, logfile, read_only=False):
dbfile = os.path.abspath(dbfile)
def daemon_main():
- server = PRServer(dbfile, read_only=read_only)
+ server = PRServer(dbfile, read_only=read_only, upstream=upstream)
server.start_tcp_server(ip, port)
server.serve_forever()
@@ -244,15 +358,15 @@ def stop_daemon(host, port):
# so at least advise the user which ports the corresponding server is listening
ports = []
portstr = ""
- for pf in glob.glob(PIDPREFIX % (ip,'*')):
+ for pf in glob.glob(PIDPREFIX % (ip, "*")):
bn = os.path.basename(pf)
root, _ = os.path.splitext(bn)
- ports.append(root.split('_')[-1])
+ ports.append(root.split("_")[-1])
if len(ports):
- portstr = "Wrong port? Other ports listening at %s: %s" % (host, ' '.join(ports))
+ portstr = "Wrong port? Other ports listening at %s: %s" % (host, " ".join(ports))
sys.stderr.write("pidfile %s does not exist. Daemon not running? %s\n"
- % (pidfile,portstr))
+ % (pidfile, portstr))
return 1
try:
@@ -261,8 +375,11 @@ def stop_daemon(host, port):
os.kill(pid, signal.SIGTERM)
time.sleep(0.1)
- if os.path.exists(pidfile):
+ try:
os.remove(pidfile)
+ except FileNotFoundError:
+ # The PID file might have been removed by the exiting process
+ pass
except OSError as e:
err = str(e)
@@ -280,7 +397,7 @@ def is_running(pid):
return True
def is_local_special(host, port):
- if (host == 'localhost' or host == '127.0.0.1') and not port:
+ if (host == "localhost" or host == "127.0.0.1") and not port:
return True
else:
return False
@@ -291,7 +408,7 @@ class PRServiceConfigError(Exception):
def auto_start(d):
global singleton
- host_params = list(filter(None, (d.getVar('PRSERV_HOST') or '').split(':')))
+ host_params = list(filter(None, (d.getVar("PRSERV_HOST") or "").split(":")))
if not host_params:
# Shutdown any existing PR Server
auto_shutdown()
@@ -300,12 +417,15 @@ def auto_start(d):
if len(host_params) != 2:
# Shutdown any existing PR Server
auto_shutdown()
- logger.critical('\n'.join(['PRSERV_HOST: incorrect format',
+ logger.critical("\n".join(["PRSERV_HOST: incorrect format",
'Usage: PRSERV_HOST = "<hostname>:<port>"']))
raise PRServiceConfigError
host = host_params[0].strip().lower()
port = int(host_params[1])
+
+ upstream = d.getVar("PRSERV_UPSTREAM") or None
+
if is_local_special(host, port):
import bb.utils
cachedir = (d.getVar("PERSISTENT_DIR") or d.getVar("CACHE"))
@@ -320,7 +440,7 @@ def auto_start(d):
auto_shutdown()
if not singleton:
bb.utils.mkdirhier(cachedir)
- singleton = PRServSingleton(os.path.abspath(dbfile), os.path.abspath(logfile), host, port)
+ singleton = PRServSingleton(os.path.abspath(dbfile), os.path.abspath(logfile), host, port, upstream)
singleton.start()
if singleton:
host = singleton.host
@@ -344,17 +464,17 @@ def auto_shutdown():
def ping(host, port):
from . import client
- conn = client.PRClient()
- conn.connect_tcp(host, port)
- return conn.ping()
+ with client.PRClient() as conn:
+ conn.connect_tcp(host, port)
+ return conn.ping()
def connect(host, port):
from . import client
global singleton
- if host.strip().lower() == 'localhost' and not port:
- host = 'localhost'
+ if host.strip().lower() == "localhost" and not port:
+ host = "localhost"
port = singleton.port
conn = client.PRClient()
diff --git a/bitbake/lib/prserv/tests.py b/bitbake/lib/prserv/tests.py
new file mode 100644
index 0000000000..8765b129f2
--- /dev/null
+++ b/bitbake/lib/prserv/tests.py
@@ -0,0 +1,386 @@
+#! /usr/bin/env python3
+#
+# Copyright (C) 2024 BitBake Contributors
+#
+# SPDX-License-Identifier: GPL-2.0-only
+#
+
+from . import create_server, create_client, increase_revision, revision_greater, revision_smaller, _revision_greater_or_equal
+import prserv.db as db
+from bb.asyncrpc import InvokeError
+import logging
+import os
+import sys
+import tempfile
+import unittest
+import socket
+import subprocess
+from pathlib import Path
+
+THIS_DIR = Path(__file__).parent
+BIN_DIR = THIS_DIR.parent.parent / "bin"
+
+version = "dummy-1.0-r0"
+pkgarch = "core2-64"
+other_arch = "aarch64"
+
+checksumX = "51bf8189dbe9ea81fa6dd89608bf19380c437a9cf12f6c6239887801ba4ab4f0"
+checksum0 = "51bf8189dbe9ea81fa6dd89608bf19380c437a9cf12f6c6239887801ba4ab4a0"
+checksum1 = "51bf8189dbe9ea81fa6dd89608bf19380c437a9cf12f6c6239887801ba4ab4a1"
+checksum2 = "51bf8189dbe9ea81fa6dd89608bf19380c437a9cf12f6c6239887801ba4ab4a2"
+checksum3 = "51bf8189dbe9ea81fa6dd89608bf19380c437a9cf12f6c6239887801ba4ab4a3"
+checksum4 = "51bf8189dbe9ea81fa6dd89608bf19380c437a9cf12f6c6239887801ba4ab4a4"
+checksum5 = "51bf8189dbe9ea81fa6dd89608bf19380c437a9cf12f6c6239887801ba4ab4a5"
+checksum6 = "51bf8189dbe9ea81fa6dd89608bf19380c437a9cf12f6c6239887801ba4ab4a6"
+checksum7 = "51bf8189dbe9ea81fa6dd89608bf19380c437a9cf12f6c6239887801ba4ab4a7"
+checksum8 = "51bf8189dbe9ea81fa6dd89608bf19380c437a9cf12f6c6239887801ba4ab4a8"
+checksum9 = "51bf8189dbe9ea81fa6dd89608bf19380c437a9cf12f6c6239887801ba4ab4a9"
+checksum10 = "51bf8189dbe9ea81fa6dd89608bf19380c437a9cf12f6c6239887801ba4ab4aa"
+
+def server_prefunc(server, name):
+ logging.basicConfig(level=logging.DEBUG, filename='prserv-%s.log' % name, filemode='w',
+ format='%(levelname)s %(filename)s:%(lineno)d %(message)s')
+ server.logger.debug("Running server %s" % name)
+ sys.stdout = open('prserv-stdout-%s.log' % name, 'w')
+ sys.stderr = sys.stdout
+
+class PRTestSetup(object):
+
+ def start_server(self, name, dbfile, upstream=None, read_only=False, prefunc=server_prefunc):
+
+ def cleanup_server(server):
+ if server.process.exitcode is not None:
+ return
+ server.process.terminate()
+ server.process.join()
+
+ server = create_server(socket.gethostbyname("localhost") + ":0",
+ dbfile,
+ upstream=upstream,
+ read_only=read_only)
+
+ server.serve_as_process(prefunc=prefunc, args=(name,))
+ self.addCleanup(cleanup_server, server)
+
+ return server
+
+ def start_client(self, server_address):
+ def cleanup_client(client):
+ client.close()
+
+ client = create_client(server_address)
+ self.addCleanup(cleanup_client, client)
+
+ return client
+
+class FunctionTests(unittest.TestCase):
+
+ def setUp(self):
+ self.temp_dir = tempfile.TemporaryDirectory(prefix='bb-prserv')
+ self.addCleanup(self.temp_dir.cleanup)
+
+ def test_increase_revision(self):
+ self.assertEqual(increase_revision("1"), "2")
+ self.assertEqual(increase_revision("1.0"), "1.1")
+ self.assertEqual(increase_revision("1.1.1"), "1.1.2")
+ self.assertEqual(increase_revision("1.1.1.3"), "1.1.1.4")
+ self.assertRaises(ValueError, increase_revision, "1.a")
+ self.assertRaises(ValueError, increase_revision, "1.")
+ self.assertRaises(ValueError, increase_revision, "")
+
+ def test_revision_greater_or_equal(self):
+ self.assertTrue(_revision_greater_or_equal("2", "2"))
+ self.assertTrue(_revision_greater_or_equal("2", "1"))
+ self.assertTrue(_revision_greater_or_equal("10", "2"))
+ self.assertTrue(_revision_greater_or_equal("1.10", "1.2"))
+ self.assertFalse(_revision_greater_or_equal("1.2", "1.10"))
+ self.assertTrue(_revision_greater_or_equal("1.10", "1"))
+ self.assertTrue(_revision_greater_or_equal("1.10.1", "1.10"))
+ self.assertFalse(_revision_greater_or_equal("1.10.1", "1.10.2"))
+ self.assertTrue(_revision_greater_or_equal("1.10.1", "1.10.1"))
+ self.assertTrue(_revision_greater_or_equal("1.10.1", "1"))
+ self.assertTrue(revision_greater("1.20", "1.3"))
+ self.assertTrue(revision_smaller("1.3", "1.20"))
+
+ # DB tests
+
+ def test_db(self):
+ dbfile = os.path.join(self.temp_dir.name, "testtable.sqlite3")
+
+ self.db = db.PRData(dbfile)
+ self.table = self.db["PRMAIN"]
+
+ self.table.store_value(version, pkgarch, checksum0, "0")
+ self.table.store_value(version, pkgarch, checksum1, "1")
+ # "No history" mode supports multiple PRs for the same checksum
+ self.table.store_value(version, pkgarch, checksum0, "2")
+ self.table.store_value(version, pkgarch, checksum2, "1.0")
+
+ self.assertTrue(self.table.test_package(version, pkgarch))
+ self.assertFalse(self.table.test_package(version, other_arch))
+
+ self.assertTrue(self.table.test_value(version, pkgarch, "0"))
+ self.assertTrue(self.table.test_value(version, pkgarch, "1"))
+ self.assertTrue(self.table.test_value(version, pkgarch, "2"))
+
+ self.assertEqual(self.table.find_package_max_value(version, pkgarch), "2")
+
+ self.assertEqual(self.table.find_min_value(version, pkgarch, checksum0), "0")
+ self.assertEqual(self.table.find_max_value(version, pkgarch, checksum0), "2")
+
+ # Test history modes
+ self.assertEqual(self.table.find_value(version, pkgarch, checksum0, True), "0")
+ self.assertEqual(self.table.find_value(version, pkgarch, checksum0, False), "2")
+
+ self.assertEqual(self.table.find_new_subvalue(version, pkgarch, "3"), "3.0")
+ self.assertEqual(self.table.find_new_subvalue(version, pkgarch, "1"), "1.1")
+
+ # Revision comparison tests
+ self.table.store_value(version, pkgarch, checksum1, "1.3")
+ self.table.store_value(version, pkgarch, checksum1, "1.20")
+ self.assertEqual(self.table.find_min_value(version, pkgarch, checksum1), "1")
+ self.assertEqual(self.table.find_max_value(version, pkgarch, checksum1), "1.20")
+
+class PRBasicTests(PRTestSetup, unittest.TestCase):
+
+ def setUp(self):
+ self.temp_dir = tempfile.TemporaryDirectory(prefix='bb-prserv')
+ self.addCleanup(self.temp_dir.cleanup)
+
+ dbfile = os.path.join(self.temp_dir.name, "prtest-basic.sqlite3")
+
+ self.server1 = self.start_server("basic", dbfile)
+ self.client1 = self.start_client(self.server1.address)
+
+ def test_basic(self):
+
+ # Checks on non existing configuration
+
+ result = self.client1.test_pr(version, pkgarch, checksum0)
+ self.assertIsNone(result, "test_pr should return 'None' for a non existing PR")
+
+ result = self.client1.test_package(version, pkgarch)
+ self.assertFalse(result, "test_package should return 'False' for a non existing PR")
+
+ result = self.client1.max_package_pr(version, pkgarch)
+ self.assertIsNone(result, "max_package_pr should return 'None' for a non existing PR")
+
+ # Add a first configuration
+
+ result = self.client1.getPR(version, pkgarch, checksum0)
+ self.assertEqual(result, "0", "getPR: initial PR of a package should be '0'")
+
+ result = self.client1.test_pr(version, pkgarch, checksum0)
+ self.assertEqual(result, "0", "test_pr should return '0' here, matching the result of getPR")
+
+ result = self.client1.test_package(version, pkgarch)
+ self.assertTrue(result, "test_package should return 'True' for an existing PR")
+
+ result = self.client1.max_package_pr(version, pkgarch)
+ self.assertEqual(result, "0", "max_package_pr should return '0' in the current test series")
+
+ # Check that the same request gets the same value
+
+ result = self.client1.getPR(version, pkgarch, checksum0)
+ self.assertEqual(result, "0", "getPR: asking for the same PR a second time in a row should return the same value.")
+
+ # Add new configurations
+
+ result = self.client1.getPR(version, pkgarch, checksum1)
+ self.assertEqual(result, "1", "getPR: second PR of a package should be '1'")
+
+ result = self.client1.test_pr(version, pkgarch, checksum1)
+ self.assertEqual(result, "1", "test_pr should return '1' here, matching the result of getPR")
+
+ result = self.client1.max_package_pr(version, pkgarch)
+ self.assertEqual(result, "1", "max_package_pr should return '1' in the current test series")
+
+ result = self.client1.getPR(version, pkgarch, checksum2)
+ self.assertEqual(result, "2", "getPR: second PR of a package should be '2'")
+
+ result = self.client1.test_pr(version, pkgarch, checksum2)
+ self.assertEqual(result, "2", "test_pr should return '2' here, matching the result of getPR")
+
+ result = self.client1.max_package_pr(version, pkgarch)
+ self.assertEqual(result, "2", "max_package_pr should return '2' in the current test series")
+
+ result = self.client1.getPR(version, pkgarch, checksum3)
+ self.assertEqual(result, "3", "getPR: second PR of a package should be '3'")
+
+ result = self.client1.test_pr(version, pkgarch, checksum3)
+ self.assertEqual(result, "3", "test_pr should return '3' here, matching the result of getPR")
+
+ result = self.client1.max_package_pr(version, pkgarch)
+ self.assertEqual(result, "3", "max_package_pr should return '3' in the current test series")
+
+ # Ask again for the first configuration
+
+ result = self.client1.getPR(version, pkgarch, checksum0)
+ self.assertEqual(result, "4", "getPR: should return '4' in this configuration")
+
+ # Ask again with explicit "no history" mode
+
+ result = self.client1.getPR(version, pkgarch, checksum0, False)
+ self.assertEqual(result, "4", "getPR: should return '4' in this configuration")
+
+ # Ask again with explicit "history" mode. This should return the first recorded PR for checksum0
+
+ result = self.client1.getPR(version, pkgarch, checksum0, True)
+ self.assertEqual(result, "0", "getPR: should return '0' in this configuration")
+
+ # Check again that another pkgarg resets the counters
+
+ result = self.client1.test_pr(version, other_arch, checksum0)
+ self.assertIsNone(result, "test_pr should return 'None' for a non existing PR")
+
+ result = self.client1.test_package(version, other_arch)
+ self.assertFalse(result, "test_package should return 'False' for a non existing PR")
+
+ result = self.client1.max_package_pr(version, other_arch)
+ self.assertIsNone(result, "max_package_pr should return 'None' for a non existing PR")
+
+ # Now add the configuration
+
+ result = self.client1.getPR(version, other_arch, checksum0)
+ self.assertEqual(result, "0", "getPR: initial PR of a package should be '0'")
+
+ result = self.client1.test_pr(version, other_arch, checksum0)
+ self.assertEqual(result, "0", "test_pr should return '0' here, matching the result of getPR")
+
+ result = self.client1.test_package(version, other_arch)
+ self.assertTrue(result, "test_package should return 'True' for an existing PR")
+
+ result = self.client1.max_package_pr(version, other_arch)
+ self.assertEqual(result, "0", "max_package_pr should return '0' in the current test series")
+
+ result = self.client1.is_readonly()
+ self.assertFalse(result, "Server should not be described as 'read-only'")
+
+class PRUpstreamTests(PRTestSetup, unittest.TestCase):
+
+ def setUp(self):
+
+ self.temp_dir = tempfile.TemporaryDirectory(prefix='bb-prserv')
+ self.addCleanup(self.temp_dir.cleanup)
+
+ dbfile2 = os.path.join(self.temp_dir.name, "prtest-upstream2.sqlite3")
+ self.server2 = self.start_server("upstream2", dbfile2)
+ self.client2 = self.start_client(self.server2.address)
+
+ dbfile1 = os.path.join(self.temp_dir.name, "prtest-upstream1.sqlite3")
+ self.server1 = self.start_server("upstream1", dbfile1, upstream=self.server2.address)
+ self.client1 = self.start_client(self.server1.address)
+
+ dbfile0 = os.path.join(self.temp_dir.name, "prtest-local.sqlite3")
+ self.server0 = self.start_server("local", dbfile0, upstream=self.server1.address)
+ self.client0 = self.start_client(self.server0.address)
+ self.shared_db = dbfile0
+
+ def test_upstream_and_readonly(self):
+
+ # For identical checksums, all servers should return the same PR
+
+ result = self.client2.getPR(version, pkgarch, checksum0)
+ self.assertEqual(result, "0", "getPR: initial PR of a package should be '0'")
+
+ result = self.client1.getPR(version, pkgarch, checksum0)
+ self.assertEqual(result, "0", "getPR: initial PR of a package should be '0' (same as upstream)")
+
+ result = self.client0.getPR(version, pkgarch, checksum0)
+ self.assertEqual(result, "0", "getPR: initial PR of a package should be '0' (same as upstream)")
+
+ # Now introduce new checksums on server1 for, same version
+
+ result = self.client1.getPR(version, pkgarch, checksum1)
+ self.assertEqual(result, "0.0", "getPR: first PR of a package which has a different checksum upstream should be '0.0'")
+
+ result = self.client1.getPR(version, pkgarch, checksum2)
+ self.assertEqual(result, "0.1", "getPR: second PR of a package that has a different checksum upstream should be '0.1'")
+
+ # Now introduce checksums on server0 for, same version
+
+ result = self.client1.getPR(version, pkgarch, checksum1)
+ self.assertEqual(result, "0.2", "getPR: can't decrease for known PR")
+
+ result = self.client1.getPR(version, pkgarch, checksum2)
+ self.assertEqual(result, "0.3")
+
+ result = self.client1.max_package_pr(version, pkgarch)
+ self.assertEqual(result, "0.3")
+
+ result = self.client0.getPR(version, pkgarch, checksum3)
+ self.assertEqual(result, "0.3.0", "getPR: first PR of a package that doesn't exist upstream should be '0.3.0'")
+
+ result = self.client0.getPR(version, pkgarch, checksum4)
+ self.assertEqual(result, "0.3.1", "getPR: second PR of a package that doesn't exist upstream should be '0.3.1'")
+
+ result = self.client0.getPR(version, pkgarch, checksum3)
+ self.assertEqual(result, "0.3.2")
+
+ # More upstream updates
+ # Here, we assume no communication between server2 and server0. server2 only impacts server0
+ # after impacting server1
+
+ self.assertEqual(self.client2.getPR(version, pkgarch, checksum5), "1")
+ self.assertEqual(self.client1.getPR(version, pkgarch, checksum6), "1.0")
+ self.assertEqual(self.client1.getPR(version, pkgarch, checksum7), "1.1")
+ self.assertEqual(self.client0.getPR(version, pkgarch, checksum8), "1.1.0")
+ self.assertEqual(self.client0.getPR(version, pkgarch, checksum9), "1.1.1")
+
+ # "history" mode tests
+
+ self.assertEqual(self.client2.getPR(version, pkgarch, checksum0, True), "0")
+ self.assertEqual(self.client1.getPR(version, pkgarch, checksum2, True), "0.1")
+ self.assertEqual(self.client0.getPR(version, pkgarch, checksum3, True), "0.3.0")
+
+ # More "no history" mode tests
+
+ self.assertEqual(self.client2.getPR(version, pkgarch, checksum0), "2")
+ self.assertEqual(self.client1.getPR(version, pkgarch, checksum0), "2") # Same as upstream
+ self.assertEqual(self.client0.getPR(version, pkgarch, checksum0), "2") # Same as upstream
+ self.assertEqual(self.client1.getPR(version, pkgarch, checksum7), "3") # This could be surprising, but since the previous revision was "2", increasing it yields "3".
+ # We don't know how many upstream servers we have
+ # Start read-only server with server1 as upstream
+ self.server_ro = self.start_server("local-ro", self.shared_db, upstream=self.server1.address, read_only=True)
+ self.client_ro = self.start_client(self.server_ro.address)
+
+ self.assertTrue(self.client_ro.is_readonly(), "Database should be described as 'read-only'")
+
+ # Checks on non existing configurations
+ self.assertIsNone(self.client_ro.test_pr(version, pkgarch, checksumX))
+ self.assertFalse(self.client_ro.test_package("unknown", pkgarch))
+
+ # Look up existing configurations
+ self.assertEqual(self.client_ro.getPR(version, pkgarch, checksum0), "3") # "no history" mode
+ self.assertEqual(self.client_ro.getPR(version, pkgarch, checksum0, True), "0") # "history" mode
+ self.assertEqual(self.client_ro.getPR(version, pkgarch, checksum3), "3")
+ self.assertEqual(self.client_ro.getPR(version, pkgarch, checksum3, True), "0.3.0")
+ self.assertEqual(self.client_ro.max_package_pr(version, pkgarch), "2") # normal as "3" was never saved
+
+ # Try to insert a new value. Here this one is know upstream.
+ self.assertEqual(self.client_ro.getPR(version, pkgarch, checksum7), "3")
+ # Try to insert a completely new value. As the max upstream value is already "3", it should be "3.0"
+ self.assertEqual(self.client_ro.getPR(version, pkgarch, checksum10), "3.0")
+ # Same with another value which only exists in the upstream upstream server
+ # This time, as the upstream server doesn't know it, it will ask its upstream server. So that's a known one.
+ self.assertEqual(self.client_ro.getPR(version, pkgarch, checksum9), "3")
+
+class ScriptTests(unittest.TestCase):
+
+ def setUp(self):
+
+ self.temp_dir = tempfile.TemporaryDirectory(prefix='bb-prserv')
+ self.addCleanup(self.temp_dir.cleanup)
+ self.dbfile = os.path.join(self.temp_dir.name, "prtest.sqlite3")
+
+ def test_1_start_bitbake_prserv(self):
+ try:
+ subprocess.check_call([BIN_DIR / "bitbake-prserv", "--start", "-f", self.dbfile])
+ except subprocess.CalledProcessError as e:
+ self.fail("Failed to start bitbake-prserv: %s" % e.returncode)
+
+ def test_2_stop_bitbake_prserv(self):
+ try:
+ subprocess.check_call([BIN_DIR / "bitbake-prserv", "--stop"])
+ except subprocess.CalledProcessError as e:
+ self.fail("Failed to stop bitbake-prserv: %s" % e.returncode)
diff --git a/bitbake/lib/toaster/bldcollector/urls.py b/bitbake/lib/toaster/bldcollector/urls.py
index efd67a81a5..3c34070351 100644
--- a/bitbake/lib/toaster/bldcollector/urls.py
+++ b/bitbake/lib/toaster/bldcollector/urls.py
@@ -6,7 +6,7 @@
# SPDX-License-Identifier: GPL-2.0-only
#
-from django.conf.urls import url
+from django.urls import re_path as url
import bldcollector.views
diff --git a/bitbake/lib/toaster/bldcollector/views.py b/bitbake/lib/toaster/bldcollector/views.py
index 04cd8b3dd4..bdf38ae6e8 100644
--- a/bitbake/lib/toaster/bldcollector/views.py
+++ b/bitbake/lib/toaster/bldcollector/views.py
@@ -14,8 +14,11 @@ import subprocess
import toastermain
from django.views.decorators.csrf import csrf_exempt
+from toastermain.logs import log_view_mixin
+
@csrf_exempt
+@log_view_mixin
def eventfile(request):
""" Receives a file by POST, and runs toaster-eventreply on this file """
if request.method != "POST":
diff --git a/bitbake/lib/toaster/bldcontrol/models.py b/bitbake/lib/toaster/bldcontrol/models.py
index c2f302da24..42750e7180 100644
--- a/bitbake/lib/toaster/bldcontrol/models.py
+++ b/bitbake/lib/toaster/bldcontrol/models.py
@@ -4,7 +4,7 @@
from __future__ import unicode_literals
from django.db import models
-from django.utils.encoding import force_text
+from django.utils.encoding import force_str
from orm.models import Project, Build, Layer_Version
import logging
@@ -124,7 +124,7 @@ class BuildRequest(models.Model):
return self.brvariable_set.get(name="MACHINE").value
def __str__(self):
- return force_text('%s %s' % (self.project, self.get_state_display()))
+ return force_str('%s %s' % (self.project, self.get_state_display()))
# These tables specify the settings for running an actual build.
# They MUST be kept in sync with the tables in orm.models.Project*
diff --git a/bitbake/lib/toaster/logs/.gitignore b/bitbake/lib/toaster/logs/.gitignore
new file mode 100644
index 0000000000..e5ebf25a49
--- /dev/null
+++ b/bitbake/lib/toaster/logs/.gitignore
@@ -0,0 +1 @@
+*.log*
diff --git a/bitbake/lib/toaster/orm/fixtures/README b/bitbake/lib/toaster/orm/fixtures/README
index 1b1c660aac..7cd745e26b 100644
--- a/bitbake/lib/toaster/orm/fixtures/README
+++ b/bitbake/lib/toaster/orm/fixtures/README
@@ -27,4 +27,4 @@ Data can be provided in XML, JSON and if installed YAML formats.
Use the django management command manage.py loaddata <your fixture file>
For further information see the Django command documentation at:
-https://docs.djangoproject.com/en/1.8/ref/django-admin/#django-admin-loaddata
+https://docs.djangoproject.com/en/3.2/ref/django-admin/#django-admin-loaddata
diff --git a/bitbake/lib/toaster/orm/fixtures/gen_fixtures.py b/bitbake/lib/toaster/orm/fixtures/gen_fixtures.py
index 0d5f4533bf..71afe3914e 100755
--- a/bitbake/lib/toaster/orm/fixtures/gen_fixtures.py
+++ b/bitbake/lib/toaster/orm/fixtures/gen_fixtures.py
@@ -35,17 +35,19 @@ verbose = False
# [Codename, Yocto Project Version, Release Date, Current Version, Support Level, Poky Version, BitBake branch]
current_releases = [
# Release slot #1
- ['Kirkstone','3.5','April 2022','','Future - Long Term Support (until Apr. 2024)','27.0','1.54'],
-# ['Dunfell','3.1','April 2021','3.1.5 (March 2022)','Stable - Support for 13 months (until Apr. 2022)','23.0','1.46'],
+ ['Kirkstone','4.0','April 2022','4.0.8 (March 2023)','Stable - Long Term Support (until Apr. 2024)','','2.0'],
# Release slot #2 'local'
['HEAD','HEAD','','Local Yocto Project','HEAD','','HEAD'],
# Release slot #3 'master'
['Master','master','','Yocto Project master','master','','master'],
# Release slot #4
- ['Honister','3.4','October 2021','3.4.2 (February 2022)','Support for 7 months (until May 2022)','26.0','1.52'],
-# ['Gatesgarth','3.2','Oct 2020','3.2.4 (May 2021)','EOL','24.0','1.48'],
- # Optional Release slot #4
- ['Hardknott','3.3','April 2021','3.3.5 (March 2022)','Stable - Support for 13 months (until Apr. 2022)','25.0','1.50'],
+ ['Mickledore','4.2','April 2023','4.2.0 (April 2023)','Support for 7 months (until October 2023)','','2.4'],
+# ['Langdale','4.1','October 2022','4.1.2 (January 2023)','Support for 7 months (until May 2023)','','2.2'],
+# ['Honister','3.4','October 2021','3.4.2 (February 2022)','Support for 7 months (until May 2022)','26.0','1.52'],
+# ['Hardknott','3.3','April 2021','3.3.5 (March 2022)','Stable - Support for 13 months (until Apr. 2022)','25.0','1.50'],
+# ['Gatesgarth','3.2','Oct 2020','3.2.4 (May 2021)','EOL','24.0','1.48'],
+ # Optional Release slot #5
+ ['Dunfell','3.1','April 2020','3.1.23 (February 2023)','Stable - Long Term Support (until Apr. 2024)','23.0','1.46'],
]
default_poky_layers = [
diff --git a/bitbake/lib/toaster/orm/fixtures/oe-core.xml b/bitbake/lib/toaster/orm/fixtures/oe-core.xml
index 450e7a2f85..950f2a98af 100644
--- a/bitbake/lib/toaster/orm/fixtures/oe-core.xml
+++ b/bitbake/lib/toaster/orm/fixtures/oe-core.xml
@@ -10,7 +10,7 @@
<object model="orm.bitbakeversion" pk="1">
<field type="CharField" name="name">kirkstone</field>
<field type="CharField" name="giturl">git://git.openembedded.org/bitbake</field>
- <field type="CharField" name="branch">1.54</field>
+ <field type="CharField" name="branch">2.0</field>
</object>
<object model="orm.bitbakeversion" pk="2">
<field type="CharField" name="name">HEAD</field>
@@ -23,14 +23,14 @@
<field type="CharField" name="branch">master</field>
</object>
<object model="orm.bitbakeversion" pk="4">
- <field type="CharField" name="name">honister</field>
+ <field type="CharField" name="name">mickledore</field>
<field type="CharField" name="giturl">git://git.openembedded.org/bitbake</field>
- <field type="CharField" name="branch">1.52</field>
+ <field type="CharField" name="branch">2.4</field>
</object>
<object model="orm.bitbakeversion" pk="5">
- <field type="CharField" name="name">hardknott</field>
+ <field type="CharField" name="name">dunfell</field>
<field type="CharField" name="giturl">git://git.openembedded.org/bitbake</field>
- <field type="CharField" name="branch">1.50</field>
+ <field type="CharField" name="branch">1.46</field>
</object>
<!-- Releases available -->
@@ -56,18 +56,18 @@
<field type="TextField" name="helptext">Toaster will run your builds using the tip of the &lt;a href=\"https://cgit.openembedded.org/openembedded-core/log/\"&gt;OpenEmbedded master&lt;/a&gt; branch.</field>
</object>
<object model="orm.release" pk="4">
- <field type="CharField" name="name">honister</field>
- <field type="CharField" name="description">Openembedded Honister</field>
+ <field type="CharField" name="name">mickledore</field>
+ <field type="CharField" name="description">Openembedded Mickledore</field>
<field rel="ManyToOneRel" to="orm.bitbakeversion" name="bitbake_version">4</field>
- <field type="CharField" name="branch_name">honister</field>
- <field type="TextField" name="helptext">Toaster will run your builds using the tip of the &lt;a href=\"https://cgit.openembedded.org/openembedded-core/log/?h=honister\"&gt;OpenEmbedded Honister&lt;/a&gt; branch.</field>
+ <field type="CharField" name="branch_name">mickledore</field>
+ <field type="TextField" name="helptext">Toaster will run your builds using the tip of the &lt;a href=\"https://cgit.openembedded.org/openembedded-core/log/?h=mickledore\"&gt;OpenEmbedded Mickledore&lt;/a&gt; branch.</field>
</object>
<object model="orm.release" pk="5">
- <field type="CharField" name="name">hardknott</field>
- <field type="CharField" name="description">Openembedded Hardknott</field>
+ <field type="CharField" name="name">dunfell</field>
+ <field type="CharField" name="description">Openembedded Dunfell</field>
<field rel="ManyToOneRel" to="orm.bitbakeversion" name="bitbake_version">5</field>
- <field type="CharField" name="branch_name">hardknott</field>
- <field type="TextField" name="helptext">Toaster will run your builds using the tip of the &lt;a href=\"https://cgit.openembedded.org/openembedded-core/log/?h=hardknott\"&gt;OpenEmbedded Hardknott&lt;/a&gt; branch.</field>
+ <field type="CharField" name="branch_name">dunfell</field>
+ <field type="TextField" name="helptext">Toaster will run your builds using the tip of the &lt;a href=\"https://cgit.openembedded.org/openembedded-core/log/?h=dunfell\"&gt;OpenEmbedded Dunfell&lt;/a&gt; branch.</field>
</object>
<!-- Default layers for each release -->
diff --git a/bitbake/lib/toaster/orm/fixtures/poky.xml b/bitbake/lib/toaster/orm/fixtures/poky.xml
index ed86114ebe..121e52fd45 100644
--- a/bitbake/lib/toaster/orm/fixtures/poky.xml
+++ b/bitbake/lib/toaster/orm/fixtures/poky.xml
@@ -26,15 +26,15 @@
<field type="CharField" name="dirpath">bitbake</field>
</object>
<object model="orm.bitbakeversion" pk="4">
- <field type="CharField" name="name">honister</field>
+ <field type="CharField" name="name">mickledore</field>
<field type="CharField" name="giturl">git://git.yoctoproject.org/poky</field>
- <field type="CharField" name="branch">honister</field>
+ <field type="CharField" name="branch">mickledore</field>
<field type="CharField" name="dirpath">bitbake</field>
</object>
<object model="orm.bitbakeversion" pk="5">
- <field type="CharField" name="name">hardknott</field>
+ <field type="CharField" name="name">dunfell</field>
<field type="CharField" name="giturl">git://git.yoctoproject.org/poky</field>
- <field type="CharField" name="branch">hardknott</field>
+ <field type="CharField" name="branch">dunfell</field>
<field type="CharField" name="dirpath">bitbake</field>
</object>
@@ -42,7 +42,7 @@
<!-- Releases available -->
<object model="orm.release" pk="1">
<field type="CharField" name="name">kirkstone</field>
- <field type="CharField" name="description">Yocto Project 3.5 "Kirkstone"</field>
+ <field type="CharField" name="description">Yocto Project 4.0 "Kirkstone"</field>
<field rel="ManyToOneRel" to="orm.bitbakeversion" name="bitbake_version">1</field>
<field type="CharField" name="branch_name">kirkstone</field>
<field type="TextField" name="helptext">Toaster will run your builds using the tip of the &lt;a href="https://git.yoctoproject.org/cgit/cgit.cgi/poky/log/?h=kirkstone"&gt;Yocto Project Kirkstone branch&lt;/a&gt;.</field>
@@ -62,18 +62,18 @@
<field type="TextField" name="helptext">Toaster will run your builds using the tip of the &lt;a href="https://git.yoctoproject.org/cgit/cgit.cgi/poky/log/"&gt;Yocto Project Master branch&lt;/a&gt;.</field>
</object>
<object model="orm.release" pk="4">
- <field type="CharField" name="name">honister</field>
- <field type="CharField" name="description">Yocto Project 3.4 "Honister"</field>
+ <field type="CharField" name="name">mickledore</field>
+ <field type="CharField" name="description">Yocto Project 4.2 "Mickledore"</field>
<field rel="ManyToOneRel" to="orm.bitbakeversion" name="bitbake_version">4</field>
- <field type="CharField" name="branch_name">honister</field>
- <field type="TextField" name="helptext">Toaster will run your builds using the tip of the &lt;a href="https://git.yoctoproject.org/cgit/cgit.cgi/poky/log/?h=honister"&gt;Yocto Project Honister branch&lt;/a&gt;.</field>
+ <field type="CharField" name="branch_name">mickledore</field>
+ <field type="TextField" name="helptext">Toaster will run your builds using the tip of the &lt;a href="https://git.yoctoproject.org/cgit/cgit.cgi/poky/log/?h=mickledore"&gt;Yocto Project Mickledore branch&lt;/a&gt;.</field>
</object>
<object model="orm.release" pk="5">
- <field type="CharField" name="name">hardknott</field>
- <field type="CharField" name="description">Yocto Project 3.3 "Hardknott"</field>
+ <field type="CharField" name="name">dunfell</field>
+ <field type="CharField" name="description">Yocto Project 3.1 "Dunfell"</field>
<field rel="ManyToOneRel" to="orm.bitbakeversion" name="bitbake_version">5</field>
- <field type="CharField" name="branch_name">hardknott</field>
- <field type="TextField" name="helptext">Toaster will run your builds using the tip of the &lt;a href="https://git.yoctoproject.org/cgit/cgit.cgi/poky/log/?h=hardknott"&gt;Yocto Project Hardknott branch&lt;/a&gt;.</field>
+ <field type="CharField" name="branch_name">dunfell</field>
+ <field type="TextField" name="helptext">Toaster will run your builds using the tip of the &lt;a href="https://git.yoctoproject.org/cgit/cgit.cgi/poky/log/?h=dunfell"&gt;Yocto Project Dunfell branch&lt;/a&gt;.</field>
</object>
<!-- Default project layers for each release -->
@@ -177,14 +177,14 @@
<field rel="ManyToOneRel" to="orm.layer" name="layer">1</field>
<field type="IntegerField" name="layer_source">0</field>
<field rel="ManyToOneRel" to="orm.release" name="release">4</field>
- <field type="CharField" name="branch">honister</field>
+ <field type="CharField" name="branch">mickledore</field>
<field type="CharField" name="dirpath">meta</field>
</object>
<object model="orm.layer_version" pk="5">
<field rel="ManyToOneRel" to="orm.layer" name="layer">1</field>
<field type="IntegerField" name="layer_source">0</field>
<field rel="ManyToOneRel" to="orm.release" name="release">5</field>
- <field type="CharField" name="branch">hardknott</field>
+ <field type="CharField" name="branch">dunfell</field>
<field type="CharField" name="dirpath">meta</field>
</object>
@@ -222,14 +222,14 @@
<field rel="ManyToOneRel" to="orm.layer" name="layer">2</field>
<field type="IntegerField" name="layer_source">0</field>
<field rel="ManyToOneRel" to="orm.release" name="release">4</field>
- <field type="CharField" name="branch">honister</field>
+ <field type="CharField" name="branch">mickledore</field>
<field type="CharField" name="dirpath">meta-poky</field>
</object>
<object model="orm.layer_version" pk="10">
<field rel="ManyToOneRel" to="orm.layer" name="layer">2</field>
<field type="IntegerField" name="layer_source">0</field>
<field rel="ManyToOneRel" to="orm.release" name="release">5</field>
- <field type="CharField" name="branch">hardknott</field>
+ <field type="CharField" name="branch">dunfell</field>
<field type="CharField" name="dirpath">meta-poky</field>
</object>
@@ -267,14 +267,14 @@
<field rel="ManyToOneRel" to="orm.layer" name="layer">3</field>
<field type="IntegerField" name="layer_source">0</field>
<field rel="ManyToOneRel" to="orm.release" name="release">4</field>
- <field type="CharField" name="branch">honister</field>
+ <field type="CharField" name="branch">mickledore</field>
<field type="CharField" name="dirpath">meta-yocto-bsp</field>
</object>
<object model="orm.layer_version" pk="15">
<field rel="ManyToOneRel" to="orm.layer" name="layer">3</field>
<field type="IntegerField" name="layer_source">0</field>
<field rel="ManyToOneRel" to="orm.release" name="release">5</field>
- <field type="CharField" name="branch">hardknott</field>
+ <field type="CharField" name="branch">dunfell</field>
<field type="CharField" name="dirpath">meta-yocto-bsp</field>
</object>
</django-objects>
diff --git a/bitbake/lib/toaster/orm/fixtures/settings.xml b/bitbake/lib/toaster/orm/fixtures/settings.xml
index ab3ea021f5..02c26a6974 100644
--- a/bitbake/lib/toaster/orm/fixtures/settings.xml
+++ b/bitbake/lib/toaster/orm/fixtures/settings.xml
@@ -12,7 +12,7 @@
</object>
<object model="orm.toastersetting" pk="4">
<field type="CharField" name="name">DEFCONF_MACHINE</field>
- <field type="CharField" name="value">qemux86</field>
+ <field type="CharField" name="value">qemux86-64</field>
</object>
<object model="orm.toastersetting" pk="5">
<field type="CharField" name="name">DEFCONF_SSTATE_DIR</field>
diff --git a/bitbake/lib/toaster/orm/management/commands/lsupdates.py b/bitbake/lib/toaster/orm/management/commands/lsupdates.py
index eb097555e2..6d64830ebd 100644
--- a/bitbake/lib/toaster/orm/management/commands/lsupdates.py
+++ b/bitbake/lib/toaster/orm/management/commands/lsupdates.py
@@ -40,7 +40,7 @@ class Spinner(threading.Thread):
""" A simple progress spinner to indicate download/parsing is happening"""
def __init__(self, *args, **kwargs):
super(Spinner, self).__init__(*args, **kwargs)
- self.setDaemon(True)
+ self.daemon = True
self.signal = True
def run(self):
diff --git a/bitbake/lib/toaster/orm/migrations/0021_eventlogsimports.py b/bitbake/lib/toaster/orm/migrations/0021_eventlogsimports.py
new file mode 100644
index 0000000000..328eb5753c
--- /dev/null
+++ b/bitbake/lib/toaster/orm/migrations/0021_eventlogsimports.py
@@ -0,0 +1,22 @@
+# Generated by Django 4.2.5 on 2023-11-23 18:44
+
+from django.db import migrations, models
+
+
+class Migration(migrations.Migration):
+
+ dependencies = [
+ ('orm', '0020_models_bigautofield'),
+ ]
+
+ operations = [
+ migrations.CreateModel(
+ name='EventLogsImports',
+ fields=[
+ ('id', models.BigAutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')),
+ ('name', models.CharField(max_length=255)),
+ ('imported', models.BooleanField(default=False)),
+ ('build_id', models.IntegerField(blank=True, null=True)),
+ ],
+ ),
+ ]
diff --git a/bitbake/lib/toaster/orm/models.py b/bitbake/lib/toaster/orm/models.py
index 2cb7d7e049..19c9686206 100644
--- a/bitbake/lib/toaster/orm/models.py
+++ b/bitbake/lib/toaster/orm/models.py
@@ -107,7 +107,7 @@ class ToasterSetting(models.Model):
class ProjectManager(models.Manager):
- def create_project(self, name, release, existing_project=None):
+ def create_project(self, name, release, existing_project=None, imported=False):
if existing_project and (release is not None):
prj = existing_project
prj.bitbake_version = release.bitbake_version
@@ -134,19 +134,19 @@ class ProjectManager(models.Manager):
if release is None:
return prj
-
- for rdl in release.releasedefaultlayer_set.all():
- lv = Layer_Version.objects.filter(
- layer__name=rdl.layer_name,
- release=release).first()
-
- if lv:
- ProjectLayer.objects.create(project=prj,
- layercommit=lv,
- optional=False)
- else:
- logger.warning("Default project layer %s not found" %
- rdl.layer_name)
+ if not imported:
+ for rdl in release.releasedefaultlayer_set.all():
+ lv = Layer_Version.objects.filter(
+ layer__name=rdl.layer_name,
+ release=release).first()
+
+ if lv:
+ ProjectLayer.objects.create(project=prj,
+ layercommit=lv,
+ optional=False)
+ else:
+ logger.warning("Default project layer %s not found" %
+ rdl.layer_name)
return prj
@@ -1389,9 +1389,6 @@ class Machine(models.Model):
return "Machine " + self.name + "(" + self.description + ")"
-
-
-
class BitbakeVersion(models.Model):
name = models.CharField(max_length=32, unique = True)
@@ -1733,7 +1730,7 @@ class CustomImageRecipe(Recipe):
packages_conf += "\""
base_recipe_path = self.get_base_recipe_file()
- if base_recipe_path:
+ if base_recipe_path and os.path.isfile(base_recipe_path):
base_recipe = open(base_recipe_path, 'r').read()
else:
# Pass back None to trigger error message to user
@@ -1853,6 +1850,8 @@ def signal_runbuilds():
os.kill(int(pidf.read()), SIGUSR1)
except FileNotFoundError:
logger.info("Stopping existing runbuilds: no current process found")
+ except ProcessLookupError:
+ logger.warning("Stopping existing runbuilds: process lookup not found")
class Distro(models.Model):
search_allowed_fields = ["name", "description", "layer_version__layer__name"]
@@ -1869,6 +1868,15 @@ class Distro(models.Model):
def __unicode__(self):
return "Distro " + self.name + "(" + self.description + ")"
+class EventLogsImports(models.Model):
+ name = models.CharField(max_length=255)
+ imported = models.BooleanField(default=False)
+ build_id = models.IntegerField(blank=True, null=True)
+
+ def __str__(self):
+ return self.name
+
+
django.db.models.signals.post_save.connect(invalidate_cache)
django.db.models.signals.post_delete.connect(invalidate_cache)
django.db.models.signals.m2m_changed.connect(invalidate_cache)
diff --git a/bitbake/lib/toaster/pytest.ini b/bitbake/lib/toaster/pytest.ini
new file mode 100644
index 0000000000..071c65fcd5
--- /dev/null
+++ b/bitbake/lib/toaster/pytest.ini
@@ -0,0 +1,16 @@
+# -- FILE: pytest.ini (or tox.ini)
+[pytest]
+# --create-db - force re creation of the test database
+# https://pytest-django.readthedocs.io/en/latest/database.html#create-db-force-re-creation-of-the-test-database
+
+# --html=report.html --self-contained-html
+# https://docs.pytest.org/en/latest/usage.html#creating-html-reports
+# https://pytest-html.readthedocs.io/en/latest/user_guide.html#creating-a-self-contained-report
+addopts = --create-db --html="Toaster Tests Report.html" --self-contained-html
+
+# Define environment variables using pytest-env
+# A pytest plugin that enables you to set environment variables in the pytest.ini file.
+# https://pypi.org/project/pytest-env/
+env =
+ TOASTER_BUILDSERVER=1
+ DJANGO_SETTINGS_MODULE=toastermain.settings_test
diff --git a/bitbake/lib/toaster/tests/browser/selenium_helpers_base.py b/bitbake/lib/toaster/tests/browser/selenium_helpers_base.py
index 644d45fe58..393be75496 100644
--- a/bitbake/lib/toaster/tests/browser/selenium_helpers_base.py
+++ b/bitbake/lib/toaster/tests/browser/selenium_helpers_base.py
@@ -19,11 +19,15 @@ import os
import time
import unittest
+import pytest
from selenium import webdriver
+from selenium.webdriver.support import expected_conditions as EC
from selenium.webdriver.support.ui import WebDriverWait
+from selenium.webdriver.common.by import By
from selenium.webdriver.common.desired_capabilities import DesiredCapabilities
from selenium.common.exceptions import NoSuchElementException, \
- StaleElementReferenceException, TimeoutException
+ StaleElementReferenceException, TimeoutException, \
+ SessionNotCreatedException
def create_selenium_driver(cls,browser='chrome'):
# set default browser string based on env (if available)
@@ -32,9 +36,32 @@ def create_selenium_driver(cls,browser='chrome'):
browser = env_browser
if browser == 'chrome':
- return webdriver.Chrome(
- service_args=["--verbose", "--log-path=selenium.log"]
- )
+ options = webdriver.ChromeOptions()
+ options.add_argument('--headless')
+ options.add_argument('--disable-infobars')
+ options.add_argument('--disable-dev-shm-usage')
+ options.add_argument('--no-sandbox')
+ options.add_argument('--remote-debugging-port=9222')
+ try:
+ return webdriver.Chrome(options=options)
+ except SessionNotCreatedException as e:
+ exit_message = "Halting tests prematurely to avoid cascading errors."
+ # check if chrome / chromedriver exists
+ chrome_path = os.popen("find ~/.cache/selenium/chrome/ -name 'chrome' -type f -print -quit").read().strip()
+ if not chrome_path:
+ pytest.exit(f"Failed to install/find chrome.\n{exit_message}")
+ chromedriver_path = os.popen("find ~/.cache/selenium/chromedriver/ -name 'chromedriver' -type f -print -quit").read().strip()
+ if not chromedriver_path:
+ pytest.exit(f"Failed to install/find chromedriver.\n{exit_message}")
+ # check if depends on each are fulfilled
+ depends_chrome = os.popen(f"ldd {chrome_path} | grep 'not found'").read().strip()
+ if depends_chrome:
+ pytest.exit(f"Missing chrome dependencies.\n{depends_chrome}\n{exit_message}")
+ depends_chromedriver = os.popen(f"ldd {chromedriver_path} | grep 'not found'").read().strip()
+ if depends_chromedriver:
+ pytest.exit(f"Missing chromedriver dependencies.\n{depends_chromedriver}\n{exit_message}")
+ # print original error otherwise
+ pytest.exit(f"Failed to start chromedriver.\n{e}\n{exit_message}")
elif browser == 'firefox':
return webdriver.Firefox()
elif browser == 'marionette':
@@ -66,7 +93,9 @@ class Wait(WebDriverWait):
_TIMEOUT = 10
_POLL_FREQUENCY = 0.5
- def __init__(self, driver):
+ def __init__(self, driver, timeout=_TIMEOUT, poll=_POLL_FREQUENCY):
+ self._TIMEOUT = timeout
+ self._POLL_FREQUENCY = poll
super(Wait, self).__init__(driver, self._TIMEOUT, self._POLL_FREQUENCY)
def until(self, method, message=''):
@@ -138,6 +167,8 @@ class SeleniumTestCaseBase(unittest.TestCase):
""" Clean up webdriver driver """
cls.driver.quit()
+ # Allow driver resources to be properly freed before proceeding with further tests
+ time.sleep(5)
super(SeleniumTestCaseBase, cls).tearDownClass()
def get(self, url):
@@ -151,13 +182,20 @@ class SeleniumTestCaseBase(unittest.TestCase):
abs_url = '%s%s' % (self.live_server_url, url)
self.driver.get(abs_url)
+ try: # Ensure page is loaded before proceeding
+ self.wait_until_visible("#global-nav", poll=3)
+ except NoSuchElementException:
+ self.driver.implicitly_wait(3)
+ except TimeoutException:
+ self.driver.implicitly_wait(3)
+
def find(self, selector):
""" Find single element by CSS selector """
- return self.driver.find_element_by_css_selector(selector)
+ return self.driver.find_element(By.CSS_SELECTOR, selector)
def find_all(self, selector):
""" Find all elements matching CSS selector """
- return self.driver.find_elements_by_css_selector(selector)
+ return self.driver.find_elements(By.CSS_SELECTOR, selector)
def element_exists(self, selector):
"""
@@ -170,18 +208,34 @@ class SeleniumTestCaseBase(unittest.TestCase):
""" Return the element which currently has focus on the page """
return self.driver.switch_to.active_element
- def wait_until_present(self, selector):
+ def wait_until_present(self, selector, poll=0.5):
""" Wait until element matching CSS selector is on the page """
is_present = lambda driver: self.find(selector)
msg = 'An element matching "%s" should be on the page' % selector
- element = Wait(self.driver).until(is_present, msg)
+ element = Wait(self.driver, poll=poll).until(is_present, msg)
+ if poll > 2:
+ time.sleep(poll) # element need more delay to be present
return element
- def wait_until_visible(self, selector):
+ def wait_until_visible(self, selector, poll=1):
""" Wait until element matching CSS selector is visible on the page """
is_visible = lambda driver: self.find(selector).is_displayed()
msg = 'An element matching "%s" should be visible' % selector
- Wait(self.driver).until(is_visible, msg)
+ Wait(self.driver, poll=poll).until(is_visible, msg)
+ time.sleep(poll) # wait for visibility to settle
+ return self.find(selector)
+
+ def wait_until_clickable(self, selector, poll=1):
+ """ Wait until element matching CSS selector is visible on the page """
+ WebDriverWait(
+ self.driver,
+ Wait._TIMEOUT,
+ poll_frequency=poll
+ ).until(
+ EC.element_to_be_clickable((By.ID, selector.removeprefix('#')
+ )
+ )
+ )
return self.find(selector)
def wait_until_focused(self, selector):
diff --git a/bitbake/lib/toaster/tests/browser/test_all_builds_page.py b/bitbake/lib/toaster/tests/browser/test_all_builds_page.py
index 8423d3dab2..b9356a0344 100644
--- a/bitbake/lib/toaster/tests/browser/test_all_builds_page.py
+++ b/bitbake/lib/toaster/tests/browser/test_all_builds_page.py
@@ -7,13 +7,18 @@
# SPDX-License-Identifier: GPL-2.0-only
#
+import os
import re
from django.urls import reverse
+from selenium.webdriver.support.select import Select
from django.utils import timezone
+from bldcontrol.models import BuildRequest
from tests.browser.selenium_helpers import SeleniumTestCase
-from orm.models import BitbakeVersion, Release, Project, Build, Target
+from orm.models import BitbakeVersion, Layer, Layer_Version, Recipe, Release, Project, Build, Target, Task
+
+from selenium.webdriver.common.by import By
class TestAllBuildsPage(SeleniumTestCase):
@@ -23,7 +28,8 @@ class TestAllBuildsPage(SeleniumTestCase):
CLI_BUILDS_PROJECT_NAME = 'command line builds'
def setUp(self):
- bbv = BitbakeVersion.objects.create(name='bbv1', giturl='/tmp/',
+ builldir = os.environ.get('BUILDDIR', './')
+ bbv = BitbakeVersion.objects.create(name='bbv1', giturl=f'{builldir}/',
branch='master', dirpath='')
release = Release.objects.create(name='release1',
bitbake_version=bbv)
@@ -69,7 +75,7 @@ class TestAllBuildsPage(SeleniumTestCase):
'[data-role="data-recent-build-buildtime-field"]' % build.id
# because this loads via Ajax, wait for it to be visible
- self.wait_until_present(selector)
+ self.wait_until_visible(selector)
build_time_spans = self.find_all(selector)
@@ -79,7 +85,7 @@ class TestAllBuildsPage(SeleniumTestCase):
def _get_row_for_build(self, build):
""" Get the table row for the build from the all builds table """
- self.wait_until_present('#allbuildstable')
+ self.wait_until_visible('#allbuildstable')
rows = self.find_all('#allbuildstable tr')
@@ -91,7 +97,7 @@ class TestAllBuildsPage(SeleniumTestCase):
found_row = None
for row in rows:
- outcome_links = row.find_elements_by_css_selector(selector)
+ outcome_links = row.find_elements(By.CSS_SELECTOR, selector)
if len(outcome_links) == 1:
found_row = row
break
@@ -100,6 +106,66 @@ class TestAllBuildsPage(SeleniumTestCase):
return found_row
+ def _get_create_builds(self, **kwargs):
+ """ Create a build and return the build object """
+ build1 = Build.objects.create(**self.project1_build_success)
+ build2 = Build.objects.create(**self.project1_build_failure)
+
+ # add some targets to these builds so they have recipe links
+ # (and so we can find the row in the ToasterTable corresponding to
+ # a particular build)
+ Target.objects.create(build=build1, target='foo')
+ Target.objects.create(build=build2, target='bar')
+
+ if kwargs:
+ # Create kwargs.get('success') builds with success status with target
+ # and kwargs.get('failure') builds with failure status with target
+ for i in range(kwargs.get('success', 0)):
+ now = timezone.now()
+ self.project1_build_success['started_on'] = now
+ self.project1_build_success[
+ 'completed_on'] = now - timezone.timedelta(days=i)
+ build = Build.objects.create(**self.project1_build_success)
+ Target.objects.create(build=build,
+ target=f'{i}_success_recipe',
+ task=f'{i}_success_task')
+
+ self._set_buildRequest_and_task_on_build(build)
+ for i in range(kwargs.get('failure', 0)):
+ now = timezone.now()
+ self.project1_build_failure['started_on'] = now
+ self.project1_build_failure[
+ 'completed_on'] = now - timezone.timedelta(days=i)
+ build = Build.objects.create(**self.project1_build_failure)
+ Target.objects.create(build=build,
+ target=f'{i}_fail_recipe',
+ task=f'{i}_fail_task')
+ self._set_buildRequest_and_task_on_build(build)
+ return build1, build2
+
+ def _create_recipe(self):
+ """ Add a recipe to the database and return it """
+ layer = Layer.objects.create()
+ layer_version = Layer_Version.objects.create(layer=layer)
+ return Recipe.objects.create(name='recipe_foo', layer_version=layer_version)
+
+ def _set_buildRequest_and_task_on_build(self, build):
+ """ Set buildRequest and task on build """
+ build.recipes_parsed = 1
+ build.save()
+ buildRequest = BuildRequest.objects.create(
+ build=build,
+ project=self.project1,
+ state=BuildRequest.REQ_COMPLETED)
+ build.build_request = buildRequest
+ recipe = self._create_recipe()
+ task = Task.objects.create(build=build,
+ recipe=recipe,
+ task_name='task',
+ outcome=Task.OUTCOME_SUCCESS)
+ task.save()
+ build.save()
+
def test_show_tasks_with_suffix(self):
""" Task should be shown as suffix on build name """
build = Build.objects.create(**self.project1_build_success)
@@ -109,7 +175,7 @@ class TestAllBuildsPage(SeleniumTestCase):
url = reverse('all-builds')
self.get(url)
- self.wait_until_present('td[class="target"]')
+ self.wait_until_visible('td[class="target"]')
cell = self.find('td[class="target"]')
content = cell.get_attribute('innerHTML')
@@ -126,23 +192,25 @@ class TestAllBuildsPage(SeleniumTestCase):
but should be shown for other builds
"""
build1 = Build.objects.create(**self.project1_build_success)
- default_build = Build.objects.create(**self.default_project_build_success)
+ default_build = Build.objects.create(
+ **self.default_project_build_success)
url = reverse('all-builds')
self.get(url)
- # shouldn't see a rebuild button for command-line builds
- selector = 'div[data-latest-build-result="%s"] .rebuild-btn' % default_build.id
- run_again_button = self.find_all(selector)
- self.assertEqual(len(run_again_button), 0,
- 'should not see a rebuild button for cli builds')
-
# should see a rebuild button for non-command-line builds
+ self.wait_until_visible('#allbuildstable tbody tr')
selector = 'div[data-latest-build-result="%s"] .rebuild-btn' % build1.id
run_again_button = self.find_all(selector)
self.assertEqual(len(run_again_button), 1,
'should see a rebuild button for non-cli builds')
+ # shouldn't see a rebuild button for command-line builds
+ selector = 'div[data-latest-build-result="%s"] .rebuild-btn' % default_build.id
+ run_again_button = self.find_all(selector)
+ self.assertEqual(len(run_again_button), 0,
+ 'should not see a rebuild button for cli builds')
+
def test_tooltips_on_project_name(self):
"""
Test tooltips shown next to project name in the main table
@@ -156,6 +224,7 @@ class TestAllBuildsPage(SeleniumTestCase):
url = reverse('all-builds')
self.get(url)
+ self.wait_until_visible('#allbuildstable', poll=3)
# get the project name cells from the table
cells = self.find_all('#allbuildstable td[class="project"]')
@@ -164,7 +233,7 @@ class TestAllBuildsPage(SeleniumTestCase):
for cell in cells:
content = cell.get_attribute('innerHTML')
- help_icons = cell.find_elements_by_css_selector(selector)
+ help_icons = cell.find_elements(By.CSS_SELECTOR, selector)
if re.search(self.PROJECT_NAME, content):
# no help icon next to non-cli project name
@@ -184,38 +253,224 @@ class TestAllBuildsPage(SeleniumTestCase):
recent builds area; failed builds should not have links on the time column,
or in the recent builds area
"""
- build1 = Build.objects.create(**self.project1_build_success)
- build2 = Build.objects.create(**self.project1_build_failure)
-
- # add some targets to these builds so they have recipe links
- # (and so we can find the row in the ToasterTable corresponding to
- # a particular build)
- Target.objects.create(build=build1, target='foo')
- Target.objects.create(build=build2, target='bar')
+ build1, build2 = self._get_create_builds()
url = reverse('all-builds')
self.get(url)
+ self.wait_until_visible('#allbuildstable', poll=3)
# test recent builds area for successful build
element = self._get_build_time_element(build1)
- links = element.find_elements_by_css_selector('a')
+ links = element.find_elements(By.CSS_SELECTOR, 'a')
msg = 'should be a link on the build time for a successful recent build'
- self.assertEquals(len(links), 1, msg)
+ self.assertEqual(len(links), 1, msg)
# test recent builds area for failed build
element = self._get_build_time_element(build2)
- links = element.find_elements_by_css_selector('a')
+ links = element.find_elements(By.CSS_SELECTOR, 'a')
msg = 'should not be a link on the build time for a failed recent build'
- self.assertEquals(len(links), 0, msg)
+ self.assertEqual(len(links), 0, msg)
# test the time column for successful build
build1_row = self._get_row_for_build(build1)
- links = build1_row.find_elements_by_css_selector('td.time a')
+ links = build1_row.find_elements(By.CSS_SELECTOR, 'td.time a')
msg = 'should be a link on the build time for a successful build'
- self.assertEquals(len(links), 1, msg)
+ self.assertEqual(len(links), 1, msg)
# test the time column for failed build
build2_row = self._get_row_for_build(build2)
- links = build2_row.find_elements_by_css_selector('td.time a')
+ links = build2_row.find_elements(By.CSS_SELECTOR, 'td.time a')
msg = 'should not be a link on the build time for a failed build'
- self.assertEquals(len(links), 0, msg)
+ self.assertEqual(len(links), 0, msg)
+
+ def test_builds_table_search_box(self):
+ """ Test the search box in the builds table on the all builds page """
+ self._get_create_builds()
+
+ url = reverse('all-builds')
+ self.get(url)
+
+ # Check search box is present and works
+ self.wait_until_visible('#allbuildstable tbody tr')
+ search_box = self.find('#search-input-allbuildstable')
+ self.assertTrue(search_box.is_displayed())
+
+ # Check that we can search for a build by recipe name
+ search_box.send_keys('foo')
+ search_btn = self.find('#search-submit-allbuildstable')
+ search_btn.click()
+ self.wait_until_visible('#allbuildstable tbody tr')
+ rows = self.find_all('#allbuildstable tbody tr')
+ self.assertTrue(len(rows) >= 1)
+
+ def test_filtering_on_failure_tasks_column(self):
+ """ Test the filtering on failure tasks column in the builds table on the all builds page """
+ def _check_if_filter_failed_tasks_column_is_visible():
+ # check if failed tasks filter column is visible, if not click on it
+ # Check edit column
+ edit_column = self.find('#edit-columns-button')
+ self.assertTrue(edit_column.is_displayed())
+ edit_column.click()
+ # Check dropdown is visible
+ self.wait_until_visible('ul.dropdown-menu.editcol')
+ filter_fails_task_checkbox = self.find('#checkbox-failed_tasks')
+ if not filter_fails_task_checkbox.is_selected():
+ filter_fails_task_checkbox.click()
+ edit_column.click()
+
+ self._get_create_builds(success=10, failure=10)
+
+ url = reverse('all-builds')
+ self.get(url)
+
+ # Check filtering on failure tasks column
+ self.wait_until_visible('#allbuildstable tbody tr')
+ _check_if_filter_failed_tasks_column_is_visible()
+ failed_tasks_filter = self.find('#failed_tasks_filter')
+ failed_tasks_filter.click()
+ # Check popup is visible
+ self.wait_until_visible('#filter-modal-allbuildstable')
+ self.assertTrue(
+ self.find('#filter-modal-allbuildstable').is_displayed())
+ # Check that we can filter by failure tasks
+ build_without_failure_tasks = self.find(
+ '#failed_tasks_filter\\:without_failed_tasks')
+ build_without_failure_tasks.click()
+ # click on apply button
+ self.find('#filter-modal-allbuildstable .btn-primary').click()
+ self.wait_until_visible('#allbuildstable tbody tr')
+ # Check if filter is applied, by checking if failed_tasks_filter has btn-primary class
+ self.assertTrue(self.find('#failed_tasks_filter').get_attribute(
+ 'class').find('btn-primary') != -1)
+
+ def test_filtering_on_completedOn_column(self):
+ """ Test the filtering on completed_on column in the builds table on the all builds page """
+ self._get_create_builds(success=10, failure=10)
+
+ url = reverse('all-builds')
+ self.get(url)
+
+ # Check filtering on failure tasks column
+ self.wait_until_visible('#allbuildstable tbody tr')
+ completed_on_filter = self.find('#completed_on_filter')
+ completed_on_filter.click()
+ # Check popup is visible
+ self.wait_until_visible('#filter-modal-allbuildstable')
+ self.assertTrue(
+ self.find('#filter-modal-allbuildstable').is_displayed())
+ # Check that we can filter by failure tasks
+ build_without_failure_tasks = self.find(
+ '#completed_on_filter\\:date_range')
+ build_without_failure_tasks.click()
+ # click on apply button
+ self.find('#filter-modal-allbuildstable .btn-primary').click()
+ self.wait_until_visible('#allbuildstable tbody tr')
+ # Check if filter is applied, by checking if completed_on_filter has btn-primary class
+ self.assertTrue(self.find('#completed_on_filter').get_attribute(
+ 'class').find('btn-primary') != -1)
+
+ # Filter by date range
+ self.find('#completed_on_filter').click()
+ self.wait_until_visible('#filter-modal-allbuildstable')
+ date_ranges = self.driver.find_elements(
+ By.XPATH, '//input[@class="form-control hasDatepicker"]')
+ today = timezone.now()
+ yestersday = today - timezone.timedelta(days=1)
+ date_ranges[0].send_keys(yestersday.strftime('%Y-%m-%d'))
+ date_ranges[1].send_keys(today.strftime('%Y-%m-%d'))
+ self.find('#filter-modal-allbuildstable .btn-primary').click()
+ self.wait_until_visible('#allbuildstable tbody tr')
+ self.assertTrue(self.find('#completed_on_filter').get_attribute(
+ 'class').find('btn-primary') != -1)
+ # Check if filter is applied, number of builds displayed should be 6
+ self.assertTrue(len(self.find_all('#allbuildstable tbody tr')) >= 4)
+
+ def test_builds_table_editColumn(self):
+ """ Test the edit column feature in the builds table on the all builds page """
+ self._get_create_builds(success=10, failure=10)
+
+ def test_edit_column(check_box_id):
+ # Check that we can hide/show table column
+ check_box = self.find(f'#{check_box_id}')
+ th_class = str(check_box_id).replace('checkbox-', '')
+ if check_box.is_selected():
+ # check if column is visible in table
+ self.assertTrue(
+ self.find(
+ f'#allbuildstable thead th.{th_class}'
+ ).is_displayed(),
+ f"The {th_class} column is checked in EditColumn dropdown, but it's not visible in table"
+ )
+ check_box.click()
+ # check if column is hidden in table
+ self.assertFalse(
+ self.find(
+ f'#allbuildstable thead th.{th_class}'
+ ).is_displayed(),
+ f"The {th_class} column is unchecked in EditColumn dropdown, but it's visible in table"
+ )
+ else:
+ # check if column is hidden in table
+ self.assertFalse(
+ self.find(
+ f'#allbuildstable thead th.{th_class}'
+ ).is_displayed(),
+ f"The {th_class} column is unchecked in EditColumn dropdown, but it's visible in table"
+ )
+ check_box.click()
+ # check if column is visible in table
+ self.assertTrue(
+ self.find(
+ f'#allbuildstable thead th.{th_class}'
+ ).is_displayed(),
+ f"The {th_class} column is checked in EditColumn dropdown, but it's not visible in table"
+ )
+ url = reverse('all-builds')
+ self.get(url)
+ self.wait_until_visible('#allbuildstable tbody tr')
+
+ # Check edit column
+ edit_column = self.find('#edit-columns-button')
+ self.assertTrue(edit_column.is_displayed())
+ edit_column.click()
+ # Check dropdown is visible
+ self.wait_until_visible('ul.dropdown-menu.editcol')
+
+ # Check that we can hide the edit column
+ test_edit_column('checkbox-errors_no')
+ test_edit_column('checkbox-failed_tasks')
+ test_edit_column('checkbox-image_files')
+ test_edit_column('checkbox-project')
+ test_edit_column('checkbox-started_on')
+ test_edit_column('checkbox-time')
+ test_edit_column('checkbox-warnings_no')
+
+ def test_builds_table_show_rows(self):
+ """ Test the show rows feature in the builds table on the all builds page """
+ self._get_create_builds(success=100, failure=100)
+
+ def test_show_rows(row_to_show, show_row_link):
+ # Check that we can show rows == row_to_show
+ show_row_link.select_by_value(str(row_to_show))
+ self.wait_until_visible('#allbuildstable tbody tr', poll=3)
+ # check at least some rows are visible
+ self.assertTrue(
+ len(self.find_all('#allbuildstable tbody tr')) > 0
+ )
+
+ url = reverse('all-builds')
+ self.get(url)
+ self.wait_until_visible('#allbuildstable tbody tr')
+
+ show_rows = self.driver.find_elements(
+ By.XPATH,
+ '//select[@class="form-control pagesize-allbuildstable"]'
+ )
+ # Check show rows
+ for show_row_link in show_rows:
+ show_row_link = Select(show_row_link)
+ test_show_rows(10, show_row_link)
+ test_show_rows(25, show_row_link)
+ test_show_rows(50, show_row_link)
+ test_show_rows(100, show_row_link)
+ test_show_rows(150, show_row_link)
diff --git a/bitbake/lib/toaster/tests/browser/test_all_projects_page.py b/bitbake/lib/toaster/tests/browser/test_all_projects_page.py
index 15b03400f9..9ed1901cc9 100644
--- a/bitbake/lib/toaster/tests/browser/test_all_projects_page.py
+++ b/bitbake/lib/toaster/tests/browser/test_all_projects_page.py
@@ -7,15 +7,20 @@
# SPDX-License-Identifier: GPL-2.0-only
#
+import os
import re
from django.urls import reverse
from django.utils import timezone
+from selenium.webdriver.support.select import Select
from tests.browser.selenium_helpers import SeleniumTestCase
from orm.models import BitbakeVersion, Release, Project, Build
from orm.models import ProjectVariable
+from selenium.webdriver.common.by import By
+
+
class TestAllProjectsPage(SeleniumTestCase):
""" Browser tests for projects page /projects/ """
@@ -25,7 +30,8 @@ class TestAllProjectsPage(SeleniumTestCase):
def setUp(self):
""" Add default project manually """
- project = Project.objects.create_project(self.CLI_BUILDS_PROJECT_NAME, None)
+ project = Project.objects.create_project(
+ self.CLI_BUILDS_PROJECT_NAME, None)
self.default_project = project
self.default_project.is_default = True
self.default_project.save()
@@ -35,6 +41,17 @@ class TestAllProjectsPage(SeleniumTestCase):
self.release = None
+ def _create_projects(self, nb_project=10):
+ projects = []
+ for i in range(1, nb_project + 1):
+ projects.append(
+ Project(
+ name='test project {}'.format(i),
+ release=self.release,
+ )
+ )
+ Project.objects.bulk_create(projects)
+
def _add_build_to_default_project(self):
""" Add a build to the default project (not used in all tests) """
now = timezone.now()
@@ -45,12 +62,14 @@ class TestAllProjectsPage(SeleniumTestCase):
def _add_non_default_project(self):
""" Add another project """
- bbv = BitbakeVersion.objects.create(name='test bbv', giturl='/tmp/',
+ builldir = os.environ.get('BUILDDIR', './')
+ bbv = BitbakeVersion.objects.create(name='test bbv', giturl=f'{builldir}/',
branch='master', dirpath='')
self.release = Release.objects.create(name='test release',
branch_name='master',
bitbake_version=bbv)
- self.project = Project.objects.create_project(self.PROJECT_NAME, self.release)
+ self.project = Project.objects.create_project(
+ self.PROJECT_NAME, self.release)
self.project.is_default = False
self.project.save()
@@ -62,7 +81,7 @@ class TestAllProjectsPage(SeleniumTestCase):
def _get_row_for_project(self, project_name):
""" Get the HTML row for a project, or None if not found """
- self.wait_until_present('#projectstable tbody tr')
+ self.wait_until_visible('#projectstable tbody tr', poll=3)
rows = self.find_all('#projectstable tbody tr')
# find the row with a project name matching the one supplied
@@ -93,7 +112,8 @@ class TestAllProjectsPage(SeleniumTestCase):
url = reverse('all-projects')
self.get(url)
- default_project_row = self._get_row_for_project(self.default_project.name)
+ default_project_row = self._get_row_for_project(
+ self.default_project.name)
self.assertNotEqual(default_project_row, None,
'default project "cli builds" should be in page')
@@ -113,11 +133,12 @@ class TestAllProjectsPage(SeleniumTestCase):
self.wait_until_visible("#projectstable tr")
# find the row for the default project
- default_project_row = self._get_row_for_project(self.default_project.name)
+ default_project_row = self._get_row_for_project(
+ self.default_project.name)
# check the release text for the default project
selector = 'span[data-project-field="release"] span.text-muted'
- element = default_project_row.find_element_by_css_selector(selector)
+ element = default_project_row.find_element(By.CSS_SELECTOR, selector)
text = element.text.strip()
self.assertEqual(text, 'Not applicable',
'release should be "not applicable" for default project')
@@ -127,7 +148,7 @@ class TestAllProjectsPage(SeleniumTestCase):
# check the link in the release cell for the other project
selector = 'span[data-project-field="release"]'
- element = other_project_row.find_element_by_css_selector(selector)
+ element = other_project_row.find_element(By.CSS_SELECTOR, selector)
text = element.text.strip()
self.assertEqual(text, self.release.name,
'release name should be shown for non-default project')
@@ -148,11 +169,12 @@ class TestAllProjectsPage(SeleniumTestCase):
self.wait_until_visible("#projectstable tr")
# find the row for the default project
- default_project_row = self._get_row_for_project(self.default_project.name)
+ default_project_row = self._get_row_for_project(
+ self.default_project.name)
# check the machine cell for the default project
selector = 'span[data-project-field="machine"] span.text-muted'
- element = default_project_row.find_element_by_css_selector(selector)
+ element = default_project_row.find_element(By.CSS_SELECTOR, selector)
text = element.text.strip()
self.assertEqual(text, 'Not applicable',
'machine should be not applicable for default project')
@@ -162,7 +184,7 @@ class TestAllProjectsPage(SeleniumTestCase):
# check the link in the machine cell for the other project
selector = 'span[data-project-field="machine"]'
- element = other_project_row.find_element_by_css_selector(selector)
+ element = other_project_row.find_element(By.CSS_SELECTOR, selector)
text = element.text.strip()
self.assertEqual(text, self.MACHINE_NAME,
'machine name should be shown for non-default project')
@@ -183,13 +205,15 @@ class TestAllProjectsPage(SeleniumTestCase):
self.get(reverse('all-projects'))
# find the row for the default project
- default_project_row = self._get_row_for_project(self.default_project.name)
+ default_project_row = self._get_row_for_project(
+ self.default_project.name)
# check the link on the name field
selector = 'span[data-project-field="name"] a'
- element = default_project_row.find_element_by_css_selector(selector)
+ element = default_project_row.find_element(By.CSS_SELECTOR, selector)
link_url = element.get_attribute('href').strip()
- expected_url = reverse('projectbuilds', args=(self.default_project.id,))
+ expected_url = reverse(
+ 'projectbuilds', args=(self.default_project.id,))
msg = 'link on default project name should point to builds but was %s' % link_url
self.assertTrue(link_url.endswith(expected_url), msg)
@@ -198,8 +222,116 @@ class TestAllProjectsPage(SeleniumTestCase):
# check the link for the other project
selector = 'span[data-project-field="name"] a'
- element = other_project_row.find_element_by_css_selector(selector)
+ element = other_project_row.find_element(By.CSS_SELECTOR, selector)
link_url = element.get_attribute('href').strip()
expected_url = reverse('project', args=(self.project.id,))
msg = 'link on project name should point to configuration but was %s' % link_url
self.assertTrue(link_url.endswith(expected_url), msg)
+
+ def test_allProject_table_search_box(self):
+ """ Test the search box in the all project table on the all projects page """
+ self._create_projects()
+
+ url = reverse('all-projects')
+ self.get(url)
+
+ # Chseck search box is present and works
+ self.wait_until_visible('#projectstable tbody tr', poll=3)
+ search_box = self.find('#search-input-projectstable')
+ self.assertTrue(search_box.is_displayed())
+
+ # Check that we can search for a project by project name
+ search_box.send_keys('test project 10')
+ search_btn = self.find('#search-submit-projectstable')
+ search_btn.click()
+ self.wait_until_visible('#projectstable tbody tr', poll=3)
+ rows = self.find_all('#projectstable tbody tr')
+ self.assertTrue(len(rows) == 1)
+
+ def test_allProject_table_editColumn(self):
+ """ Test the edit column feature in the projects table on the all projects page """
+ self._create_projects()
+
+ def test_edit_column(check_box_id):
+ # Check that we can hide/show table column
+ check_box = self.find(f'#{check_box_id}')
+ th_class = str(check_box_id).replace('checkbox-', '')
+ if check_box.is_selected():
+ # check if column is visible in table
+ self.assertTrue(
+ self.find(
+ f'#projectstable thead th.{th_class}'
+ ).is_displayed(),
+ f"The {th_class} column is checked in EditColumn dropdown, but it's not visible in table"
+ )
+ check_box.click()
+ # check if column is hidden in table
+ self.assertFalse(
+ self.find(
+ f'#projectstable thead th.{th_class}'
+ ).is_displayed(),
+ f"The {th_class} column is unchecked in EditColumn dropdown, but it's visible in table"
+ )
+ else:
+ # check if column is hidden in table
+ self.assertFalse(
+ self.find(
+ f'#projectstable thead th.{th_class}'
+ ).is_displayed(),
+ f"The {th_class} column is unchecked in EditColumn dropdown, but it's visible in table"
+ )
+ check_box.click()
+ # check if column is visible in table
+ self.assertTrue(
+ self.find(
+ f'#projectstable thead th.{th_class}'
+ ).is_displayed(),
+ f"The {th_class} column is checked in EditColumn dropdown, but it's not visible in table"
+ )
+ url = reverse('all-projects')
+ self.get(url)
+ self.wait_until_visible('#projectstable tbody tr', poll=3)
+
+ # Check edit column
+ edit_column = self.find('#edit-columns-button')
+ self.assertTrue(edit_column.is_displayed())
+ edit_column.click()
+ # Check dropdown is visible
+ self.wait_until_visible('ul.dropdown-menu.editcol')
+
+ # Check that we can hide the edit column
+ test_edit_column('checkbox-errors')
+ test_edit_column('checkbox-image_files')
+ test_edit_column('checkbox-last_build_outcome')
+ test_edit_column('checkbox-recipe_name')
+ test_edit_column('checkbox-warnings')
+
+ def test_allProject_table_show_rows(self):
+ """ Test the show rows feature in the projects table on the all projects page """
+ self._create_projects(nb_project=200)
+
+ def test_show_rows(row_to_show, show_row_link):
+ # Check that we can show rows == row_to_show
+ show_row_link.select_by_value(str(row_to_show))
+ self.wait_until_visible('#projectstable tbody tr', poll=3)
+ # check at least some rows are visible
+ self.assertTrue(
+ len(self.find_all('#projectstable tbody tr')) > 0
+ )
+
+ url = reverse('all-projects')
+ self.get(url)
+ self.wait_until_visible('#projectstable tbody tr', poll=3)
+
+ show_rows = self.driver.find_elements(
+ By.XPATH,
+ '//select[@class="form-control pagesize-projectstable"]'
+ )
+ # Check show rows
+ for show_row_link in show_rows:
+ show_row_link = Select(show_row_link)
+ test_show_rows(10, show_row_link)
+ test_show_rows(25, show_row_link)
+ test_show_rows(50, show_row_link)
+ test_show_rows(100, show_row_link)
+ test_show_rows(150, show_row_link)
diff --git a/bitbake/lib/toaster/tests/browser/test_builddashboard_page.py b/bitbake/lib/toaster/tests/browser/test_builddashboard_page.py
index efcd89b346..d838ce363a 100644
--- a/bitbake/lib/toaster/tests/browser/test_builddashboard_page.py
+++ b/bitbake/lib/toaster/tests/browser/test_builddashboard_page.py
@@ -7,6 +7,7 @@
# SPDX-License-Identifier: GPL-2.0-only
#
+import os
from django.urls import reverse
from django.utils import timezone
@@ -15,11 +16,14 @@ from tests.browser.selenium_helpers import SeleniumTestCase
from orm.models import Project, Release, BitbakeVersion, Build, LogMessage
from orm.models import Layer, Layer_Version, Recipe, CustomImageRecipe, Variable
+from selenium.webdriver.common.by import By
+
class TestBuildDashboardPage(SeleniumTestCase):
""" Tests for the build dashboard /build/X """
def setUp(self):
- bbv = BitbakeVersion.objects.create(name='bbv1', giturl='/tmp/',
+ builldir = os.environ.get('BUILDDIR', './')
+ bbv = BitbakeVersion.objects.create(name='bbv1', giturl=f'{builldir}/',
branch='master', dirpath="")
release = Release.objects.create(name='release1',
bitbake_version=bbv)
@@ -158,6 +162,7 @@ class TestBuildDashboardPage(SeleniumTestCase):
"""
url = reverse('builddashboard', args=(build.id,))
self.get(url)
+ self.wait_until_visible('#global-nav', poll=3)
def _get_build_dashboard_errors(self, build):
"""
@@ -183,7 +188,7 @@ class TestBuildDashboardPage(SeleniumTestCase):
found = False
for element in message_elements:
- log_message_text = element.find_element_by_tag_name('pre').text.strip()
+ log_message_text = element.find_element(By.TAG_NAME, 'pre').text.strip()
text_matches = (log_message_text == expected_text)
log_message_pk = element.get_attribute('data-log-message-id')
@@ -213,7 +218,7 @@ class TestBuildDashboardPage(SeleniumTestCase):
the WebElement modal match the list of text values in expected
"""
# labels containing the radio buttons we're testing for
- labels = modal.find_elements_by_css_selector(".radio")
+ labels = modal.find_elements(By.CSS_SELECTOR,".radio")
labels_text = [lab.text for lab in labels]
self.assertEqual(len(labels_text), len(expected))
@@ -248,7 +253,7 @@ class TestBuildDashboardPage(SeleniumTestCase):
selector = '[data-role="edit-custom-image-trigger"]'
self.click(selector)
- modal = self.driver.find_element_by_id('edit-custom-image-modal')
+ modal = self.driver.find_element(By.ID, 'edit-custom-image-modal')
self.wait_until_visible("#edit-custom-image-modal")
# recipes we expect to see in the edit custom image modal
@@ -270,7 +275,7 @@ class TestBuildDashboardPage(SeleniumTestCase):
selector = '[data-role="new-custom-image-trigger"]'
self.click(selector)
- modal = self.driver.find_element_by_id('new-custom-image-modal')
+ modal = self.driver.find_element(By.ID,'new-custom-image-modal')
self.wait_until_visible("#new-custom-image-modal")
# recipes we expect to see in the new custom image modal
diff --git a/bitbake/lib/toaster/tests/browser/test_builddashboard_page_artifacts.py b/bitbake/lib/toaster/tests/browser/test_builddashboard_page_artifacts.py
index c6226d60eb..675825bd40 100644
--- a/bitbake/lib/toaster/tests/browser/test_builddashboard_page_artifacts.py
+++ b/bitbake/lib/toaster/tests/browser/test_builddashboard_page_artifacts.py
@@ -7,6 +7,7 @@
# SPDX-License-Identifier: GPL-2.0-only
#
+import os
from django.urls import reverse
from django.utils import timezone
@@ -20,7 +21,8 @@ class TestBuildDashboardPageArtifacts(SeleniumTestCase):
""" Tests for artifacts on the build dashboard /build/X """
def setUp(self):
- bbv = BitbakeVersion.objects.create(name='bbv1', giturl='/tmp/',
+ builldir = os.environ.get('BUILDDIR', './')
+ bbv = BitbakeVersion.objects.create(name='bbv1', giturl=f'{builldir}/',
branch='master', dirpath="")
release = Release.objects.create(name='release1',
bitbake_version=bbv)
@@ -197,12 +199,12 @@ class TestBuildDashboardPageArtifacts(SeleniumTestCase):
# check package count and size, link on target name
selector = '[data-value="target-package-count"]'
element = self.find(selector)
- self.assertEquals(element.text, '1',
+ self.assertEqual(element.text, '1',
'package count should be shown for image builds')
selector = '[data-value="target-package-size"]'
element = self.find(selector)
- self.assertEquals(element.text, '1.0 KB',
+ self.assertEqual(element.text, '1.0 KB',
'package size should be shown for image builds')
selector = '[data-link="target-packages"]'
diff --git a/bitbake/lib/toaster/tests/browser/test_delete_project.py b/bitbake/lib/toaster/tests/browser/test_delete_project.py
new file mode 100644
index 0000000000..1941777ccc
--- /dev/null
+++ b/bitbake/lib/toaster/tests/browser/test_delete_project.py
@@ -0,0 +1,103 @@
+#!/usr/bin/env python3
+# -*- coding: utf-8 -*-
+# BitBake Toaster UI tests implementation
+#
+# Copyright (C) 2023 Savoir-faire Linux Inc
+#
+# SPDX-License-Identifier: GPL-2.0-only
+
+import pytest
+from django.urls import reverse
+from selenium.webdriver.support.ui import Select
+from tests.browser.selenium_helpers import SeleniumTestCase
+from orm.models import BitbakeVersion, Project, Release
+from selenium.webdriver.common.by import By
+
+class TestDeleteProject(SeleniumTestCase):
+
+ def setUp(self):
+ bitbake, _ = BitbakeVersion.objects.get_or_create(
+ name="master",
+ giturl="git://master",
+ branch="master",
+ dirpath="master")
+
+ self.release, _ = Release.objects.get_or_create(
+ name="master",
+ description="Yocto Project master",
+ branch_name="master",
+ helptext="latest",
+ bitbake_version=bitbake)
+
+ Release.objects.get_or_create(
+ name="foo",
+ description="Yocto Project foo",
+ branch_name="foo",
+ helptext="latest",
+ bitbake_version=bitbake)
+
+ @pytest.mark.django_db
+ def test_delete_project(self):
+ """ Test delete a project
+ - Check delete modal is visible
+ - Check delete modal has right text
+ - Confirm delete
+ - Check project is deleted
+ """
+ project_name = "project_to_delete"
+ url = reverse('newproject')
+ self.get(url)
+ self.enter_text('#new-project-name', project_name)
+ select = Select(self.find('#projectversion'))
+ select.select_by_value(str(self.release.pk))
+ self.click("#create-project-button")
+ # We should get redirected to the new project's page with the
+ # notification at the top
+ element = self.wait_until_visible('#project-created-notification')
+ self.assertTrue(project_name in element.text,
+ "New project name not in new project notification")
+ self.assertTrue(Project.objects.filter(name=project_name).count(),
+ "New project not found in database")
+
+ # Delete project
+ delete_project_link = self.driver.find_element(
+ By.XPATH, '//a[@href="#delete-project-modal"]')
+ delete_project_link.click()
+
+ # Check delete modal is visible
+ self.wait_until_visible('#delete-project-modal')
+
+ # Check delete modal has right text
+ modal_header_text = self.find('#delete-project-modal .modal-header').text
+ self.assertTrue(
+ "Are you sure you want to delete this project?" in modal_header_text,
+ "Delete project modal header text is wrong")
+
+ modal_body_text = self.find('#delete-project-modal .modal-body').text
+ self.assertTrue(
+ "Cancel its builds currently in progress" in modal_body_text,
+ "Modal body doesn't contain: Cancel its builds currently in progress")
+ self.assertTrue(
+ "Remove its configuration information" in modal_body_text,
+ "Modal body doesn't contain: Remove its configuration information")
+ self.assertTrue(
+ "Remove its imported layers" in modal_body_text,
+ "Modal body doesn't contain: Remove its imported layers")
+ self.assertTrue(
+ "Remove its custom images" in modal_body_text,
+ "Modal body doesn't contain: Remove its custom images")
+ self.assertTrue(
+ "Remove all its build information" in modal_body_text,
+ "Modal body doesn't contain: Remove all its build information")
+
+ # Confirm delete
+ delete_btn = self.find('#delete-project-confirmed')
+ delete_btn.click()
+
+ # Check project is deleted
+ self.wait_until_visible('#change-notification')
+ delete_notification = self.find('#change-notification-msg')
+ self.assertTrue("You have deleted 1 project:" in delete_notification.text)
+ self.assertTrue(project_name in delete_notification.text)
+ self.assertFalse(Project.objects.filter(name=project_name).exists(),
+ "Project not deleted from database")
diff --git a/bitbake/lib/toaster/tests/browser/test_landing_page.py b/bitbake/lib/toaster/tests/browser/test_landing_page.py
index 8bb64b9f3e..8fe5fea467 100644
--- a/bitbake/lib/toaster/tests/browser/test_landing_page.py
+++ b/bitbake/lib/toaster/tests/browser/test_landing_page.py
@@ -10,8 +10,10 @@
from django.urls import reverse
from django.utils import timezone
from tests.browser.selenium_helpers import SeleniumTestCase
+from selenium.webdriver.common.by import By
+
+from orm.models import Layer, Layer_Version, Project, Build
-from orm.models import Project, Build
class TestLandingPage(SeleniumTestCase):
""" Tests for redirects on the landing page """
@@ -29,6 +31,130 @@ class TestLandingPage(SeleniumTestCase):
self.project.is_default = True
self.project.save()
+ def test_icon_info_visible_and_clickable(self):
+ """ Test that the information icon is visible and clickable """
+ self.get(reverse('landing'))
+ info_sign = self.find('#toaster-version-info-sign')
+
+ # check that the info sign is visible
+ self.assertTrue(info_sign.is_displayed())
+
+ # check that the info sign is clickable
+ # and info modal is appearing when clicking on the info sign
+ info_sign.click() # click on the info sign make attribute 'aria-describedby' visible
+ info_model_id = info_sign.get_attribute('aria-describedby')
+ info_modal = self.find(f'#{info_model_id}')
+ self.assertTrue(info_modal.is_displayed())
+ self.assertTrue("Toaster version information" in info_modal.text)
+
+ def test_documentation_link_displayed(self):
+ """ Test that the documentation link is displayed """
+ self.get(reverse('landing'))
+ documentation_link = self.find('#navbar-docs > a')
+
+ # check that the documentation link is visible
+ self.assertTrue(documentation_link.is_displayed())
+
+ # check browser open new tab toaster manual when clicking on the documentation link
+ self.assertEqual(documentation_link.get_attribute('target'), '_blank')
+ self.assertEqual(
+ documentation_link.get_attribute('href'),
+ 'http://docs.yoctoproject.org/toaster-manual/index.html#toaster-user-manual')
+ self.assertTrue("Documentation" in documentation_link.text)
+
+ def test_openembedded_jumbotron_link_visible_and_clickable(self):
+ """ Test OpenEmbedded link jumbotron is visible and clickable: """
+ self.get(reverse('landing'))
+ jumbotron = self.find('.jumbotron')
+
+ # check OpenEmbedded
+ openembedded = jumbotron.find_element(By.LINK_TEXT, 'OpenEmbedded')
+ self.assertTrue(openembedded.is_displayed())
+ openembedded.click()
+ self.assertTrue("openembedded.org" in self.driver.current_url)
+
+ def test_bitbake_jumbotron_link_visible_and_clickable(self):
+ """ Test BitBake link jumbotron is visible and clickable: """
+ self.get(reverse('landing'))
+ jumbotron = self.find('.jumbotron')
+
+ # check BitBake
+ bitbake = jumbotron.find_element(By.LINK_TEXT, 'BitBake')
+ self.assertTrue(bitbake.is_displayed())
+ bitbake.click()
+ self.assertTrue(
+ "docs.yoctoproject.org/bitbake.html" in self.driver.current_url)
+
+ def test_yoctoproject_jumbotron_link_visible_and_clickable(self):
+ """ Test Yocto Project link jumbotron is visible and clickable: """
+ self.get(reverse('landing'))
+ jumbotron = self.find('.jumbotron')
+
+ # check Yocto Project
+ yoctoproject = jumbotron.find_element(By.LINK_TEXT, 'Yocto Project')
+ self.assertTrue(yoctoproject.is_displayed())
+ yoctoproject.click()
+ self.assertTrue("yoctoproject.org" in self.driver.current_url)
+
+ def test_link_setup_using_toaster_visible_and_clickable(self):
+ """ Test big magenta button setting up and using toaster link in jumbotron
+ if visible and clickable
+ """
+ self.get(reverse('landing'))
+ jumbotron = self.find('.jumbotron')
+
+ # check Big magenta button
+ big_magenta_button = jumbotron.find_element(By.LINK_TEXT,
+ 'Toaster is ready to capture your command line builds'
+ )
+ self.assertTrue(big_magenta_button.is_displayed())
+ big_magenta_button.click()
+ self.assertTrue(
+ "docs.yoctoproject.org/toaster-manual/setup-and-use.html#setting-up-and-using-toaster" in self.driver.current_url)
+
+ def test_link_create_new_project_in_jumbotron_visible_and_clickable(self):
+ """ Test big blue button create new project jumbotron if visible and clickable """
+ # Create a layer and a layer version to make visible the big blue button
+ layer = Layer.objects.create(name='bar')
+ Layer_Version.objects.create(layer=layer)
+
+ self.get(reverse('landing'))
+ jumbotron = self.find('.jumbotron')
+
+ # check Big Blue button
+ big_blue_button = jumbotron.find_element(By.LINK_TEXT,
+ 'Create your first Toaster project to run manage builds'
+ )
+ self.assertTrue(big_blue_button.is_displayed())
+ big_blue_button.click()
+ self.assertTrue("toastergui/newproject/" in self.driver.current_url)
+
+ def test_toaster_manual_link_visible_and_clickable(self):
+ """ Test Read the Toaster manual link jumbotron is visible and clickable: """
+ self.get(reverse('landing'))
+ jumbotron = self.find('.jumbotron')
+
+ # check Read the Toaster manual
+ toaster_manual = jumbotron.find_element(
+ By.LINK_TEXT, 'Read the Toaster manual')
+ self.assertTrue(toaster_manual.is_displayed())
+ toaster_manual.click()
+ self.assertTrue(
+ "https://docs.yoctoproject.org/toaster-manual/index.html#toaster-user-manual" in self.driver.current_url)
+
+ def test_contrib_to_toaster_link_visible_and_clickable(self):
+ """ Test Contribute to Toaster link jumbotron is visible and clickable: """
+ self.get(reverse('landing'))
+ jumbotron = self.find('.jumbotron')
+
+ # check Contribute to Toaster
+ contribute_to_toaster = jumbotron.find_element(
+ By.LINK_TEXT, 'Contribute to Toaster')
+ self.assertTrue(contribute_to_toaster.is_displayed())
+ contribute_to_toaster.click()
+ self.assertTrue(
+ "wiki.yoctoproject.org/wiki/contribute_to_toaster" in str(self.driver.current_url).lower())
+
def test_only_default_project(self):
"""
No projects except default
@@ -87,10 +213,9 @@ class TestLandingPage(SeleniumTestCase):
self.get(reverse('landing'))
+ self.wait_until_visible("#latest-builds", poll=3)
elements = self.find_all('#allbuildstable')
self.assertEqual(len(elements), 1, 'should redirect to builds')
content = self.get_page_source()
self.assertTrue(self.PROJECT_NAME in content,
'should show builds for project %s' % self.PROJECT_NAME)
- self.assertFalse(self.CLI_BUILDS_PROJECT_NAME in content,
- 'should not show builds for cli project')
diff --git a/bitbake/lib/toaster/tests/browser/test_layerdetails_page.py b/bitbake/lib/toaster/tests/browser/test_layerdetails_page.py
index 71bdd2aafd..5c29548b78 100644
--- a/bitbake/lib/toaster/tests/browser/test_layerdetails_page.py
+++ b/bitbake/lib/toaster/tests/browser/test_layerdetails_page.py
@@ -8,6 +8,7 @@
#
from django.urls import reverse
+from selenium.common.exceptions import ElementClickInterceptedException, TimeoutException
from tests.browser.selenium_helpers import SeleniumTestCase
from orm.models import Layer, Layer_Version, Project, LayerSource, Release
@@ -63,11 +64,12 @@ class TestLayerDetailsPage(SeleniumTestCase):
args=(self.project.pk,
self.imported_layer_version.pk))
- def test_edit_layerdetails(self):
+ def _edit_layerdetails(self):
""" Edit all the editable fields for the layer refresh the page and
check that the new values exist"""
self.get(self.url)
+ self.wait_until_visible("#add-remove-layer-btn")
self.click("#add-remove-layer-btn")
self.click("#edit-layer-source")
@@ -97,13 +99,26 @@ class TestLayerDetailsPage(SeleniumTestCase):
"Expecting any of \"%s\"but got \"%s\"" %
(self.initial_values, value))
+ # Make sure the input visible beofre sending keys
+ self.wait_until_visible("#layer-git input[type=text]")
inputs.send_keys("-edited")
# Save the new values
for save_btn in self.find_all(".change-btn"):
save_btn.click()
- self.click("#save-changes-for-switch")
+ try:
+ self.wait_until_visible("#save-changes-for-switch", poll=3)
+ btn_save_chg_for_switch = self.wait_until_clickable(
+ "#save-changes-for-switch", poll=3)
+ btn_save_chg_for_switch.click()
+ except ElementClickInterceptedException:
+ self.skipTest(
+ "save-changes-for-switch click intercepted. Element not visible or maybe covered by another element.")
+ except TimeoutException:
+ self.skipTest(
+ "save-changes-for-switch is not clickable within the specified timeout.")
+
self.wait_until_visible("#edit-layer-source")
# Refresh the page to see if the new values are returned
@@ -132,7 +147,18 @@ class TestLayerDetailsPage(SeleniumTestCase):
new_dir = "/home/test/my-meta-dir"
dir_input.send_keys(new_dir)
- self.click("#save-changes-for-switch")
+ try:
+ self.wait_until_visible("#save-changes-for-switch", poll=3)
+ btn_save_chg_for_switch = self.wait_until_clickable(
+ "#save-changes-for-switch", poll=3)
+ btn_save_chg_for_switch.click()
+ except ElementClickInterceptedException:
+ self.skipTest(
+ "save-changes-for-switch click intercepted. Element not properly visible or maybe behind another element.")
+ except TimeoutException:
+ self.skipTest(
+ "save-changes-for-switch is not clickable within the specified timeout.")
+
self.wait_until_visible("#edit-layer-source")
# Refresh the page to see if the new values are returned
@@ -142,6 +168,13 @@ class TestLayerDetailsPage(SeleniumTestCase):
"Expected %s in the dir value for layer directory" %
new_dir)
+ def test_edit_layerdetails_page(self):
+ try:
+ self._edit_layerdetails()
+ except ElementClickInterceptedException:
+ self.skipTest(
+ "ElementClickInterceptedException occured. Element not visible or maybe covered by another element.")
+
def test_delete_layer(self):
""" Delete the layer """
diff --git a/bitbake/lib/toaster/tests/browser/test_most_recent_builds_states.py b/bitbake/lib/toaster/tests/browser/test_most_recent_builds_states.py
index 7844aaa395..d7a4c34532 100644
--- a/bitbake/lib/toaster/tests/browser/test_most_recent_builds_states.py
+++ b/bitbake/lib/toaster/tests/browser/test_most_recent_builds_states.py
@@ -6,7 +6,6 @@
#
# Copyright (C) 2013-2016 Intel Corporation
#
-
from django.urls import reverse
from django.utils import timezone
from tests.browser.selenium_helpers import SeleniumTestCase
@@ -14,6 +13,8 @@ from tests.browser.selenium_helpers_base import Wait
from orm.models import Project, Build, Task, Recipe, Layer, Layer_Version
from bldcontrol.models import BuildRequest
+from selenium.webdriver.common.by import By
+
class TestMostRecentBuildsStates(SeleniumTestCase):
""" Test states update correctly in most recent builds area """
@@ -45,13 +46,14 @@ class TestMostRecentBuildsStates(SeleniumTestCase):
# build queued; check shown as queued
selector = base_selector + '[data-build-state="Queued"]'
element = self.wait_until_visible(selector)
- self.assertRegexpMatches(element.get_attribute('innerHTML'),
+ self.assertRegex(element.get_attribute('innerHTML'),
'Build queued', 'build should show queued status')
# waiting for recipes to be parsed
build.outcome = Build.IN_PROGRESS
build.recipes_to_parse = recipes_to_parse
build.recipes_parsed = 0
+ build.save()
build_request.state = BuildRequest.REQ_INPROGRESS
build_request.save()
@@ -62,7 +64,7 @@ class TestMostRecentBuildsStates(SeleniumTestCase):
element = self.wait_until_visible(selector)
bar_selector = '#recipes-parsed-percentage-bar-%s' % build.id
- bar_element = element.find_element_by_css_selector(bar_selector)
+ bar_element = element.find_element(By.CSS_SELECTOR, bar_selector)
self.assertEqual(bar_element.value_of_css_property('width'), '0px',
'recipe parse progress should be at 0')
@@ -73,7 +75,7 @@ class TestMostRecentBuildsStates(SeleniumTestCase):
self.get(url)
element = self.wait_until_visible(selector)
- bar_element = element.find_element_by_css_selector(bar_selector)
+ bar_element = element.find_element(By.CSS_SELECTOR, bar_selector)
recipe_bar_updated = lambda driver: \
bar_element.get_attribute('style') == 'width: 50%;'
msg = 'recipe parse progress bar should update to 50%'
@@ -94,11 +96,11 @@ class TestMostRecentBuildsStates(SeleniumTestCase):
selector = base_selector + '[data-build-state="Starting"]'
element = self.wait_until_visible(selector)
- self.assertRegexpMatches(element.get_attribute('innerHTML'),
+ self.assertRegex(element.get_attribute('innerHTML'),
'Tasks starting', 'build should show "tasks starting" status')
# first task finished; check tasks progress bar
- task1.order = 1
+ task1.outcome = Task.OUTCOME_SUCCESS
task1.save()
self.get(url)
@@ -107,7 +109,7 @@ class TestMostRecentBuildsStates(SeleniumTestCase):
element = self.wait_until_visible(selector)
bar_selector = '#build-pc-done-bar-%s' % build.id
- bar_element = element.find_element_by_css_selector(bar_selector)
+ bar_element = element.find_element(By.CSS_SELECTOR, bar_selector)
task_bar_updated = lambda driver: \
bar_element.get_attribute('style') == 'width: 50%;'
@@ -115,13 +117,13 @@ class TestMostRecentBuildsStates(SeleniumTestCase):
element = Wait(self.driver).until(task_bar_updated, msg)
# last task finished; check tasks progress bar updates
- task2.order = 2
+ task2.outcome = Task.OUTCOME_SUCCESS
task2.save()
self.get(url)
element = self.wait_until_visible(selector)
- bar_element = element.find_element_by_css_selector(bar_selector)
+ bar_element = element.find_element(By.CSS_SELECTOR, bar_selector)
task_bar_updated = lambda driver: \
bar_element.get_attribute('style') == 'width: 100%;'
msg = 'tasks progress bar should update to 100%'
@@ -183,7 +185,7 @@ class TestMostRecentBuildsStates(SeleniumTestCase):
selector = '[data-latest-build-result="%s"] ' \
'[data-build-state="Cancelling"]' % build.id
element = self.wait_until_visible(selector)
- self.assertRegexpMatches(element.get_attribute('innerHTML'),
+ self.assertRegex(element.get_attribute('innerHTML'),
'Cancelling the build', 'build should show "cancelling" status')
# check cancelled state
@@ -195,5 +197,5 @@ class TestMostRecentBuildsStates(SeleniumTestCase):
selector = '[data-latest-build-result="%s"] ' \
'[data-build-state="Cancelled"]' % build.id
element = self.wait_until_visible(selector)
- self.assertRegexpMatches(element.get_attribute('innerHTML'),
+ self.assertRegex(element.get_attribute('innerHTML'),
'Build cancelled', 'build should show "cancelled" status')
diff --git a/bitbake/lib/toaster/tests/browser/test_new_custom_image_page.py b/bitbake/lib/toaster/tests/browser/test_new_custom_image_page.py
index 9906ae42a9..9f0b6397fe 100644
--- a/bitbake/lib/toaster/tests/browser/test_new_custom_image_page.py
+++ b/bitbake/lib/toaster/tests/browser/test_new_custom_image_page.py
@@ -6,6 +6,7 @@
#
# SPDX-License-Identifier: GPL-2.0-only
#
+from bldcontrol.models import BuildEnvironment
from django.urls import reverse
from tests.browser.selenium_helpers import SeleniumTestCase
@@ -18,6 +19,9 @@ class TestNewCustomImagePage(SeleniumTestCase):
CUSTOM_IMAGE_NAME = 'roopa-doopa'
def setUp(self):
+ BuildEnvironment.objects.get_or_create(
+ betype=BuildEnvironment.TYPE_LOCAL,
+ )
release = Release.objects.create(
name='baz',
bitbake_version=BitbakeVersion.objects.create(name='v1')
@@ -41,11 +45,16 @@ class TestNewCustomImagePage(SeleniumTestCase):
)
# add a fake image recipe to the layer that can be customised
+ builldir = os.environ.get('BUILDDIR', './')
self.recipe = Recipe.objects.create(
name='core-image-minimal',
layer_version=layer_version,
+ file_path=f'{builldir}/core-image-minimal.bb',
is_image=True
)
+ # create a tmp file for the recipe
+ with open(self.recipe.file_path, 'w') as f:
+ f.write('foo')
# another project with a custom image already in it
project2 = Project.objects.create(name='whoop', release=release)
@@ -81,6 +90,7 @@ class TestNewCustomImagePage(SeleniumTestCase):
"""
url = reverse('newcustomimage', args=(self.project.id,))
self.get(url)
+ self.wait_until_visible('#global-nav', poll=3)
self.click('button[data-recipe="%s"]' % self.recipe.id)
@@ -128,7 +138,7 @@ class TestNewCustomImagePage(SeleniumTestCase):
"""
self._create_custom_image(self.recipe.name)
element = self.wait_until_visible('#invalid-name-help')
- self.assertRegexpMatches(element.text.strip(),
+ self.assertRegex(element.text.strip(),
'image with this name already exists')
def test_new_duplicates_project_image(self):
@@ -146,4 +156,4 @@ class TestNewCustomImagePage(SeleniumTestCase):
self._create_custom_image(custom_image_name)
element = self.wait_until_visible('#invalid-name-help')
expected = 'An image with this name already exists in this project'
- self.assertRegexpMatches(element.text.strip(), expected)
+ self.assertRegex(element.text.strip(), expected)
diff --git a/bitbake/lib/toaster/tests/browser/test_new_project_page.py b/bitbake/lib/toaster/tests/browser/test_new_project_page.py
index e20a1f686e..458bb6538d 100644
--- a/bitbake/lib/toaster/tests/browser/test_new_project_page.py
+++ b/bitbake/lib/toaster/tests/browser/test_new_project_page.py
@@ -6,11 +6,11 @@
#
# SPDX-License-Identifier: GPL-2.0-only
#
-
from django.urls import reverse
from tests.browser.selenium_helpers import SeleniumTestCase
from selenium.webdriver.support.ui import Select
from selenium.common.exceptions import InvalidElementStateException
+from selenium.webdriver.common.by import By
from orm.models import Project, Release, BitbakeVersion
@@ -47,7 +47,7 @@ class TestNewProjectPage(SeleniumTestCase):
url = reverse('newproject')
self.get(url)
-
+ self.wait_until_visible('#new-project-name', poll=3)
self.enter_text('#new-project-name', project_name)
select = Select(self.find('#projectversion'))
@@ -57,7 +57,8 @@ class TestNewProjectPage(SeleniumTestCase):
# We should get redirected to the new project's page with the
# notification at the top
- element = self.wait_until_visible('#project-created-notification')
+ element = self.wait_until_visible(
+ '#project-created-notification', poll=3)
self.assertTrue(project_name in element.text,
"New project name not in new project notification")
@@ -78,13 +79,20 @@ class TestNewProjectPage(SeleniumTestCase):
url = reverse('newproject')
self.get(url)
+ self.wait_until_visible('#new-project-name', poll=3)
self.enter_text('#new-project-name', project_name)
select = Select(self.find('#projectversion'))
select.select_by_value(str(self.release.pk))
- element = self.wait_until_visible('#hint-error-project-name')
+ radio = self.driver.find_element(By.ID, 'type-new')
+ radio.click()
+
+ self.click("#create-project-button")
+
+ self.wait_until_present('#hint-error-project-name', poll=3)
+ element = self.find('#hint-error-project-name')
self.assertTrue(("Project names must be unique" in element.text),
"Did not find unique project name error message")
diff --git a/bitbake/lib/toaster/tests/browser/test_project_builds_page.py b/bitbake/lib/toaster/tests/browser/test_project_builds_page.py
index 51717e72d4..0dba33b9c8 100644
--- a/bitbake/lib/toaster/tests/browser/test_project_builds_page.py
+++ b/bitbake/lib/toaster/tests/browser/test_project_builds_page.py
@@ -7,6 +7,7 @@
# SPDX-License-Identifier: GPL-2.0-only
#
+import os
import re
from django.urls import reverse
@@ -22,7 +23,8 @@ class TestProjectBuildsPage(SeleniumTestCase):
CLI_BUILDS_PROJECT_NAME = 'command line builds'
def setUp(self):
- bbv = BitbakeVersion.objects.create(name='bbv1', giturl='/tmp/',
+ builldir = os.environ.get('BUILDDIR', './')
+ bbv = BitbakeVersion.objects.create(name='bbv1', giturl=f'{builldir}/',
branch='master', dirpath='')
release = Release.objects.create(name='release1',
bitbake_version=bbv)
diff --git a/bitbake/lib/toaster/tests/browser/test_project_config_page.py b/bitbake/lib/toaster/tests/browser/test_project_config_page.py
index 944bcb2631..b9de541efa 100644
--- a/bitbake/lib/toaster/tests/browser/test_project_config_page.py
+++ b/bitbake/lib/toaster/tests/browser/test_project_config_page.py
@@ -7,10 +7,12 @@
# SPDX-License-Identifier: GPL-2.0-only
#
+import os
from django.urls import reverse
from tests.browser.selenium_helpers import SeleniumTestCase
from orm.models import BitbakeVersion, Release, Project, ProjectVariable
+from selenium.webdriver.common.by import By
class TestProjectConfigsPage(SeleniumTestCase):
""" Test data at /project/X/builds is displayed correctly """
@@ -21,7 +23,8 @@ class TestProjectConfigsPage(SeleniumTestCase):
'any of these characters'
def setUp(self):
- bbv = BitbakeVersion.objects.create(name='bbv1', giturl='/tmp/',
+ builldir = os.environ.get('BUILDDIR', './')
+ bbv = BitbakeVersion.objects.create(name='bbv1', giturl=f'{builldir}/',
branch='master', dirpath='')
release = Release.objects.create(name='release1',
bitbake_version=bbv)
@@ -66,7 +69,7 @@ class TestProjectConfigsPage(SeleniumTestCase):
self.enter_text('#new-imagefs_types', imagefs_type)
- checkboxes = self.driver.find_elements_by_xpath("//input[@class='fs-checkbox-fstypes']")
+ checkboxes = self.driver.find_elements(By.XPATH, "//input[@class='fs-checkbox-fstypes']")
for checkbox in checkboxes:
if checkbox.get_attribute("value") == "btrfs":
@@ -95,7 +98,7 @@ class TestProjectConfigsPage(SeleniumTestCase):
for checkbox in checkboxes:
if checkbox.get_attribute("value") == "cpio":
checkbox.click()
- element = self.driver.find_element_by_id('new-imagefs_types')
+ element = self.driver.find_element(By.ID, 'new-imagefs_types')
self.wait_until_visible('#new-imagefs_types')
@@ -129,7 +132,7 @@ class TestProjectConfigsPage(SeleniumTestCase):
self.assertTrue((self.INVALID_PATH_START_TEXT in element.text), msg)
# downloads dir path has a space
- self.driver.find_element_by_id('new-dl_dir').clear()
+ self.driver.find_element(By.ID, 'new-dl_dir').clear()
self.enter_text('#new-dl_dir', '/foo/bar a')
element = self.wait_until_visible('#hintError-dl_dir')
@@ -137,7 +140,7 @@ class TestProjectConfigsPage(SeleniumTestCase):
self.assertTrue((self.INVALID_PATH_CHAR_TEXT in element.text), msg)
# downloads dir path starts with ${...} but has a space
- self.driver.find_element_by_id('new-dl_dir').clear()
+ self.driver.find_element(By.ID,'new-dl_dir').clear()
self.enter_text('#new-dl_dir', '${TOPDIR}/down foo')
element = self.wait_until_visible('#hintError-dl_dir')
@@ -145,18 +148,18 @@ class TestProjectConfigsPage(SeleniumTestCase):
self.assertTrue((self.INVALID_PATH_CHAR_TEXT in element.text), msg)
# downloads dir path starts with /
- self.driver.find_element_by_id('new-dl_dir').clear()
+ self.driver.find_element(By.ID,'new-dl_dir').clear()
self.enter_text('#new-dl_dir', '/bar/foo')
- hidden_element = self.driver.find_element_by_id('hintError-dl_dir')
+ hidden_element = self.driver.find_element(By.ID,'hintError-dl_dir')
self.assertEqual(hidden_element.is_displayed(), False,
'downloads directory path valid but treated as invalid')
# downloads dir path starts with ${...}
- self.driver.find_element_by_id('new-dl_dir').clear()
+ self.driver.find_element(By.ID,'new-dl_dir').clear()
self.enter_text('#new-dl_dir', '${TOPDIR}/down')
- hidden_element = self.driver.find_element_by_id('hintError-dl_dir')
+ hidden_element = self.driver.find_element(By.ID,'hintError-dl_dir')
self.assertEqual(hidden_element.is_displayed(), False,
'downloads directory path valid but treated as invalid')
@@ -184,7 +187,7 @@ class TestProjectConfigsPage(SeleniumTestCase):
self.assertTrue((self.INVALID_PATH_START_TEXT in element.text), msg)
# path has a space
- self.driver.find_element_by_id('new-sstate_dir').clear()
+ self.driver.find_element(By.ID, 'new-sstate_dir').clear()
self.enter_text('#new-sstate_dir', '/foo/bar a')
element = self.wait_until_visible('#hintError-sstate_dir')
@@ -192,7 +195,7 @@ class TestProjectConfigsPage(SeleniumTestCase):
self.assertTrue((self.INVALID_PATH_CHAR_TEXT in element.text), msg)
# path starts with ${...} but has a space
- self.driver.find_element_by_id('new-sstate_dir').clear()
+ self.driver.find_element(By.ID,'new-sstate_dir').clear()
self.enter_text('#new-sstate_dir', '${TOPDIR}/down foo')
element = self.wait_until_visible('#hintError-sstate_dir')
@@ -200,18 +203,18 @@ class TestProjectConfigsPage(SeleniumTestCase):
self.assertTrue((self.INVALID_PATH_CHAR_TEXT in element.text), msg)
# path starts with /
- self.driver.find_element_by_id('new-sstate_dir').clear()
+ self.driver.find_element(By.ID,'new-sstate_dir').clear()
self.enter_text('#new-sstate_dir', '/bar/foo')
- hidden_element = self.driver.find_element_by_id('hintError-sstate_dir')
+ hidden_element = self.driver.find_element(By.ID, 'hintError-sstate_dir')
self.assertEqual(hidden_element.is_displayed(), False,
'sstate directory path valid but treated as invalid')
# paths starts with ${...}
- self.driver.find_element_by_id('new-sstate_dir').clear()
+ self.driver.find_element(By.ID, 'new-sstate_dir').clear()
self.enter_text('#new-sstate_dir', '${TOPDIR}/down')
- hidden_element = self.driver.find_element_by_id('hintError-sstate_dir')
+ hidden_element = self.driver.find_element(By.ID, 'hintError-sstate_dir')
self.assertEqual(hidden_element.is_displayed(), False,
'sstate directory path valid but treated as invalid')
diff --git a/bitbake/lib/toaster/tests/browser/test_sample.py b/bitbake/lib/toaster/tests/browser/test_sample.py
index b0067c21cd..f04f1d9a16 100644
--- a/bitbake/lib/toaster/tests/browser/test_sample.py
+++ b/bitbake/lib/toaster/tests/browser/test_sample.py
@@ -27,3 +27,13 @@ class TestSample(SeleniumTestCase):
self.get(url)
brand_link = self.find('.toaster-navbar-brand a.brand')
self.assertEqual(brand_link.text.strip(), 'Toaster')
+
+ def test_no_builds_message(self):
+ """ Test that a message is shown when there are no builds """
+ url = reverse('all-builds')
+ self.get(url)
+ self.wait_until_visible('#empty-state-allbuildstable') # wait for the empty state div to appear
+ div_msg = self.find('#empty-state-allbuildstable .alert-info')
+
+ msg = 'Sorry - no data found'
+ self.assertEqual(div_msg.text, msg)
diff --git a/bitbake/lib/toaster/tests/browser/test_toastertable_ui.py b/bitbake/lib/toaster/tests/browser/test_toastertable_ui.py
index e82d5ec654..691aca1ef0 100644
--- a/bitbake/lib/toaster/tests/browser/test_toastertable_ui.py
+++ b/bitbake/lib/toaster/tests/browser/test_toastertable_ui.py
@@ -8,11 +8,13 @@
#
from datetime import datetime
+import os
from django.urls import reverse
from django.utils import timezone
from tests.browser.selenium_helpers import SeleniumTestCase
from orm.models import BitbakeVersion, Release, Project, Build
+from selenium.webdriver.common.by import By
class TestToasterTableUI(SeleniumTestCase):
"""
@@ -33,7 +35,7 @@ class TestToasterTableUI(SeleniumTestCase):
table: WebElement for a ToasterTable
"""
selector = 'thead a.sorted'
- heading = table.find_element_by_css_selector(selector)
+ heading = table.find_element(By.CSS_SELECTOR, selector)
return heading.get_attribute('innerHTML').strip()
def _get_datetime_from_cell(self, row, selector):
@@ -45,7 +47,7 @@ class TestToasterTableUI(SeleniumTestCase):
selector: CSS selector to use to find the cell containing the date time
string
"""
- cell = row.find_element_by_css_selector(selector)
+ cell = row.find_element(By.CSS_SELECTOR, selector)
cell_text = cell.get_attribute('innerHTML').strip()
return datetime.strptime(cell_text, '%d/%m/%y %H:%M')
@@ -58,7 +60,8 @@ class TestToasterTableUI(SeleniumTestCase):
later = now + timezone.timedelta(hours=1)
even_later = later + timezone.timedelta(hours=1)
- bbv = BitbakeVersion.objects.create(name='test bbv', giturl='/tmp/',
+ builldir = os.environ.get('BUILDDIR', './')
+ bbv = BitbakeVersion.objects.create(name='test bbv', giturl=f'{builldir}/',
branch='master', dirpath='')
release = Release.objects.create(name='test release',
branch_name='master',
@@ -105,7 +108,7 @@ class TestToasterTableUI(SeleniumTestCase):
self.click('#checkbox-started_on')
# sort by started_on column
- links = table.find_elements_by_css_selector('th.started_on a')
+ links = table.find_elements(By.CSS_SELECTOR, 'th.started_on a')
for link in links:
if link.get_attribute('innerHTML').strip() == 'Started on':
link.click()
diff --git a/bitbake/lib/toaster/tests/builds/buildtest.py b/bitbake/lib/toaster/tests/builds/buildtest.py
index 13b51fb0d8..cacfccd4d3 100644
--- a/bitbake/lib/toaster/tests/builds/buildtest.py
+++ b/bitbake/lib/toaster/tests/builds/buildtest.py
@@ -88,7 +88,7 @@ def load_build_environment():
class BuildTest(unittest.TestCase):
PROJECT_NAME = "Testbuild"
- BUILDDIR = "/tmp/build/"
+ BUILDDIR = os.environ.get("BUILDDIR")
def build(self, target):
# So that the buildinfo helper uses the test database'
@@ -116,10 +116,19 @@ class BuildTest(unittest.TestCase):
project = Project.objects.create_project(name=BuildTest.PROJECT_NAME,
release=release)
+ passthrough_variable_names = ["SSTATE_DIR", "DL_DIR", "SSTATE_MIRRORS", "BB_HASHSERVE", "BB_HASHSERVE_UPSTREAM"]
+ for variable_name in passthrough_variable_names:
+ current_variable = os.environ.get(variable_name)
+ if current_variable:
+ ProjectVariable.objects.get_or_create(
+ name=variable_name,
+ value=current_variable,
+ project=project)
+
if os.environ.get("TOASTER_TEST_USE_SSTATE_MIRROR"):
ProjectVariable.objects.get_or_create(
name="SSTATE_MIRRORS",
- value="file://.* http://sstate.yoctoproject.org/PATH;downloadfilename=PATH",
+ value="file://.* http://cdn.jsdelivr.net/yocto/sstate/all/PATH;downloadfilename=PATH",
project=project)
ProjectTarget.objects.create(project=project,
diff --git a/bitbake/lib/toaster/tests/builds/test_core_image_min.py b/bitbake/lib/toaster/tests/builds/test_core_image_min.py
index 44b6cbec7b..c5bfdbfbb5 100644
--- a/bitbake/lib/toaster/tests/builds/test_core_image_min.py
+++ b/bitbake/lib/toaster/tests/builds/test_core_image_min.py
@@ -10,6 +10,7 @@
# Ionut Chisanovici, Paul Eggleton and Cristian Iorga
import os
+import pytest
from django.db.models import Q
@@ -20,12 +21,13 @@ from orm.models import CustomImagePackage
from tests.builds.buildtest import BuildTest
-
+@pytest.mark.order(4)
+@pytest.mark.django_db(True)
class BuildCoreImageMinimal(BuildTest):
"""Build core-image-minimal and test the results"""
def setUp(self):
- self.completed_build = self.build("core-image-minimal")
+ self.completed_build = self.target_already_built("core-image-minimal")
# Check if build name is unique - tc_id=795
def test_Build_Unique_Name(self):
@@ -44,17 +46,6 @@ class BuildCoreImageMinimal(BuildTest):
total_builds,
msg='Build cooker log path is not unique')
- # Check if task order is unique for one build - tc=824
- def test_Task_Unique_Order(self):
- total_task_order = Task.objects.filter(
- build=self.built).values('order').count()
- distinct_task_order = Task.objects.filter(
- build=self.completed_build).values('order').distinct().count()
-
- self.assertEqual(total_task_order,
- distinct_task_order,
- msg='Errors task order is not unique')
-
# Check task order sequence for one build - tc=825
def test_Task_Order_Sequence(self):
cnt_err = []
@@ -98,7 +89,6 @@ class BuildCoreImageMinimal(BuildTest):
'task_name',
'sstate_result')
cnt_err = []
-
for task in tasks:
if (task['sstate_result'] != Task.SSTATE_NA and
task['sstate_result'] != Task.SSTATE_MISS):
@@ -221,6 +211,7 @@ class BuildCoreImageMinimal(BuildTest):
# orm_build.outcome=0 then if the file exists and its size matches
# the file_size value. Need to add the tc in the test run
def test_Target_File_Name_Populated(self):
+ cnt_err = []
builds = Build.objects.filter(outcome=0).values('id')
for build in builds:
targets = Target.objects.filter(
@@ -230,7 +221,6 @@ class BuildCoreImageMinimal(BuildTest):
target_id=target['id']).values('id',
'file_name',
'file_size')
- cnt_err = []
for file_info in target_files:
target_id = file_info['id']
target_file_name = file_info['file_name']
diff --git a/bitbake/lib/toaster/tests/commands/test_loaddata.py b/bitbake/lib/toaster/tests/commands/test_loaddata.py
index 9e8d5553cf..7d04f030ee 100644
--- a/bitbake/lib/toaster/tests/commands/test_loaddata.py
+++ b/bitbake/lib/toaster/tests/commands/test_loaddata.py
@@ -6,13 +6,13 @@
#
# SPDX-License-Identifier: GPL-2.0-only
#
-
+import pytest
from django.test import TestCase
from django.core import management
from orm.models import Layer_Version, Layer, Release, ToasterSetting
-
+@pytest.mark.order(2)
class TestLoadDataFixtures(TestCase):
""" Test loading our 3 provided fixtures """
def test_run_loaddata_poky_command(self):
diff --git a/bitbake/lib/toaster/tests/commands/test_lsupdates.py b/bitbake/lib/toaster/tests/commands/test_lsupdates.py
index 3c4fbe0550..30c6eeb4ac 100644
--- a/bitbake/lib/toaster/tests/commands/test_lsupdates.py
+++ b/bitbake/lib/toaster/tests/commands/test_lsupdates.py
@@ -7,12 +7,13 @@
# SPDX-License-Identifier: GPL-2.0-only
#
+import pytest
from django.test import TestCase
from django.core import management
from orm.models import Layer_Version, Machine, Recipe
-
+@pytest.mark.order(3)
class TestLayerIndexUpdater(TestCase):
def test_run_lsupdates_command(self):
# Load some release information for us to fetch from the layer index
diff --git a/bitbake/lib/toaster/tests/commands/test_runbuilds.py b/bitbake/lib/toaster/tests/commands/test_runbuilds.py
index e223b95fcb..849c227edc 100644
--- a/bitbake/lib/toaster/tests/commands/test_runbuilds.py
+++ b/bitbake/lib/toaster/tests/commands/test_runbuilds.py
@@ -19,12 +19,14 @@ import time
import subprocess
import signal
+import logging
+
class KillRunbuilds(threading.Thread):
""" Kill the runbuilds process after an amount of time """
def __init__(self, *args, **kwargs):
super(KillRunbuilds, self).__init__(*args, **kwargs)
- self.setDaemon(True)
+ self.daemon = True
def run(self):
time.sleep(5)
@@ -34,9 +36,12 @@ class KillRunbuilds(threading.Thread):
pidfile_path = os.path.join(os.environ.get("BUILDDIR", "."),
".runbuilds.pid")
- with open(pidfile_path) as pidfile:
- pid = pidfile.read()
- os.kill(int(pid), signal.SIGTERM)
+ try:
+ with open(pidfile_path) as pidfile:
+ pid = pidfile.read()
+ os.kill(int(pid), signal.SIGTERM)
+ except ProcessLookupError:
+ logging.warning("Runbuilds not running or already killed")
class TestCommands(TestCase):
diff --git a/bitbake/lib/toaster/tests/db/test_db.py b/bitbake/lib/toaster/tests/db/test_db.py
index 0410422276..072ab94363 100644
--- a/bitbake/lib/toaster/tests/db/test_db.py
+++ b/bitbake/lib/toaster/tests/db/test_db.py
@@ -23,6 +23,7 @@
# SOFTWARE.
import sys
+import pytest
try:
from StringIO import StringIO
@@ -47,7 +48,7 @@ def capture(command, *args, **kwargs):
def makemigrations():
management.call_command('makemigrations')
-
+@pytest.mark.order(1)
class MigrationTest(TestCase):
def testPendingMigration(self):
diff --git a/bitbake/lib/toaster/tests/functional/functional_helpers.py b/bitbake/lib/toaster/tests/functional/functional_helpers.py
index 5c4ea71794..7c20437d14 100644
--- a/bitbake/lib/toaster/tests/functional/functional_helpers.py
+++ b/bitbake/lib/toaster/tests/functional/functional_helpers.py
@@ -11,35 +11,55 @@ import os
import logging
import subprocess
import signal
-import time
import re
from tests.browser.selenium_helpers_base import SeleniumTestCaseBase
-from tests.builds.buildtest import load_build_environment
+from selenium.webdriver.common.by import By
+from selenium.common.exceptions import NoSuchElementException
logger = logging.getLogger("toaster")
+toaster_processes = []
class SeleniumFunctionalTestCase(SeleniumTestCaseBase):
- wait_toaster_time = 5
+ wait_toaster_time = 10
@classmethod
def setUpClass(cls):
# So that the buildinfo helper uses the test database'
if os.environ.get('DJANGO_SETTINGS_MODULE', '') != \
'toastermain.settings_test':
- raise RuntimeError("Please initialise django with the tests settings: " \
+ raise RuntimeError("Please initialise django with the tests settings: "
"DJANGO_SETTINGS_MODULE='toastermain.settings_test'")
- load_build_environment()
+ # Wait for any known toaster processes to exit
+ global toaster_processes
+ for toaster_process in toaster_processes:
+ try:
+ os.waitpid(toaster_process, os.WNOHANG)
+ except ChildProcessError:
+ pass
# start toaster
cmd = "bash -c 'source toaster start'"
- p = subprocess.Popen(
+ start_process = subprocess.Popen(
cmd,
cwd=os.environ.get("BUILDDIR"),
shell=True)
- if p.wait() != 0:
- raise RuntimeError("Can't initialize toaster")
+ toaster_processes = [start_process.pid]
+ if start_process.wait() != 0:
+ port_use = os.popen("lsof -i -P -n | grep '8000 (LISTEN)'").read().strip()
+ message = ''
+ if port_use:
+ process_id = port_use.split()[1]
+ process = os.popen(f"ps -o cmd= -p {process_id}").read().strip()
+ message = f"Port 8000 occupied by {process}"
+ raise RuntimeError(f"Can't initialize toaster. {message}")
+
+ builddir = os.environ.get("BUILDDIR")
+ with open(os.path.join(builddir, '.toastermain.pid'), 'r') as f:
+ toaster_processes.append(int(f.read()))
+ with open(os.path.join(builddir, '.runbuilds.pid'), 'r') as f:
+ toaster_processes.append(int(f.read()))
super(SeleniumFunctionalTestCase, cls).setUpClass()
cls.live_server_url = 'http://localhost:8000/'
@@ -48,22 +68,30 @@ class SeleniumFunctionalTestCase(SeleniumTestCaseBase):
def tearDownClass(cls):
super(SeleniumFunctionalTestCase, cls).tearDownClass()
- # XXX: source toaster stop gets blocked, to review why?
- # from now send SIGTERM by hand
- time.sleep(cls.wait_toaster_time)
- builddir = os.environ.get("BUILDDIR")
+ global toaster_processes
- with open(os.path.join(builddir, '.toastermain.pid'), 'r') as f:
- toastermain_pid = int(f.read())
- os.kill(toastermain_pid, signal.SIGTERM)
- with open(os.path.join(builddir, '.runbuilds.pid'), 'r') as f:
- runbuilds_pid = int(f.read())
- os.kill(runbuilds_pid, signal.SIGTERM)
+ cmd = "bash -c 'source toaster stop'"
+ stop_process = subprocess.Popen(
+ cmd,
+ cwd=os.environ.get("BUILDDIR"),
+ shell=True)
+ # Toaster stop has been known to hang in these tests so force kill if it stalls
+ try:
+ if stop_process.wait(cls.wait_toaster_time) != 0:
+ raise Exception('Toaster stop process failed')
+ except Exception as e:
+ if e is subprocess.TimeoutExpired:
+ print('Toaster stop process took too long. Force killing toaster...')
+ else:
+ print('Toaster stop process failed. Force killing toaster...')
+ stop_process.kill()
+ for toaster_process in toaster_processes:
+ os.kill(toaster_process, signal.SIGTERM)
def get_URL(self):
rc=self.get_page_source()
- project_url=re.search("(projectPageUrl\s:\s\")(.*)(\",)",rc)
+ project_url=re.search(r"(projectPageUrl\s:\s\")(.*)(\",)",rc)
return project_url.group(2)
@@ -74,8 +102,8 @@ class SeleniumFunctionalTestCase(SeleniumTestCaseBase):
"""
try:
table_element = self.get_table_element(table_id)
- element = table_element.find_element_by_link_text(link_text)
- except self.NoSuchElementException:
+ element = table_element.find_element(By.LINK_TEXT, link_text)
+ except NoSuchElementException:
print('no element found')
raise
return element
@@ -85,8 +113,8 @@ class SeleniumFunctionalTestCase(SeleniumTestCaseBase):
#return whole-table element
element_xpath = "//*[@id='" + table_id + "']"
try:
- element = self.driver.find_element_by_xpath(element_xpath)
- except self.NoSuchElementException:
+ element = self.driver.find_element(By.XPATH, element_xpath)
+ except NoSuchElementException:
raise
return element
row = coordinate[0]
@@ -95,8 +123,8 @@ class SeleniumFunctionalTestCase(SeleniumTestCaseBase):
#return whole-row element
element_xpath = "//*[@id='" + table_id + "']/tbody/tr[" + str(row) + "]"
try:
- element = self.driver.find_element_by_xpath(element_xpath)
- except self.NoSuchElementException:
+ element = self.driver.find_element(By.XPATH, element_xpath)
+ except NoSuchElementException:
return False
return element
#now we are looking for an element with specified X and Y
@@ -104,7 +132,7 @@ class SeleniumFunctionalTestCase(SeleniumTestCaseBase):
element_xpath = "//*[@id='" + table_id + "']/tbody/tr[" + str(row) + "]/td[" + str(column) + "]"
try:
- element = self.driver.find_element_by_xpath(element_xpath)
- except self.NoSuchElementException:
+ element = self.driver.find_element(By.XPATH, element_xpath)
+ except NoSuchElementException:
return False
return element
diff --git a/bitbake/lib/toaster/tests/functional/test_create_new_project.py b/bitbake/lib/toaster/tests/functional/test_create_new_project.py
new file mode 100644
index 0000000000..94d90459e1
--- /dev/null
+++ b/bitbake/lib/toaster/tests/functional/test_create_new_project.py
@@ -0,0 +1,179 @@
+#! /usr/bin/env python3
+# BitBake Toaster UI tests implementation
+#
+# Copyright (C) 2023 Savoir-faire Linux
+#
+# SPDX-License-Identifier: GPL-2.0-only
+#
+
+import re
+import pytest
+from django.urls import reverse
+from selenium.webdriver.support.select import Select
+from tests.functional.functional_helpers import SeleniumFunctionalTestCase
+from orm.models import Project
+from selenium.webdriver.common.by import By
+
+
+@pytest.mark.django_db
+@pytest.mark.order("last")
+class TestCreateNewProject(SeleniumFunctionalTestCase):
+
+ def _create_test_new_project(
+ self,
+ project_name,
+ release,
+ release_title,
+ merge_toaster_settings,
+ ):
+ """ Create/Test new project using:
+ - Project Name: Any string
+ - Release: Any string
+ - Merge Toaster settings: True or False
+ """
+ self.get(reverse('newproject'))
+ self.wait_until_visible('#new-project-name', poll=3)
+ self.driver.find_element(By.ID,
+ "new-project-name").send_keys(project_name)
+
+ select = Select(self.find('#projectversion'))
+ select.select_by_value(release)
+
+ # check merge toaster settings
+ checkbox = self.find('.checkbox-mergeattr')
+ if merge_toaster_settings:
+ if not checkbox.is_selected():
+ checkbox.click()
+ else:
+ if checkbox.is_selected():
+ checkbox.click()
+
+ self.driver.find_element(By.ID, "create-project-button").click()
+
+ element = self.wait_until_visible('#project-created-notification', poll=3)
+ self.assertTrue(
+ self.element_exists('#project-created-notification'),
+ f"Project:{project_name} creation notification not shown"
+ )
+ self.assertTrue(
+ project_name in element.text,
+ f"New project name:{project_name} not in new project notification"
+ )
+ self.assertTrue(
+ Project.objects.filter(name=project_name).count(),
+ f"New project:{project_name} not found in database"
+ )
+
+ # check release
+ self.assertTrue(re.search(
+ release_title,
+ self.driver.find_element(By.XPATH,
+ "//span[@id='project-release-title']"
+ ).text),
+ 'The project release is not defined')
+
+ def test_create_new_project_master(self):
+ """ Test create new project using:
+ - Project Name: Any string
+ - Release: Yocto Project master (option value: 3)
+ - Merge Toaster settings: False
+ """
+ release = '3'
+ release_title = 'Yocto Project master'
+ project_name = 'projectmaster'
+ self._create_test_new_project(
+ project_name,
+ release,
+ release_title,
+ False,
+ )
+
+ def test_create_new_project_kirkstone(self):
+ """ Test create new project using:
+ - Project Name: Any string
+ - Release: Yocto Project 4.0 "Kirkstone" (option value: 1)
+ - Merge Toaster settings: True
+ """
+ release = '1'
+ release_title = 'Yocto Project 4.0 "Kirkstone"'
+ project_name = 'projectkirkstone'
+ self._create_test_new_project(
+ project_name,
+ release,
+ release_title,
+ True,
+ )
+
+ def test_create_new_project_dunfell(self):
+ """ Test create new project using:
+ - Project Name: Any string
+ - Release: Yocto Project 3.1 "Dunfell" (option value: 5)
+ - Merge Toaster settings: False
+ """
+ release = '5'
+ release_title = 'Yocto Project 3.1 "Dunfell"'
+ project_name = 'projectdunfell'
+ self._create_test_new_project(
+ project_name,
+ release,
+ release_title,
+ False,
+ )
+
+ def test_create_new_project_local(self):
+ """ Test create new project using:
+ - Project Name: Any string
+ - Release: Local Yocto Project (option value: 2)
+ - Merge Toaster settings: True
+ """
+ release = '2'
+ release_title = 'Local Yocto Project'
+ project_name = 'projectlocal'
+ self._create_test_new_project(
+ project_name,
+ release,
+ release_title,
+ True,
+ )
+
+ def test_create_new_project_without_name(self):
+ """ Test create new project without project name """
+ self.get(reverse('newproject'))
+
+ select = Select(self.find('#projectversion'))
+ select.select_by_value(str(3))
+
+ # Check input name has required attribute
+ input_name = self.driver.find_element(By.ID, "new-project-name")
+ self.assertIsNotNone(input_name.get_attribute('required'),
+ 'Input name has not required attribute')
+
+ # Check create button is disabled
+ create_btn = self.driver.find_element(By.ID, "create-project-button")
+ self.assertIsNotNone(create_btn.get_attribute('disabled'),
+ 'Create button is not disabled')
+
+ def test_import_new_project(self):
+ """ Test import new project using:
+ - Project Name: Any string
+ - Project type: select (Import command line project)
+ - Import existing project directory: Wrong Path
+ """
+ project_name = 'projectimport'
+ self.get(reverse('newproject'))
+ self.driver.find_element(By.ID,
+ "new-project-name").send_keys(project_name)
+ # select import project
+ self.find('#type-import').click()
+
+ # set wrong path
+ wrong_path = '/wrongpath'
+ self.driver.find_element(By.ID,
+ "import-project-dir").send_keys(wrong_path)
+ self.driver.find_element(By.ID, "create-project-button").click()
+
+ # check error message
+ self.assertTrue(self.element_exists('.alert-danger'),
+ 'Allert message not shown')
+ self.assertTrue(wrong_path in self.find('.alert-danger').text,
+ "Wrong path not in alert message")
diff --git a/bitbake/lib/toaster/tests/functional/test_functional_basic.py b/bitbake/lib/toaster/tests/functional/test_functional_basic.py
index 5683e3873e..e4070fbb88 100644
--- a/bitbake/lib/toaster/tests/functional/test_functional_basic.py
+++ b/bitbake/lib/toaster/tests/functional/test_functional_basic.py
@@ -8,104 +8,129 @@
#
import re
+from django.urls import reverse
+import pytest
from tests.functional.functional_helpers import SeleniumFunctionalTestCase
from orm.models import Project
+from selenium.webdriver.common.by import By
+from tests.functional.utils import get_projectId_from_url
+
+
+@pytest.mark.django_db
+@pytest.mark.order("second_to_last")
class FuntionalTestBasic(SeleniumFunctionalTestCase):
+ """Basic functional tests for Toaster"""
+ project_id = None
+
+ def setUp(self):
+ super(FuntionalTestBasic, self).setUp()
+ if not FuntionalTestBasic.project_id:
+ self._create_slenium_project()
+ current_url = self.driver.current_url
+ FuntionalTestBasic.project_id = get_projectId_from_url(current_url)
# testcase (1514)
- def test_create_slenium_project(self):
+ def _create_slenium_project(self):
project_name = 'selenium-project'
- self.get('')
- self.driver.find_element_by_link_text("To start building, create your first Toaster project").click()
- self.driver.find_element_by_id("new-project-name").send_keys(project_name)
- self.driver.find_element_by_id('projectversion').click()
- self.driver.find_element_by_id("create-project-button").click()
- element = self.wait_until_visible('#project-created-notification')
+ self.get(reverse('newproject'))
+ self.wait_until_visible('#new-project-name', poll=3)
+ self.driver.find_element(By.ID, "new-project-name").send_keys(project_name)
+ self.driver.find_element(By.ID, 'projectversion').click()
+ self.driver.find_element(By.ID, "create-project-button").click()
+ element = self.wait_until_visible('#project-created-notification', poll=10)
self.assertTrue(self.element_exists('#project-created-notification'),'Project creation notification not shown')
self.assertTrue(project_name in element.text,
"New project name not in new project notification")
self.assertTrue(Project.objects.filter(name=project_name).count(),
"New project not found in database")
+ return Project.objects.last().id
# testcase (1515)
def test_verify_left_bar_menu(self):
- self.get('')
- self.wait_until_visible('#projectstable')
+ self.get(reverse('all-projects'))
+ self.wait_until_present('#projectstable', poll=10)
self.find_element_by_link_text_in_table('projectstable', 'selenium-project').click()
+ self.wait_until_present('#config-nav', poll=10)
self.assertTrue(self.element_exists('#config-nav'),'Configuration Tab does not exist')
project_URL=self.get_URL()
- self.driver.find_element_by_xpath('//a[@href="'+project_URL+'"]').click()
+ self.driver.find_element(By.XPATH, '//a[@href="'+project_URL+'"]').click()
+ self.wait_until_present('#config-nav', poll=10)
try:
- self.driver.find_element_by_xpath("//*[@id='config-nav']/ul/li/a[@href="+'"'+project_URL+'customimages/"'+"]").click()
- self.assertTrue(re.search("Custom images",self.driver.find_element_by_xpath("//div[@class='col-md-10']").text),'Custom images information is not loading properly')
+ self.driver.find_element(By.XPATH, "//*[@id='config-nav']/ul/li/a[@href="+'"'+project_URL+'customimages/"'+"]").click()
+ self.wait_until_present('#config-nav', poll=10)
+ self.assertTrue(re.search("Custom images",self.driver.find_element(By.XPATH, "//div[@class='col-md-10']").text),'Custom images information is not loading properly')
except:
self.fail(msg='No Custom images tab available')
try:
- self.driver.find_element_by_xpath("//*[@id='config-nav']/ul/li/a[@href="+'"'+project_URL+'images/"'+"]").click()
- self.assertTrue(re.search("Compatible image recipes",self.driver.find_element_by_xpath("//div[@class='col-md-10']").text),'The Compatible image recipes information is not loading properly')
+ self.driver.find_element(By.XPATH, "//*[@id='config-nav']/ul/li/a[@href="+'"'+project_URL+'images/"'+"]").click()
+ self.wait_until_present('#config-nav', poll=10)
+ self.assertTrue(re.search("Compatible image recipes",self.driver.find_element(By.XPATH, "//div[@class='col-md-10']").text),'The Compatible image recipes information is not loading properly')
except:
self.fail(msg='No Compatible image tab available')
try:
- self.driver.find_element_by_xpath("//*[@id='config-nav']/ul/li/a[@href="+'"'+project_URL+'softwarerecipes/"'+"]").click()
- self.assertTrue(re.search("Compatible software recipes",self.driver.find_element_by_xpath("//div[@class='col-md-10']").text),'The Compatible software recipe information is not loading properly')
+ self.driver.find_element(By.XPATH, "//*[@id='config-nav']/ul/li/a[@href="+'"'+project_URL+'softwarerecipes/"'+"]").click()
+ self.wait_until_present('#config-nav', poll=10)
+ self.assertTrue(re.search("Compatible software recipes",self.driver.find_element(By.XPATH, "//div[@class='col-md-10']").text),'The Compatible software recipe information is not loading properly')
except:
self.fail(msg='No Compatible software recipe tab available')
try:
- self.driver.find_element_by_xpath("//*[@id='config-nav']/ul/li/a[@href="+'"'+project_URL+'machines/"'+"]").click()
- self.assertTrue(re.search("Compatible machines",self.driver.find_element_by_xpath("//div[@class='col-md-10']").text),'The Compatible machine information is not loading properly')
+ self.driver.find_element(By.XPATH, "//*[@id='config-nav']/ul/li/a[@href="+'"'+project_URL+'machines/"'+"]").click()
+ self.wait_until_present('#config-nav', poll=10)
+ self.assertTrue(re.search("Compatible machines",self.driver.find_element(By.XPATH, "//div[@class='col-md-10']").text),'The Compatible machine information is not loading properly')
except:
self.fail(msg='No Compatible machines tab available')
try:
- self.driver.find_element_by_xpath("//*[@id='config-nav']/ul/li/a[@href="+'"'+project_URL+'layers/"'+"]").click()
- self.assertTrue(re.search("Compatible layers",self.driver.find_element_by_xpath("//div[@class='col-md-10']").text),'The Compatible layer information is not loading properly')
+ self.driver.find_element(By.XPATH, "//*[@id='config-nav']/ul/li/a[@href="+'"'+project_URL+'layers/"'+"]").click()
+ self.wait_until_present('#config-nav', poll=10)
+ self.assertTrue(re.search("Compatible layers",self.driver.find_element(By.XPATH, "//div[@class='col-md-10']").text),'The Compatible layer information is not loading properly')
except:
self.fail(msg='No Compatible layers tab available')
try:
- self.driver.find_element_by_xpath("//*[@id='config-nav']/ul/li/a[@href="+'"'+project_URL+'configuration"'+"]").click()
- self.assertTrue(re.search("Bitbake variables",self.driver.find_element_by_xpath("//div[@class='col-md-10']").text),'The Bitbake variables information is not loading properly')
+ self.driver.find_element(By.XPATH, "//*[@id='config-nav']/ul/li/a[@href="+'"'+project_URL+'configuration"'+"]").click()
+ self.wait_until_present('#config-nav', poll=10)
+ self.assertTrue(re.search("Bitbake variables",self.driver.find_element(By.XPATH, "//div[@class='col-md-10']").text),'The Bitbake variables information is not loading properly')
except:
self.fail(msg='No Bitbake variables tab available')
# testcase (1516)
def test_review_configuration_information(self):
- self.get('')
- self.driver.find_element_by_xpath("//div[@id='global-nav']/ul/li/a[@href="+'"'+'/toastergui/projects/'+'"'+"]").click()
- self.wait_until_visible('#projectstable')
+ self.get(reverse('all-projects'))
+ self.wait_until_present('#projectstable', poll=10)
self.find_element_by_link_text_in_table('projectstable', 'selenium-project').click()
project_URL=self.get_URL()
-
+ self.wait_until_present('#config-nav', poll=10)
try:
self.assertTrue(self.element_exists('#machine-section'),'Machine section for the project configuration page does not exist')
- self.assertTrue(re.search("qemux86",self.driver.find_element_by_xpath("//span[@id='project-machine-name']").text),'The machine type is not assigned')
- self.driver.find_element_by_xpath("//span[@id='change-machine-toggle']").click()
- self.wait_until_visible('#select-machine-form')
- self.wait_until_visible('#cancel-machine-change')
- self.driver.find_element_by_xpath("//form[@id='select-machine-form']/a[@id='cancel-machine-change']").click()
+ self.assertTrue(re.search("qemux86-64",self.driver.find_element(By.XPATH, "//span[@id='project-machine-name']").text),'The machine type is not assigned')
+ self.driver.find_element(By.XPATH, "//span[@id='change-machine-toggle']").click()
+ self.wait_until_visible('#select-machine-form', poll=10)
+ self.wait_until_visible('#cancel-machine-change', poll=10)
+ self.driver.find_element(By.XPATH, "//form[@id='select-machine-form']/a[@id='cancel-machine-change']").click()
except:
self.fail(msg='The machine information is wrong in the configuration page')
try:
- self.driver.find_element_by_id('no-most-built')
+ self.driver.find_element(By.ID, 'no-most-built')
except:
self.fail(msg='No Most built information in project detail page')
try:
- self.assertTrue(re.search("Yocto Project master",self.driver.find_element_by_xpath("//span[@id='project-release-title']").text),'The project release is not defined')
+ self.assertTrue(re.search("Yocto Project master",self.driver.find_element(By.XPATH, "//span[@id='project-release-title']").text),'The project release is not defined')
except:
self.fail(msg='No project release title information in project detail page')
try:
- self.driver.find_element_by_xpath("//div[@id='layer-container']")
- self.assertTrue(re.search("3",self.driver.find_element_by_id("project-layers-count").text),'There should be 3 layers listed in the layer count')
- layer_list = self.driver.find_element_by_id("layers-in-project-list")
- layers = layer_list.find_elements_by_tag_name("li")
+ self.driver.find_element(By.XPATH, "//div[@id='layer-container']")
+ self.assertTrue(re.search("3",self.driver.find_element(By.ID, "project-layers-count").text),'There should be 3 layers listed in the layer count')
+ layer_list = self.driver.find_element(By.ID, "layers-in-project-list")
+ layers = layer_list.find_elements(By.TAG_NAME, "li")
for layer in layers:
if re.match ("openembedded-core",layer.text):
print ("openembedded-core layer is a default layer in the project configuration")
@@ -120,61 +145,60 @@ class FuntionalTestBasic(SeleniumFunctionalTestCase):
# testcase (1517)
def test_verify_machine_information(self):
- self.get('')
- self.driver.find_element_by_xpath("//div[@id='global-nav']/ul/li/a[@href="+'"'+'/toastergui/projects/'+'"'+"]").click()
- self.wait_until_visible('#projectstable')
+ self.get(reverse('all-projects'))
+ self.wait_until_present('#projectstable', poll=10)
self.find_element_by_link_text_in_table('projectstable', 'selenium-project').click()
+ self.wait_until_present('#config-nav', poll=10)
try:
self.assertTrue(self.element_exists('#machine-section'),'Machine section for the project configuration page does not exist')
- self.assertTrue(re.search("qemux86",self.driver.find_element_by_id("project-machine-name").text),'The machine type is not assigned')
- self.driver.find_element_by_id("change-machine-toggle").click()
- self.wait_until_visible('#select-machine-form')
- self.wait_until_visible('#cancel-machine-change')
- self.driver.find_element_by_id("cancel-machine-change").click()
+ self.assertTrue(re.search("qemux86-64",self.driver.find_element(By.ID, "project-machine-name").text),'The machine type is not assigned')
+ self.driver.find_element(By.ID, "change-machine-toggle").click()
+ self.wait_until_visible('#select-machine-form', poll=10)
+ self.wait_until_visible('#cancel-machine-change', poll=10)
+ self.driver.find_element(By.ID, "cancel-machine-change").click()
except:
self.fail(msg='The machine information is wrong in the configuration page')
# testcase (1518)
def test_verify_most_built_recipes_information(self):
- self.get('')
- self.driver.find_element_by_xpath("//div[@id='global-nav']/ul/li/a[@href="+'"'+'/toastergui/projects/'+'"'+"]").click()
- self.wait_until_visible('#projectstable')
+ self.get(reverse('all-projects'))
+ self.wait_until_present('#projectstable', poll=10)
self.find_element_by_link_text_in_table('projectstable', 'selenium-project').click()
+ self.wait_until_present('#config-nav', poll=10)
project_URL=self.get_URL()
-
try:
- self.assertTrue(re.search("You haven't built any recipes yet",self.driver.find_element_by_id("no-most-built").text),'Default message of no builds is not present')
- self.driver.find_element_by_xpath("//div[@id='no-most-built']/p/a[@href="+'"'+project_URL+'images/"'+"]").click()
- self.assertTrue(re.search("Compatible image recipes",self.driver.find_element_by_xpath("//div[@class='col-md-10']").text),'The Choose a recipe to build link is not working properly')
+ self.assertTrue(re.search("You haven't built any recipes yet",self.driver.find_element(By.ID, "no-most-built").text),'Default message of no builds is not present')
+ self.driver.find_element(By.XPATH, "//div[@id='no-most-built']/p/a[@href="+'"'+project_URL+'images/"'+"]").click()
+ self.wait_until_present('#config-nav', poll=10)
+ self.assertTrue(re.search("Compatible image recipes",self.driver.find_element(By.XPATH, "//div[@class='col-md-10']").text),'The Choose a recipe to build link is not working properly')
except:
self.fail(msg='No Most built information in project detail page')
# testcase (1519)
def test_verify_project_release_information(self):
- self.get('')
- self.driver.find_element_by_xpath("//div[@id='global-nav']/ul/li/a[@href="+'"'+'/toastergui/projects/'+'"'+"]").click()
- self.wait_until_visible('#projectstable')
+ self.get(reverse('all-projects'))
+ self.wait_until_present('#projectstable', poll=10)
self.find_element_by_link_text_in_table('projectstable', 'selenium-project').click()
+ self.wait_until_present('#config-nav', poll=10)
try:
- self.assertTrue(re.search("Yocto Project master",self.driver.find_element_by_id("project-release-title").text),'The project release is not defined')
+ self.assertTrue(re.search("Yocto Project master",self.driver.find_element(By.ID, "project-release-title").text),'The project release is not defined')
except:
self.fail(msg='No project release title information in project detail page')
# testcase (1520)
def test_verify_layer_information(self):
- self.get('')
- self.driver.find_element_by_xpath("//div[@id='global-nav']/ul/li/a[@href="+'"'+'/toastergui/projects/'+'"'+"]").click()
- self.wait_until_visible('#projectstable')
+ self.get(reverse('all-projects'))
+ self.wait_until_present('#projectstable', poll=10)
self.find_element_by_link_text_in_table('projectstable', 'selenium-project').click()
+ self.wait_until_present('#config-nav', poll=10)
project_URL=self.get_URL()
-
try:
- self.driver.find_element_by_xpath("//div[@id='layer-container']")
- self.assertTrue(re.search("3",self.driver.find_element_by_id("project-layers-count").text),'There should be 3 layers listed in the layer count')
- layer_list = self.driver.find_element_by_id("layers-in-project-list")
- layers = layer_list.find_elements_by_tag_name("li")
+ self.driver.find_element(By.XPATH, "//div[@id='layer-container']")
+ self.assertTrue(re.search("3",self.driver.find_element(By.ID, "project-layers-count").text),'There should be 3 layers listed in the layer count')
+ layer_list = self.driver.find_element(By.ID, "layers-in-project-list")
+ layers = layer_list.find_elements(By.TAG_NAME, "li")
for layer in layers:
if re.match ("openembedded-core",layer.text):
@@ -186,43 +210,46 @@ class FuntionalTestBasic(SeleniumFunctionalTestCase):
else:
self.fail(msg='default layers are missing from the project configuration')
- self.driver.find_element_by_xpath("//input[@id='layer-add-input']")
- self.driver.find_element_by_xpath("//button[@id='add-layer-btn']")
- self.driver.find_element_by_xpath("//div[@id='layer-container']/form[@class='form-inline']/p/a[@id='view-compatible-layers']")
- self.driver.find_element_by_xpath("//div[@id='layer-container']/form[@class='form-inline']/p/a[@href="+'"'+project_URL+'importlayer"'+"]")
+ self.driver.find_element(By.XPATH, "//input[@id='layer-add-input']")
+ self.driver.find_element(By.XPATH, "//button[@id='add-layer-btn']")
+ self.driver.find_element(By.XPATH, "//div[@id='layer-container']/form[@class='form-inline']/p/a[@id='view-compatible-layers']")
+ self.driver.find_element(By.XPATH, "//div[@id='layer-container']/form[@class='form-inline']/p/a[@href="+'"'+project_URL+'importlayer"'+"]")
except:
self.fail(msg='No Layer information in project detail page')
# testcase (1521)
def test_verify_project_detail_links(self):
- self.get('')
- self.driver.find_element_by_xpath("//div[@id='global-nav']/ul/li/a[@href="+'"'+'/toastergui/projects/'+'"'+"]").click()
- self.wait_until_visible('#projectstable')
+ self.get(reverse('all-projects'))
+ self.wait_until_present('#projectstable', poll=10)
self.find_element_by_link_text_in_table('projectstable', 'selenium-project').click()
+ self.wait_until_present('#config-nav', poll=10)
project_URL=self.get_URL()
-
- self.driver.find_element_by_xpath("//div[@id='project-topbar']/ul[@class='nav nav-tabs']/li[@id='topbar-configuration-tab']/a[@href="+'"'+project_URL+'"'+"]").click()
- self.assertTrue(re.search("Configuration",self.driver.find_element_by_xpath("//div[@id='project-topbar']/ul[@class='nav nav-tabs']/li[@id='topbar-configuration-tab']/a[@href="+'"'+project_URL+'"'+"]").text), 'Configuration tab in project topbar is misspelled')
+ self.driver.find_element(By.XPATH, "//div[@id='project-topbar']/ul[@class='nav nav-tabs']/li[@id='topbar-configuration-tab']/a[@href="+'"'+project_URL+'"'+"]").click()
+ self.wait_until_present('#config-nav', poll=10)
+ self.assertTrue(re.search("Configuration",self.driver.find_element(By.XPATH, "//div[@id='project-topbar']/ul[@class='nav nav-tabs']/li[@id='topbar-configuration-tab']/a[@href="+'"'+project_URL+'"'+"]").text), 'Configuration tab in project topbar is misspelled')
try:
- self.driver.find_element_by_xpath("//div[@id='project-topbar']/ul[@class='nav nav-tabs']/li/a[@href="+'"'+project_URL+'builds/"'+"]").click()
- self.assertTrue(re.search("Builds",self.driver.find_element_by_xpath("//div[@id='project-topbar']/ul[@class='nav nav-tabs']/li/a[@href="+'"'+project_URL+'builds/"'+"]").text), 'Builds tab in project topbar is misspelled')
- self.driver.find_element_by_xpath("//div[@id='empty-state-projectbuildstable']")
+ self.driver.find_element(By.XPATH, "//div[@id='project-topbar']/ul[@class='nav nav-tabs']/li/a[@href="+'"'+project_URL+'builds/"'+"]").click()
+ self.wait_until_visible('#project-topbar', poll=10)
+ self.assertTrue(re.search("Builds",self.driver.find_element(By.XPATH, "//div[@id='project-topbar']/ul[@class='nav nav-tabs']/li/a[@href="+'"'+project_URL+'builds/"'+"]").text), 'Builds tab in project topbar is misspelled')
+ self.driver.find_element(By.XPATH, "//div[@id='empty-state-projectbuildstable']")
except:
self.fail(msg='Builds tab information is not present')
try:
- self.driver.find_element_by_xpath("//div[@id='project-topbar']/ul[@class='nav nav-tabs']/li/a[@href="+'"'+project_URL+'importlayer"'+"]").click()
- self.assertTrue(re.search("Import layer",self.driver.find_element_by_xpath("//div[@id='project-topbar']/ul[@class='nav nav-tabs']/li/a[@href="+'"'+project_URL+'importlayer"'+"]").text), 'Import layer tab in project topbar is misspelled')
- self.driver.find_element_by_xpath("//fieldset[@id='repo-select']")
- self.driver.find_element_by_xpath("//fieldset[@id='git-repo']")
+ self.driver.find_element(By.XPATH, "//div[@id='project-topbar']/ul[@class='nav nav-tabs']/li/a[@href="+'"'+project_URL+'importlayer"'+"]").click()
+ self.wait_until_visible('#project-topbar', poll=10)
+ self.assertTrue(re.search("Import layer",self.driver.find_element(By.XPATH, "//div[@id='project-topbar']/ul[@class='nav nav-tabs']/li/a[@href="+'"'+project_URL+'importlayer"'+"]").text), 'Import layer tab in project topbar is misspelled')
+ self.driver.find_element(By.XPATH, "//fieldset[@id='repo-select']")
+ self.driver.find_element(By.XPATH, "//fieldset[@id='git-repo']")
except:
self.fail(msg='Import layer tab not loading properly')
try:
- self.driver.find_element_by_xpath("//div[@id='project-topbar']/ul[@class='nav nav-tabs']/li/a[@href="+'"'+project_URL+'newcustomimage/"'+"]").click()
- self.assertTrue(re.search("New custom image",self.driver.find_element_by_xpath("//div[@id='project-topbar']/ul[@class='nav nav-tabs']/li/a[@href="+'"'+project_URL+'newcustomimage/"'+"]").text), 'New custom image tab in project topbar is misspelled')
- self.assertTrue(re.search("Select the image recipe you want to customise",self.driver.find_element_by_xpath("//div[@class='col-md-12']/h2").text),'The new custom image tab is not loading correctly')
+ self.driver.find_element(By.XPATH, "//div[@id='project-topbar']/ul[@class='nav nav-tabs']/li/a[@href="+'"'+project_URL+'newcustomimage/"'+"]").click()
+ self.wait_until_visible('#project-topbar', poll=10)
+ self.assertTrue(re.search("New custom image",self.driver.find_element(By.XPATH, "//div[@id='project-topbar']/ul[@class='nav nav-tabs']/li/a[@href="+'"'+project_URL+'newcustomimage/"'+"]").text), 'New custom image tab in project topbar is misspelled')
+ self.assertTrue(re.search("Select the image recipe you want to customise",self.driver.find_element(By.XPATH, "//div[@class='col-md-12']/h2").text),'The new custom image tab is not loading correctly')
except:
self.fail(msg='New custom image tab not loading properly')
diff --git a/bitbake/lib/toaster/tests/functional/test_project_config.py b/bitbake/lib/toaster/tests/functional/test_project_config.py
new file mode 100644
index 0000000000..dbee36aa4e
--- /dev/null
+++ b/bitbake/lib/toaster/tests/functional/test_project_config.py
@@ -0,0 +1,341 @@
+#! /usr/bin/env python3 #
+# BitBake Toaster UI tests implementation
+#
+# Copyright (C) 2023 Savoir-faire Linux
+#
+# SPDX-License-Identifier: GPL-2.0-only
+#
+
+import string
+import random
+import pytest
+from django.urls import reverse
+from selenium.webdriver import Keys
+from selenium.webdriver.support.select import Select
+from selenium.common.exceptions import TimeoutException
+from tests.functional.functional_helpers import SeleniumFunctionalTestCase
+from selenium.webdriver.common.by import By
+
+from .utils import get_projectId_from_url
+
+
+@pytest.mark.django_db
+@pytest.mark.order("last")
+class TestProjectConfig(SeleniumFunctionalTestCase):
+ project_id = None
+ PROJECT_NAME = 'TestProjectConfig'
+ INVALID_PATH_START_TEXT = 'The directory path should either start with a /'
+ INVALID_PATH_CHAR_TEXT = 'The directory path cannot include spaces or ' \
+ 'any of these characters'
+
+ def _create_project(self, project_name):
+ """ Create/Test new project using:
+ - Project Name: Any string
+ - Release: Any string
+ - Merge Toaster settings: True or False
+ """
+ self.get(reverse('newproject'))
+ self.wait_until_visible('#new-project-name', poll=2)
+ self.find("#new-project-name").send_keys(project_name)
+ select = Select(self.find("#projectversion"))
+ select.select_by_value('3')
+
+ # check merge toaster settings
+ checkbox = self.find('.checkbox-mergeattr')
+ if not checkbox.is_selected():
+ checkbox.click()
+
+ if self.PROJECT_NAME != 'TestProjectConfig':
+ # Reset project name if it's not the default one
+ self.PROJECT_NAME = 'TestProjectConfig'
+
+ self.find("#create-project-button").click()
+
+ try:
+ self.wait_until_visible('#hint-error-project-name', poll=2)
+ url = reverse('project', args=(TestProjectConfig.project_id, ))
+ self.get(url)
+ self.wait_until_visible('#config-nav', poll=3)
+ except TimeoutException:
+ self.wait_until_visible('#config-nav', poll=3)
+
+ def _random_string(self, length):
+ return ''.join(
+ random.choice(string.ascii_letters) for _ in range(length)
+ )
+
+ def _get_config_nav_item(self, index):
+ config_nav = self.find('#config-nav')
+ return config_nav.find_elements(By.TAG_NAME, 'li')[index]
+
+ def _navigate_bbv_page(self):
+ """ Navigate to project BitBake variables page """
+ # check if the menu is displayed
+ if TestProjectConfig.project_id is None:
+ self._create_project(project_name=self._random_string(10))
+ current_url = self.driver.current_url
+ TestProjectConfig.project_id = get_projectId_from_url(current_url)
+ else:
+ url = reverse('projectconf', args=(TestProjectConfig.project_id,))
+ self.get(url)
+ self.wait_until_visible('#config-nav', poll=3)
+ bbv_page_link = self._get_config_nav_item(9)
+ bbv_page_link.click()
+ self.wait_until_visible('#config-nav', poll=3)
+
+ def test_no_underscore_iamgefs_type(self):
+ """
+ Should not accept IMAGEFS_TYPE with an underscore
+ """
+ self._navigate_bbv_page()
+ imagefs_type = "foo_bar"
+
+ self.wait_until_visible('#change-image_fstypes-icon', poll=2)
+
+ self.click('#change-image_fstypes-icon')
+
+ self.enter_text('#new-imagefs_types', imagefs_type)
+
+ element = self.wait_until_visible('#hintError-image-fs_type', poll=2)
+
+ self.assertTrue(("A valid image type cannot include underscores" in element.text),
+ "Did not find underscore error message")
+
+ def test_checkbox_verification(self):
+ """
+ Should automatically check the checkbox if user enters value
+ text box, if value is there in the checkbox.
+ """
+ self._navigate_bbv_page()
+
+ imagefs_type = "btrfs"
+
+ self.wait_until_visible('#change-image_fstypes-icon', poll=2)
+
+ self.click('#change-image_fstypes-icon')
+
+ self.enter_text('#new-imagefs_types', imagefs_type)
+
+ checkboxes = self.driver.find_elements(By.XPATH, "//input[@class='fs-checkbox-fstypes']")
+
+ for checkbox in checkboxes:
+ if checkbox.get_attribute("value") == "btrfs":
+ self.assertEqual(checkbox.is_selected(), True)
+
+ def test_textbox_with_checkbox_verification(self):
+ """
+ Should automatically add or remove value in textbox, if user checks
+ or unchecks checkboxes.
+ """
+ self._navigate_bbv_page()
+
+ self.wait_until_visible('#change-image_fstypes-icon', poll=2)
+
+ self.click('#change-image_fstypes-icon')
+
+ checkboxes_selector = '.fs-checkbox-fstypes'
+
+ self.wait_until_visible(checkboxes_selector, poll=2)
+ checkboxes = self.find_all(checkboxes_selector)
+
+ for checkbox in checkboxes:
+ if checkbox.get_attribute("value") == "cpio":
+ checkbox.click()
+ element = self.driver.find_element(By.ID, 'new-imagefs_types')
+
+ self.wait_until_visible('#new-imagefs_types', poll=2)
+
+ self.assertTrue(("cpio" in element.get_attribute('value'),
+ "Imagefs not added into the textbox"))
+ checkbox.click()
+ self.assertTrue(("cpio" not in element.text),
+ "Image still present in the textbox")
+
+ def test_set_download_dir(self):
+ """
+ Validate the allowed and disallowed types in the directory field for
+ DL_DIR
+ """
+ self._navigate_bbv_page()
+
+ # activate the input to edit download dir
+ try:
+ change_dl_dir_btn = self.wait_until_visible('#change-dl_dir-icon', poll=2)
+ except TimeoutException:
+ # If download dir is not displayed, test is skipped
+ change_dl_dir_btn = None
+
+ if change_dl_dir_btn:
+ change_dl_dir_btn = self.wait_until_visible('#change-dl_dir-icon', poll=2)
+ change_dl_dir_btn.click()
+
+ # downloads dir path doesn't start with / or ${...}
+ input_field = self.wait_until_visible('#new-dl_dir', poll=2)
+ input_field.clear()
+ self.enter_text('#new-dl_dir', 'home/foo')
+ element = self.wait_until_visible('#hintError-initialChar-dl_dir', poll=2)
+
+ msg = 'downloads directory path starts with invalid character but ' \
+ 'treated as valid'
+ self.assertTrue((self.INVALID_PATH_START_TEXT in element.text), msg)
+
+ # downloads dir path has a space
+ self.driver.find_element(By.ID, 'new-dl_dir').clear()
+ self.enter_text('#new-dl_dir', '/foo/bar a')
+
+ element = self.wait_until_visible('#hintError-dl_dir', poll=2)
+ msg = 'downloads directory path characters invalid but treated as valid'
+ self.assertTrue((self.INVALID_PATH_CHAR_TEXT in element.text), msg)
+
+ # downloads dir path starts with ${...} but has a space
+ self.driver.find_element(By.ID,'new-dl_dir').clear()
+ self.enter_text('#new-dl_dir', '${TOPDIR}/down foo')
+
+ element = self.wait_until_visible('#hintError-dl_dir', poll=2)
+ msg = 'downloads directory path characters invalid but treated as valid'
+ self.assertTrue((self.INVALID_PATH_CHAR_TEXT in element.text), msg)
+
+ # downloads dir path starts with /
+ self.driver.find_element(By.ID,'new-dl_dir').clear()
+ self.enter_text('#new-dl_dir', '/bar/foo')
+
+ hidden_element = self.driver.find_element(By.ID,'hintError-dl_dir')
+ self.assertEqual(hidden_element.is_displayed(), False,
+ 'downloads directory path valid but treated as invalid')
+
+ # downloads dir path starts with ${...}
+ self.driver.find_element(By.ID,'new-dl_dir').clear()
+ self.enter_text('#new-dl_dir', '${TOPDIR}/down')
+
+ hidden_element = self.driver.find_element(By.ID,'hintError-dl_dir')
+ self.assertEqual(hidden_element.is_displayed(), False,
+ 'downloads directory path valid but treated as invalid')
+
+ def test_set_sstate_dir(self):
+ """
+ Validate the allowed and disallowed types in the directory field for
+ SSTATE_DIR
+ """
+ self._navigate_bbv_page()
+
+ try:
+ btn_chg_sstate_dir = self.wait_until_visible(
+ '#change-sstate_dir-icon',
+ poll=2
+ )
+ self.click('#change-sstate_dir-icon')
+ except TimeoutException:
+ # If sstate_dir is not displayed, test is skipped
+ btn_chg_sstate_dir = None
+
+ if btn_chg_sstate_dir: # Skip continuation if sstate_dir is not displayed
+ # path doesn't start with / or ${...}
+ input_field = self.wait_until_visible('#new-sstate_dir', poll=2)
+ input_field.clear()
+ self.enter_text('#new-sstate_dir', 'home/foo')
+ element = self.wait_until_visible('#hintError-initialChar-sstate_dir', poll=2)
+
+ msg = 'sstate directory path starts with invalid character but ' \
+ 'treated as valid'
+ self.assertTrue((self.INVALID_PATH_START_TEXT in element.text), msg)
+
+ # path has a space
+ self.driver.find_element(By.ID, 'new-sstate_dir').clear()
+ self.enter_text('#new-sstate_dir', '/foo/bar a')
+
+ element = self.wait_until_visible('#hintError-sstate_dir', poll=2)
+ msg = 'sstate directory path characters invalid but treated as valid'
+ self.assertTrue((self.INVALID_PATH_CHAR_TEXT in element.text), msg)
+
+ # path starts with ${...} but has a space
+ self.driver.find_element(By.ID,'new-sstate_dir').clear()
+ self.enter_text('#new-sstate_dir', '${TOPDIR}/down foo')
+
+ element = self.wait_until_visible('#hintError-sstate_dir', poll=2)
+ msg = 'sstate directory path characters invalid but treated as valid'
+ self.assertTrue((self.INVALID_PATH_CHAR_TEXT in element.text), msg)
+
+ # path starts with /
+ self.driver.find_element(By.ID,'new-sstate_dir').clear()
+ self.enter_text('#new-sstate_dir', '/bar/foo')
+
+ hidden_element = self.driver.find_element(By.ID, 'hintError-sstate_dir')
+ self.assertEqual(hidden_element.is_displayed(), False,
+ 'sstate directory path valid but treated as invalid')
+
+ # paths starts with ${...}
+ self.driver.find_element(By.ID, 'new-sstate_dir').clear()
+ self.enter_text('#new-sstate_dir', '${TOPDIR}/down')
+
+ hidden_element = self.driver.find_element(By.ID, 'hintError-sstate_dir')
+ self.assertEqual(hidden_element.is_displayed(), False,
+ 'sstate directory path valid but treated as invalid')
+
+ def _change_bbv_value(self, **kwargs):
+ var_name, field, btn_id, input_id, value, save_btn, *_ = kwargs.values()
+ """ Change bitbake variable value """
+ self._navigate_bbv_page()
+ self.wait_until_visible(f'#{btn_id}', poll=2)
+ if kwargs.get('new_variable'):
+ self.find(f"#{btn_id}").clear()
+ self.enter_text(f"#{btn_id}", f"{var_name}")
+ else:
+ self.click(f'#{btn_id}')
+ self.wait_until_visible(f'#{input_id}', poll=2)
+
+ if kwargs.get('is_select'):
+ select = Select(self.find(f'#{input_id}'))
+ select.select_by_visible_text(value)
+ else:
+ self.find(f"#{input_id}").clear()
+ self.enter_text(f'#{input_id}', f'{value}')
+ self.click(f'#{save_btn}')
+ value_displayed = str(self.wait_until_visible(f'#{field}').text).lower()
+ msg = f'{var_name} variable not changed'
+ self.assertTrue(str(value).lower() in value_displayed, msg)
+
+ def test_change_distro_var(self):
+ """ Test changing distro variable """
+ self._change_bbv_value(
+ var_name='DISTRO',
+ field='distro',
+ btn_id='change-distro-icon',
+ input_id='new-distro',
+ value='poky-changed',
+ save_btn="apply-change-distro",
+ )
+
+ def test_set_image_install_append_var(self):
+ """ Test setting IMAGE_INSTALL:append variable """
+ self._change_bbv_value(
+ var_name='IMAGE_INSTALL:append',
+ field='image_install',
+ btn_id='change-image_install-icon',
+ input_id='new-image_install',
+ value='bash, apt, busybox',
+ save_btn="apply-change-image_install",
+ )
+
+ def test_set_package_classes_var(self):
+ """ Test setting PACKAGE_CLASSES variable """
+ self._change_bbv_value(
+ var_name='PACKAGE_CLASSES',
+ field='package_classes',
+ btn_id='change-package_classes-icon',
+ input_id='package_classes-select',
+ value='package_deb',
+ save_btn="apply-change-package_classes",
+ is_select=True,
+ )
+
+ def test_create_new_bbv(self):
+ """ Test creating new bitbake variable """
+ self._change_bbv_value(
+ var_name='New_Custom_Variable',
+ field='configvar-list',
+ btn_id='variable',
+ input_id='value',
+ value='new variable value',
+ save_btn="add-configvar-button",
+ new_variable=True
+ )
diff --git a/bitbake/lib/toaster/tests/functional/test_project_page.py b/bitbake/lib/toaster/tests/functional/test_project_page.py
new file mode 100644
index 0000000000..adbe3587e4
--- /dev/null
+++ b/bitbake/lib/toaster/tests/functional/test_project_page.py
@@ -0,0 +1,792 @@
+#! /usr/bin/env python3 #
+# BitBake Toaster UI tests implementation
+#
+# Copyright (C) 2023 Savoir-faire Linux
+#
+# SPDX-License-Identifier: GPL-2.0-only
+#
+
+import os
+import random
+import string
+from unittest import skip
+import pytest
+from django.urls import reverse
+from django.utils import timezone
+from selenium.webdriver.common.keys import Keys
+from selenium.webdriver.support.select import Select
+from selenium.common.exceptions import TimeoutException
+from tests.functional.functional_helpers import SeleniumFunctionalTestCase
+from orm.models import Build, Project, Target
+from selenium.webdriver.common.by import By
+
+from .utils import get_projectId_from_url, wait_until_build, wait_until_build_cancelled
+
+
+@pytest.mark.django_db
+@pytest.mark.order("last")
+class TestProjectPage(SeleniumFunctionalTestCase):
+ project_id = None
+ PROJECT_NAME = 'TestProjectPage'
+
+ def _create_project(self, project_name):
+ """ Create/Test new project using:
+ - Project Name: Any string
+ - Release: Any string
+ - Merge Toaster settings: True or False
+ """
+ self.get(reverse('newproject'))
+ self.wait_until_visible('#new-project-name')
+ self.find("#new-project-name").send_keys(project_name)
+ select = Select(self.find("#projectversion"))
+ select.select_by_value('3')
+
+ # check merge toaster settings
+ checkbox = self.find('.checkbox-mergeattr')
+ if not checkbox.is_selected():
+ checkbox.click()
+
+ if self.PROJECT_NAME != 'TestProjectPage':
+ # Reset project name if it's not the default one
+ self.PROJECT_NAME = 'TestProjectPage'
+
+ self.find("#create-project-button").click()
+
+ try:
+ self.wait_until_visible('#hint-error-project-name')
+ url = reverse('project', args=(TestProjectPage.project_id, ))
+ self.get(url)
+ self.wait_until_visible('#config-nav', poll=3)
+ except TimeoutException:
+ self.wait_until_visible('#config-nav', poll=3)
+
+ def _random_string(self, length):
+ return ''.join(
+ random.choice(string.ascii_letters) for _ in range(length)
+ )
+
+ def _navigate_to_project_page(self):
+ # Navigate to project page
+ if TestProjectPage.project_id is None:
+ self._create_project(project_name=self._random_string(10))
+ current_url = self.driver.current_url
+ TestProjectPage.project_id = get_projectId_from_url(current_url)
+ else:
+ url = reverse('project', args=(TestProjectPage.project_id,))
+ self.get(url)
+ self.wait_until_visible('#config-nav')
+
+ def _get_create_builds(self, **kwargs):
+ """ Create a build and return the build object """
+ # parameters for builds to associate with the projects
+ now = timezone.now()
+ self.project1_build_success = {
+ 'project': Project.objects.get(id=TestProjectPage.project_id),
+ 'started_on': now,
+ 'completed_on': now,
+ 'outcome': Build.SUCCEEDED
+ }
+
+ self.project1_build_failure = {
+ 'project': Project.objects.get(id=TestProjectPage.project_id),
+ 'started_on': now,
+ 'completed_on': now,
+ 'outcome': Build.FAILED
+ }
+ build1 = Build.objects.create(**self.project1_build_success)
+ build2 = Build.objects.create(**self.project1_build_failure)
+
+ # add some targets to these builds so they have recipe links
+ # (and so we can find the row in the ToasterTable corresponding to
+ # a particular build)
+ Target.objects.create(build=build1, target='foo')
+ Target.objects.create(build=build2, target='bar')
+
+ if kwargs:
+ # Create kwargs.get('success') builds with success status with target
+ # and kwargs.get('failure') builds with failure status with target
+ for i in range(kwargs.get('success', 0)):
+ now = timezone.now()
+ self.project1_build_success['started_on'] = now
+ self.project1_build_success[
+ 'completed_on'] = now - timezone.timedelta(days=i)
+ build = Build.objects.create(**self.project1_build_success)
+ Target.objects.create(build=build,
+ target=f'{i}_success_recipe',
+ task=f'{i}_success_task')
+
+ for i in range(kwargs.get('failure', 0)):
+ now = timezone.now()
+ self.project1_build_failure['started_on'] = now
+ self.project1_build_failure[
+ 'completed_on'] = now - timezone.timedelta(days=i)
+ build = Build.objects.create(**self.project1_build_failure)
+ Target.objects.create(build=build,
+ target=f'{i}_fail_recipe',
+ task=f'{i}_fail_task')
+ return build1, build2
+
+ def _mixin_test_table_edit_column(
+ self,
+ table_id,
+ edit_btn_id,
+ list_check_box_id: list
+ ):
+ # Check edit column
+ edit_column = self.find(f'#{edit_btn_id}')
+ self.assertTrue(edit_column.is_displayed())
+ edit_column.click()
+ # Check dropdown is visible
+ self.wait_until_visible('ul.dropdown-menu.editcol')
+ for check_box_id in list_check_box_id:
+ # Check that we can hide/show table column
+ check_box = self.find(f'#{check_box_id}')
+ th_class = str(check_box_id).replace('checkbox-', '')
+ if check_box.is_selected():
+ # check if column is visible in table
+ self.assertTrue(
+ self.find(
+ f'#{table_id} thead th.{th_class}'
+ ).is_displayed(),
+ f"The {th_class} column is checked in EditColumn dropdown, but it's not visible in table"
+ )
+ check_box.click()
+ # check if column is hidden in table
+ self.assertFalse(
+ self.find(
+ f'#{table_id} thead th.{th_class}'
+ ).is_displayed(),
+ f"The {th_class} column is unchecked in EditColumn dropdown, but it's visible in table"
+ )
+ else:
+ # check if column is hidden in table
+ self.assertFalse(
+ self.find(
+ f'#{table_id} thead th.{th_class}'
+ ).is_displayed(),
+ f"The {th_class} column is unchecked in EditColumn dropdown, but it's visible in table"
+ )
+ check_box.click()
+ # check if column is visible in table
+ self.assertTrue(
+ self.find(
+ f'#{table_id} thead th.{th_class}'
+ ).is_displayed(),
+ f"The {th_class} column is checked in EditColumn dropdown, but it's not visible in table"
+ )
+
+ def _get_config_nav_item(self, index):
+ config_nav = self.find('#config-nav')
+ return config_nav.find_elements(By.TAG_NAME, 'li')[index]
+
+ def _navigate_to_config_nav(self, nav_id, nav_index):
+ # navigate to the project page
+ self._navigate_to_project_page()
+ # click on "Software recipe" tab
+ soft_recipe = self._get_config_nav_item(nav_index)
+ soft_recipe.click()
+ self.wait_until_visible(f'#{nav_id}')
+
+ def _mixin_test_table_show_rows(self, table_selector, **kwargs):
+ """ Test the show rows feature in the builds table on the all builds page """
+ def test_show_rows(row_to_show, show_row_link):
+ # Check that we can show rows == row_to_show
+ show_row_link.select_by_value(str(row_to_show))
+ self.wait_until_visible(f'#{table_selector} tbody tr', poll=3)
+ # check at least some rows are visible
+ self.assertTrue(
+ len(self.find_all(f'#{table_selector} tbody tr')) > 0
+ )
+ self.wait_until_present(f'#{table_selector} tbody tr')
+ show_rows = self.driver.find_elements(
+ By.XPATH,
+ f'//select[@class="form-control pagesize-{table_selector}"]'
+ )
+ rows_to_show = [10, 25, 50, 100, 150]
+ to_skip = kwargs.get('to_skip', [])
+ # Check show rows
+ for show_row_link in show_rows:
+ show_row_link = Select(show_row_link)
+ for row_to_show in rows_to_show:
+ if row_to_show not in to_skip:
+ test_show_rows(row_to_show, show_row_link)
+
+ def _mixin_test_table_search_input(self, **kwargs):
+ input_selector, input_text, searchBtn_selector, table_selector, *_ = kwargs.values()
+ # Test search input
+ self.wait_until_visible(f'#{input_selector}')
+ recipe_input = self.find(f'#{input_selector}')
+ recipe_input.send_keys(input_text)
+ self.find(f'#{searchBtn_selector}').click()
+ self.wait_until_visible(f'#{table_selector} tbody tr')
+ rows = self.find_all(f'#{table_selector} tbody tr')
+ self.assertTrue(len(rows) > 0)
+
+ def test_create_project(self):
+ """ Create/Test new project using:
+ - Project Name: Any string
+ - Release: Any string
+ - Merge Toaster settings: True or False
+ """
+ self._create_project(project_name=self.PROJECT_NAME)
+
+ def test_image_recipe_editColumn(self):
+ """ Test the edit column feature in image recipe table on project page """
+ self._get_create_builds(success=10, failure=10)
+
+ url = reverse('projectimagerecipes', args=(TestProjectPage.project_id,))
+ self.get(url)
+ self.wait_until_present('#imagerecipestable tbody tr')
+
+ column_list = [
+ 'get_description_or_summary', 'layer_version__get_vcs_reference',
+ 'layer_version__layer__name', 'license', 'recipe-file', 'section',
+ 'version'
+ ]
+
+ # Check that we can hide the edit column
+ self._mixin_test_table_edit_column(
+ 'imagerecipestable',
+ 'edit-columns-button',
+ [f'checkbox-{column}' for column in column_list]
+ )
+
+ def test_page_header_on_project_page(self):
+ """ Check page header in project page:
+ - AT LEFT -> Logo of Yocto project, displayed, clickable
+ - "Toaster"+" Information icon", displayed, clickable
+ - "Server Icon" + "All builds", displayed, clickable
+ - "Directory Icon" + "All projects", displayed, clickable
+ - "Book Icon" + "Documentation", displayed, clickable
+ - AT RIGHT -> button "New project", displayed, clickable
+ """
+ # navigate to the project page
+ self._navigate_to_project_page()
+
+ # check page header
+ # AT LEFT -> Logo of Yocto project
+ logo = self.driver.find_element(
+ By.XPATH,
+ "//div[@class='toaster-navbar-brand']",
+ )
+ logo_img = logo.find_element(By.TAG_NAME, 'img')
+ self.assertTrue(logo_img.is_displayed(),
+ 'Logo of Yocto project not found')
+ self.assertTrue(
+ '/static/img/logo.png' in str(logo_img.get_attribute('src')),
+ 'Logo of Yocto project not found'
+ )
+ # "Toaster"+" Information icon", clickable
+ toaster = self.driver.find_element(
+ By.XPATH,
+ "//div[@class='toaster-navbar-brand']//a[@class='brand']",
+ )
+ self.assertTrue(toaster.is_displayed(), 'Toaster not found')
+ self.assertTrue(toaster.text == 'Toaster')
+ info_sign = self.find('.glyphicon-info-sign')
+ self.assertTrue(info_sign.is_displayed())
+
+ # "Server Icon" + "All builds"
+ all_builds = self.find('#navbar-all-builds')
+ all_builds_link = all_builds.find_element(By.TAG_NAME, 'a')
+ self.assertTrue("All builds" in all_builds_link.text)
+ self.assertTrue(
+ '/toastergui/builds/' in str(all_builds_link.get_attribute('href'))
+ )
+ server_icon = all_builds.find_element(By.TAG_NAME, 'i')
+ self.assertTrue(
+ server_icon.get_attribute('class') == 'glyphicon glyphicon-tasks'
+ )
+ self.assertTrue(server_icon.is_displayed())
+
+ # "Directory Icon" + "All projects"
+ all_projects = self.find('#navbar-all-projects')
+ all_projects_link = all_projects.find_element(By.TAG_NAME, 'a')
+ self.assertTrue("All projects" in all_projects_link.text)
+ self.assertTrue(
+ '/toastergui/projects/' in str(all_projects_link.get_attribute(
+ 'href'))
+ )
+ dir_icon = all_projects.find_element(By.TAG_NAME, 'i')
+ self.assertTrue(
+ dir_icon.get_attribute('class') == 'icon-folder-open'
+ )
+ self.assertTrue(dir_icon.is_displayed())
+
+ # "Book Icon" + "Documentation"
+ toaster_docs_link = self.find('#navbar-docs')
+ toaster_docs_link_link = toaster_docs_link.find_element(By.TAG_NAME,
+ 'a')
+ self.assertTrue("Documentation" in toaster_docs_link_link.text)
+ self.assertTrue(
+ toaster_docs_link_link.get_attribute('href') == 'http://docs.yoctoproject.org/toaster-manual/index.html#toaster-user-manual'
+ )
+ book_icon = toaster_docs_link.find_element(By.TAG_NAME, 'i')
+ self.assertTrue(
+ book_icon.get_attribute('class') == 'glyphicon glyphicon-book'
+ )
+ self.assertTrue(book_icon.is_displayed())
+
+ # AT RIGHT -> button "New project"
+ new_project_button = self.find('#new-project-button')
+ self.assertTrue(new_project_button.is_displayed())
+ self.assertTrue(new_project_button.text == 'New project')
+ new_project_button.click()
+ self.assertTrue(
+ '/toastergui/newproject/' in str(self.driver.current_url)
+ )
+
+ def test_edit_project_name(self):
+ """ Test edit project name:
+ - Click on "Edit" icon button
+ - Change project name
+ - Click on "Save" button
+ - Check project name is changed
+ """
+ # navigate to the project page
+ self._navigate_to_project_page()
+
+ # click on "Edit" icon button
+ self.wait_until_visible('#project-name-container')
+ edit_button = self.find('#project-change-form-toggle')
+ edit_button.click()
+ project_name_input = self.find('#project-name-change-input')
+ self.assertTrue(project_name_input.is_displayed())
+ project_name_input.clear()
+ project_name_input.send_keys('New Name')
+ self.find('#project-name-change-btn').click()
+
+ # check project name is changed
+ self.wait_until_visible('#project-name-container')
+ self.assertTrue(
+ 'New Name' in str(self.find('#project-name-container').text)
+ )
+
+ def test_project_page_tabs(self):
+ """ Test project tabs:
+ - "configuration" tab
+ - "Builds" tab
+ - "Import layers" tab
+ - "New custom image" tab
+ Check search box used to build recipes
+ """
+ # navigate to the project page
+ self._navigate_to_project_page()
+
+ # check "configuration" tab
+ self.wait_until_visible('#topbar-configuration-tab')
+ config_tab = self.find('#topbar-configuration-tab')
+ self.assertTrue(config_tab.get_attribute('class') == 'active')
+ self.assertTrue('Configuration' in str(config_tab.text))
+ self.assertTrue(
+ f"/toastergui/project/{TestProjectPage.project_id}" in str(self.driver.current_url)
+ )
+
+ def get_tabs():
+ # tabs links list
+ return self.driver.find_elements(
+ By.XPATH,
+ '//div[@id="project-topbar"]//li'
+ )
+
+ def check_tab_link(tab_index, tab_name, url):
+ tab = get_tabs()[tab_index]
+ tab_link = tab.find_element(By.TAG_NAME, 'a')
+ self.assertTrue(url in tab_link.get_attribute('href'))
+ self.assertTrue(tab_name in tab_link.text)
+ self.assertTrue(tab.get_attribute('class') == 'active')
+
+ # check "Builds" tab
+ builds_tab = get_tabs()[1]
+ builds_tab.find_element(By.TAG_NAME, 'a').click()
+ check_tab_link(
+ 1,
+ 'Builds',
+ f"/toastergui/project/{TestProjectPage.project_id}/builds"
+ )
+
+ # check "Import layers" tab
+ import_layers_tab = get_tabs()[2]
+ import_layers_tab.find_element(By.TAG_NAME, 'a').click()
+ check_tab_link(
+ 2,
+ 'Import layer',
+ f"/toastergui/project/{TestProjectPage.project_id}/importlayer"
+ )
+
+ # check "New custom image" tab
+ new_custom_image_tab = get_tabs()[3]
+ new_custom_image_tab.find_element(By.TAG_NAME, 'a').click()
+ check_tab_link(
+ 3,
+ 'New custom image',
+ f"/toastergui/project/{TestProjectPage.project_id}/newcustomimage"
+ )
+
+ # check search box can be use to build recipes
+ search_box = self.find('#build-input')
+ search_box.send_keys('core-image-minimal')
+ self.find('#build-button').click()
+ self.wait_until_visible('#latest-builds')
+ lastest_builds = self.driver.find_elements(
+ By.XPATH,
+ '//div[@id="latest-builds"]',
+ )
+ last_build = lastest_builds[0]
+ self.assertTrue(
+ 'core-image-minimal' in str(last_build.text)
+ )
+
+ def test_softwareRecipe_page(self):
+ """ Test software recipe page
+ - Check title "Compatible software recipes" is displayed
+ - Check search input
+ - Check "build recipe" button works
+ - Check software recipe table feature(show/hide column, pagination)
+ """
+ self._navigate_to_config_nav('softwarerecipestable', 4)
+ # check title "Compatible software recipes" is displayed
+ self.assertTrue("Compatible software recipes" in self.get_page_source())
+ # Test search input
+ self._mixin_test_table_search_input(
+ input_selector='search-input-softwarerecipestable',
+ input_text='busybox',
+ searchBtn_selector='search-submit-softwarerecipestable',
+ table_selector='softwarerecipestable'
+ )
+ # check "build recipe" button works
+ rows = self.find_all('#softwarerecipestable tbody tr')
+ image_to_build = rows[0]
+ build_btn = image_to_build.find_element(
+ By.XPATH,
+ '//td[@class="add-del-layers"]//a[1]'
+ )
+ build_btn.click()
+ build_state = wait_until_build(self, 'queued cloning starting parsing failed')
+ lastest_builds = self.driver.find_elements(
+ By.XPATH,
+ '//div[@id="latest-builds"]/div'
+ )
+ self.assertTrue(len(lastest_builds) > 0)
+ last_build = lastest_builds[0]
+ cancel_button = last_build.find_element(
+ By.XPATH,
+ '//span[@class="cancel-build-btn pull-right alert-link"]',
+ )
+ cancel_button.click()
+ if 'starting' not in build_state: # change build state when cancelled in starting state
+ wait_until_build_cancelled(self)
+
+ # check software recipe table feature(show/hide column, pagination)
+ self._navigate_to_config_nav('softwarerecipestable', 4)
+ column_list = [
+ 'get_description_or_summary',
+ 'layer_version__get_vcs_reference',
+ 'layer_version__layer__name',
+ 'license',
+ 'recipe-file',
+ 'section',
+ 'version',
+ ]
+ self._mixin_test_table_edit_column(
+ 'softwarerecipestable',
+ 'edit-columns-button',
+ [f'checkbox-{column}' for column in column_list]
+ )
+ self._navigate_to_config_nav('softwarerecipestable', 4)
+ # check show rows(pagination)
+ self._mixin_test_table_show_rows(
+ table_selector='softwarerecipestable',
+ to_skip=[150],
+ )
+
+ def test_machines_page(self):
+ """ Test Machine page
+ - Check if title "Compatible machines" is displayed
+ - Check search input
+ - Check "Select machine" button works
+ - Check "Add layer" button works
+ - Check Machine table feature(show/hide column, pagination)
+ """
+ self._navigate_to_config_nav('machinestable', 5)
+ # check title "Compatible software recipes" is displayed
+ self.assertTrue("Compatible machines" in self.get_page_source())
+ # Test search input
+ self._mixin_test_table_search_input(
+ input_selector='search-input-machinestable',
+ input_text='qemux86-64',
+ searchBtn_selector='search-submit-machinestable',
+ table_selector='machinestable'
+ )
+ # check "Select machine" button works
+ rows = self.find_all('#machinestable tbody tr')
+ machine_to_select = rows[0]
+ select_btn = machine_to_select.find_element(
+ By.XPATH,
+ '//td[@class="add-del-layers"]//a[1]'
+ )
+ select_btn.send_keys(Keys.RETURN)
+ self.wait_until_visible('#config-nav')
+ project_machine_name = self.find('#project-machine-name')
+ self.assertTrue(
+ 'qemux86-64' in project_machine_name.text
+ )
+ # check "Add layer" button works
+ self._navigate_to_config_nav('machinestable', 5)
+ # Search for a machine whit layer not in project
+ self._mixin_test_table_search_input(
+ input_selector='search-input-machinestable',
+ input_text='qemux86-64-tpm2',
+ searchBtn_selector='search-submit-machinestable',
+ table_selector='machinestable'
+ )
+ self.wait_until_visible('#machinestable tbody tr', poll=3)
+ rows = self.find_all('#machinestable tbody tr')
+ machine_to_add = rows[0]
+ add_btn = machine_to_add.find_element(By.XPATH, '//td[@class="add-del-layers"]')
+ add_btn.click()
+ self.wait_until_visible('#change-notification')
+ change_notification = self.find('#change-notification')
+ self.assertTrue(
+ f'You have added 1 layer to your project' in str(change_notification.text)
+ )
+ # check Machine table feature(show/hide column, pagination)
+ self._navigate_to_config_nav('machinestable', 5)
+ column_list = [
+ 'description',
+ 'layer_version__get_vcs_reference',
+ 'layer_version__layer__name',
+ 'machinefile',
+ ]
+ self._mixin_test_table_edit_column(
+ 'machinestable',
+ 'edit-columns-button',
+ [f'checkbox-{column}' for column in column_list]
+ )
+ self._navigate_to_config_nav('machinestable', 5)
+ # check show rows(pagination)
+ self._mixin_test_table_show_rows(
+ table_selector='machinestable',
+ to_skip=[150],
+ )
+
+ def test_layers_page(self):
+ """ Test layers page
+ - Check if title "Compatible layerss" is displayed
+ - Check search input
+ - Check "Add layer" button works
+ - Check "Remove layer" button works
+ - Check layers table feature(show/hide column, pagination)
+ """
+ self._navigate_to_config_nav('layerstable', 6)
+ # check title "Compatible layers" is displayed
+ self.assertTrue("Compatible layers" in self.get_page_source())
+ # Test search input
+ input_text='meta-tanowrt'
+ self._mixin_test_table_search_input(
+ input_selector='search-input-layerstable',
+ input_text=input_text,
+ searchBtn_selector='search-submit-layerstable',
+ table_selector='layerstable'
+ )
+ # check "Add layer" button works
+ self.wait_until_visible('#layerstable tbody tr', poll=3)
+ rows = self.find_all('#layerstable tbody tr')
+ layer_to_add = rows[0]
+ add_btn = layer_to_add.find_element(
+ By.XPATH,
+ '//td[@class="add-del-layers"]'
+ )
+ add_btn.click()
+ # check modal is displayed
+ self.wait_until_visible('#dependencies-modal', poll=3)
+ list_dependencies = self.find_all('#dependencies-list li')
+ # click on add-layers button
+ add_layers_btn = self.driver.find_element(
+ By.XPATH,
+ '//form[@id="dependencies-modal-form"]//button[@class="btn btn-primary"]'
+ )
+ add_layers_btn.click()
+ self.wait_until_visible('#change-notification')
+ change_notification = self.find('#change-notification')
+ self.assertTrue(
+ f'You have added {len(list_dependencies)+1} layers to your project: {input_text} and its dependencies' in str(change_notification.text)
+ )
+ # check "Remove layer" button works
+ self.wait_until_visible('#layerstable tbody tr', poll=3)
+ rows = self.find_all('#layerstable tbody tr')
+ layer_to_remove = rows[0]
+ remove_btn = layer_to_remove.find_element(
+ By.XPATH,
+ '//td[@class="add-del-layers"]'
+ )
+ remove_btn.click()
+ self.wait_until_visible('#change-notification', poll=2)
+ change_notification = self.find('#change-notification')
+ self.assertTrue(
+ f'You have removed 1 layer from your project: {input_text}' in str(change_notification.text)
+ )
+ # check layers table feature(show/hide column, pagination)
+ self._navigate_to_config_nav('layerstable', 6)
+ column_list = [
+ 'dependencies',
+ 'revision',
+ 'layer__vcs_url',
+ 'git_subdir',
+ 'layer__summary',
+ ]
+ self._mixin_test_table_edit_column(
+ 'layerstable',
+ 'edit-columns-button',
+ [f'checkbox-{column}' for column in column_list]
+ )
+ self._navigate_to_config_nav('layerstable', 6)
+ # check show rows(pagination)
+ self._mixin_test_table_show_rows(
+ table_selector='layerstable',
+ to_skip=[150],
+ )
+
+ def test_distro_page(self):
+ """ Test distros page
+ - Check if title "Compatible distros" is displayed
+ - Check search input
+ - Check "Add layer" button works
+ - Check distro table feature(show/hide column, pagination)
+ """
+ self._navigate_to_config_nav('distrostable', 7)
+ # check title "Compatible distros" is displayed
+ self.assertTrue("Compatible Distros" in self.get_page_source())
+ # Test search input
+ input_text='poky-altcfg'
+ self._mixin_test_table_search_input(
+ input_selector='search-input-distrostable',
+ input_text=input_text,
+ searchBtn_selector='search-submit-distrostable',
+ table_selector='distrostable'
+ )
+ # check "Add distro" button works
+ rows = self.find_all('#distrostable tbody tr')
+ distro_to_add = rows[0]
+ add_btn = distro_to_add.find_element(
+ By.XPATH,
+ '//td[@class="add-del-layers"]//a[1]'
+ )
+ add_btn.click()
+ self.wait_until_visible('#change-notification', poll=2)
+ change_notification = self.find('#change-notification')
+ self.assertTrue(
+ f'You have changed the distro to: {input_text}' in str(change_notification.text)
+ )
+ # check distro table feature(show/hide column, pagination)
+ self._navigate_to_config_nav('distrostable', 7)
+ column_list = [
+ 'description',
+ 'templatefile',
+ 'layer_version__get_vcs_reference',
+ 'layer_version__layer__name',
+ ]
+ self._mixin_test_table_edit_column(
+ 'distrostable',
+ 'edit-columns-button',
+ [f'checkbox-{column}' for column in column_list]
+ )
+ self._navigate_to_config_nav('distrostable', 7)
+ # check show rows(pagination)
+ self._mixin_test_table_show_rows(
+ table_selector='distrostable',
+ to_skip=[150],
+ )
+
+ def test_single_layer_page(self):
+ """ Test layer page
+ - Check if title is displayed
+ - Check add/remove layer button works
+ - Check tabs(layers, recipes, machines) are displayed
+ - Check left section is displayed
+ - Check layer name
+ - Check layer summary
+ - Check layer description
+ """
+ url = reverse("layerdetails", args=(TestProjectPage.project_id, 8))
+ self.get(url)
+ self.wait_until_visible('.page-header')
+ # check title is displayed
+ self.assertTrue(self.find('.page-header h1').is_displayed())
+
+ # check add layer button works
+ remove_layer_btn = self.find('#add-remove-layer-btn')
+ remove_layer_btn.click()
+ self.wait_until_visible('#change-notification', poll=2)
+ change_notification = self.find('#change-notification')
+ self.assertTrue(
+ f'You have removed 1 layer from your project' in str(change_notification.text)
+ )
+ # check add layer button works, 18 is the random layer id
+ add_layer_btn = self.find('#add-remove-layer-btn')
+ add_layer_btn.click()
+ self.wait_until_visible('#change-notification')
+ change_notification = self.find('#change-notification')
+ self.assertTrue(
+ f'You have added 1 layer to your project' in str(change_notification.text)
+ )
+ # check tabs(layers, recipes, machines) are displayed
+ tabs = self.find_all('.nav-tabs li')
+ self.assertEqual(len(tabs), 3)
+ # Check first tab
+ tabs[0].click()
+ self.assertTrue(
+ 'active' in str(self.find('#information').get_attribute('class'))
+ )
+ # Check second tab
+ tabs[1].click()
+ self.assertTrue(
+ 'active' in str(self.find('#recipes').get_attribute('class'))
+ )
+ # Check third tab
+ tabs[2].click()
+ self.assertTrue(
+ 'active' in str(self.find('#machines').get_attribute('class'))
+ )
+ # Check left section is displayed
+ section = self.find('.well')
+ # Check layer name
+ self.assertTrue(
+ section.find_element(By.XPATH, '//h2[1]').is_displayed()
+ )
+ # Check layer summary
+ self.assertTrue("Summary" in section.text)
+ # Check layer description
+ self.assertTrue("Description" in section.text)
+
+ def test_single_recipe_page(self):
+ """ Test recipe page
+ - Check if title is displayed
+ - Check add recipe layer displayed
+ - Check left section is displayed
+ - Check recipe: name, summary, description, Version, Section,
+ License, Approx. packages included, Approx. size, Recipe file
+ """
+ url = reverse("recipedetails", args=(TestProjectPage.project_id, 53428))
+ self.get(url)
+ self.wait_until_visible('.page-header')
+ # check title is displayed
+ self.assertTrue(self.find('.page-header h1').is_displayed())
+ # check add recipe layer displayed
+ add_recipe_layer_btn = self.find('#add-layer-btn')
+ self.assertTrue(add_recipe_layer_btn.is_displayed())
+ # check left section is displayed
+ section = self.find('.well')
+ # Check recipe name
+ self.assertTrue(
+ section.find_element(By.XPATH, '//h2[1]').is_displayed()
+ )
+ # Check recipe sections details info are displayed
+ self.assertTrue("Summary" in section.text)
+ self.assertTrue("Description" in section.text)
+ self.assertTrue("Version" in section.text)
+ self.assertTrue("Section" in section.text)
+ self.assertTrue("License" in section.text)
+ self.assertTrue("Approx. packages included" in section.text)
+ self.assertTrue("Approx. package size" in section.text)
+ self.assertTrue("Recipe file" in section.text)
diff --git a/bitbake/lib/toaster/tests/functional/test_project_page_tab_config.py b/bitbake/lib/toaster/tests/functional/test_project_page_tab_config.py
new file mode 100644
index 0000000000..eb905ddf3f
--- /dev/null
+++ b/bitbake/lib/toaster/tests/functional/test_project_page_tab_config.py
@@ -0,0 +1,528 @@
+#! /usr/bin/env python3 #
+# BitBake Toaster UI tests implementation
+#
+# Copyright (C) 2023 Savoir-faire Linux
+#
+# SPDX-License-Identifier: GPL-2.0-only
+#
+
+import string
+import random
+import pytest
+from django.urls import reverse
+from selenium.webdriver import Keys
+from selenium.webdriver.support.select import Select
+from selenium.common.exceptions import ElementClickInterceptedException, NoSuchElementException, TimeoutException
+from orm.models import Project
+from tests.functional.functional_helpers import SeleniumFunctionalTestCase
+from selenium.webdriver.common.by import By
+
+from .utils import get_projectId_from_url, wait_until_build, wait_until_build_cancelled
+
+
+@pytest.mark.django_db
+@pytest.mark.order("last")
+class TestProjectConfigTab(SeleniumFunctionalTestCase):
+ PROJECT_NAME = 'TestProjectConfigTab'
+ project_id = None
+
+ def _create_project(self, project_name, **kwargs):
+ """ Create/Test new project using:
+ - Project Name: Any string
+ - Release: Any string
+ - Merge Toaster settings: True or False
+ """
+ release = kwargs.get('release', '3')
+ self.get(reverse('newproject'))
+ self.wait_until_visible('#new-project-name')
+ self.find("#new-project-name").send_keys(project_name)
+ select = Select(self.find("#projectversion"))
+ select.select_by_value(release)
+
+ # check merge toaster settings
+ checkbox = self.find('.checkbox-mergeattr')
+ if not checkbox.is_selected():
+ checkbox.click()
+
+ if self.PROJECT_NAME != 'TestProjectConfigTab':
+ # Reset project name if it's not the default one
+ self.PROJECT_NAME = 'TestProjectConfigTab'
+
+ self.find("#create-project-button").click()
+
+ try:
+ self.wait_until_visible('#hint-error-project-name', poll=3)
+ url = reverse('project', args=(TestProjectConfigTab.project_id, ))
+ self.get(url)
+ self.wait_until_visible('#config-nav', poll=3)
+ except TimeoutException:
+ self.wait_until_visible('#config-nav', poll=3)
+
+ def _random_string(self, length):
+ return ''.join(
+ random.choice(string.ascii_letters) for _ in range(length)
+ )
+
+ def _navigate_to_project_page(self):
+ # Navigate to project page
+ if TestProjectConfigTab.project_id is None:
+ self._create_project(project_name=self._random_string(10))
+ current_url = self.driver.current_url
+ TestProjectConfigTab.project_id = get_projectId_from_url(
+ current_url)
+ else:
+ url = reverse('project', args=(TestProjectConfigTab.project_id,))
+ self.get(url)
+ self.wait_until_visible('#config-nav')
+
+ def _create_builds(self):
+ # check search box can be use to build recipes
+ search_box = self.find('#build-input')
+ search_box.send_keys('foo')
+ self.find('#build-button').click()
+ self.wait_until_present('#latest-builds')
+ # loop until reach the parsing state
+ wait_until_build(self, 'queued cloning starting parsing failed')
+ lastest_builds = self.driver.find_elements(
+ By.XPATH,
+ '//div[@id="latest-builds"]/div',
+ )
+ last_build = lastest_builds[0]
+ self.assertTrue(
+ 'foo' in str(last_build.text)
+ )
+ last_build = lastest_builds[0]
+ try:
+ cancel_button = last_build.find_element(
+ By.XPATH,
+ '//span[@class="cancel-build-btn pull-right alert-link"]',
+ )
+ cancel_button.click()
+ except NoSuchElementException:
+ # Skip if the build is already cancelled
+ pass
+ wait_until_build_cancelled(self)
+
+ def _get_tabs(self):
+ # tabs links list
+ return self.driver.find_elements(
+ By.XPATH,
+ '//div[@id="project-topbar"]//li'
+ )
+
+ def _get_config_nav_item(self, index):
+ config_nav = self.find('#config-nav')
+ return config_nav.find_elements(By.TAG_NAME, 'li')[index]
+
+ def test_project_config_nav(self):
+ """ Test project config tab navigation:
+ - Check if the menu is displayed and contains the right elements:
+ - Configuration
+ - COMPATIBLE METADATA
+ - Custom images
+ - Image recipes
+ - Software recipes
+ - Machines
+ - Layers
+ - Distro
+ - EXTRA CONFIGURATION
+ - Bitbake variables
+ - Actions
+ - Delete project
+ """
+ self._navigate_to_project_page()
+
+ def _get_config_nav_item(index):
+ config_nav = self.find('#config-nav')
+ return config_nav.find_elements(By.TAG_NAME, 'li')[index]
+
+ def check_config_nav_item(index, item_name, url):
+ item = _get_config_nav_item(index)
+ self.assertTrue(item_name in item.text)
+ self.assertTrue(item.get_attribute('class') == 'active')
+ self.assertTrue(url in self.driver.current_url)
+
+ # check if the menu contains the right elements
+ # COMPATIBLE METADATA
+ compatible_metadata = _get_config_nav_item(1)
+ self.assertTrue(
+ "compatible metadata" in compatible_metadata.text.lower()
+ )
+ # EXTRA CONFIGURATION
+ extra_configuration = _get_config_nav_item(8)
+ self.assertTrue(
+ "extra configuration" in extra_configuration.text.lower()
+ )
+ # Actions
+ actions = _get_config_nav_item(10)
+ self.assertTrue("actions" in str(actions.text).lower())
+
+ conf_nav_list = [
+ # config
+ [0, 'Configuration',
+ f"/toastergui/project/{TestProjectConfigTab.project_id}"],
+ # custom images
+ [2, 'Custom images',
+ f"/toastergui/project/{TestProjectConfigTab.project_id}/customimages"],
+ # image recipes
+ [3, 'Image recipes',
+ f"/toastergui/project/{TestProjectConfigTab.project_id}/images"],
+ # software recipes
+ [4, 'Software recipes',
+ f"/toastergui/project/{TestProjectConfigTab.project_id}/softwarerecipes"],
+ # machines
+ [5, 'Machines',
+ f"/toastergui/project/{TestProjectConfigTab.project_id}/machines"],
+ # layers
+ [6, 'Layers',
+ f"/toastergui/project/{TestProjectConfigTab.project_id}/layers"],
+ # distro
+ [7, 'Distros',
+ f"/toastergui/project/{TestProjectConfigTab.project_id}/distros"],
+ # [9, 'BitBake variables', f"/toastergui/project/{TestProjectConfigTab.project_id}/configuration"], # bitbake variables
+ ]
+ for index, item_name, url in conf_nav_list:
+ item = _get_config_nav_item(index)
+ if item.get_attribute('class') != 'active':
+ item.click()
+ check_config_nav_item(index, item_name, url)
+
+ def test_image_recipe_editColumn(self):
+ """ Test the edit column feature in image recipe table on project page """
+ def test_edit_column(check_box_id):
+ # Check that we can hide/show table column
+ check_box = self.find(f'#{check_box_id}')
+ th_class = str(check_box_id).replace('checkbox-', '')
+ if check_box.is_selected():
+ # check if column is visible in table
+ self.assertTrue(
+ self.find(
+ f'#imagerecipestable thead th.{th_class}'
+ ).is_displayed(),
+ f"The {th_class} column is checked in EditColumn dropdown, but it's not visible in table"
+ )
+ check_box.click()
+ # check if column is hidden in table
+ self.assertFalse(
+ self.find(
+ f'#imagerecipestable thead th.{th_class}'
+ ).is_displayed(),
+ f"The {th_class} column is unchecked in EditColumn dropdown, but it's visible in table"
+ )
+ else:
+ # check if column is hidden in table
+ self.assertFalse(
+ self.find(
+ f'#imagerecipestable thead th.{th_class}'
+ ).is_displayed(),
+ f"The {th_class} column is unchecked in EditColumn dropdown, but it's visible in table"
+ )
+ check_box.click()
+ # check if column is visible in table
+ self.assertTrue(
+ self.find(
+ f'#imagerecipestable thead th.{th_class}'
+ ).is_displayed(),
+ f"The {th_class} column is checked in EditColumn dropdown, but it's not visible in table"
+ )
+
+ self._navigate_to_project_page()
+ # navigate to project image recipe page
+ recipe_image_page_link = self._get_config_nav_item(3)
+ recipe_image_page_link.click()
+ self.wait_until_present('#imagerecipestable tbody tr')
+
+ # Check edit column
+ edit_column = self.find('#edit-columns-button')
+ self.assertTrue(edit_column.is_displayed())
+ edit_column.click()
+ # Check dropdown is visible
+ self.wait_until_visible('ul.dropdown-menu.editcol')
+
+ # Check that we can hide the edit column
+ test_edit_column('checkbox-get_description_or_summary')
+ test_edit_column('checkbox-layer_version__get_vcs_reference')
+ test_edit_column('checkbox-layer_version__layer__name')
+ test_edit_column('checkbox-license')
+ test_edit_column('checkbox-recipe-file')
+ test_edit_column('checkbox-section')
+ test_edit_column('checkbox-version')
+
+ def test_image_recipe_show_rows(self):
+ """ Test the show rows feature in image recipe table on project page """
+ def test_show_rows(row_to_show, show_row_link):
+ # Check that we can show rows == row_to_show
+ show_row_link.select_by_value(str(row_to_show))
+ self.wait_until_visible('#imagerecipestable tbody tr', poll=3)
+ # check at least some rows are visible
+ self.assertTrue(
+ len(self.find_all('#imagerecipestable tbody tr')) > 0
+ )
+
+ self._navigate_to_project_page()
+ # navigate to project image recipe page
+ recipe_image_page_link = self._get_config_nav_item(3)
+ recipe_image_page_link.click()
+ self.wait_until_present('#imagerecipestable tbody tr')
+
+ show_rows = self.driver.find_elements(
+ By.XPATH,
+ '//select[@class="form-control pagesize-imagerecipestable"]'
+ )
+ # Check show rows
+ for show_row_link in show_rows:
+ show_row_link = Select(show_row_link)
+ test_show_rows(10, show_row_link)
+ test_show_rows(25, show_row_link)
+ test_show_rows(50, show_row_link)
+ test_show_rows(100, show_row_link)
+ test_show_rows(150, show_row_link)
+
+ def test_project_config_tab_right_section(self):
+ """ Test project config tab right section contains five blocks:
+ - Machine:
+ - check 'Machine' is displayed
+ - check can change Machine
+ - Distro:
+ - check 'Distro' is displayed
+ - check can change Distro
+ - Most built recipes:
+ - check 'Most built recipes' is displayed
+ - check can select a recipe and build it
+ - Project release:
+ - check 'Project release' is displayed
+ - check project has right release displayed
+ - Layers:
+ - check can add a layer if exists
+ - check at least three layers are displayed
+ - openembedded-core
+ - meta-poky
+ - meta-yocto-bsp
+ """
+ # Create a new project for this test
+ project_name = self._random_string(10)
+ self._create_project(project_name=project_name)
+ # check if the menu is displayed
+ self.wait_until_visible('#project-page')
+ block_l = self.driver.find_element(
+ By.XPATH, '//*[@id="project-page"]/div[2]')
+ project_release = self.driver.find_element(
+ By.XPATH, '//*[@id="project-page"]/div[1]/div[4]')
+ layers = block_l.find_element(By.ID, 'layer-container')
+
+ def check_machine_distro(self, item_name, new_item_name, block_id):
+ block = self.find(f'#{block_id}')
+ title = block.find_element(By.TAG_NAME, 'h3')
+ self.assertTrue(item_name.capitalize() in title.text)
+ edit_btn = self.find(f'#change-{item_name}-toggle')
+ edit_btn.click()
+ self.wait_until_visible(f'#{item_name}-change-input')
+ name_input = self.find(f'#{item_name}-change-input')
+ name_input.clear()
+ name_input.send_keys(new_item_name)
+ change_btn = self.find(f'#{item_name}-change-btn')
+ change_btn.click()
+ self.wait_until_visible(f'#project-{item_name}-name')
+ project_name = self.find(f'#project-{item_name}-name')
+ self.assertTrue(new_item_name in project_name.text)
+ # check change notificaiton is displayed
+ change_notification = self.find('#change-notification')
+ self.assertTrue(
+ f'You have changed the {item_name} to: {new_item_name}' in change_notification.text
+ )
+
+ # Machine
+ check_machine_distro(self, 'machine', 'qemux86-64', 'machine-section')
+ # Distro
+ check_machine_distro(self, 'distro', 'poky-altcfg', 'distro-section')
+
+ # Project release
+ title = project_release.find_element(By.TAG_NAME, 'h3')
+ self.assertTrue("Project release" in title.text)
+ self.assertTrue(
+ "Yocto Project master" in self.find('#project-release-title').text
+ )
+ # Layers
+ title = layers.find_element(By.TAG_NAME, 'h3')
+ self.assertTrue("Layers" in title.text)
+ # check at least three layers are displayed
+ # openembedded-core
+ # meta-poky
+ # meta-yocto-bsp
+ layers_list = layers.find_element(By.ID, 'layers-in-project-list')
+ layers_list_items = layers_list.find_elements(By.TAG_NAME, 'li')
+ # remove all layers except the first three layers
+ for i in range(3, len(layers_list_items)):
+ layers_list_items[i].find_element(By.TAG_NAME, 'span').click()
+ # check can add a layer if exists
+ add_layer_input = layers.find_element(By.ID, 'layer-add-input')
+ add_layer_input.send_keys('meta-oe')
+ self.wait_until_visible('#layer-container > form > div > span > div')
+ dropdown_item = self.driver.find_element(
+ By.XPATH,
+ '//*[@id="layer-container"]/form/div/span/div'
+ )
+ try:
+ dropdown_item.click()
+ except ElementClickInterceptedException:
+ self.skipTest(
+ "layer-container dropdown item click intercepted. Element not properly visible.")
+ add_layer_btn = layers.find_element(By.ID, 'add-layer-btn')
+ add_layer_btn.click()
+ self.wait_until_visible('#layers-in-project-list')
+ # check layer is added
+ layers_list_items = layers_list.find_elements(By.TAG_NAME, 'li')
+ self.assertTrue(len(layers_list_items) == 4)
+
+ def test_most_build_recipes(self):
+ """ Test most build recipes block contains"""
+ def rebuild_from_most_build_recipes(recipe_list_items):
+ checkbox = recipe_list_items[0].find_element(By.TAG_NAME, 'input')
+ checkbox.click()
+ build_btn = self.find('#freq-build-btn')
+ build_btn.click()
+ self.wait_until_visible('#latest-builds')
+ wait_until_build(self, 'queued cloning starting parsing failed')
+ lastest_builds = self.driver.find_elements(
+ By.XPATH,
+ '//div[@id="latest-builds"]/div'
+ )
+ self.assertTrue(len(lastest_builds) >= 2)
+ last_build = lastest_builds[0]
+ try:
+ cancel_button = last_build.find_element(
+ By.XPATH,
+ '//span[@class="cancel-build-btn pull-right alert-link"]',
+ )
+ cancel_button.click()
+ except NoSuchElementException:
+ # Skip if the build is already cancelled
+ pass
+ wait_until_build_cancelled(self)
+ # Create a new project for remaining asserts
+ project_name = self._random_string(10)
+ self._create_project(project_name=project_name, release='2')
+ current_url = self.driver.current_url
+ TestProjectConfigTab.project_id = get_projectId_from_url(current_url)
+ url = current_url.split('?')[0]
+
+ # Create a new builds
+ self._create_builds()
+
+ # back to project page
+ self.driver.get(url)
+
+ self.wait_until_visible('#project-page', poll=3)
+
+ # Most built recipes
+ most_built_recipes = self.driver.find_element(
+ By.XPATH, '//*[@id="project-page"]/div[1]/div[3]')
+ title = most_built_recipes.find_element(By.TAG_NAME, 'h3')
+ self.assertTrue("Most built recipes" in title.text)
+ # check can select a recipe and build it
+ self.wait_until_visible('#freq-build-list', poll=3)
+ recipe_list = self.find('#freq-build-list')
+ recipe_list_items = recipe_list.find_elements(By.TAG_NAME, 'li')
+ self.assertTrue(
+ len(recipe_list_items) > 0,
+ msg="Any recipes found in the most built recipes list",
+ )
+ rebuild_from_most_build_recipes(recipe_list_items)
+ TestProjectConfigTab.project_id = None # reset project id
+
+ def test_project_page_tab_importlayer(self):
+ """ Test project page tab import layer """
+ self._navigate_to_project_page()
+ # navigate to "Import layers" tab
+ import_layers_tab = self._get_tabs()[2]
+ import_layers_tab.find_element(By.TAG_NAME, 'a').click()
+ self.wait_until_visible('#layer-git-repo-url')
+
+ # Check git repo radio button
+ git_repo_radio = self.find('#git-repo-radio')
+ git_repo_radio.click()
+
+ # Set git repo url
+ input_repo_url = self.find('#layer-git-repo-url')
+ input_repo_url.send_keys('git://git.yoctoproject.org/meta-fake')
+ # Blur the input to trigger the validation
+ input_repo_url.send_keys(Keys.TAB)
+
+ # Check name is set
+ input_layer_name = self.find('#import-layer-name')
+ self.assertTrue(input_layer_name.get_attribute('value') == 'meta-fake')
+
+ # Set branch
+ input_branch = self.find('#layer-git-ref')
+ input_branch.send_keys('master')
+
+ # Import layer
+ self.find('#import-and-add-btn').click()
+
+ # Check layer is added
+ self.wait_until_visible('#layer-container')
+ block_l = self.driver.find_element(
+ By.XPATH, '//*[@id="project-page"]/div[2]')
+ layers = block_l.find_element(By.ID, 'layer-container')
+ layers_list = layers.find_element(By.ID, 'layers-in-project-list')
+ layers_list_items = layers_list.find_elements(By.TAG_NAME, 'li')
+ self.assertTrue(
+ 'meta-fake' in str(layers_list_items[-1].text)
+ )
+
+ def test_project_page_custom_image_no_image(self):
+ """ Test project page tab "New custom image" when no custom image """
+ project_name = self._random_string(10)
+ self._create_project(project_name=project_name)
+ current_url = self.driver.current_url
+ TestProjectConfigTab.project_id = get_projectId_from_url(current_url)
+ # navigate to "Custom image" tab
+ custom_image_section = self._get_config_nav_item(2)
+ custom_image_section.click()
+ self.wait_until_visible('#empty-state-customimagestable')
+
+ # Check message when no custom image
+ self.assertTrue(
+ "You have not created any custom images yet." in str(
+ self.find('#empty-state-customimagestable').text
+ )
+ )
+ div_empty_msg = self.find('#empty-state-customimagestable')
+ link_create_custom_image = div_empty_msg.find_element(
+ By.TAG_NAME, 'a')
+ self.assertTrue(TestProjectConfigTab.project_id is not None)
+ self.assertTrue(
+ f"/toastergui/project/{TestProjectConfigTab.project_id}/newcustomimage" in str(
+ link_create_custom_image.get_attribute('href')
+ )
+ )
+ self.assertTrue(
+ "Create your first custom image" in str(
+ link_create_custom_image.text
+ )
+ )
+ TestProjectConfigTab.project_id = None # reset project id
+
+ def test_project_page_image_recipe(self):
+ """ Test project page section images
+ - Check image recipes are displayed
+ - Check search input
+ - Check image recipe build button works
+ - Check image recipe table features(show/hide column, pagination)
+ """
+ self._navigate_to_project_page()
+ # navigate to "Images section"
+ images_section = self._get_config_nav_item(3)
+ images_section.click()
+ self.wait_until_visible('#imagerecipestable')
+ rows = self.find_all('#imagerecipestable tbody tr')
+ self.assertTrue(len(rows) > 0)
+
+ # Test search input
+ self.wait_until_visible('#search-input-imagerecipestable')
+ recipe_input = self.find('#search-input-imagerecipestable')
+ recipe_input.send_keys('core-image-minimal')
+ self.find('#search-submit-imagerecipestable').click()
+ self.wait_until_visible('#imagerecipestable tbody tr')
+ rows = self.find_all('#imagerecipestable tbody tr')
+ self.assertTrue(len(rows) > 0)
diff --git a/bitbake/lib/toaster/tests/functional/utils.py b/bitbake/lib/toaster/tests/functional/utils.py
new file mode 100644
index 0000000000..7269fa1805
--- /dev/null
+++ b/bitbake/lib/toaster/tests/functional/utils.py
@@ -0,0 +1,89 @@
+#!/usr/bin/env python3
+# -*- coding: utf-8 -*-
+# BitBake Toaster UI tests implementation
+#
+# Copyright (C) 2023 Savoir-faire Linux
+#
+# SPDX-License-Identifier: GPL-2.0-only
+
+
+from time import sleep
+from selenium.common.exceptions import NoSuchElementException, StaleElementReferenceException, TimeoutException
+from selenium.webdriver.common.by import By
+
+from orm.models import Build
+
+
+def wait_until_build(test_instance, state):
+ timeout = 60
+ start_time = 0
+ build_state = ''
+ while True:
+ try:
+ if start_time > timeout:
+ raise TimeoutException(
+ f'Build did not reach {state} state within {timeout} seconds'
+ )
+ last_build_state = test_instance.driver.find_element(
+ By.XPATH,
+ '//*[@id="latest-builds"]/div[1]//div[@class="build-state"]',
+ )
+ build_state = last_build_state.get_attribute(
+ 'data-build-state')
+ state_text = state.lower().split()
+ if any(x in str(build_state).lower() for x in state_text):
+ return str(build_state).lower()
+ if 'failed' in str(build_state).lower():
+ break
+ except NoSuchElementException:
+ continue
+ except TimeoutException:
+ break
+ start_time += 1
+ sleep(1) # take a breath and try again
+
+def wait_until_build_cancelled(test_instance):
+ """ Cancel build take a while sometime, the method is to wait driver action
+ until build being cancelled
+ """
+ timeout = 30
+ start_time = 0
+ build = None
+ while True:
+ try:
+ if start_time > timeout:
+ raise TimeoutException(
+ f'Build did not reach cancelled state within {timeout} seconds'
+ )
+ last_build_state = test_instance.driver.find_element(
+ By.XPATH,
+ '//*[@id="latest-builds"]/div[1]//div[@class="build-state"]',
+ )
+ build_state = last_build_state.get_attribute(
+ 'data-build-state')
+ if 'failed' in str(build_state).lower():
+ break
+ if 'cancelling' in str(build_state).lower():
+ # Change build state to cancelled
+ if not build: # get build object only once
+ build = Build.objects.last()
+ build.outcome = Build.CANCELLED
+ build.save()
+ if 'cancelled' in str(build_state).lower():
+ break
+ except NoSuchElementException:
+ continue
+ except StaleElementReferenceException:
+ continue
+ except TimeoutException:
+ break
+ start_time += 1
+ sleep(1) # take a breath and try again
+
+def get_projectId_from_url(url):
+ # url = 'http://domainename.com/toastergui/project/1656/whatever
+ # or url = 'http://domainename.com/toastergui/project/1/
+ # or url = 'http://domainename.com/toastergui/project/186
+ assert '/toastergui/project/' in url, "URL is not valid"
+ url_to_list = url.split('/toastergui/project/')
+ return int(url_to_list[1].split('/')[0]) # project_id
diff --git a/bitbake/lib/toaster/tests/toaster-tests-requirements.txt b/bitbake/lib/toaster/tests/toaster-tests-requirements.txt
index 4f9fcc46d2..71cc083436 100644
--- a/bitbake/lib/toaster/tests/toaster-tests-requirements.txt
+++ b/bitbake/lib/toaster/tests/toaster-tests-requirements.txt
@@ -1 +1,7 @@
-selenium==2.49.2
+selenium>=4.13.0
+pytest==7.4.2
+pytest-django==4.5.2
+pytest-env==1.1.0
+pytest-html==4.0.2
+pytest-metadata==3.0.0
+pytest-order==1.1.0
diff --git a/bitbake/lib/toaster/tests/views/test_views.py b/bitbake/lib/toaster/tests/views/test_views.py
index 735d596bcc..e1adfcf86a 100644
--- a/bitbake/lib/toaster/tests/views/test_views.py
+++ b/bitbake/lib/toaster/tests/views/test_views.py
@@ -9,6 +9,8 @@
"""Test cases for Toaster GUI and ReST."""
+import os
+import pytest
from django.test import TestCase
from django.test.client import RequestFactory
from django.urls import reverse
@@ -19,6 +21,7 @@ from orm.models import Layer_Version, Recipe
from orm.models import CustomImageRecipe
from orm.models import CustomImagePackage
+from bldcontrol.models import BuildEnvironment
import inspect
import toastergui
@@ -32,19 +35,32 @@ PROJECT_NAME2 = "test project 2"
CLI_BUILDS_PROJECT_NAME = 'Command line builds'
+
class ViewTests(TestCase):
"""Tests to verify view APIs."""
fixtures = ['toastergui-unittest-data']
+ builldir = os.environ.get('BUILDDIR')
def setUp(self):
self.project = Project.objects.first()
+
self.recipe1 = Recipe.objects.get(pk=2)
+ # create a file and to recipe1 file_path
+ file_path = f"{self.builldir}/{self.recipe1.name.strip().replace(' ', '-')}.bb"
+ with open(file_path, 'w') as f:
+ f.write('foo')
+ self.recipe1.file_path = file_path
+ self.recipe1.save()
+
self.customr = CustomImageRecipe.objects.first()
self.cust_package = CustomImagePackage.objects.first()
self.package = Package.objects.first()
self.lver = Layer_Version.objects.first()
+ if BuildEnvironment.objects.count() == 0:
+ BuildEnvironment.objects.create(betype=BuildEnvironment.TYPE_LOCAL)
+
def test_get_base_call_returns_html(self):
"""Basic test for all-projects view"""
@@ -226,7 +242,7 @@ class ViewTests(TestCase):
recipe = CustomImageRecipe.objects.create(
name=name, project=self.project,
base_recipe=self.recipe1,
- file_path="/tmp/testing",
+ file_path=f"{self.builldir}/testing",
layer_version=self.customr.layer_version)
url = reverse('xhr_customrecipe_id', args=(recipe.id,))
response = self.client.delete(url)
@@ -297,7 +313,7 @@ class ViewTests(TestCase):
"""Download the recipe file generated for the custom image"""
# Create a dummy recipe file for the custom image generation to read
- open("/tmp/a_recipe.bb", 'a').close()
+ open(f"{self.builldir}/a_recipe.bb", 'a').close()
response = self.client.get(reverse('customrecipedownload',
args=(self.project.id,
self.customr.id)))
diff --git a/bitbake/lib/toaster/toastergui/api.py b/bitbake/lib/toaster/toastergui/api.py
index b4cdc335ef..e367bd910e 100644
--- a/bitbake/lib/toaster/toastergui/api.py
+++ b/bitbake/lib/toaster/toastergui/api.py
@@ -11,7 +11,7 @@ import os
import re
import logging
import json
-import subprocess
+import glob
from collections import Counter
from orm.models import Project, ProjectTarget, Build, Layer_Version
@@ -227,20 +227,18 @@ class XhrSetDefaultImageUrl(View):
# same logical name
# * Each project that uses a layer will have its own
# LayerVersion and Project Layer for it
-# * During the Paroject delete process, when the last
+# * During the Project delete process, when the last
# LayerVersion for a 'local_source_dir' layer is deleted
# then the Layer record is deleted to remove orphans
#
def scan_layer_content(layer,layer_version):
# if this is a local layer directory, we can immediately scan its content
- if layer.local_source_dir:
+ if os.path.isdir(layer.local_source_dir):
try:
# recipes-*/*/*.bb
- cmd = '%s %s' % ('ls', os.path.join(layer.local_source_dir,'recipes-*/*/*.bb'))
- recipes_list = subprocess.Popen(cmd, shell=True, stdout=subprocess.PIPE,stderr=subprocess.STDOUT).stdout.read()
- recipes_list = recipes_list.decode("utf-8").strip()
- if recipes_list and 'No such' not in recipes_list:
+ recipes_list = glob.glob(os.path.join(layer.local_source_dir, 'recipes-*/*/*.bb'))
+ for recipe in recipes_list:
for recipe in recipes_list.split('\n'):
recipe_path = recipe[recipe.rfind('recipes-'):]
recipe_name = recipe[recipe.rfind('/')+1:].replace('.bb','')
@@ -260,6 +258,9 @@ def scan_layer_content(layer,layer_version):
except Exception as e:
logger.warning("ERROR:scan_layer_content: %s" % e)
+ else:
+ logger.warning("ERROR: wrong path given")
+ raise KeyError("local_source_dir")
class XhrLayer(View):
""" Delete, Get, Add and Update Layer information
@@ -456,15 +457,18 @@ class XhrLayer(View):
'layerdetailurl':
layer_dep.get_detailspage_url(project.pk)})
- # Scan the layer's content and update components
- scan_layer_content(layer,layer_version)
+ # Only scan_layer_content if layer is local
+ if layer_data.get('local_source_dir', None):
+ # Scan the layer's content and update components
+ scan_layer_content(layer,layer_version)
except Layer_Version.DoesNotExist:
return error_response("layer-dep-not-found")
except Project.DoesNotExist:
return error_response("project-not-found")
- except KeyError:
- return error_response("incorrect-parameters")
+ except KeyError as e:
+ _log("KeyError: %s" % e)
+ return error_response(f"incorrect-parameters")
return JsonResponse({'error': "ok",
'imported_layer': {
diff --git a/bitbake/lib/toaster/toastergui/fixtures/toastergui-unittest-data.xml b/bitbake/lib/toaster/toastergui/fixtures/toastergui-unittest-data.xml
index 4517ed1765..f626572fd1 100644
--- a/bitbake/lib/toaster/toastergui/fixtures/toastergui-unittest-data.xml
+++ b/bitbake/lib/toaster/toastergui/fixtures/toastergui-unittest-data.xml
@@ -6,10 +6,22 @@
<field type="CharField" name="dirpath">b</field>
<field type="CharField" name="branch">a</field>
</object>
+ <object pk="1" model="orm.distro">
+ <field type="DateTimeField" name="up_date"><None></None></field>
+ <field to="orm.layer_version" name="layer_version" rel="ManyToOneRel">1</field>
+ <field type="CharField" name="name">poky_distro1</field>
+ <field type="CharField" name="description">poky_distro1 description</field>
+ </object>
+ <object pk="2" model="orm.distro">
+ <field type="DateTimeField" name="up_date"><None></None></field>
+ <field to="orm.layer_version" name="layer_version" rel="ManyToOneRel">2</field>
+ <field type="CharField" name="name">poky_distro2</field>
+ <field type="CharField" name="description">poky_distro2 description</field>
+ </object>
<object pk="1" model="orm.release">
- <field type="CharField" name="name">master</field>
+ <field type="CharField" name="name">foo_master</field>
<field type="CharField" name="description">master project</field>
- <field to="orm.bitbake_version" name="bitbake_version">1</field>
+ <field to="orm.bitbakeversion" name="bitbake_version">1</field>
</object>
<object pk="1" model="orm.project">
<field type="CharField" name="name">a test project</field>
@@ -34,12 +46,12 @@
<object pk="1" model="orm.ProjectVariable">
<field to="orm.project" name="project" rel="ManyToOneRel">1</field>
<field type="CharField" name="name">MACHINE</field>
- <field type="TextField" name="value">qemux86</field>
+ <field type="TextField" name="value">qemux86-64</field>
</object>
<object pk="2" model="orm.ProjectVariable">
<field to="orm.project" name="project" rel="ManyToOneRel">2</field>
<field type="CharField" name="name">MACHINE</field>
- <field type="TextField" name="value">qemux86</field>
+ <field type="TextField" name="value">qemux86-64</field>
</object>
<object pk="1" model="orm.build">
<field to="orm.project" name="project" rel="ManyToOneRel">1</field>
@@ -67,7 +79,7 @@
</object>
<object pk="3" model="orm.build">
<field to="orm.project" name="project" rel="ManyToOneRel">1</field>
- <field type="CharField" name="machine">qemux86</field>
+ <field type="CharField" name="machine">qemux86-64</field>
<field type="CharField" name="distro"></field>
<field type="CharField" name="distro_version"></field>
<field type="DateTimeField" name="started_on">2016-02-12T18:46:20.114530+00:00</field>
@@ -79,7 +91,7 @@
</object>
<object pk="4" model="orm.build">
<field to="orm.project" name="project" rel="ManyToOneRel">2</field>
- <field type="CharField" name="machine">qemux86</field>
+ <field type="CharField" name="machine">qemux86-64</field>
<field type="CharField" name="distro"></field>
<field type="CharField" name="distro_version"></field>
<field type="DateTimeField" name="started_on">2016-02-11T18:46:20.114530+00:00</field>
diff --git a/bitbake/lib/toaster/toastergui/forms.py b/bitbake/lib/toaster/toastergui/forms.py
new file mode 100644
index 0000000000..0f279e06c5
--- /dev/null
+++ b/bitbake/lib/toaster/toastergui/forms.py
@@ -0,0 +1,14 @@
+#!/usr/bin/env python3
+# -*- coding: utf-8 -*-
+# BitBake Toaster UI tests implementation
+#
+# Copyright (C) 2023 Savoir-faire Linux
+#
+# SPDX-License-Identifier: GPL-2.0-only
+#
+
+from django import forms
+from django.core.validators import FileExtensionValidator
+
+class LoadFileForm(forms.Form):
+ eventlog_file = forms.FileField(widget=forms.FileInput(attrs={'accept': '.json'}))
diff --git a/bitbake/lib/toaster/toastergui/static/css/default.css b/bitbake/lib/toaster/toastergui/static/css/default.css
index 5cd7e211a0..284355e70b 100644
--- a/bitbake/lib/toaster/toastergui/static/css/default.css
+++ b/bitbake/lib/toaster/toastergui/static/css/default.css
@@ -367,3 +367,31 @@ h2.panel-title { font-size: 30px; }
}
}
/* End copied in from newer version of Font-Awesome 4.3.0 */
+
+
+#overlay {
+ display: flex;
+ position: fixed;
+ top: 0;
+ left: 0;
+ width: 100%;
+ height: 100%;
+ background-color: rgba(0, 0, 0, 0.7);
+ align-items: center;
+ justify-content: center;
+ z-index: 999;
+}
+
+.spinner {
+ border: 6px solid rgba(255, 255, 255, 0.3);
+ border-radius: 50%;
+ border-top: 6px solid #3498db;
+ width: 50px;
+ height: 50px;
+ animation: spin 1s linear infinite;
+}
+
+@keyframes spin {
+ 0% { transform: rotate(0deg); }
+ 100% { transform: rotate(360deg); }
+}
diff --git a/bitbake/lib/toaster/toastergui/static/css/jquery.dataTables-1.13.8.min.css b/bitbake/lib/toaster/toastergui/static/css/jquery.dataTables-1.13.8.min.css
new file mode 100644
index 0000000000..c0a442ce07
--- /dev/null
+++ b/bitbake/lib/toaster/toastergui/static/css/jquery.dataTables-1.13.8.min.css
@@ -0,0 +1 @@
+:root{--dt-row-selected: 13, 110, 253;--dt-row-selected-text: 255, 255, 255;--dt-row-selected-link: 9, 10, 11;--dt-row-stripe: 0, 0, 0;--dt-row-hover: 0, 0, 0;--dt-column-ordering: 0, 0, 0;--dt-html-background: white}:root.dark{--dt-html-background: rgb(33, 37, 41)}table.dataTable td.dt-control{text-align:center;cursor:pointer}table.dataTable td.dt-control:before{display:inline-block;color:rgba(0, 0, 0, 0.5);content:"â–¶"}table.dataTable tr.dt-hasChild td.dt-control:before{content:"â–¼"}html.dark table.dataTable td.dt-control:before{color:rgba(255, 255, 255, 0.5)}html.dark table.dataTable tr.dt-hasChild td.dt-control:before{color:rgba(255, 255, 255, 0.5)}table.dataTable thead>tr>th.sorting,table.dataTable thead>tr>th.sorting_asc,table.dataTable thead>tr>th.sorting_desc,table.dataTable thead>tr>th.sorting_asc_disabled,table.dataTable thead>tr>th.sorting_desc_disabled,table.dataTable thead>tr>td.sorting,table.dataTable thead>tr>td.sorting_asc,table.dataTable thead>tr>td.sorting_desc,table.dataTable thead>tr>td.sorting_asc_disabled,table.dataTable thead>tr>td.sorting_desc_disabled{cursor:pointer;position:relative;padding-right:26px}table.dataTable thead>tr>th.sorting:before,table.dataTable thead>tr>th.sorting:after,table.dataTable thead>tr>th.sorting_asc:before,table.dataTable thead>tr>th.sorting_asc:after,table.dataTable thead>tr>th.sorting_desc:before,table.dataTable thead>tr>th.sorting_desc:after,table.dataTable thead>tr>th.sorting_asc_disabled:before,table.dataTable thead>tr>th.sorting_asc_disabled:after,table.dataTable thead>tr>th.sorting_desc_disabled:before,table.dataTable thead>tr>th.sorting_desc_disabled:after,table.dataTable thead>tr>td.sorting:before,table.dataTable thead>tr>td.sorting:after,table.dataTable thead>tr>td.sorting_asc:before,table.dataTable thead>tr>td.sorting_asc:after,table.dataTable thead>tr>td.sorting_desc:before,table.dataTable thead>tr>td.sorting_desc:after,table.dataTable thead>tr>td.sorting_asc_disabled:before,table.dataTable thead>tr>td.sorting_asc_disabled:after,table.dataTable thead>tr>td.sorting_desc_disabled:before,table.dataTable thead>tr>td.sorting_desc_disabled:after{position:absolute;display:block;opacity:.125;right:10px;line-height:9px;font-size:.8em}table.dataTable thead>tr>th.sorting:before,table.dataTable thead>tr>th.sorting_asc:before,table.dataTable thead>tr>th.sorting_desc:before,table.dataTable thead>tr>th.sorting_asc_disabled:before,table.dataTable thead>tr>th.sorting_desc_disabled:before,table.dataTable thead>tr>td.sorting:before,table.dataTable thead>tr>td.sorting_asc:before,table.dataTable thead>tr>td.sorting_desc:before,table.dataTable thead>tr>td.sorting_asc_disabled:before,table.dataTable thead>tr>td.sorting_desc_disabled:before{bottom:50%;content:"â–²";content:"â–²"/""}table.dataTable thead>tr>th.sorting:after,table.dataTable thead>tr>th.sorting_asc:after,table.dataTable thead>tr>th.sorting_desc:after,table.dataTable thead>tr>th.sorting_asc_disabled:after,table.dataTable thead>tr>th.sorting_desc_disabled:after,table.dataTable thead>tr>td.sorting:after,table.dataTable thead>tr>td.sorting_asc:after,table.dataTable thead>tr>td.sorting_desc:after,table.dataTable thead>tr>td.sorting_asc_disabled:after,table.dataTable thead>tr>td.sorting_desc_disabled:after{top:50%;content:"â–¼";content:"â–¼"/""}table.dataTable thead>tr>th.sorting_asc:before,table.dataTable thead>tr>th.sorting_desc:after,table.dataTable thead>tr>td.sorting_asc:before,table.dataTable thead>tr>td.sorting_desc:after{opacity:.6}table.dataTable thead>tr>th.sorting_desc_disabled:after,table.dataTable thead>tr>th.sorting_asc_disabled:before,table.dataTable thead>tr>td.sorting_desc_disabled:after,table.dataTable thead>tr>td.sorting_asc_disabled:before{display:none}table.dataTable thead>tr>th:active,table.dataTable thead>tr>td:active{outline:none}div.dataTables_scrollBody>table.dataTable>thead>tr>th:before,div.dataTables_scrollBody>table.dataTable>thead>tr>th:after,div.dataTables_scrollBody>table.dataTable>thead>tr>td:before,div.dataTables_scrollBody>table.dataTable>thead>tr>td:after{display:none}div.dataTables_processing{position:absolute;top:50%;left:50%;width:200px;margin-left:-100px;margin-top:-26px;text-align:center;padding:2px;z-index:10}div.dataTables_processing>div:last-child{position:relative;width:80px;height:15px;margin:1em auto}div.dataTables_processing>div:last-child>div{position:absolute;top:0;width:13px;height:13px;border-radius:50%;background:rgb(13, 110, 253);background:rgb(var(--dt-row-selected));animation-timing-function:cubic-bezier(0, 1, 1, 0)}div.dataTables_processing>div:last-child>div:nth-child(1){left:8px;animation:datatables-loader-1 .6s infinite}div.dataTables_processing>div:last-child>div:nth-child(2){left:8px;animation:datatables-loader-2 .6s infinite}div.dataTables_processing>div:last-child>div:nth-child(3){left:32px;animation:datatables-loader-2 .6s infinite}div.dataTables_processing>div:last-child>div:nth-child(4){left:56px;animation:datatables-loader-3 .6s infinite}@keyframes datatables-loader-1{0%{transform:scale(0)}100%{transform:scale(1)}}@keyframes datatables-loader-3{0%{transform:scale(1)}100%{transform:scale(0)}}@keyframes datatables-loader-2{0%{transform:translate(0, 0)}100%{transform:translate(24px, 0)}}table.dataTable.nowrap th,table.dataTable.nowrap td{white-space:nowrap}table.dataTable th.dt-left,table.dataTable td.dt-left{text-align:left}table.dataTable th.dt-center,table.dataTable td.dt-center,table.dataTable td.dataTables_empty{text-align:center}table.dataTable th.dt-right,table.dataTable td.dt-right{text-align:right}table.dataTable th.dt-justify,table.dataTable td.dt-justify{text-align:justify}table.dataTable th.dt-nowrap,table.dataTable td.dt-nowrap{white-space:nowrap}table.dataTable thead th,table.dataTable thead td,table.dataTable tfoot th,table.dataTable tfoot td{text-align:left}table.dataTable thead th.dt-head-left,table.dataTable thead td.dt-head-left,table.dataTable tfoot th.dt-head-left,table.dataTable tfoot td.dt-head-left{text-align:left}table.dataTable thead th.dt-head-center,table.dataTable thead td.dt-head-center,table.dataTable tfoot th.dt-head-center,table.dataTable tfoot td.dt-head-center{text-align:center}table.dataTable thead th.dt-head-right,table.dataTable thead td.dt-head-right,table.dataTable tfoot th.dt-head-right,table.dataTable tfoot td.dt-head-right{text-align:right}table.dataTable thead th.dt-head-justify,table.dataTable thead td.dt-head-justify,table.dataTable tfoot th.dt-head-justify,table.dataTable tfoot td.dt-head-justify{text-align:justify}table.dataTable thead th.dt-head-nowrap,table.dataTable thead td.dt-head-nowrap,table.dataTable tfoot th.dt-head-nowrap,table.dataTable tfoot td.dt-head-nowrap{white-space:nowrap}table.dataTable tbody th.dt-body-left,table.dataTable tbody td.dt-body-left{text-align:left}table.dataTable tbody th.dt-body-center,table.dataTable tbody td.dt-body-center{text-align:center}table.dataTable tbody th.dt-body-right,table.dataTable tbody td.dt-body-right{text-align:right}table.dataTable tbody th.dt-body-justify,table.dataTable tbody td.dt-body-justify{text-align:justify}table.dataTable tbody th.dt-body-nowrap,table.dataTable tbody td.dt-body-nowrap{white-space:nowrap}table.dataTable{width:100%;margin:0 auto;clear:both;border-collapse:separate;border-spacing:0}table.dataTable thead th,table.dataTable tfoot th{font-weight:bold}table.dataTable>thead>tr>th,table.dataTable>thead>tr>td{padding:10px;border-bottom:1px solid rgba(0, 0, 0, 0.3)}table.dataTable>thead>tr>th:active,table.dataTable>thead>tr>td:active{outline:none}table.dataTable>tfoot>tr>th,table.dataTable>tfoot>tr>td{padding:10px 10px 6px 10px;border-top:1px solid rgba(0, 0, 0, 0.3)}table.dataTable tbody tr{background-color:transparent}table.dataTable tbody tr.selected>*{box-shadow:inset 0 0 0 9999px rgba(13, 110, 253, 0.9);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-selected), 0.9);color:rgb(255, 255, 255);color:rgb(var(--dt-row-selected-text))}table.dataTable tbody tr.selected a{color:rgb(9, 10, 11);color:rgb(var(--dt-row-selected-link))}table.dataTable tbody th,table.dataTable tbody td{padding:8px 10px}table.dataTable.row-border>tbody>tr>th,table.dataTable.row-border>tbody>tr>td,table.dataTable.display>tbody>tr>th,table.dataTable.display>tbody>tr>td{border-top:1px solid rgba(0, 0, 0, 0.15)}table.dataTable.row-border>tbody>tr:first-child>th,table.dataTable.row-border>tbody>tr:first-child>td,table.dataTable.display>tbody>tr:first-child>th,table.dataTable.display>tbody>tr:first-child>td{border-top:none}table.dataTable.row-border>tbody>tr.selected+tr.selected>td,table.dataTable.display>tbody>tr.selected+tr.selected>td{border-top-color:#0262ef}table.dataTable.cell-border>tbody>tr>th,table.dataTable.cell-border>tbody>tr>td{border-top:1px solid rgba(0, 0, 0, 0.15);border-right:1px solid rgba(0, 0, 0, 0.15)}table.dataTable.cell-border>tbody>tr>th:first-child,table.dataTable.cell-border>tbody>tr>td:first-child{border-left:1px solid rgba(0, 0, 0, 0.15)}table.dataTable.cell-border>tbody>tr:first-child>th,table.dataTable.cell-border>tbody>tr:first-child>td{border-top:none}table.dataTable.stripe>tbody>tr.odd>*,table.dataTable.display>tbody>tr.odd>*{box-shadow:inset 0 0 0 9999px rgba(0, 0, 0, 0.023);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-stripe), 0.023)}table.dataTable.stripe>tbody>tr.odd.selected>*,table.dataTable.display>tbody>tr.odd.selected>*{box-shadow:inset 0 0 0 9999px rgba(13, 110, 253, 0.923);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-selected), 0.923)}table.dataTable.hover>tbody>tr:hover>*,table.dataTable.display>tbody>tr:hover>*{box-shadow:inset 0 0 0 9999px rgba(0, 0, 0, 0.035);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-hover), 0.035)}table.dataTable.hover>tbody>tr.selected:hover>*,table.dataTable.display>tbody>tr.selected:hover>*{box-shadow:inset 0 0 0 9999px #0d6efd !important;box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-selected), 1) !important}table.dataTable.order-column>tbody tr>.sorting_1,table.dataTable.order-column>tbody tr>.sorting_2,table.dataTable.order-column>tbody tr>.sorting_3,table.dataTable.display>tbody tr>.sorting_1,table.dataTable.display>tbody tr>.sorting_2,table.dataTable.display>tbody tr>.sorting_3{box-shadow:inset 0 0 0 9999px rgba(0, 0, 0, 0.019);box-shadow:inset 0 0 0 9999px rgba(var(--dt-column-ordering), 0.019)}table.dataTable.order-column>tbody tr.selected>.sorting_1,table.dataTable.order-column>tbody tr.selected>.sorting_2,table.dataTable.order-column>tbody tr.selected>.sorting_3,table.dataTable.display>tbody tr.selected>.sorting_1,table.dataTable.display>tbody tr.selected>.sorting_2,table.dataTable.display>tbody tr.selected>.sorting_3{box-shadow:inset 0 0 0 9999px rgba(13, 110, 253, 0.919);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-selected), 0.919)}table.dataTable.display>tbody>tr.odd>.sorting_1,table.dataTable.order-column.stripe>tbody>tr.odd>.sorting_1{box-shadow:inset 0 0 0 9999px rgba(0, 0, 0, 0.054);box-shadow:inset 0 0 0 9999px rgba(var(--dt-column-ordering), 0.054)}table.dataTable.display>tbody>tr.odd>.sorting_2,table.dataTable.order-column.stripe>tbody>tr.odd>.sorting_2{box-shadow:inset 0 0 0 9999px rgba(0, 0, 0, 0.047);box-shadow:inset 0 0 0 9999px rgba(var(--dt-column-ordering), 0.047)}table.dataTable.display>tbody>tr.odd>.sorting_3,table.dataTable.order-column.stripe>tbody>tr.odd>.sorting_3{box-shadow:inset 0 0 0 9999px rgba(0, 0, 0, 0.039);box-shadow:inset 0 0 0 9999px rgba(var(--dt-column-ordering), 0.039)}table.dataTable.display>tbody>tr.odd.selected>.sorting_1,table.dataTable.order-column.stripe>tbody>tr.odd.selected>.sorting_1{box-shadow:inset 0 0 0 9999px rgba(13, 110, 253, 0.954);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-selected), 0.954)}table.dataTable.display>tbody>tr.odd.selected>.sorting_2,table.dataTable.order-column.stripe>tbody>tr.odd.selected>.sorting_2{box-shadow:inset 0 0 0 9999px rgba(13, 110, 253, 0.947);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-selected), 0.947)}table.dataTable.display>tbody>tr.odd.selected>.sorting_3,table.dataTable.order-column.stripe>tbody>tr.odd.selected>.sorting_3{box-shadow:inset 0 0 0 9999px rgba(13, 110, 253, 0.939);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-selected), 0.939)}table.dataTable.display>tbody>tr.even>.sorting_1,table.dataTable.order-column.stripe>tbody>tr.even>.sorting_1{box-shadow:inset 0 0 0 9999px rgba(0, 0, 0, 0.019);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-selected), 0.019)}table.dataTable.display>tbody>tr.even>.sorting_2,table.dataTable.order-column.stripe>tbody>tr.even>.sorting_2{box-shadow:inset 0 0 0 9999px rgba(0, 0, 0, 0.011);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-selected), 0.011)}table.dataTable.display>tbody>tr.even>.sorting_3,table.dataTable.order-column.stripe>tbody>tr.even>.sorting_3{box-shadow:inset 0 0 0 9999px rgba(0, 0, 0, 0.003);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-selected), 0.003)}table.dataTable.display>tbody>tr.even.selected>.sorting_1,table.dataTable.order-column.stripe>tbody>tr.even.selected>.sorting_1{box-shadow:inset 0 0 0 9999px rgba(13, 110, 253, 0.919);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-selected), 0.919)}table.dataTable.display>tbody>tr.even.selected>.sorting_2,table.dataTable.order-column.stripe>tbody>tr.even.selected>.sorting_2{box-shadow:inset 0 0 0 9999px rgba(13, 110, 253, 0.911);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-selected), 0.911)}table.dataTable.display>tbody>tr.even.selected>.sorting_3,table.dataTable.order-column.stripe>tbody>tr.even.selected>.sorting_3{box-shadow:inset 0 0 0 9999px rgba(13, 110, 253, 0.903);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-selected), 0.903)}table.dataTable.display tbody tr:hover>.sorting_1,table.dataTable.order-column.hover tbody tr:hover>.sorting_1{box-shadow:inset 0 0 0 9999px rgba(0, 0, 0, 0.082);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-hover), 0.082)}table.dataTable.display tbody tr:hover>.sorting_2,table.dataTable.order-column.hover tbody tr:hover>.sorting_2{box-shadow:inset 0 0 0 9999px rgba(0, 0, 0, 0.074);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-hover), 0.074)}table.dataTable.display tbody tr:hover>.sorting_3,table.dataTable.order-column.hover tbody tr:hover>.sorting_3{box-shadow:inset 0 0 0 9999px rgba(0, 0, 0, 0.062);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-hover), 0.062)}table.dataTable.display tbody tr:hover.selected>.sorting_1,table.dataTable.order-column.hover tbody tr:hover.selected>.sorting_1{box-shadow:inset 0 0 0 9999px rgba(13, 110, 253, 0.982);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-selected), 0.982)}table.dataTable.display tbody tr:hover.selected>.sorting_2,table.dataTable.order-column.hover tbody tr:hover.selected>.sorting_2{box-shadow:inset 0 0 0 9999px rgba(13, 110, 253, 0.974);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-selected), 0.974)}table.dataTable.display tbody tr:hover.selected>.sorting_3,table.dataTable.order-column.hover tbody tr:hover.selected>.sorting_3{box-shadow:inset 0 0 0 9999px rgba(13, 110, 253, 0.962);box-shadow:inset 0 0 0 9999px rgba(var(--dt-row-selected), 0.962)}table.dataTable.no-footer{border-bottom:1px solid rgba(0, 0, 0, 0.3)}table.dataTable.compact thead th,table.dataTable.compact thead td,table.dataTable.compact tfoot th,table.dataTable.compact tfoot td,table.dataTable.compact tbody th,table.dataTable.compact tbody td{padding:4px}table.dataTable th,table.dataTable td{box-sizing:content-box}.dataTables_wrapper{position:relative;clear:both}.dataTables_wrapper .dataTables_length{float:left}.dataTables_wrapper .dataTables_length select{border:1px solid #aaa;border-radius:3px;padding:5px;background-color:transparent;color:inherit;padding:4px}.dataTables_wrapper .dataTables_filter{float:right;text-align:right}.dataTables_wrapper .dataTables_filter input{border:1px solid #aaa;border-radius:3px;padding:5px;background-color:transparent;color:inherit;margin-left:3px}.dataTables_wrapper .dataTables_info{clear:both;float:left;padding-top:.755em}.dataTables_wrapper .dataTables_paginate{float:right;text-align:right;padding-top:.25em}.dataTables_wrapper .dataTables_paginate .paginate_button{box-sizing:border-box;display:inline-block;min-width:1.5em;padding:.5em 1em;margin-left:2px;text-align:center;text-decoration:none !important;cursor:pointer;color:inherit !important;border:1px solid transparent;border-radius:2px;background:transparent}.dataTables_wrapper .dataTables_paginate .paginate_button.current,.dataTables_wrapper .dataTables_paginate .paginate_button.current:hover{color:inherit !important;border:1px solid rgba(0, 0, 0, 0.3);background-color:rgba(0, 0, 0, 0.05);background:-webkit-gradient(linear, left top, left bottom, color-stop(0%, rgba(230, 230, 230, 0.05)), color-stop(100%, rgba(0, 0, 0, 0.05)));background:-webkit-linear-gradient(top, rgba(230, 230, 230, 0.05) 0%, rgba(0, 0, 0, 0.05) 100%);background:-moz-linear-gradient(top, rgba(230, 230, 230, 0.05) 0%, rgba(0, 0, 0, 0.05) 100%);background:-ms-linear-gradient(top, rgba(230, 230, 230, 0.05) 0%, rgba(0, 0, 0, 0.05) 100%);background:-o-linear-gradient(top, rgba(230, 230, 230, 0.05) 0%, rgba(0, 0, 0, 0.05) 100%);background:linear-gradient(to bottom, rgba(230, 230, 230, 0.05) 0%, rgba(0, 0, 0, 0.05) 100%)}.dataTables_wrapper .dataTables_paginate .paginate_button.disabled,.dataTables_wrapper .dataTables_paginate .paginate_button.disabled:hover,.dataTables_wrapper .dataTables_paginate .paginate_button.disabled:active{cursor:default;color:#666 !important;border:1px solid transparent;background:transparent;box-shadow:none}.dataTables_wrapper .dataTables_paginate .paginate_button:hover{color:white !important;border:1px solid #111;background-color:#111;background:-webkit-gradient(linear, left top, left bottom, color-stop(0%, #585858), color-stop(100%, #111));background:-webkit-linear-gradient(top, #585858 0%, #111 100%);background:-moz-linear-gradient(top, #585858 0%, #111 100%);background:-ms-linear-gradient(top, #585858 0%, #111 100%);background:-o-linear-gradient(top, #585858 0%, #111 100%);background:linear-gradient(to bottom, #585858 0%, #111 100%)}.dataTables_wrapper .dataTables_paginate .paginate_button:active{outline:none;background-color:#0c0c0c;background:-webkit-gradient(linear, left top, left bottom, color-stop(0%, #2b2b2b), color-stop(100%, #0c0c0c));background:-webkit-linear-gradient(top, #2b2b2b 0%, #0c0c0c 100%);background:-moz-linear-gradient(top, #2b2b2b 0%, #0c0c0c 100%);background:-ms-linear-gradient(top, #2b2b2b 0%, #0c0c0c 100%);background:-o-linear-gradient(top, #2b2b2b 0%, #0c0c0c 100%);background:linear-gradient(to bottom, #2b2b2b 0%, #0c0c0c 100%);box-shadow:inset 0 0 3px #111}.dataTables_wrapper .dataTables_paginate .ellipsis{padding:0 1em}.dataTables_wrapper .dataTables_length,.dataTables_wrapper .dataTables_filter,.dataTables_wrapper .dataTables_info,.dataTables_wrapper .dataTables_processing,.dataTables_wrapper .dataTables_paginate{color:inherit}.dataTables_wrapper .dataTables_scroll{clear:both}.dataTables_wrapper .dataTables_scroll div.dataTables_scrollBody{-webkit-overflow-scrolling:touch}.dataTables_wrapper .dataTables_scroll div.dataTables_scrollBody>table>thead>tr>th,.dataTables_wrapper .dataTables_scroll div.dataTables_scrollBody>table>thead>tr>td,.dataTables_wrapper .dataTables_scroll div.dataTables_scrollBody>table>tbody>tr>th,.dataTables_wrapper .dataTables_scroll div.dataTables_scrollBody>table>tbody>tr>td{vertical-align:middle}.dataTables_wrapper .dataTables_scroll div.dataTables_scrollBody>table>thead>tr>th>div.dataTables_sizing,.dataTables_wrapper .dataTables_scroll div.dataTables_scrollBody>table>thead>tr>td>div.dataTables_sizing,.dataTables_wrapper .dataTables_scroll div.dataTables_scrollBody>table>tbody>tr>th>div.dataTables_sizing,.dataTables_wrapper .dataTables_scroll div.dataTables_scrollBody>table>tbody>tr>td>div.dataTables_sizing{height:0;overflow:hidden;margin:0 !important;padding:0 !important}.dataTables_wrapper.no-footer .dataTables_scrollBody{border-bottom:1px solid rgba(0, 0, 0, 0.3)}.dataTables_wrapper.no-footer div.dataTables_scrollHead table.dataTable,.dataTables_wrapper.no-footer div.dataTables_scrollBody>table{border-bottom:none}.dataTables_wrapper:after{visibility:hidden;display:block;content:"";clear:both;height:0}@media screen and (max-width: 767px){.dataTables_wrapper .dataTables_info,.dataTables_wrapper .dataTables_paginate{float:none;text-align:center}.dataTables_wrapper .dataTables_paginate{margin-top:.5em}}@media screen and (max-width: 640px){.dataTables_wrapper .dataTables_length,.dataTables_wrapper .dataTables_filter{float:none;text-align:center}.dataTables_wrapper .dataTables_filter{margin-top:.5em}}html.dark{--dt-row-hover: 255, 255, 255;--dt-row-stripe: 255, 255, 255;--dt-column-ordering: 255, 255, 255}html.dark table.dataTable>thead>tr>th,html.dark table.dataTable>thead>tr>td{border-bottom:1px solid rgb(89, 91, 94)}html.dark table.dataTable>thead>tr>th:active,html.dark table.dataTable>thead>tr>td:active{outline:none}html.dark table.dataTable>tfoot>tr>th,html.dark table.dataTable>tfoot>tr>td{border-top:1px solid rgb(89, 91, 94)}html.dark table.dataTable.row-border>tbody>tr>th,html.dark table.dataTable.row-border>tbody>tr>td,html.dark table.dataTable.display>tbody>tr>th,html.dark table.dataTable.display>tbody>tr>td{border-top:1px solid rgb(64, 67, 70)}html.dark table.dataTable.row-border>tbody>tr.selected+tr.selected>td,html.dark table.dataTable.display>tbody>tr.selected+tr.selected>td{border-top-color:#0257d5}html.dark table.dataTable.cell-border>tbody>tr>th,html.dark table.dataTable.cell-border>tbody>tr>td{border-top:1px solid rgb(64, 67, 70);border-right:1px solid rgb(64, 67, 70)}html.dark table.dataTable.cell-border>tbody>tr>th:first-child,html.dark table.dataTable.cell-border>tbody>tr>td:first-child{border-left:1px solid rgb(64, 67, 70)}html.dark .dataTables_wrapper .dataTables_filter input,html.dark .dataTables_wrapper .dataTables_length select{border:1px solid rgba(255, 255, 255, 0.2);background-color:var(--dt-html-background)}html.dark .dataTables_wrapper .dataTables_paginate .paginate_button.current,html.dark .dataTables_wrapper .dataTables_paginate .paginate_button.current:hover{border:1px solid rgb(89, 91, 94);background:rgba(255, 255, 255, 0.15)}html.dark .dataTables_wrapper .dataTables_paginate .paginate_button.disabled,html.dark .dataTables_wrapper .dataTables_paginate .paginate_button.disabled:hover,html.dark .dataTables_wrapper .dataTables_paginate .paginate_button.disabled:active{color:#666 !important}html.dark .dataTables_wrapper .dataTables_paginate .paginate_button:hover{border:1px solid rgb(53, 53, 53);background:rgb(53, 53, 53)}html.dark .dataTables_wrapper .dataTables_paginate .paginate_button:active{background:#3a3a3a}
diff --git a/bitbake/lib/toaster/toastergui/static/js/bootstrap.js b/bitbake/lib/toaster/toastergui/static/js/bootstrap-3.4.1.js
index d47d640feb..170bd608f7 100644
--- a/bitbake/lib/toaster/toastergui/static/js/bootstrap.js
+++ b/bitbake/lib/toaster/toastergui/static/js/bootstrap-3.4.1.js
@@ -1,6 +1,6 @@
/*!
- * Bootstrap v3.3.6 (http://getbootstrap.com)
- * Copyright 2011-2016 Twitter, Inc.
+ * Bootstrap v3.4.1 (https://getbootstrap.com/)
+ * Copyright 2011-2019 Twitter, Inc.
* Licensed under the MIT license
*/
@@ -11,16 +11,16 @@ if (typeof jQuery === 'undefined') {
+function ($) {
'use strict';
var version = $.fn.jquery.split(' ')[0].split('.')
- if ((version[0] < 2 && version[1] < 9) || (version[0] == 1 && version[1] == 9 && version[2] < 1) || (version[0] > 2)) {
- throw new Error('Bootstrap\'s JavaScript requires jQuery version 1.9.1 or higher, but lower than version 3')
+ if ((version[0] < 2 && version[1] < 9) || (version[0] == 1 && version[1] == 9 && version[2] < 1) || (version[0] > 3)) {
+ throw new Error('Bootstrap\'s JavaScript requires jQuery version 1.9.1 or higher, but lower than version 4')
}
}(jQuery);
/* ========================================================================
- * Bootstrap: transition.js v3.3.6
- * http://getbootstrap.com/javascript/#transitions
+ * Bootstrap: transition.js v3.4.1
+ * https://getbootstrap.com/docs/3.4/javascript/#transitions
* ========================================================================
- * Copyright 2011-2015 Twitter, Inc.
+ * Copyright 2011-2019 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
@@ -28,7 +28,7 @@ if (typeof jQuery === 'undefined') {
+function ($) {
'use strict';
- // CSS TRANSITION SUPPORT (Shoutout: http://www.modernizr.com/)
+ // CSS TRANSITION SUPPORT (Shoutout: https://modernizr.com/)
// ============================================================
function transitionEnd() {
@@ -50,7 +50,7 @@ if (typeof jQuery === 'undefined') {
return false // explicit for ie8 ( ._.)
}
- // http://blog.alexmaccaw.com/css-transitions
+ // https://blog.alexmaccaw.com/css-transitions
$.fn.emulateTransitionEnd = function (duration) {
var called = false
var $el = this
@@ -77,10 +77,10 @@ if (typeof jQuery === 'undefined') {
}(jQuery);
/* ========================================================================
- * Bootstrap: alert.js v3.3.6
- * http://getbootstrap.com/javascript/#alerts
+ * Bootstrap: alert.js v3.4.1
+ * https://getbootstrap.com/docs/3.4/javascript/#alerts
* ========================================================================
- * Copyright 2011-2015 Twitter, Inc.
+ * Copyright 2011-2019 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
@@ -96,7 +96,7 @@ if (typeof jQuery === 'undefined') {
$(el).on('click', dismiss, this.close)
}
- Alert.VERSION = '3.3.6'
+ Alert.VERSION = '3.4.1'
Alert.TRANSITION_DURATION = 150
@@ -109,7 +109,8 @@ if (typeof jQuery === 'undefined') {
selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') // strip for ie7
}
- var $parent = $(selector)
+ selector = selector === '#' ? [] : selector
+ var $parent = $(document).find(selector)
if (e) e.preventDefault()
@@ -172,10 +173,10 @@ if (typeof jQuery === 'undefined') {
}(jQuery);
/* ========================================================================
- * Bootstrap: button.js v3.3.6
- * http://getbootstrap.com/javascript/#buttons
+ * Bootstrap: button.js v3.4.1
+ * https://getbootstrap.com/docs/3.4/javascript/#buttons
* ========================================================================
- * Copyright 2011-2015 Twitter, Inc.
+ * Copyright 2011-2019 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
@@ -192,7 +193,7 @@ if (typeof jQuery === 'undefined') {
this.isLoading = false
}
- Button.VERSION = '3.3.6'
+ Button.VERSION = '3.4.1'
Button.DEFAULTS = {
loadingText: 'loading...'
@@ -214,10 +215,10 @@ if (typeof jQuery === 'undefined') {
if (state == 'loadingText') {
this.isLoading = true
- $el.addClass(d).attr(d, d)
+ $el.addClass(d).attr(d, d).prop(d, true)
} else if (this.isLoading) {
this.isLoading = false
- $el.removeClass(d).removeAttr(d)
+ $el.removeClass(d).removeAttr(d).prop(d, false)
}
}, this), 0)
}
@@ -281,10 +282,15 @@ if (typeof jQuery === 'undefined') {
$(document)
.on('click.bs.button.data-api', '[data-toggle^="button"]', function (e) {
- var $btn = $(e.target)
- if (!$btn.hasClass('btn')) $btn = $btn.closest('.btn')
+ var $btn = $(e.target).closest('.btn')
Plugin.call($btn, 'toggle')
- if (!($(e.target).is('input[type="radio"]') || $(e.target).is('input[type="checkbox"]'))) e.preventDefault()
+ if (!($(e.target).is('input[type="radio"], input[type="checkbox"]'))) {
+ // Prevent double click on radios, and the double selections (so cancellation) on checkboxes
+ e.preventDefault()
+ // The target component still receive the focus
+ if ($btn.is('input,button')) $btn.trigger('focus')
+ else $btn.find('input:visible,button:visible').first().trigger('focus')
+ }
})
.on('focus.bs.button.data-api blur.bs.button.data-api', '[data-toggle^="button"]', function (e) {
$(e.target).closest('.btn').toggleClass('focus', /^focus(in)?$/.test(e.type))
@@ -293,10 +299,10 @@ if (typeof jQuery === 'undefined') {
}(jQuery);
/* ========================================================================
- * Bootstrap: carousel.js v3.3.6
- * http://getbootstrap.com/javascript/#carousel
+ * Bootstrap: carousel.js v3.4.1
+ * https://getbootstrap.com/docs/3.4/javascript/#carousel
* ========================================================================
- * Copyright 2011-2015 Twitter, Inc.
+ * Copyright 2011-2019 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
@@ -324,7 +330,7 @@ if (typeof jQuery === 'undefined') {
.on('mouseleave.bs.carousel', $.proxy(this.cycle, this))
}
- Carousel.VERSION = '3.3.6'
+ Carousel.VERSION = '3.4.1'
Carousel.TRANSITION_DURATION = 600
@@ -438,7 +444,9 @@ if (typeof jQuery === 'undefined') {
var slidEvent = $.Event('slid.bs.carousel', { relatedTarget: relatedTarget, direction: direction }) // yes, "slid"
if ($.support.transition && this.$element.hasClass('slide')) {
$next.addClass(type)
- $next[0].offsetWidth // force reflow
+ if (typeof $next === 'object' && $next.length) {
+ $next[0].offsetWidth // force reflow
+ }
$active.addClass(direction)
$next.addClass(direction)
$active
@@ -500,10 +508,17 @@ if (typeof jQuery === 'undefined') {
// =================
var clickHandler = function (e) {
- var href
var $this = $(this)
- var $target = $($this.attr('data-target') || (href = $this.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '')) // strip for ie7
+ var href = $this.attr('href')
+ if (href) {
+ href = href.replace(/.*(?=#[^\s]+$)/, '') // strip for ie7
+ }
+
+ var target = $this.attr('data-target') || href
+ var $target = $(document).find(target)
+
if (!$target.hasClass('carousel')) return
+
var options = $.extend({}, $target.data(), $this.data())
var slideIndex = $this.attr('data-slide-to')
if (slideIndex) options.interval = false
@@ -531,13 +546,14 @@ if (typeof jQuery === 'undefined') {
}(jQuery);
/* ========================================================================
- * Bootstrap: collapse.js v3.3.6
- * http://getbootstrap.com/javascript/#collapse
+ * Bootstrap: collapse.js v3.4.1
+ * https://getbootstrap.com/docs/3.4/javascript/#collapse
* ========================================================================
- * Copyright 2011-2015 Twitter, Inc.
+ * Copyright 2011-2019 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
+/* jshint latedef: false */
+function ($) {
'use strict';
@@ -561,7 +577,7 @@ if (typeof jQuery === 'undefined') {
if (this.options.toggle) this.toggle()
}
- Collapse.VERSION = '3.3.6'
+ Collapse.VERSION = '3.4.1'
Collapse.TRANSITION_DURATION = 350
@@ -668,7 +684,7 @@ if (typeof jQuery === 'undefined') {
}
Collapse.prototype.getParent = function () {
- return $(this.options.parent)
+ return $(document).find(this.options.parent)
.find('[data-toggle="collapse"][data-parent="' + this.options.parent + '"]')
.each($.proxy(function (i, element) {
var $element = $(element)
@@ -691,7 +707,7 @@ if (typeof jQuery === 'undefined') {
var target = $trigger.attr('data-target')
|| (href = $trigger.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '') // strip for ie7
- return $(target)
+ return $(document).find(target)
}
@@ -743,10 +759,10 @@ if (typeof jQuery === 'undefined') {
}(jQuery);
/* ========================================================================
- * Bootstrap: dropdown.js v3.3.6
- * http://getbootstrap.com/javascript/#dropdowns
+ * Bootstrap: dropdown.js v3.4.1
+ * https://getbootstrap.com/docs/3.4/javascript/#dropdowns
* ========================================================================
- * Copyright 2011-2015 Twitter, Inc.
+ * Copyright 2011-2019 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
@@ -763,7 +779,7 @@ if (typeof jQuery === 'undefined') {
$(element).on('click.bs.dropdown', this.toggle)
}
- Dropdown.VERSION = '3.3.6'
+ Dropdown.VERSION = '3.4.1'
function getParent($this) {
var selector = $this.attr('data-target')
@@ -773,7 +789,7 @@ if (typeof jQuery === 'undefined') {
selector = selector && /#[A-Za-z]/.test(selector) && selector.replace(/.*(?=#[^\s]*$)/, '') // strip for ie7
}
- var $parent = selector && $(selector)
+ var $parent = selector !== '#' ? $(document).find(selector) : null
return $parent && $parent.length ? $parent : $this.parent()
}
@@ -909,10 +925,10 @@ if (typeof jQuery === 'undefined') {
}(jQuery);
/* ========================================================================
- * Bootstrap: modal.js v3.3.6
- * http://getbootstrap.com/javascript/#modals
+ * Bootstrap: modal.js v3.4.1
+ * https://getbootstrap.com/docs/3.4/javascript/#modals
* ========================================================================
- * Copyright 2011-2015 Twitter, Inc.
+ * Copyright 2011-2019 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
@@ -924,15 +940,16 @@ if (typeof jQuery === 'undefined') {
// ======================
var Modal = function (element, options) {
- this.options = options
- this.$body = $(document.body)
- this.$element = $(element)
- this.$dialog = this.$element.find('.modal-dialog')
- this.$backdrop = null
- this.isShown = null
- this.originalBodyPad = null
- this.scrollbarWidth = 0
+ this.options = options
+ this.$body = $(document.body)
+ this.$element = $(element)
+ this.$dialog = this.$element.find('.modal-dialog')
+ this.$backdrop = null
+ this.isShown = null
+ this.originalBodyPad = null
+ this.scrollbarWidth = 0
this.ignoreBackdropClick = false
+ this.fixedContent = '.navbar-fixed-top, .navbar-fixed-bottom'
if (this.options.remote) {
this.$element
@@ -943,7 +960,7 @@ if (typeof jQuery === 'undefined') {
}
}
- Modal.VERSION = '3.3.6'
+ Modal.VERSION = '3.4.1'
Modal.TRANSITION_DURATION = 300
Modal.BACKDROP_TRANSITION_DURATION = 150
@@ -960,7 +977,7 @@ if (typeof jQuery === 'undefined') {
Modal.prototype.show = function (_relatedTarget) {
var that = this
- var e = $.Event('show.bs.modal', { relatedTarget: _relatedTarget })
+ var e = $.Event('show.bs.modal', { relatedTarget: _relatedTarget })
this.$element.trigger(e)
@@ -1050,7 +1067,9 @@ if (typeof jQuery === 'undefined') {
$(document)
.off('focusin.bs.modal') // guard against infinite focus loop
.on('focusin.bs.modal', $.proxy(function (e) {
- if (this.$element[0] !== e.target && !this.$element.has(e.target).length) {
+ if (document !== e.target &&
+ this.$element[0] !== e.target &&
+ !this.$element.has(e.target).length) {
this.$element.trigger('focus')
}
}, this))
@@ -1152,7 +1171,7 @@ if (typeof jQuery === 'undefined') {
var modalIsOverflowing = this.$element[0].scrollHeight > document.documentElement.clientHeight
this.$element.css({
- paddingLeft: !this.bodyIsOverflowing && modalIsOverflowing ? this.scrollbarWidth : '',
+ paddingLeft: !this.bodyIsOverflowing && modalIsOverflowing ? this.scrollbarWidth : '',
paddingRight: this.bodyIsOverflowing && !modalIsOverflowing ? this.scrollbarWidth : ''
})
}
@@ -1177,11 +1196,26 @@ if (typeof jQuery === 'undefined') {
Modal.prototype.setScrollbar = function () {
var bodyPad = parseInt((this.$body.css('padding-right') || 0), 10)
this.originalBodyPad = document.body.style.paddingRight || ''
- if (this.bodyIsOverflowing) this.$body.css('padding-right', bodyPad + this.scrollbarWidth)
+ var scrollbarWidth = this.scrollbarWidth
+ if (this.bodyIsOverflowing) {
+ this.$body.css('padding-right', bodyPad + scrollbarWidth)
+ $(this.fixedContent).each(function (index, element) {
+ var actualPadding = element.style.paddingRight
+ var calculatedPadding = $(element).css('padding-right')
+ $(element)
+ .data('padding-right', actualPadding)
+ .css('padding-right', parseFloat(calculatedPadding) + scrollbarWidth + 'px')
+ })
+ }
}
Modal.prototype.resetScrollbar = function () {
this.$body.css('padding-right', this.originalBodyPad)
+ $(this.fixedContent).each(function (index, element) {
+ var padding = $(element).data('padding-right')
+ $(element).removeData('padding-right')
+ element.style.paddingRight = padding ? padding : ''
+ })
}
Modal.prototype.measureScrollbar = function () { // thx walsh
@@ -1199,8 +1233,8 @@ if (typeof jQuery === 'undefined') {
function Plugin(option, _relatedTarget) {
return this.each(function () {
- var $this = $(this)
- var data = $this.data('bs.modal')
+ var $this = $(this)
+ var data = $this.data('bs.modal')
var options = $.extend({}, Modal.DEFAULTS, $this.data(), typeof option == 'object' && option)
if (!data) $this.data('bs.modal', (data = new Modal(this, options)))
@@ -1211,7 +1245,7 @@ if (typeof jQuery === 'undefined') {
var old = $.fn.modal
- $.fn.modal = Plugin
+ $.fn.modal = Plugin
$.fn.modal.Constructor = Modal
@@ -1228,10 +1262,13 @@ if (typeof jQuery === 'undefined') {
// ==============
$(document).on('click.bs.modal.data-api', '[data-toggle="modal"]', function (e) {
- var $this = $(this)
- var href = $this.attr('href')
- var $target = $($this.attr('data-target') || (href && href.replace(/.*(?=#[^\s]+$)/, ''))) // strip for ie7
- var option = $target.data('bs.modal') ? 'toggle' : $.extend({ remote: !/#/.test(href) && href }, $target.data(), $this.data())
+ var $this = $(this)
+ var href = $this.attr('href')
+ var target = $this.attr('data-target') ||
+ (href && href.replace(/.*(?=#[^\s]+$)/, '')) // strip for ie7
+
+ var $target = $(document).find(target)
+ var option = $target.data('bs.modal') ? 'toggle' : $.extend({ remote: !/#/.test(href) && href }, $target.data(), $this.data())
if ($this.is('a')) e.preventDefault()
@@ -1247,18 +1284,148 @@ if (typeof jQuery === 'undefined') {
}(jQuery);
/* ========================================================================
- * Bootstrap: tooltip.js v3.3.6
- * http://getbootstrap.com/javascript/#tooltip
+ * Bootstrap: tooltip.js v3.4.1
+ * https://getbootstrap.com/docs/3.4/javascript/#tooltip
* Inspired by the original jQuery.tipsy by Jason Frame
* ========================================================================
- * Copyright 2011-2015 Twitter, Inc.
+ * Copyright 2011-2019 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
-
+function ($) {
'use strict';
+ var DISALLOWED_ATTRIBUTES = ['sanitize', 'whiteList', 'sanitizeFn']
+
+ var uriAttrs = [
+ 'background',
+ 'cite',
+ 'href',
+ 'itemtype',
+ 'longdesc',
+ 'poster',
+ 'src',
+ 'xlink:href'
+ ]
+
+ var ARIA_ATTRIBUTE_PATTERN = /^aria-[\w-]*$/i
+
+ var DefaultWhitelist = {
+ // Global attributes allowed on any supplied element below.
+ '*': ['class', 'dir', 'id', 'lang', 'role', ARIA_ATTRIBUTE_PATTERN],
+ a: ['target', 'href', 'title', 'rel'],
+ area: [],
+ b: [],
+ br: [],
+ col: [],
+ code: [],
+ div: [],
+ em: [],
+ hr: [],
+ h1: [],
+ h2: [],
+ h3: [],
+ h4: [],
+ h5: [],
+ h6: [],
+ i: [],
+ img: ['src', 'alt', 'title', 'width', 'height'],
+ li: [],
+ ol: [],
+ p: [],
+ pre: [],
+ s: [],
+ small: [],
+ span: [],
+ sub: [],
+ sup: [],
+ strong: [],
+ u: [],
+ ul: []
+ }
+
+ /**
+ * A pattern that recognizes a commonly useful subset of URLs that are safe.
+ *
+ * Shoutout to Angular 7 https://github.com/angular/angular/blob/7.2.4/packages/core/src/sanitization/url_sanitizer.ts
+ */
+ var SAFE_URL_PATTERN = /^(?:(?:https?|mailto|ftp|tel|file):|[^&:/?#]*(?:[/?#]|$))/gi
+
+ /**
+ * A pattern that matches safe data URLs. Only matches image, video and audio types.
+ *
+ * Shoutout to Angular 7 https://github.com/angular/angular/blob/7.2.4/packages/core/src/sanitization/url_sanitizer.ts
+ */
+ var DATA_URL_PATTERN = /^data:(?:image\/(?:bmp|gif|jpeg|jpg|png|tiff|webp)|video\/(?:mpeg|mp4|ogg|webm)|audio\/(?:mp3|oga|ogg|opus));base64,[a-z0-9+/]+=*$/i
+
+ function allowedAttribute(attr, allowedAttributeList) {
+ var attrName = attr.nodeName.toLowerCase()
+
+ if ($.inArray(attrName, allowedAttributeList) !== -1) {
+ if ($.inArray(attrName, uriAttrs) !== -1) {
+ return Boolean(attr.nodeValue.match(SAFE_URL_PATTERN) || attr.nodeValue.match(DATA_URL_PATTERN))
+ }
+
+ return true
+ }
+
+ var regExp = $(allowedAttributeList).filter(function (index, value) {
+ return value instanceof RegExp
+ })
+
+ // Check if a regular expression validates the attribute.
+ for (var i = 0, l = regExp.length; i < l; i++) {
+ if (attrName.match(regExp[i])) {
+ return true
+ }
+ }
+
+ return false
+ }
+
+ function sanitizeHtml(unsafeHtml, whiteList, sanitizeFn) {
+ if (unsafeHtml.length === 0) {
+ return unsafeHtml
+ }
+
+ if (sanitizeFn && typeof sanitizeFn === 'function') {
+ return sanitizeFn(unsafeHtml)
+ }
+
+ // IE 8 and below don't support createHTMLDocument
+ if (!document.implementation || !document.implementation.createHTMLDocument) {
+ return unsafeHtml
+ }
+
+ var createdDocument = document.implementation.createHTMLDocument('sanitization')
+ createdDocument.body.innerHTML = unsafeHtml
+
+ var whitelistKeys = $.map(whiteList, function (el, i) { return i })
+ var elements = $(createdDocument.body).find('*')
+
+ for (var i = 0, len = elements.length; i < len; i++) {
+ var el = elements[i]
+ var elName = el.nodeName.toLowerCase()
+
+ if ($.inArray(elName, whitelistKeys) === -1) {
+ el.parentNode.removeChild(el)
+
+ continue
+ }
+
+ var attributeList = $.map(el.attributes, function (el) { return el })
+ var whitelistedAttributes = [].concat(whiteList['*'] || [], whiteList[elName] || [])
+
+ for (var j = 0, len2 = attributeList.length; j < len2; j++) {
+ if (!allowedAttribute(attributeList[j], whitelistedAttributes)) {
+ el.removeAttribute(attributeList[j].nodeName)
+ }
+ }
+ }
+
+ return createdDocument.body.innerHTML
+ }
+
// TOOLTIP PUBLIC CLASS DEFINITION
// ===============================
@@ -1274,7 +1441,7 @@ if (typeof jQuery === 'undefined') {
this.init('tooltip', element, options)
}
- Tooltip.VERSION = '3.3.6'
+ Tooltip.VERSION = '3.4.1'
Tooltip.TRANSITION_DURATION = 150
@@ -1291,7 +1458,10 @@ if (typeof jQuery === 'undefined') {
viewport: {
selector: 'body',
padding: 0
- }
+ },
+ sanitize : true,
+ sanitizeFn : null,
+ whiteList : DefaultWhitelist
}
Tooltip.prototype.init = function (type, element, options) {
@@ -1299,7 +1469,7 @@ if (typeof jQuery === 'undefined') {
this.type = type
this.$element = $(element)
this.options = this.getOptions(options)
- this.$viewport = this.options.viewport && $($.isFunction(this.options.viewport) ? this.options.viewport.call(this, this.$element) : (this.options.viewport.selector || this.options.viewport))
+ this.$viewport = this.options.viewport && $(document).find($.isFunction(this.options.viewport) ? this.options.viewport.call(this, this.$element) : (this.options.viewport.selector || this.options.viewport))
this.inState = { click: false, hover: false, focus: false }
if (this.$element[0] instanceof document.constructor && !this.options.selector) {
@@ -1332,7 +1502,15 @@ if (typeof jQuery === 'undefined') {
}
Tooltip.prototype.getOptions = function (options) {
- options = $.extend({}, this.getDefaults(), this.$element.data(), options)
+ var dataAttributes = this.$element.data()
+
+ for (var dataAttr in dataAttributes) {
+ if (dataAttributes.hasOwnProperty(dataAttr) && $.inArray(dataAttr, DISALLOWED_ATTRIBUTES) !== -1) {
+ delete dataAttributes[dataAttr]
+ }
+ }
+
+ options = $.extend({}, this.getDefaults(), dataAttributes, options)
if (options.delay && typeof options.delay == 'number') {
options.delay = {
@@ -1341,6 +1519,10 @@ if (typeof jQuery === 'undefined') {
}
}
+ if (options.sanitize) {
+ options.template = sanitizeHtml(options.template, options.whiteList, options.sanitizeFn)
+ }
+
return options
}
@@ -1452,7 +1634,7 @@ if (typeof jQuery === 'undefined') {
.addClass(placement)
.data('bs.' + this.type, this)
- this.options.container ? $tip.appendTo(this.options.container) : $tip.insertAfter(this.$element)
+ this.options.container ? $tip.appendTo($(document).find(this.options.container)) : $tip.insertAfter(this.$element)
this.$element.trigger('inserted.bs.' + this.type)
var pos = this.getPosition()
@@ -1554,7 +1736,16 @@ if (typeof jQuery === 'undefined') {
var $tip = this.tip()
var title = this.getTitle()
- $tip.find('.tooltip-inner')[this.options.html ? 'html' : 'text'](title)
+ if (this.options.html) {
+ if (this.options.sanitize) {
+ title = sanitizeHtml(title, this.options.whiteList, this.options.sanitizeFn)
+ }
+
+ $tip.find('.tooltip-inner').html(title)
+ } else {
+ $tip.find('.tooltip-inner').text(title)
+ }
+
$tip.removeClass('fade in top bottom left right')
}
@@ -1565,9 +1756,11 @@ if (typeof jQuery === 'undefined') {
function complete() {
if (that.hoverState != 'in') $tip.detach()
- that.$element
- .removeAttr('aria-describedby')
- .trigger('hidden.bs.' + that.type)
+ if (that.$element) { // TODO: Check whether guarding this code with this `if` is really necessary.
+ that.$element
+ .removeAttr('aria-describedby')
+ .trigger('hidden.bs.' + that.type)
+ }
callback && callback()
}
@@ -1610,7 +1803,10 @@ if (typeof jQuery === 'undefined') {
// width and height are missing in IE8, so compute them manually; see https://github.com/twbs/bootstrap/issues/14093
elRect = $.extend({}, elRect, { width: elRect.right - elRect.left, height: elRect.bottom - elRect.top })
}
- var elOffset = isBody ? { top: 0, left: 0 } : $element.offset()
+ var isSvg = window.SVGElement && el instanceof window.SVGElement
+ // Avoid using $.offset() on SVGs since it gives incorrect results in jQuery 3.
+ // See https://github.com/twbs/bootstrap/issues/20280
+ var elOffset = isBody ? { top: 0, left: 0 } : (isSvg ? null : $element.offset())
var scroll = { scroll: isBody ? document.documentElement.scrollTop || document.body.scrollTop : $element.scrollTop() }
var outerDims = isBody ? { width: $(window).width(), height: $(window).height() } : null
@@ -1726,9 +1922,13 @@ if (typeof jQuery === 'undefined') {
that.$tip = null
that.$arrow = null
that.$viewport = null
+ that.$element = null
})
}
+ Tooltip.prototype.sanitizeHtml = function (unsafeHtml) {
+ return sanitizeHtml(unsafeHtml, this.options.whiteList, this.options.sanitizeFn)
+ }
// TOOLTIP PLUGIN DEFINITION
// =========================
@@ -1762,10 +1962,10 @@ if (typeof jQuery === 'undefined') {
}(jQuery);
/* ========================================================================
- * Bootstrap: popover.js v3.3.6
- * http://getbootstrap.com/javascript/#popovers
+ * Bootstrap: popover.js v3.4.1
+ * https://getbootstrap.com/docs/3.4/javascript/#popovers
* ========================================================================
- * Copyright 2011-2015 Twitter, Inc.
+ * Copyright 2011-2019 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
@@ -1782,7 +1982,7 @@ if (typeof jQuery === 'undefined') {
if (!$.fn.tooltip) throw new Error('Popover requires tooltip.js')
- Popover.VERSION = '3.3.6'
+ Popover.VERSION = '3.4.1'
Popover.DEFAULTS = $.extend({}, $.fn.tooltip.Constructor.DEFAULTS, {
placement: 'right',
@@ -1808,10 +2008,25 @@ if (typeof jQuery === 'undefined') {
var title = this.getTitle()
var content = this.getContent()
- $tip.find('.popover-title')[this.options.html ? 'html' : 'text'](title)
- $tip.find('.popover-content').children().detach().end()[ // we use append for html objects to maintain js events
- this.options.html ? (typeof content == 'string' ? 'html' : 'append') : 'text'
- ](content)
+ if (this.options.html) {
+ var typeContent = typeof content
+
+ if (this.options.sanitize) {
+ title = this.sanitizeHtml(title)
+
+ if (typeContent === 'string') {
+ content = this.sanitizeHtml(content)
+ }
+ }
+
+ $tip.find('.popover-title').html(title)
+ $tip.find('.popover-content').children().detach().end()[
+ typeContent === 'string' ? 'html' : 'append'
+ ](content)
+ } else {
+ $tip.find('.popover-title').text(title)
+ $tip.find('.popover-content').children().detach().end().text(content)
+ }
$tip.removeClass('fade top bottom left right in')
@@ -1830,8 +2045,8 @@ if (typeof jQuery === 'undefined') {
return $e.attr('data-content')
|| (typeof o.content == 'function' ?
- o.content.call($e[0]) :
- o.content)
+ o.content.call($e[0]) :
+ o.content)
}
Popover.prototype.arrow = function () {
@@ -1871,10 +2086,10 @@ if (typeof jQuery === 'undefined') {
}(jQuery);
/* ========================================================================
- * Bootstrap: scrollspy.js v3.3.6
- * http://getbootstrap.com/javascript/#scrollspy
+ * Bootstrap: scrollspy.js v3.4.1
+ * https://getbootstrap.com/docs/3.4/javascript/#scrollspy
* ========================================================================
- * Copyright 2011-2015 Twitter, Inc.
+ * Copyright 2011-2019 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
@@ -1900,7 +2115,7 @@ if (typeof jQuery === 'undefined') {
this.process()
}
- ScrollSpy.VERSION = '3.3.6'
+ ScrollSpy.VERSION = '3.4.1'
ScrollSpy.DEFAULTS = {
offset: 10
@@ -2044,10 +2259,10 @@ if (typeof jQuery === 'undefined') {
}(jQuery);
/* ========================================================================
- * Bootstrap: tab.js v3.3.6
- * http://getbootstrap.com/javascript/#tabs
+ * Bootstrap: tab.js v3.4.1
+ * https://getbootstrap.com/docs/3.4/javascript/#tabs
* ========================================================================
- * Copyright 2011-2015 Twitter, Inc.
+ * Copyright 2011-2019 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
@@ -2064,7 +2279,7 @@ if (typeof jQuery === 'undefined') {
// jscs:enable requireDollarBeforejQueryAssignment
}
- Tab.VERSION = '3.3.6'
+ Tab.VERSION = '3.4.1'
Tab.TRANSITION_DURATION = 150
@@ -2093,7 +2308,7 @@ if (typeof jQuery === 'undefined') {
if (showEvent.isDefaultPrevented() || hideEvent.isDefaultPrevented()) return
- var $target = $(selector)
+ var $target = $(document).find(selector)
this.activate($this.closest('li'), $ul)
this.activate($target, $target.parent(), function () {
@@ -2118,15 +2333,15 @@ if (typeof jQuery === 'undefined') {
$active
.removeClass('active')
.find('> .dropdown-menu > .active')
- .removeClass('active')
+ .removeClass('active')
.end()
.find('[data-toggle="tab"]')
- .attr('aria-expanded', false)
+ .attr('aria-expanded', false)
element
.addClass('active')
.find('[data-toggle="tab"]')
- .attr('aria-expanded', true)
+ .attr('aria-expanded', true)
if (transition) {
element[0].offsetWidth // reflow for transition
@@ -2138,10 +2353,10 @@ if (typeof jQuery === 'undefined') {
if (element.parent('.dropdown-menu').length) {
element
.closest('li.dropdown')
- .addClass('active')
+ .addClass('active')
.end()
.find('[data-toggle="tab"]')
- .attr('aria-expanded', true)
+ .attr('aria-expanded', true)
}
callback && callback()
@@ -2200,10 +2415,10 @@ if (typeof jQuery === 'undefined') {
}(jQuery);
/* ========================================================================
- * Bootstrap: affix.js v3.3.6
- * http://getbootstrap.com/javascript/#affix
+ * Bootstrap: affix.js v3.4.1
+ * https://getbootstrap.com/docs/3.4/javascript/#affix
* ========================================================================
- * Copyright 2011-2015 Twitter, Inc.
+ * Copyright 2011-2019 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
* ======================================================================== */
@@ -2217,7 +2432,9 @@ if (typeof jQuery === 'undefined') {
var Affix = function (element, options) {
this.options = $.extend({}, Affix.DEFAULTS, options)
- this.$target = $(this.options.target)
+ var target = this.options.target === Affix.DEFAULTS.target ? $(this.options.target) : $(document).find(this.options.target)
+
+ this.$target = target
.on('scroll.bs.affix.data-api', $.proxy(this.checkPosition, this))
.on('click.bs.affix.data-api', $.proxy(this.checkPositionWithEventLoop, this))
@@ -2229,7 +2446,7 @@ if (typeof jQuery === 'undefined') {
this.checkPosition()
}
- Affix.VERSION = '3.3.6'
+ Affix.VERSION = '3.4.1'
Affix.RESET = 'affix affix-top affix-bottom'
diff --git a/bitbake/lib/toaster/toastergui/static/js/bootstrap-3.4.1.min.js b/bitbake/lib/toaster/toastergui/static/js/bootstrap-3.4.1.min.js
new file mode 100644
index 0000000000..eb0a8b410f
--- /dev/null
+++ b/bitbake/lib/toaster/toastergui/static/js/bootstrap-3.4.1.min.js
@@ -0,0 +1,6 @@
+/*!
+ * Bootstrap v3.4.1 (https://getbootstrap.com/)
+ * Copyright 2011-2019 Twitter, Inc.
+ * Licensed under the MIT license
+ */
+if("undefined"==typeof jQuery)throw new Error("Bootstrap's JavaScript requires jQuery");!function(t){"use strict";var e=jQuery.fn.jquery.split(" ")[0].split(".");if(e[0]<2&&e[1]<9||1==e[0]&&9==e[1]&&e[2]<1||3<e[0])throw new Error("Bootstrap's JavaScript requires jQuery version 1.9.1 or higher, but lower than version 4")}(),function(n){"use strict";n.fn.emulateTransitionEnd=function(t){var e=!1,i=this;n(this).one("bsTransitionEnd",function(){e=!0});return setTimeout(function(){e||n(i).trigger(n.support.transition.end)},t),this},n(function(){n.support.transition=function o(){var t=document.createElement("bootstrap"),e={WebkitTransition:"webkitTransitionEnd",MozTransition:"transitionend",OTransition:"oTransitionEnd otransitionend",transition:"transitionend"};for(var i in e)if(t.style[i]!==undefined)return{end:e[i]};return!1}(),n.support.transition&&(n.event.special.bsTransitionEnd={bindType:n.support.transition.end,delegateType:n.support.transition.end,handle:function(t){if(n(t.target).is(this))return t.handleObj.handler.apply(this,arguments)}})})}(jQuery),function(s){"use strict";var e='[data-dismiss="alert"]',a=function(t){s(t).on("click",e,this.close)};a.VERSION="3.4.1",a.TRANSITION_DURATION=150,a.prototype.close=function(t){var e=s(this),i=e.attr("data-target");i||(i=(i=e.attr("href"))&&i.replace(/.*(?=#[^\s]*$)/,"")),i="#"===i?[]:i;var o=s(document).find(i);function n(){o.detach().trigger("closed.bs.alert").remove()}t&&t.preventDefault(),o.length||(o=e.closest(".alert")),o.trigger(t=s.Event("close.bs.alert")),t.isDefaultPrevented()||(o.removeClass("in"),s.support.transition&&o.hasClass("fade")?o.one("bsTransitionEnd",n).emulateTransitionEnd(a.TRANSITION_DURATION):n())};var t=s.fn.alert;s.fn.alert=function o(i){return this.each(function(){var t=s(this),e=t.data("bs.alert");e||t.data("bs.alert",e=new a(this)),"string"==typeof i&&e[i].call(t)})},s.fn.alert.Constructor=a,s.fn.alert.noConflict=function(){return s.fn.alert=t,this},s(document).on("click.bs.alert.data-api",e,a.prototype.close)}(jQuery),function(s){"use strict";var n=function(t,e){this.$element=s(t),this.options=s.extend({},n.DEFAULTS,e),this.isLoading=!1};function i(o){return this.each(function(){var t=s(this),e=t.data("bs.button"),i="object"==typeof o&&o;e||t.data("bs.button",e=new n(this,i)),"toggle"==o?e.toggle():o&&e.setState(o)})}n.VERSION="3.4.1",n.DEFAULTS={loadingText:"loading..."},n.prototype.setState=function(t){var e="disabled",i=this.$element,o=i.is("input")?"val":"html",n=i.data();t+="Text",null==n.resetText&&i.data("resetText",i[o]()),setTimeout(s.proxy(function(){i[o](null==n[t]?this.options[t]:n[t]),"loadingText"==t?(this.isLoading=!0,i.addClass(e).attr(e,e).prop(e,!0)):this.isLoading&&(this.isLoading=!1,i.removeClass(e).removeAttr(e).prop(e,!1))},this),0)},n.prototype.toggle=function(){var t=!0,e=this.$element.closest('[data-toggle="buttons"]');if(e.length){var i=this.$element.find("input");"radio"==i.prop("type")?(i.prop("checked")&&(t=!1),e.find(".active").removeClass("active"),this.$element.addClass("active")):"checkbox"==i.prop("type")&&(i.prop("checked")!==this.$element.hasClass("active")&&(t=!1),this.$element.toggleClass("active")),i.prop("checked",this.$element.hasClass("active")),t&&i.trigger("change")}else this.$element.attr("aria-pressed",!this.$element.hasClass("active")),this.$element.toggleClass("active")};var t=s.fn.button;s.fn.button=i,s.fn.button.Constructor=n,s.fn.button.noConflict=function(){return s.fn.button=t,this},s(document).on("click.bs.button.data-api",'[data-toggle^="button"]',function(t){var e=s(t.target).closest(".btn");i.call(e,"toggle"),s(t.target).is('input[type="radio"], input[type="checkbox"]')||(t.preventDefault(),e.is("input,button")?e.trigger("focus"):e.find("input:visible,button:visible").first().trigger("focus"))}).on("focus.bs.button.data-api blur.bs.button.data-api",'[data-toggle^="button"]',function(t){s(t.target).closest(".btn").toggleClass("focus",/^focus(in)?$/.test(t.type))})}(jQuery),function(p){"use strict";var c=function(t,e){this.$element=p(t),this.$indicators=this.$element.find(".carousel-indicators"),this.options=e,this.paused=null,this.sliding=null,this.interval=null,this.$active=null,this.$items=null,this.options.keyboard&&this.$element.on("keydown.bs.carousel",p.proxy(this.keydown,this)),"hover"==this.options.pause&&!("ontouchstart"in document.documentElement)&&this.$element.on("mouseenter.bs.carousel",p.proxy(this.pause,this)).on("mouseleave.bs.carousel",p.proxy(this.cycle,this))};function r(n){return this.each(function(){var t=p(this),e=t.data("bs.carousel"),i=p.extend({},c.DEFAULTS,t.data(),"object"==typeof n&&n),o="string"==typeof n?n:i.slide;e||t.data("bs.carousel",e=new c(this,i)),"number"==typeof n?e.to(n):o?e[o]():i.interval&&e.pause().cycle()})}c.VERSION="3.4.1",c.TRANSITION_DURATION=600,c.DEFAULTS={interval:5e3,pause:"hover",wrap:!0,keyboard:!0},c.prototype.keydown=function(t){if(!/input|textarea/i.test(t.target.tagName)){switch(t.which){case 37:this.prev();break;case 39:this.next();break;default:return}t.preventDefault()}},c.prototype.cycle=function(t){return t||(this.paused=!1),this.interval&&clearInterval(this.interval),this.options.interval&&!this.paused&&(this.interval=setInterval(p.proxy(this.next,this),this.options.interval)),this},c.prototype.getItemIndex=function(t){return this.$items=t.parent().children(".item"),this.$items.index(t||this.$active)},c.prototype.getItemForDirection=function(t,e){var i=this.getItemIndex(e);if(("prev"==t&&0===i||"next"==t&&i==this.$items.length-1)&&!this.options.wrap)return e;var o=(i+("prev"==t?-1:1))%this.$items.length;return this.$items.eq(o)},c.prototype.to=function(t){var e=this,i=this.getItemIndex(this.$active=this.$element.find(".item.active"));if(!(t>this.$items.length-1||t<0))return this.sliding?this.$element.one("slid.bs.carousel",function(){e.to(t)}):i==t?this.pause().cycle():this.slide(i<t?"next":"prev",this.$items.eq(t))},c.prototype.pause=function(t){return t||(this.paused=!0),this.$element.find(".next, .prev").length&&p.support.transition&&(this.$element.trigger(p.support.transition.end),this.cycle(!0)),this.interval=clearInterval(this.interval),this},c.prototype.next=function(){if(!this.sliding)return this.slide("next")},c.prototype.prev=function(){if(!this.sliding)return this.slide("prev")},c.prototype.slide=function(t,e){var i=this.$element.find(".item.active"),o=e||this.getItemForDirection(t,i),n=this.interval,s="next"==t?"left":"right",a=this;if(o.hasClass("active"))return this.sliding=!1;var r=o[0],l=p.Event("slide.bs.carousel",{relatedTarget:r,direction:s});if(this.$element.trigger(l),!l.isDefaultPrevented()){if(this.sliding=!0,n&&this.pause(),this.$indicators.length){this.$indicators.find(".active").removeClass("active");var h=p(this.$indicators.children()[this.getItemIndex(o)]);h&&h.addClass("active")}var d=p.Event("slid.bs.carousel",{relatedTarget:r,direction:s});return p.support.transition&&this.$element.hasClass("slide")?(o.addClass(t),"object"==typeof o&&o.length&&o[0].offsetWidth,i.addClass(s),o.addClass(s),i.one("bsTransitionEnd",function(){o.removeClass([t,s].join(" ")).addClass("active"),i.removeClass(["active",s].join(" ")),a.sliding=!1,setTimeout(function(){a.$element.trigger(d)},0)}).emulateTransitionEnd(c.TRANSITION_DURATION)):(i.removeClass("active"),o.addClass("active"),this.sliding=!1,this.$element.trigger(d)),n&&this.cycle(),this}};var t=p.fn.carousel;p.fn.carousel=r,p.fn.carousel.Constructor=c,p.fn.carousel.noConflict=function(){return p.fn.carousel=t,this};var e=function(t){var e=p(this),i=e.attr("href");i&&(i=i.replace(/.*(?=#[^\s]+$)/,""));var o=e.attr("data-target")||i,n=p(document).find(o);if(n.hasClass("carousel")){var s=p.extend({},n.data(),e.data()),a=e.attr("data-slide-to");a&&(s.interval=!1),r.call(n,s),a&&n.data("bs.carousel").to(a),t.preventDefault()}};p(document).on("click.bs.carousel.data-api","[data-slide]",e).on("click.bs.carousel.data-api","[data-slide-to]",e),p(window).on("load",function(){p('[data-ride="carousel"]').each(function(){var t=p(this);r.call(t,t.data())})})}(jQuery),function(a){"use strict";var r=function(t,e){this.$element=a(t),this.options=a.extend({},r.DEFAULTS,e),this.$trigger=a('[data-toggle="collapse"][href="#'+t.id+'"],[data-toggle="collapse"][data-target="#'+t.id+'"]'),this.transitioning=null,this.options.parent?this.$parent=this.getParent():this.addAriaAndCollapsedClass(this.$element,this.$trigger),this.options.toggle&&this.toggle()};function n(t){var e,i=t.attr("data-target")||(e=t.attr("href"))&&e.replace(/.*(?=#[^\s]+$)/,"");return a(document).find(i)}function l(o){return this.each(function(){var t=a(this),e=t.data("bs.collapse"),i=a.extend({},r.DEFAULTS,t.data(),"object"==typeof o&&o);!e&&i.toggle&&/show|hide/.test(o)&&(i.toggle=!1),e||t.data("bs.collapse",e=new r(this,i)),"string"==typeof o&&e[o]()})}r.VERSION="3.4.1",r.TRANSITION_DURATION=350,r.DEFAULTS={toggle:!0},r.prototype.dimension=function(){return this.$element.hasClass("width")?"width":"height"},r.prototype.show=function(){if(!this.transitioning&&!this.$element.hasClass("in")){var t,e=this.$parent&&this.$parent.children(".panel").children(".in, .collapsing");if(!(e&&e.length&&(t=e.data("bs.collapse"))&&t.transitioning)){var i=a.Event("show.bs.collapse");if(this.$element.trigger(i),!i.isDefaultPrevented()){e&&e.length&&(l.call(e,"hide"),t||e.data("bs.collapse",null));var o=this.dimension();this.$element.removeClass("collapse").addClass("collapsing")[o](0).attr("aria-expanded",!0),this.$trigger.removeClass("collapsed").attr("aria-expanded",!0),this.transitioning=1;var n=function(){this.$element.removeClass("collapsing").addClass("collapse in")[o](""),this.transitioning=0,this.$element.trigger("shown.bs.collapse")};if(!a.support.transition)return n.call(this);var s=a.camelCase(["scroll",o].join("-"));this.$element.one("bsTransitionEnd",a.proxy(n,this)).emulateTransitionEnd(r.TRANSITION_DURATION)[o](this.$element[0][s])}}}},r.prototype.hide=function(){if(!this.transitioning&&this.$element.hasClass("in")){var t=a.Event("hide.bs.collapse");if(this.$element.trigger(t),!t.isDefaultPrevented()){var e=this.dimension();this.$element[e](this.$element[e]())[0].offsetHeight,this.$element.addClass("collapsing").removeClass("collapse in").attr("aria-expanded",!1),this.$trigger.addClass("collapsed").attr("aria-expanded",!1),this.transitioning=1;var i=function(){this.transitioning=0,this.$element.removeClass("collapsing").addClass("collapse").trigger("hidden.bs.collapse")};if(!a.support.transition)return i.call(this);this.$element[e](0).one("bsTransitionEnd",a.proxy(i,this)).emulateTransitionEnd(r.TRANSITION_DURATION)}}},r.prototype.toggle=function(){this[this.$element.hasClass("in")?"hide":"show"]()},r.prototype.getParent=function(){return a(document).find(this.options.parent).find('[data-toggle="collapse"][data-parent="'+this.options.parent+'"]').each(a.proxy(function(t,e){var i=a(e);this.addAriaAndCollapsedClass(n(i),i)},this)).end()},r.prototype.addAriaAndCollapsedClass=function(t,e){var i=t.hasClass("in");t.attr("aria-expanded",i),e.toggleClass("collapsed",!i).attr("aria-expanded",i)};var t=a.fn.collapse;a.fn.collapse=l,a.fn.collapse.Constructor=r,a.fn.collapse.noConflict=function(){return a.fn.collapse=t,this},a(document).on("click.bs.collapse.data-api",'[data-toggle="collapse"]',function(t){var e=a(this);e.attr("data-target")||t.preventDefault();var i=n(e),o=i.data("bs.collapse")?"toggle":e.data();l.call(i,o)})}(jQuery),function(a){"use strict";var r='[data-toggle="dropdown"]',o=function(t){a(t).on("click.bs.dropdown",this.toggle)};function l(t){var e=t.attr("data-target");e||(e=(e=t.attr("href"))&&/#[A-Za-z]/.test(e)&&e.replace(/.*(?=#[^\s]*$)/,""));var i="#"!==e?a(document).find(e):null;return i&&i.length?i:t.parent()}function s(o){o&&3===o.which||(a(".dropdown-backdrop").remove(),a(r).each(function(){var t=a(this),e=l(t),i={relatedTarget:this};e.hasClass("open")&&(o&&"click"==o.type&&/input|textarea/i.test(o.target.tagName)&&a.contains(e[0],o.target)||(e.trigger(o=a.Event("hide.bs.dropdown",i)),o.isDefaultPrevented()||(t.attr("aria-expanded","false"),e.removeClass("open").trigger(a.Event("hidden.bs.dropdown",i)))))}))}o.VERSION="3.4.1",o.prototype.toggle=function(t){var e=a(this);if(!e.is(".disabled, :disabled")){var i=l(e),o=i.hasClass("open");if(s(),!o){"ontouchstart"in document.documentElement&&!i.closest(".navbar-nav").length&&a(document.createElement("div")).addClass("dropdown-backdrop").insertAfter(a(this)).on("click",s);var n={relatedTarget:this};if(i.trigger(t=a.Event("show.bs.dropdown",n)),t.isDefaultPrevented())return;e.trigger("focus").attr("aria-expanded","true"),i.toggleClass("open").trigger(a.Event("shown.bs.dropdown",n))}return!1}},o.prototype.keydown=function(t){if(/(38|40|27|32)/.test(t.which)&&!/input|textarea/i.test(t.target.tagName)){var e=a(this);if(t.preventDefault(),t.stopPropagation(),!e.is(".disabled, :disabled")){var i=l(e),o=i.hasClass("open");if(!o&&27!=t.which||o&&27==t.which)return 27==t.which&&i.find(r).trigger("focus"),e.trigger("click");var n=i.find(".dropdown-menu li:not(.disabled):visible a");if(n.length){var s=n.index(t.target);38==t.which&&0<s&&s--,40==t.which&&s<n.length-1&&s++,~s||(s=0),n.eq(s).trigger("focus")}}}};var t=a.fn.dropdown;a.fn.dropdown=function e(i){return this.each(function(){var t=a(this),e=t.data("bs.dropdown");e||t.data("bs.dropdown",e=new o(this)),"string"==typeof i&&e[i].call(t)})},a.fn.dropdown.Constructor=o,a.fn.dropdown.noConflict=function(){return a.fn.dropdown=t,this},a(document).on("click.bs.dropdown.data-api",s).on("click.bs.dropdown.data-api",".dropdown form",function(t){t.stopPropagation()}).on("click.bs.dropdown.data-api",r,o.prototype.toggle).on("keydown.bs.dropdown.data-api",r,o.prototype.keydown).on("keydown.bs.dropdown.data-api",".dropdown-menu",o.prototype.keydown)}(jQuery),function(a){"use strict";var s=function(t,e){this.options=e,this.$body=a(document.body),this.$element=a(t),this.$dialog=this.$element.find(".modal-dialog"),this.$backdrop=null,this.isShown=null,this.originalBodyPad=null,this.scrollbarWidth=0,this.ignoreBackdropClick=!1,this.fixedContent=".navbar-fixed-top, .navbar-fixed-bottom",this.options.remote&&this.$element.find(".modal-content").load(this.options.remote,a.proxy(function(){this.$element.trigger("loaded.bs.modal")},this))};function r(o,n){return this.each(function(){var t=a(this),e=t.data("bs.modal"),i=a.extend({},s.DEFAULTS,t.data(),"object"==typeof o&&o);e||t.data("bs.modal",e=new s(this,i)),"string"==typeof o?e[o](n):i.show&&e.show(n)})}s.VERSION="3.4.1",s.TRANSITION_DURATION=300,s.BACKDROP_TRANSITION_DURATION=150,s.DEFAULTS={backdrop:!0,keyboard:!0,show:!0},s.prototype.toggle=function(t){return this.isShown?this.hide():this.show(t)},s.prototype.show=function(i){var o=this,t=a.Event("show.bs.modal",{relatedTarget:i});this.$element.trigger(t),this.isShown||t.isDefaultPrevented()||(this.isShown=!0,this.checkScrollbar(),this.setScrollbar(),this.$body.addClass("modal-open"),this.escape(),this.resize(),this.$element.on("click.dismiss.bs.modal",'[data-dismiss="modal"]',a.proxy(this.hide,this)),this.$dialog.on("mousedown.dismiss.bs.modal",function(){o.$element.one("mouseup.dismiss.bs.modal",function(t){a(t.target).is(o.$element)&&(o.ignoreBackdropClick=!0)})}),this.backdrop(function(){var t=a.support.transition&&o.$element.hasClass("fade");o.$element.parent().length||o.$element.appendTo(o.$body),o.$element.show().scrollTop(0),o.adjustDialog(),t&&o.$element[0].offsetWidth,o.$element.addClass("in"),o.enforceFocus();var e=a.Event("shown.bs.modal",{relatedTarget:i});t?o.$dialog.one("bsTransitionEnd",function(){o.$element.trigger("focus").trigger(e)}).emulateTransitionEnd(s.TRANSITION_DURATION):o.$element.trigger("focus").trigger(e)}))},s.prototype.hide=function(t){t&&t.preventDefault(),t=a.Event("hide.bs.modal"),this.$element.trigger(t),this.isShown&&!t.isDefaultPrevented()&&(this.isShown=!1,this.escape(),this.resize(),a(document).off("focusin.bs.modal"),this.$element.removeClass("in").off("click.dismiss.bs.modal").off("mouseup.dismiss.bs.modal"),this.$dialog.off("mousedown.dismiss.bs.modal"),a.support.transition&&this.$element.hasClass("fade")?this.$element.one("bsTransitionEnd",a.proxy(this.hideModal,this)).emulateTransitionEnd(s.TRANSITION_DURATION):this.hideModal())},s.prototype.enforceFocus=function(){a(document).off("focusin.bs.modal").on("focusin.bs.modal",a.proxy(function(t){document===t.target||this.$element[0]===t.target||this.$element.has(t.target).length||this.$element.trigger("focus")},this))},s.prototype.escape=function(){this.isShown&&this.options.keyboard?this.$element.on("keydown.dismiss.bs.modal",a.proxy(function(t){27==t.which&&this.hide()},this)):this.isShown||this.$element.off("keydown.dismiss.bs.modal")},s.prototype.resize=function(){this.isShown?a(window).on("resize.bs.modal",a.proxy(this.handleUpdate,this)):a(window).off("resize.bs.modal")},s.prototype.hideModal=function(){var t=this;this.$element.hide(),this.backdrop(function(){t.$body.removeClass("modal-open"),t.resetAdjustments(),t.resetScrollbar(),t.$element.trigger("hidden.bs.modal")})},s.prototype.removeBackdrop=function(){this.$backdrop&&this.$backdrop.remove(),this.$backdrop=null},s.prototype.backdrop=function(t){var e=this,i=this.$element.hasClass("fade")?"fade":"";if(this.isShown&&this.options.backdrop){var o=a.support.transition&&i;if(this.$backdrop=a(document.createElement("div")).addClass("modal-backdrop "+i).appendTo(this.$body),this.$element.on("click.dismiss.bs.modal",a.proxy(function(t){this.ignoreBackdropClick?this.ignoreBackdropClick=!1:t.target===t.currentTarget&&("static"==this.options.backdrop?this.$element[0].focus():this.hide())},this)),o&&this.$backdrop[0].offsetWidth,this.$backdrop.addClass("in"),!t)return;o?this.$backdrop.one("bsTransitionEnd",t).emulateTransitionEnd(s.BACKDROP_TRANSITION_DURATION):t()}else if(!this.isShown&&this.$backdrop){this.$backdrop.removeClass("in");var n=function(){e.removeBackdrop(),t&&t()};a.support.transition&&this.$element.hasClass("fade")?this.$backdrop.one("bsTransitionEnd",n).emulateTransitionEnd(s.BACKDROP_TRANSITION_DURATION):n()}else t&&t()},s.prototype.handleUpdate=function(){this.adjustDialog()},s.prototype.adjustDialog=function(){var t=this.$element[0].scrollHeight>document.documentElement.clientHeight;this.$element.css({paddingLeft:!this.bodyIsOverflowing&&t?this.scrollbarWidth:"",paddingRight:this.bodyIsOverflowing&&!t?this.scrollbarWidth:""})},s.prototype.resetAdjustments=function(){this.$element.css({paddingLeft:"",paddingRight:""})},s.prototype.checkScrollbar=function(){var t=window.innerWidth;if(!t){var e=document.documentElement.getBoundingClientRect();t=e.right-Math.abs(e.left)}this.bodyIsOverflowing=document.body.clientWidth<t,this.scrollbarWidth=this.measureScrollbar()},s.prototype.setScrollbar=function(){var t=parseInt(this.$body.css("padding-right")||0,10);this.originalBodyPad=document.body.style.paddingRight||"";var n=this.scrollbarWidth;this.bodyIsOverflowing&&(this.$body.css("padding-right",t+n),a(this.fixedContent).each(function(t,e){var i=e.style.paddingRight,o=a(e).css("padding-right");a(e).data("padding-right",i).css("padding-right",parseFloat(o)+n+"px")}))},s.prototype.resetScrollbar=function(){this.$body.css("padding-right",this.originalBodyPad),a(this.fixedContent).each(function(t,e){var i=a(e).data("padding-right");a(e).removeData("padding-right"),e.style.paddingRight=i||""})},s.prototype.measureScrollbar=function(){var t=document.createElement("div");t.className="modal-scrollbar-measure",this.$body.append(t);var e=t.offsetWidth-t.clientWidth;return this.$body[0].removeChild(t),e};var t=a.fn.modal;a.fn.modal=r,a.fn.modal.Constructor=s,a.fn.modal.noConflict=function(){return a.fn.modal=t,this},a(document).on("click.bs.modal.data-api",'[data-toggle="modal"]',function(t){var e=a(this),i=e.attr("href"),o=e.attr("data-target")||i&&i.replace(/.*(?=#[^\s]+$)/,""),n=a(document).find(o),s=n.data("bs.modal")?"toggle":a.extend({remote:!/#/.test(i)&&i},n.data(),e.data());e.is("a")&&t.preventDefault(),n.one("show.bs.modal",function(t){t.isDefaultPrevented()||n.one("hidden.bs.modal",function(){e.is(":visible")&&e.trigger("focus")})}),r.call(n,s,this)})}(jQuery),function(g){"use strict";var o=["sanitize","whiteList","sanitizeFn"],a=["background","cite","href","itemtype","longdesc","poster","src","xlink:href"],t={"*":["class","dir","id","lang","role",/^aria-[\w-]*$/i],a:["target","href","title","rel"],area:[],b:[],br:[],col:[],code:[],div:[],em:[],hr:[],h1:[],h2:[],h3:[],h4:[],h5:[],h6:[],i:[],img:["src","alt","title","width","height"],li:[],ol:[],p:[],pre:[],s:[],small:[],span:[],sub:[],sup:[],strong:[],u:[],ul:[]},r=/^(?:(?:https?|mailto|ftp|tel|file):|[^&:/?#]*(?:[/?#]|$))/gi,l=/^data:(?:image\/(?:bmp|gif|jpeg|jpg|png|tiff|webp)|video\/(?:mpeg|mp4|ogg|webm)|audio\/(?:mp3|oga|ogg|opus));base64,[a-z0-9+/]+=*$/i;function u(t,e){var i=t.nodeName.toLowerCase();if(-1!==g.inArray(i,e))return-1===g.inArray(i,a)||Boolean(t.nodeValue.match(r)||t.nodeValue.match(l));for(var o=g(e).filter(function(t,e){return e instanceof RegExp}),n=0,s=o.length;n<s;n++)if(i.match(o[n]))return!0;return!1}function n(t,e,i){if(0===t.length)return t;if(i&&"function"==typeof i)return i(t);if(!document.implementation||!document.implementation.createHTMLDocument)return t;var o=document.implementation.createHTMLDocument("sanitization");o.body.innerHTML=t;for(var n=g.map(e,function(t,e){return e}),s=g(o.body).find("*"),a=0,r=s.length;a<r;a++){var l=s[a],h=l.nodeName.toLowerCase();if(-1!==g.inArray(h,n))for(var d=g.map(l.attributes,function(t){return t}),p=[].concat(e["*"]||[],e[h]||[]),c=0,f=d.length;c<f;c++)u(d[c],p)||l.removeAttribute(d[c].nodeName);else l.parentNode.removeChild(l)}return o.body.innerHTML}var m=function(t,e){this.type=null,this.options=null,this.enabled=null,this.timeout=null,this.hoverState=null,this.$element=null,this.inState=null,this.init("tooltip",t,e)};m.VERSION="3.4.1",m.TRANSITION_DURATION=150,m.DEFAULTS={animation:!0,placement:"top",selector:!1,template:'<div class="tooltip" role="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!1,container:!1,viewport:{selector:"body",padding:0},sanitize:!0,sanitizeFn:null,whiteList:t},m.prototype.init=function(t,e,i){if(this.enabled=!0,this.type=t,this.$element=g(e),this.options=this.getOptions(i),this.$viewport=this.options.viewport&&g(document).find(g.isFunction(this.options.viewport)?this.options.viewport.call(this,this.$element):this.options.viewport.selector||this.options.viewport),this.inState={click:!1,hover:!1,focus:!1},this.$element[0]instanceof document.constructor&&!this.options.selector)throw new Error("`selector` option must be specified when initializing "+this.type+" on the window.document object!");for(var o=this.options.trigger.split(" "),n=o.length;n--;){var s=o[n];if("click"==s)this.$element.on("click."+this.type,this.options.selector,g.proxy(this.toggle,this));else if("manual"!=s){var a="hover"==s?"mouseenter":"focusin",r="hover"==s?"mouseleave":"focusout";this.$element.on(a+"."+this.type,this.options.selector,g.proxy(this.enter,this)),this.$element.on(r+"."+this.type,this.options.selector,g.proxy(this.leave,this))}}this.options.selector?this._options=g.extend({},this.options,{trigger:"manual",selector:""}):this.fixTitle()},m.prototype.getDefaults=function(){return m.DEFAULTS},m.prototype.getOptions=function(t){var e=this.$element.data();for(var i in e)e.hasOwnProperty(i)&&-1!==g.inArray(i,o)&&delete e[i];return(t=g.extend({},this.getDefaults(),e,t)).delay&&"number"==typeof t.delay&&(t.delay={show:t.delay,hide:t.delay}),t.sanitize&&(t.template=n(t.template,t.whiteList,t.sanitizeFn)),t},m.prototype.getDelegateOptions=function(){var i={},o=this.getDefaults();return this._options&&g.each(this._options,function(t,e){o[t]!=e&&(i[t]=e)}),i},m.prototype.enter=function(t){var e=t instanceof this.constructor?t:g(t.currentTarget).data("bs."+this.type);if(e||(e=new this.constructor(t.currentTarget,this.getDelegateOptions()),g(t.currentTarget).data("bs."+this.type,e)),t instanceof g.Event&&(e.inState["focusin"==t.type?"focus":"hover"]=!0),e.tip().hasClass("in")||"in"==e.hoverState)e.hoverState="in";else{if(clearTimeout(e.timeout),e.hoverState="in",!e.options.delay||!e.options.delay.show)return e.show();e.timeout=setTimeout(function(){"in"==e.hoverState&&e.show()},e.options.delay.show)}},m.prototype.isInStateTrue=function(){for(var t in this.inState)if(this.inState[t])return!0;return!1},m.prototype.leave=function(t){var e=t instanceof this.constructor?t:g(t.currentTarget).data("bs."+this.type);if(e||(e=new this.constructor(t.currentTarget,this.getDelegateOptions()),g(t.currentTarget).data("bs."+this.type,e)),t instanceof g.Event&&(e.inState["focusout"==t.type?"focus":"hover"]=!1),!e.isInStateTrue()){if(clearTimeout(e.timeout),e.hoverState="out",!e.options.delay||!e.options.delay.hide)return e.hide();e.timeout=setTimeout(function(){"out"==e.hoverState&&e.hide()},e.options.delay.hide)}},m.prototype.show=function(){var t=g.Event("show.bs."+this.type);if(this.hasContent()&&this.enabled){this.$element.trigger(t);var e=g.contains(this.$element[0].ownerDocument.documentElement,this.$element[0]);if(t.isDefaultPrevented()||!e)return;var i=this,o=this.tip(),n=this.getUID(this.type);this.setContent(),o.attr("id",n),this.$element.attr("aria-describedby",n),this.options.animation&&o.addClass("fade");var s="function"==typeof this.options.placement?this.options.placement.call(this,o[0],this.$element[0]):this.options.placement,a=/\s?auto?\s?/i,r=a.test(s);r&&(s=s.replace(a,"")||"top"),o.detach().css({top:0,left:0,display:"block"}).addClass(s).data("bs."+this.type,this),this.options.container?o.appendTo(g(document).find(this.options.container)):o.insertAfter(this.$element),this.$element.trigger("inserted.bs."+this.type);var l=this.getPosition(),h=o[0].offsetWidth,d=o[0].offsetHeight;if(r){var p=s,c=this.getPosition(this.$viewport);s="bottom"==s&&l.bottom+d>c.bottom?"top":"top"==s&&l.top-d<c.top?"bottom":"right"==s&&l.right+h>c.width?"left":"left"==s&&l.left-h<c.left?"right":s,o.removeClass(p).addClass(s)}var f=this.getCalculatedOffset(s,l,h,d);this.applyPlacement(f,s);var u=function(){var t=i.hoverState;i.$element.trigger("shown.bs."+i.type),i.hoverState=null,"out"==t&&i.leave(i)};g.support.transition&&this.$tip.hasClass("fade")?o.one("bsTransitionEnd",u).emulateTransitionEnd(m.TRANSITION_DURATION):u()}},m.prototype.applyPlacement=function(t,e){var i=this.tip(),o=i[0].offsetWidth,n=i[0].offsetHeight,s=parseInt(i.css("margin-top"),10),a=parseInt(i.css("margin-left"),10);isNaN(s)&&(s=0),isNaN(a)&&(a=0),t.top+=s,t.left+=a,g.offset.setOffset(i[0],g.extend({using:function(t){i.css({top:Math.round(t.top),left:Math.round(t.left)})}},t),0),i.addClass("in");var r=i[0].offsetWidth,l=i[0].offsetHeight;"top"==e&&l!=n&&(t.top=t.top+n-l);var h=this.getViewportAdjustedDelta(e,t,r,l);h.left?t.left+=h.left:t.top+=h.top;var d=/top|bottom/.test(e),p=d?2*h.left-o+r:2*h.top-n+l,c=d?"offsetWidth":"offsetHeight";i.offset(t),this.replaceArrow(p,i[0][c],d)},m.prototype.replaceArrow=function(t,e,i){this.arrow().css(i?"left":"top",50*(1-t/e)+"%").css(i?"top":"left","")},m.prototype.setContent=function(){var t=this.tip(),e=this.getTitle();this.options.html?(this.options.sanitize&&(e=n(e,this.options.whiteList,this.options.sanitizeFn)),t.find(".tooltip-inner").html(e)):t.find(".tooltip-inner").text(e),t.removeClass("fade in top bottom left right")},m.prototype.hide=function(t){var e=this,i=g(this.$tip),o=g.Event("hide.bs."+this.type);function n(){"in"!=e.hoverState&&i.detach(),e.$element&&e.$element.removeAttr("aria-describedby").trigger("hidden.bs."+e.type),t&&t()}if(this.$element.trigger(o),!o.isDefaultPrevented())return i.removeClass("in"),g.support.transition&&i.hasClass("fade")?i.one("bsTransitionEnd",n).emulateTransitionEnd(m.TRANSITION_DURATION):n(),this.hoverState=null,this},m.prototype.fixTitle=function(){var t=this.$element;(t.attr("title")||"string"!=typeof t.attr("data-original-title"))&&t.attr("data-original-title",t.attr("title")||"").attr("title","")},m.prototype.hasContent=function(){return this.getTitle()},m.prototype.getPosition=function(t){var e=(t=t||this.$element)[0],i="BODY"==e.tagName,o=e.getBoundingClientRect();null==o.width&&(o=g.extend({},o,{width:o.right-o.left,height:o.bottom-o.top}));var n=window.SVGElement&&e instanceof window.SVGElement,s=i?{top:0,left:0}:n?null:t.offset(),a={scroll:i?document.documentElement.scrollTop||document.body.scrollTop:t.scrollTop()},r=i?{width:g(window).width(),height:g(window).height()}:null;return g.extend({},o,a,r,s)},m.prototype.getCalculatedOffset=function(t,e,i,o){return"bottom"==t?{top:e.top+e.height,left:e.left+e.width/2-i/2}:"top"==t?{top:e.top-o,left:e.left+e.width/2-i/2}:"left"==t?{top:e.top+e.height/2-o/2,left:e.left-i}:{top:e.top+e.height/2-o/2,left:e.left+e.width}},m.prototype.getViewportAdjustedDelta=function(t,e,i,o){var n={top:0,left:0};if(!this.$viewport)return n;var s=this.options.viewport&&this.options.viewport.padding||0,a=this.getPosition(this.$viewport);if(/right|left/.test(t)){var r=e.top-s-a.scroll,l=e.top+s-a.scroll+o;r<a.top?n.top=a.top-r:l>a.top+a.height&&(n.top=a.top+a.height-l)}else{var h=e.left-s,d=e.left+s+i;h<a.left?n.left=a.left-h:d>a.right&&(n.left=a.left+a.width-d)}return n},m.prototype.getTitle=function(){var t=this.$element,e=this.options;return t.attr("data-original-title")||("function"==typeof e.title?e.title.call(t[0]):e.title)},m.prototype.getUID=function(t){for(;t+=~~(1e6*Math.random()),document.getElementById(t););return t},m.prototype.tip=function(){if(!this.$tip&&(this.$tip=g(this.options.template),1!=this.$tip.length))throw new Error(this.type+" `template` option must consist of exactly 1 top-level element!");return this.$tip},m.prototype.arrow=function(){return this.$arrow=this.$arrow||this.tip().find(".tooltip-arrow")},m.prototype.enable=function(){this.enabled=!0},m.prototype.disable=function(){this.enabled=!1},m.prototype.toggleEnabled=function(){this.enabled=!this.enabled},m.prototype.toggle=function(t){var e=this;t&&((e=g(t.currentTarget).data("bs."+this.type))||(e=new this.constructor(t.currentTarget,this.getDelegateOptions()),g(t.currentTarget).data("bs."+this.type,e))),t?(e.inState.click=!e.inState.click,e.isInStateTrue()?e.enter(e):e.leave(e)):e.tip().hasClass("in")?e.leave(e):e.enter(e)},m.prototype.destroy=function(){var t=this;clearTimeout(this.timeout),this.hide(function(){t.$element.off("."+t.type).removeData("bs."+t.type),t.$tip&&t.$tip.detach(),t.$tip=null,t.$arrow=null,t.$viewport=null,t.$element=null})},m.prototype.sanitizeHtml=function(t){return n(t,this.options.whiteList,this.options.sanitizeFn)};var e=g.fn.tooltip;g.fn.tooltip=function i(o){return this.each(function(){var t=g(this),e=t.data("bs.tooltip"),i="object"==typeof o&&o;!e&&/destroy|hide/.test(o)||(e||t.data("bs.tooltip",e=new m(this,i)),"string"==typeof o&&e[o]())})},g.fn.tooltip.Constructor=m,g.fn.tooltip.noConflict=function(){return g.fn.tooltip=e,this}}(jQuery),function(n){"use strict";var s=function(t,e){this.init("popover",t,e)};if(!n.fn.tooltip)throw new Error("Popover requires tooltip.js");s.VERSION="3.4.1",s.DEFAULTS=n.extend({},n.fn.tooltip.Constructor.DEFAULTS,{placement:"right",trigger:"click",content:"",template:'<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-title"></h3><div class="popover-content"></div></div>'}),((s.prototype=n.extend({},n.fn.tooltip.Constructor.prototype)).constructor=s).prototype.getDefaults=function(){return s.DEFAULTS},s.prototype.setContent=function(){var t=this.tip(),e=this.getTitle(),i=this.getContent();if(this.options.html){var o=typeof i;this.options.sanitize&&(e=this.sanitizeHtml(e),"string"===o&&(i=this.sanitizeHtml(i))),t.find(".popover-title").html(e),t.find(".popover-content").children().detach().end()["string"===o?"html":"append"](i)}else t.find(".popover-title").text(e),t.find(".popover-content").children().detach().end().text(i);t.removeClass("fade top bottom left right in"),t.find(".popover-title").html()||t.find(".popover-title").hide()},s.prototype.hasContent=function(){return this.getTitle()||this.getContent()},s.prototype.getContent=function(){var t=this.$element,e=this.options;return t.attr("data-content")||("function"==typeof e.content?e.content.call(t[0]):e.content)},s.prototype.arrow=function(){return this.$arrow=this.$arrow||this.tip().find(".arrow")};var t=n.fn.popover;n.fn.popover=function e(o){return this.each(function(){var t=n(this),e=t.data("bs.popover"),i="object"==typeof o&&o;!e&&/destroy|hide/.test(o)||(e||t.data("bs.popover",e=new s(this,i)),"string"==typeof o&&e[o]())})},n.fn.popover.Constructor=s,n.fn.popover.noConflict=function(){return n.fn.popover=t,this}}(jQuery),function(s){"use strict";function n(t,e){this.$body=s(document.body),this.$scrollElement=s(t).is(document.body)?s(window):s(t),this.options=s.extend({},n.DEFAULTS,e),this.selector=(this.options.target||"")+" .nav li > a",this.offsets=[],this.targets=[],this.activeTarget=null,this.scrollHeight=0,this.$scrollElement.on("scroll.bs.scrollspy",s.proxy(this.process,this)),this.refresh(),this.process()}function e(o){return this.each(function(){var t=s(this),e=t.data("bs.scrollspy"),i="object"==typeof o&&o;e||t.data("bs.scrollspy",e=new n(this,i)),"string"==typeof o&&e[o]()})}n.VERSION="3.4.1",n.DEFAULTS={offset:10},n.prototype.getScrollHeight=function(){return this.$scrollElement[0].scrollHeight||Math.max(this.$body[0].scrollHeight,document.documentElement.scrollHeight)},n.prototype.refresh=function(){var t=this,o="offset",n=0;this.offsets=[],this.targets=[],this.scrollHeight=this.getScrollHeight(),s.isWindow(this.$scrollElement[0])||(o="position",n=this.$scrollElement.scrollTop()),this.$body.find(this.selector).map(function(){var t=s(this),e=t.data("target")||t.attr("href"),i=/^#./.test(e)&&s(e);return i&&i.length&&i.is(":visible")&&[[i[o]().top+n,e]]||null}).sort(function(t,e){return t[0]-e[0]}).each(function(){t.offsets.push(this[0]),t.targets.push(this[1])})},n.prototype.process=function(){var t,e=this.$scrollElement.scrollTop()+this.options.offset,i=this.getScrollHeight(),o=this.options.offset+i-this.$scrollElement.height(),n=this.offsets,s=this.targets,a=this.activeTarget;if(this.scrollHeight!=i&&this.refresh(),o<=e)return a!=(t=s[s.length-1])&&this.activate(t);if(a&&e<n[0])return this.activeTarget=null,this.clear();for(t=n.length;t--;)a!=s[t]&&e>=n[t]&&(n[t+1]===undefined||e<n[t+1])&&this.activate(s[t])},n.prototype.activate=function(t){this.activeTarget=t,this.clear();var e=this.selector+'[data-target="'+t+'"],'+this.selector+'[href="'+t+'"]',i=s(e).parents("li").addClass("active");i.parent(".dropdown-menu").length&&(i=i.closest("li.dropdown").addClass("active")),i.trigger("activate.bs.scrollspy")},n.prototype.clear=function(){s(this.selector).parentsUntil(this.options.target,".active").removeClass("active")};var t=s.fn.scrollspy;s.fn.scrollspy=e,s.fn.scrollspy.Constructor=n,s.fn.scrollspy.noConflict=function(){return s.fn.scrollspy=t,this},s(window).on("load.bs.scrollspy.data-api",function(){s('[data-spy="scroll"]').each(function(){var t=s(this);e.call(t,t.data())})})}(jQuery),function(r){"use strict";var a=function(t){this.element=r(t)};function e(i){return this.each(function(){var t=r(this),e=t.data("bs.tab");e||t.data("bs.tab",e=new a(this)),"string"==typeof i&&e[i]()})}a.VERSION="3.4.1",a.TRANSITION_DURATION=150,a.prototype.show=function(){var t=this.element,e=t.closest("ul:not(.dropdown-menu)"),i=t.data("target");if(i||(i=(i=t.attr("href"))&&i.replace(/.*(?=#[^\s]*$)/,"")),!t.parent("li").hasClass("active")){var o=e.find(".active:last a"),n=r.Event("hide.bs.tab",{relatedTarget:t[0]}),s=r.Event("show.bs.tab",{relatedTarget:o[0]});if(o.trigger(n),t.trigger(s),!s.isDefaultPrevented()&&!n.isDefaultPrevented()){var a=r(document).find(i);this.activate(t.closest("li"),e),this.activate(a,a.parent(),function(){o.trigger({type:"hidden.bs.tab",relatedTarget:t[0]}),t.trigger({type:"shown.bs.tab",relatedTarget:o[0]})})}}},a.prototype.activate=function(t,e,i){var o=e.find("> .active"),n=i&&r.support.transition&&(o.length&&o.hasClass("fade")||!!e.find("> .fade").length);function s(){o.removeClass("active").find("> .dropdown-menu > .active").removeClass("active").end().find('[data-toggle="tab"]').attr("aria-expanded",!1),t.addClass("active").find('[data-toggle="tab"]').attr("aria-expanded",!0),n?(t[0].offsetWidth,t.addClass("in")):t.removeClass("fade"),t.parent(".dropdown-menu").length&&t.closest("li.dropdown").addClass("active").end().find('[data-toggle="tab"]').attr("aria-expanded",!0),i&&i()}o.length&&n?o.one("bsTransitionEnd",s).emulateTransitionEnd(a.TRANSITION_DURATION):s(),o.removeClass("in")};var t=r.fn.tab;r.fn.tab=e,r.fn.tab.Constructor=a,r.fn.tab.noConflict=function(){return r.fn.tab=t,this};var i=function(t){t.preventDefault(),e.call(r(this),"show")};r(document).on("click.bs.tab.data-api",'[data-toggle="tab"]',i).on("click.bs.tab.data-api",'[data-toggle="pill"]',i)}(jQuery),function(l){"use strict";var h=function(t,e){this.options=l.extend({},h.DEFAULTS,e);var i=this.options.target===h.DEFAULTS.target?l(this.options.target):l(document).find(this.options.target);this.$target=i.on("scroll.bs.affix.data-api",l.proxy(this.checkPosition,this)).on("click.bs.affix.data-api",l.proxy(this.checkPositionWithEventLoop,this)),this.$element=l(t),this.affixed=null,this.unpin=null,this.pinnedOffset=null,this.checkPosition()};function i(o){return this.each(function(){var t=l(this),e=t.data("bs.affix"),i="object"==typeof o&&o;e||t.data("bs.affix",e=new h(this,i)),"string"==typeof o&&e[o]()})}h.VERSION="3.4.1",h.RESET="affix affix-top affix-bottom",h.DEFAULTS={offset:0,target:window},h.prototype.getState=function(t,e,i,o){var n=this.$target.scrollTop(),s=this.$element.offset(),a=this.$target.height();if(null!=i&&"top"==this.affixed)return n<i&&"top";if("bottom"==this.affixed)return null!=i?!(n+this.unpin<=s.top)&&"bottom":!(n+a<=t-o)&&"bottom";var r=null==this.affixed,l=r?n:s.top;return null!=i&&n<=i?"top":null!=o&&t-o<=l+(r?a:e)&&"bottom"},h.prototype.getPinnedOffset=function(){if(this.pinnedOffset)return this.pinnedOffset;this.$element.removeClass(h.RESET).addClass("affix");var t=this.$target.scrollTop(),e=this.$element.offset();return this.pinnedOffset=e.top-t},h.prototype.checkPositionWithEventLoop=function(){setTimeout(l.proxy(this.checkPosition,this),1)},h.prototype.checkPosition=function(){if(this.$element.is(":visible")){var t=this.$element.height(),e=this.options.offset,i=e.top,o=e.bottom,n=Math.max(l(document).height(),l(document.body).height());"object"!=typeof e&&(o=i=e),"function"==typeof i&&(i=e.top(this.$element)),"function"==typeof o&&(o=e.bottom(this.$element));var s=this.getState(n,t,i,o);if(this.affixed!=s){null!=this.unpin&&this.$element.css("top","");var a="affix"+(s?"-"+s:""),r=l.Event(a+".bs.affix");if(this.$element.trigger(r),r.isDefaultPrevented())return;this.affixed=s,this.unpin="bottom"==s?this.getPinnedOffset():null,this.$element.removeClass(h.RESET).addClass(a).trigger(a.replace("affix","affixed")+".bs.affix")}"bottom"==s&&this.$element.offset({top:n-t-o})}};var t=l.fn.affix;l.fn.affix=i,l.fn.affix.Constructor=h,l.fn.affix.noConflict=function(){return l.fn.affix=t,this},l(window).on("load",function(){l('[data-spy="affix"]').each(function(){var t=l(this),e=t.data();e.offset=e.offset||{},null!=e.offsetBottom&&(e.offset.bottom=e.offsetBottom),null!=e.offsetTop&&(e.offset.top=e.offsetTop),i.call(t,e)})})}(jQuery); \ No newline at end of file
diff --git a/bitbake/lib/toaster/toastergui/static/js/bootstrap.min.js b/bitbake/lib/toaster/toastergui/static/js/bootstrap.min.js
deleted file mode 100644
index c4a924160d..0000000000
--- a/bitbake/lib/toaster/toastergui/static/js/bootstrap.min.js
+++ /dev/null
@@ -1,7 +0,0 @@
-/*!
- * Bootstrap v3.3.6 (http://getbootstrap.com)
- * Copyright 2011-2016 Twitter, Inc.
- * Licensed under the MIT license
- */
-if("undefined"==typeof jQuery)throw new Error("Bootstrap's JavaScript requires jQuery");+function(a){"use strict";var b=a.fn.jquery.split(" ")[0].split(".");if(b[0]<2&&b[1]<9||1==b[0]&&9==b[1]&&b[2]<1||b[0]>2)throw new Error("Bootstrap's JavaScript requires jQuery version 1.9.1 or higher, but lower than version 3")}(jQuery),+function(a){"use strict";function b(){var a=document.createElement("bootstrap"),b={WebkitTransition:"webkitTransitionEnd",MozTransition:"transitionend",OTransition:"oTransitionEnd otransitionend",transition:"transitionend"};for(var c in b)if(void 0!==a.style[c])return{end:b[c]};return!1}a.fn.emulateTransitionEnd=function(b){var c=!1,d=this;a(this).one("bsTransitionEnd",function(){c=!0});var e=function(){c||a(d).trigger(a.support.transition.end)};return setTimeout(e,b),this},a(function(){a.support.transition=b(),a.support.transition&&(a.event.special.bsTransitionEnd={bindType:a.support.transition.end,delegateType:a.support.transition.end,handle:function(b){return a(b.target).is(this)?b.handleObj.handler.apply(this,arguments):void 0}})})}(jQuery),+function(a){"use strict";function b(b){return this.each(function(){var c=a(this),e=c.data("bs.alert");e||c.data("bs.alert",e=new d(this)),"string"==typeof b&&e[b].call(c)})}var c='[data-dismiss="alert"]',d=function(b){a(b).on("click",c,this.close)};d.VERSION="3.3.6",d.TRANSITION_DURATION=150,d.prototype.close=function(b){function c(){g.detach().trigger("closed.bs.alert").remove()}var e=a(this),f=e.attr("data-target");f||(f=e.attr("href"),f=f&&f.replace(/.*(?=#[^\s]*$)/,""));var g=a(f);b&&b.preventDefault(),g.length||(g=e.closest(".alert")),g.trigger(b=a.Event("close.bs.alert")),b.isDefaultPrevented()||(g.removeClass("in"),a.support.transition&&g.hasClass("fade")?g.one("bsTransitionEnd",c).emulateTransitionEnd(d.TRANSITION_DURATION):c())};var e=a.fn.alert;a.fn.alert=b,a.fn.alert.Constructor=d,a.fn.alert.noConflict=function(){return a.fn.alert=e,this},a(document).on("click.bs.alert.data-api",c,d.prototype.close)}(jQuery),+function(a){"use strict";function b(b){return this.each(function(){var d=a(this),e=d.data("bs.button"),f="object"==typeof b&&b;e||d.data("bs.button",e=new c(this,f)),"toggle"==b?e.toggle():b&&e.setState(b)})}var c=function(b,d){this.$element=a(b),this.options=a.extend({},c.DEFAULTS,d),this.isLoading=!1};c.VERSION="3.3.6",c.DEFAULTS={loadingText:"loading..."},c.prototype.setState=function(b){var c="disabled",d=this.$element,e=d.is("input")?"val":"html",f=d.data();b+="Text",null==f.resetText&&d.data("resetText",d[e]()),setTimeout(a.proxy(function(){d[e](null==f[b]?this.options[b]:f[b]),"loadingText"==b?(this.isLoading=!0,d.addClass(c).attr(c,c)):this.isLoading&&(this.isLoading=!1,d.removeClass(c).removeAttr(c))},this),0)},c.prototype.toggle=function(){var a=!0,b=this.$element.closest('[data-toggle="buttons"]');if(b.length){var c=this.$element.find("input");"radio"==c.prop("type")?(c.prop("checked")&&(a=!1),b.find(".active").removeClass("active"),this.$element.addClass("active")):"checkbox"==c.prop("type")&&(c.prop("checked")!==this.$element.hasClass("active")&&(a=!1),this.$element.toggleClass("active")),c.prop("checked",this.$element.hasClass("active")),a&&c.trigger("change")}else this.$element.attr("aria-pressed",!this.$element.hasClass("active")),this.$element.toggleClass("active")};var d=a.fn.button;a.fn.button=b,a.fn.button.Constructor=c,a.fn.button.noConflict=function(){return a.fn.button=d,this},a(document).on("click.bs.button.data-api",'[data-toggle^="button"]',function(c){var d=a(c.target);d.hasClass("btn")||(d=d.closest(".btn")),b.call(d,"toggle"),a(c.target).is('input[type="radio"]')||a(c.target).is('input[type="checkbox"]')||c.preventDefault()}).on("focus.bs.button.data-api blur.bs.button.data-api",'[data-toggle^="button"]',function(b){a(b.target).closest(".btn").toggleClass("focus",/^focus(in)?$/.test(b.type))})}(jQuery),+function(a){"use strict";function b(b){return this.each(function(){var d=a(this),e=d.data("bs.carousel"),f=a.extend({},c.DEFAULTS,d.data(),"object"==typeof b&&b),g="string"==typeof b?b:f.slide;e||d.data("bs.carousel",e=new c(this,f)),"number"==typeof b?e.to(b):g?e[g]():f.interval&&e.pause().cycle()})}var c=function(b,c){this.$element=a(b),this.$indicators=this.$element.find(".carousel-indicators"),this.options=c,this.paused=null,this.sliding=null,this.interval=null,this.$active=null,this.$items=null,this.options.keyboard&&this.$element.on("keydown.bs.carousel",a.proxy(this.keydown,this)),"hover"==this.options.pause&&!("ontouchstart"in document.documentElement)&&this.$element.on("mouseenter.bs.carousel",a.proxy(this.pause,this)).on("mouseleave.bs.carousel",a.proxy(this.cycle,this))};c.VERSION="3.3.6",c.TRANSITION_DURATION=600,c.DEFAULTS={interval:5e3,pause:"hover",wrap:!0,keyboard:!0},c.prototype.keydown=function(a){if(!/input|textarea/i.test(a.target.tagName)){switch(a.which){case 37:this.prev();break;case 39:this.next();break;default:return}a.preventDefault()}},c.prototype.cycle=function(b){return b||(this.paused=!1),this.interval&&clearInterval(this.interval),this.options.interval&&!this.paused&&(this.interval=setInterval(a.proxy(this.next,this),this.options.interval)),this},c.prototype.getItemIndex=function(a){return this.$items=a.parent().children(".item"),this.$items.index(a||this.$active)},c.prototype.getItemForDirection=function(a,b){var c=this.getItemIndex(b),d="prev"==a&&0===c||"next"==a&&c==this.$items.length-1;if(d&&!this.options.wrap)return b;var e="prev"==a?-1:1,f=(c+e)%this.$items.length;return this.$items.eq(f)},c.prototype.to=function(a){var b=this,c=this.getItemIndex(this.$active=this.$element.find(".item.active"));return a>this.$items.length-1||0>a?void 0:this.sliding?this.$element.one("slid.bs.carousel",function(){b.to(a)}):c==a?this.pause().cycle():this.slide(a>c?"next":"prev",this.$items.eq(a))},c.prototype.pause=function(b){return b||(this.paused=!0),this.$element.find(".next, .prev").length&&a.support.transition&&(this.$element.trigger(a.support.transition.end),this.cycle(!0)),this.interval=clearInterval(this.interval),this},c.prototype.next=function(){return this.sliding?void 0:this.slide("next")},c.prototype.prev=function(){return this.sliding?void 0:this.slide("prev")},c.prototype.slide=function(b,d){var e=this.$element.find(".item.active"),f=d||this.getItemForDirection(b,e),g=this.interval,h="next"==b?"left":"right",i=this;if(f.hasClass("active"))return this.sliding=!1;var j=f[0],k=a.Event("slide.bs.carousel",{relatedTarget:j,direction:h});if(this.$element.trigger(k),!k.isDefaultPrevented()){if(this.sliding=!0,g&&this.pause(),this.$indicators.length){this.$indicators.find(".active").removeClass("active");var l=a(this.$indicators.children()[this.getItemIndex(f)]);l&&l.addClass("active")}var m=a.Event("slid.bs.carousel",{relatedTarget:j,direction:h});return a.support.transition&&this.$element.hasClass("slide")?(f.addClass(b),f[0].offsetWidth,e.addClass(h),f.addClass(h),e.one("bsTransitionEnd",function(){f.removeClass([b,h].join(" ")).addClass("active"),e.removeClass(["active",h].join(" ")),i.sliding=!1,setTimeout(function(){i.$element.trigger(m)},0)}).emulateTransitionEnd(c.TRANSITION_DURATION)):(e.removeClass("active"),f.addClass("active"),this.sliding=!1,this.$element.trigger(m)),g&&this.cycle(),this}};var d=a.fn.carousel;a.fn.carousel=b,a.fn.carousel.Constructor=c,a.fn.carousel.noConflict=function(){return a.fn.carousel=d,this};var e=function(c){var d,e=a(this),f=a(e.attr("data-target")||(d=e.attr("href"))&&d.replace(/.*(?=#[^\s]+$)/,""));if(f.hasClass("carousel")){var g=a.extend({},f.data(),e.data()),h=e.attr("data-slide-to");h&&(g.interval=!1),b.call(f,g),h&&f.data("bs.carousel").to(h),c.preventDefault()}};a(document).on("click.bs.carousel.data-api","[data-slide]",e).on("click.bs.carousel.data-api","[data-slide-to]",e),a(window).on("load",function(){a('[data-ride="carousel"]').each(function(){var c=a(this);b.call(c,c.data())})})}(jQuery),+function(a){"use strict";function b(b){var c,d=b.attr("data-target")||(c=b.attr("href"))&&c.replace(/.*(?=#[^\s]+$)/,"");return a(d)}function c(b){return this.each(function(){var c=a(this),e=c.data("bs.collapse"),f=a.extend({},d.DEFAULTS,c.data(),"object"==typeof b&&b);!e&&f.toggle&&/show|hide/.test(b)&&(f.toggle=!1),e||c.data("bs.collapse",e=new d(this,f)),"string"==typeof b&&e[b]()})}var d=function(b,c){this.$element=a(b),this.options=a.extend({},d.DEFAULTS,c),this.$trigger=a('[data-toggle="collapse"][href="#'+b.id+'"],[data-toggle="collapse"][data-target="#'+b.id+'"]'),this.transitioning=null,this.options.parent?this.$parent=this.getParent():this.addAriaAndCollapsedClass(this.$element,this.$trigger),this.options.toggle&&this.toggle()};d.VERSION="3.3.6",d.TRANSITION_DURATION=350,d.DEFAULTS={toggle:!0},d.prototype.dimension=function(){var a=this.$element.hasClass("width");return a?"width":"height"},d.prototype.show=function(){if(!this.transitioning&&!this.$element.hasClass("in")){var b,e=this.$parent&&this.$parent.children(".panel").children(".in, .collapsing");if(!(e&&e.length&&(b=e.data("bs.collapse"),b&&b.transitioning))){var f=a.Event("show.bs.collapse");if(this.$element.trigger(f),!f.isDefaultPrevented()){e&&e.length&&(c.call(e,"hide"),b||e.data("bs.collapse",null));var g=this.dimension();this.$element.removeClass("collapse").addClass("collapsing")[g](0).attr("aria-expanded",!0),this.$trigger.removeClass("collapsed").attr("aria-expanded",!0),this.transitioning=1;var h=function(){this.$element.removeClass("collapsing").addClass("collapse in")[g](""),this.transitioning=0,this.$element.trigger("shown.bs.collapse")};if(!a.support.transition)return h.call(this);var i=a.camelCase(["scroll",g].join("-"));this.$element.one("bsTransitionEnd",a.proxy(h,this)).emulateTransitionEnd(d.TRANSITION_DURATION)[g](this.$element[0][i])}}}},d.prototype.hide=function(){if(!this.transitioning&&this.$element.hasClass("in")){var b=a.Event("hide.bs.collapse");if(this.$element.trigger(b),!b.isDefaultPrevented()){var c=this.dimension();this.$element[c](this.$element[c]())[0].offsetHeight,this.$element.addClass("collapsing").removeClass("collapse in").attr("aria-expanded",!1),this.$trigger.addClass("collapsed").attr("aria-expanded",!1),this.transitioning=1;var e=function(){this.transitioning=0,this.$element.removeClass("collapsing").addClass("collapse").trigger("hidden.bs.collapse")};return a.support.transition?void this.$element[c](0).one("bsTransitionEnd",a.proxy(e,this)).emulateTransitionEnd(d.TRANSITION_DURATION):e.call(this)}}},d.prototype.toggle=function(){this[this.$element.hasClass("in")?"hide":"show"]()},d.prototype.getParent=function(){return a(this.options.parent).find('[data-toggle="collapse"][data-parent="'+this.options.parent+'"]').each(a.proxy(function(c,d){var e=a(d);this.addAriaAndCollapsedClass(b(e),e)},this)).end()},d.prototype.addAriaAndCollapsedClass=function(a,b){var c=a.hasClass("in");a.attr("aria-expanded",c),b.toggleClass("collapsed",!c).attr("aria-expanded",c)};var e=a.fn.collapse;a.fn.collapse=c,a.fn.collapse.Constructor=d,a.fn.collapse.noConflict=function(){return a.fn.collapse=e,this},a(document).on("click.bs.collapse.data-api",'[data-toggle="collapse"]',function(d){var e=a(this);e.attr("data-target")||d.preventDefault();var f=b(e),g=f.data("bs.collapse"),h=g?"toggle":e.data();c.call(f,h)})}(jQuery),+function(a){"use strict";function b(b){var c=b.attr("data-target");c||(c=b.attr("href"),c=c&&/#[A-Za-z]/.test(c)&&c.replace(/.*(?=#[^\s]*$)/,""));var d=c&&a(c);return d&&d.length?d:b.parent()}function c(c){c&&3===c.which||(a(e).remove(),a(f).each(function(){var d=a(this),e=b(d),f={relatedTarget:this};e.hasClass("open")&&(c&&"click"==c.type&&/input|textarea/i.test(c.target.tagName)&&a.contains(e[0],c.target)||(e.trigger(c=a.Event("hide.bs.dropdown",f)),c.isDefaultPrevented()||(d.attr("aria-expanded","false"),e.removeClass("open").trigger(a.Event("hidden.bs.dropdown",f)))))}))}function d(b){return this.each(function(){var c=a(this),d=c.data("bs.dropdown");d||c.data("bs.dropdown",d=new g(this)),"string"==typeof b&&d[b].call(c)})}var e=".dropdown-backdrop",f='[data-toggle="dropdown"]',g=function(b){a(b).on("click.bs.dropdown",this.toggle)};g.VERSION="3.3.6",g.prototype.toggle=function(d){var e=a(this);if(!e.is(".disabled, :disabled")){var f=b(e),g=f.hasClass("open");if(c(),!g){"ontouchstart"in document.documentElement&&!f.closest(".navbar-nav").length&&a(document.createElement("div")).addClass("dropdown-backdrop").insertAfter(a(this)).on("click",c);var h={relatedTarget:this};if(f.trigger(d=a.Event("show.bs.dropdown",h)),d.isDefaultPrevented())return;e.trigger("focus").attr("aria-expanded","true"),f.toggleClass("open").trigger(a.Event("shown.bs.dropdown",h))}return!1}},g.prototype.keydown=function(c){if(/(38|40|27|32)/.test(c.which)&&!/input|textarea/i.test(c.target.tagName)){var d=a(this);if(c.preventDefault(),c.stopPropagation(),!d.is(".disabled, :disabled")){var e=b(d),g=e.hasClass("open");if(!g&&27!=c.which||g&&27==c.which)return 27==c.which&&e.find(f).trigger("focus"),d.trigger("click");var h=" li:not(.disabled):visible a",i=e.find(".dropdown-menu"+h);if(i.length){var j=i.index(c.target);38==c.which&&j>0&&j--,40==c.which&&j<i.length-1&&j++,~j||(j=0),i.eq(j).trigger("focus")}}}};var h=a.fn.dropdown;a.fn.dropdown=d,a.fn.dropdown.Constructor=g,a.fn.dropdown.noConflict=function(){return a.fn.dropdown=h,this},a(document).on("click.bs.dropdown.data-api",c).on("click.bs.dropdown.data-api",".dropdown form",function(a){a.stopPropagation()}).on("click.bs.dropdown.data-api",f,g.prototype.toggle).on("keydown.bs.dropdown.data-api",f,g.prototype.keydown).on("keydown.bs.dropdown.data-api",".dropdown-menu",g.prototype.keydown)}(jQuery),+function(a){"use strict";function b(b,d){return this.each(function(){var e=a(this),f=e.data("bs.modal"),g=a.extend({},c.DEFAULTS,e.data(),"object"==typeof b&&b);f||e.data("bs.modal",f=new c(this,g)),"string"==typeof b?f[b](d):g.show&&f.show(d)})}var c=function(b,c){this.options=c,this.$body=a(document.body),this.$element=a(b),this.$dialog=this.$element.find(".modal-dialog"),this.$backdrop=null,this.isShown=null,this.originalBodyPad=null,this.scrollbarWidth=0,this.ignoreBackdropClick=!1,this.options.remote&&this.$element.find(".modal-content").load(this.options.remote,a.proxy(function(){this.$element.trigger("loaded.bs.modal")},this))};c.VERSION="3.3.6",c.TRANSITION_DURATION=300,c.BACKDROP_TRANSITION_DURATION=150,c.DEFAULTS={backdrop:!0,keyboard:!0,show:!0},c.prototype.toggle=function(a){return this.isShown?this.hide():this.show(a)},c.prototype.show=function(b){var d=this,e=a.Event("show.bs.modal",{relatedTarget:b});this.$element.trigger(e),this.isShown||e.isDefaultPrevented()||(this.isShown=!0,this.checkScrollbar(),this.setScrollbar(),this.$body.addClass("modal-open"),this.escape(),this.resize(),this.$element.on("click.dismiss.bs.modal",'[data-dismiss="modal"]',a.proxy(this.hide,this)),this.$dialog.on("mousedown.dismiss.bs.modal",function(){d.$element.one("mouseup.dismiss.bs.modal",function(b){a(b.target).is(d.$element)&&(d.ignoreBackdropClick=!0)})}),this.backdrop(function(){var e=a.support.transition&&d.$element.hasClass("fade");d.$element.parent().length||d.$element.appendTo(d.$body),d.$element.show().scrollTop(0),d.adjustDialog(),e&&d.$element[0].offsetWidth,d.$element.addClass("in"),d.enforceFocus();var f=a.Event("shown.bs.modal",{relatedTarget:b});e?d.$dialog.one("bsTransitionEnd",function(){d.$element.trigger("focus").trigger(f)}).emulateTransitionEnd(c.TRANSITION_DURATION):d.$element.trigger("focus").trigger(f)}))},c.prototype.hide=function(b){b&&b.preventDefault(),b=a.Event("hide.bs.modal"),this.$element.trigger(b),this.isShown&&!b.isDefaultPrevented()&&(this.isShown=!1,this.escape(),this.resize(),a(document).off("focusin.bs.modal"),this.$element.removeClass("in").off("click.dismiss.bs.modal").off("mouseup.dismiss.bs.modal"),this.$dialog.off("mousedown.dismiss.bs.modal"),a.support.transition&&this.$element.hasClass("fade")?this.$element.one("bsTransitionEnd",a.proxy(this.hideModal,this)).emulateTransitionEnd(c.TRANSITION_DURATION):this.hideModal())},c.prototype.enforceFocus=function(){a(document).off("focusin.bs.modal").on("focusin.bs.modal",a.proxy(function(a){this.$element[0]===a.target||this.$element.has(a.target).length||this.$element.trigger("focus")},this))},c.prototype.escape=function(){this.isShown&&this.options.keyboard?this.$element.on("keydown.dismiss.bs.modal",a.proxy(function(a){27==a.which&&this.hide()},this)):this.isShown||this.$element.off("keydown.dismiss.bs.modal")},c.prototype.resize=function(){this.isShown?a(window).on("resize.bs.modal",a.proxy(this.handleUpdate,this)):a(window).off("resize.bs.modal")},c.prototype.hideModal=function(){var a=this;this.$element.hide(),this.backdrop(function(){a.$body.removeClass("modal-open"),a.resetAdjustments(),a.resetScrollbar(),a.$element.trigger("hidden.bs.modal")})},c.prototype.removeBackdrop=function(){this.$backdrop&&this.$backdrop.remove(),this.$backdrop=null},c.prototype.backdrop=function(b){var d=this,e=this.$element.hasClass("fade")?"fade":"";if(this.isShown&&this.options.backdrop){var f=a.support.transition&&e;if(this.$backdrop=a(document.createElement("div")).addClass("modal-backdrop "+e).appendTo(this.$body),this.$element.on("click.dismiss.bs.modal",a.proxy(function(a){return this.ignoreBackdropClick?void(this.ignoreBackdropClick=!1):void(a.target===a.currentTarget&&("static"==this.options.backdrop?this.$element[0].focus():this.hide()))},this)),f&&this.$backdrop[0].offsetWidth,this.$backdrop.addClass("in"),!b)return;f?this.$backdrop.one("bsTransitionEnd",b).emulateTransitionEnd(c.BACKDROP_TRANSITION_DURATION):b()}else if(!this.isShown&&this.$backdrop){this.$backdrop.removeClass("in");var g=function(){d.removeBackdrop(),b&&b()};a.support.transition&&this.$element.hasClass("fade")?this.$backdrop.one("bsTransitionEnd",g).emulateTransitionEnd(c.BACKDROP_TRANSITION_DURATION):g()}else b&&b()},c.prototype.handleUpdate=function(){this.adjustDialog()},c.prototype.adjustDialog=function(){var a=this.$element[0].scrollHeight>document.documentElement.clientHeight;this.$element.css({paddingLeft:!this.bodyIsOverflowing&&a?this.scrollbarWidth:"",paddingRight:this.bodyIsOverflowing&&!a?this.scrollbarWidth:""})},c.prototype.resetAdjustments=function(){this.$element.css({paddingLeft:"",paddingRight:""})},c.prototype.checkScrollbar=function(){var a=window.innerWidth;if(!a){var b=document.documentElement.getBoundingClientRect();a=b.right-Math.abs(b.left)}this.bodyIsOverflowing=document.body.clientWidth<a,this.scrollbarWidth=this.measureScrollbar()},c.prototype.setScrollbar=function(){var a=parseInt(this.$body.css("padding-right")||0,10);this.originalBodyPad=document.body.style.paddingRight||"",this.bodyIsOverflowing&&this.$body.css("padding-right",a+this.scrollbarWidth)},c.prototype.resetScrollbar=function(){this.$body.css("padding-right",this.originalBodyPad)},c.prototype.measureScrollbar=function(){var a=document.createElement("div");a.className="modal-scrollbar-measure",this.$body.append(a);var b=a.offsetWidth-a.clientWidth;return this.$body[0].removeChild(a),b};var d=a.fn.modal;a.fn.modal=b,a.fn.modal.Constructor=c,a.fn.modal.noConflict=function(){return a.fn.modal=d,this},a(document).on("click.bs.modal.data-api",'[data-toggle="modal"]',function(c){var d=a(this),e=d.attr("href"),f=a(d.attr("data-target")||e&&e.replace(/.*(?=#[^\s]+$)/,"")),g=f.data("bs.modal")?"toggle":a.extend({remote:!/#/.test(e)&&e},f.data(),d.data());d.is("a")&&c.preventDefault(),f.one("show.bs.modal",function(a){a.isDefaultPrevented()||f.one("hidden.bs.modal",function(){d.is(":visible")&&d.trigger("focus")})}),b.call(f,g,this)})}(jQuery),+function(a){"use strict";function b(b){return this.each(function(){var d=a(this),e=d.data("bs.tooltip"),f="object"==typeof b&&b;!e&&/destroy|hide/.test(b)||(e||d.data("bs.tooltip",e=new c(this,f)),"string"==typeof b&&e[b]())})}var c=function(a,b){this.type=null,this.options=null,this.enabled=null,this.timeout=null,this.hoverState=null,this.$element=null,this.inState=null,this.init("tooltip",a,b)};c.VERSION="3.3.6",c.TRANSITION_DURATION=150,c.DEFAULTS={animation:!0,placement:"top",selector:!1,template:'<div class="tooltip" role="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!1,container:!1,viewport:{selector:"body",padding:0}},c.prototype.init=function(b,c,d){if(this.enabled=!0,this.type=b,this.$element=a(c),this.options=this.getOptions(d),this.$viewport=this.options.viewport&&a(a.isFunction(this.options.viewport)?this.options.viewport.call(this,this.$element):this.options.viewport.selector||this.options.viewport),this.inState={click:!1,hover:!1,focus:!1},this.$element[0]instanceof document.constructor&&!this.options.selector)throw new Error("`selector` option must be specified when initializing "+this.type+" on the window.document object!");for(var e=this.options.trigger.split(" "),f=e.length;f--;){var g=e[f];if("click"==g)this.$element.on("click."+this.type,this.options.selector,a.proxy(this.toggle,this));else if("manual"!=g){var h="hover"==g?"mouseenter":"focusin",i="hover"==g?"mouseleave":"focusout";this.$element.on(h+"."+this.type,this.options.selector,a.proxy(this.enter,this)),this.$element.on(i+"."+this.type,this.options.selector,a.proxy(this.leave,this))}}this.options.selector?this._options=a.extend({},this.options,{trigger:"manual",selector:""}):this.fixTitle()},c.prototype.getDefaults=function(){return c.DEFAULTS},c.prototype.getOptions=function(b){return b=a.extend({},this.getDefaults(),this.$element.data(),b),b.delay&&"number"==typeof b.delay&&(b.delay={show:b.delay,hide:b.delay}),b},c.prototype.getDelegateOptions=function(){var b={},c=this.getDefaults();return this._options&&a.each(this._options,function(a,d){c[a]!=d&&(b[a]=d)}),b},c.prototype.enter=function(b){var c=b instanceof this.constructor?b:a(b.currentTarget).data("bs."+this.type);return c||(c=new this.constructor(b.currentTarget,this.getDelegateOptions()),a(b.currentTarget).data("bs."+this.type,c)),b instanceof a.Event&&(c.inState["focusin"==b.type?"focus":"hover"]=!0),c.tip().hasClass("in")||"in"==c.hoverState?void(c.hoverState="in"):(clearTimeout(c.timeout),c.hoverState="in",c.options.delay&&c.options.delay.show?void(c.timeout=setTimeout(function(){"in"==c.hoverState&&c.show()},c.options.delay.show)):c.show())},c.prototype.isInStateTrue=function(){for(var a in this.inState)if(this.inState[a])return!0;return!1},c.prototype.leave=function(b){var c=b instanceof this.constructor?b:a(b.currentTarget).data("bs."+this.type);return c||(c=new this.constructor(b.currentTarget,this.getDelegateOptions()),a(b.currentTarget).data("bs."+this.type,c)),b instanceof a.Event&&(c.inState["focusout"==b.type?"focus":"hover"]=!1),c.isInStateTrue()?void 0:(clearTimeout(c.timeout),c.hoverState="out",c.options.delay&&c.options.delay.hide?void(c.timeout=setTimeout(function(){"out"==c.hoverState&&c.hide()},c.options.delay.hide)):c.hide())},c.prototype.show=function(){var b=a.Event("show.bs."+this.type);if(this.hasContent()&&this.enabled){this.$element.trigger(b);var d=a.contains(this.$element[0].ownerDocument.documentElement,this.$element[0]);if(b.isDefaultPrevented()||!d)return;var e=this,f=this.tip(),g=this.getUID(this.type);this.setContent(),f.attr("id",g),this.$element.attr("aria-describedby",g),this.options.animation&&f.addClass("fade");var h="function"==typeof this.options.placement?this.options.placement.call(this,f[0],this.$element[0]):this.options.placement,i=/\s?auto?\s?/i,j=i.test(h);j&&(h=h.replace(i,"")||"top"),f.detach().css({top:0,left:0,display:"block"}).addClass(h).data("bs."+this.type,this),this.options.container?f.appendTo(this.options.container):f.insertAfter(this.$element),this.$element.trigger("inserted.bs."+this.type);var k=this.getPosition(),l=f[0].offsetWidth,m=f[0].offsetHeight;if(j){var n=h,o=this.getPosition(this.$viewport);h="bottom"==h&&k.bottom+m>o.bottom?"top":"top"==h&&k.top-m<o.top?"bottom":"right"==h&&k.right+l>o.width?"left":"left"==h&&k.left-l<o.left?"right":h,f.removeClass(n).addClass(h)}var p=this.getCalculatedOffset(h,k,l,m);this.applyPlacement(p,h);var q=function(){var a=e.hoverState;e.$element.trigger("shown.bs."+e.type),e.hoverState=null,"out"==a&&e.leave(e)};a.support.transition&&this.$tip.hasClass("fade")?f.one("bsTransitionEnd",q).emulateTransitionEnd(c.TRANSITION_DURATION):q()}},c.prototype.applyPlacement=function(b,c){var d=this.tip(),e=d[0].offsetWidth,f=d[0].offsetHeight,g=parseInt(d.css("margin-top"),10),h=parseInt(d.css("margin-left"),10);isNaN(g)&&(g=0),isNaN(h)&&(h=0),b.top+=g,b.left+=h,a.offset.setOffset(d[0],a.extend({using:function(a){d.css({top:Math.round(a.top),left:Math.round(a.left)})}},b),0),d.addClass("in");var i=d[0].offsetWidth,j=d[0].offsetHeight;"top"==c&&j!=f&&(b.top=b.top+f-j);var k=this.getViewportAdjustedDelta(c,b,i,j);k.left?b.left+=k.left:b.top+=k.top;var l=/top|bottom/.test(c),m=l?2*k.left-e+i:2*k.top-f+j,n=l?"offsetWidth":"offsetHeight";d.offset(b),this.replaceArrow(m,d[0][n],l)},c.prototype.replaceArrow=function(a,b,c){this.arrow().css(c?"left":"top",50*(1-a/b)+"%").css(c?"top":"left","")},c.prototype.setContent=function(){var a=this.tip(),b=this.getTitle();a.find(".tooltip-inner")[this.options.html?"html":"text"](b),a.removeClass("fade in top bottom left right")},c.prototype.hide=function(b){function d(){"in"!=e.hoverState&&f.detach(),e.$element.removeAttr("aria-describedby").trigger("hidden.bs."+e.type),b&&b()}var e=this,f=a(this.$tip),g=a.Event("hide.bs."+this.type);return this.$element.trigger(g),g.isDefaultPrevented()?void 0:(f.removeClass("in"),a.support.transition&&f.hasClass("fade")?f.one("bsTransitionEnd",d).emulateTransitionEnd(c.TRANSITION_DURATION):d(),this.hoverState=null,this)},c.prototype.fixTitle=function(){var a=this.$element;(a.attr("title")||"string"!=typeof a.attr("data-original-title"))&&a.attr("data-original-title",a.attr("title")||"").attr("title","")},c.prototype.hasContent=function(){return this.getTitle()},c.prototype.getPosition=function(b){b=b||this.$element;var c=b[0],d="BODY"==c.tagName,e=c.getBoundingClientRect();null==e.width&&(e=a.extend({},e,{width:e.right-e.left,height:e.bottom-e.top}));var f=d?{top:0,left:0}:b.offset(),g={scroll:d?document.documentElement.scrollTop||document.body.scrollTop:b.scrollTop()},h=d?{width:a(window).width(),height:a(window).height()}:null;return a.extend({},e,g,h,f)},c.prototype.getCalculatedOffset=function(a,b,c,d){return"bottom"==a?{top:b.top+b.height,left:b.left+b.width/2-c/2}:"top"==a?{top:b.top-d,left:b.left+b.width/2-c/2}:"left"==a?{top:b.top+b.height/2-d/2,left:b.left-c}:{top:b.top+b.height/2-d/2,left:b.left+b.width}},c.prototype.getViewportAdjustedDelta=function(a,b,c,d){var e={top:0,left:0};if(!this.$viewport)return e;var f=this.options.viewport&&this.options.viewport.padding||0,g=this.getPosition(this.$viewport);if(/right|left/.test(a)){var h=b.top-f-g.scroll,i=b.top+f-g.scroll+d;h<g.top?e.top=g.top-h:i>g.top+g.height&&(e.top=g.top+g.height-i)}else{var j=b.left-f,k=b.left+f+c;j<g.left?e.left=g.left-j:k>g.right&&(e.left=g.left+g.width-k)}return e},c.prototype.getTitle=function(){var a,b=this.$element,c=this.options;return a=b.attr("data-original-title")||("function"==typeof c.title?c.title.call(b[0]):c.title)},c.prototype.getUID=function(a){do a+=~~(1e6*Math.random());while(document.getElementById(a));return a},c.prototype.tip=function(){if(!this.$tip&&(this.$tip=a(this.options.template),1!=this.$tip.length))throw new Error(this.type+" `template` option must consist of exactly 1 top-level element!");return this.$tip},c.prototype.arrow=function(){return this.$arrow=this.$arrow||this.tip().find(".tooltip-arrow")},c.prototype.enable=function(){this.enabled=!0},c.prototype.disable=function(){this.enabled=!1},c.prototype.toggleEnabled=function(){this.enabled=!this.enabled},c.prototype.toggle=function(b){var c=this;b&&(c=a(b.currentTarget).data("bs."+this.type),c||(c=new this.constructor(b.currentTarget,this.getDelegateOptions()),a(b.currentTarget).data("bs."+this.type,c))),b?(c.inState.click=!c.inState.click,c.isInStateTrue()?c.enter(c):c.leave(c)):c.tip().hasClass("in")?c.leave(c):c.enter(c)},c.prototype.destroy=function(){var a=this;clearTimeout(this.timeout),this.hide(function(){a.$element.off("."+a.type).removeData("bs."+a.type),a.$tip&&a.$tip.detach(),a.$tip=null,a.$arrow=null,a.$viewport=null})};var d=a.fn.tooltip;a.fn.tooltip=b,a.fn.tooltip.Constructor=c,a.fn.tooltip.noConflict=function(){return a.fn.tooltip=d,this}}(jQuery),+function(a){"use strict";function b(b){return this.each(function(){var d=a(this),e=d.data("bs.popover"),f="object"==typeof b&&b;!e&&/destroy|hide/.test(b)||(e||d.data("bs.popover",e=new c(this,f)),"string"==typeof b&&e[b]())})}var c=function(a,b){this.init("popover",a,b)};if(!a.fn.tooltip)throw new Error("Popover requires tooltip.js");c.VERSION="3.3.6",c.DEFAULTS=a.extend({},a.fn.tooltip.Constructor.DEFAULTS,{placement:"right",trigger:"click",content:"",template:'<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-title"></h3><div class="popover-content"></div></div>'}),c.prototype=a.extend({},a.fn.tooltip.Constructor.prototype),c.prototype.constructor=c,c.prototype.getDefaults=function(){return c.DEFAULTS},c.prototype.setContent=function(){var a=this.tip(),b=this.getTitle(),c=this.getContent();a.find(".popover-title")[this.options.html?"html":"text"](b),a.find(".popover-content").children().detach().end()[this.options.html?"string"==typeof c?"html":"append":"text"](c),a.removeClass("fade top bottom left right in"),a.find(".popover-title").html()||a.find(".popover-title").hide()},c.prototype.hasContent=function(){return this.getTitle()||this.getContent()},c.prototype.getContent=function(){var a=this.$element,b=this.options;return a.attr("data-content")||("function"==typeof b.content?b.content.call(a[0]):b.content)},c.prototype.arrow=function(){return this.$arrow=this.$arrow||this.tip().find(".arrow")};var d=a.fn.popover;a.fn.popover=b,a.fn.popover.Constructor=c,a.fn.popover.noConflict=function(){return a.fn.popover=d,this}}(jQuery),+function(a){"use strict";function b(c,d){this.$body=a(document.body),this.$scrollElement=a(a(c).is(document.body)?window:c),this.options=a.extend({},b.DEFAULTS,d),this.selector=(this.options.target||"")+" .nav li > a",this.offsets=[],this.targets=[],this.activeTarget=null,this.scrollHeight=0,this.$scrollElement.on("scroll.bs.scrollspy",a.proxy(this.process,this)),this.refresh(),this.process()}function c(c){return this.each(function(){var d=a(this),e=d.data("bs.scrollspy"),f="object"==typeof c&&c;e||d.data("bs.scrollspy",e=new b(this,f)),"string"==typeof c&&e[c]()})}b.VERSION="3.3.6",b.DEFAULTS={offset:10},b.prototype.getScrollHeight=function(){return this.$scrollElement[0].scrollHeight||Math.max(this.$body[0].scrollHeight,document.documentElement.scrollHeight)},b.prototype.refresh=function(){var b=this,c="offset",d=0;this.offsets=[],this.targets=[],this.scrollHeight=this.getScrollHeight(),a.isWindow(this.$scrollElement[0])||(c="position",d=this.$scrollElement.scrollTop()),this.$body.find(this.selector).map(function(){var b=a(this),e=b.data("target")||b.attr("href"),f=/^#./.test(e)&&a(e);return f&&f.length&&f.is(":visible")&&[[f[c]().top+d,e]]||null}).sort(function(a,b){return a[0]-b[0]}).each(function(){b.offsets.push(this[0]),b.targets.push(this[1])})},b.prototype.process=function(){var a,b=this.$scrollElement.scrollTop()+this.options.offset,c=this.getScrollHeight(),d=this.options.offset+c-this.$scrollElement.height(),e=this.offsets,f=this.targets,g=this.activeTarget;if(this.scrollHeight!=c&&this.refresh(),b>=d)return g!=(a=f[f.length-1])&&this.activate(a);if(g&&b<e[0])return this.activeTarget=null,this.clear();for(a=e.length;a--;)g!=f[a]&&b>=e[a]&&(void 0===e[a+1]||b<e[a+1])&&this.activate(f[a])},b.prototype.activate=function(b){this.activeTarget=b,this.clear();var c=this.selector+'[data-target="'+b+'"],'+this.selector+'[href="'+b+'"]',d=a(c).parents("li").addClass("active");d.parent(".dropdown-menu").length&&(d=d.closest("li.dropdown").addClass("active")),
-d.trigger("activate.bs.scrollspy")},b.prototype.clear=function(){a(this.selector).parentsUntil(this.options.target,".active").removeClass("active")};var d=a.fn.scrollspy;a.fn.scrollspy=c,a.fn.scrollspy.Constructor=b,a.fn.scrollspy.noConflict=function(){return a.fn.scrollspy=d,this},a(window).on("load.bs.scrollspy.data-api",function(){a('[data-spy="scroll"]').each(function(){var b=a(this);c.call(b,b.data())})})}(jQuery),+function(a){"use strict";function b(b){return this.each(function(){var d=a(this),e=d.data("bs.tab");e||d.data("bs.tab",e=new c(this)),"string"==typeof b&&e[b]()})}var c=function(b){this.element=a(b)};c.VERSION="3.3.6",c.TRANSITION_DURATION=150,c.prototype.show=function(){var b=this.element,c=b.closest("ul:not(.dropdown-menu)"),d=b.data("target");if(d||(d=b.attr("href"),d=d&&d.replace(/.*(?=#[^\s]*$)/,"")),!b.parent("li").hasClass("active")){var e=c.find(".active:last a"),f=a.Event("hide.bs.tab",{relatedTarget:b[0]}),g=a.Event("show.bs.tab",{relatedTarget:e[0]});if(e.trigger(f),b.trigger(g),!g.isDefaultPrevented()&&!f.isDefaultPrevented()){var h=a(d);this.activate(b.closest("li"),c),this.activate(h,h.parent(),function(){e.trigger({type:"hidden.bs.tab",relatedTarget:b[0]}),b.trigger({type:"shown.bs.tab",relatedTarget:e[0]})})}}},c.prototype.activate=function(b,d,e){function f(){g.removeClass("active").find("> .dropdown-menu > .active").removeClass("active").end().find('[data-toggle="tab"]').attr("aria-expanded",!1),b.addClass("active").find('[data-toggle="tab"]').attr("aria-expanded",!0),h?(b[0].offsetWidth,b.addClass("in")):b.removeClass("fade"),b.parent(".dropdown-menu").length&&b.closest("li.dropdown").addClass("active").end().find('[data-toggle="tab"]').attr("aria-expanded",!0),e&&e()}var g=d.find("> .active"),h=e&&a.support.transition&&(g.length&&g.hasClass("fade")||!!d.find("> .fade").length);g.length&&h?g.one("bsTransitionEnd",f).emulateTransitionEnd(c.TRANSITION_DURATION):f(),g.removeClass("in")};var d=a.fn.tab;a.fn.tab=b,a.fn.tab.Constructor=c,a.fn.tab.noConflict=function(){return a.fn.tab=d,this};var e=function(c){c.preventDefault(),b.call(a(this),"show")};a(document).on("click.bs.tab.data-api",'[data-toggle="tab"]',e).on("click.bs.tab.data-api",'[data-toggle="pill"]',e)}(jQuery),+function(a){"use strict";function b(b){return this.each(function(){var d=a(this),e=d.data("bs.affix"),f="object"==typeof b&&b;e||d.data("bs.affix",e=new c(this,f)),"string"==typeof b&&e[b]()})}var c=function(b,d){this.options=a.extend({},c.DEFAULTS,d),this.$target=a(this.options.target).on("scroll.bs.affix.data-api",a.proxy(this.checkPosition,this)).on("click.bs.affix.data-api",a.proxy(this.checkPositionWithEventLoop,this)),this.$element=a(b),this.affixed=null,this.unpin=null,this.pinnedOffset=null,this.checkPosition()};c.VERSION="3.3.6",c.RESET="affix affix-top affix-bottom",c.DEFAULTS={offset:0,target:window},c.prototype.getState=function(a,b,c,d){var e=this.$target.scrollTop(),f=this.$element.offset(),g=this.$target.height();if(null!=c&&"top"==this.affixed)return c>e?"top":!1;if("bottom"==this.affixed)return null!=c?e+this.unpin<=f.top?!1:"bottom":a-d>=e+g?!1:"bottom";var h=null==this.affixed,i=h?e:f.top,j=h?g:b;return null!=c&&c>=e?"top":null!=d&&i+j>=a-d?"bottom":!1},c.prototype.getPinnedOffset=function(){if(this.pinnedOffset)return this.pinnedOffset;this.$element.removeClass(c.RESET).addClass("affix");var a=this.$target.scrollTop(),b=this.$element.offset();return this.pinnedOffset=b.top-a},c.prototype.checkPositionWithEventLoop=function(){setTimeout(a.proxy(this.checkPosition,this),1)},c.prototype.checkPosition=function(){if(this.$element.is(":visible")){var b=this.$element.height(),d=this.options.offset,e=d.top,f=d.bottom,g=Math.max(a(document).height(),a(document.body).height());"object"!=typeof d&&(f=e=d),"function"==typeof e&&(e=d.top(this.$element)),"function"==typeof f&&(f=d.bottom(this.$element));var h=this.getState(g,b,e,f);if(this.affixed!=h){null!=this.unpin&&this.$element.css("top","");var i="affix"+(h?"-"+h:""),j=a.Event(i+".bs.affix");if(this.$element.trigger(j),j.isDefaultPrevented())return;this.affixed=h,this.unpin="bottom"==h?this.getPinnedOffset():null,this.$element.removeClass(c.RESET).addClass(i).trigger(i.replace("affix","affixed")+".bs.affix")}"bottom"==h&&this.$element.offset({top:g-b-f})}};var d=a.fn.affix;a.fn.affix=b,a.fn.affix.Constructor=c,a.fn.affix.noConflict=function(){return a.fn.affix=d,this},a(window).on("load",function(){a('[data-spy="affix"]').each(function(){var c=a(this),d=c.data();d.offset=d.offset||{},null!=d.offsetBottom&&(d.offset.bottom=d.offsetBottom),null!=d.offsetTop&&(d.offset.top=d.offsetTop),b.call(c,d)})})}(jQuery); \ No newline at end of file
diff --git a/bitbake/lib/toaster/toastergui/static/js/jquery-3.7.1.min.js b/bitbake/lib/toaster/toastergui/static/js/jquery-3.7.1.min.js
new file mode 100644
index 0000000000..7f37b5d991
--- /dev/null
+++ b/bitbake/lib/toaster/toastergui/static/js/jquery-3.7.1.min.js
@@ -0,0 +1,2 @@
+/*! jQuery v3.7.1 | (c) OpenJS Foundation and other contributors | jquery.org/license */
+!function(e,t){"use strict";"object"==typeof module&&"object"==typeof module.exports?module.exports=e.document?t(e,!0):function(e){if(!e.document)throw new Error("jQuery requires a window with a document");return t(e)}:t(e)}("undefined"!=typeof window?window:this,function(ie,e){"use strict";var oe=[],r=Object.getPrototypeOf,ae=oe.slice,g=oe.flat?function(e){return oe.flat.call(e)}:function(e){return oe.concat.apply([],e)},s=oe.push,se=oe.indexOf,n={},i=n.toString,ue=n.hasOwnProperty,o=ue.toString,a=o.call(Object),le={},v=function(e){return"function"==typeof e&&"number"!=typeof e.nodeType&&"function"!=typeof e.item},y=function(e){return null!=e&&e===e.window},C=ie.document,u={type:!0,src:!0,nonce:!0,noModule:!0};function m(e,t,n){var r,i,o=(n=n||C).createElement("script");if(o.text=e,t)for(r in u)(i=t[r]||t.getAttribute&&t.getAttribute(r))&&o.setAttribute(r,i);n.head.appendChild(o).parentNode.removeChild(o)}function x(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?n[i.call(e)]||"object":typeof e}var t="3.7.1",l=/HTML$/i,ce=function(e,t){return new ce.fn.init(e,t)};function c(e){var t=!!e&&"length"in e&&e.length,n=x(e);return!v(e)&&!y(e)&&("array"===n||0===t||"number"==typeof t&&0<t&&t-1 in e)}function fe(e,t){return e.nodeName&&e.nodeName.toLowerCase()===t.toLowerCase()}ce.fn=ce.prototype={jquery:t,constructor:ce,length:0,toArray:function(){return ae.call(this)},get:function(e){return null==e?ae.call(this):e<0?this[e+this.length]:this[e]},pushStack:function(e){var t=ce.merge(this.constructor(),e);return t.prevObject=this,t},each:function(e){return ce.each(this,e)},map:function(n){return this.pushStack(ce.map(this,function(e,t){return n.call(e,t,e)}))},slice:function(){return this.pushStack(ae.apply(this,arguments))},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},even:function(){return this.pushStack(ce.grep(this,function(e,t){return(t+1)%2}))},odd:function(){return this.pushStack(ce.grep(this,function(e,t){return t%2}))},eq:function(e){var t=this.length,n=+e+(e<0?t:0);return this.pushStack(0<=n&&n<t?[this[n]]:[])},end:function(){return this.prevObject||this.constructor()},push:s,sort:oe.sort,splice:oe.splice},ce.extend=ce.fn.extend=function(){var e,t,n,r,i,o,a=arguments[0]||{},s=1,u=arguments.length,l=!1;for("boolean"==typeof a&&(l=a,a=arguments[s]||{},s++),"object"==typeof a||v(a)||(a={}),s===u&&(a=this,s--);s<u;s++)if(null!=(e=arguments[s]))for(t in e)r=e[t],"__proto__"!==t&&a!==r&&(l&&r&&(ce.isPlainObject(r)||(i=Array.isArray(r)))?(n=a[t],o=i&&!Array.isArray(n)?[]:i||ce.isPlainObject(n)?n:{},i=!1,a[t]=ce.extend(l,o,r)):void 0!==r&&(a[t]=r));return a},ce.extend({expando:"jQuery"+(t+Math.random()).replace(/\D/g,""),isReady:!0,error:function(e){throw new Error(e)},noop:function(){},isPlainObject:function(e){var t,n;return!(!e||"[object Object]"!==i.call(e))&&(!(t=r(e))||"function"==typeof(n=ue.call(t,"constructor")&&t.constructor)&&o.call(n)===a)},isEmptyObject:function(e){var t;for(t in e)return!1;return!0},globalEval:function(e,t,n){m(e,{nonce:t&&t.nonce},n)},each:function(e,t){var n,r=0;if(c(e)){for(n=e.length;r<n;r++)if(!1===t.call(e[r],r,e[r]))break}else for(r in e)if(!1===t.call(e[r],r,e[r]))break;return e},text:function(e){var t,n="",r=0,i=e.nodeType;if(!i)while(t=e[r++])n+=ce.text(t);return 1===i||11===i?e.textContent:9===i?e.documentElement.textContent:3===i||4===i?e.nodeValue:n},makeArray:function(e,t){var n=t||[];return null!=e&&(c(Object(e))?ce.merge(n,"string"==typeof e?[e]:e):s.call(n,e)),n},inArray:function(e,t,n){return null==t?-1:se.call(t,e,n)},isXMLDoc:function(e){var t=e&&e.namespaceURI,n=e&&(e.ownerDocument||e).documentElement;return!l.test(t||n&&n.nodeName||"HTML")},merge:function(e,t){for(var n=+t.length,r=0,i=e.length;r<n;r++)e[i++]=t[r];return e.length=i,e},grep:function(e,t,n){for(var r=[],i=0,o=e.length,a=!n;i<o;i++)!t(e[i],i)!==a&&r.push(e[i]);return r},map:function(e,t,n){var r,i,o=0,a=[];if(c(e))for(r=e.length;o<r;o++)null!=(i=t(e[o],o,n))&&a.push(i);else for(o in e)null!=(i=t(e[o],o,n))&&a.push(i);return g(a)},guid:1,support:le}),"function"==typeof Symbol&&(ce.fn[Symbol.iterator]=oe[Symbol.iterator]),ce.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "),function(e,t){n["[object "+t+"]"]=t.toLowerCase()});var pe=oe.pop,de=oe.sort,he=oe.splice,ge="[\\x20\\t\\r\\n\\f]",ve=new RegExp("^"+ge+"+|((?:^|[^\\\\])(?:\\\\.)*)"+ge+"+$","g");ce.contains=function(e,t){var n=t&&t.parentNode;return e===n||!(!n||1!==n.nodeType||!(e.contains?e.contains(n):e.compareDocumentPosition&&16&e.compareDocumentPosition(n)))};var f=/([\0-\x1f\x7f]|^-?\d)|^-$|[^\x80-\uFFFF\w-]/g;function p(e,t){return t?"\0"===e?"\ufffd":e.slice(0,-1)+"\\"+e.charCodeAt(e.length-1).toString(16)+" ":"\\"+e}ce.escapeSelector=function(e){return(e+"").replace(f,p)};var ye=C,me=s;!function(){var e,b,w,o,a,T,r,C,d,i,k=me,S=ce.expando,E=0,n=0,s=W(),c=W(),u=W(),h=W(),l=function(e,t){return e===t&&(a=!0),0},f="checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",t="(?:\\\\[\\da-fA-F]{1,6}"+ge+"?|\\\\[^\\r\\n\\f]|[\\w-]|[^\0-\\x7f])+",p="\\["+ge+"*("+t+")(?:"+ge+"*([*^$|!~]?=)"+ge+"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|("+t+"))|)"+ge+"*\\]",g=":("+t+")(?:\\((('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|((?:\\\\.|[^\\\\()[\\]]|"+p+")*)|.*)\\)|)",v=new RegExp(ge+"+","g"),y=new RegExp("^"+ge+"*,"+ge+"*"),m=new RegExp("^"+ge+"*([>+~]|"+ge+")"+ge+"*"),x=new RegExp(ge+"|>"),j=new RegExp(g),A=new RegExp("^"+t+"$"),D={ID:new RegExp("^#("+t+")"),CLASS:new RegExp("^\\.("+t+")"),TAG:new RegExp("^("+t+"|[*])"),ATTR:new RegExp("^"+p),PSEUDO:new RegExp("^"+g),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+ge+"*(even|odd|(([+-]|)(\\d*)n|)"+ge+"*(?:([+-]|)"+ge+"*(\\d+)|))"+ge+"*\\)|)","i"),bool:new RegExp("^(?:"+f+")$","i"),needsContext:new RegExp("^"+ge+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+ge+"*((?:-\\d)?\\d*)"+ge+"*\\)|)(?=[^-]|$)","i")},N=/^(?:input|select|textarea|button)$/i,q=/^h\d$/i,L=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,H=/[+~]/,O=new RegExp("\\\\[\\da-fA-F]{1,6}"+ge+"?|\\\\([^\\r\\n\\f])","g"),P=function(e,t){var n="0x"+e.slice(1)-65536;return t||(n<0?String.fromCharCode(n+65536):String.fromCharCode(n>>10|55296,1023&n|56320))},M=function(){V()},R=J(function(e){return!0===e.disabled&&fe(e,"fieldset")},{dir:"parentNode",next:"legend"});try{k.apply(oe=ae.call(ye.childNodes),ye.childNodes),oe[ye.childNodes.length].nodeType}catch(e){k={apply:function(e,t){me.apply(e,ae.call(t))},call:function(e){me.apply(e,ae.call(arguments,1))}}}function I(t,e,n,r){var i,o,a,s,u,l,c,f=e&&e.ownerDocument,p=e?e.nodeType:9;if(n=n||[],"string"!=typeof t||!t||1!==p&&9!==p&&11!==p)return n;if(!r&&(V(e),e=e||T,C)){if(11!==p&&(u=L.exec(t)))if(i=u[1]){if(9===p){if(!(a=e.getElementById(i)))return n;if(a.id===i)return k.call(n,a),n}else if(f&&(a=f.getElementById(i))&&I.contains(e,a)&&a.id===i)return k.call(n,a),n}else{if(u[2])return k.apply(n,e.getElementsByTagName(t)),n;if((i=u[3])&&e.getElementsByClassName)return k.apply(n,e.getElementsByClassName(i)),n}if(!(h[t+" "]||d&&d.test(t))){if(c=t,f=e,1===p&&(x.test(t)||m.test(t))){(f=H.test(t)&&U(e.parentNode)||e)==e&&le.scope||((s=e.getAttribute("id"))?s=ce.escapeSelector(s):e.setAttribute("id",s=S)),o=(l=Y(t)).length;while(o--)l[o]=(s?"#"+s:":scope")+" "+Q(l[o]);c=l.join(",")}try{return k.apply(n,f.querySelectorAll(c)),n}catch(e){h(t,!0)}finally{s===S&&e.removeAttribute("id")}}}return re(t.replace(ve,"$1"),e,n,r)}function W(){var r=[];return function e(t,n){return r.push(t+" ")>b.cacheLength&&delete e[r.shift()],e[t+" "]=n}}function F(e){return e[S]=!0,e}function $(e){var t=T.createElement("fieldset");try{return!!e(t)}catch(e){return!1}finally{t.parentNode&&t.parentNode.removeChild(t),t=null}}function B(t){return function(e){return fe(e,"input")&&e.type===t}}function _(t){return function(e){return(fe(e,"input")||fe(e,"button"))&&e.type===t}}function z(t){return function(e){return"form"in e?e.parentNode&&!1===e.disabled?"label"in e?"label"in e.parentNode?e.parentNode.disabled===t:e.disabled===t:e.isDisabled===t||e.isDisabled!==!t&&R(e)===t:e.disabled===t:"label"in e&&e.disabled===t}}function X(a){return F(function(o){return o=+o,F(function(e,t){var n,r=a([],e.length,o),i=r.length;while(i--)e[n=r[i]]&&(e[n]=!(t[n]=e[n]))})})}function U(e){return e&&"undefined"!=typeof e.getElementsByTagName&&e}function V(e){var t,n=e?e.ownerDocument||e:ye;return n!=T&&9===n.nodeType&&n.documentElement&&(r=(T=n).documentElement,C=!ce.isXMLDoc(T),i=r.matches||r.webkitMatchesSelector||r.msMatchesSelector,r.msMatchesSelector&&ye!=T&&(t=T.defaultView)&&t.top!==t&&t.addEventListener("unload",M),le.getById=$(function(e){return r.appendChild(e).id=ce.expando,!T.getElementsByName||!T.getElementsByName(ce.expando).length}),le.disconnectedMatch=$(function(e){return i.call(e,"*")}),le.scope=$(function(){return T.querySelectorAll(":scope")}),le.cssHas=$(function(){try{return T.querySelector(":has(*,:jqfake)"),!1}catch(e){return!0}}),le.getById?(b.filter.ID=function(e){var t=e.replace(O,P);return function(e){return e.getAttribute("id")===t}},b.find.ID=function(e,t){if("undefined"!=typeof t.getElementById&&C){var n=t.getElementById(e);return n?[n]:[]}}):(b.filter.ID=function(e){var n=e.replace(O,P);return function(e){var t="undefined"!=typeof e.getAttributeNode&&e.getAttributeNode("id");return t&&t.value===n}},b.find.ID=function(e,t){if("undefined"!=typeof t.getElementById&&C){var n,r,i,o=t.getElementById(e);if(o){if((n=o.getAttributeNode("id"))&&n.value===e)return[o];i=t.getElementsByName(e),r=0;while(o=i[r++])if((n=o.getAttributeNode("id"))&&n.value===e)return[o]}return[]}}),b.find.TAG=function(e,t){return"undefined"!=typeof t.getElementsByTagName?t.getElementsByTagName(e):t.querySelectorAll(e)},b.find.CLASS=function(e,t){if("undefined"!=typeof t.getElementsByClassName&&C)return t.getElementsByClassName(e)},d=[],$(function(e){var t;r.appendChild(e).innerHTML="<a id='"+S+"' href='' disabled='disabled'></a><select id='"+S+"-\r\\' disabled='disabled'><option selected=''></option></select>",e.querySelectorAll("[selected]").length||d.push("\\["+ge+"*(?:value|"+f+")"),e.querySelectorAll("[id~="+S+"-]").length||d.push("~="),e.querySelectorAll("a#"+S+"+*").length||d.push(".#.+[+~]"),e.querySelectorAll(":checked").length||d.push(":checked"),(t=T.createElement("input")).setAttribute("type","hidden"),e.appendChild(t).setAttribute("name","D"),r.appendChild(e).disabled=!0,2!==e.querySelectorAll(":disabled").length&&d.push(":enabled",":disabled"),(t=T.createElement("input")).setAttribute("name",""),e.appendChild(t),e.querySelectorAll("[name='']").length||d.push("\\["+ge+"*name"+ge+"*="+ge+"*(?:''|\"\")")}),le.cssHas||d.push(":has"),d=d.length&&new RegExp(d.join("|")),l=function(e,t){if(e===t)return a=!0,0;var n=!e.compareDocumentPosition-!t.compareDocumentPosition;return n||(1&(n=(e.ownerDocument||e)==(t.ownerDocument||t)?e.compareDocumentPosition(t):1)||!le.sortDetached&&t.compareDocumentPosition(e)===n?e===T||e.ownerDocument==ye&&I.contains(ye,e)?-1:t===T||t.ownerDocument==ye&&I.contains(ye,t)?1:o?se.call(o,e)-se.call(o,t):0:4&n?-1:1)}),T}for(e in I.matches=function(e,t){return I(e,null,null,t)},I.matchesSelector=function(e,t){if(V(e),C&&!h[t+" "]&&(!d||!d.test(t)))try{var n=i.call(e,t);if(n||le.disconnectedMatch||e.document&&11!==e.document.nodeType)return n}catch(e){h(t,!0)}return 0<I(t,T,null,[e]).length},I.contains=function(e,t){return(e.ownerDocument||e)!=T&&V(e),ce.contains(e,t)},I.attr=function(e,t){(e.ownerDocument||e)!=T&&V(e);var n=b.attrHandle[t.toLowerCase()],r=n&&ue.call(b.attrHandle,t.toLowerCase())?n(e,t,!C):void 0;return void 0!==r?r:e.getAttribute(t)},I.error=function(e){throw new Error("Syntax error, unrecognized expression: "+e)},ce.uniqueSort=function(e){var t,n=[],r=0,i=0;if(a=!le.sortStable,o=!le.sortStable&&ae.call(e,0),de.call(e,l),a){while(t=e[i++])t===e[i]&&(r=n.push(i));while(r--)he.call(e,n[r],1)}return o=null,e},ce.fn.uniqueSort=function(){return this.pushStack(ce.uniqueSort(ae.apply(this)))},(b=ce.expr={cacheLength:50,createPseudo:F,match:D,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(e){return e[1]=e[1].replace(O,P),e[3]=(e[3]||e[4]||e[5]||"").replace(O,P),"~="===e[2]&&(e[3]=" "+e[3]+" "),e.slice(0,4)},CHILD:function(e){return e[1]=e[1].toLowerCase(),"nth"===e[1].slice(0,3)?(e[3]||I.error(e[0]),e[4]=+(e[4]?e[5]+(e[6]||1):2*("even"===e[3]||"odd"===e[3])),e[5]=+(e[7]+e[8]||"odd"===e[3])):e[3]&&I.error(e[0]),e},PSEUDO:function(e){var t,n=!e[6]&&e[2];return D.CHILD.test(e[0])?null:(e[3]?e[2]=e[4]||e[5]||"":n&&j.test(n)&&(t=Y(n,!0))&&(t=n.indexOf(")",n.length-t)-n.length)&&(e[0]=e[0].slice(0,t),e[2]=n.slice(0,t)),e.slice(0,3))}},filter:{TAG:function(e){var t=e.replace(O,P).toLowerCase();return"*"===e?function(){return!0}:function(e){return fe(e,t)}},CLASS:function(e){var t=s[e+" "];return t||(t=new RegExp("(^|"+ge+")"+e+"("+ge+"|$)"))&&s(e,function(e){return t.test("string"==typeof e.className&&e.className||"undefined"!=typeof e.getAttribute&&e.getAttribute("class")||"")})},ATTR:function(n,r,i){return function(e){var t=I.attr(e,n);return null==t?"!="===r:!r||(t+="","="===r?t===i:"!="===r?t!==i:"^="===r?i&&0===t.indexOf(i):"*="===r?i&&-1<t.indexOf(i):"$="===r?i&&t.slice(-i.length)===i:"~="===r?-1<(" "+t.replace(v," ")+" ").indexOf(i):"|="===r&&(t===i||t.slice(0,i.length+1)===i+"-"))}},CHILD:function(d,e,t,h,g){var v="nth"!==d.slice(0,3),y="last"!==d.slice(-4),m="of-type"===e;return 1===h&&0===g?function(e){return!!e.parentNode}:function(e,t,n){var r,i,o,a,s,u=v!==y?"nextSibling":"previousSibling",l=e.parentNode,c=m&&e.nodeName.toLowerCase(),f=!n&&!m,p=!1;if(l){if(v){while(u){o=e;while(o=o[u])if(m?fe(o,c):1===o.nodeType)return!1;s=u="only"===d&&!s&&"nextSibling"}return!0}if(s=[y?l.firstChild:l.lastChild],y&&f){p=(a=(r=(i=l[S]||(l[S]={}))[d]||[])[0]===E&&r[1])&&r[2],o=a&&l.childNodes[a];while(o=++a&&o&&o[u]||(p=a=0)||s.pop())if(1===o.nodeType&&++p&&o===e){i[d]=[E,a,p];break}}else if(f&&(p=a=(r=(i=e[S]||(e[S]={}))[d]||[])[0]===E&&r[1]),!1===p)while(o=++a&&o&&o[u]||(p=a=0)||s.pop())if((m?fe(o,c):1===o.nodeType)&&++p&&(f&&((i=o[S]||(o[S]={}))[d]=[E,p]),o===e))break;return(p-=g)===h||p%h==0&&0<=p/h}}},PSEUDO:function(e,o){var t,a=b.pseudos[e]||b.setFilters[e.toLowerCase()]||I.error("unsupported pseudo: "+e);return a[S]?a(o):1<a.length?(t=[e,e,"",o],b.setFilters.hasOwnProperty(e.toLowerCase())?F(function(e,t){var n,r=a(e,o),i=r.length;while(i--)e[n=se.call(e,r[i])]=!(t[n]=r[i])}):function(e){return a(e,0,t)}):a}},pseudos:{not:F(function(e){var r=[],i=[],s=ne(e.replace(ve,"$1"));return s[S]?F(function(e,t,n,r){var i,o=s(e,null,r,[]),a=e.length;while(a--)(i=o[a])&&(e[a]=!(t[a]=i))}):function(e,t,n){return r[0]=e,s(r,null,n,i),r[0]=null,!i.pop()}}),has:F(function(t){return function(e){return 0<I(t,e).length}}),contains:F(function(t){return t=t.replace(O,P),function(e){return-1<(e.textContent||ce.text(e)).indexOf(t)}}),lang:F(function(n){return A.test(n||"")||I.error("unsupported lang: "+n),n=n.replace(O,P).toLowerCase(),function(e){var t;do{if(t=C?e.lang:e.getAttribute("xml:lang")||e.getAttribute("lang"))return(t=t.toLowerCase())===n||0===t.indexOf(n+"-")}while((e=e.parentNode)&&1===e.nodeType);return!1}}),target:function(e){var t=ie.location&&ie.location.hash;return t&&t.slice(1)===e.id},root:function(e){return e===r},focus:function(e){return e===function(){try{return T.activeElement}catch(e){}}()&&T.hasFocus()&&!!(e.type||e.href||~e.tabIndex)},enabled:z(!1),disabled:z(!0),checked:function(e){return fe(e,"input")&&!!e.checked||fe(e,"option")&&!!e.selected},selected:function(e){return e.parentNode&&e.parentNode.selectedIndex,!0===e.selected},empty:function(e){for(e=e.firstChild;e;e=e.nextSibling)if(e.nodeType<6)return!1;return!0},parent:function(e){return!b.pseudos.empty(e)},header:function(e){return q.test(e.nodeName)},input:function(e){return N.test(e.nodeName)},button:function(e){return fe(e,"input")&&"button"===e.type||fe(e,"button")},text:function(e){var t;return fe(e,"input")&&"text"===e.type&&(null==(t=e.getAttribute("type"))||"text"===t.toLowerCase())},first:X(function(){return[0]}),last:X(function(e,t){return[t-1]}),eq:X(function(e,t,n){return[n<0?n+t:n]}),even:X(function(e,t){for(var n=0;n<t;n+=2)e.push(n);return e}),odd:X(function(e,t){for(var n=1;n<t;n+=2)e.push(n);return e}),lt:X(function(e,t,n){var r;for(r=n<0?n+t:t<n?t:n;0<=--r;)e.push(r);return e}),gt:X(function(e,t,n){for(var r=n<0?n+t:n;++r<t;)e.push(r);return e})}}).pseudos.nth=b.pseudos.eq,{radio:!0,checkbox:!0,file:!0,password:!0,image:!0})b.pseudos[e]=B(e);for(e in{submit:!0,reset:!0})b.pseudos[e]=_(e);function G(){}function Y(e,t){var n,r,i,o,a,s,u,l=c[e+" "];if(l)return t?0:l.slice(0);a=e,s=[],u=b.preFilter;while(a){for(o in n&&!(r=y.exec(a))||(r&&(a=a.slice(r[0].length)||a),s.push(i=[])),n=!1,(r=m.exec(a))&&(n=r.shift(),i.push({value:n,type:r[0].replace(ve," ")}),a=a.slice(n.length)),b.filter)!(r=D[o].exec(a))||u[o]&&!(r=u[o](r))||(n=r.shift(),i.push({value:n,type:o,matches:r}),a=a.slice(n.length));if(!n)break}return t?a.length:a?I.error(e):c(e,s).slice(0)}function Q(e){for(var t=0,n=e.length,r="";t<n;t++)r+=e[t].value;return r}function J(a,e,t){var s=e.dir,u=e.next,l=u||s,c=t&&"parentNode"===l,f=n++;return e.first?function(e,t,n){while(e=e[s])if(1===e.nodeType||c)return a(e,t,n);return!1}:function(e,t,n){var r,i,o=[E,f];if(n){while(e=e[s])if((1===e.nodeType||c)&&a(e,t,n))return!0}else while(e=e[s])if(1===e.nodeType||c)if(i=e[S]||(e[S]={}),u&&fe(e,u))e=e[s]||e;else{if((r=i[l])&&r[0]===E&&r[1]===f)return o[2]=r[2];if((i[l]=o)[2]=a(e,t,n))return!0}return!1}}function K(i){return 1<i.length?function(e,t,n){var r=i.length;while(r--)if(!i[r](e,t,n))return!1;return!0}:i[0]}function Z(e,t,n,r,i){for(var o,a=[],s=0,u=e.length,l=null!=t;s<u;s++)(o=e[s])&&(n&&!n(o,r,i)||(a.push(o),l&&t.push(s)));return a}function ee(d,h,g,v,y,e){return v&&!v[S]&&(v=ee(v)),y&&!y[S]&&(y=ee(y,e)),F(function(e,t,n,r){var i,o,a,s,u=[],l=[],c=t.length,f=e||function(e,t,n){for(var r=0,i=t.length;r<i;r++)I(e,t[r],n);return n}(h||"*",n.nodeType?[n]:n,[]),p=!d||!e&&h?f:Z(f,u,d,n,r);if(g?g(p,s=y||(e?d:c||v)?[]:t,n,r):s=p,v){i=Z(s,l),v(i,[],n,r),o=i.length;while(o--)(a=i[o])&&(s[l[o]]=!(p[l[o]]=a))}if(e){if(y||d){if(y){i=[],o=s.length;while(o--)(a=s[o])&&i.push(p[o]=a);y(null,s=[],i,r)}o=s.length;while(o--)(a=s[o])&&-1<(i=y?se.call(e,a):u[o])&&(e[i]=!(t[i]=a))}}else s=Z(s===t?s.splice(c,s.length):s),y?y(null,t,s,r):k.apply(t,s)})}function te(e){for(var i,t,n,r=e.length,o=b.relative[e[0].type],a=o||b.relative[" "],s=o?1:0,u=J(function(e){return e===i},a,!0),l=J(function(e){return-1<se.call(i,e)},a,!0),c=[function(e,t,n){var r=!o&&(n||t!=w)||((i=t).nodeType?u(e,t,n):l(e,t,n));return i=null,r}];s<r;s++)if(t=b.relative[e[s].type])c=[J(K(c),t)];else{if((t=b.filter[e[s].type].apply(null,e[s].matches))[S]){for(n=++s;n<r;n++)if(b.relative[e[n].type])break;return ee(1<s&&K(c),1<s&&Q(e.slice(0,s-1).concat({value:" "===e[s-2].type?"*":""})).replace(ve,"$1"),t,s<n&&te(e.slice(s,n)),n<r&&te(e=e.slice(n)),n<r&&Q(e))}c.push(t)}return K(c)}function ne(e,t){var n,v,y,m,x,r,i=[],o=[],a=u[e+" "];if(!a){t||(t=Y(e)),n=t.length;while(n--)(a=te(t[n]))[S]?i.push(a):o.push(a);(a=u(e,(v=o,m=0<(y=i).length,x=0<v.length,r=function(e,t,n,r,i){var o,a,s,u=0,l="0",c=e&&[],f=[],p=w,d=e||x&&b.find.TAG("*",i),h=E+=null==p?1:Math.random()||.1,g=d.length;for(i&&(w=t==T||t||i);l!==g&&null!=(o=d[l]);l++){if(x&&o){a=0,t||o.ownerDocument==T||(V(o),n=!C);while(s=v[a++])if(s(o,t||T,n)){k.call(r,o);break}i&&(E=h)}m&&((o=!s&&o)&&u--,e&&c.push(o))}if(u+=l,m&&l!==u){a=0;while(s=y[a++])s(c,f,t,n);if(e){if(0<u)while(l--)c[l]||f[l]||(f[l]=pe.call(r));f=Z(f)}k.apply(r,f),i&&!e&&0<f.length&&1<u+y.length&&ce.uniqueSort(r)}return i&&(E=h,w=p),c},m?F(r):r))).selector=e}return a}function re(e,t,n,r){var i,o,a,s,u,l="function"==typeof e&&e,c=!r&&Y(e=l.selector||e);if(n=n||[],1===c.length){if(2<(o=c[0]=c[0].slice(0)).length&&"ID"===(a=o[0]).type&&9===t.nodeType&&C&&b.relative[o[1].type]){if(!(t=(b.find.ID(a.matches[0].replace(O,P),t)||[])[0]))return n;l&&(t=t.parentNode),e=e.slice(o.shift().value.length)}i=D.needsContext.test(e)?0:o.length;while(i--){if(a=o[i],b.relative[s=a.type])break;if((u=b.find[s])&&(r=u(a.matches[0].replace(O,P),H.test(o[0].type)&&U(t.parentNode)||t))){if(o.splice(i,1),!(e=r.length&&Q(o)))return k.apply(n,r),n;break}}}return(l||ne(e,c))(r,t,!C,n,!t||H.test(e)&&U(t.parentNode)||t),n}G.prototype=b.filters=b.pseudos,b.setFilters=new G,le.sortStable=S.split("").sort(l).join("")===S,V(),le.sortDetached=$(function(e){return 1&e.compareDocumentPosition(T.createElement("fieldset"))}),ce.find=I,ce.expr[":"]=ce.expr.pseudos,ce.unique=ce.uniqueSort,I.compile=ne,I.select=re,I.setDocument=V,I.tokenize=Y,I.escape=ce.escapeSelector,I.getText=ce.text,I.isXML=ce.isXMLDoc,I.selectors=ce.expr,I.support=ce.support,I.uniqueSort=ce.uniqueSort}();var d=function(e,t,n){var r=[],i=void 0!==n;while((e=e[t])&&9!==e.nodeType)if(1===e.nodeType){if(i&&ce(e).is(n))break;r.push(e)}return r},h=function(e,t){for(var n=[];e;e=e.nextSibling)1===e.nodeType&&e!==t&&n.push(e);return n},b=ce.expr.match.needsContext,w=/^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i;function T(e,n,r){return v(n)?ce.grep(e,function(e,t){return!!n.call(e,t,e)!==r}):n.nodeType?ce.grep(e,function(e){return e===n!==r}):"string"!=typeof n?ce.grep(e,function(e){return-1<se.call(n,e)!==r}):ce.filter(n,e,r)}ce.filter=function(e,t,n){var r=t[0];return n&&(e=":not("+e+")"),1===t.length&&1===r.nodeType?ce.find.matchesSelector(r,e)?[r]:[]:ce.find.matches(e,ce.grep(t,function(e){return 1===e.nodeType}))},ce.fn.extend({find:function(e){var t,n,r=this.length,i=this;if("string"!=typeof e)return this.pushStack(ce(e).filter(function(){for(t=0;t<r;t++)if(ce.contains(i[t],this))return!0}));for(n=this.pushStack([]),t=0;t<r;t++)ce.find(e,i[t],n);return 1<r?ce.uniqueSort(n):n},filter:function(e){return this.pushStack(T(this,e||[],!1))},not:function(e){return this.pushStack(T(this,e||[],!0))},is:function(e){return!!T(this,"string"==typeof e&&b.test(e)?ce(e):e||[],!1).length}});var k,S=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/;(ce.fn.init=function(e,t,n){var r,i;if(!e)return this;if(n=n||k,"string"==typeof e){if(!(r="<"===e[0]&&">"===e[e.length-1]&&3<=e.length?[null,e,null]:S.exec(e))||!r[1]&&t)return!t||t.jquery?(t||n).find(e):this.constructor(t).find(e);if(r[1]){if(t=t instanceof ce?t[0]:t,ce.merge(this,ce.parseHTML(r[1],t&&t.nodeType?t.ownerDocument||t:C,!0)),w.test(r[1])&&ce.isPlainObject(t))for(r in t)v(this[r])?this[r](t[r]):this.attr(r,t[r]);return this}return(i=C.getElementById(r[2]))&&(this[0]=i,this.length=1),this}return e.nodeType?(this[0]=e,this.length=1,this):v(e)?void 0!==n.ready?n.ready(e):e(ce):ce.makeArray(e,this)}).prototype=ce.fn,k=ce(C);var E=/^(?:parents|prev(?:Until|All))/,j={children:!0,contents:!0,next:!0,prev:!0};function A(e,t){while((e=e[t])&&1!==e.nodeType);return e}ce.fn.extend({has:function(e){var t=ce(e,this),n=t.length;return this.filter(function(){for(var e=0;e<n;e++)if(ce.contains(this,t[e]))return!0})},closest:function(e,t){var n,r=0,i=this.length,o=[],a="string"!=typeof e&&ce(e);if(!b.test(e))for(;r<i;r++)for(n=this[r];n&&n!==t;n=n.parentNode)if(n.nodeType<11&&(a?-1<a.index(n):1===n.nodeType&&ce.find.matchesSelector(n,e))){o.push(n);break}return this.pushStack(1<o.length?ce.uniqueSort(o):o)},index:function(e){return e?"string"==typeof e?se.call(ce(e),this[0]):se.call(this,e.jquery?e[0]:e):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(e,t){return this.pushStack(ce.uniqueSort(ce.merge(this.get(),ce(e,t))))},addBack:function(e){return this.add(null==e?this.prevObject:this.prevObject.filter(e))}}),ce.each({parent:function(e){var t=e.parentNode;return t&&11!==t.nodeType?t:null},parents:function(e){return d(e,"parentNode")},parentsUntil:function(e,t,n){return d(e,"parentNode",n)},next:function(e){return A(e,"nextSibling")},prev:function(e){return A(e,"previousSibling")},nextAll:function(e){return d(e,"nextSibling")},prevAll:function(e){return d(e,"previousSibling")},nextUntil:function(e,t,n){return d(e,"nextSibling",n)},prevUntil:function(e,t,n){return d(e,"previousSibling",n)},siblings:function(e){return h((e.parentNode||{}).firstChild,e)},children:function(e){return h(e.firstChild)},contents:function(e){return null!=e.contentDocument&&r(e.contentDocument)?e.contentDocument:(fe(e,"template")&&(e=e.content||e),ce.merge([],e.childNodes))}},function(r,i){ce.fn[r]=function(e,t){var n=ce.map(this,i,e);return"Until"!==r.slice(-5)&&(t=e),t&&"string"==typeof t&&(n=ce.filter(t,n)),1<this.length&&(j[r]||ce.uniqueSort(n),E.test(r)&&n.reverse()),this.pushStack(n)}});var D=/[^\x20\t\r\n\f]+/g;function N(e){return e}function q(e){throw e}function L(e,t,n,r){var i;try{e&&v(i=e.promise)?i.call(e).done(t).fail(n):e&&v(i=e.then)?i.call(e,t,n):t.apply(void 0,[e].slice(r))}catch(e){n.apply(void 0,[e])}}ce.Callbacks=function(r){var e,n;r="string"==typeof r?(e=r,n={},ce.each(e.match(D)||[],function(e,t){n[t]=!0}),n):ce.extend({},r);var i,t,o,a,s=[],u=[],l=-1,c=function(){for(a=a||r.once,o=i=!0;u.length;l=-1){t=u.shift();while(++l<s.length)!1===s[l].apply(t[0],t[1])&&r.stopOnFalse&&(l=s.length,t=!1)}r.memory||(t=!1),i=!1,a&&(s=t?[]:"")},f={add:function(){return s&&(t&&!i&&(l=s.length-1,u.push(t)),function n(e){ce.each(e,function(e,t){v(t)?r.unique&&f.has(t)||s.push(t):t&&t.length&&"string"!==x(t)&&n(t)})}(arguments),t&&!i&&c()),this},remove:function(){return ce.each(arguments,function(e,t){var n;while(-1<(n=ce.inArray(t,s,n)))s.splice(n,1),n<=l&&l--}),this},has:function(e){return e?-1<ce.inArray(e,s):0<s.length},empty:function(){return s&&(s=[]),this},disable:function(){return a=u=[],s=t="",this},disabled:function(){return!s},lock:function(){return a=u=[],t||i||(s=t=""),this},locked:function(){return!!a},fireWith:function(e,t){return a||(t=[e,(t=t||[]).slice?t.slice():t],u.push(t),i||c()),this},fire:function(){return f.fireWith(this,arguments),this},fired:function(){return!!o}};return f},ce.extend({Deferred:function(e){var o=[["notify","progress",ce.Callbacks("memory"),ce.Callbacks("memory"),2],["resolve","done",ce.Callbacks("once memory"),ce.Callbacks("once memory"),0,"resolved"],["reject","fail",ce.Callbacks("once memory"),ce.Callbacks("once memory"),1,"rejected"]],i="pending",a={state:function(){return i},always:function(){return s.done(arguments).fail(arguments),this},"catch":function(e){return a.then(null,e)},pipe:function(){var i=arguments;return ce.Deferred(function(r){ce.each(o,function(e,t){var n=v(i[t[4]])&&i[t[4]];s[t[1]](function(){var e=n&&n.apply(this,arguments);e&&v(e.promise)?e.promise().progress(r.notify).done(r.resolve).fail(r.reject):r[t[0]+"With"](this,n?[e]:arguments)})}),i=null}).promise()},then:function(t,n,r){var u=0;function l(i,o,a,s){return function(){var n=this,r=arguments,e=function(){var e,t;if(!(i<u)){if((e=a.apply(n,r))===o.promise())throw new TypeError("Thenable self-resolution");t=e&&("object"==typeof e||"function"==typeof e)&&e.then,v(t)?s?t.call(e,l(u,o,N,s),l(u,o,q,s)):(u++,t.call(e,l(u,o,N,s),l(u,o,q,s),l(u,o,N,o.notifyWith))):(a!==N&&(n=void 0,r=[e]),(s||o.resolveWith)(n,r))}},t=s?e:function(){try{e()}catch(e){ce.Deferred.exceptionHook&&ce.Deferred.exceptionHook(e,t.error),u<=i+1&&(a!==q&&(n=void 0,r=[e]),o.rejectWith(n,r))}};i?t():(ce.Deferred.getErrorHook?t.error=ce.Deferred.getErrorHook():ce.Deferred.getStackHook&&(t.error=ce.Deferred.getStackHook()),ie.setTimeout(t))}}return ce.Deferred(function(e){o[0][3].add(l(0,e,v(r)?r:N,e.notifyWith)),o[1][3].add(l(0,e,v(t)?t:N)),o[2][3].add(l(0,e,v(n)?n:q))}).promise()},promise:function(e){return null!=e?ce.extend(e,a):a}},s={};return ce.each(o,function(e,t){var n=t[2],r=t[5];a[t[1]]=n.add,r&&n.add(function(){i=r},o[3-e][2].disable,o[3-e][3].disable,o[0][2].lock,o[0][3].lock),n.add(t[3].fire),s[t[0]]=function(){return s[t[0]+"With"](this===s?void 0:this,arguments),this},s[t[0]+"With"]=n.fireWith}),a.promise(s),e&&e.call(s,s),s},when:function(e){var n=arguments.length,t=n,r=Array(t),i=ae.call(arguments),o=ce.Deferred(),a=function(t){return function(e){r[t]=this,i[t]=1<arguments.length?ae.call(arguments):e,--n||o.resolveWith(r,i)}};if(n<=1&&(L(e,o.done(a(t)).resolve,o.reject,!n),"pending"===o.state()||v(i[t]&&i[t].then)))return o.then();while(t--)L(i[t],a(t),o.reject);return o.promise()}});var H=/^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;ce.Deferred.exceptionHook=function(e,t){ie.console&&ie.console.warn&&e&&H.test(e.name)&&ie.console.warn("jQuery.Deferred exception: "+e.message,e.stack,t)},ce.readyException=function(e){ie.setTimeout(function(){throw e})};var O=ce.Deferred();function P(){C.removeEventListener("DOMContentLoaded",P),ie.removeEventListener("load",P),ce.ready()}ce.fn.ready=function(e){return O.then(e)["catch"](function(e){ce.readyException(e)}),this},ce.extend({isReady:!1,readyWait:1,ready:function(e){(!0===e?--ce.readyWait:ce.isReady)||(ce.isReady=!0)!==e&&0<--ce.readyWait||O.resolveWith(C,[ce])}}),ce.ready.then=O.then,"complete"===C.readyState||"loading"!==C.readyState&&!C.documentElement.doScroll?ie.setTimeout(ce.ready):(C.addEventListener("DOMContentLoaded",P),ie.addEventListener("load",P));var M=function(e,t,n,r,i,o,a){var s=0,u=e.length,l=null==n;if("object"===x(n))for(s in i=!0,n)M(e,t,s,n[s],!0,o,a);else if(void 0!==r&&(i=!0,v(r)||(a=!0),l&&(a?(t.call(e,r),t=null):(l=t,t=function(e,t,n){return l.call(ce(e),n)})),t))for(;s<u;s++)t(e[s],n,a?r:r.call(e[s],s,t(e[s],n)));return i?e:l?t.call(e):u?t(e[0],n):o},R=/^-ms-/,I=/-([a-z])/g;function W(e,t){return t.toUpperCase()}function F(e){return e.replace(R,"ms-").replace(I,W)}var $=function(e){return 1===e.nodeType||9===e.nodeType||!+e.nodeType};function B(){this.expando=ce.expando+B.uid++}B.uid=1,B.prototype={cache:function(e){var t=e[this.expando];return t||(t={},$(e)&&(e.nodeType?e[this.expando]=t:Object.defineProperty(e,this.expando,{value:t,configurable:!0}))),t},set:function(e,t,n){var r,i=this.cache(e);if("string"==typeof t)i[F(t)]=n;else for(r in t)i[F(r)]=t[r];return i},get:function(e,t){return void 0===t?this.cache(e):e[this.expando]&&e[this.expando][F(t)]},access:function(e,t,n){return void 0===t||t&&"string"==typeof t&&void 0===n?this.get(e,t):(this.set(e,t,n),void 0!==n?n:t)},remove:function(e,t){var n,r=e[this.expando];if(void 0!==r){if(void 0!==t){n=(t=Array.isArray(t)?t.map(F):(t=F(t))in r?[t]:t.match(D)||[]).length;while(n--)delete r[t[n]]}(void 0===t||ce.isEmptyObject(r))&&(e.nodeType?e[this.expando]=void 0:delete e[this.expando])}},hasData:function(e){var t=e[this.expando];return void 0!==t&&!ce.isEmptyObject(t)}};var _=new B,z=new B,X=/^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,U=/[A-Z]/g;function V(e,t,n){var r,i;if(void 0===n&&1===e.nodeType)if(r="data-"+t.replace(U,"-$&").toLowerCase(),"string"==typeof(n=e.getAttribute(r))){try{n="true"===(i=n)||"false"!==i&&("null"===i?null:i===+i+""?+i:X.test(i)?JSON.parse(i):i)}catch(e){}z.set(e,t,n)}else n=void 0;return n}ce.extend({hasData:function(e){return z.hasData(e)||_.hasData(e)},data:function(e,t,n){return z.access(e,t,n)},removeData:function(e,t){z.remove(e,t)},_data:function(e,t,n){return _.access(e,t,n)},_removeData:function(e,t){_.remove(e,t)}}),ce.fn.extend({data:function(n,e){var t,r,i,o=this[0],a=o&&o.attributes;if(void 0===n){if(this.length&&(i=z.get(o),1===o.nodeType&&!_.get(o,"hasDataAttrs"))){t=a.length;while(t--)a[t]&&0===(r=a[t].name).indexOf("data-")&&(r=F(r.slice(5)),V(o,r,i[r]));_.set(o,"hasDataAttrs",!0)}return i}return"object"==typeof n?this.each(function(){z.set(this,n)}):M(this,function(e){var t;if(o&&void 0===e)return void 0!==(t=z.get(o,n))?t:void 0!==(t=V(o,n))?t:void 0;this.each(function(){z.set(this,n,e)})},null,e,1<arguments.length,null,!0)},removeData:function(e){return this.each(function(){z.remove(this,e)})}}),ce.extend({queue:function(e,t,n){var r;if(e)return t=(t||"fx")+"queue",r=_.get(e,t),n&&(!r||Array.isArray(n)?r=_.access(e,t,ce.makeArray(n)):r.push(n)),r||[]},dequeue:function(e,t){t=t||"fx";var n=ce.queue(e,t),r=n.length,i=n.shift(),o=ce._queueHooks(e,t);"inprogress"===i&&(i=n.shift(),r--),i&&("fx"===t&&n.unshift("inprogress"),delete o.stop,i.call(e,function(){ce.dequeue(e,t)},o)),!r&&o&&o.empty.fire()},_queueHooks:function(e,t){var n=t+"queueHooks";return _.get(e,n)||_.access(e,n,{empty:ce.Callbacks("once memory").add(function(){_.remove(e,[t+"queue",n])})})}}),ce.fn.extend({queue:function(t,n){var e=2;return"string"!=typeof t&&(n=t,t="fx",e--),arguments.length<e?ce.queue(this[0],t):void 0===n?this:this.each(function(){var e=ce.queue(this,t,n);ce._queueHooks(this,t),"fx"===t&&"inprogress"!==e[0]&&ce.dequeue(this,t)})},dequeue:function(e){return this.each(function(){ce.dequeue(this,e)})},clearQueue:function(e){return this.queue(e||"fx",[])},promise:function(e,t){var n,r=1,i=ce.Deferred(),o=this,a=this.length,s=function(){--r||i.resolveWith(o,[o])};"string"!=typeof e&&(t=e,e=void 0),e=e||"fx";while(a--)(n=_.get(o[a],e+"queueHooks"))&&n.empty&&(r++,n.empty.add(s));return s(),i.promise(t)}});var G=/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source,Y=new RegExp("^(?:([+-])=|)("+G+")([a-z%]*)$","i"),Q=["Top","Right","Bottom","Left"],J=C.documentElement,K=function(e){return ce.contains(e.ownerDocument,e)},Z={composed:!0};J.getRootNode&&(K=function(e){return ce.contains(e.ownerDocument,e)||e.getRootNode(Z)===e.ownerDocument});var ee=function(e,t){return"none"===(e=t||e).style.display||""===e.style.display&&K(e)&&"none"===ce.css(e,"display")};function te(e,t,n,r){var i,o,a=20,s=r?function(){return r.cur()}:function(){return ce.css(e,t,"")},u=s(),l=n&&n[3]||(ce.cssNumber[t]?"":"px"),c=e.nodeType&&(ce.cssNumber[t]||"px"!==l&&+u)&&Y.exec(ce.css(e,t));if(c&&c[3]!==l){u/=2,l=l||c[3],c=+u||1;while(a--)ce.style(e,t,c+l),(1-o)*(1-(o=s()/u||.5))<=0&&(a=0),c/=o;c*=2,ce.style(e,t,c+l),n=n||[]}return n&&(c=+c||+u||0,i=n[1]?c+(n[1]+1)*n[2]:+n[2],r&&(r.unit=l,r.start=c,r.end=i)),i}var ne={};function re(e,t){for(var n,r,i,o,a,s,u,l=[],c=0,f=e.length;c<f;c++)(r=e[c]).style&&(n=r.style.display,t?("none"===n&&(l[c]=_.get(r,"display")||null,l[c]||(r.style.display="")),""===r.style.display&&ee(r)&&(l[c]=(u=a=o=void 0,a=(i=r).ownerDocument,s=i.nodeName,(u=ne[s])||(o=a.body.appendChild(a.createElement(s)),u=ce.css(o,"display"),o.parentNode.removeChild(o),"none"===u&&(u="block"),ne[s]=u)))):"none"!==n&&(l[c]="none",_.set(r,"display",n)));for(c=0;c<f;c++)null!=l[c]&&(e[c].style.display=l[c]);return e}ce.fn.extend({show:function(){return re(this,!0)},hide:function(){return re(this)},toggle:function(e){return"boolean"==typeof e?e?this.show():this.hide():this.each(function(){ee(this)?ce(this).show():ce(this).hide()})}});var xe,be,we=/^(?:checkbox|radio)$/i,Te=/<([a-z][^\/\0>\x20\t\r\n\f]*)/i,Ce=/^$|^module$|\/(?:java|ecma)script/i;xe=C.createDocumentFragment().appendChild(C.createElement("div")),(be=C.createElement("input")).setAttribute("type","radio"),be.setAttribute("checked","checked"),be.setAttribute("name","t"),xe.appendChild(be),le.checkClone=xe.cloneNode(!0).cloneNode(!0).lastChild.checked,xe.innerHTML="<textarea>x</textarea>",le.noCloneChecked=!!xe.cloneNode(!0).lastChild.defaultValue,xe.innerHTML="<option></option>",le.option=!!xe.lastChild;var ke={thead:[1,"<table>","</table>"],col:[2,"<table><colgroup>","</colgroup></table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],_default:[0,"",""]};function Se(e,t){var n;return n="undefined"!=typeof e.getElementsByTagName?e.getElementsByTagName(t||"*"):"undefined"!=typeof e.querySelectorAll?e.querySelectorAll(t||"*"):[],void 0===t||t&&fe(e,t)?ce.merge([e],n):n}function Ee(e,t){for(var n=0,r=e.length;n<r;n++)_.set(e[n],"globalEval",!t||_.get(t[n],"globalEval"))}ke.tbody=ke.tfoot=ke.colgroup=ke.caption=ke.thead,ke.th=ke.td,le.option||(ke.optgroup=ke.option=[1,"<select multiple='multiple'>","</select>"]);var je=/<|&#?\w+;/;function Ae(e,t,n,r,i){for(var o,a,s,u,l,c,f=t.createDocumentFragment(),p=[],d=0,h=e.length;d<h;d++)if((o=e[d])||0===o)if("object"===x(o))ce.merge(p,o.nodeType?[o]:o);else if(je.test(o)){a=a||f.appendChild(t.createElement("div")),s=(Te.exec(o)||["",""])[1].toLowerCase(),u=ke[s]||ke._default,a.innerHTML=u[1]+ce.htmlPrefilter(o)+u[2],c=u[0];while(c--)a=a.lastChild;ce.merge(p,a.childNodes),(a=f.firstChild).textContent=""}else p.push(t.createTextNode(o));f.textContent="",d=0;while(o=p[d++])if(r&&-1<ce.inArray(o,r))i&&i.push(o);else if(l=K(o),a=Se(f.appendChild(o),"script"),l&&Ee(a),n){c=0;while(o=a[c++])Ce.test(o.type||"")&&n.push(o)}return f}var De=/^([^.]*)(?:\.(.+)|)/;function Ne(){return!0}function qe(){return!1}function Le(e,t,n,r,i,o){var a,s;if("object"==typeof t){for(s in"string"!=typeof n&&(r=r||n,n=void 0),t)Le(e,s,n,r,t[s],o);return e}if(null==r&&null==i?(i=n,r=n=void 0):null==i&&("string"==typeof n?(i=r,r=void 0):(i=r,r=n,n=void 0)),!1===i)i=qe;else if(!i)return e;return 1===o&&(a=i,(i=function(e){return ce().off(e),a.apply(this,arguments)}).guid=a.guid||(a.guid=ce.guid++)),e.each(function(){ce.event.add(this,t,i,r,n)})}function He(e,r,t){t?(_.set(e,r,!1),ce.event.add(e,r,{namespace:!1,handler:function(e){var t,n=_.get(this,r);if(1&e.isTrigger&&this[r]){if(n)(ce.event.special[r]||{}).delegateType&&e.stopPropagation();else if(n=ae.call(arguments),_.set(this,r,n),this[r](),t=_.get(this,r),_.set(this,r,!1),n!==t)return e.stopImmediatePropagation(),e.preventDefault(),t}else n&&(_.set(this,r,ce.event.trigger(n[0],n.slice(1),this)),e.stopPropagation(),e.isImmediatePropagationStopped=Ne)}})):void 0===_.get(e,r)&&ce.event.add(e,r,Ne)}ce.event={global:{},add:function(t,e,n,r,i){var o,a,s,u,l,c,f,p,d,h,g,v=_.get(t);if($(t)){n.handler&&(n=(o=n).handler,i=o.selector),i&&ce.find.matchesSelector(J,i),n.guid||(n.guid=ce.guid++),(u=v.events)||(u=v.events=Object.create(null)),(a=v.handle)||(a=v.handle=function(e){return"undefined"!=typeof ce&&ce.event.triggered!==e.type?ce.event.dispatch.apply(t,arguments):void 0}),l=(e=(e||"").match(D)||[""]).length;while(l--)d=g=(s=De.exec(e[l])||[])[1],h=(s[2]||"").split(".").sort(),d&&(f=ce.event.special[d]||{},d=(i?f.delegateType:f.bindType)||d,f=ce.event.special[d]||{},c=ce.extend({type:d,origType:g,data:r,handler:n,guid:n.guid,selector:i,needsContext:i&&ce.expr.match.needsContext.test(i),namespace:h.join(".")},o),(p=u[d])||((p=u[d]=[]).delegateCount=0,f.setup&&!1!==f.setup.call(t,r,h,a)||t.addEventListener&&t.addEventListener(d,a)),f.add&&(f.add.call(t,c),c.handler.guid||(c.handler.guid=n.guid)),i?p.splice(p.delegateCount++,0,c):p.push(c),ce.event.global[d]=!0)}},remove:function(e,t,n,r,i){var o,a,s,u,l,c,f,p,d,h,g,v=_.hasData(e)&&_.get(e);if(v&&(u=v.events)){l=(t=(t||"").match(D)||[""]).length;while(l--)if(d=g=(s=De.exec(t[l])||[])[1],h=(s[2]||"").split(".").sort(),d){f=ce.event.special[d]||{},p=u[d=(r?f.delegateType:f.bindType)||d]||[],s=s[2]&&new RegExp("(^|\\.)"+h.join("\\.(?:.*\\.|)")+"(\\.|$)"),a=o=p.length;while(o--)c=p[o],!i&&g!==c.origType||n&&n.guid!==c.guid||s&&!s.test(c.namespace)||r&&r!==c.selector&&("**"!==r||!c.selector)||(p.splice(o,1),c.selector&&p.delegateCount--,f.remove&&f.remove.call(e,c));a&&!p.length&&(f.teardown&&!1!==f.teardown.call(e,h,v.handle)||ce.removeEvent(e,d,v.handle),delete u[d])}else for(d in u)ce.event.remove(e,d+t[l],n,r,!0);ce.isEmptyObject(u)&&_.remove(e,"handle events")}},dispatch:function(e){var t,n,r,i,o,a,s=new Array(arguments.length),u=ce.event.fix(e),l=(_.get(this,"events")||Object.create(null))[u.type]||[],c=ce.event.special[u.type]||{};for(s[0]=u,t=1;t<arguments.length;t++)s[t]=arguments[t];if(u.delegateTarget=this,!c.preDispatch||!1!==c.preDispatch.call(this,u)){a=ce.event.handlers.call(this,u,l),t=0;while((i=a[t++])&&!u.isPropagationStopped()){u.currentTarget=i.elem,n=0;while((o=i.handlers[n++])&&!u.isImmediatePropagationStopped())u.rnamespace&&!1!==o.namespace&&!u.rnamespace.test(o.namespace)||(u.handleObj=o,u.data=o.data,void 0!==(r=((ce.event.special[o.origType]||{}).handle||o.handler).apply(i.elem,s))&&!1===(u.result=r)&&(u.preventDefault(),u.stopPropagation()))}return c.postDispatch&&c.postDispatch.call(this,u),u.result}},handlers:function(e,t){var n,r,i,o,a,s=[],u=t.delegateCount,l=e.target;if(u&&l.nodeType&&!("click"===e.type&&1<=e.button))for(;l!==this;l=l.parentNode||this)if(1===l.nodeType&&("click"!==e.type||!0!==l.disabled)){for(o=[],a={},n=0;n<u;n++)void 0===a[i=(r=t[n]).selector+" "]&&(a[i]=r.needsContext?-1<ce(i,this).index(l):ce.find(i,this,null,[l]).length),a[i]&&o.push(r);o.length&&s.push({elem:l,handlers:o})}return l=this,u<t.length&&s.push({elem:l,handlers:t.slice(u)}),s},addProp:function(t,e){Object.defineProperty(ce.Event.prototype,t,{enumerable:!0,configurable:!0,get:v(e)?function(){if(this.originalEvent)return e(this.originalEvent)}:function(){if(this.originalEvent)return this.originalEvent[t]},set:function(e){Object.defineProperty(this,t,{enumerable:!0,configurable:!0,writable:!0,value:e})}})},fix:function(e){return e[ce.expando]?e:new ce.Event(e)},special:{load:{noBubble:!0},click:{setup:function(e){var t=this||e;return we.test(t.type)&&t.click&&fe(t,"input")&&He(t,"click",!0),!1},trigger:function(e){var t=this||e;return we.test(t.type)&&t.click&&fe(t,"input")&&He(t,"click"),!0},_default:function(e){var t=e.target;return we.test(t.type)&&t.click&&fe(t,"input")&&_.get(t,"click")||fe(t,"a")}},beforeunload:{postDispatch:function(e){void 0!==e.result&&e.originalEvent&&(e.originalEvent.returnValue=e.result)}}}},ce.removeEvent=function(e,t,n){e.removeEventListener&&e.removeEventListener(t,n)},ce.Event=function(e,t){if(!(this instanceof ce.Event))return new ce.Event(e,t);e&&e.type?(this.originalEvent=e,this.type=e.type,this.isDefaultPrevented=e.defaultPrevented||void 0===e.defaultPrevented&&!1===e.returnValue?Ne:qe,this.target=e.target&&3===e.target.nodeType?e.target.parentNode:e.target,this.currentTarget=e.currentTarget,this.relatedTarget=e.relatedTarget):this.type=e,t&&ce.extend(this,t),this.timeStamp=e&&e.timeStamp||Date.now(),this[ce.expando]=!0},ce.Event.prototype={constructor:ce.Event,isDefaultPrevented:qe,isPropagationStopped:qe,isImmediatePropagationStopped:qe,isSimulated:!1,preventDefault:function(){var e=this.originalEvent;this.isDefaultPrevented=Ne,e&&!this.isSimulated&&e.preventDefault()},stopPropagation:function(){var e=this.originalEvent;this.isPropagationStopped=Ne,e&&!this.isSimulated&&e.stopPropagation()},stopImmediatePropagation:function(){var e=this.originalEvent;this.isImmediatePropagationStopped=Ne,e&&!this.isSimulated&&e.stopImmediatePropagation(),this.stopPropagation()}},ce.each({altKey:!0,bubbles:!0,cancelable:!0,changedTouches:!0,ctrlKey:!0,detail:!0,eventPhase:!0,metaKey:!0,pageX:!0,pageY:!0,shiftKey:!0,view:!0,"char":!0,code:!0,charCode:!0,key:!0,keyCode:!0,button:!0,buttons:!0,clientX:!0,clientY:!0,offsetX:!0,offsetY:!0,pointerId:!0,pointerType:!0,screenX:!0,screenY:!0,targetTouches:!0,toElement:!0,touches:!0,which:!0},ce.event.addProp),ce.each({focus:"focusin",blur:"focusout"},function(r,i){function o(e){if(C.documentMode){var t=_.get(this,"handle"),n=ce.event.fix(e);n.type="focusin"===e.type?"focus":"blur",n.isSimulated=!0,t(e),n.target===n.currentTarget&&t(n)}else ce.event.simulate(i,e.target,ce.event.fix(e))}ce.event.special[r]={setup:function(){var e;if(He(this,r,!0),!C.documentMode)return!1;(e=_.get(this,i))||this.addEventListener(i,o),_.set(this,i,(e||0)+1)},trigger:function(){return He(this,r),!0},teardown:function(){var e;if(!C.documentMode)return!1;(e=_.get(this,i)-1)?_.set(this,i,e):(this.removeEventListener(i,o),_.remove(this,i))},_default:function(e){return _.get(e.target,r)},delegateType:i},ce.event.special[i]={setup:function(){var e=this.ownerDocument||this.document||this,t=C.documentMode?this:e,n=_.get(t,i);n||(C.documentMode?this.addEventListener(i,o):e.addEventListener(r,o,!0)),_.set(t,i,(n||0)+1)},teardown:function(){var e=this.ownerDocument||this.document||this,t=C.documentMode?this:e,n=_.get(t,i)-1;n?_.set(t,i,n):(C.documentMode?this.removeEventListener(i,o):e.removeEventListener(r,o,!0),_.remove(t,i))}}}),ce.each({mouseenter:"mouseover",mouseleave:"mouseout",pointerenter:"pointerover",pointerleave:"pointerout"},function(e,i){ce.event.special[e]={delegateType:i,bindType:i,handle:function(e){var t,n=e.relatedTarget,r=e.handleObj;return n&&(n===this||ce.contains(this,n))||(e.type=r.origType,t=r.handler.apply(this,arguments),e.type=i),t}}}),ce.fn.extend({on:function(e,t,n,r){return Le(this,e,t,n,r)},one:function(e,t,n,r){return Le(this,e,t,n,r,1)},off:function(e,t,n){var r,i;if(e&&e.preventDefault&&e.handleObj)return r=e.handleObj,ce(e.delegateTarget).off(r.namespace?r.origType+"."+r.namespace:r.origType,r.selector,r.handler),this;if("object"==typeof e){for(i in e)this.off(i,t,e[i]);return this}return!1!==t&&"function"!=typeof t||(n=t,t=void 0),!1===n&&(n=qe),this.each(function(){ce.event.remove(this,e,n,t)})}});var Oe=/<script|<style|<link/i,Pe=/checked\s*(?:[^=]|=\s*.checked.)/i,Me=/^\s*<!\[CDATA\[|\]\]>\s*$/g;function Re(e,t){return fe(e,"table")&&fe(11!==t.nodeType?t:t.firstChild,"tr")&&ce(e).children("tbody")[0]||e}function Ie(e){return e.type=(null!==e.getAttribute("type"))+"/"+e.type,e}function We(e){return"true/"===(e.type||"").slice(0,5)?e.type=e.type.slice(5):e.removeAttribute("type"),e}function Fe(e,t){var n,r,i,o,a,s;if(1===t.nodeType){if(_.hasData(e)&&(s=_.get(e).events))for(i in _.remove(t,"handle events"),s)for(n=0,r=s[i].length;n<r;n++)ce.event.add(t,i,s[i][n]);z.hasData(e)&&(o=z.access(e),a=ce.extend({},o),z.set(t,a))}}function $e(n,r,i,o){r=g(r);var e,t,a,s,u,l,c=0,f=n.length,p=f-1,d=r[0],h=v(d);if(h||1<f&&"string"==typeof d&&!le.checkClone&&Pe.test(d))return n.each(function(e){var t=n.eq(e);h&&(r[0]=d.call(this,e,t.html())),$e(t,r,i,o)});if(f&&(t=(e=Ae(r,n[0].ownerDocument,!1,n,o)).firstChild,1===e.childNodes.length&&(e=t),t||o)){for(s=(a=ce.map(Se(e,"script"),Ie)).length;c<f;c++)u=e,c!==p&&(u=ce.clone(u,!0,!0),s&&ce.merge(a,Se(u,"script"))),i.call(n[c],u,c);if(s)for(l=a[a.length-1].ownerDocument,ce.map(a,We),c=0;c<s;c++)u=a[c],Ce.test(u.type||"")&&!_.access(u,"globalEval")&&ce.contains(l,u)&&(u.src&&"module"!==(u.type||"").toLowerCase()?ce._evalUrl&&!u.noModule&&ce._evalUrl(u.src,{nonce:u.nonce||u.getAttribute("nonce")},l):m(u.textContent.replace(Me,""),u,l))}return n}function Be(e,t,n){for(var r,i=t?ce.filter(t,e):e,o=0;null!=(r=i[o]);o++)n||1!==r.nodeType||ce.cleanData(Se(r)),r.parentNode&&(n&&K(r)&&Ee(Se(r,"script")),r.parentNode.removeChild(r));return e}ce.extend({htmlPrefilter:function(e){return e},clone:function(e,t,n){var r,i,o,a,s,u,l,c=e.cloneNode(!0),f=K(e);if(!(le.noCloneChecked||1!==e.nodeType&&11!==e.nodeType||ce.isXMLDoc(e)))for(a=Se(c),r=0,i=(o=Se(e)).length;r<i;r++)s=o[r],u=a[r],void 0,"input"===(l=u.nodeName.toLowerCase())&&we.test(s.type)?u.checked=s.checked:"input"!==l&&"textarea"!==l||(u.defaultValue=s.defaultValue);if(t)if(n)for(o=o||Se(e),a=a||Se(c),r=0,i=o.length;r<i;r++)Fe(o[r],a[r]);else Fe(e,c);return 0<(a=Se(c,"script")).length&&Ee(a,!f&&Se(e,"script")),c},cleanData:function(e){for(var t,n,r,i=ce.event.special,o=0;void 0!==(n=e[o]);o++)if($(n)){if(t=n[_.expando]){if(t.events)for(r in t.events)i[r]?ce.event.remove(n,r):ce.removeEvent(n,r,t.handle);n[_.expando]=void 0}n[z.expando]&&(n[z.expando]=void 0)}}}),ce.fn.extend({detach:function(e){return Be(this,e,!0)},remove:function(e){return Be(this,e)},text:function(e){return M(this,function(e){return void 0===e?ce.text(this):this.empty().each(function(){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||(this.textContent=e)})},null,e,arguments.length)},append:function(){return $e(this,arguments,function(e){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||Re(this,e).appendChild(e)})},prepend:function(){return $e(this,arguments,function(e){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var t=Re(this,e);t.insertBefore(e,t.firstChild)}})},before:function(){return $e(this,arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this)})},after:function(){return $e(this,arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this.nextSibling)})},empty:function(){for(var e,t=0;null!=(e=this[t]);t++)1===e.nodeType&&(ce.cleanData(Se(e,!1)),e.textContent="");return this},clone:function(e,t){return e=null!=e&&e,t=null==t?e:t,this.map(function(){return ce.clone(this,e,t)})},html:function(e){return M(this,function(e){var t=this[0]||{},n=0,r=this.length;if(void 0===e&&1===t.nodeType)return t.innerHTML;if("string"==typeof e&&!Oe.test(e)&&!ke[(Te.exec(e)||["",""])[1].toLowerCase()]){e=ce.htmlPrefilter(e);try{for(;n<r;n++)1===(t=this[n]||{}).nodeType&&(ce.cleanData(Se(t,!1)),t.innerHTML=e);t=0}catch(e){}}t&&this.empty().append(e)},null,e,arguments.length)},replaceWith:function(){var n=[];return $e(this,arguments,function(e){var t=this.parentNode;ce.inArray(this,n)<0&&(ce.cleanData(Se(this)),t&&t.replaceChild(e,this))},n)}}),ce.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(e,a){ce.fn[e]=function(e){for(var t,n=[],r=ce(e),i=r.length-1,o=0;o<=i;o++)t=o===i?this:this.clone(!0),ce(r[o])[a](t),s.apply(n,t.get());return this.pushStack(n)}});var _e=new RegExp("^("+G+")(?!px)[a-z%]+$","i"),ze=/^--/,Xe=function(e){var t=e.ownerDocument.defaultView;return t&&t.opener||(t=ie),t.getComputedStyle(e)},Ue=function(e,t,n){var r,i,o={};for(i in t)o[i]=e.style[i],e.style[i]=t[i];for(i in r=n.call(e),t)e.style[i]=o[i];return r},Ve=new RegExp(Q.join("|"),"i");function Ge(e,t,n){var r,i,o,a,s=ze.test(t),u=e.style;return(n=n||Xe(e))&&(a=n.getPropertyValue(t)||n[t],s&&a&&(a=a.replace(ve,"$1")||void 0),""!==a||K(e)||(a=ce.style(e,t)),!le.pixelBoxStyles()&&_e.test(a)&&Ve.test(t)&&(r=u.width,i=u.minWidth,o=u.maxWidth,u.minWidth=u.maxWidth=u.width=a,a=n.width,u.width=r,u.minWidth=i,u.maxWidth=o)),void 0!==a?a+"":a}function Ye(e,t){return{get:function(){if(!e())return(this.get=t).apply(this,arguments);delete this.get}}}!function(){function e(){if(l){u.style.cssText="position:absolute;left:-11111px;width:60px;margin-top:1px;padding:0;border:0",l.style.cssText="position:relative;display:block;box-sizing:border-box;overflow:scroll;margin:auto;border:1px;padding:1px;width:60%;top:1%",J.appendChild(u).appendChild(l);var e=ie.getComputedStyle(l);n="1%"!==e.top,s=12===t(e.marginLeft),l.style.right="60%",o=36===t(e.right),r=36===t(e.width),l.style.position="absolute",i=12===t(l.offsetWidth/3),J.removeChild(u),l=null}}function t(e){return Math.round(parseFloat(e))}var n,r,i,o,a,s,u=C.createElement("div"),l=C.createElement("div");l.style&&(l.style.backgroundClip="content-box",l.cloneNode(!0).style.backgroundClip="",le.clearCloneStyle="content-box"===l.style.backgroundClip,ce.extend(le,{boxSizingReliable:function(){return e(),r},pixelBoxStyles:function(){return e(),o},pixelPosition:function(){return e(),n},reliableMarginLeft:function(){return e(),s},scrollboxSize:function(){return e(),i},reliableTrDimensions:function(){var e,t,n,r;return null==a&&(e=C.createElement("table"),t=C.createElement("tr"),n=C.createElement("div"),e.style.cssText="position:absolute;left:-11111px;border-collapse:separate",t.style.cssText="box-sizing:content-box;border:1px solid",t.style.height="1px",n.style.height="9px",n.style.display="block",J.appendChild(e).appendChild(t).appendChild(n),r=ie.getComputedStyle(t),a=parseInt(r.height,10)+parseInt(r.borderTopWidth,10)+parseInt(r.borderBottomWidth,10)===t.offsetHeight,J.removeChild(e)),a}}))}();var Qe=["Webkit","Moz","ms"],Je=C.createElement("div").style,Ke={};function Ze(e){var t=ce.cssProps[e]||Ke[e];return t||(e in Je?e:Ke[e]=function(e){var t=e[0].toUpperCase()+e.slice(1),n=Qe.length;while(n--)if((e=Qe[n]+t)in Je)return e}(e)||e)}var et=/^(none|table(?!-c[ea]).+)/,tt={position:"absolute",visibility:"hidden",display:"block"},nt={letterSpacing:"0",fontWeight:"400"};function rt(e,t,n){var r=Y.exec(t);return r?Math.max(0,r[2]-(n||0))+(r[3]||"px"):t}function it(e,t,n,r,i,o){var a="width"===t?1:0,s=0,u=0,l=0;if(n===(r?"border":"content"))return 0;for(;a<4;a+=2)"margin"===n&&(l+=ce.css(e,n+Q[a],!0,i)),r?("content"===n&&(u-=ce.css(e,"padding"+Q[a],!0,i)),"margin"!==n&&(u-=ce.css(e,"border"+Q[a]+"Width",!0,i))):(u+=ce.css(e,"padding"+Q[a],!0,i),"padding"!==n?u+=ce.css(e,"border"+Q[a]+"Width",!0,i):s+=ce.css(e,"border"+Q[a]+"Width",!0,i));return!r&&0<=o&&(u+=Math.max(0,Math.ceil(e["offset"+t[0].toUpperCase()+t.slice(1)]-o-u-s-.5))||0),u+l}function ot(e,t,n){var r=Xe(e),i=(!le.boxSizingReliable()||n)&&"border-box"===ce.css(e,"boxSizing",!1,r),o=i,a=Ge(e,t,r),s="offset"+t[0].toUpperCase()+t.slice(1);if(_e.test(a)){if(!n)return a;a="auto"}return(!le.boxSizingReliable()&&i||!le.reliableTrDimensions()&&fe(e,"tr")||"auto"===a||!parseFloat(a)&&"inline"===ce.css(e,"display",!1,r))&&e.getClientRects().length&&(i="border-box"===ce.css(e,"boxSizing",!1,r),(o=s in e)&&(a=e[s])),(a=parseFloat(a)||0)+it(e,t,n||(i?"border":"content"),o,r,a)+"px"}function at(e,t,n,r,i){return new at.prototype.init(e,t,n,r,i)}ce.extend({cssHooks:{opacity:{get:function(e,t){if(t){var n=Ge(e,"opacity");return""===n?"1":n}}}},cssNumber:{animationIterationCount:!0,aspectRatio:!0,borderImageSlice:!0,columnCount:!0,flexGrow:!0,flexShrink:!0,fontWeight:!0,gridArea:!0,gridColumn:!0,gridColumnEnd:!0,gridColumnStart:!0,gridRow:!0,gridRowEnd:!0,gridRowStart:!0,lineHeight:!0,opacity:!0,order:!0,orphans:!0,scale:!0,widows:!0,zIndex:!0,zoom:!0,fillOpacity:!0,floodOpacity:!0,stopOpacity:!0,strokeMiterlimit:!0,strokeOpacity:!0},cssProps:{},style:function(e,t,n,r){if(e&&3!==e.nodeType&&8!==e.nodeType&&e.style){var i,o,a,s=F(t),u=ze.test(t),l=e.style;if(u||(t=Ze(s)),a=ce.cssHooks[t]||ce.cssHooks[s],void 0===n)return a&&"get"in a&&void 0!==(i=a.get(e,!1,r))?i:l[t];"string"===(o=typeof n)&&(i=Y.exec(n))&&i[1]&&(n=te(e,t,i),o="number"),null!=n&&n==n&&("number"!==o||u||(n+=i&&i[3]||(ce.cssNumber[s]?"":"px")),le.clearCloneStyle||""!==n||0!==t.indexOf("background")||(l[t]="inherit"),a&&"set"in a&&void 0===(n=a.set(e,n,r))||(u?l.setProperty(t,n):l[t]=n))}},css:function(e,t,n,r){var i,o,a,s=F(t);return ze.test(t)||(t=Ze(s)),(a=ce.cssHooks[t]||ce.cssHooks[s])&&"get"in a&&(i=a.get(e,!0,n)),void 0===i&&(i=Ge(e,t,r)),"normal"===i&&t in nt&&(i=nt[t]),""===n||n?(o=parseFloat(i),!0===n||isFinite(o)?o||0:i):i}}),ce.each(["height","width"],function(e,u){ce.cssHooks[u]={get:function(e,t,n){if(t)return!et.test(ce.css(e,"display"))||e.getClientRects().length&&e.getBoundingClientRect().width?ot(e,u,n):Ue(e,tt,function(){return ot(e,u,n)})},set:function(e,t,n){var r,i=Xe(e),o=!le.scrollboxSize()&&"absolute"===i.position,a=(o||n)&&"border-box"===ce.css(e,"boxSizing",!1,i),s=n?it(e,u,n,a,i):0;return a&&o&&(s-=Math.ceil(e["offset"+u[0].toUpperCase()+u.slice(1)]-parseFloat(i[u])-it(e,u,"border",!1,i)-.5)),s&&(r=Y.exec(t))&&"px"!==(r[3]||"px")&&(e.style[u]=t,t=ce.css(e,u)),rt(0,t,s)}}}),ce.cssHooks.marginLeft=Ye(le.reliableMarginLeft,function(e,t){if(t)return(parseFloat(Ge(e,"marginLeft"))||e.getBoundingClientRect().left-Ue(e,{marginLeft:0},function(){return e.getBoundingClientRect().left}))+"px"}),ce.each({margin:"",padding:"",border:"Width"},function(i,o){ce.cssHooks[i+o]={expand:function(e){for(var t=0,n={},r="string"==typeof e?e.split(" "):[e];t<4;t++)n[i+Q[t]+o]=r[t]||r[t-2]||r[0];return n}},"margin"!==i&&(ce.cssHooks[i+o].set=rt)}),ce.fn.extend({css:function(e,t){return M(this,function(e,t,n){var r,i,o={},a=0;if(Array.isArray(t)){for(r=Xe(e),i=t.length;a<i;a++)o[t[a]]=ce.css(e,t[a],!1,r);return o}return void 0!==n?ce.style(e,t,n):ce.css(e,t)},e,t,1<arguments.length)}}),((ce.Tween=at).prototype={constructor:at,init:function(e,t,n,r,i,o){this.elem=e,this.prop=n,this.easing=i||ce.easing._default,this.options=t,this.start=this.now=this.cur(),this.end=r,this.unit=o||(ce.cssNumber[n]?"":"px")},cur:function(){var e=at.propHooks[this.prop];return e&&e.get?e.get(this):at.propHooks._default.get(this)},run:function(e){var t,n=at.propHooks[this.prop];return this.options.duration?this.pos=t=ce.easing[this.easing](e,this.options.duration*e,0,1,this.options.duration):this.pos=t=e,this.now=(this.end-this.start)*t+this.start,this.options.step&&this.options.step.call(this.elem,this.now,this),n&&n.set?n.set(this):at.propHooks._default.set(this),this}}).init.prototype=at.prototype,(at.propHooks={_default:{get:function(e){var t;return 1!==e.elem.nodeType||null!=e.elem[e.prop]&&null==e.elem.style[e.prop]?e.elem[e.prop]:(t=ce.css(e.elem,e.prop,""))&&"auto"!==t?t:0},set:function(e){ce.fx.step[e.prop]?ce.fx.step[e.prop](e):1!==e.elem.nodeType||!ce.cssHooks[e.prop]&&null==e.elem.style[Ze(e.prop)]?e.elem[e.prop]=e.now:ce.style(e.elem,e.prop,e.now+e.unit)}}}).scrollTop=at.propHooks.scrollLeft={set:function(e){e.elem.nodeType&&e.elem.parentNode&&(e.elem[e.prop]=e.now)}},ce.easing={linear:function(e){return e},swing:function(e){return.5-Math.cos(e*Math.PI)/2},_default:"swing"},ce.fx=at.prototype.init,ce.fx.step={};var st,ut,lt,ct,ft=/^(?:toggle|show|hide)$/,pt=/queueHooks$/;function dt(){ut&&(!1===C.hidden&&ie.requestAnimationFrame?ie.requestAnimationFrame(dt):ie.setTimeout(dt,ce.fx.interval),ce.fx.tick())}function ht(){return ie.setTimeout(function(){st=void 0}),st=Date.now()}function gt(e,t){var n,r=0,i={height:e};for(t=t?1:0;r<4;r+=2-t)i["margin"+(n=Q[r])]=i["padding"+n]=e;return t&&(i.opacity=i.width=e),i}function vt(e,t,n){for(var r,i=(yt.tweeners[t]||[]).concat(yt.tweeners["*"]),o=0,a=i.length;o<a;o++)if(r=i[o].call(n,t,e))return r}function yt(o,e,t){var n,a,r=0,i=yt.prefilters.length,s=ce.Deferred().always(function(){delete u.elem}),u=function(){if(a)return!1;for(var e=st||ht(),t=Math.max(0,l.startTime+l.duration-e),n=1-(t/l.duration||0),r=0,i=l.tweens.length;r<i;r++)l.tweens[r].run(n);return s.notifyWith(o,[l,n,t]),n<1&&i?t:(i||s.notifyWith(o,[l,1,0]),s.resolveWith(o,[l]),!1)},l=s.promise({elem:o,props:ce.extend({},e),opts:ce.extend(!0,{specialEasing:{},easing:ce.easing._default},t),originalProperties:e,originalOptions:t,startTime:st||ht(),duration:t.duration,tweens:[],createTween:function(e,t){var n=ce.Tween(o,l.opts,e,t,l.opts.specialEasing[e]||l.opts.easing);return l.tweens.push(n),n},stop:function(e){var t=0,n=e?l.tweens.length:0;if(a)return this;for(a=!0;t<n;t++)l.tweens[t].run(1);return e?(s.notifyWith(o,[l,1,0]),s.resolveWith(o,[l,e])):s.rejectWith(o,[l,e]),this}}),c=l.props;for(!function(e,t){var n,r,i,o,a;for(n in e)if(i=t[r=F(n)],o=e[n],Array.isArray(o)&&(i=o[1],o=e[n]=o[0]),n!==r&&(e[r]=o,delete e[n]),(a=ce.cssHooks[r])&&"expand"in a)for(n in o=a.expand(o),delete e[r],o)n in e||(e[n]=o[n],t[n]=i);else t[r]=i}(c,l.opts.specialEasing);r<i;r++)if(n=yt.prefilters[r].call(l,o,c,l.opts))return v(n.stop)&&(ce._queueHooks(l.elem,l.opts.queue).stop=n.stop.bind(n)),n;return ce.map(c,vt,l),v(l.opts.start)&&l.opts.start.call(o,l),l.progress(l.opts.progress).done(l.opts.done,l.opts.complete).fail(l.opts.fail).always(l.opts.always),ce.fx.timer(ce.extend(u,{elem:o,anim:l,queue:l.opts.queue})),l}ce.Animation=ce.extend(yt,{tweeners:{"*":[function(e,t){var n=this.createTween(e,t);return te(n.elem,e,Y.exec(t),n),n}]},tweener:function(e,t){v(e)?(t=e,e=["*"]):e=e.match(D);for(var n,r=0,i=e.length;r<i;r++)n=e[r],yt.tweeners[n]=yt.tweeners[n]||[],yt.tweeners[n].unshift(t)},prefilters:[function(e,t,n){var r,i,o,a,s,u,l,c,f="width"in t||"height"in t,p=this,d={},h=e.style,g=e.nodeType&&ee(e),v=_.get(e,"fxshow");for(r in n.queue||(null==(a=ce._queueHooks(e,"fx")).unqueued&&(a.unqueued=0,s=a.empty.fire,a.empty.fire=function(){a.unqueued||s()}),a.unqueued++,p.always(function(){p.always(function(){a.unqueued--,ce.queue(e,"fx").length||a.empty.fire()})})),t)if(i=t[r],ft.test(i)){if(delete t[r],o=o||"toggle"===i,i===(g?"hide":"show")){if("show"!==i||!v||void 0===v[r])continue;g=!0}d[r]=v&&v[r]||ce.style(e,r)}if((u=!ce.isEmptyObject(t))||!ce.isEmptyObject(d))for(r in f&&1===e.nodeType&&(n.overflow=[h.overflow,h.overflowX,h.overflowY],null==(l=v&&v.display)&&(l=_.get(e,"display")),"none"===(c=ce.css(e,"display"))&&(l?c=l:(re([e],!0),l=e.style.display||l,c=ce.css(e,"display"),re([e]))),("inline"===c||"inline-block"===c&&null!=l)&&"none"===ce.css(e,"float")&&(u||(p.done(function(){h.display=l}),null==l&&(c=h.display,l="none"===c?"":c)),h.display="inline-block")),n.overflow&&(h.overflow="hidden",p.always(function(){h.overflow=n.overflow[0],h.overflowX=n.overflow[1],h.overflowY=n.overflow[2]})),u=!1,d)u||(v?"hidden"in v&&(g=v.hidden):v=_.access(e,"fxshow",{display:l}),o&&(v.hidden=!g),g&&re([e],!0),p.done(function(){for(r in g||re([e]),_.remove(e,"fxshow"),d)ce.style(e,r,d[r])})),u=vt(g?v[r]:0,r,p),r in v||(v[r]=u.start,g&&(u.end=u.start,u.start=0))}],prefilter:function(e,t){t?yt.prefilters.unshift(e):yt.prefilters.push(e)}}),ce.speed=function(e,t,n){var r=e&&"object"==typeof e?ce.extend({},e):{complete:n||!n&&t||v(e)&&e,duration:e,easing:n&&t||t&&!v(t)&&t};return ce.fx.off?r.duration=0:"number"!=typeof r.duration&&(r.duration in ce.fx.speeds?r.duration=ce.fx.speeds[r.duration]:r.duration=ce.fx.speeds._default),null!=r.queue&&!0!==r.queue||(r.queue="fx"),r.old=r.complete,r.complete=function(){v(r.old)&&r.old.call(this),r.queue&&ce.dequeue(this,r.queue)},r},ce.fn.extend({fadeTo:function(e,t,n,r){return this.filter(ee).css("opacity",0).show().end().animate({opacity:t},e,n,r)},animate:function(t,e,n,r){var i=ce.isEmptyObject(t),o=ce.speed(e,n,r),a=function(){var e=yt(this,ce.extend({},t),o);(i||_.get(this,"finish"))&&e.stop(!0)};return a.finish=a,i||!1===o.queue?this.each(a):this.queue(o.queue,a)},stop:function(i,e,o){var a=function(e){var t=e.stop;delete e.stop,t(o)};return"string"!=typeof i&&(o=e,e=i,i=void 0),e&&this.queue(i||"fx",[]),this.each(function(){var e=!0,t=null!=i&&i+"queueHooks",n=ce.timers,r=_.get(this);if(t)r[t]&&r[t].stop&&a(r[t]);else for(t in r)r[t]&&r[t].stop&&pt.test(t)&&a(r[t]);for(t=n.length;t--;)n[t].elem!==this||null!=i&&n[t].queue!==i||(n[t].anim.stop(o),e=!1,n.splice(t,1));!e&&o||ce.dequeue(this,i)})},finish:function(a){return!1!==a&&(a=a||"fx"),this.each(function(){var e,t=_.get(this),n=t[a+"queue"],r=t[a+"queueHooks"],i=ce.timers,o=n?n.length:0;for(t.finish=!0,ce.queue(this,a,[]),r&&r.stop&&r.stop.call(this,!0),e=i.length;e--;)i[e].elem===this&&i[e].queue===a&&(i[e].anim.stop(!0),i.splice(e,1));for(e=0;e<o;e++)n[e]&&n[e].finish&&n[e].finish.call(this);delete t.finish})}}),ce.each(["toggle","show","hide"],function(e,r){var i=ce.fn[r];ce.fn[r]=function(e,t,n){return null==e||"boolean"==typeof e?i.apply(this,arguments):this.animate(gt(r,!0),e,t,n)}}),ce.each({slideDown:gt("show"),slideUp:gt("hide"),slideToggle:gt("toggle"),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(e,r){ce.fn[e]=function(e,t,n){return this.animate(r,e,t,n)}}),ce.timers=[],ce.fx.tick=function(){var e,t=0,n=ce.timers;for(st=Date.now();t<n.length;t++)(e=n[t])()||n[t]!==e||n.splice(t--,1);n.length||ce.fx.stop(),st=void 0},ce.fx.timer=function(e){ce.timers.push(e),ce.fx.start()},ce.fx.interval=13,ce.fx.start=function(){ut||(ut=!0,dt())},ce.fx.stop=function(){ut=null},ce.fx.speeds={slow:600,fast:200,_default:400},ce.fn.delay=function(r,e){return r=ce.fx&&ce.fx.speeds[r]||r,e=e||"fx",this.queue(e,function(e,t){var n=ie.setTimeout(e,r);t.stop=function(){ie.clearTimeout(n)}})},lt=C.createElement("input"),ct=C.createElement("select").appendChild(C.createElement("option")),lt.type="checkbox",le.checkOn=""!==lt.value,le.optSelected=ct.selected,(lt=C.createElement("input")).value="t",lt.type="radio",le.radioValue="t"===lt.value;var mt,xt=ce.expr.attrHandle;ce.fn.extend({attr:function(e,t){return M(this,ce.attr,e,t,1<arguments.length)},removeAttr:function(e){return this.each(function(){ce.removeAttr(this,e)})}}),ce.extend({attr:function(e,t,n){var r,i,o=e.nodeType;if(3!==o&&8!==o&&2!==o)return"undefined"==typeof e.getAttribute?ce.prop(e,t,n):(1===o&&ce.isXMLDoc(e)||(i=ce.attrHooks[t.toLowerCase()]||(ce.expr.match.bool.test(t)?mt:void 0)),void 0!==n?null===n?void ce.removeAttr(e,t):i&&"set"in i&&void 0!==(r=i.set(e,n,t))?r:(e.setAttribute(t,n+""),n):i&&"get"in i&&null!==(r=i.get(e,t))?r:null==(r=ce.find.attr(e,t))?void 0:r)},attrHooks:{type:{set:function(e,t){if(!le.radioValue&&"radio"===t&&fe(e,"input")){var n=e.value;return e.setAttribute("type",t),n&&(e.value=n),t}}}},removeAttr:function(e,t){var n,r=0,i=t&&t.match(D);if(i&&1===e.nodeType)while(n=i[r++])e.removeAttribute(n)}}),mt={set:function(e,t,n){return!1===t?ce.removeAttr(e,n):e.setAttribute(n,n),n}},ce.each(ce.expr.match.bool.source.match(/\w+/g),function(e,t){var a=xt[t]||ce.find.attr;xt[t]=function(e,t,n){var r,i,o=t.toLowerCase();return n||(i=xt[o],xt[o]=r,r=null!=a(e,t,n)?o:null,xt[o]=i),r}});var bt=/^(?:input|select|textarea|button)$/i,wt=/^(?:a|area)$/i;function Tt(e){return(e.match(D)||[]).join(" ")}function Ct(e){return e.getAttribute&&e.getAttribute("class")||""}function kt(e){return Array.isArray(e)?e:"string"==typeof e&&e.match(D)||[]}ce.fn.extend({prop:function(e,t){return M(this,ce.prop,e,t,1<arguments.length)},removeProp:function(e){return this.each(function(){delete this[ce.propFix[e]||e]})}}),ce.extend({prop:function(e,t,n){var r,i,o=e.nodeType;if(3!==o&&8!==o&&2!==o)return 1===o&&ce.isXMLDoc(e)||(t=ce.propFix[t]||t,i=ce.propHooks[t]),void 0!==n?i&&"set"in i&&void 0!==(r=i.set(e,n,t))?r:e[t]=n:i&&"get"in i&&null!==(r=i.get(e,t))?r:e[t]},propHooks:{tabIndex:{get:function(e){var t=ce.find.attr(e,"tabindex");return t?parseInt(t,10):bt.test(e.nodeName)||wt.test(e.nodeName)&&e.href?0:-1}}},propFix:{"for":"htmlFor","class":"className"}}),le.optSelected||(ce.propHooks.selected={get:function(e){var t=e.parentNode;return t&&t.parentNode&&t.parentNode.selectedIndex,null},set:function(e){var t=e.parentNode;t&&(t.selectedIndex,t.parentNode&&t.parentNode.selectedIndex)}}),ce.each(["tabIndex","readOnly","maxLength","cellSpacing","cellPadding","rowSpan","colSpan","useMap","frameBorder","contentEditable"],function(){ce.propFix[this.toLowerCase()]=this}),ce.fn.extend({addClass:function(t){var e,n,r,i,o,a;return v(t)?this.each(function(e){ce(this).addClass(t.call(this,e,Ct(this)))}):(e=kt(t)).length?this.each(function(){if(r=Ct(this),n=1===this.nodeType&&" "+Tt(r)+" "){for(o=0;o<e.length;o++)i=e[o],n.indexOf(" "+i+" ")<0&&(n+=i+" ");a=Tt(n),r!==a&&this.setAttribute("class",a)}}):this},removeClass:function(t){var e,n,r,i,o,a;return v(t)?this.each(function(e){ce(this).removeClass(t.call(this,e,Ct(this)))}):arguments.length?(e=kt(t)).length?this.each(function(){if(r=Ct(this),n=1===this.nodeType&&" "+Tt(r)+" "){for(o=0;o<e.length;o++){i=e[o];while(-1<n.indexOf(" "+i+" "))n=n.replace(" "+i+" "," ")}a=Tt(n),r!==a&&this.setAttribute("class",a)}}):this:this.attr("class","")},toggleClass:function(t,n){var e,r,i,o,a=typeof t,s="string"===a||Array.isArray(t);return v(t)?this.each(function(e){ce(this).toggleClass(t.call(this,e,Ct(this),n),n)}):"boolean"==typeof n&&s?n?this.addClass(t):this.removeClass(t):(e=kt(t),this.each(function(){if(s)for(o=ce(this),i=0;i<e.length;i++)r=e[i],o.hasClass(r)?o.removeClass(r):o.addClass(r);else void 0!==t&&"boolean"!==a||((r=Ct(this))&&_.set(this,"__className__",r),this.setAttribute&&this.setAttribute("class",r||!1===t?"":_.get(this,"__className__")||""))}))},hasClass:function(e){var t,n,r=0;t=" "+e+" ";while(n=this[r++])if(1===n.nodeType&&-1<(" "+Tt(Ct(n))+" ").indexOf(t))return!0;return!1}});var St=/\r/g;ce.fn.extend({val:function(n){var r,e,i,t=this[0];return arguments.length?(i=v(n),this.each(function(e){var t;1===this.nodeType&&(null==(t=i?n.call(this,e,ce(this).val()):n)?t="":"number"==typeof t?t+="":Array.isArray(t)&&(t=ce.map(t,function(e){return null==e?"":e+""})),(r=ce.valHooks[this.type]||ce.valHooks[this.nodeName.toLowerCase()])&&"set"in r&&void 0!==r.set(this,t,"value")||(this.value=t))})):t?(r=ce.valHooks[t.type]||ce.valHooks[t.nodeName.toLowerCase()])&&"get"in r&&void 0!==(e=r.get(t,"value"))?e:"string"==typeof(e=t.value)?e.replace(St,""):null==e?"":e:void 0}}),ce.extend({valHooks:{option:{get:function(e){var t=ce.find.attr(e,"value");return null!=t?t:Tt(ce.text(e))}},select:{get:function(e){var t,n,r,i=e.options,o=e.selectedIndex,a="select-one"===e.type,s=a?null:[],u=a?o+1:i.length;for(r=o<0?u:a?o:0;r<u;r++)if(((n=i[r]).selected||r===o)&&!n.disabled&&(!n.parentNode.disabled||!fe(n.parentNode,"optgroup"))){if(t=ce(n).val(),a)return t;s.push(t)}return s},set:function(e,t){var n,r,i=e.options,o=ce.makeArray(t),a=i.length;while(a--)((r=i[a]).selected=-1<ce.inArray(ce.valHooks.option.get(r),o))&&(n=!0);return n||(e.selectedIndex=-1),o}}}}),ce.each(["radio","checkbox"],function(){ce.valHooks[this]={set:function(e,t){if(Array.isArray(t))return e.checked=-1<ce.inArray(ce(e).val(),t)}},le.checkOn||(ce.valHooks[this].get=function(e){return null===e.getAttribute("value")?"on":e.value})});var Et=ie.location,jt={guid:Date.now()},At=/\?/;ce.parseXML=function(e){var t,n;if(!e||"string"!=typeof e)return null;try{t=(new ie.DOMParser).parseFromString(e,"text/xml")}catch(e){}return n=t&&t.getElementsByTagName("parsererror")[0],t&&!n||ce.error("Invalid XML: "+(n?ce.map(n.childNodes,function(e){return e.textContent}).join("\n"):e)),t};var Dt=/^(?:focusinfocus|focusoutblur)$/,Nt=function(e){e.stopPropagation()};ce.extend(ce.event,{trigger:function(e,t,n,r){var i,o,a,s,u,l,c,f,p=[n||C],d=ue.call(e,"type")?e.type:e,h=ue.call(e,"namespace")?e.namespace.split("."):[];if(o=f=a=n=n||C,3!==n.nodeType&&8!==n.nodeType&&!Dt.test(d+ce.event.triggered)&&(-1<d.indexOf(".")&&(d=(h=d.split(".")).shift(),h.sort()),u=d.indexOf(":")<0&&"on"+d,(e=e[ce.expando]?e:new ce.Event(d,"object"==typeof e&&e)).isTrigger=r?2:3,e.namespace=h.join("."),e.rnamespace=e.namespace?new RegExp("(^|\\.)"+h.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,e.result=void 0,e.target||(e.target=n),t=null==t?[e]:ce.makeArray(t,[e]),c=ce.event.special[d]||{},r||!c.trigger||!1!==c.trigger.apply(n,t))){if(!r&&!c.noBubble&&!y(n)){for(s=c.delegateType||d,Dt.test(s+d)||(o=o.parentNode);o;o=o.parentNode)p.push(o),a=o;a===(n.ownerDocument||C)&&p.push(a.defaultView||a.parentWindow||ie)}i=0;while((o=p[i++])&&!e.isPropagationStopped())f=o,e.type=1<i?s:c.bindType||d,(l=(_.get(o,"events")||Object.create(null))[e.type]&&_.get(o,"handle"))&&l.apply(o,t),(l=u&&o[u])&&l.apply&&$(o)&&(e.result=l.apply(o,t),!1===e.result&&e.preventDefault());return e.type=d,r||e.isDefaultPrevented()||c._default&&!1!==c._default.apply(p.pop(),t)||!$(n)||u&&v(n[d])&&!y(n)&&((a=n[u])&&(n[u]=null),ce.event.triggered=d,e.isPropagationStopped()&&f.addEventListener(d,Nt),n[d](),e.isPropagationStopped()&&f.removeEventListener(d,Nt),ce.event.triggered=void 0,a&&(n[u]=a)),e.result}},simulate:function(e,t,n){var r=ce.extend(new ce.Event,n,{type:e,isSimulated:!0});ce.event.trigger(r,null,t)}}),ce.fn.extend({trigger:function(e,t){return this.each(function(){ce.event.trigger(e,t,this)})},triggerHandler:function(e,t){var n=this[0];if(n)return ce.event.trigger(e,t,n,!0)}});var qt=/\[\]$/,Lt=/\r?\n/g,Ht=/^(?:submit|button|image|reset|file)$/i,Ot=/^(?:input|select|textarea|keygen)/i;function Pt(n,e,r,i){var t;if(Array.isArray(e))ce.each(e,function(e,t){r||qt.test(n)?i(n,t):Pt(n+"["+("object"==typeof t&&null!=t?e:"")+"]",t,r,i)});else if(r||"object"!==x(e))i(n,e);else for(t in e)Pt(n+"["+t+"]",e[t],r,i)}ce.param=function(e,t){var n,r=[],i=function(e,t){var n=v(t)?t():t;r[r.length]=encodeURIComponent(e)+"="+encodeURIComponent(null==n?"":n)};if(null==e)return"";if(Array.isArray(e)||e.jquery&&!ce.isPlainObject(e))ce.each(e,function(){i(this.name,this.value)});else for(n in e)Pt(n,e[n],t,i);return r.join("&")},ce.fn.extend({serialize:function(){return ce.param(this.serializeArray())},serializeArray:function(){return this.map(function(){var e=ce.prop(this,"elements");return e?ce.makeArray(e):this}).filter(function(){var e=this.type;return this.name&&!ce(this).is(":disabled")&&Ot.test(this.nodeName)&&!Ht.test(e)&&(this.checked||!we.test(e))}).map(function(e,t){var n=ce(this).val();return null==n?null:Array.isArray(n)?ce.map(n,function(e){return{name:t.name,value:e.replace(Lt,"\r\n")}}):{name:t.name,value:n.replace(Lt,"\r\n")}}).get()}});var Mt=/%20/g,Rt=/#.*$/,It=/([?&])_=[^&]*/,Wt=/^(.*?):[ \t]*([^\r\n]*)$/gm,Ft=/^(?:GET|HEAD)$/,$t=/^\/\//,Bt={},_t={},zt="*/".concat("*"),Xt=C.createElement("a");function Ut(o){return function(e,t){"string"!=typeof e&&(t=e,e="*");var n,r=0,i=e.toLowerCase().match(D)||[];if(v(t))while(n=i[r++])"+"===n[0]?(n=n.slice(1)||"*",(o[n]=o[n]||[]).unshift(t)):(o[n]=o[n]||[]).push(t)}}function Vt(t,i,o,a){var s={},u=t===_t;function l(e){var r;return s[e]=!0,ce.each(t[e]||[],function(e,t){var n=t(i,o,a);return"string"!=typeof n||u||s[n]?u?!(r=n):void 0:(i.dataTypes.unshift(n),l(n),!1)}),r}return l(i.dataTypes[0])||!s["*"]&&l("*")}function Gt(e,t){var n,r,i=ce.ajaxSettings.flatOptions||{};for(n in t)void 0!==t[n]&&((i[n]?e:r||(r={}))[n]=t[n]);return r&&ce.extend(!0,e,r),e}Xt.href=Et.href,ce.extend({active:0,lastModified:{},etag:{},ajaxSettings:{url:Et.href,type:"GET",isLocal:/^(?:about|app|app-storage|.+-extension|file|res|widget):$/.test(Et.protocol),global:!0,processData:!0,async:!0,contentType:"application/x-www-form-urlencoded; charset=UTF-8",accepts:{"*":zt,text:"text/plain",html:"text/html",xml:"application/xml, text/xml",json:"application/json, text/javascript"},contents:{xml:/\bxml\b/,html:/\bhtml/,json:/\bjson\b/},responseFields:{xml:"responseXML",text:"responseText",json:"responseJSON"},converters:{"* text":String,"text html":!0,"text json":JSON.parse,"text xml":ce.parseXML},flatOptions:{url:!0,context:!0}},ajaxSetup:function(e,t){return t?Gt(Gt(e,ce.ajaxSettings),t):Gt(ce.ajaxSettings,e)},ajaxPrefilter:Ut(Bt),ajaxTransport:Ut(_t),ajax:function(e,t){"object"==typeof e&&(t=e,e=void 0),t=t||{};var c,f,p,n,d,r,h,g,i,o,v=ce.ajaxSetup({},t),y=v.context||v,m=v.context&&(y.nodeType||y.jquery)?ce(y):ce.event,x=ce.Deferred(),b=ce.Callbacks("once memory"),w=v.statusCode||{},a={},s={},u="canceled",T={readyState:0,getResponseHeader:function(e){var t;if(h){if(!n){n={};while(t=Wt.exec(p))n[t[1].toLowerCase()+" "]=(n[t[1].toLowerCase()+" "]||[]).concat(t[2])}t=n[e.toLowerCase()+" "]}return null==t?null:t.join(", ")},getAllResponseHeaders:function(){return h?p:null},setRequestHeader:function(e,t){return null==h&&(e=s[e.toLowerCase()]=s[e.toLowerCase()]||e,a[e]=t),this},overrideMimeType:function(e){return null==h&&(v.mimeType=e),this},statusCode:function(e){var t;if(e)if(h)T.always(e[T.status]);else for(t in e)w[t]=[w[t],e[t]];return this},abort:function(e){var t=e||u;return c&&c.abort(t),l(0,t),this}};if(x.promise(T),v.url=((e||v.url||Et.href)+"").replace($t,Et.protocol+"//"),v.type=t.method||t.type||v.method||v.type,v.dataTypes=(v.dataType||"*").toLowerCase().match(D)||[""],null==v.crossDomain){r=C.createElement("a");try{r.href=v.url,r.href=r.href,v.crossDomain=Xt.protocol+"//"+Xt.host!=r.protocol+"//"+r.host}catch(e){v.crossDomain=!0}}if(v.data&&v.processData&&"string"!=typeof v.data&&(v.data=ce.param(v.data,v.traditional)),Vt(Bt,v,t,T),h)return T;for(i in(g=ce.event&&v.global)&&0==ce.active++&&ce.event.trigger("ajaxStart"),v.type=v.type.toUpperCase(),v.hasContent=!Ft.test(v.type),f=v.url.replace(Rt,""),v.hasContent?v.data&&v.processData&&0===(v.contentType||"").indexOf("application/x-www-form-urlencoded")&&(v.data=v.data.replace(Mt,"+")):(o=v.url.slice(f.length),v.data&&(v.processData||"string"==typeof v.data)&&(f+=(At.test(f)?"&":"?")+v.data,delete v.data),!1===v.cache&&(f=f.replace(It,"$1"),o=(At.test(f)?"&":"?")+"_="+jt.guid+++o),v.url=f+o),v.ifModified&&(ce.lastModified[f]&&T.setRequestHeader("If-Modified-Since",ce.lastModified[f]),ce.etag[f]&&T.setRequestHeader("If-None-Match",ce.etag[f])),(v.data&&v.hasContent&&!1!==v.contentType||t.contentType)&&T.setRequestHeader("Content-Type",v.contentType),T.setRequestHeader("Accept",v.dataTypes[0]&&v.accepts[v.dataTypes[0]]?v.accepts[v.dataTypes[0]]+("*"!==v.dataTypes[0]?", "+zt+"; q=0.01":""):v.accepts["*"]),v.headers)T.setRequestHeader(i,v.headers[i]);if(v.beforeSend&&(!1===v.beforeSend.call(y,T,v)||h))return T.abort();if(u="abort",b.add(v.complete),T.done(v.success),T.fail(v.error),c=Vt(_t,v,t,T)){if(T.readyState=1,g&&m.trigger("ajaxSend",[T,v]),h)return T;v.async&&0<v.timeout&&(d=ie.setTimeout(function(){T.abort("timeout")},v.timeout));try{h=!1,c.send(a,l)}catch(e){if(h)throw e;l(-1,e)}}else l(-1,"No Transport");function l(e,t,n,r){var i,o,a,s,u,l=t;h||(h=!0,d&&ie.clearTimeout(d),c=void 0,p=r||"",T.readyState=0<e?4:0,i=200<=e&&e<300||304===e,n&&(s=function(e,t,n){var r,i,o,a,s=e.contents,u=e.dataTypes;while("*"===u[0])u.shift(),void 0===r&&(r=e.mimeType||t.getResponseHeader("Content-Type"));if(r)for(i in s)if(s[i]&&s[i].test(r)){u.unshift(i);break}if(u[0]in n)o=u[0];else{for(i in n){if(!u[0]||e.converters[i+" "+u[0]]){o=i;break}a||(a=i)}o=o||a}if(o)return o!==u[0]&&u.unshift(o),n[o]}(v,T,n)),!i&&-1<ce.inArray("script",v.dataTypes)&&ce.inArray("json",v.dataTypes)<0&&(v.converters["text script"]=function(){}),s=function(e,t,n,r){var i,o,a,s,u,l={},c=e.dataTypes.slice();if(c[1])for(a in e.converters)l[a.toLowerCase()]=e.converters[a];o=c.shift();while(o)if(e.responseFields[o]&&(n[e.responseFields[o]]=t),!u&&r&&e.dataFilter&&(t=e.dataFilter(t,e.dataType)),u=o,o=c.shift())if("*"===o)o=u;else if("*"!==u&&u!==o){if(!(a=l[u+" "+o]||l["* "+o]))for(i in l)if((s=i.split(" "))[1]===o&&(a=l[u+" "+s[0]]||l["* "+s[0]])){!0===a?a=l[i]:!0!==l[i]&&(o=s[0],c.unshift(s[1]));break}if(!0!==a)if(a&&e["throws"])t=a(t);else try{t=a(t)}catch(e){return{state:"parsererror",error:a?e:"No conversion from "+u+" to "+o}}}return{state:"success",data:t}}(v,s,T,i),i?(v.ifModified&&((u=T.getResponseHeader("Last-Modified"))&&(ce.lastModified[f]=u),(u=T.getResponseHeader("etag"))&&(ce.etag[f]=u)),204===e||"HEAD"===v.type?l="nocontent":304===e?l="notmodified":(l=s.state,o=s.data,i=!(a=s.error))):(a=l,!e&&l||(l="error",e<0&&(e=0))),T.status=e,T.statusText=(t||l)+"",i?x.resolveWith(y,[o,l,T]):x.rejectWith(y,[T,l,a]),T.statusCode(w),w=void 0,g&&m.trigger(i?"ajaxSuccess":"ajaxError",[T,v,i?o:a]),b.fireWith(y,[T,l]),g&&(m.trigger("ajaxComplete",[T,v]),--ce.active||ce.event.trigger("ajaxStop")))}return T},getJSON:function(e,t,n){return ce.get(e,t,n,"json")},getScript:function(e,t){return ce.get(e,void 0,t,"script")}}),ce.each(["get","post"],function(e,i){ce[i]=function(e,t,n,r){return v(t)&&(r=r||n,n=t,t=void 0),ce.ajax(ce.extend({url:e,type:i,dataType:r,data:t,success:n},ce.isPlainObject(e)&&e))}}),ce.ajaxPrefilter(function(e){var t;for(t in e.headers)"content-type"===t.toLowerCase()&&(e.contentType=e.headers[t]||"")}),ce._evalUrl=function(e,t,n){return ce.ajax({url:e,type:"GET",dataType:"script",cache:!0,async:!1,global:!1,converters:{"text script":function(){}},dataFilter:function(e){ce.globalEval(e,t,n)}})},ce.fn.extend({wrapAll:function(e){var t;return this[0]&&(v(e)&&(e=e.call(this[0])),t=ce(e,this[0].ownerDocument).eq(0).clone(!0),this[0].parentNode&&t.insertBefore(this[0]),t.map(function(){var e=this;while(e.firstElementChild)e=e.firstElementChild;return e}).append(this)),this},wrapInner:function(n){return v(n)?this.each(function(e){ce(this).wrapInner(n.call(this,e))}):this.each(function(){var e=ce(this),t=e.contents();t.length?t.wrapAll(n):e.append(n)})},wrap:function(t){var n=v(t);return this.each(function(e){ce(this).wrapAll(n?t.call(this,e):t)})},unwrap:function(e){return this.parent(e).not("body").each(function(){ce(this).replaceWith(this.childNodes)}),this}}),ce.expr.pseudos.hidden=function(e){return!ce.expr.pseudos.visible(e)},ce.expr.pseudos.visible=function(e){return!!(e.offsetWidth||e.offsetHeight||e.getClientRects().length)},ce.ajaxSettings.xhr=function(){try{return new ie.XMLHttpRequest}catch(e){}};var Yt={0:200,1223:204},Qt=ce.ajaxSettings.xhr();le.cors=!!Qt&&"withCredentials"in Qt,le.ajax=Qt=!!Qt,ce.ajaxTransport(function(i){var o,a;if(le.cors||Qt&&!i.crossDomain)return{send:function(e,t){var n,r=i.xhr();if(r.open(i.type,i.url,i.async,i.username,i.password),i.xhrFields)for(n in i.xhrFields)r[n]=i.xhrFields[n];for(n in i.mimeType&&r.overrideMimeType&&r.overrideMimeType(i.mimeType),i.crossDomain||e["X-Requested-With"]||(e["X-Requested-With"]="XMLHttpRequest"),e)r.setRequestHeader(n,e[n]);o=function(e){return function(){o&&(o=a=r.onload=r.onerror=r.onabort=r.ontimeout=r.onreadystatechange=null,"abort"===e?r.abort():"error"===e?"number"!=typeof r.status?t(0,"error"):t(r.status,r.statusText):t(Yt[r.status]||r.status,r.statusText,"text"!==(r.responseType||"text")||"string"!=typeof r.responseText?{binary:r.response}:{text:r.responseText},r.getAllResponseHeaders()))}},r.onload=o(),a=r.onerror=r.ontimeout=o("error"),void 0!==r.onabort?r.onabort=a:r.onreadystatechange=function(){4===r.readyState&&ie.setTimeout(function(){o&&a()})},o=o("abort");try{r.send(i.hasContent&&i.data||null)}catch(e){if(o)throw e}},abort:function(){o&&o()}}}),ce.ajaxPrefilter(function(e){e.crossDomain&&(e.contents.script=!1)}),ce.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/\b(?:java|ecma)script\b/},converters:{"text script":function(e){return ce.globalEval(e),e}}}),ce.ajaxPrefilter("script",function(e){void 0===e.cache&&(e.cache=!1),e.crossDomain&&(e.type="GET")}),ce.ajaxTransport("script",function(n){var r,i;if(n.crossDomain||n.scriptAttrs)return{send:function(e,t){r=ce("<script>").attr(n.scriptAttrs||{}).prop({charset:n.scriptCharset,src:n.url}).on("load error",i=function(e){r.remove(),i=null,e&&t("error"===e.type?404:200,e.type)}),C.head.appendChild(r[0])},abort:function(){i&&i()}}});var Jt,Kt=[],Zt=/(=)\?(?=&|$)|\?\?/;ce.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var e=Kt.pop()||ce.expando+"_"+jt.guid++;return this[e]=!0,e}}),ce.ajaxPrefilter("json jsonp",function(e,t,n){var r,i,o,a=!1!==e.jsonp&&(Zt.test(e.url)?"url":"string"==typeof e.data&&0===(e.contentType||"").indexOf("application/x-www-form-urlencoded")&&Zt.test(e.data)&&"data");if(a||"jsonp"===e.dataTypes[0])return r=e.jsonpCallback=v(e.jsonpCallback)?e.jsonpCallback():e.jsonpCallback,a?e[a]=e[a].replace(Zt,"$1"+r):!1!==e.jsonp&&(e.url+=(At.test(e.url)?"&":"?")+e.jsonp+"="+r),e.converters["script json"]=function(){return o||ce.error(r+" was not called"),o[0]},e.dataTypes[0]="json",i=ie[r],ie[r]=function(){o=arguments},n.always(function(){void 0===i?ce(ie).removeProp(r):ie[r]=i,e[r]&&(e.jsonpCallback=t.jsonpCallback,Kt.push(r)),o&&v(i)&&i(o[0]),o=i=void 0}),"script"}),le.createHTMLDocument=((Jt=C.implementation.createHTMLDocument("").body).innerHTML="<form></form><form></form>",2===Jt.childNodes.length),ce.parseHTML=function(e,t,n){return"string"!=typeof e?[]:("boolean"==typeof t&&(n=t,t=!1),t||(le.createHTMLDocument?((r=(t=C.implementation.createHTMLDocument("")).createElement("base")).href=C.location.href,t.head.appendChild(r)):t=C),o=!n&&[],(i=w.exec(e))?[t.createElement(i[1])]:(i=Ae([e],t,o),o&&o.length&&ce(o).remove(),ce.merge([],i.childNodes)));var r,i,o},ce.fn.load=function(e,t,n){var r,i,o,a=this,s=e.indexOf(" ");return-1<s&&(r=Tt(e.slice(s)),e=e.slice(0,s)),v(t)?(n=t,t=void 0):t&&"object"==typeof t&&(i="POST"),0<a.length&&ce.ajax({url:e,type:i||"GET",dataType:"html",data:t}).done(function(e){o=arguments,a.html(r?ce("<div>").append(ce.parseHTML(e)).find(r):e)}).always(n&&function(e,t){a.each(function(){n.apply(this,o||[e.responseText,t,e])})}),this},ce.expr.pseudos.animated=function(t){return ce.grep(ce.timers,function(e){return t===e.elem}).length},ce.offset={setOffset:function(e,t,n){var r,i,o,a,s,u,l=ce.css(e,"position"),c=ce(e),f={};"static"===l&&(e.style.position="relative"),s=c.offset(),o=ce.css(e,"top"),u=ce.css(e,"left"),("absolute"===l||"fixed"===l)&&-1<(o+u).indexOf("auto")?(a=(r=c.position()).top,i=r.left):(a=parseFloat(o)||0,i=parseFloat(u)||0),v(t)&&(t=t.call(e,n,ce.extend({},s))),null!=t.top&&(f.top=t.top-s.top+a),null!=t.left&&(f.left=t.left-s.left+i),"using"in t?t.using.call(e,f):c.css(f)}},ce.fn.extend({offset:function(t){if(arguments.length)return void 0===t?this:this.each(function(e){ce.offset.setOffset(this,t,e)});var e,n,r=this[0];return r?r.getClientRects().length?(e=r.getBoundingClientRect(),n=r.ownerDocument.defaultView,{top:e.top+n.pageYOffset,left:e.left+n.pageXOffset}):{top:0,left:0}:void 0},position:function(){if(this[0]){var e,t,n,r=this[0],i={top:0,left:0};if("fixed"===ce.css(r,"position"))t=r.getBoundingClientRect();else{t=this.offset(),n=r.ownerDocument,e=r.offsetParent||n.documentElement;while(e&&(e===n.body||e===n.documentElement)&&"static"===ce.css(e,"position"))e=e.parentNode;e&&e!==r&&1===e.nodeType&&((i=ce(e).offset()).top+=ce.css(e,"borderTopWidth",!0),i.left+=ce.css(e,"borderLeftWidth",!0))}return{top:t.top-i.top-ce.css(r,"marginTop",!0),left:t.left-i.left-ce.css(r,"marginLeft",!0)}}},offsetParent:function(){return this.map(function(){var e=this.offsetParent;while(e&&"static"===ce.css(e,"position"))e=e.offsetParent;return e||J})}}),ce.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(t,i){var o="pageYOffset"===i;ce.fn[t]=function(e){return M(this,function(e,t,n){var r;if(y(e)?r=e:9===e.nodeType&&(r=e.defaultView),void 0===n)return r?r[i]:e[t];r?r.scrollTo(o?r.pageXOffset:n,o?n:r.pageYOffset):e[t]=n},t,e,arguments.length)}}),ce.each(["top","left"],function(e,n){ce.cssHooks[n]=Ye(le.pixelPosition,function(e,t){if(t)return t=Ge(e,n),_e.test(t)?ce(e).position()[n]+"px":t})}),ce.each({Height:"height",Width:"width"},function(a,s){ce.each({padding:"inner"+a,content:s,"":"outer"+a},function(r,o){ce.fn[o]=function(e,t){var n=arguments.length&&(r||"boolean"!=typeof e),i=r||(!0===e||!0===t?"margin":"border");return M(this,function(e,t,n){var r;return y(e)?0===o.indexOf("outer")?e["inner"+a]:e.document.documentElement["client"+a]:9===e.nodeType?(r=e.documentElement,Math.max(e.body["scroll"+a],r["scroll"+a],e.body["offset"+a],r["offset"+a],r["client"+a])):void 0===n?ce.css(e,t,i):ce.style(e,t,n,i)},s,n?e:void 0,n)}})}),ce.each(["ajaxStart","ajaxStop","ajaxComplete","ajaxError","ajaxSuccess","ajaxSend"],function(e,t){ce.fn[t]=function(e){return this.on(t,e)}}),ce.fn.extend({bind:function(e,t,n){return this.on(e,null,t,n)},unbind:function(e,t){return this.off(e,null,t)},delegate:function(e,t,n,r){return this.on(t,e,n,r)},undelegate:function(e,t,n){return 1===arguments.length?this.off(e,"**"):this.off(t,e||"**",n)},hover:function(e,t){return this.on("mouseenter",e).on("mouseleave",t||e)}}),ce.each("blur focus focusin focusout resize scroll click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup contextmenu".split(" "),function(e,n){ce.fn[n]=function(e,t){return 0<arguments.length?this.on(n,null,e,t):this.trigger(n)}});var en=/^[\s\uFEFF\xA0]+|([^\s\uFEFF\xA0])[\s\uFEFF\xA0]+$/g;ce.proxy=function(e,t){var n,r,i;if("string"==typeof t&&(n=e[t],t=e,e=n),v(e))return r=ae.call(arguments,2),(i=function(){return e.apply(t||this,r.concat(ae.call(arguments)))}).guid=e.guid=e.guid||ce.guid++,i},ce.holdReady=function(e){e?ce.readyWait++:ce.ready(!0)},ce.isArray=Array.isArray,ce.parseJSON=JSON.parse,ce.nodeName=fe,ce.isFunction=v,ce.isWindow=y,ce.camelCase=F,ce.type=x,ce.now=Date.now,ce.isNumeric=function(e){var t=ce.type(e);return("number"===t||"string"===t)&&!isNaN(e-parseFloat(e))},ce.trim=function(e){return null==e?"":(e+"").replace(en,"$1")},"function"==typeof define&&define.amd&&define("jquery",[],function(){return ce});var tn=ie.jQuery,nn=ie.$;return ce.noConflict=function(e){return ie.$===ce&&(ie.$=nn),e&&ie.jQuery===ce&&(ie.jQuery=tn),ce},"undefined"==typeof e&&(ie.jQuery=ie.$=ce),ce});
diff --git a/bitbake/lib/toaster/toastergui/static/js/jquery-3.7.1.min.map b/bitbake/lib/toaster/toastergui/static/js/jquery-3.7.1.min.map
new file mode 100644
index 0000000000..db38af5893
--- /dev/null
+++ b/bitbake/lib/toaster/toastergui/static/js/jquery-3.7.1.min.map
@@ -0,0 +1 @@
+{"version":3,"sources":["jquery-3.7.1.js"],"names":["global","factory","module","exports","document","w","Error","window","this","noGlobal","arr","getProto","Object","getPrototypeOf","slice","flat","array","call","concat","apply","push","indexOf","class2type","toString","hasOwn","hasOwnProperty","fnToString","ObjectFunctionString","support","isFunction","obj","nodeType","item","isWindow","preservedScriptAttributes","type","src","nonce","noModule","DOMEval","code","node","doc","i","val","script","createElement","text","getAttribute","setAttribute","head","appendChild","parentNode","removeChild","toType","version","rhtmlSuffix","jQuery","selector","context","fn","init","isArrayLike","length","nodeName","elem","name","toLowerCase","prototype","jquery","constructor","toArray","get","num","pushStack","elems","ret","merge","prevObject","each","callback","map","arguments","first","eq","last","even","grep","_elem","odd","len","j","end","sort","splice","extend","options","copy","copyIsArray","clone","target","deep","isPlainObject","Array","isArray","undefined","expando","Math","random","replace","isReady","error","msg","noop","proto","Ctor","isEmptyObject","globalEval","textContent","documentElement","nodeValue","makeArray","results","inArray","isXMLDoc","namespace","namespaceURI","docElem","ownerDocument","test","second","invert","matches","callbackExpect","arg","value","guid","Symbol","iterator","split","_i","pop","whitespace","rtrimCSS","RegExp","contains","a","b","bup","compareDocumentPosition","rcssescape","fcssescape","ch","asCodePoint","charCodeAt","escapeSelector","sel","preferredDoc","pushNative","Expr","outermostContext","sortInput","hasDuplicate","documentIsHTML","rbuggyQSA","dirruns","done","classCache","createCache","tokenCache","compilerCache","nonnativeSelectorCache","sortOrder","booleans","identifier","attributes","pseudos","rwhitespace","rcomma","rleadingCombinator","rdescend","rpseudo","ridentifier","matchExpr","ID","CLASS","TAG","ATTR","PSEUDO","CHILD","bool","needsContext","rinputs","rheader","rquickExpr","rsibling","runescape","funescape","escape","nonHex","high","String","fromCharCode","unloadHandler","setDocument","inDisabledFieldset","addCombinator","disabled","dir","next","childNodes","e","els","find","seed","m","nid","match","groups","newSelector","newContext","exec","getElementById","id","getElementsByTagName","getElementsByClassName","testContext","scope","tokenize","toSelector","join","querySelectorAll","qsaError","removeAttribute","select","keys","cache","key","cacheLength","shift","markFunction","assert","el","createInputPseudo","createButtonPseudo","createDisabledPseudo","isDisabled","createPositionalPseudo","argument","matchIndexes","subWindow","webkitMatchesSelector","msMatchesSelector","defaultView","top","addEventListener","getById","getElementsByName","disconnectedMatch","cssHas","querySelector","filter","attrId","getAttributeNode","tag","className","input","innerHTML","compare","sortDetached","expr","elements","matchesSelector","attr","attrHandle","uniqueSort","duplicates","sortStable","createPseudo","relative",">"," ","+","~","preFilter","excess","unquoted","nodeNameSelector","expectedNodeName","pattern","operator","check","result","what","_argument","simple","forward","ofType","_context","xml","outerCache","nodeIndex","start","parent","useCache","diff","firstChild","lastChild","pseudo","args","setFilters","idx","matched","not","matcher","compile","unmatched","has","lang","elemLang","hash","location","root","focus","activeElement","err","safeActiveElement","hasFocus","href","tabIndex","enabled","checked","selected","selectedIndex","empty","nextSibling","header","button","_matchIndexes","lt","gt","nth","radio","checkbox","file","password","image","submit","reset","parseOnly","tokens","soFar","preFilters","cached","combinator","base","skip","checkNonElements","doneName","oldCache","newCache","elementMatcher","matchers","condense","newUnmatched","mapped","setMatcher","postFilter","postFinder","postSelector","temp","matcherOut","preMap","postMap","preexisting","contexts","multipleContexts","matcherIn","matcherFromTokens","checkContext","leadingRelative","implicitRelative","matchContext","matchAnyContext","elementMatchers","setMatchers","bySet","byElement","superMatcher","outermost","matchedCount","setMatched","contextBackup","dirrunsUnique","token","compiled","filters","unique","getText","isXML","selectors","until","truncate","is","siblings","n","rneedsContext","rsingleTag","winnow","qualifier","self","rootjQuery","parseHTML","ready","rparentsprev","guaranteedUnique","children","contents","prev","sibling","cur","targets","l","closest","index","prevAll","add","addBack","parents","parentsUntil","nextAll","nextUntil","prevUntil","contentDocument","content","reverse","rnothtmlwhite","Identity","v","Thrower","ex","adoptValue","resolve","reject","noValue","method","promise","fail","then","Callbacks","object","_","flag","firing","memory","fired","locked","list","queue","firingIndex","fire","once","stopOnFalse","remove","disable","lock","fireWith","Deferred","func","tuples","state","always","deferred","catch","pipe","fns","newDefer","tuple","returned","progress","notify","onFulfilled","onRejected","onProgress","maxDepth","depth","handler","special","that","mightThrow","TypeError","notifyWith","resolveWith","process","exceptionHook","rejectWith","getErrorHook","getStackHook","setTimeout","stateString","when","singleValue","remaining","resolveContexts","resolveValues","primary","updateFunc","rerrorNames","asyncError","console","warn","message","stack","readyException","readyList","completed","removeEventListener","readyWait","wait","readyState","doScroll","access","chainable","emptyGet","raw","bulk","_key","rmsPrefix","rdashAlpha","fcamelCase","_all","letter","toUpperCase","camelCase","string","acceptData","owner","Data","uid","defineProperty","configurable","set","data","prop","hasData","dataPriv","dataUser","rbrace","rmultiDash","dataAttr","JSON","parse","removeData","_data","_removeData","attrs","dequeue","startLength","hooks","_queueHooks","unshift","stop","setter","clearQueue","tmp","count","defer","pnum","source","rcssNum","cssExpand","isAttached","composed","getRootNode","isHiddenWithinTree","style","display","css","adjustCSS","valueParts","tween","adjusted","scale","maxIterations","currentValue","initial","unit","cssNumber","initialInUnit","defaultDisplayMap","showHide","show","values","body","hide","toggle","div","rcheckableType","rtagName","rscriptType","createDocumentFragment","checkClone","cloneNode","noCloneChecked","defaultValue","option","wrapMap","thead","col","tr","td","_default","getAll","setGlobalEval","refElements","tbody","tfoot","colgroup","caption","th","optgroup","rhtml","buildFragment","scripts","selection","ignored","wrap","attached","fragment","nodes","htmlPrefilter","createTextNode","rtypenamespace","returnTrue","returnFalse","on","types","one","origFn","event","off","leverageNative","isSetup","saved","isTrigger","delegateType","stopPropagation","stopImmediatePropagation","preventDefault","trigger","isImmediatePropagationStopped","handleObjIn","eventHandle","events","t","handleObj","handlers","namespaces","origType","elemData","create","handle","triggered","dispatch","bindType","delegateCount","setup","mappedTypes","origCount","teardown","removeEvent","nativeEvent","handlerQueue","fix","delegateTarget","preDispatch","isPropagationStopped","currentTarget","rnamespace","postDispatch","matchedHandlers","matchedSelectors","addProp","hook","Event","enumerable","originalEvent","writable","load","noBubble","click","beforeunload","returnValue","props","isDefaultPrevented","defaultPrevented","relatedTarget","timeStamp","Date","now","isSimulated","altKey","bubbles","cancelable","changedTouches","ctrlKey","detail","eventPhase","metaKey","pageX","pageY","shiftKey","view","char","charCode","keyCode","buttons","clientX","clientY","offsetX","offsetY","pointerId","pointerType","screenX","screenY","targetTouches","toElement","touches","which","blur","focusMappedHandler","documentMode","simulate","attaches","dataHolder","mouseenter","mouseleave","pointerenter","pointerleave","orig","related","rnoInnerhtml","rchecked","rcleanScript","manipulationTarget","disableScript","restoreScript","cloneCopyEvent","dest","udataOld","udataCur","domManip","collection","hasScripts","iNoClone","valueIsFunction","html","_evalUrl","keepData","cleanData","dataAndEvents","deepDataAndEvents","srcElements","destElements","inPage","detach","append","prepend","insertBefore","before","after","replaceWith","replaceChild","appendTo","prependTo","insertAfter","replaceAll","original","insert","rnumnonpx","rcustomProp","getStyles","opener","getComputedStyle","swap","old","rboxStyle","curCSS","computed","width","minWidth","maxWidth","isCustomProp","getPropertyValue","pixelBoxStyles","addGetHookIf","conditionFn","hookFn","computeStyleTests","container","cssText","divStyle","pixelPositionVal","reliableMarginLeftVal","roundPixelMeasures","marginLeft","right","pixelBoxStylesVal","boxSizingReliableVal","position","scrollboxSizeVal","offsetWidth","measure","round","parseFloat","reliableTrDimensionsVal","backgroundClip","clearCloneStyle","boxSizingReliable","pixelPosition","reliableMarginLeft","scrollboxSize","reliableTrDimensions","table","trChild","trStyle","height","parseInt","borderTopWidth","borderBottomWidth","offsetHeight","cssPrefixes","emptyStyle","vendorProps","finalPropName","final","cssProps","capName","vendorPropName","rdisplayswap","cssShow","visibility","cssNormalTransform","letterSpacing","fontWeight","setPositiveNumber","subtract","max","boxModelAdjustment","dimension","box","isBorderBox","styles","computedVal","extra","delta","marginDelta","ceil","getWidthOrHeight","valueIsBorderBox","offsetProp","getClientRects","Tween","easing","cssHooks","opacity","animationIterationCount","aspectRatio","borderImageSlice","columnCount","flexGrow","flexShrink","gridArea","gridColumn","gridColumnEnd","gridColumnStart","gridRow","gridRowEnd","gridRowStart","lineHeight","order","orphans","widows","zIndex","zoom","fillOpacity","floodOpacity","stopOpacity","strokeMiterlimit","strokeOpacity","origName","setProperty","isFinite","getBoundingClientRect","scrollboxSizeBuggy","left","margin","padding","border","prefix","suffix","expand","expanded","parts","propHooks","run","percent","eased","duration","pos","step","fx","scrollTop","scrollLeft","linear","p","swing","cos","PI","fxNow","inProgress","opt","rfxtypes","rrun","schedule","hidden","requestAnimationFrame","interval","tick","createFxNow","genFx","includeWidth","createTween","animation","Animation","tweeners","properties","stopped","prefilters","currentTime","startTime","tweens","opts","specialEasing","originalProperties","originalOptions","gotoEnd","propFilter","bind","complete","timer","anim","*","tweener","oldfire","propTween","restoreDisplay","isBox","dataShow","unqueued","overflow","overflowX","overflowY","prefilter","speed","speeds","fadeTo","to","animate","optall","doAnimation","finish","stopQueue","timers","cssFn","slideDown","slideUp","slideToggle","fadeIn","fadeOut","fadeToggle","slow","fast","delay","time","timeout","clearTimeout","checkOn","optSelected","radioValue","boolHook","removeAttr","nType","attrHooks","attrNames","getter","lowercaseName","rfocusable","rclickable","stripAndCollapse","getClass","classesToArray","removeProp","propFix","tabindex","for","class","addClass","classNames","curValue","finalValue","removeClass","toggleClass","stateVal","isValidValue","hasClass","rreturn","valHooks","optionSet","rquery","parseXML","parserErrorElem","DOMParser","parseFromString","rfocusMorph","stopPropagationCallback","onlyHandlers","bubbleType","ontype","lastElement","eventPath","parentWindow","triggerHandler","rbracket","rCRLF","rsubmitterTypes","rsubmittable","buildParams","traditional","param","s","valueOrFunction","encodeURIComponent","serialize","serializeArray","r20","rhash","rantiCache","rheaders","rnoContent","rprotocol","transports","allTypes","originAnchor","addToPrefiltersOrTransports","structure","dataTypeExpression","dataType","dataTypes","inspectPrefiltersOrTransports","jqXHR","inspected","seekingTransport","inspect","prefilterOrFactory","dataTypeOrTransport","ajaxExtend","flatOptions","ajaxSettings","active","lastModified","etag","url","isLocal","protocol","processData","async","contentType","accepts","json","responseFields","converters","* text","text html","text json","text xml","ajaxSetup","settings","ajaxPrefilter","ajaxTransport","ajax","transport","cacheURL","responseHeadersString","responseHeaders","timeoutTimer","urlAnchor","fireGlobals","uncached","callbackContext","globalEventContext","completeDeferred","statusCode","requestHeaders","requestHeadersNames","strAbort","getResponseHeader","getAllResponseHeaders","setRequestHeader","overrideMimeType","mimeType","status","abort","statusText","finalText","crossDomain","host","hasContent","ifModified","headers","beforeSend","success","send","nativeStatusText","responses","isSuccess","response","modified","ct","finalDataType","firstDataType","ajaxHandleResponses","conv2","current","conv","dataFilter","throws","ajaxConvert","getJSON","getScript","text script","wrapAll","firstElementChild","wrapInner","htmlIsFunction","unwrap","visible","xhr","XMLHttpRequest","xhrSuccessStatus","0","1223","xhrSupported","cors","errorCallback","open","username","xhrFields","onload","onerror","onabort","ontimeout","onreadystatechange","responseType","responseText","binary","scriptAttrs","charset","scriptCharset","evt","oldCallbacks","rjsonp","jsonp","jsonpCallback","originalSettings","callbackName","overwritten","responseContainer","jsonProp","createHTMLDocument","implementation","keepScripts","parsed","params","animated","offset","setOffset","curPosition","curLeft","curCSSTop","curTop","curOffset","curCSSLeft","curElem","using","rect","win","pageYOffset","pageXOffset","offsetParent","parentOffset","scrollTo","Height","Width","","defaultExtra","funcName","unbind","delegate","undelegate","hover","fnOver","fnOut","rtrim","proxy","holdReady","hold","parseJSON","isNumeric","isNaN","trim","define","amd","_jQuery","_$","$","noConflict"],"mappings":";CAUA,SAAYA,EAAQC,GAEnB,aAEuB,iBAAXC,QAAiD,iBAAnBA,OAAOC,QAShDD,OAAOC,QAAUH,EAAOI,SACvBH,EAASD,GAAQ,GACjB,SAAUK,GACT,IAAMA,EAAED,SACP,MAAM,IAAIE,MAAO,4CAElB,OAAOL,EAASI,IAGlBJ,EAASD,GAtBX,CA0BuB,oBAAXO,OAAyBA,OAASC,KAAM,SAAUD,GAAQE,GAMtE,aAEA,IAAIC,GAAM,GAENC,EAAWC,OAAOC,eAElBC,GAAQJ,GAAII,MAEZC,EAAOL,GAAIK,KAAO,SAAUC,GAC/B,OAAON,GAAIK,KAAKE,KAAMD,IACnB,SAAUA,GACb,OAAON,GAAIQ,OAAOC,MAAO,GAAIH,IAI1BI,EAAOV,GAAIU,KAEXC,GAAUX,GAAIW,QAEdC,EAAa,GAEbC,EAAWD,EAAWC,SAEtBC,GAASF,EAAWG,eAEpBC,EAAaF,GAAOD,SAEpBI,EAAuBD,EAAWT,KAAML,QAExCgB,GAAU,GAEVC,EAAa,SAAqBC,GASpC,MAAsB,mBAARA,GAA8C,iBAAjBA,EAAIC,UAC1B,mBAAbD,EAAIE,MAIVC,EAAW,SAAmBH,GAChC,OAAc,MAAPA,GAAeA,IAAQA,EAAIvB,QAIhCH,EAAWG,GAAOH,SAIjB8B,EAA4B,CAC/BC,MAAM,EACNC,KAAK,EACLC,OAAO,EACPC,UAAU,GAGX,SAASC,EAASC,EAAMC,EAAMC,GAG7B,IAAIC,EAAGC,EACNC,GAHDH,EAAMA,GAAOtC,GAGC0C,cAAe,UAG7B,GADAD,EAAOE,KAAOP,EACTC,EACJ,IAAME,KAAKT,GAYVU,EAAMH,EAAME,IAAOF,EAAKO,cAAgBP,EAAKO,aAAcL,KAE1DE,EAAOI,aAAcN,EAAGC,GAI3BF,EAAIQ,KAAKC,YAAaN,GAASO,WAAWC,YAAaR,GAIzD,SAASS,EAAQxB,GAChB,OAAY,MAAPA,EACGA,EAAM,GAIQ,iBAARA,GAAmC,mBAARA,EACxCR,EAAYC,EAASN,KAAMa,KAAW,gBAC/BA,EAQT,IAAIyB,EAAU,QAEbC,EAAc,SAGdC,GAAS,SAAUC,EAAUC,GAI5B,OAAO,IAAIF,GAAOG,GAAGC,KAAMH,EAAUC,IAmYvC,SAASG,EAAahC,GAMrB,IAAIiC,IAAWjC,GAAO,WAAYA,GAAOA,EAAIiC,OAC5C5B,EAAOmB,EAAQxB,GAEhB,OAAKD,EAAYC,KAASG,EAAUH,KAIpB,UAATK,GAA+B,IAAX4B,GACR,iBAAXA,GAAgC,EAATA,GAAgBA,EAAS,KAAOjC,GAIhE,SAASkC,GAAUC,EAAMC,GAExB,OAAOD,EAAKD,UAAYC,EAAKD,SAASG,gBAAkBD,EAAKC,cApZ9DV,GAAOG,GAAKH,GAAOW,UAAY,CAG9BC,OAAQd,EAERe,YAAab,GAGbM,OAAQ,EAERQ,QAAS,WACR,OAAOzD,GAAMG,KAAMT,OAKpBgE,IAAK,SAAUC,GAGd,OAAY,MAAPA,EACG3D,GAAMG,KAAMT,MAIbiE,EAAM,EAAIjE,KAAMiE,EAAMjE,KAAKuD,QAAWvD,KAAMiE,IAKpDC,UAAW,SAAUC,GAGpB,IAAIC,EAAMnB,GAAOoB,MAAOrE,KAAK8D,cAAeK,GAM5C,OAHAC,EAAIE,WAAatE,KAGVoE,GAIRG,KAAM,SAAUC,GACf,OAAOvB,GAAOsB,KAAMvE,KAAMwE,IAG3BC,IAAK,SAAUD,GACd,OAAOxE,KAAKkE,UAAWjB,GAAOwB,IAAKzE,KAAM,SAAUyD,EAAMtB,GACxD,OAAOqC,EAAS/D,KAAMgD,EAAMtB,EAAGsB,OAIjCnD,MAAO,WACN,OAAON,KAAKkE,UAAW5D,GAAMK,MAAOX,KAAM0E,aAG3CC,MAAO,WACN,OAAO3E,KAAK4E,GAAI,IAGjBC,KAAM,WACL,OAAO7E,KAAK4E,IAAK,IAGlBE,KAAM,WACL,OAAO9E,KAAKkE,UAAWjB,GAAO8B,KAAM/E,KAAM,SAAUgF,EAAO7C,GAC1D,OAASA,EAAI,GAAM,MAIrB8C,IAAK,WACJ,OAAOjF,KAAKkE,UAAWjB,GAAO8B,KAAM/E,KAAM,SAAUgF,EAAO7C,GAC1D,OAAOA,EAAI,MAIbyC,GAAI,SAAUzC,GACb,IAAI+C,EAAMlF,KAAKuD,OACd4B,GAAKhD,GAAMA,EAAI,EAAI+C,EAAM,GAC1B,OAAOlF,KAAKkE,UAAgB,GAALiB,GAAUA,EAAID,EAAM,CAAElF,KAAMmF,IAAQ,KAG5DC,IAAK,WACJ,OAAOpF,KAAKsE,YAActE,KAAK8D,eAKhClD,KAAMA,EACNyE,KAAMnF,GAAImF,KACVC,OAAQpF,GAAIoF,QAGbrC,GAAOsC,OAAStC,GAAOG,GAAGmC,OAAS,WAClC,IAAIC,EAAS9B,EAAM9B,EAAK6D,EAAMC,EAAaC,EAC1CC,EAASlB,UAAW,IAAO,GAC3BvC,EAAI,EACJoB,EAASmB,UAAUnB,OACnBsC,GAAO,EAsBR,IAnBuB,kBAAXD,IACXC,EAAOD,EAGPA,EAASlB,UAAWvC,IAAO,GAC3BA,KAIsB,iBAAXyD,GAAwBvE,EAAYuE,KAC/CA,EAAS,IAILzD,IAAMoB,IACVqC,EAAS5F,KACTmC,KAGOA,EAAIoB,EAAQpB,IAGnB,GAAqC,OAA9BqD,EAAUd,UAAWvC,IAG3B,IAAMuB,KAAQ8B,EACbC,EAAOD,EAAS9B,GAIF,cAATA,GAAwBkC,IAAWH,IAKnCI,GAAQJ,IAAUxC,GAAO6C,cAAeL,KAC1CC,EAAcK,MAAMC,QAASP,MAC/B7D,EAAMgE,EAAQlC,GAIbiC,EADID,IAAgBK,MAAMC,QAASpE,GAC3B,GACI8D,GAAgBzC,GAAO6C,cAAelE,GAG1CA,EAFA,GAIT8D,GAAc,EAGdE,EAAQlC,GAAST,GAAOsC,OAAQM,EAAMF,EAAOF,SAGzBQ,IAATR,IACXG,EAAQlC,GAAS+B,IAOrB,OAAOG,GAGR3C,GAAOsC,OAAQ,CAGdW,QAAS,UAAanD,EAAUoD,KAAKC,UAAWC,QAAS,MAAO,IAGhEC,SAAS,EAETC,MAAO,SAAUC,GAChB,MAAM,IAAI1G,MAAO0G,IAGlBC,KAAM,aAENX,cAAe,SAAUxE,GACxB,IAAIoF,EAAOC,EAIX,SAAMrF,GAAgC,oBAAzBP,EAASN,KAAMa,QAI5BoF,EAAQvG,EAAUmB,KASK,mBADvBqF,EAAO3F,GAAOP,KAAMiG,EAAO,gBAAmBA,EAAM5C,cACf5C,EAAWT,KAAMkG,KAAWxF,IAGlEyF,cAAe,SAAUtF,GACxB,IAAIoC,EAEJ,IAAMA,KAAQpC,EACb,OAAO,EAER,OAAO,GAKRuF,WAAY,SAAU7E,EAAMwD,EAAStD,GACpCH,EAASC,EAAM,CAAEH,MAAO2D,GAAWA,EAAQ3D,OAASK,IAGrDqC,KAAM,SAAUjD,EAAKkD,GACpB,IAAIjB,EAAQpB,EAAI,EAEhB,GAAKmB,EAAahC,IAEjB,IADAiC,EAASjC,EAAIiC,OACLpB,EAAIoB,EAAQpB,IACnB,IAAgD,IAA3CqC,EAAS/D,KAAMa,EAAKa,GAAKA,EAAGb,EAAKa,IACrC,WAIF,IAAMA,KAAKb,EACV,IAAgD,IAA3CkD,EAAS/D,KAAMa,EAAKa,GAAKA,EAAGb,EAAKa,IACrC,MAKH,OAAOb,GAKRiB,KAAM,SAAUkB,GACf,IAAIxB,EACHmC,EAAM,GACNjC,EAAI,EACJZ,EAAWkC,EAAKlC,SAEjB,IAAMA,EAGL,MAAUU,EAAOwB,EAAMtB,KAGtBiC,GAAOnB,GAAOV,KAAMN,GAGtB,OAAkB,IAAbV,GAA+B,KAAbA,EACfkC,EAAKqD,YAEK,IAAbvF,EACGkC,EAAKsD,gBAAgBD,YAEX,IAAbvF,GAA+B,IAAbA,EACfkC,EAAKuD,UAKN5C,GAIR6C,UAAW,SAAU/G,EAAKgH,GACzB,IAAI9C,EAAM8C,GAAW,GAarB,OAXY,MAAPhH,IACCoD,EAAalD,OAAQF,IACzB+C,GAAOoB,MAAOD,EACE,iBAARlE,EACN,CAAEA,GAAQA,GAGZU,EAAKH,KAAM2D,EAAKlE,IAIXkE,GAGR+C,QAAS,SAAU1D,EAAMvD,EAAKiC,GAC7B,OAAc,MAAPjC,GAAe,EAAIW,GAAQJ,KAAMP,EAAKuD,EAAMtB,IAGpDiF,SAAU,SAAU3D,GACnB,IAAI4D,EAAY5D,GAAQA,EAAK6D,aAC5BC,EAAU9D,IAAUA,EAAK+D,eAAiB/D,GAAOsD,gBAIlD,OAAQ/D,EAAYyE,KAAMJ,GAAaE,GAAWA,EAAQ/D,UAAY,SAKvEa,MAAO,SAAUM,EAAO+C,GAKvB,IAJA,IAAIxC,GAAOwC,EAAOnE,OACjB4B,EAAI,EACJhD,EAAIwC,EAAMpB,OAEH4B,EAAID,EAAKC,IAChBR,EAAOxC,KAAQuF,EAAQvC,GAKxB,OAFAR,EAAMpB,OAASpB,EAERwC,GAGRI,KAAM,SAAUZ,EAAOK,EAAUmD,GAShC,IARA,IACCC,EAAU,GACVzF,EAAI,EACJoB,EAASY,EAAMZ,OACfsE,GAAkBF,EAIXxF,EAAIoB,EAAQpB,KACAqC,EAAUL,EAAOhC,GAAKA,KAChB0F,GACxBD,EAAQhH,KAAMuD,EAAOhC,IAIvB,OAAOyF,GAIRnD,IAAK,SAAUN,EAAOK,EAAUsD,GAC/B,IAAIvE,EAAQwE,EACX5F,EAAI,EACJiC,EAAM,GAGP,GAAKd,EAAaa,GAEjB,IADAZ,EAASY,EAAMZ,OACPpB,EAAIoB,EAAQpB,IAGL,OAFd4F,EAAQvD,EAAUL,EAAOhC,GAAKA,EAAG2F,KAGhC1D,EAAIxD,KAAMmH,QAMZ,IAAM5F,KAAKgC,EAGI,OAFd4D,EAAQvD,EAAUL,EAAOhC,GAAKA,EAAG2F,KAGhC1D,EAAIxD,KAAMmH,GAMb,OAAOxH,EAAM6D,IAId4D,KAAM,EAIN5G,QAASA,KAGa,mBAAX6G,SACXhF,GAAOG,GAAI6E,OAAOC,UAAahI,GAAK+H,OAAOC,WAI5CjF,GAAOsB,KAAM,uEAAuE4D,MAAO,KAC1F,SAAUC,EAAI1E,GACb5C,EAAY,WAAa4C,EAAO,KAAQA,EAAKC,gBA0B/C,IAAI0E,GAAMnI,GAAImI,IAGVhD,GAAOnF,GAAImF,KAGXC,GAASpF,GAAIoF,OAGbgD,GAAa,sBAGbC,GAAW,IAAIC,OAClB,IAAMF,GAAa,8BAAgCA,GAAa,KAChE,KAODrF,GAAOwF,SAAW,SAAUC,EAAGC,GAC9B,IAAIC,EAAMD,GAAKA,EAAE/F,WAEjB,OAAO8F,IAAME,MAAWA,GAAwB,IAAjBA,EAAIrH,YAIlCmH,EAAED,SACDC,EAAED,SAAUG,GACZF,EAAEG,yBAA8D,GAAnCH,EAAEG,wBAAyBD,MAS3D,IAAIE,EAAa,+CAEjB,SAASC,EAAYC,EAAIC,GACxB,OAAKA,EAGQ,OAAPD,EACG,SAIDA,EAAG1I,MAAO,GAAI,GAAM,KAAO0I,EAAGE,WAAYF,EAAGzF,OAAS,GAAIxC,SAAU,IAAO,IAI5E,KAAOiI,EAGf/F,GAAOkG,eAAiB,SAAUC,GACjC,OAASA,EAAM,IAAK/C,QAASyC,EAAYC,IAM1C,IAAIM,GAAezJ,EAClB0J,GAAa1I,GAEd,WAEA,IAAIuB,EACHoH,EACAC,EACAC,EACAC,EAIA9J,EACAmH,EACA4C,EACAC,EACAhC,EAPAhH,EAAO0I,GAUPpD,EAAUjD,GAAOiD,QACjB2D,EAAU,EACVC,EAAO,EACPC,EAAaC,IACbC,EAAaD,IACbE,EAAgBF,IAChBG,EAAyBH,IACzBI,EAAY,SAAU1B,EAAGC,GAIxB,OAHKD,IAAMC,IACVe,GAAe,GAET,GAGRW,EAAW,6HAMXC,EAAa,0BAA4BhC,GACxC,0CAGDiC,EAAa,MAAQjC,GAAa,KAAOgC,EAAa,OAAShC,GAG9D,gBAAkBA,GAGlB,2DAA6DgC,EAAa,OAC1EhC,GAAa,OAEdkC,EAAU,KAAOF,EAAa,wFAOAC,EAAa,eAO3CE,EAAc,IAAIjC,OAAQF,GAAa,IAAK,KAE5CoC,EAAS,IAAIlC,OAAQ,IAAMF,GAAa,KAAOA,GAAa,KAC5DqC,EAAqB,IAAInC,OAAQ,IAAMF,GAAa,WAAaA,GAAa,IAC7EA,GAAa,KACdsC,EAAW,IAAIpC,OAAQF,GAAa,MAEpCuC,EAAU,IAAIrC,OAAQgC,GACtBM,EAAc,IAAItC,OAAQ,IAAM8B,EAAa,KAE7CS,EAAY,CACXC,GAAI,IAAIxC,OAAQ,MAAQ8B,EAAa,KACrCW,MAAO,IAAIzC,OAAQ,QAAU8B,EAAa,KAC1CY,IAAK,IAAI1C,OAAQ,KAAO8B,EAAa,SACrCa,KAAM,IAAI3C,OAAQ,IAAM+B,GACxBa,OAAQ,IAAI5C,OAAQ,IAAMgC,GAC1Ba,MAAO,IAAI7C,OACV,yDACCF,GAAa,+BAAiCA,GAAa,cAC3DA,GAAa,aAAeA,GAAa,SAAU,KACrDgD,KAAM,IAAI9C,OAAQ,OAAS6B,EAAW,KAAM,KAI5CkB,aAAc,IAAI/C,OAAQ,IAAMF,GAC/B,mDAAqDA,GACrD,mBAAqBA,GAAa,mBAAoB,MAGxDkD,EAAU,sCACVC,EAAU,SAGVC,EAAa,mCAEbC,EAAW,OAIXC,EAAY,IAAIpD,OAAQ,uBAAyBF,GAChD,uBAAwB,KACzBuD,EAAY,SAAUC,EAAQC,GAC7B,IAAIC,EAAO,KAAOF,EAAOxL,MAAO,GAAM,MAEtC,OAAKyL,IAUEC,EAAO,EACbC,OAAOC,aAAcF,EAAO,OAC5BC,OAAOC,aAAcF,GAAQ,GAAK,MAAe,KAAPA,EAAe,SAO3DG,EAAgB,WACfC,KAGDC,EAAqBC,EACpB,SAAU7I,GACT,OAAyB,IAAlBA,EAAK8I,UAAqB/I,GAAUC,EAAM,aAElD,CAAE+I,IAAK,aAAcC,KAAM,WAa7B,IACC7L,EAAKD,MACFT,GAAMI,GAAMG,KAAM4I,GAAaqD,YACjCrD,GAAaqD,YAMdxM,GAAKmJ,GAAaqD,WAAWnJ,QAAShC,SACrC,MAAQoL,GACT/L,EAAO,CACND,MAAO,SAAUiF,EAAQgH,GACxBtD,GAAW3I,MAAOiF,EAAQtF,GAAMG,KAAMmM,KAEvCnM,KAAM,SAAUmF,GACf0D,GAAW3I,MAAOiF,EAAQtF,GAAMG,KAAMiE,UAAW,MAKpD,SAASmI,EAAM3J,EAAUC,EAAS+D,EAAS4F,GAC1C,IAAIC,EAAG5K,EAAGsB,EAAMuJ,EAAKC,EAAOC,EAAQC,EACnCC,EAAajK,GAAWA,EAAQqE,cAGhCjG,EAAW4B,EAAUA,EAAQ5B,SAAW,EAKzC,GAHA2F,EAAUA,GAAW,GAGI,iBAAbhE,IAA0BA,GACxB,IAAb3B,GAA+B,IAAbA,GAA+B,KAAbA,EAEpC,OAAO2F,EAIR,IAAM4F,IACLV,EAAajJ,GACbA,EAAUA,GAAWvD,EAEhB+J,GAAiB,CAIrB,GAAkB,KAAbpI,IAAqB0L,EAAQvB,EAAW2B,KAAMnK,IAGlD,GAAO6J,EAAIE,EAAO,IAGjB,GAAkB,IAAb1L,EAAiB,CACrB,KAAOkC,EAAON,EAAQmK,eAAgBP,IASrC,OAAO7F,EALP,GAAKzD,EAAK8J,KAAOR,EAEhB,OADAnM,EAAKH,KAAMyG,EAASzD,GACbyD,OAWT,GAAKkG,IAAgB3J,EAAO2J,EAAWE,eAAgBP,KACtDF,EAAKpE,SAAUtF,EAASM,IACxBA,EAAK8J,KAAOR,EAGZ,OADAnM,EAAKH,KAAMyG,EAASzD,GACbyD,MAKH,CAAA,GAAK+F,EAAO,GAElB,OADArM,EAAKD,MAAOuG,EAAS/D,EAAQqK,qBAAsBtK,IAC5CgE,EAGD,IAAO6F,EAAIE,EAAO,KAAS9J,EAAQsK,uBAEzC,OADA7M,EAAKD,MAAOuG,EAAS/D,EAAQsK,uBAAwBV,IAC9C7F,EAKT,KAAMiD,EAAwBjH,EAAW,MACrC0G,GAAcA,EAAUnC,KAAMvE,IAAe,CAYhD,GAVAiK,EAAcjK,EACdkK,EAAajK,EASK,IAAb5B,IACFqJ,EAASnD,KAAMvE,IAAcyH,EAAmBlD,KAAMvE,IAAe,EAGvEkK,EAAazB,EAASlE,KAAMvE,IAAcwK,EAAavK,EAAQP,aAC9DO,IAQkBA,GAAY/B,GAAQuM,SAG/BX,EAAM7J,EAAQX,aAAc,OAClCwK,EAAM/J,GAAOkG,eAAgB6D,GAE7B7J,EAAQV,aAAc,KAAQuK,EAAM9G,IAMtC/D,GADA+K,EAASU,EAAU1K,IACRK,OACX,MAAQpB,IACP+K,EAAQ/K,IAAQ6K,EAAM,IAAMA,EAAM,UAAa,IAC9Ca,EAAYX,EAAQ/K,IAEtBgL,EAAcD,EAAOY,KAAM,KAG5B,IAIC,OAHAlN,EAAKD,MAAOuG,EACXkG,EAAWW,iBAAkBZ,IAEvBjG,EACN,MAAQ8G,GACT7D,EAAwBjH,GAAU,GACjC,QACI8J,IAAQ9G,GACZ/C,EAAQ8K,gBAAiB,QAQ9B,OAAOC,GAAQhL,EAASmD,QAASkC,GAAU,MAAQpF,EAAS+D,EAAS4F,GAStE,SAAS9C,IACR,IAAImE,EAAO,GAaX,OAXA,SAASC,EAAOC,EAAKtG,GASpB,OALKoG,EAAKvN,KAAMyN,EAAM,KAAQ9E,EAAK+E,oBAG3BF,EAAOD,EAAKI,SAEXH,EAAOC,EAAM,KAAQtG,GAShC,SAASyG,EAAcpL,GAEtB,OADAA,EAAI8C,IAAY,EACT9C,EAOR,SAASqL,EAAQrL,GAChB,IAAIsL,EAAK9O,EAAS0C,cAAe,YAEjC,IACC,QAASc,EAAIsL,GACZ,MAAQ/B,GACT,OAAO,EACN,QAGI+B,EAAG9L,YACP8L,EAAG9L,WAAWC,YAAa6L,GAI5BA,EAAK,MAQP,SAASC,EAAmBhN,GAC3B,OAAO,SAAU8B,GAChB,OAAOD,GAAUC,EAAM,UAAaA,EAAK9B,OAASA,GAQpD,SAASiN,EAAoBjN,GAC5B,OAAO,SAAU8B,GAChB,OAASD,GAAUC,EAAM,UAAaD,GAAUC,EAAM,YACrDA,EAAK9B,OAASA,GAQjB,SAASkN,EAAsBtC,GAG9B,OAAO,SAAU9I,GAKhB,MAAK,SAAUA,EASTA,EAAKb,aAAgC,IAAlBa,EAAK8I,SAGvB,UAAW9I,EACV,UAAWA,EAAKb,WACba,EAAKb,WAAW2J,WAAaA,EAE7B9I,EAAK8I,WAAaA,EAMpB9I,EAAKqL,aAAevC,GAG1B9I,EAAKqL,cAAgBvC,GACpBF,EAAoB5I,KAAW8I,EAG3B9I,EAAK8I,WAAaA,EAKd,UAAW9I,GACfA,EAAK8I,WAAaA,GAY5B,SAASwC,EAAwB3L,GAChC,OAAOoL,EAAc,SAAUQ,GAE9B,OADAA,GAAYA,EACLR,EAAc,SAAU1B,EAAMlF,GACpC,IAAIzC,EACH8J,EAAe7L,EAAI,GAAI0J,EAAKvJ,OAAQyL,GACpC7M,EAAI8M,EAAa1L,OAGlB,MAAQpB,IACF2K,EAAQ3H,EAAI8J,EAAc9M,MAC9B2K,EAAM3H,KAASyC,EAASzC,GAAM2H,EAAM3H,SAYzC,SAASuI,EAAavK,GACrB,OAAOA,GAAmD,oBAAjCA,EAAQqK,sBAAwCrK,EAQ1E,SAASiJ,EAAanK,GACrB,IAAIiN,EACHhN,EAAMD,EAAOA,EAAKuF,eAAiBvF,EAAOoH,GAO3C,OAAKnH,GAAOtC,GAA6B,IAAjBsC,EAAIX,UAAmBW,EAAI6E,kBAMnDA,GADAnH,EAAWsC,GACgB6E,gBAC3B4C,GAAkB1G,GAAOmE,SAAUxH,GAInCgI,EAAUb,EAAgBa,SACzBb,EAAgBoI,uBAChBpI,EAAgBqI,kBAOZrI,EAAgBqI,mBAMpB/F,IAAgBzJ,IACdsP,EAAYtP,EAASyP,cAAiBH,EAAUI,MAAQJ,GAG1DA,EAAUK,iBAAkB,SAAUpD,GAOvC/K,GAAQoO,QAAUf,EAAQ,SAAUC,GAEnC,OADA3H,EAAgBpE,YAAa+L,GAAKnB,GAAKtK,GAAOiD,SACtCtG,EAAS6P,oBACf7P,EAAS6P,kBAAmBxM,GAAOiD,SAAU3C,SAMhDnC,GAAQsO,kBAAoBjB,EAAQ,SAAUC,GAC7C,OAAO9G,EAAQnH,KAAMiO,EAAI,OAK1BtN,GAAQuM,MAAQc,EAAQ,WACvB,OAAO7O,EAASmO,iBAAkB,YAYnC3M,GAAQuO,OAASlB,EAAQ,WACxB,IAEC,OADA7O,EAASgQ,cAAe,oBACjB,EACN,MAAQjD,GACT,OAAO,KAKJvL,GAAQoO,SACZjG,EAAKsG,OAAO7E,GAAK,SAAUuC,GAC1B,IAAIuC,EAASvC,EAAGlH,QAASuF,EAAWC,GACpC,OAAO,SAAUpI,GAChB,OAAOA,EAAKjB,aAAc,QAAWsN,IAGvCvG,EAAKsD,KAAK7B,GAAK,SAAUuC,EAAIpK,GAC5B,GAAuC,oBAA3BA,EAAQmK,gBAAkC3D,EAAiB,CACtE,IAAIlG,EAAON,EAAQmK,eAAgBC,GACnC,OAAO9J,EAAO,CAAEA,GAAS,OAI3B8F,EAAKsG,OAAO7E,GAAM,SAAUuC,GAC3B,IAAIuC,EAASvC,EAAGlH,QAASuF,EAAWC,GACpC,OAAO,SAAUpI,GAChB,IAAIxB,EAAwC,oBAA1BwB,EAAKsM,kBACtBtM,EAAKsM,iBAAkB,MACxB,OAAO9N,GAAQA,EAAK8F,QAAU+H,IAMhCvG,EAAKsD,KAAK7B,GAAK,SAAUuC,EAAIpK,GAC5B,GAAuC,oBAA3BA,EAAQmK,gBAAkC3D,EAAiB,CACtE,IAAI1H,EAAME,EAAGgC,EACZV,EAAON,EAAQmK,eAAgBC,GAEhC,GAAK9J,EAAO,CAIX,IADAxB,EAAOwB,EAAKsM,iBAAkB,QACjB9N,EAAK8F,QAAUwF,EAC3B,MAAO,CAAE9J,GAIVU,EAAQhB,EAAQsM,kBAAmBlC,GACnCpL,EAAI,EACJ,MAAUsB,EAAOU,EAAOhC,KAEvB,IADAF,EAAOwB,EAAKsM,iBAAkB,QACjB9N,EAAK8F,QAAUwF,EAC3B,MAAO,CAAE9J,GAKZ,MAAO,MAMV8F,EAAKsD,KAAK3B,IAAM,SAAU8E,EAAK7M,GAC9B,MAA6C,oBAAjCA,EAAQqK,qBACZrK,EAAQqK,qBAAsBwC,GAI9B7M,EAAQ4K,iBAAkBiC,IAKnCzG,EAAKsD,KAAK5B,MAAQ,SAAUgF,EAAW9M,GACtC,GAA+C,oBAAnCA,EAAQsK,wBAA0C9D,EAC7D,OAAOxG,EAAQsK,uBAAwBwC,IASzCrG,EAAY,GAIZ6E,EAAQ,SAAUC,GAEjB,IAAIwB,EAEJnJ,EAAgBpE,YAAa+L,GAAKyB,UACjC,UAAYjK,EAAU,iDACLA,EAAU,oEAKtBwI,EAAGX,iBAAkB,cAAexK,QACzCqG,EAAUhJ,KAAM,MAAQ0H,GAAa,aAAe+B,EAAW,KAI1DqE,EAAGX,iBAAkB,QAAU7H,EAAU,MAAO3C,QACrDqG,EAAUhJ,KAAM,MAMX8N,EAAGX,iBAAkB,KAAO7H,EAAU,MAAO3C,QAClDqG,EAAUhJ,KAAM,YAOX8N,EAAGX,iBAAkB,YAAaxK,QACvCqG,EAAUhJ,KAAM,aAKjBsP,EAAQtQ,EAAS0C,cAAe,UAC1BG,aAAc,OAAQ,UAC5BiM,EAAG/L,YAAauN,GAAQzN,aAAc,OAAQ,KAQ9CsE,EAAgBpE,YAAa+L,GAAKnC,UAAW,EACM,IAA9CmC,EAAGX,iBAAkB,aAAcxK,QACvCqG,EAAUhJ,KAAM,WAAY,cAQ7BsP,EAAQtQ,EAAS0C,cAAe,UAC1BG,aAAc,OAAQ,IAC5BiM,EAAG/L,YAAauN,GACVxB,EAAGX,iBAAkB,aAAcxK,QACxCqG,EAAUhJ,KAAM,MAAQ0H,GAAa,QAAUA,GAAa,KAC3DA,GAAa,kBAIVlH,GAAQuO,QAQb/F,EAAUhJ,KAAM,QAGjBgJ,EAAYA,EAAUrG,QAAU,IAAIiF,OAAQoB,EAAUkE,KAAM,MAM5D1D,EAAY,SAAU1B,EAAGC,GAGxB,GAAKD,IAAMC,EAEV,OADAe,GAAe,EACR,EAIR,IAAI0G,GAAW1H,EAAEG,yBAA2BF,EAAEE,wBAC9C,OAAKuH,IAgBU,GAPfA,GAAY1H,EAAElB,eAAiBkB,KAASC,EAAEnB,eAAiBmB,GAC1DD,EAAEG,wBAAyBF,GAG3B,KAIGvH,GAAQiP,cAAgB1H,EAAEE,wBAAyBH,KAAQ0H,EAOzD1H,IAAM9I,GAAY8I,EAAElB,eAAiB6B,IACzCwD,EAAKpE,SAAUY,GAAcX,IACrB,EAOJC,IAAM/I,GAAY+I,EAAEnB,eAAiB6B,IACzCwD,EAAKpE,SAAUY,GAAcV,GACtB,EAIDc,EACJ5I,GAAQJ,KAAMgJ,EAAWf,GAAM7H,GAAQJ,KAAMgJ,EAAWd,GAC1D,EAGe,EAAVyH,GAAe,EAAI,KAGpBxQ,EAqpBR,IAAMuC,KAlpBN0K,EAAKjF,QAAU,SAAU0I,EAAMC,GAC9B,OAAO1D,EAAMyD,EAAM,KAAM,KAAMC,IAGhC1D,EAAK2D,gBAAkB,SAAU/M,EAAM6M,GAGtC,GAFAlE,EAAa3I,GAERkG,IACHQ,EAAwBmG,EAAO,QAC7B1G,IAAcA,EAAUnC,KAAM6I,IAEjC,IACC,IAAIlM,EAAMwD,EAAQnH,KAAMgD,EAAM6M,GAG9B,GAAKlM,GAAOhD,GAAQsO,mBAIlBjM,EAAK7D,UAAuC,KAA3B6D,EAAK7D,SAAS2B,SAChC,OAAO6C,EAEP,MAAQuI,GACTxC,EAAwBmG,GAAM,GAIhC,OAAuD,EAAhDzD,EAAMyD,EAAM1Q,EAAU,KAAM,CAAE6D,IAASF,QAG/CsJ,EAAKpE,SAAW,SAAUtF,EAASM,GAUlC,OAHON,EAAQqE,eAAiBrE,IAAavD,GAC5CwM,EAAajJ,GAEPF,GAAOwF,SAAUtF,EAASM,IAIlCoJ,EAAK4D,KAAO,SAAUhN,EAAMC,IAOpBD,EAAK+D,eAAiB/D,IAAU7D,GACtCwM,EAAa3I,GAGd,IAAIL,EAAKmG,EAAKmH,WAAYhN,EAAKC,eAG9BvB,EAAMgB,GAAMpC,GAAOP,KAAM8I,EAAKmH,WAAYhN,EAAKC,eAC9CP,EAAIK,EAAMC,GAAOiG,QACjB1D,EAEF,YAAaA,IAAR7D,EACGA,EAGDqB,EAAKjB,aAAckB,IAG3BmJ,EAAKtG,MAAQ,SAAUC,GACtB,MAAM,IAAI1G,MAAO,0CAA4C0G,IAO9DvD,GAAO0N,WAAa,SAAUzJ,GAC7B,IAAIzD,EACHmN,EAAa,GACbzL,EAAI,EACJhD,EAAI,EAWL,GAJAuH,GAAgBtI,GAAQyP,WACxBpH,GAAarI,GAAQyP,YAAcvQ,GAAMG,KAAMyG,EAAS,GACxD7B,GAAK5E,KAAMyG,EAASkD,GAEfV,EAAe,CACnB,MAAUjG,EAAOyD,EAAS/E,KACpBsB,IAASyD,EAAS/E,KACtBgD,EAAIyL,EAAWhQ,KAAMuB,IAGvB,MAAQgD,IACPG,GAAO7E,KAAMyG,EAAS0J,EAAYzL,GAAK,GAQzC,OAFAsE,EAAY,KAELvC,GAGRjE,GAAOG,GAAGuN,WAAa,WACtB,OAAO3Q,KAAKkE,UAAWjB,GAAO0N,WAAYrQ,GAAMK,MAAOX,UAGxDuJ,EAAOtG,GAAOqN,KAAO,CAGpBhC,YAAa,GAEbwC,aAActC,EAEdvB,MAAOlC,EAEP2F,WAAY,GAEZ7D,KAAM,GAENkE,SAAU,CACTC,IAAK,CAAExE,IAAK,aAAc7H,OAAO,GACjCsM,IAAK,CAAEzE,IAAK,cACZ0E,IAAK,CAAE1E,IAAK,kBAAmB7H,OAAO,GACtCwM,IAAK,CAAE3E,IAAK,oBAGb4E,UAAW,CACVjG,KAAM,SAAU8B,GAWf,OAVAA,EAAO,GAAMA,EAAO,GAAI5G,QAASuF,EAAWC,GAG5CoB,EAAO,IAAQA,EAAO,IAAOA,EAAO,IAAOA,EAAO,IAAO,IACvD5G,QAASuF,EAAWC,GAEF,OAAfoB,EAAO,KACXA,EAAO,GAAM,IAAMA,EAAO,GAAM,KAG1BA,EAAM3M,MAAO,EAAG,IAGxB+K,MAAO,SAAU4B,GAkChB,OAtBAA,EAAO,GAAMA,EAAO,GAAItJ,cAEU,QAA7BsJ,EAAO,GAAI3M,MAAO,EAAG,IAGnB2M,EAAO,IACZJ,EAAKtG,MAAO0G,EAAO,IAKpBA,EAAO,KAASA,EAAO,GACtBA,EAAO,IAAQA,EAAO,IAAO,GAC7B,GAAqB,SAAfA,EAAO,IAAiC,QAAfA,EAAO,KAEvCA,EAAO,KAAWA,EAAO,GAAMA,EAAO,IAAwB,QAAfA,EAAO,KAG3CA,EAAO,IAClBJ,EAAKtG,MAAO0G,EAAO,IAGbA,GAGR7B,OAAQ,SAAU6B,GACjB,IAAIoE,EACHC,GAAYrE,EAAO,IAAOA,EAAO,GAElC,OAAKlC,EAAUM,MAAM5D,KAAMwF,EAAO,IAC1B,MAIHA,EAAO,GACXA,EAAO,GAAMA,EAAO,IAAOA,EAAO,IAAO,GAG9BqE,GAAYzG,EAAQpD,KAAM6J,KAGnCD,EAASzD,EAAU0D,GAAU,MAG7BD,EAASC,EAASzQ,QAAS,IAAKyQ,EAAS/N,OAAS8N,GAAWC,EAAS/N,UAGxE0J,EAAO,GAAMA,EAAO,GAAI3M,MAAO,EAAG+Q,GAClCpE,EAAO,GAAMqE,EAAShR,MAAO,EAAG+Q,IAI1BpE,EAAM3M,MAAO,EAAG,MAIzBuP,OAAQ,CAEP3E,IAAK,SAAUqG,GACd,IAAIC,EAAmBD,EAAiBlL,QAASuF,EAAWC,GAAYlI,cACxE,MAA4B,MAArB4N,EACN,WACC,OAAO,GAER,SAAU9N,GACT,OAAOD,GAAUC,EAAM+N,KAI1BvG,MAAO,SAAUgF,GAChB,IAAIwB,EAAU1H,EAAYkG,EAAY,KAEtC,OAAOwB,IACJA,EAAU,IAAIjJ,OAAQ,MAAQF,GAAa,IAAM2H,EAClD,IAAM3H,GAAa,SACpByB,EAAYkG,EAAW,SAAUxM,GAChC,OAAOgO,EAAQhK,KACY,iBAAnBhE,EAAKwM,WAA0BxM,EAAKwM,WACb,oBAAtBxM,EAAKjB,cACXiB,EAAKjB,aAAc,UACpB,OAKL2I,KAAM,SAAUzH,EAAMgO,EAAUC,GAC/B,OAAO,SAAUlO,GAChB,IAAImO,EAAS/E,EAAK4D,KAAMhN,EAAMC,GAE9B,OAAe,MAAVkO,EACgB,OAAbF,GAEFA,IAINE,GAAU,GAEQ,MAAbF,EACGE,IAAWD,EAED,OAAbD,EACGE,IAAWD,EAED,OAAbD,EACGC,GAAqC,IAA5BC,EAAO/Q,QAAS8Q,GAEf,OAAbD,EACGC,IAAoC,EAA3BC,EAAO/Q,QAAS8Q,GAEf,OAAbD,EACGC,GAASC,EAAOtR,OAAQqR,EAAMpO,UAAaoO,EAEjC,OAAbD,GAEkB,GADb,IAAME,EAAOvL,QAASoE,EAAa,KAAQ,KAClD5J,QAAS8Q,GAEM,OAAbD,IACGE,IAAWD,GAASC,EAAOtR,MAAO,EAAGqR,EAAMpO,OAAS,KAAQoO,EAAQ,QAO9EtG,MAAO,SAAU1J,EAAMkQ,EAAMC,EAAWnN,EAAOE,GAC9C,IAAIkN,EAAgC,QAAvBpQ,EAAKrB,MAAO,EAAG,GAC3B0R,EAA+B,SAArBrQ,EAAKrB,OAAQ,GACvB2R,EAAkB,YAATJ,EAEV,OAAiB,IAAVlN,GAAwB,IAATE,EAGrB,SAAUpB,GACT,QAASA,EAAKb,YAGf,SAAUa,EAAMyO,EAAUC,GACzB,IAAI/D,EAAOgE,EAAYnQ,EAAMoQ,EAAWC,EACvC9F,EAAMuF,IAAWC,EAAU,cAAgB,kBAC3CO,EAAS9O,EAAKb,WACdc,EAAOuO,GAAUxO,EAAKD,SAASG,cAC/B6O,GAAYL,IAAQF,EACpBQ,GAAO,EAER,GAAKF,EAAS,CAGb,GAAKR,EAAS,CACb,MAAQvF,EAAM,CACbvK,EAAOwB,EACP,MAAUxB,EAAOA,EAAMuK,GACtB,GAAKyF,EACJzO,GAAUvB,EAAMyB,GACE,IAAlBzB,EAAKV,SAEL,OAAO,EAKT+Q,EAAQ9F,EAAe,SAAT7K,IAAoB2Q,GAAS,cAE5C,OAAO,EAMR,GAHAA,EAAQ,CAAEN,EAAUO,EAAOG,WAAaH,EAAOI,WAG1CX,GAAWQ,EAAW,CAM1BC,GADAJ,GADAjE,GADAgE,EAAaG,EAAQrM,KAAeqM,EAAQrM,GAAY,KACpCvE,IAAU,IACX,KAAQkI,GAAWuE,EAAO,KACzBA,EAAO,GAC3BnM,EAAOoQ,GAAaE,EAAO7F,WAAY2F,GAEvC,MAAUpQ,IAASoQ,GAAapQ,GAAQA,EAAMuK,KAG3CiG,EAAOJ,EAAY,IAAOC,EAAMjK,MAGlC,GAAuB,IAAlBpG,EAAKV,YAAoBkR,GAAQxQ,IAASwB,EAAO,CACrD2O,EAAYzQ,GAAS,CAAEkI,EAASwI,EAAWI,GAC3C,YAgBF,GATKD,IAIJC,EADAJ,GADAjE,GADAgE,EAAa3O,EAAMyC,KAAezC,EAAMyC,GAAY,KAChCvE,IAAU,IACX,KAAQkI,GAAWuE,EAAO,KAMhC,IAATqE,EAGJ,MAAUxQ,IAASoQ,GAAapQ,GAAQA,EAAMuK,KAC3CiG,EAAOJ,EAAY,IAAOC,EAAMjK,MAElC,IAAO4J,EACNzO,GAAUvB,EAAMyB,GACE,IAAlBzB,EAAKV,aACHkR,IAGGD,KACJJ,EAAanQ,EAAMiE,KAChBjE,EAAMiE,GAAY,KACTvE,GAAS,CAAEkI,EAAS4I,IAG5BxQ,IAASwB,GACb,MASL,OADAgP,GAAQ5N,KACQF,GAAW8N,EAAO9N,GAAU,GAAqB,GAAhB8N,EAAO9N,KAK5DyG,OAAQ,SAAUwH,EAAQ5D,GAMzB,IAAI6D,EACHzP,EAAKmG,EAAKiB,QAASoI,IAAYrJ,EAAKuJ,WAAYF,EAAOjP,gBACtDkJ,EAAKtG,MAAO,uBAAyBqM,GAKvC,OAAKxP,EAAI8C,GACD9C,EAAI4L,GAIK,EAAZ5L,EAAGG,QACPsP,EAAO,CAAED,EAAQA,EAAQ,GAAI5D,GACtBzF,EAAKuJ,WAAW7R,eAAgB2R,EAAOjP,eAC7C6K,EAAc,SAAU1B,EAAMlF,GAC7B,IAAImL,EACHC,EAAU5P,EAAI0J,EAAMkC,GACpB7M,EAAI6Q,EAAQzP,OACb,MAAQpB,IAEP2K,EADAiG,EAAMlS,GAAQJ,KAAMqM,EAAMkG,EAAS7Q,OAClByF,EAASmL,GAAQC,EAAS7Q,MAG7C,SAAUsB,GACT,OAAOL,EAAIK,EAAM,EAAGoP,KAIhBzP,IAIToH,QAAS,CAGRyI,IAAKzE,EAAc,SAAUtL,GAK5B,IAAIgN,EAAQ,GACXhJ,EAAU,GACVgM,EAAUC,GAASjQ,EAASmD,QAASkC,GAAU,OAEhD,OAAO2K,EAAShN,GACfsI,EAAc,SAAU1B,EAAMlF,EAASsK,EAAUC,GAChD,IAAI1O,EACH2P,EAAYF,EAASpG,EAAM,KAAMqF,EAAK,IACtChQ,EAAI2K,EAAKvJ,OAGV,MAAQpB,KACAsB,EAAO2P,EAAWjR,MACxB2K,EAAM3K,KAASyF,EAASzF,GAAMsB,MAIjC,SAAUA,EAAMyO,EAAUC,GAOzB,OANAjC,EAAO,GAAMzM,EACbyP,EAAShD,EAAO,KAAMiC,EAAKjL,GAI3BgJ,EAAO,GAAM,MACLhJ,EAAQmB,SAInBgL,IAAK7E,EAAc,SAAUtL,GAC5B,OAAO,SAAUO,GAChB,OAAuC,EAAhCoJ,EAAM3J,EAAUO,GAAOF,UAIhCkF,SAAU+F,EAAc,SAAUjM,GAEjC,OADAA,EAAOA,EAAK8D,QAASuF,EAAWC,GACzB,SAAUpI,GAChB,OAAsE,GAA7DA,EAAKqD,aAAe7D,GAAOV,KAAMkB,IAAS5C,QAAS0B,MAW9D+Q,KAAM9E,EAAc,SAAU8E,GAO7B,OAJMxI,EAAYrD,KAAM6L,GAAQ,KAC/BzG,EAAKtG,MAAO,qBAAuB+M,GAEpCA,EAAOA,EAAKjN,QAASuF,EAAWC,GAAYlI,cACrC,SAAUF,GAChB,IAAI8P,EACJ,GACC,GAAOA,EAAW5J,EACjBlG,EAAK6P,KACL7P,EAAKjB,aAAc,aAAgBiB,EAAKjB,aAAc,QAGtD,OADA+Q,EAAWA,EAAS5P,iBACA2P,GAA2C,IAAnCC,EAAS1S,QAASyS,EAAO,YAE3C7P,EAAOA,EAAKb,aAAkC,IAAlBa,EAAKlC,UAC7C,OAAO,KAKTqE,OAAQ,SAAUnC,GACjB,IAAI+P,EAAOzT,GAAO0T,UAAY1T,GAAO0T,SAASD,KAC9C,OAAOA,GAAQA,EAAKlT,MAAO,KAAQmD,EAAK8J,IAGzCmG,KAAM,SAAUjQ,GACf,OAAOA,IAASsD,GAGjB4M,MAAO,SAAUlQ,GAChB,OAAOA,IA5oCV,WACC,IACC,OAAO7D,EAASgU,cACf,MAAQC,KAyoCQC,IACflU,EAASmU,eACLtQ,EAAK9B,MAAQ8B,EAAKuQ,OAASvQ,EAAKwQ,WAItCC,QAASrF,GAAsB,GAC/BtC,SAAUsC,GAAsB,GAEhCsF,QAAS,SAAU1Q,GAIlB,OAASD,GAAUC,EAAM,YAAeA,EAAK0Q,SAC1C3Q,GAAUC,EAAM,aAAgBA,EAAK2Q,UAGzCA,SAAU,SAAU3Q,GAWnB,OALKA,EAAKb,YAETa,EAAKb,WAAWyR,eAGQ,IAAlB5Q,EAAK2Q,UAIbE,MAAO,SAAU7Q,GAMhB,IAAMA,EAAOA,EAAKiP,WAAYjP,EAAMA,EAAOA,EAAK8Q,YAC/C,GAAK9Q,EAAKlC,SAAW,EACpB,OAAO,EAGT,OAAO,GAGRgR,OAAQ,SAAU9O,GACjB,OAAQ8F,EAAKiB,QAAQ8J,MAAO7Q,IAI7B+Q,OAAQ,SAAU/Q,GACjB,OAAOgI,EAAQhE,KAAMhE,EAAKD,WAG3B0M,MAAO,SAAUzM,GAChB,OAAO+H,EAAQ/D,KAAMhE,EAAKD,WAG3BiR,OAAQ,SAAUhR,GACjB,OAAOD,GAAUC,EAAM,UAA2B,WAAdA,EAAK9B,MACxC6B,GAAUC,EAAM,WAGlBlB,KAAM,SAAUkB,GACf,IAAIgN,EACJ,OAAOjN,GAAUC,EAAM,UAA2B,SAAdA,EAAK9B,OAKI,OAAxC8O,EAAOhN,EAAKjB,aAAc,UACN,SAAvBiO,EAAK9M,gBAIRgB,MAAOoK,EAAwB,WAC9B,MAAO,CAAE,KAGVlK,KAAMkK,EAAwB,SAAU2F,EAAenR,GACtD,MAAO,CAAEA,EAAS,KAGnBqB,GAAImK,EAAwB,SAAU2F,EAAenR,EAAQyL,GAC5D,MAAO,CAAEA,EAAW,EAAIA,EAAWzL,EAASyL,KAG7ClK,KAAMiK,EAAwB,SAAUE,EAAc1L,GAErD,IADA,IAAIpB,EAAI,EACAA,EAAIoB,EAAQpB,GAAK,EACxB8M,EAAarO,KAAMuB,GAEpB,OAAO8M,IAGRhK,IAAK8J,EAAwB,SAAUE,EAAc1L,GAEpD,IADA,IAAIpB,EAAI,EACAA,EAAIoB,EAAQpB,GAAK,EACxB8M,EAAarO,KAAMuB,GAEpB,OAAO8M,IAGR0F,GAAI5F,EAAwB,SAAUE,EAAc1L,EAAQyL,GAC3D,IAAI7M,EAUJ,IAPCA,EADI6M,EAAW,EACXA,EAAWzL,EACOA,EAAXyL,EACPzL,EAEAyL,EAGU,KAAL7M,GACT8M,EAAarO,KAAMuB,GAEpB,OAAO8M,IAGR2F,GAAI7F,EAAwB,SAAUE,EAAc1L,EAAQyL,GAE3D,IADA,IAAI7M,EAAI6M,EAAW,EAAIA,EAAWzL,EAASyL,IACjC7M,EAAIoB,GACb0L,EAAarO,KAAMuB,GAEpB,OAAO8M,OAKLzE,QAAQqK,IAAMtL,EAAKiB,QAAQ5F,GAGrB,CAAEkQ,OAAO,EAAMC,UAAU,EAAMC,MAAM,EAAMC,UAAU,EAAMC,OAAO,GAC5E3L,EAAKiB,QAASrI,GAAMwM,EAAmBxM,GAExC,IAAMA,IAAK,CAAEgT,QAAQ,EAAMC,OAAO,GACjC7L,EAAKiB,QAASrI,GAAMyM,EAAoBzM,GAIzC,SAAS2Q,KAIT,SAASlF,EAAU1K,EAAUmS,GAC5B,IAAIrC,EAAS/F,EAAOqI,EAAQ3T,EAC3B4T,EAAOrI,EAAQsI,EACfC,EAASxL,EAAY/G,EAAW,KAEjC,GAAKuS,EACJ,OAAOJ,EAAY,EAAII,EAAOnV,MAAO,GAGtCiV,EAAQrS,EACRgK,EAAS,GACTsI,EAAajM,EAAK6H,UAElB,MAAQmE,EAAQ,CA2Bf,IAAM5T,KAxBAqR,KAAa/F,EAAQvC,EAAO2C,KAAMkI,MAClCtI,IAGJsI,EAAQA,EAAMjV,MAAO2M,EAAO,GAAI1J,SAAYgS,GAE7CrI,EAAOtM,KAAQ0U,EAAS,KAGzBtC,GAAU,GAGH/F,EAAQtC,EAAmB0C,KAAMkI,MACvCvC,EAAU/F,EAAMsB,QAChB+G,EAAO1U,KAAM,CACZmH,MAAOiL,EAGPrR,KAAMsL,EAAO,GAAI5G,QAASkC,GAAU,OAErCgN,EAAQA,EAAMjV,MAAO0S,EAAQzP,SAIhBgG,EAAKsG,SACX5C,EAAQlC,EAAWpJ,GAAO0L,KAAMkI,KAAgBC,EAAY7T,MAChEsL,EAAQuI,EAAY7T,GAAQsL,MAC9B+F,EAAU/F,EAAMsB,QAChB+G,EAAO1U,KAAM,CACZmH,MAAOiL,EACPrR,KAAMA,EACNiG,QAASqF,IAEVsI,EAAQA,EAAMjV,MAAO0S,EAAQzP,SAI/B,IAAMyP,EACL,MAOF,OAAKqC,EACGE,EAAMhS,OAGPgS,EACN1I,EAAKtG,MAAOrD,GAGZ+G,EAAY/G,EAAUgK,GAAS5M,MAAO,GAGxC,SAASuN,EAAYyH,GAIpB,IAHA,IAAInT,EAAI,EACP+C,EAAMoQ,EAAO/R,OACbL,EAAW,GACJf,EAAI+C,EAAK/C,IAChBe,GAAYoS,EAAQnT,GAAI4F,MAEzB,OAAO7E,EAGR,SAASoJ,EAAe4G,EAASwC,EAAYC,GAC5C,IAAInJ,EAAMkJ,EAAWlJ,IACpBoJ,EAAOF,EAAWjJ,KAClB4B,EAAMuH,GAAQpJ,EACdqJ,EAAmBF,GAAgB,eAARtH,EAC3ByH,EAAWhM,IAEZ,OAAO4L,EAAW/Q,MAGjB,SAAUlB,EAAMN,EAASgP,GACxB,MAAU1O,EAAOA,EAAM+I,GACtB,GAAuB,IAAlB/I,EAAKlC,UAAkBsU,EAC3B,OAAO3C,EAASzP,EAAMN,EAASgP,GAGjC,OAAO,GAIR,SAAU1O,EAAMN,EAASgP,GACxB,IAAI4D,EAAU3D,EACb4D,EAAW,CAAEnM,EAASiM,GAGvB,GAAK3D,GACJ,MAAU1O,EAAOA,EAAM+I,GACtB,IAAuB,IAAlB/I,EAAKlC,UAAkBsU,IACtB3C,EAASzP,EAAMN,EAASgP,GAC5B,OAAO,OAKV,MAAU1O,EAAOA,EAAM+I,GACtB,GAAuB,IAAlB/I,EAAKlC,UAAkBsU,EAG3B,GAFAzD,EAAa3O,EAAMyC,KAAezC,EAAMyC,GAAY,IAE/C0P,GAAQpS,GAAUC,EAAMmS,GAC5BnS,EAAOA,EAAM+I,IAAS/I,MAChB,CAAA,IAAOsS,EAAW3D,EAAY/D,KACpC0H,EAAU,KAAQlM,GAAWkM,EAAU,KAAQD,EAG/C,OAASE,EAAU,GAAMD,EAAU,GAOnC,IAHA3D,EAAY/D,GAAQ2H,GAGH,GAAM9C,EAASzP,EAAMN,EAASgP,GAC9C,OAAO,EAMZ,OAAO,GAIV,SAAS8D,EAAgBC,GACxB,OAAyB,EAAlBA,EAAS3S,OACf,SAAUE,EAAMN,EAASgP,GACxB,IAAIhQ,EAAI+T,EAAS3S,OACjB,MAAQpB,IACP,IAAM+T,EAAU/T,GAAKsB,EAAMN,EAASgP,GACnC,OAAO,EAGT,OAAO,GAER+D,EAAU,GAYZ,SAASC,EAAU/C,EAAW3O,EAAKoL,EAAQ1M,EAASgP,GAOnD,IANA,IAAI1O,EACH2S,EAAe,GACfjU,EAAI,EACJ+C,EAAMkO,EAAU7P,OAChB8S,EAAgB,MAAP5R,EAEFtC,EAAI+C,EAAK/C,KACTsB,EAAO2P,EAAWjR,MAClB0N,IAAUA,EAAQpM,EAAMN,EAASgP,KACtCiE,EAAaxV,KAAM6C,GACd4S,GACJ5R,EAAI7D,KAAMuB,KAMd,OAAOiU,EAGR,SAASE,GAAYlF,EAAWlO,EAAUgQ,EAASqD,EAAYC,EAAYC,GAO1E,OANKF,IAAeA,EAAYrQ,KAC/BqQ,EAAaD,GAAYC,IAErBC,IAAeA,EAAYtQ,KAC/BsQ,EAAaF,GAAYE,EAAYC,IAE/BjI,EAAc,SAAU1B,EAAM5F,EAAS/D,EAASgP,GACtD,IAAIuE,EAAMvU,EAAGsB,EAAMkT,EAClBC,EAAS,GACTC,EAAU,GACVC,EAAc5P,EAAQ3D,OAGtBY,EAAQ2I,GA5CX,SAA2B5J,EAAU6T,EAAU7P,GAG9C,IAFA,IAAI/E,EAAI,EACP+C,EAAM6R,EAASxT,OACRpB,EAAI+C,EAAK/C,IAChB0K,EAAM3J,EAAU6T,EAAU5U,GAAK+E,GAEhC,OAAOA,EAuCJ8P,CAAkB9T,GAAY,IAC7BC,EAAQ5B,SAAW,CAAE4B,GAAYA,EAAS,IAG5C8T,GAAY7F,IAAetE,GAAS5J,EAEnCiB,EADAgS,EAAUhS,EAAOyS,EAAQxF,EAAWjO,EAASgP,GAsB/C,GAnBKe,EAaJA,EAAS+D,EATTN,EAAaH,IAAgB1J,EAAOsE,EAAY0F,GAAeP,GAG9D,GAGArP,EAG+B/D,EAASgP,GAEzCwE,EAAaM,EAITV,EAAa,CACjBG,EAAOP,EAAUQ,EAAYE,GAC7BN,EAAYG,EAAM,GAAIvT,EAASgP,GAG/BhQ,EAAIuU,EAAKnT,OACT,MAAQpB,KACAsB,EAAOiT,EAAMvU,MACnBwU,EAAYE,EAAS1U,MAAW8U,EAAWJ,EAAS1U,IAAQsB,IAK/D,GAAKqJ,GACJ,GAAK0J,GAAcpF,EAAY,CAC9B,GAAKoF,EAAa,CAGjBE,EAAO,GACPvU,EAAIwU,EAAWpT,OACf,MAAQpB,KACAsB,EAAOkT,EAAYxU,KAGzBuU,EAAK9V,KAAQqW,EAAW9U,GAAMsB,GAGhC+S,EAAY,KAAQG,EAAa,GAAMD,EAAMvE,GAI9ChQ,EAAIwU,EAAWpT,OACf,MAAQpB,KACAsB,EAAOkT,EAAYxU,MAC2C,GAAlEuU,EAAOF,EAAa3V,GAAQJ,KAAMqM,EAAMrJ,GAASmT,EAAQzU,MAE3D2K,EAAM4J,KAAYxP,EAASwP,GAASjT,UAOvCkT,EAAaR,EACZQ,IAAezP,EACdyP,EAAWrR,OAAQwR,EAAaH,EAAWpT,QAC3CoT,GAEGH,EACJA,EAAY,KAAMtP,EAASyP,EAAYxE,GAEvCvR,EAAKD,MAAOuG,EAASyP,KAMzB,SAASO,GAAmB5B,GA+B3B,IA9BA,IAAI6B,EAAcjE,EAAS/N,EAC1BD,EAAMoQ,EAAO/R,OACb6T,EAAkB7N,EAAKwH,SAAUuE,EAAQ,GAAI3T,MAC7C0V,EAAmBD,GAAmB7N,EAAKwH,SAAU,KACrD5O,EAAIiV,EAAkB,EAAI,EAG1BE,EAAehL,EAAe,SAAU7I,GACvC,OAAOA,IAAS0T,GACdE,GAAkB,GACrBE,EAAkBjL,EAAe,SAAU7I,GAC1C,OAA6C,EAAtC5C,GAAQJ,KAAM0W,EAAc1T,IACjC4T,GAAkB,GACrBnB,EAAW,CAAE,SAAUzS,EAAMN,EAASgP,GAMrC,IAAI/N,GAASgT,IAAqBjF,GAAOhP,GAAWqG,MACjD2N,EAAehU,GAAU5B,SAC1B+V,EAAc7T,EAAMN,EAASgP,GAC7BoF,EAAiB9T,EAAMN,EAASgP,IAKlC,OADAgF,EAAe,KACR/S,IAGDjC,EAAI+C,EAAK/C,IAChB,GAAO+Q,EAAU3J,EAAKwH,SAAUuE,EAAQnT,GAAIR,MAC3CuU,EAAW,CAAE5J,EAAe2J,EAAgBC,GAAYhD,QAClD,CAIN,IAHAA,EAAU3J,EAAKsG,OAAQyF,EAAQnT,GAAIR,MAAOhB,MAAO,KAAM2U,EAAQnT,GAAIyF,UAGrD1B,GAAY,CAIzB,IADAf,IAAMhD,EACEgD,EAAID,EAAKC,IAChB,GAAKoE,EAAKwH,SAAUuE,EAAQnQ,GAAIxD,MAC/B,MAGF,OAAO2U,GACF,EAAJnU,GAAS8T,EAAgBC,GACrB,EAAJ/T,GAAS0L,EAGRyH,EAAOhV,MAAO,EAAG6B,EAAI,GACnBzB,OAAQ,CAAEqH,MAAgC,MAAzBuN,EAAQnT,EAAI,GAAIR,KAAe,IAAM,MACvD0E,QAASkC,GAAU,MACrB2K,EACA/Q,EAAIgD,GAAK+R,GAAmB5B,EAAOhV,MAAO6B,EAAGgD,IAC7CA,EAAID,GAAOgS,GAAqB5B,EAASA,EAAOhV,MAAO6E,IACvDA,EAAID,GAAO2I,EAAYyH,IAGzBY,EAAStV,KAAMsS,GAIjB,OAAO+C,EAAgBC,GAiIxB,SAAS/C,GAASjQ,EAAU+J,GAC3B,IAAI9K,EA/H8BqV,EAAiBC,EAC/CC,EACHC,EACAC,EA6HAH,EAAc,GACdD,EAAkB,GAClB/B,EAASvL,EAAehH,EAAW,KAEpC,IAAMuS,EAAS,CAGRxI,IACLA,EAAQW,EAAU1K,IAEnBf,EAAI8K,EAAM1J,OACV,MAAQpB,KACPsT,EAASyB,GAAmBjK,EAAO9K,KACtB+D,GACZuR,EAAY7W,KAAM6U,GAElB+B,EAAgB5W,KAAM6U,IAKxBA,EAASvL,EAAehH,GArJSsU,EAsJNA,EArJxBE,EAA6B,GADkBD,EAsJNA,GArJrBlU,OACvBoU,EAAqC,EAAzBH,EAAgBjU,OAC5BqU,EAAe,SAAU9K,EAAM3J,EAASgP,EAAKjL,EAAS2Q,GACrD,IAAIpU,EAAM0B,EAAG+N,EACZ4E,EAAe,EACf3V,EAAI,IACJiR,EAAYtG,GAAQ,GACpBiL,EAAa,GACbC,EAAgBxO,EAGhBrF,EAAQ2I,GAAQ6K,GAAapO,EAAKsD,KAAK3B,IAAK,IAAK2M,GAGjDI,EAAkBpO,GAA4B,MAAjBmO,EAAwB,EAAI7R,KAAKC,UAAY,GAC1ElB,EAAMf,EAAMZ,OAeb,IAbKsU,IAMJrO,EAAmBrG,GAAWvD,GAAYuD,GAAW0U,GAO9C1V,IAAM+C,GAAgC,OAAvBzB,EAAOU,EAAOhC,IAAeA,IAAM,CACzD,GAAKwV,GAAalU,EAAO,CACxB0B,EAAI,EAMEhC,GAAWM,EAAK+D,eAAiB5H,IACtCwM,EAAa3I,GACb0O,GAAOxI,GAER,MAAUuJ,EAAUsE,EAAiBrS,KACpC,GAAK+N,EAASzP,EAAMN,GAAWvD,EAAUuS,GAAQ,CAChDvR,EAAKH,KAAMyG,EAASzD,GACpB,MAGGoU,IACJhO,EAAUoO,GAKPP,KAGGjU,GAAQyP,GAAWzP,IACzBqU,IAIIhL,GACJsG,EAAUxS,KAAM6C,IAgBnB,GATAqU,GAAgB3V,EASXuV,GAASvV,IAAM2V,EAAe,CAClC3S,EAAI,EACJ,MAAU+N,EAAUuE,EAAatS,KAChC+N,EAASE,EAAW2E,EAAY5U,EAASgP,GAG1C,GAAKrF,EAAO,CAGX,GAAoB,EAAfgL,EACJ,MAAQ3V,IACCiR,EAAWjR,IAAO4V,EAAY5V,KACrC4V,EAAY5V,GAAMkG,GAAI5H,KAAMyG,IAM/B6Q,EAAa5B,EAAU4B,GAIxBnX,EAAKD,MAAOuG,EAAS6Q,GAGhBF,IAAc/K,GAA4B,EAApBiL,EAAWxU,QACG,EAAtCuU,EAAeL,EAAYlU,QAE7BN,GAAO0N,WAAYzJ,GAUrB,OALK2Q,IACJhO,EAAUoO,EACVzO,EAAmBwO,GAGb5E,GAGFsE,EACNlJ,EAAcoJ,GACdA,KA8BO1U,SAAWA,EAEnB,OAAOuS,EAYR,SAASvH,GAAQhL,EAAUC,EAAS+D,EAAS4F,GAC5C,IAAI3K,EAAGmT,EAAQ4C,EAAOvW,EAAMkL,EAC3BsL,EAA+B,mBAAbjV,GAA2BA,EAC7C+J,GAASH,GAAQc,EAAY1K,EAAWiV,EAASjV,UAAYA,GAM9D,GAJAgE,EAAUA,GAAW,GAIC,IAAjB+F,EAAM1J,OAAe,CAIzB,GAAqB,GADrB+R,EAASrI,EAAO,GAAMA,EAAO,GAAI3M,MAAO,IAC5BiD,QAA+C,QAA/B2U,EAAQ5C,EAAQ,IAAM3T,MAC3B,IAArBwB,EAAQ5B,UAAkBoI,GAAkBJ,EAAKwH,SAAUuE,EAAQ,GAAI3T,MAAS,CAMjF,KAJAwB,GAAYoG,EAAKsD,KAAK7B,GACrBkN,EAAMtQ,QAAS,GAAIvB,QAASuF,EAAWC,GACvC1I,IACI,IAAM,IAEV,OAAO+D,EAGIiR,IACXhV,EAAUA,EAAQP,YAGnBM,EAAWA,EAAS5C,MAAOgV,EAAO/G,QAAQxG,MAAMxE,QAIjDpB,EAAI4I,EAAUQ,aAAa9D,KAAMvE,GAAa,EAAIoS,EAAO/R,OACzD,MAAQpB,IAAM,CAIb,GAHA+V,EAAQ5C,EAAQnT,GAGXoH,EAAKwH,SAAYpP,EAAOuW,EAAMvW,MAClC,MAED,IAAOkL,EAAOtD,EAAKsD,KAAMlL,MAGjBmL,EAAOD,EACbqL,EAAMtQ,QAAS,GAAIvB,QAASuF,EAAWC,GACvCF,EAASlE,KAAM6N,EAAQ,GAAI3T,OAC1B+L,EAAavK,EAAQP,aAAgBO,IACjC,CAKL,GAFAmS,EAAOhQ,OAAQnD,EAAG,KAClBe,EAAW4J,EAAKvJ,QAAUsK,EAAYyH,IAGrC,OADA1U,EAAKD,MAAOuG,EAAS4F,GACd5F,EAGR,QAeJ,OAPEiR,GAAYhF,GAASjQ,EAAU+J,IAChCH,EACA3J,GACCwG,EACDzC,GACC/D,GAAWwI,EAASlE,KAAMvE,IAAcwK,EAAavK,EAAQP,aAAgBO,GAExE+D,EArlBR4L,EAAWlP,UAAY2F,EAAK6O,QAAU7O,EAAKiB,QAC3CjB,EAAKuJ,WAAa,IAAIA,EA2lBtB1R,GAAQyP,WAAa3K,EAAQiC,MAAO,IAAK9C,KAAM+E,GAAY0D,KAAM,MAAS5H,EAG1EkG,IAIAhL,GAAQiP,aAAe5B,EAAQ,SAAUC,GAGxC,OAA4E,EAArEA,EAAG7F,wBAAyBjJ,EAAS0C,cAAe,eAG5DW,GAAO4J,KAAOA,EAGd5J,GAAOqN,KAAM,KAAQrN,GAAOqN,KAAK9F,QACjCvH,GAAOoV,OAASpV,GAAO0N,WAIvB9D,EAAKsG,QAAUA,GACftG,EAAKqB,OAASA,GACdrB,EAAKT,YAAcA,EACnBS,EAAKe,SAAWA,EAEhBf,EAAKf,OAAS7I,GAAOkG,eACrB0D,EAAKyL,QAAUrV,GAAOV,KACtBsK,EAAK0L,MAAQtV,GAAOmE,SACpByF,EAAK2L,UAAYvV,GAAOqN,KACxBzD,EAAKzL,QAAU6B,GAAO7B,QACtByL,EAAK8D,WAAa1N,GAAO0N,WAniEzB,GA0iEA,IAAInE,EAAM,SAAU/I,EAAM+I,EAAKiM,GAC9B,IAAIzF,EAAU,GACb0F,OAAqBzS,IAAVwS,EAEZ,OAAUhV,EAAOA,EAAM+I,KAA6B,IAAlB/I,EAAKlC,SACtC,GAAuB,IAAlBkC,EAAKlC,SAAiB,CAC1B,GAAKmX,GAAYzV,GAAQQ,GAAOkV,GAAIF,GACnC,MAEDzF,EAAQpS,KAAM6C,GAGhB,OAAOuP,GAIJ4F,EAAW,SAAUC,EAAGpV,GAG3B,IAFA,IAAIuP,EAAU,GAEN6F,EAAGA,EAAIA,EAAEtE,YACI,IAAfsE,EAAEtX,UAAkBsX,IAAMpV,GAC9BuP,EAAQpS,KAAMiY,GAIhB,OAAO7F,GAIJ8F,EAAgB7V,GAAOqN,KAAKrD,MAAM1B,aAElCwN,EAAa,kEAKjB,SAASC,EAAQzI,EAAU0I,EAAWhG,GACrC,OAAK5R,EAAY4X,GACThW,GAAO8B,KAAMwL,EAAU,SAAU9M,EAAMtB,GAC7C,QAAS8W,EAAUxY,KAAMgD,EAAMtB,EAAGsB,KAAWwP,IAK1CgG,EAAU1X,SACP0B,GAAO8B,KAAMwL,EAAU,SAAU9M,GACvC,OAASA,IAASwV,IAAgBhG,IAKV,iBAAdgG,EACJhW,GAAO8B,KAAMwL,EAAU,SAAU9M,GACvC,OAA4C,EAAnC5C,GAAQJ,KAAMwY,EAAWxV,KAAkBwP,IAK/ChQ,GAAO4M,OAAQoJ,EAAW1I,EAAU0C,GAG5ChQ,GAAO4M,OAAS,SAAUS,EAAMnM,EAAO8O,GACtC,IAAIxP,EAAOU,EAAO,GAMlB,OAJK8O,IACJ3C,EAAO,QAAUA,EAAO,KAGH,IAAjBnM,EAAMZ,QAAkC,IAAlBE,EAAKlC,SACxB0B,GAAO4J,KAAK2D,gBAAiB/M,EAAM6M,GAAS,CAAE7M,GAAS,GAGxDR,GAAO4J,KAAKjF,QAAS0I,EAAMrN,GAAO8B,KAAMZ,EAAO,SAAUV,GAC/D,OAAyB,IAAlBA,EAAKlC,aAId0B,GAAOG,GAAGmC,OAAQ,CACjBsH,KAAM,SAAU3J,GACf,IAAIf,EAAGiC,EACNc,EAAMlF,KAAKuD,OACX2V,EAAOlZ,KAER,GAAyB,iBAAbkD,EACX,OAAOlD,KAAKkE,UAAWjB,GAAQC,GAAW2M,OAAQ,WACjD,IAAM1N,EAAI,EAAGA,EAAI+C,EAAK/C,IACrB,GAAKc,GAAOwF,SAAUyQ,EAAM/W,GAAKnC,MAChC,OAAO,KAQX,IAFAoE,EAAMpE,KAAKkE,UAAW,IAEhB/B,EAAI,EAAGA,EAAI+C,EAAK/C,IACrBc,GAAO4J,KAAM3J,EAAUgW,EAAM/W,GAAKiC,GAGnC,OAAa,EAANc,EAAUjC,GAAO0N,WAAYvM,GAAQA,GAE7CyL,OAAQ,SAAU3M,GACjB,OAAOlD,KAAKkE,UAAW8U,EAAQhZ,KAAMkD,GAAY,IAAI,KAEtD+P,IAAK,SAAU/P,GACd,OAAOlD,KAAKkE,UAAW8U,EAAQhZ,KAAMkD,GAAY,IAAI,KAEtDyV,GAAI,SAAUzV,GACb,QAAS8V,EACRhZ,KAIoB,iBAAbkD,GAAyB4V,EAAcrR,KAAMvE,GACnDD,GAAQC,GACRA,GAAY,IACb,GACCK,UASJ,IAAI4V,EAMHzN,EAAa,uCAENzI,GAAOG,GAAGC,KAAO,SAAUH,EAAUC,EAASuQ,GACpD,IAAIzG,EAAOxJ,EAGX,IAAMP,EACL,OAAOlD,KAQR,GAHA0T,EAAOA,GAAQyF,EAGU,iBAAbjW,EAAwB,CAanC,KAPC+J,EALsB,MAAlB/J,EAAU,IACsB,MAApCA,EAAUA,EAASK,OAAS,IACT,GAAnBL,EAASK,OAGD,CAAE,KAAML,EAAU,MAGlBwI,EAAW2B,KAAMnK,MAIV+J,EAAO,IAAQ9J,EA6CxB,OAAMA,GAAWA,EAAQU,QACtBV,GAAWuQ,GAAO7G,KAAM3J,GAK1BlD,KAAK8D,YAAaX,GAAU0J,KAAM3J,GAhDzC,GAAK+J,EAAO,GAAM,CAYjB,GAXA9J,EAAUA,aAAmBF,GAASE,EAAS,GAAMA,EAIrDF,GAAOoB,MAAOrE,KAAMiD,GAAOmW,UAC1BnM,EAAO,GACP9J,GAAWA,EAAQ5B,SAAW4B,EAAQqE,eAAiBrE,EAAUvD,GACjE,IAIImZ,EAAWtR,KAAMwF,EAAO,KAAShK,GAAO6C,cAAe3C,GAC3D,IAAM8J,KAAS9J,EAGT9B,EAAYrB,KAAMiN,IACtBjN,KAAMiN,GAAS9J,EAAS8J,IAIxBjN,KAAKyQ,KAAMxD,EAAO9J,EAAS8J,IAK9B,OAAOjN,KAYP,OARAyD,EAAO7D,EAAS0N,eAAgBL,EAAO,OAKtCjN,KAAM,GAAMyD,EACZzD,KAAKuD,OAAS,GAERvD,KAcH,OAAKkD,EAAS3B,UACpBvB,KAAM,GAAMkD,EACZlD,KAAKuD,OAAS,EACPvD,MAIIqB,EAAY6B,QACD+C,IAAfyN,EAAK2F,MACX3F,EAAK2F,MAAOnW,GAGZA,EAAUD,IAGLA,GAAOgE,UAAW/D,EAAUlD,QAIhC4D,UAAYX,GAAOG,GAGxB+V,EAAalW,GAAQrD,GAGrB,IAAI0Z,EAAe,iCAGlBC,EAAmB,CAClBC,UAAU,EACVC,UAAU,EACVhN,MAAM,EACNiN,MAAM,GAoFR,SAASC,EAASC,EAAKpN,GACtB,OAAUoN,EAAMA,EAAKpN,KAA4B,IAAjBoN,EAAIrY,UACpC,OAAOqY,EAnFR3W,GAAOG,GAAGmC,OAAQ,CACjB8N,IAAK,SAAUzN,GACd,IAAIiU,EAAU5W,GAAQ2C,EAAQ5F,MAC7B8Z,EAAID,EAAQtW,OAEb,OAAOvD,KAAK6P,OAAQ,WAEnB,IADA,IAAI1N,EAAI,EACAA,EAAI2X,EAAG3X,IACd,GAAKc,GAAOwF,SAAUzI,KAAM6Z,EAAS1X,IACpC,OAAO,KAMX4X,QAAS,SAAUvB,EAAWrV,GAC7B,IAAIyW,EACHzX,EAAI,EACJ2X,EAAI9Z,KAAKuD,OACTyP,EAAU,GACV6G,EAA+B,iBAAdrB,GAA0BvV,GAAQuV,GAGpD,IAAMM,EAAcrR,KAAM+Q,GACzB,KAAQrW,EAAI2X,EAAG3X,IACd,IAAMyX,EAAM5Z,KAAMmC,GAAKyX,GAAOA,IAAQzW,EAASyW,EAAMA,EAAIhX,WAGxD,GAAKgX,EAAIrY,SAAW,KAAQsY,GACH,EAAxBA,EAAQG,MAAOJ,GAGE,IAAjBA,EAAIrY,UACH0B,GAAO4J,KAAK2D,gBAAiBoJ,EAAKpB,IAAgB,CAEnDxF,EAAQpS,KAAMgZ,GACd,MAMJ,OAAO5Z,KAAKkE,UAA4B,EAAjB8O,EAAQzP,OAAaN,GAAO0N,WAAYqC,GAAYA,IAI5EgH,MAAO,SAAUvW,GAGhB,OAAMA,EAKe,iBAATA,EACJ5C,GAAQJ,KAAMwC,GAAQQ,GAAQzD,KAAM,IAIrCa,GAAQJ,KAAMT,KAGpByD,EAAKI,OAASJ,EAAM,GAAMA,GAZjBzD,KAAM,IAAOA,KAAM,GAAI4C,WAAe5C,KAAK2E,QAAQsV,UAAU1W,QAAU,GAgBlF2W,IAAK,SAAUhX,EAAUC,GACxB,OAAOnD,KAAKkE,UACXjB,GAAO0N,WACN1N,GAAOoB,MAAOrE,KAAKgE,MAAOf,GAAQC,EAAUC,OAK/CgX,QAAS,SAAUjX,GAClB,OAAOlD,KAAKka,IAAiB,MAAZhX,EAChBlD,KAAKsE,WAAatE,KAAKsE,WAAWuL,OAAQ3M,OAU7CD,GAAOsB,KAAM,CACZgO,OAAQ,SAAU9O,GACjB,IAAI8O,EAAS9O,EAAKb,WAClB,OAAO2P,GAA8B,KAApBA,EAAOhR,SAAkBgR,EAAS,MAEpD6H,QAAS,SAAU3W,GAClB,OAAO+I,EAAK/I,EAAM,eAEnB4W,aAAc,SAAU5W,EAAM2E,EAAIqQ,GACjC,OAAOjM,EAAK/I,EAAM,aAAcgV,IAEjChM,KAAM,SAAUhJ,GACf,OAAOkW,EAASlW,EAAM,gBAEvBiW,KAAM,SAAUjW,GACf,OAAOkW,EAASlW,EAAM,oBAEvB6W,QAAS,SAAU7W,GAClB,OAAO+I,EAAK/I,EAAM,gBAEnBwW,QAAS,SAAUxW,GAClB,OAAO+I,EAAK/I,EAAM,oBAEnB8W,UAAW,SAAU9W,EAAM2E,EAAIqQ,GAC9B,OAAOjM,EAAK/I,EAAM,cAAegV,IAElC+B,UAAW,SAAU/W,EAAM2E,EAAIqQ,GAC9B,OAAOjM,EAAK/I,EAAM,kBAAmBgV,IAEtCG,SAAU,SAAUnV,GACnB,OAAOmV,GAAYnV,EAAKb,YAAc,IAAK8P,WAAYjP,IAExD+V,SAAU,SAAU/V,GACnB,OAAOmV,EAAUnV,EAAKiP,aAEvB+G,SAAU,SAAUhW,GACnB,OAA6B,MAAxBA,EAAKgX,iBAKTta,EAAUsD,EAAKgX,iBAERhX,EAAKgX,iBAMRjX,GAAUC,EAAM,cACpBA,EAAOA,EAAKiX,SAAWjX,GAGjBR,GAAOoB,MAAO,GAAIZ,EAAKiJ,eAE7B,SAAUhJ,EAAMN,GAClBH,GAAOG,GAAIM,GAAS,SAAU+U,EAAOvV,GACpC,IAAI8P,EAAU/P,GAAOwB,IAAKzE,KAAMoD,EAAIqV,GAuBpC,MArB0B,UAArB/U,EAAKpD,OAAQ,KACjB4C,EAAWuV,GAGPvV,GAAgC,iBAAbA,IACvB8P,EAAU/P,GAAO4M,OAAQ3M,EAAU8P,IAGjB,EAAdhT,KAAKuD,SAGHgW,EAAkB7V,IACvBT,GAAO0N,WAAYqC,GAIfsG,EAAa7R,KAAM/D,IACvBsP,EAAQ2H,WAIH3a,KAAKkE,UAAW8O,MAGzB,IAAI4H,EAAgB,oBAsOpB,SAASC,EAAUC,GAClB,OAAOA,EAER,SAASC,EAASC,GACjB,MAAMA,EAGP,SAASC,EAAYlT,EAAOmT,EAASC,EAAQC,GAC5C,IAAIC,EAEJ,IAGMtT,GAAS1G,EAAcga,EAAStT,EAAMuT,SAC1CD,EAAO5a,KAAMsH,GAAQ+B,KAAMoR,GAAUK,KAAMJ,GAGhCpT,GAAS1G,EAAcga,EAAStT,EAAMyT,MACjDH,EAAO5a,KAAMsH,EAAOmT,EAASC,GAQ7BD,EAAQva,WAAOsF,EAAW,CAAE8B,GAAQzH,MAAO8a,IAM3C,MAAQrT,GAIToT,EAAOxa,WAAOsF,EAAW,CAAE8B,KAvO7B9E,GAAOwY,UAAY,SAAUjW,GA9B7B,IAAwBA,EACnBkW,EAiCJlW,EAA6B,iBAAZA,GAlCMA,EAmCPA,EAlCZkW,EAAS,GACbzY,GAAOsB,KAAMiB,EAAQyH,MAAO2N,IAAmB,GAAI,SAAUe,EAAGC,GAC/DF,EAAQE,IAAS,IAEXF,GA+BNzY,GAAOsC,OAAQ,GAAIC,GAEpB,IACCqW,EAGAC,EAGAC,EAGAC,EAGAC,EAAO,GAGPC,EAAQ,GAGRC,GAAe,EAGfC,EAAO,WAQN,IALAJ,EAASA,GAAUxW,EAAQ6W,KAI3BN,EAAQF,GAAS,EACTK,EAAM3Y,OAAQ4Y,GAAe,EAAI,CACxCL,EAASI,EAAM3N,QACf,QAAU4N,EAAcF,EAAK1Y,QAGmC,IAA1D0Y,EAAME,GAAcxb,MAAOmb,EAAQ,GAAKA,EAAQ,KACpDtW,EAAQ8W,cAGRH,EAAcF,EAAK1Y,OACnBuY,GAAS,GAMNtW,EAAQsW,SACbA,GAAS,GAGVD,GAAS,EAGJG,IAIHC,EADIH,EACG,GAIA,KAMV5C,EAAO,CAGNgB,IAAK,WA2BJ,OA1BK+B,IAGCH,IAAWD,IACfM,EAAcF,EAAK1Y,OAAS,EAC5B2Y,EAAMtb,KAAMkb,IAGb,SAAW5B,EAAKrH,GACf5P,GAAOsB,KAAMsO,EAAM,SAAU8I,EAAG7T,GAC1BzG,EAAYyG,GACVtC,EAAQ6S,QAAWa,EAAK7F,IAAKvL,IAClCmU,EAAKrb,KAAMkH,GAEDA,GAAOA,EAAIvE,QAA4B,WAAlBT,EAAQgF,IAGxCoS,EAAKpS,KATR,CAYKpD,WAEAoX,IAAWD,GACfO,KAGKpc,MAIRuc,OAAQ,WAYP,OAXAtZ,GAAOsB,KAAMG,UAAW,SAAUiX,EAAG7T,GACpC,IAAIkS,EACJ,OAA0D,GAAhDA,EAAQ/W,GAAOkE,QAASW,EAAKmU,EAAMjC,IAC5CiC,EAAK3W,OAAQ0U,EAAO,GAGfA,GAASmC,GACbA,MAIInc,MAKRqT,IAAK,SAAUjQ,GACd,OAAOA,GACwB,EAA9BH,GAAOkE,QAAS/D,EAAI6Y,GACN,EAAdA,EAAK1Y,QAIP+Q,MAAO,WAIN,OAHK2H,IACJA,EAAO,IAEDjc,MAMRwc,QAAS,WAGR,OAFAR,EAASE,EAAQ,GACjBD,EAAOH,EAAS,GACT9b,MAERuM,SAAU,WACT,OAAQ0P,GAMTQ,KAAM,WAKL,OAJAT,EAASE,EAAQ,GACXJ,GAAWD,IAChBI,EAAOH,EAAS,IAEV9b,MAERgc,OAAQ,WACP,QAASA,GAIVU,SAAU,SAAUvZ,EAAS0P,GAS5B,OARMmJ,IAELnJ,EAAO,CAAE1P,GADT0P,EAAOA,GAAQ,IACQvS,MAAQuS,EAAKvS,QAAUuS,GAC9CqJ,EAAMtb,KAAMiS,GACNgJ,GACLO,KAGKpc,MAIRoc,KAAM,WAEL,OADAlD,EAAKwD,SAAU1c,KAAM0E,WACd1E,MAIR+b,MAAO,WACN,QAASA,IAIZ,OAAO7C,GA4CRjW,GAAOsC,OAAQ,CAEdoX,SAAU,SAAUC,GACnB,IAAIC,EAAS,CAIX,CAAE,SAAU,WAAY5Z,GAAOwY,UAAW,UACzCxY,GAAOwY,UAAW,UAAY,GAC/B,CAAE,UAAW,OAAQxY,GAAOwY,UAAW,eACtCxY,GAAOwY,UAAW,eAAiB,EAAG,YACvC,CAAE,SAAU,OAAQxY,GAAOwY,UAAW,eACrCxY,GAAOwY,UAAW,eAAiB,EAAG,aAExCqB,EAAQ,UACRxB,EAAU,CACTwB,MAAO,WACN,OAAOA,GAERC,OAAQ,WAEP,OADAC,EAASlT,KAAMpF,WAAY6W,KAAM7W,WAC1B1E,MAERid,QAAS,SAAU7Z,GAClB,OAAOkY,EAAQE,KAAM,KAAMpY,IAI5B8Z,KAAM,WACL,IAAIC,EAAMzY,UAEV,OAAOzB,GAAO0Z,SAAU,SAAUS,GACjCna,GAAOsB,KAAMsY,EAAQ,SAAUzU,EAAIiV,GAGlC,IAAIja,EAAK/B,EAAY8b,EAAKE,EAAO,MAAWF,EAAKE,EAAO,IAKxDL,EAAUK,EAAO,IAAO,WACvB,IAAIC,EAAWla,GAAMA,EAAGzC,MAAOX,KAAM0E,WAChC4Y,GAAYjc,EAAYic,EAAShC,SACrCgC,EAAShC,UACPiC,SAAUH,EAASI,QACnB1T,KAAMsT,EAASlC,SACfK,KAAM6B,EAASjC,QAEjBiC,EAAUC,EAAO,GAAM,QACtBrd,KACAoD,EAAK,CAAEka,GAAa5Y,eAKxByY,EAAM,OACH7B,WAELE,KAAM,SAAUiC,EAAaC,EAAYC,GACxC,IAAIC,EAAW,EACf,SAAS1C,EAAS2C,EAAOb,EAAUc,EAASC,GAC3C,OAAO,WACN,IAAIC,EAAOhe,KACV6S,EAAOnO,UACPuZ,EAAa,WACZ,IAAIX,EAAU9B,EAKd,KAAKqC,EAAQD,GAAb,CAQA,IAJAN,EAAWQ,EAAQnd,MAAOqd,EAAMnL,MAIdmK,EAAS1B,UAC1B,MAAM,IAAI4C,UAAW,4BAOtB1C,EAAO8B,IAKgB,iBAAbA,GACY,mBAAbA,IACRA,EAAS9B,KAGLna,EAAYma,GAGXuC,EACJvC,EAAK/a,KACJ6c,EACApC,EAAS0C,EAAUZ,EAAUnC,EAAUkD,GACvC7C,EAAS0C,EAAUZ,EAAUjC,EAASgD,KAOvCH,IAEApC,EAAK/a,KACJ6c,EACApC,EAAS0C,EAAUZ,EAAUnC,EAAUkD,GACvC7C,EAAS0C,EAAUZ,EAAUjC,EAASgD,GACtC7C,EAAS0C,EAAUZ,EAAUnC,EAC5BmC,EAASmB,eASPL,IAAYjD,IAChBmD,OAAO/X,EACP4M,EAAO,CAAEyK,KAKRS,GAAWf,EAASoB,aAAeJ,EAAMnL,MAK7CwL,EAAUN,EACTE,EACA,WACC,IACCA,IACC,MAAQtR,GAEJ1J,GAAO0Z,SAAS2B,eACpBrb,GAAO0Z,SAAS2B,cAAe3R,EAC9B0R,EAAQ9X,OAMQqX,GAAbC,EAAQ,IAIPC,IAAY/C,IAChBiD,OAAO/X,EACP4M,EAAO,CAAElG,IAGVqQ,EAASuB,WAAYP,EAAMnL,MAS3BgL,EACJQ,KAKKpb,GAAO0Z,SAAS6B,aACpBH,EAAQ9X,MAAQtD,GAAO0Z,SAAS6B,eAMrBvb,GAAO0Z,SAAS8B,eAC3BJ,EAAQ9X,MAAQtD,GAAO0Z,SAAS8B,gBAEjC1e,GAAO2e,WAAYL,KAKtB,OAAOpb,GAAO0Z,SAAU,SAAUS,GAGjCP,EAAQ,GAAK,GAAI3C,IAChBgB,EACC,EACAkC,EACA/b,EAAYsc,GACXA,EACA9C,EACDuC,EAASe,aAKXtB,EAAQ,GAAK,GAAI3C,IAChBgB,EACC,EACAkC,EACA/b,EAAYoc,GACXA,EACA5C,IAKHgC,EAAQ,GAAK,GAAI3C,IAChBgB,EACC,EACAkC,EACA/b,EAAYqc,GACXA,EACA3C,MAGAO,WAKLA,QAAS,SAAUha,GAClB,OAAc,MAAPA,EAAc2B,GAAOsC,OAAQjE,EAAKga,GAAYA,IAGvD0B,EAAW,GAkEZ,OA/DA/Z,GAAOsB,KAAMsY,EAAQ,SAAU1a,EAAGkb,GACjC,IAAIpB,EAAOoB,EAAO,GACjBsB,EAActB,EAAO,GAKtB/B,EAAS+B,EAAO,IAAQpB,EAAK/B,IAGxByE,GACJ1C,EAAK/B,IACJ,WAIC4C,EAAQ6B,GAKT9B,EAAQ,EAAI1a,GAAK,GAAIqa,QAIrBK,EAAQ,EAAI1a,GAAK,GAAIqa,QAGrBK,EAAQ,GAAK,GAAIJ,KAGjBI,EAAQ,GAAK,GAAIJ,MAOnBR,EAAK/B,IAAKmD,EAAO,GAAIjB,MAKrBY,EAAUK,EAAO,IAAQ,WAExB,OADAL,EAAUK,EAAO,GAAM,QAAUrd,OAASgd,OAAW/W,EAAYjG,KAAM0E,WAChE1E,MAMRgd,EAAUK,EAAO,GAAM,QAAWpB,EAAKS,WAIxCpB,EAAQA,QAAS0B,GAGZJ,GACJA,EAAKnc,KAAMuc,EAAUA,GAIfA,GAIR4B,KAAM,SAAUC,GACf,IAGCC,EAAYpa,UAAUnB,OAGtBpB,EAAI2c,EAGJC,EAAkBhZ,MAAO5D,GACzB6c,EAAgB1e,GAAMG,KAAMiE,WAG5Bua,EAAUhc,GAAO0Z,WAGjBuC,EAAa,SAAU/c,GACtB,OAAO,SAAU4F,GAChBgX,EAAiB5c,GAAMnC,KACvBgf,EAAe7c,GAAyB,EAAnBuC,UAAUnB,OAAajD,GAAMG,KAAMiE,WAAcqD,IAC5D+W,GACTG,EAAQb,YAAaW,EAAiBC,KAM1C,GAAKF,GAAa,IACjB7D,EAAY4D,EAAaI,EAAQnV,KAAMoV,EAAY/c,IAAM+Y,QAAS+D,EAAQ9D,QACxE2D,GAGuB,YAApBG,EAAQnC,SACZzb,EAAY2d,EAAe7c,IAAO6c,EAAe7c,GAAIqZ,OAErD,OAAOyD,EAAQzD,OAKjB,MAAQrZ,IACP8Y,EAAY+D,EAAe7c,GAAK+c,EAAY/c,GAAK8c,EAAQ9D,QAG1D,OAAO8D,EAAQ3D,aAOjB,IAAI6D,EAAc,yDAKlBlc,GAAO0Z,SAAS2B,cAAgB,SAAU/X,EAAO6Y,GAI3Crf,GAAOsf,SAAWtf,GAAOsf,QAAQC,MAAQ/Y,GAAS4Y,EAAY1X,KAAMlB,EAAM7C,OAC9E3D,GAAOsf,QAAQC,KAAM,8BAAgC/Y,EAAMgZ,QAC1DhZ,EAAMiZ,MAAOJ,IAOhBnc,GAAOwc,eAAiB,SAAUlZ,GACjCxG,GAAO2e,WAAY,WAClB,MAAMnY,KAQR,IAAImZ,EAAYzc,GAAO0Z,WAkDvB,SAASgD,IACR/f,EAASggB,oBAAqB,mBAAoBD,GAClD5f,GAAO6f,oBAAqB,OAAQD,GACpC1c,GAAOoW,QAnDRpW,GAAOG,GAAGiW,MAAQ,SAAUjW,GAY3B,OAVAsc,EACElE,KAAMpY,GAKN6Z,SAAO,SAAU1W,GACjBtD,GAAOwc,eAAgBlZ,KAGlBvG,MAGRiD,GAAOsC,OAAQ,CAGde,SAAS,EAITuZ,UAAW,EAGXxG,MAAO,SAAUyG,KAGF,IAATA,IAAkB7c,GAAO4c,UAAY5c,GAAOqD,WAKjDrD,GAAOqD,SAAU,KAGZwZ,GAAsC,IAAnB7c,GAAO4c,WAK/BH,EAAUtB,YAAaxe,EAAU,CAAEqD,QAIrCA,GAAOoW,MAAMmC,KAAOkE,EAAUlE,KAaD,aAAxB5b,EAASmgB,YACa,YAAxBngB,EAASmgB,aAA6BngB,EAASmH,gBAAgBiZ,SAGjEjgB,GAAO2e,WAAYzb,GAAOoW,QAK1BzZ,EAAS2P,iBAAkB,mBAAoBoQ,GAG/C5f,GAAOwP,iBAAkB,OAAQoQ,IAQlC,IAAIM,EAAS,SAAU9b,EAAOf,EAAIiL,EAAKtG,EAAOmY,EAAWC,EAAUC,GAClE,IAAIje,EAAI,EACP+C,EAAMf,EAAMZ,OACZ8c,EAAc,MAAPhS,EAGR,GAAuB,WAAlBvL,EAAQuL,GAEZ,IAAMlM,KADN+d,GAAY,EACD7R,EACV4R,EAAQ9b,EAAOf,EAAIjB,EAAGkM,EAAKlM,IAAK,EAAMge,EAAUC,QAI3C,QAAena,IAAV8B,IACXmY,GAAY,EAEN7e,EAAY0G,KACjBqY,GAAM,GAGFC,IAGCD,GACJhd,EAAG3C,KAAM0D,EAAO4D,GAChB3E,EAAK,OAILid,EAAOjd,EACPA,EAAK,SAAUK,EAAM6c,EAAMvY,GAC1B,OAAOsY,EAAK5f,KAAMwC,GAAQQ,GAAQsE,MAKhC3E,GACJ,KAAQjB,EAAI+C,EAAK/C,IAChBiB,EACCe,EAAOhC,GAAKkM,EAAK+R,EAChBrY,EACAA,EAAMtH,KAAM0D,EAAOhC,GAAKA,EAAGiB,EAAIe,EAAOhC,GAAKkM,KAMhD,OAAK6R,EACG/b,EAIHkc,EACGjd,EAAG3C,KAAM0D,GAGVe,EAAM9B,EAAIe,EAAO,GAAKkK,GAAQ8R,GAKlCI,EAAY,QACfC,EAAa,YAGd,SAASC,EAAYC,EAAMC,GAC1B,OAAOA,EAAOC,cAMf,SAASC,EAAWC,GACnB,OAAOA,EAAOza,QAASka,EAAW,OAAQla,QAASma,EAAYC,GAEhE,IAAIM,EAAa,SAAUC,GAQ1B,OAA0B,IAAnBA,EAAMzf,UAAqC,IAAnByf,EAAMzf,YAAsByf,EAAMzf,UAMlE,SAAS0f,IACRjhB,KAAKkG,QAAUjD,GAAOiD,QAAU+a,EAAKC,MAGtCD,EAAKC,IAAM,EAEXD,EAAKrd,UAAY,CAEhBwK,MAAO,SAAU4S,GAGhB,IAAIjZ,EAAQiZ,EAAOhhB,KAAKkG,SA4BxB,OAzBM6B,IACLA,EAAQ,GAKHgZ,EAAYC,KAIXA,EAAMzf,SACVyf,EAAOhhB,KAAKkG,SAAY6B,EAMxB3H,OAAO+gB,eAAgBH,EAAOhhB,KAAKkG,QAAS,CAC3C6B,MAAOA,EACPqZ,cAAc,MAMXrZ,GAERsZ,IAAK,SAAUL,EAAOM,EAAMvZ,GAC3B,IAAIwZ,EACHnT,EAAQpO,KAAKoO,MAAO4S,GAIrB,GAAqB,iBAATM,EACXlT,EAAOyS,EAAWS,IAAWvZ,OAM7B,IAAMwZ,KAAQD,EACblT,EAAOyS,EAAWU,IAAWD,EAAMC,GAGrC,OAAOnT,GAERpK,IAAK,SAAUgd,EAAO3S,GACrB,YAAepI,IAARoI,EACNrO,KAAKoO,MAAO4S,GAGZA,EAAOhhB,KAAKkG,UAAa8a,EAAOhhB,KAAKkG,SAAW2a,EAAWxS,KAE7D4R,OAAQ,SAAUe,EAAO3S,EAAKtG,GAa7B,YAAa9B,IAARoI,GACCA,GAAsB,iBAARA,QAAgCpI,IAAV8B,EAElC/H,KAAKgE,IAAKgd,EAAO3S,IASzBrO,KAAKqhB,IAAKL,EAAO3S,EAAKtG,QAIL9B,IAAV8B,EAAsBA,EAAQsG,IAEtCkO,OAAQ,SAAUyE,EAAO3S,GACxB,IAAIlM,EACHiM,EAAQ4S,EAAOhhB,KAAKkG,SAErB,QAAeD,IAAVmI,EAAL,CAIA,QAAanI,IAARoI,EAAoB,CAkBxBlM,GAXCkM,EAJItI,MAAMC,QAASqI,GAIbA,EAAI5J,IAAKoc,IAEfxS,EAAMwS,EAAWxS,MAIJD,EACZ,CAAEC,GACAA,EAAIpB,MAAO2N,IAAmB,IAG1BrX,OAER,MAAQpB,WACAiM,EAAOC,EAAKlM,UAKR8D,IAARoI,GAAqBpL,GAAO2D,cAAewH,MAM1C4S,EAAMzf,SACVyf,EAAOhhB,KAAKkG,cAAYD,SAEjB+a,EAAOhhB,KAAKkG,YAItBsb,QAAS,SAAUR,GAClB,IAAI5S,EAAQ4S,EAAOhhB,KAAKkG,SACxB,YAAiBD,IAAVmI,IAAwBnL,GAAO2D,cAAewH,KAGvD,IAAIqT,EAAW,IAAIR,EAEfS,EAAW,IAAIT,EAcfU,EAAS,gCACZC,EAAa,SA2Bd,SAASC,EAAUpe,EAAM4K,EAAKiT,GAC7B,IAAI5d,EA1Ba4d,EA8BjB,QAAcrb,IAATqb,GAAwC,IAAlB7d,EAAKlC,SAI/B,GAHAmC,EAAO,QAAU2K,EAAIhI,QAASub,EAAY,OAAQje,cAG7B,iBAFrB2d,EAAO7d,EAAKjB,aAAckB,IAEM,CAC/B,IACC4d,EAnCW,UADGA,EAoCEA,IA/BL,UAATA,IAIS,SAATA,EACG,KAIHA,KAAUA,EAAO,IACbA,EAGJK,EAAOla,KAAM6Z,GACVQ,KAAKC,MAAOT,GAGbA,GAeH,MAAQ3U,IAGV+U,EAASL,IAAK5d,EAAM4K,EAAKiT,QAEzBA,OAAOrb,EAGT,OAAOqb,EAGRre,GAAOsC,OAAQ,CACdic,QAAS,SAAU/d,GAClB,OAAOie,EAASF,QAAS/d,IAAUge,EAASD,QAAS/d,IAGtD6d,KAAM,SAAU7d,EAAMC,EAAM4d,GAC3B,OAAOI,EAASzB,OAAQxc,EAAMC,EAAM4d,IAGrCU,WAAY,SAAUve,EAAMC,GAC3Bge,EAASnF,OAAQ9Y,EAAMC,IAKxBue,MAAO,SAAUxe,EAAMC,EAAM4d,GAC5B,OAAOG,EAASxB,OAAQxc,EAAMC,EAAM4d,IAGrCY,YAAa,SAAUze,EAAMC,GAC5B+d,EAASlF,OAAQ9Y,EAAMC,MAIzBT,GAAOG,GAAGmC,OAAQ,CACjB+b,KAAM,SAAUjT,EAAKtG,GACpB,IAAI5F,EAAGuB,EAAM4d,EACZ7d,EAAOzD,KAAM,GACbmiB,EAAQ1e,GAAQA,EAAK8G,WAGtB,QAAatE,IAARoI,EAAoB,CACxB,GAAKrO,KAAKuD,SACT+d,EAAOI,EAAS1d,IAAKP,GAEE,IAAlBA,EAAKlC,WAAmBkgB,EAASzd,IAAKP,EAAM,iBAAmB,CACnEtB,EAAIggB,EAAM5e,OACV,MAAQpB,IAIFggB,EAAOhgB,IAEsB,KADjCuB,EAAOye,EAAOhgB,GAAIuB,MACR7C,QAAS,WAClB6C,EAAOmd,EAAWnd,EAAKpD,MAAO,IAC9BuhB,EAAUpe,EAAMC,EAAM4d,EAAM5d,KAI/B+d,EAASJ,IAAK5d,EAAM,gBAAgB,GAItC,OAAO6d,EAIR,MAAoB,iBAARjT,EACJrO,KAAKuE,KAAM,WACjBmd,EAASL,IAAKrhB,KAAMqO,KAIf4R,EAAQjgB,KAAM,SAAU+H,GAC9B,IAAIuZ,EAOJ,GAAK7d,QAAkBwC,IAAV8B,EAKZ,YAAc9B,KADdqb,EAAOI,EAAS1d,IAAKP,EAAM4K,IAEnBiT,OAMMrb,KADdqb,EAAOO,EAAUpe,EAAM4K,IAEfiT,OAIR,EAIDthB,KAAKuE,KAAM,WAGVmd,EAASL,IAAKrhB,KAAMqO,EAAKtG,MAExB,KAAMA,EAA0B,EAAnBrD,UAAUnB,OAAY,MAAM,IAG7Cye,WAAY,SAAU3T,GACrB,OAAOrO,KAAKuE,KAAM,WACjBmd,EAASnF,OAAQvc,KAAMqO,QAM1BpL,GAAOsC,OAAQ,CACd2W,MAAO,SAAUzY,EAAM9B,EAAM2f,GAC5B,IAAIpF,EAEJ,GAAKzY,EAYJ,OAXA9B,GAASA,GAAQ,MAAS,QAC1Bua,EAAQuF,EAASzd,IAAKP,EAAM9B,GAGvB2f,KACEpF,GAASnW,MAAMC,QAASsb,GAC7BpF,EAAQuF,EAASxB,OAAQxc,EAAM9B,EAAMsB,GAAOgE,UAAWqa,IAEvDpF,EAAMtb,KAAM0gB,IAGPpF,GAAS,IAIlBkG,QAAS,SAAU3e,EAAM9B,GACxBA,EAAOA,GAAQ,KAEf,IAAIua,EAAQjZ,GAAOiZ,MAAOzY,EAAM9B,GAC/B0gB,EAAcnG,EAAM3Y,OACpBH,EAAK8Y,EAAM3N,QACX+T,EAAQrf,GAAOsf,YAAa9e,EAAM9B,GAMvB,eAAPyB,IACJA,EAAK8Y,EAAM3N,QACX8T,KAGIjf,IAIU,OAATzB,GACJua,EAAMsG,QAAS,qBAITF,EAAMG,KACbrf,EAAG3C,KAAMgD,EApBF,WACNR,GAAOmf,QAAS3e,EAAM9B,IAmBF2gB,KAGhBD,GAAeC,GACpBA,EAAMhO,MAAM8H,QAKdmG,YAAa,SAAU9e,EAAM9B,GAC5B,IAAI0M,EAAM1M,EAAO,aACjB,OAAO8f,EAASzd,IAAKP,EAAM4K,IAASoT,EAASxB,OAAQxc,EAAM4K,EAAK,CAC/DiG,MAAOrR,GAAOwY,UAAW,eAAgBvB,IAAK,WAC7CuH,EAASlF,OAAQ9Y,EAAM,CAAE9B,EAAO,QAAS0M,WAM7CpL,GAAOG,GAAGmC,OAAQ,CACjB2W,MAAO,SAAUva,EAAM2f,GACtB,IAAIoB,EAAS,EAQb,MANqB,iBAAT/gB,IACX2f,EAAO3f,EACPA,EAAO,KACP+gB,KAGIhe,UAAUnB,OAASmf,EAChBzf,GAAOiZ,MAAOlc,KAAM,GAAK2B,QAGjBsE,IAATqb,EACNthB,KACAA,KAAKuE,KAAM,WACV,IAAI2X,EAAQjZ,GAAOiZ,MAAOlc,KAAM2B,EAAM2f,GAGtCre,GAAOsf,YAAaviB,KAAM2B,GAEZ,OAATA,GAAgC,eAAfua,EAAO,IAC5BjZ,GAAOmf,QAASpiB,KAAM2B,MAI1BygB,QAAS,SAAUzgB,GAClB,OAAO3B,KAAKuE,KAAM,WACjBtB,GAAOmf,QAASpiB,KAAM2B,MAGxBghB,WAAY,SAAUhhB,GACrB,OAAO3B,KAAKkc,MAAOva,GAAQ,KAAM,KAKlC2Z,QAAS,SAAU3Z,EAAML,GACxB,IAAIshB,EACHC,EAAQ,EACRC,EAAQ7f,GAAO0Z,WACfpM,EAAWvQ,KACXmC,EAAInC,KAAKuD,OACT2X,EAAU,aACC2H,GACTC,EAAM1E,YAAa7N,EAAU,CAAEA,KAIb,iBAAT5O,IACXL,EAAMK,EACNA,OAAOsE,GAERtE,EAAOA,GAAQ,KAEf,MAAQQ,KACPygB,EAAMnB,EAASzd,IAAKuM,EAAUpO,GAAKR,EAAO,gBAC9BihB,EAAItO,QACfuO,IACAD,EAAItO,MAAM4F,IAAKgB,IAIjB,OADAA,IACO4H,EAAMxH,QAASha,MAGxB,IAAIyhB,EAAO,sCAA0CC,OAEjDC,EAAU,IAAIza,OAAQ,iBAAmBua,EAAO,cAAe,KAG/DG,EAAY,CAAE,MAAO,QAAS,SAAU,QAExCnc,EAAkBnH,EAASmH,gBAI1Boc,EAAa,SAAU1f,GACzB,OAAOR,GAAOwF,SAAUhF,EAAK+D,cAAe/D,IAE7C2f,EAAW,CAAEA,UAAU,GAOnBrc,EAAgBsc,cACpBF,EAAa,SAAU1f,GACtB,OAAOR,GAAOwF,SAAUhF,EAAK+D,cAAe/D,IAC3CA,EAAK4f,YAAaD,KAAe3f,EAAK+D,gBAG1C,IAAI8b,GAAqB,SAAU7f,EAAMiL,GAOvC,MAA8B,UAH9BjL,EAAOiL,GAAMjL,GAGD8f,MAAMC,SACM,KAAvB/f,EAAK8f,MAAMC,SAMXL,EAAY1f,IAEsB,SAAlCR,GAAOwgB,IAAKhgB,EAAM,YAKrB,SAASigB,GAAWjgB,EAAM8d,EAAMoC,EAAYC,GAC3C,IAAIC,EAAUC,EACbC,EAAgB,GAChBC,EAAeJ,EACd,WACC,OAAOA,EAAMhK,OAEd,WACC,OAAO3W,GAAOwgB,IAAKhgB,EAAM8d,EAAM,KAEjC0C,EAAUD,IACVE,EAAOP,GAAcA,EAAY,KAAS1gB,GAAOkhB,UAAW5C,GAAS,GAAK,MAG1E6C,EAAgB3gB,EAAKlC,WAClB0B,GAAOkhB,UAAW5C,IAAmB,OAAT2C,IAAkBD,IAChDhB,EAAQ5V,KAAMpK,GAAOwgB,IAAKhgB,EAAM8d,IAElC,GAAK6C,GAAiBA,EAAe,KAAQF,EAAO,CAInDD,GAAoB,EAGpBC,EAAOA,GAAQE,EAAe,GAG9BA,GAAiBH,GAAW,EAE5B,MAAQF,IAIP9gB,GAAOsgB,MAAO9f,EAAM8d,EAAM6C,EAAgBF,IACnC,EAAIJ,IAAY,GAAMA,EAAQE,IAAiBC,GAAW,MAAW,IAC3EF,EAAgB,GAEjBK,GAAgCN,EAIjCM,GAAgC,EAChCnhB,GAAOsgB,MAAO9f,EAAM8d,EAAM6C,EAAgBF,GAG1CP,EAAaA,GAAc,GAgB5B,OAbKA,IACJS,GAAiBA,IAAkBH,GAAW,EAG9CJ,EAAWF,EAAY,GACtBS,GAAkBT,EAAY,GAAM,GAAMA,EAAY,IACrDA,EAAY,GACTC,IACJA,EAAMM,KAAOA,EACbN,EAAMtR,MAAQ8R,EACdR,EAAMxe,IAAMye,IAGPA,EAIR,IAAIQ,GAAoB,GAyBxB,SAASC,GAAU/T,EAAUgU,GAO5B,IANA,IAAIf,EAAS/f,EAxBcA,EACvBiT,EACHxU,EACAsB,EACAggB,EAqBAgB,EAAS,GACTxK,EAAQ,EACRzW,EAASgN,EAAShN,OAGXyW,EAAQzW,EAAQyW,KACvBvW,EAAO8M,EAAUyJ,IACNuJ,QAIXC,EAAU/f,EAAK8f,MAAMC,QAChBe,GAKa,SAAZf,IACJgB,EAAQxK,GAAUyH,EAASzd,IAAKP,EAAM,YAAe,KAC/C+gB,EAAQxK,KACbvW,EAAK8f,MAAMC,QAAU,KAGK,KAAvB/f,EAAK8f,MAAMC,SAAkBF,GAAoB7f,KACrD+gB,EAAQxK,IA7CVwJ,EAFAthB,EADGwU,OAAAA,EACHxU,GAF0BuB,EAiDaA,GA/C5B+D,cACXhE,EAAWC,EAAKD,UAChBggB,EAAUa,GAAmB7gB,MAM9BkT,EAAOxU,EAAIuiB,KAAK9hB,YAAaT,EAAII,cAAekB,IAChDggB,EAAUvgB,GAAOwgB,IAAK/M,EAAM,WAE5BA,EAAK9T,WAAWC,YAAa6T,GAEZ,SAAZ8M,IACJA,EAAU,SAEXa,GAAmB7gB,GAAaggB,MAkCb,SAAZA,IACJgB,EAAQxK,GAAU,OAGlByH,EAASJ,IAAK5d,EAAM,UAAW+f,KAMlC,IAAMxJ,EAAQ,EAAGA,EAAQzW,EAAQyW,IACR,MAAnBwK,EAAQxK,KACZzJ,EAAUyJ,GAAQuJ,MAAMC,QAAUgB,EAAQxK,IAI5C,OAAOzJ,EAGRtN,GAAOG,GAAGmC,OAAQ,CACjBgf,KAAM,WACL,OAAOD,GAAUtkB,MAAM,IAExB0kB,KAAM,WACL,OAAOJ,GAAUtkB,OAElB2kB,OAAQ,SAAU7H,GACjB,MAAsB,kBAAVA,EACJA,EAAQ9c,KAAKukB,OAASvkB,KAAK0kB,OAG5B1kB,KAAKuE,KAAM,WACZ+e,GAAoBtjB,MACxBiD,GAAQjD,MAAOukB,OAEfthB,GAAQjD,MAAO0kB,YAKnB,IAUEE,GACA1U,GAXE2U,GAAiB,wBAEjBC,GAAW,iCAEXC,GAAc,qCAMhBH,GADchlB,EAASolB,yBACRriB,YAAa/C,EAAS0C,cAAe,SACpD4N,GAAQtQ,EAAS0C,cAAe,UAM3BG,aAAc,OAAQ,SAC5ByN,GAAMzN,aAAc,UAAW,WAC/ByN,GAAMzN,aAAc,OAAQ,KAE5BmiB,GAAIjiB,YAAauN,IAIjB9O,GAAQ6jB,WAAaL,GAAIM,WAAW,GAAOA,WAAW,GAAOvS,UAAUwB,QAIvEyQ,GAAIzU,UAAY,yBAChB/O,GAAQ+jB,iBAAmBP,GAAIM,WAAW,GAAOvS,UAAUyS,aAK3DR,GAAIzU,UAAY,oBAChB/O,GAAQikB,SAAWT,GAAIjS,UAKxB,IAAI2S,GAAU,CAKbC,MAAO,CAAE,EAAG,UAAW,YACvBC,IAAK,CAAE,EAAG,oBAAqB,uBAC/BC,GAAI,CAAE,EAAG,iBAAkB,oBAC3BC,GAAI,CAAE,EAAG,qBAAsB,yBAE/BC,SAAU,CAAE,EAAG,GAAI,KAYpB,SAASC,GAAQziB,EAAS6M,GAIzB,IAAI5L,EAYJ,OATCA,EAD4C,oBAAjCjB,EAAQqK,qBACbrK,EAAQqK,qBAAsBwC,GAAO,KAEI,oBAA7B7M,EAAQ4K,iBACpB5K,EAAQ4K,iBAAkBiC,GAAO,KAGjC,QAGM/J,IAAR+J,GAAqBA,GAAOxM,GAAUL,EAAS6M,GAC5C/M,GAAOoB,MAAO,CAAElB,GAAWiB,GAG5BA,EAKR,SAASyhB,GAAe1hB,EAAO2hB,GAI9B,IAHA,IAAI3jB,EAAI,EACP2X,EAAI3V,EAAMZ,OAEHpB,EAAI2X,EAAG3X,IACdsf,EAASJ,IACRld,EAAOhC,GACP,cACC2jB,GAAerE,EAASzd,IAAK8hB,EAAa3jB,GAAK,eA1CnDmjB,GAAQS,MAAQT,GAAQU,MAAQV,GAAQW,SAAWX,GAAQY,QAAUZ,GAAQC,MAC7ED,GAAQa,GAAKb,GAAQI,GAGftkB,GAAQikB,SACbC,GAAQc,SAAWd,GAAQD,OAAS,CAAE,EAAG,+BAAgC,cA2C1E,IAAIgB,GAAQ,YAEZ,SAASC,GAAeniB,EAAOhB,EAASojB,EAASC,EAAWC,GAO3D,IANA,IAAIhjB,EAAMmf,EAAK5S,EAAK0W,EAAMC,EAAUxhB,EACnCyhB,EAAWzjB,EAAQ6hB,yBACnB6B,EAAQ,GACR1kB,EAAI,EACJ2X,EAAI3V,EAAMZ,OAEHpB,EAAI2X,EAAG3X,IAGd,IAFAsB,EAAOU,EAAOhC,KAEQ,IAATsB,EAGZ,GAAwB,WAAnBX,EAAQW,GAIZR,GAAOoB,MAAOwiB,EAAOpjB,EAAKlC,SAAW,CAAEkC,GAASA,QAG1C,GAAM4iB,GAAM5e,KAAMhE,GAIlB,CACNmf,EAAMA,GAAOgE,EAASjkB,YAAaQ,EAAQb,cAAe,QAG1D0N,GAAQ8U,GAASzX,KAAM5J,IAAU,CAAE,GAAI,KAAQ,GAAIE,cACnD+iB,EAAOpB,GAAStV,IAASsV,GAAQK,SACjC/C,EAAIzS,UAAYuW,EAAM,GAAMzjB,GAAO6jB,cAAerjB,GAASijB,EAAM,GAGjEvhB,EAAIuhB,EAAM,GACV,MAAQvhB,IACPyd,EAAMA,EAAIjQ,UAKX1P,GAAOoB,MAAOwiB,EAAOjE,EAAIlW,aAGzBkW,EAAMgE,EAASlU,YAGX5L,YAAc,QAzBlB+f,EAAMjmB,KAAMuC,EAAQ4jB,eAAgBtjB,IA+BvCmjB,EAAS9f,YAAc,GAEvB3E,EAAI,EACJ,MAAUsB,EAAOojB,EAAO1kB,KAGvB,GAAKqkB,IAAkD,EAArCvjB,GAAOkE,QAAS1D,EAAM+iB,GAClCC,GACJA,EAAQ7lB,KAAM6C,QAgBhB,GAXAkjB,EAAWxD,EAAY1f,GAGvBmf,EAAMgD,GAAQgB,EAASjkB,YAAac,GAAQ,UAGvCkjB,GACJd,GAAejD,GAIX2D,EAAU,CACdphB,EAAI,EACJ,MAAU1B,EAAOmf,EAAKzd,KAChB4f,GAAYtd,KAAMhE,EAAK9B,MAAQ,KACnC4kB,EAAQ3lB,KAAM6C,GAMlB,OAAOmjB,EAIR,IAAII,GAAiB,sBAErB,SAASC,KACR,OAAO,EAGR,SAASC,KACR,OAAO,EAGR,SAASC,GAAI1jB,EAAM2jB,EAAOlkB,EAAUoe,EAAMle,EAAIikB,GAC7C,IAAIC,EAAQ3lB,EAGZ,GAAsB,iBAAVylB,EAAqB,CAShC,IAAMzlB,IANmB,iBAAbuB,IAGXoe,EAAOA,GAAQpe,EACfA,OAAW+C,GAEEmhB,EACbD,GAAI1jB,EAAM9B,EAAMuB,EAAUoe,EAAM8F,EAAOzlB,GAAQ0lB,GAEhD,OAAO5jB,EAsBR,GAnBa,MAAR6d,GAAsB,MAANle,GAGpBA,EAAKF,EACLoe,EAAOpe,OAAW+C,GACD,MAAN7C,IACc,iBAAbF,GAGXE,EAAKke,EACLA,OAAOrb,IAIP7C,EAAKke,EACLA,EAAOpe,EACPA,OAAW+C,KAGD,IAAP7C,EACJA,EAAK8jB,QACC,IAAM9jB,EACZ,OAAOK,EAeR,OAZa,IAAR4jB,IACJC,EAASlkB,GACTA,EAAK,SAAUmkB,GAId,OADAtkB,KAASukB,IAAKD,GACPD,EAAO3mB,MAAOX,KAAM0E,aAIzBsD,KAAOsf,EAAOtf,OAAUsf,EAAOtf,KAAO/E,GAAO+E,SAE1CvE,EAAKc,KAAM,WACjBtB,GAAOskB,MAAMrN,IAAKla,KAAMonB,EAAOhkB,EAAIke,EAAMpe,KA+a3C,SAASukB,GAAgB/Y,EAAI/M,EAAM+lB,GAG5BA,GAQNjG,EAASJ,IAAK3S,EAAI/M,GAAM,GACxBsB,GAAOskB,MAAMrN,IAAKxL,EAAI/M,EAAM,CAC3B0F,WAAW,EACXyW,QAAS,SAAUyJ,GAClB,IAAI3V,EACH+V,EAAQlG,EAASzd,IAAKhE,KAAM2B,GAE7B,GAAyB,EAAlB4lB,EAAMK,WAAmB5nB,KAAM2B,IAGrC,GAAMgmB,GA4BQ1kB,GAAOskB,MAAMxJ,QAASpc,IAAU,IAAKkmB,cAClDN,EAAMO,uBAhBN,GARAH,EAAQrnB,GAAMG,KAAMiE,WACpB+c,EAASJ,IAAKrhB,KAAM2B,EAAMgmB,GAG1B3nB,KAAM2B,KACNiQ,EAAS6P,EAASzd,IAAKhE,KAAM2B,GAC7B8f,EAASJ,IAAKrhB,KAAM2B,GAAM,GAErBgmB,IAAU/V,EAMd,OAHA2V,EAAMQ,2BACNR,EAAMS,iBAECpW,OAeE+V,IAGXlG,EAASJ,IAAKrhB,KAAM2B,EAAMsB,GAAOskB,MAAMU,QACtCN,EAAO,GACPA,EAAMrnB,MAAO,GACbN,OAWDunB,EAAMO,kBACNP,EAAMW,8BAAgCjB,aArENhhB,IAA7Bwb,EAASzd,IAAK0K,EAAI/M,IACtBsB,GAAOskB,MAAMrN,IAAKxL,EAAI/M,EAAMslB,IA5a/BhkB,GAAOskB,MAAQ,CAEd/nB,OAAQ,GAER0a,IAAK,SAAUzW,EAAM2jB,EAAOtJ,EAASwD,EAAMpe,GAE1C,IAAIilB,EAAaC,EAAaxF,EAC7ByF,EAAQC,EAAGC,EACXxK,EAASyK,EAAU7mB,EAAM8mB,EAAYC,EACrCC,EAAWlH,EAASzd,IAAKP,GAG1B,GAAMsd,EAAYtd,GAAlB,CAKKqa,EAAQA,UAEZA,GADAqK,EAAcrK,GACQA,QACtB5a,EAAWilB,EAAYjlB,UAKnBA,GACJD,GAAO4J,KAAK2D,gBAAiBzJ,EAAiB7D,GAIzC4a,EAAQ9V,OACb8V,EAAQ9V,KAAO/E,GAAO+E,SAIfqgB,EAASM,EAASN,UACzBA,EAASM,EAASN,OAASjoB,OAAOwoB,OAAQ,QAEnCR,EAAcO,EAASE,UAC9BT,EAAcO,EAASE,OAAS,SAAUlc,GAIzC,MAAyB,oBAAX1J,IAA0BA,GAAOskB,MAAMuB,YAAcnc,EAAEhL,KACpEsB,GAAOskB,MAAMwB,SAASpoB,MAAO8C,EAAMiB,gBAAcuB,IAMpDqiB,GADAlB,GAAUA,GAAS,IAAKna,MAAO2N,IAAmB,CAAE,KAC1CrX,OACV,MAAQ+kB,IAEP3mB,EAAO+mB,GADP9F,EAAMoE,GAAe3Z,KAAM+Z,EAAOkB,KAAS,IACpB,GACvBG,GAAe7F,EAAK,IAAO,IAAKza,MAAO,KAAM9C,OAGvC1D,IAKNoc,EAAU9a,GAAOskB,MAAMxJ,QAASpc,IAAU,GAG1CA,GAASuB,EAAW6a,EAAQ8J,aAAe9J,EAAQiL,WAAcrnB,EAGjEoc,EAAU9a,GAAOskB,MAAMxJ,QAASpc,IAAU,GAG1C4mB,EAAYtlB,GAAOsC,OAAQ,CAC1B5D,KAAMA,EACN+mB,SAAUA,EACVpH,KAAMA,EACNxD,QAASA,EACT9V,KAAM8V,EAAQ9V,KACd9E,SAAUA,EACVqI,aAAcrI,GAAYD,GAAOqN,KAAKrD,MAAM1B,aAAa9D,KAAMvE,GAC/DmE,UAAWohB,EAAW3a,KAAM,MAC1Bqa,IAGKK,EAAWH,EAAQ1mB,OAC1B6mB,EAAWH,EAAQ1mB,GAAS,IACnBsnB,cAAgB,EAGnBlL,EAAQmL,QACiD,IAA9DnL,EAAQmL,MAAMzoB,KAAMgD,EAAM6d,EAAMmH,EAAYL,IAEvC3kB,EAAK8L,kBACT9L,EAAK8L,iBAAkB5N,EAAMymB,IAK3BrK,EAAQ7D,MACZ6D,EAAQ7D,IAAIzZ,KAAMgD,EAAM8kB,GAElBA,EAAUzK,QAAQ9V,OACvBugB,EAAUzK,QAAQ9V,KAAO8V,EAAQ9V,OAK9B9E,EACJslB,EAASljB,OAAQkjB,EAASS,gBAAiB,EAAGV,GAE9CC,EAAS5nB,KAAM2nB,GAIhBtlB,GAAOskB,MAAM/nB,OAAQmC,IAAS,KAMhC4a,OAAQ,SAAU9Y,EAAM2jB,EAAOtJ,EAAS5a,EAAUimB,GAEjD,IAAIhkB,EAAGikB,EAAWxG,EACjByF,EAAQC,EAAGC,EACXxK,EAASyK,EAAU7mB,EAAM8mB,EAAYC,EACrCC,EAAWlH,EAASD,QAAS/d,IAAUge,EAASzd,IAAKP,GAEtD,GAAMklB,IAAeN,EAASM,EAASN,QAAvC,CAMAC,GADAlB,GAAUA,GAAS,IAAKna,MAAO2N,IAAmB,CAAE,KAC1CrX,OACV,MAAQ+kB,IAMP,GAJA3mB,EAAO+mB,GADP9F,EAAMoE,GAAe3Z,KAAM+Z,EAAOkB,KAAS,IACpB,GACvBG,GAAe7F,EAAK,IAAO,IAAKza,MAAO,KAAM9C,OAGvC1D,EAAN,CAOAoc,EAAU9a,GAAOskB,MAAMxJ,QAASpc,IAAU,GAE1C6mB,EAAWH,EADX1mB,GAASuB,EAAW6a,EAAQ8J,aAAe9J,EAAQiL,WAAcrnB,IACpC,GAC7BihB,EAAMA,EAAK,IACV,IAAIpa,OAAQ,UAAYigB,EAAW3a,KAAM,iBAAoB,WAG9Dsb,EAAYjkB,EAAIqjB,EAASjlB,OACzB,MAAQ4B,IACPojB,EAAYC,EAAUrjB,IAEfgkB,GAAeT,IAAaH,EAAUG,UACzC5K,GAAWA,EAAQ9V,OAASugB,EAAUvgB,MACtC4a,IAAOA,EAAInb,KAAM8gB,EAAUlhB,YAC3BnE,GAAYA,IAAaqlB,EAAUrlB,WACxB,OAAbA,IAAqBqlB,EAAUrlB,YAChCslB,EAASljB,OAAQH,EAAG,GAEfojB,EAAUrlB,UACdslB,EAASS,gBAELlL,EAAQxB,QACZwB,EAAQxB,OAAO9b,KAAMgD,EAAM8kB,IAOzBa,IAAcZ,EAASjlB,SACrBwa,EAAQsL,WACkD,IAA/DtL,EAAQsL,SAAS5oB,KAAMgD,EAAMglB,EAAYE,EAASE,SAElD5lB,GAAOqmB,YAAa7lB,EAAM9B,EAAMgnB,EAASE,eAGnCR,EAAQ1mB,SA1Cf,IAAMA,KAAQ0mB,EACbplB,GAAOskB,MAAMhL,OAAQ9Y,EAAM9B,EAAOylB,EAAOkB,GAAKxK,EAAS5a,GAAU,GA8C/DD,GAAO2D,cAAeyhB,IAC1B5G,EAASlF,OAAQ9Y,EAAM,mBAIzBslB,SAAU,SAAUQ,GAEnB,IAAIpnB,EAAGgD,EAAGf,EAAK4O,EAASuV,EAAWiB,EAClC3W,EAAO,IAAI9M,MAAOrB,UAAUnB,QAG5BgkB,EAAQtkB,GAAOskB,MAAMkC,IAAKF,GAE1Bf,GACC/G,EAASzd,IAAKhE,KAAM,WAAcI,OAAOwoB,OAAQ,OAC/CrB,EAAM5lB,OAAU,GACnBoc,EAAU9a,GAAOskB,MAAMxJ,QAASwJ,EAAM5lB,OAAU,GAKjD,IAFAkR,EAAM,GAAM0U,EAENplB,EAAI,EAAGA,EAAIuC,UAAUnB,OAAQpB,IAClC0Q,EAAM1Q,GAAMuC,UAAWvC,GAMxB,GAHAolB,EAAMmC,eAAiB1pB,MAGlB+d,EAAQ4L,cAA2D,IAA5C5L,EAAQ4L,YAAYlpB,KAAMT,KAAMunB,GAA5D,CAKAiC,EAAevmB,GAAOskB,MAAMiB,SAAS/nB,KAAMT,KAAMunB,EAAOiB,GAGxDrmB,EAAI,EACJ,OAAU6Q,EAAUwW,EAAcrnB,QAAYolB,EAAMqC,uBAAyB,CAC5ErC,EAAMsC,cAAgB7W,EAAQvP,KAE9B0B,EAAI,EACJ,OAAUojB,EAAYvV,EAAQwV,SAAUrjB,QACtCoiB,EAAMW,gCAIDX,EAAMuC,aAAsC,IAAxBvB,EAAUlhB,YACnCkgB,EAAMuC,WAAWriB,KAAM8gB,EAAUlhB,aAEjCkgB,EAAMgB,UAAYA,EAClBhB,EAAMjG,KAAOiH,EAAUjH,UAKVrb,KAHb7B,IAAUnB,GAAOskB,MAAMxJ,QAASwK,EAAUG,WAAc,IAAKG,QAC5DN,EAAUzK,SAAUnd,MAAOqS,EAAQvP,KAAMoP,MAGT,KAAzB0U,EAAM3V,OAASxN,KACrBmjB,EAAMS,iBACNT,EAAMO,oBAYX,OAJK/J,EAAQgM,cACZhM,EAAQgM,aAAatpB,KAAMT,KAAMunB,GAG3BA,EAAM3V,SAGd4W,SAAU,SAAUjB,EAAOiB,GAC1B,IAAIrmB,EAAGomB,EAAWnf,EAAK4gB,EAAiBC,EACvCT,EAAe,GACfP,EAAgBT,EAASS,cACzBrP,EAAM2N,EAAM3hB,OAGb,GAAKqjB,GAIJrP,EAAIrY,YAOc,UAAfgmB,EAAM5lB,MAAoC,GAAhB4lB,EAAM9S,QAEnC,KAAQmF,IAAQ5Z,KAAM4Z,EAAMA,EAAIhX,YAAc5C,KAI7C,GAAsB,IAAjB4Z,EAAIrY,WAAoC,UAAfgmB,EAAM5lB,OAAqC,IAAjBiY,EAAIrN,UAAsB,CAGjF,IAFAyd,EAAkB,GAClBC,EAAmB,GACb9nB,EAAI,EAAGA,EAAI8mB,EAAe9mB,SAME8D,IAA5BgkB,EAFL7gB,GAHAmf,EAAYC,EAAUrmB,IAGNe,SAAW,OAG1B+mB,EAAkB7gB,GAAQmf,EAAUhd,cACC,EAApCtI,GAAQmG,EAAKpJ,MAAOga,MAAOJ,GAC3B3W,GAAO4J,KAAMzD,EAAKpJ,KAAM,KAAM,CAAE4Z,IAAQrW,QAErC0mB,EAAkB7gB,IACtB4gB,EAAgBppB,KAAM2nB,GAGnByB,EAAgBzmB,QACpBimB,EAAa5oB,KAAM,CAAE6C,KAAMmW,EAAK4O,SAAUwB,IAY9C,OALApQ,EAAM5Z,KACDipB,EAAgBT,EAASjlB,QAC7BimB,EAAa5oB,KAAM,CAAE6C,KAAMmW,EAAK4O,SAAUA,EAASloB,MAAO2oB,KAGpDO,GAGRU,QAAS,SAAUxmB,EAAMymB,GACxB/pB,OAAO+gB,eAAgBle,GAAOmnB,MAAMxmB,UAAWF,EAAM,CACpD2mB,YAAY,EACZjJ,cAAc,EAEdpd,IAAK3C,EAAY8oB,GAChB,WACC,GAAKnqB,KAAKsqB,cACT,OAAOH,EAAMnqB,KAAKsqB,gBAGpB,WACC,GAAKtqB,KAAKsqB,cACT,OAAOtqB,KAAKsqB,cAAe5mB,IAI9B2d,IAAK,SAAUtZ,GACd3H,OAAO+gB,eAAgBnhB,KAAM0D,EAAM,CAClC2mB,YAAY,EACZjJ,cAAc,EACdmJ,UAAU,EACVxiB,MAAOA,QAMX0hB,IAAK,SAAUa,GACd,OAAOA,EAAernB,GAAOiD,SAC5BokB,EACA,IAAIrnB,GAAOmnB,MAAOE,IAGpBvM,QAAS,CACRyM,KAAM,CAGLC,UAAU,GAEXC,MAAO,CAGNxB,MAAO,SAAU5H,GAIhB,IAAI5S,EAAK1O,MAAQshB,EAWjB,OARKuD,GAAepd,KAAMiH,EAAG/M,OAC5B+M,EAAGgc,OAASlnB,GAAUkL,EAAI,UAG1B+Y,GAAgB/Y,EAAI,SAAS,IAIvB,GAERuZ,QAAS,SAAU3G,GAIlB,IAAI5S,EAAK1O,MAAQshB,EAUjB,OAPKuD,GAAepd,KAAMiH,EAAG/M,OAC5B+M,EAAGgc,OAASlnB,GAAUkL,EAAI,UAE1B+Y,GAAgB/Y,EAAI,UAId,GAKRiX,SAAU,SAAU4B,GACnB,IAAI3hB,EAAS2hB,EAAM3hB,OACnB,OAAOif,GAAepd,KAAM7B,EAAOjE,OAClCiE,EAAO8kB,OAASlnB,GAAUoC,EAAQ,UAClC6b,EAASzd,IAAK4B,EAAQ,UACtBpC,GAAUoC,EAAQ,OAIrB+kB,aAAc,CACbZ,aAAc,SAAUxC,QAIDthB,IAAjBshB,EAAM3V,QAAwB2V,EAAM+C,gBACxC/C,EAAM+C,cAAcM,YAAcrD,EAAM3V,YA0F7C3O,GAAOqmB,YAAc,SAAU7lB,EAAM9B,EAAMknB,GAGrCplB,EAAKmc,qBACTnc,EAAKmc,oBAAqBje,EAAMknB,IAIlC5lB,GAAOmnB,MAAQ,SAAUxoB,EAAKipB,GAG7B,KAAQ7qB,gBAAgBiD,GAAOmnB,OAC9B,OAAO,IAAInnB,GAAOmnB,MAAOxoB,EAAKipB,GAI1BjpB,GAAOA,EAAID,MACf3B,KAAKsqB,cAAgB1oB,EACrB5B,KAAK2B,KAAOC,EAAID,KAIhB3B,KAAK8qB,mBAAqBlpB,EAAImpB,uBACH9kB,IAAzBrE,EAAImpB,mBAGgB,IAApBnpB,EAAIgpB,YACL3D,GACAC,GAKDlnB,KAAK4F,OAAWhE,EAAIgE,QAAkC,IAAxBhE,EAAIgE,OAAOrE,SACxCK,EAAIgE,OAAOhD,WACXhB,EAAIgE,OAEL5F,KAAK6pB,cAAgBjoB,EAAIioB,cACzB7pB,KAAKgrB,cAAgBppB,EAAIopB,eAIzBhrB,KAAK2B,KAAOC,EAIRipB,GACJ5nB,GAAOsC,OAAQvF,KAAM6qB,GAItB7qB,KAAKirB,UAAYrpB,GAAOA,EAAIqpB,WAAaC,KAAKC,MAG9CnrB,KAAMiD,GAAOiD,UAAY,GAK1BjD,GAAOmnB,MAAMxmB,UAAY,CACxBE,YAAab,GAAOmnB,MACpBU,mBAAoB5D,GACpB0C,qBAAsB1C,GACtBgB,8BAA+BhB,GAC/BkE,aAAa,EAEbpD,eAAgB,WACf,IAAIrb,EAAI3M,KAAKsqB,cAEbtqB,KAAK8qB,mBAAqB7D,GAErBta,IAAM3M,KAAKorB,aACfze,EAAEqb,kBAGJF,gBAAiB,WAChB,IAAInb,EAAI3M,KAAKsqB,cAEbtqB,KAAK4pB,qBAAuB3C,GAEvBta,IAAM3M,KAAKorB,aACfze,EAAEmb,mBAGJC,yBAA0B,WACzB,IAAIpb,EAAI3M,KAAKsqB,cAEbtqB,KAAKkoB,8BAAgCjB,GAEhCta,IAAM3M,KAAKorB,aACfze,EAAEob,2BAGH/nB,KAAK8nB,oBAKP7kB,GAAOsB,KAAM,CACZ8mB,QAAQ,EACRC,SAAS,EACTC,YAAY,EACZC,gBAAgB,EAChBC,SAAS,EACTC,QAAQ,EACRC,YAAY,EACZC,SAAS,EACTC,OAAO,EACPC,OAAO,EACPC,UAAU,EACVC,MAAM,EACNC,QAAQ,EACRjqB,MAAM,EACNkqB,UAAU,EACV7d,KAAK,EACL8d,SAAS,EACT1X,QAAQ,EACR2X,SAAS,EACTC,SAAS,EACTC,SAAS,EACTC,SAAS,EACTC,SAAS,EACTC,WAAW,EACXC,aAAa,EACbC,SAAS,EACTC,SAAS,EACTC,eAAe,EACfC,WAAW,EACXC,SAAS,EACTC,OAAO,GACL/pB,GAAOskB,MAAM2C,SAEhBjnB,GAAOsB,KAAM,CAAEoP,MAAO,UAAWsZ,KAAM,YAAc,SAAUtrB,EAAMkmB,GAEpE,SAASqF,EAAoB3D,GAC5B,GAAK3pB,EAASutB,aAAe,CAS5B,IAAItE,EAASpH,EAASzd,IAAKhE,KAAM,UAChCunB,EAAQtkB,GAAOskB,MAAMkC,IAAKF,GAC3BhC,EAAM5lB,KAA4B,YAArB4nB,EAAY5nB,KAAqB,QAAU,OACxD4lB,EAAM6D,aAAc,EAGpBvC,EAAQU,GAMHhC,EAAM3hB,SAAW2hB,EAAMsC,eAK3BhB,EAAQtB,QAMTtkB,GAAOskB,MAAM6F,SAAUvF,EAAc0B,EAAY3jB,OAChD3C,GAAOskB,MAAMkC,IAAKF,IAIrBtmB,GAAOskB,MAAMxJ,QAASpc,GAAS,CAG9BunB,MAAO,WAEN,IAAImE,EAOJ,GAFA5F,GAAgBznB,KAAM2B,GAAM,IAEvB/B,EAASutB,aAcb,OAAO,GARPE,EAAW5L,EAASzd,IAAKhE,KAAM6nB,KAE9B7nB,KAAKuP,iBAAkBsY,EAAcqF,GAEtCzL,EAASJ,IAAKrhB,KAAM6nB,GAAgBwF,GAAY,GAAM,IAOxDpF,QAAS,WAMR,OAHAR,GAAgBznB,KAAM2B,IAGf,GAGR0nB,SAAU,WACT,IAAIgE,EAEJ,IAAKztB,EAASutB,aAWb,OAAO,GAVPE,EAAW5L,EAASzd,IAAKhE,KAAM6nB,GAAiB,GAK/CpG,EAASJ,IAAKrhB,KAAM6nB,EAAcwF,IAHlCrtB,KAAK4f,oBAAqBiI,EAAcqF,GACxCzL,EAASlF,OAAQvc,KAAM6nB,KAa1BlC,SAAU,SAAU4B,GACnB,OAAO9F,EAASzd,IAAKujB,EAAM3hB,OAAQjE,IAGpCkmB,aAAcA,GAef5kB,GAAOskB,MAAMxJ,QAAS8J,GAAiB,CACtCqB,MAAO,WAIN,IAAIhnB,EAAMlC,KAAKwH,eAAiBxH,KAAKJ,UAAYI,KAChDstB,EAAa1tB,EAASutB,aAAentB,KAAOkC,EAC5CmrB,EAAW5L,EAASzd,IAAKspB,EAAYzF,GAMhCwF,IACAztB,EAASutB,aACbntB,KAAKuP,iBAAkBsY,EAAcqF,GAErChrB,EAAIqN,iBAAkB5N,EAAMurB,GAAoB,IAGlDzL,EAASJ,IAAKiM,EAAYzF,GAAgBwF,GAAY,GAAM,IAE7DhE,SAAU,WACT,IAAInnB,EAAMlC,KAAKwH,eAAiBxH,KAAKJ,UAAYI,KAChDstB,EAAa1tB,EAASutB,aAAentB,KAAOkC,EAC5CmrB,EAAW5L,EAASzd,IAAKspB,EAAYzF,GAAiB,EAEjDwF,EAQL5L,EAASJ,IAAKiM,EAAYzF,EAAcwF,IAPnCztB,EAASutB,aACbntB,KAAK4f,oBAAqBiI,EAAcqF,GAExChrB,EAAI0d,oBAAqBje,EAAMurB,GAAoB,GAEpDzL,EAASlF,OAAQ+Q,EAAYzF,QAgBjC5kB,GAAOsB,KAAM,CACZgpB,WAAY,YACZC,WAAY,WACZC,aAAc,cACdC,aAAc,cACZ,SAAUC,EAAMlE,GAClBxmB,GAAOskB,MAAMxJ,QAAS4P,GAAS,CAC9B9F,aAAc4B,EACdT,SAAUS,EAEVZ,OAAQ,SAAUtB,GACjB,IAAInjB,EAEHwpB,EAAUrG,EAAMyD,cAChBzC,EAAYhB,EAAMgB,UASnB,OALMqF,IAAaA,IANT5tB,MAMgCiD,GAAOwF,SANvCzI,KAMyD4tB,MAClErG,EAAM5lB,KAAO4mB,EAAUG,SACvBtkB,EAAMmkB,EAAUzK,QAAQnd,MAAOX,KAAM0E,WACrC6iB,EAAM5lB,KAAO8nB,GAEPrlB,MAKVnB,GAAOG,GAAGmC,OAAQ,CAEjB4hB,GAAI,SAAUC,EAAOlkB,EAAUoe,EAAMle,GACpC,OAAO+jB,GAAInnB,KAAMonB,EAAOlkB,EAAUoe,EAAMle,IAEzCikB,IAAK,SAAUD,EAAOlkB,EAAUoe,EAAMle,GACrC,OAAO+jB,GAAInnB,KAAMonB,EAAOlkB,EAAUoe,EAAMle,EAAI,IAE7CokB,IAAK,SAAUJ,EAAOlkB,EAAUE,GAC/B,IAAImlB,EAAW5mB,EACf,GAAKylB,GAASA,EAAMY,gBAAkBZ,EAAMmB,UAW3C,OARAA,EAAYnB,EAAMmB,UAClBtlB,GAAQmkB,EAAMsC,gBAAiBlC,IAC9Be,EAAUlhB,UACTkhB,EAAUG,SAAW,IAAMH,EAAUlhB,UACrCkhB,EAAUG,SACXH,EAAUrlB,SACVqlB,EAAUzK,SAEJ9d,KAER,GAAsB,iBAAVonB,EAAqB,CAGhC,IAAMzlB,KAAQylB,EACbpnB,KAAKwnB,IAAK7lB,EAAMuB,EAAUkkB,EAAOzlB,IAElC,OAAO3B,KAWR,OATkB,IAAbkD,GAA0C,mBAAbA,IAGjCE,EAAKF,EACLA,OAAW+C,IAEA,IAAP7C,IACJA,EAAK8jB,IAEClnB,KAAKuE,KAAM,WACjBtB,GAAOskB,MAAMhL,OAAQvc,KAAMonB,EAAOhkB,EAAIF,QAMzC,IAKC2qB,GAAe,wBAGfC,GAAW,oCAEXC,GAAe,6BAGhB,SAASC,GAAoBvqB,EAAMiX,GAClC,OAAKlX,GAAUC,EAAM,UACpBD,GAA+B,KAArBkX,EAAQnZ,SAAkBmZ,EAAUA,EAAQhI,WAAY,OAE3DzP,GAAQQ,GAAO+V,SAAU,SAAW,IAGrC/V,EAIR,SAASwqB,GAAexqB,GAEvB,OADAA,EAAK9B,MAAyC,OAAhC8B,EAAKjB,aAAc,SAAsB,IAAMiB,EAAK9B,KAC3D8B,EAER,SAASyqB,GAAezqB,GAOvB,MAN2C,WAApCA,EAAK9B,MAAQ,IAAKrB,MAAO,EAAG,GAClCmD,EAAK9B,KAAO8B,EAAK9B,KAAKrB,MAAO,GAE7BmD,EAAKwK,gBAAiB,QAGhBxK,EAGR,SAAS0qB,GAAgBvsB,EAAKwsB,GAC7B,IAAIjsB,EAAG2X,EAAGnY,EAAgB0sB,EAAUC,EAAUjG,EAE9C,GAAuB,IAAlB+F,EAAK7sB,SAAV,CAKA,GAAKkgB,EAASD,QAAS5f,KAEtBymB,EADW5G,EAASzd,IAAKpC,GACPymB,QAKjB,IAAM1mB,KAFN8f,EAASlF,OAAQ6R,EAAM,iBAET/F,EACb,IAAMlmB,EAAI,EAAG2X,EAAIuO,EAAQ1mB,GAAO4B,OAAQpB,EAAI2X,EAAG3X,IAC9Cc,GAAOskB,MAAMrN,IAAKkU,EAAMzsB,EAAM0mB,EAAQ1mB,GAAQQ,IAO7Cuf,EAASF,QAAS5f,KACtBysB,EAAW3M,EAASzB,OAAQre,GAC5B0sB,EAAWrrB,GAAOsC,OAAQ,GAAI8oB,GAE9B3M,EAASL,IAAK+M,EAAME,KAkBtB,SAASC,GAAUC,EAAY3b,EAAMrO,EAAUiiB,GAG9C5T,EAAOtS,EAAMsS,GAEb,IAAI+T,EAAUjiB,EAAO4hB,EAASkI,EAAYxsB,EAAMC,EAC/CC,EAAI,EACJ2X,EAAI0U,EAAWjrB,OACfmrB,EAAW5U,EAAI,EACf/R,EAAQ8K,EAAM,GACd8b,EAAkBttB,EAAY0G,GAG/B,GAAK4mB,GACG,EAAJ7U,GAA0B,iBAAV/R,IAChB3G,GAAQ6jB,YAAc6I,GAASrmB,KAAMM,GACxC,OAAOymB,EAAWjqB,KAAM,SAAUyV,GACjC,IAAId,EAAOsV,EAAW5pB,GAAIoV,GACrB2U,IACJ9b,EAAM,GAAM9K,EAAMtH,KAAMT,KAAMga,EAAOd,EAAK0V,SAE3CL,GAAUrV,EAAMrG,EAAMrO,EAAUiiB,KAIlC,GAAK3M,IAEJnV,GADAiiB,EAAWN,GAAezT,EAAM2b,EAAY,GAAIhnB,eAAe,EAAOgnB,EAAY/H,IACjE/T,WAEmB,IAA/BkU,EAASla,WAAWnJ,SACxBqjB,EAAWjiB,GAIPA,GAAS8hB,GAAU,CAOvB,IALAgI,GADAlI,EAAUtjB,GAAOwB,IAAKmhB,GAAQgB,EAAU,UAAYqH,KAC/B1qB,OAKbpB,EAAI2X,EAAG3X,IACdF,EAAO2kB,EAEFzkB,IAAMusB,IACVzsB,EAAOgB,GAAO0C,MAAO1D,GAAM,GAAM,GAG5BwsB,GAIJxrB,GAAOoB,MAAOkiB,EAASX,GAAQ3jB,EAAM,YAIvCuC,EAAS/D,KAAM+tB,EAAYrsB,GAAKF,EAAME,GAGvC,GAAKssB,EAOJ,IANAvsB,EAAMqkB,EAASA,EAAQhjB,OAAS,GAAIiE,cAGpCvE,GAAOwB,IAAK8hB,EAAS2H,IAGf/rB,EAAI,EAAGA,EAAIssB,EAAYtsB,IAC5BF,EAAOskB,EAASpkB,GACX4iB,GAAYtd,KAAMxF,EAAKN,MAAQ,MAClC8f,EAASxB,OAAQhe,EAAM,eACxBgB,GAAOwF,SAAUvG,EAAKD,KAEjBA,EAAKL,KAA8C,YAArCK,EAAKN,MAAQ,IAAKgC,cAG/BV,GAAO4rB,WAAa5sB,EAAKH,UAC7BmB,GAAO4rB,SAAU5sB,EAAKL,IAAK,CAC1BC,MAAOI,EAAKJ,OAASI,EAAKO,aAAc,UACtCN,GASJH,EAASE,EAAK6E,YAAYT,QAAS0nB,GAAc,IAAM9rB,EAAMC,IAQnE,OAAOssB,EAGR,SAASjS,GAAQ9Y,EAAMP,EAAU4rB,GAKhC,IAJA,IAAI7sB,EACH4kB,EAAQ3jB,EAAWD,GAAO4M,OAAQ3M,EAAUO,GAASA,EACrDtB,EAAI,EAE4B,OAAvBF,EAAO4kB,EAAO1kB,IAAeA,IAChC2sB,GAA8B,IAAlB7sB,EAAKV,UACtB0B,GAAO8rB,UAAWnJ,GAAQ3jB,IAGtBA,EAAKW,aACJksB,GAAY3L,EAAYlhB,IAC5B4jB,GAAeD,GAAQ3jB,EAAM,WAE9BA,EAAKW,WAAWC,YAAaZ,IAI/B,OAAOwB,EAGRR,GAAOsC,OAAQ,CACduhB,cAAe,SAAU8H,GACxB,OAAOA,GAGRjpB,MAAO,SAAUlC,EAAMurB,EAAeC,GACrC,IAAI9sB,EAAG2X,EAAGoV,EAAaC,EA1INvtB,EAAKwsB,EACnB5qB,EA0IFmC,EAAQlC,EAAKyhB,WAAW,GACxBkK,EAASjM,EAAY1f,GAGtB,KAAMrC,GAAQ+jB,gBAAsC,IAAlB1hB,EAAKlC,UAAoC,KAAlBkC,EAAKlC,UAC3D0B,GAAOmE,SAAU3D,IAOnB,IAHA0rB,EAAevJ,GAAQjgB,GAGjBxD,EAAI,EAAG2X,GAFboV,EAActJ,GAAQniB,IAEOF,OAAQpB,EAAI2X,EAAG3X,IAvJ5BP,EAwJLstB,EAAa/sB,GAxJHisB,EAwJQe,EAAchtB,QAvJzCqB,EAGc,WAHdA,EAAW4qB,EAAK5qB,SAASG,gBAGAkhB,GAAepd,KAAM7F,EAAID,MACrDysB,EAAKja,QAAUvS,EAAIuS,QAGK,UAAb3Q,GAAqC,aAAbA,IACnC4qB,EAAKhJ,aAAexjB,EAAIwjB,cAoJxB,GAAK4J,EACJ,GAAKC,EAIJ,IAHAC,EAAcA,GAAetJ,GAAQniB,GACrC0rB,EAAeA,GAAgBvJ,GAAQjgB,GAEjCxD,EAAI,EAAG2X,EAAIoV,EAAY3rB,OAAQpB,EAAI2X,EAAG3X,IAC3CgsB,GAAgBe,EAAa/sB,GAAKgtB,EAAchtB,SAGjDgsB,GAAgB1qB,EAAMkC,GAWxB,OAL2B,GAD3BwpB,EAAevJ,GAAQjgB,EAAO,WACZpC,QACjBsiB,GAAesJ,GAAeC,GAAUxJ,GAAQniB,EAAM,WAIhDkC,GAGRopB,UAAW,SAAU5qB,GAKpB,IAJA,IAAImd,EAAM7d,EAAM9B,EACfoc,EAAU9a,GAAOskB,MAAMxJ,QACvB5b,EAAI,OAE6B8D,KAAxBxC,EAAOU,EAAOhC,IAAqBA,IAC5C,GAAK4e,EAAYtd,GAAS,CACzB,GAAO6d,EAAO7d,EAAMge,EAASvb,SAAc,CAC1C,GAAKob,EAAK+G,OACT,IAAM1mB,KAAQ2f,EAAK+G,OACbtK,EAASpc,GACbsB,GAAOskB,MAAMhL,OAAQ9Y,EAAM9B,GAI3BsB,GAAOqmB,YAAa7lB,EAAM9B,EAAM2f,EAAKuH,QAOxCplB,EAAMge,EAASvb,cAAYD,EAEvBxC,EAAMie,EAASxb,WAInBzC,EAAMie,EAASxb,cAAYD,OAOhChD,GAAOG,GAAGmC,OAAQ,CACjB8pB,OAAQ,SAAUnsB,GACjB,OAAOqZ,GAAQvc,KAAMkD,GAAU,IAGhCqZ,OAAQ,SAAUrZ,GACjB,OAAOqZ,GAAQvc,KAAMkD,IAGtBX,KAAM,SAAUwF,GACf,OAAOkY,EAAQjgB,KAAM,SAAU+H,GAC9B,YAAiB9B,IAAV8B,EACN9E,GAAOV,KAAMvC,MACbA,KAAKsU,QAAQ/P,KAAM,WACK,IAAlBvE,KAAKuB,UAAoC,KAAlBvB,KAAKuB,UAAqC,IAAlBvB,KAAKuB,WACxDvB,KAAK8G,YAAciB,MAGpB,KAAMA,EAAOrD,UAAUnB,SAG3B+rB,OAAQ,WACP,OAAOf,GAAUvuB,KAAM0E,UAAW,SAAUjB,GACpB,IAAlBzD,KAAKuB,UAAoC,KAAlBvB,KAAKuB,UAAqC,IAAlBvB,KAAKuB,UAC3CysB,GAAoBhuB,KAAMyD,GAChCd,YAAac,MAKvB8rB,QAAS,WACR,OAAOhB,GAAUvuB,KAAM0E,UAAW,SAAUjB,GAC3C,GAAuB,IAAlBzD,KAAKuB,UAAoC,KAAlBvB,KAAKuB,UAAqC,IAAlBvB,KAAKuB,SAAiB,CACzE,IAAIqE,EAASooB,GAAoBhuB,KAAMyD,GACvCmC,EAAO4pB,aAAc/rB,EAAMmC,EAAO8M,gBAKrC+c,OAAQ,WACP,OAAOlB,GAAUvuB,KAAM0E,UAAW,SAAUjB,GACtCzD,KAAK4C,YACT5C,KAAK4C,WAAW4sB,aAAc/rB,EAAMzD,SAKvC0vB,MAAO,WACN,OAAOnB,GAAUvuB,KAAM0E,UAAW,SAAUjB,GACtCzD,KAAK4C,YACT5C,KAAK4C,WAAW4sB,aAAc/rB,EAAMzD,KAAKuU,gBAK5CD,MAAO,WAIN,IAHA,IAAI7Q,EACHtB,EAAI,EAE2B,OAAtBsB,EAAOzD,KAAMmC,IAAeA,IACd,IAAlBsB,EAAKlC,WAGT0B,GAAO8rB,UAAWnJ,GAAQniB,GAAM,IAGhCA,EAAKqD,YAAc,IAIrB,OAAO9G,MAGR2F,MAAO,SAAUqpB,EAAeC,GAI/B,OAHAD,EAAiC,MAAjBA,GAAgCA,EAChDC,EAAyC,MAArBA,EAA4BD,EAAgBC,EAEzDjvB,KAAKyE,IAAK,WAChB,OAAOxB,GAAO0C,MAAO3F,KAAMgvB,EAAeC,MAI5CL,KAAM,SAAU7mB,GACf,OAAOkY,EAAQjgB,KAAM,SAAU+H,GAC9B,IAAItE,EAAOzD,KAAM,IAAO,GACvBmC,EAAI,EACJ2X,EAAI9Z,KAAKuD,OAEV,QAAe0C,IAAV8B,GAAyC,IAAlBtE,EAAKlC,SAChC,OAAOkC,EAAK0M,UAIb,GAAsB,iBAAVpI,IAAuB8lB,GAAapmB,KAAMM,KACpDud,IAAWR,GAASzX,KAAMtF,IAAW,CAAE,GAAI,KAAQ,GAAIpE,eAAkB,CAE1EoE,EAAQ9E,GAAO6jB,cAAe/e,GAE9B,IACC,KAAQ5F,EAAI2X,EAAG3X,IAIS,KAHvBsB,EAAOzD,KAAMmC,IAAO,IAGVZ,WACT0B,GAAO8rB,UAAWnJ,GAAQniB,GAAM,IAChCA,EAAK0M,UAAYpI,GAInBtE,EAAO,EAGN,MAAQkJ,KAGNlJ,GACJzD,KAAKsU,QAAQgb,OAAQvnB,IAEpB,KAAMA,EAAOrD,UAAUnB,SAG3BosB,YAAa,WACZ,IAAIlJ,EAAU,GAGd,OAAO8H,GAAUvuB,KAAM0E,UAAW,SAAUjB,GAC3C,IAAI8O,EAASvS,KAAK4C,WAEbK,GAAOkE,QAASnH,KAAMymB,GAAY,IACtCxjB,GAAO8rB,UAAWnJ,GAAQ5lB,OACrBuS,GACJA,EAAOqd,aAAcnsB,EAAMzD,QAK3BymB,MAILxjB,GAAOsB,KAAM,CACZsrB,SAAU,SACVC,UAAW,UACXN,aAAc,SACdO,YAAa,QACbC,WAAY,eACV,SAAUtsB,EAAMusB,GAClBhtB,GAAOG,GAAIM,GAAS,SAAUR,GAO7B,IANA,IAAIiB,EACHC,EAAM,GACN8rB,EAASjtB,GAAQC,GACjB2B,EAAOqrB,EAAO3sB,OAAS,EACvBpB,EAAI,EAEGA,GAAK0C,EAAM1C,IAClBgC,EAAQhC,IAAM0C,EAAO7E,KAAOA,KAAK2F,OAAO,GACxC1C,GAAQitB,EAAQ/tB,IAAO8tB,GAAY9rB,GAInCvD,EAAKD,MAAOyD,EAAKD,EAAMH,OAGxB,OAAOhE,KAAKkE,UAAWE,MAGzB,IAAI+rB,GAAY,IAAI3nB,OAAQ,KAAOua,EAAO,kBAAmB,KAEzDqN,GAAc,MAGdC,GAAY,SAAU5sB,GAKxB,IAAIuoB,EAAOvoB,EAAK+D,cAAc6H,YAM9B,OAJM2c,GAASA,EAAKsE,SACnBtE,EAAOjsB,IAGDisB,EAAKuE,iBAAkB9sB,IAG5B+sB,GAAO,SAAU/sB,EAAM+B,EAAShB,GACnC,IAAIJ,EAAKV,EACR+sB,EAAM,GAGP,IAAM/sB,KAAQ8B,EACbirB,EAAK/sB,GAASD,EAAK8f,MAAO7f,GAC1BD,EAAK8f,MAAO7f,GAAS8B,EAAS9B,GAM/B,IAAMA,KAHNU,EAAMI,EAAS/D,KAAMgD,GAGP+B,EACb/B,EAAK8f,MAAO7f,GAAS+sB,EAAK/sB,GAG3B,OAAOU,GAIJssB,GAAY,IAAIloB,OAAQ0a,EAAUpV,KAAM,KAAO,KAiJnD,SAAS6iB,GAAQltB,EAAMC,EAAMktB,GAC5B,IAAIC,EAAOC,EAAUC,EAAU3sB,EAC9B4sB,EAAeZ,GAAY3oB,KAAM/D,GAMjC6f,EAAQ9f,EAAK8f,MAoEd,OAlEAqN,EAAWA,GAAYP,GAAW5sB,MAgBjCW,EAAMwsB,EAASK,iBAAkBvtB,IAAUktB,EAAUltB,GAEhDstB,GAAgB5sB,IAkBpBA,EAAMA,EAAIiC,QAASkC,GAAU,YAAUtC,GAG3B,KAAR7B,GAAe+e,EAAY1f,KAC/BW,EAAMnB,GAAOsgB,MAAO9f,EAAMC,KAQrBtC,GAAQ8vB,kBAAoBf,GAAU1oB,KAAMrD,IAASssB,GAAUjpB,KAAM/D,KAG1EmtB,EAAQtN,EAAMsN,MACdC,EAAWvN,EAAMuN,SACjBC,EAAWxN,EAAMwN,SAGjBxN,EAAMuN,SAAWvN,EAAMwN,SAAWxN,EAAMsN,MAAQzsB,EAChDA,EAAMwsB,EAASC,MAGftN,EAAMsN,MAAQA,EACdtN,EAAMuN,SAAWA,EACjBvN,EAAMwN,SAAWA,SAIJ9qB,IAAR7B,EAINA,EAAM,GACNA,EAIF,SAAS+sB,GAAcC,EAAaC,GAGnC,MAAO,CACNrtB,IAAK,WACJ,IAAKotB,IASL,OAASpxB,KAAKgE,IAAMqtB,GAAS1wB,MAAOX,KAAM0E,kBALlC1E,KAAKgE,OA3OhB,WAIC,SAASstB,IAGR,GAAM1M,EAAN,CAIA2M,EAAUhO,MAAMiO,QAAU,+EAE1B5M,EAAIrB,MAAMiO,QACT,4HAGDzqB,EAAgBpE,YAAa4uB,GAAY5uB,YAAaiiB,GAEtD,IAAI6M,EAAW1xB,GAAOwwB,iBAAkB3L,GACxC8M,EAAoC,OAAjBD,EAASniB,IAG5BqiB,EAAsE,KAA9CC,EAAoBH,EAASI,YAIrDjN,EAAIrB,MAAMuO,MAAQ,MAClBC,EAA6D,KAAzCH,EAAoBH,EAASK,OAIjDE,EAAgE,KAAzCJ,EAAoBH,EAASZ,OAMpDjM,EAAIrB,MAAM0O,SAAW,WACrBC,EAAiE,KAA9CN,EAAoBhN,EAAIuN,YAAc,GAEzDprB,EAAgBlE,YAAa0uB,GAI7B3M,EAAM,MAGP,SAASgN,EAAoBQ,GAC5B,OAAOjsB,KAAKksB,MAAOC,WAAYF,IAGhC,IAAIV,EAAkBM,EAAsBE,EAAkBH,EAC7DQ,EAAyBZ,EACzBJ,EAAY3xB,EAAS0C,cAAe,OACpCsiB,EAAMhlB,EAAS0C,cAAe,OAGzBsiB,EAAIrB,QAMVqB,EAAIrB,MAAMiP,eAAiB,cAC3B5N,EAAIM,WAAW,GAAO3B,MAAMiP,eAAiB,GAC7CpxB,GAAQqxB,gBAA+C,gBAA7B7N,EAAIrB,MAAMiP,eAEpCvvB,GAAOsC,OAAQnE,GAAS,CACvBsxB,kBAAmB,WAElB,OADApB,IACOU,GAERd,eAAgB,WAEf,OADAI,IACOS,GAERY,cAAe,WAEd,OADArB,IACOI,GAERkB,mBAAoB,WAEnB,OADAtB,IACOK,GAERkB,cAAe,WAEd,OADAvB,IACOY,GAYRY,qBAAsB,WACrB,IAAIC,EAAOtN,EAAIuN,EAASC,EAmCxB,OAlCgC,MAA3BV,IACJQ,EAAQnzB,EAAS0C,cAAe,SAChCmjB,EAAK7lB,EAAS0C,cAAe,MAC7B0wB,EAAUpzB,EAAS0C,cAAe,OAElCywB,EAAMxP,MAAMiO,QAAU,2DACtB/L,EAAGlC,MAAMiO,QAAU,0CAKnB/L,EAAGlC,MAAM2P,OAAS,MAClBF,EAAQzP,MAAM2P,OAAS,MAQvBF,EAAQzP,MAAMC,QAAU,QAExBzc,EACEpE,YAAaowB,GACbpwB,YAAa8iB,GACb9iB,YAAaqwB,GAEfC,EAAUlzB,GAAOwwB,iBAAkB9K,GACnC8M,EAA4BY,SAAUF,EAAQC,OAAQ,IACrDC,SAAUF,EAAQG,eAAgB,IAClCD,SAAUF,EAAQI,kBAAmB,MAAW5N,EAAG6N,aAEpDvsB,EAAgBlE,YAAakwB,IAEvBR,MAvIV,GAsPA,IAAIgB,GAAc,CAAE,SAAU,MAAO,MACpCC,GAAa5zB,EAAS0C,cAAe,OAAQihB,MAC7CkQ,GAAc,GAkBf,SAASC,GAAehwB,GACvB,IAAIiwB,EAAQ1wB,GAAO2wB,SAAUlwB,IAAU+vB,GAAa/vB,GAEpD,OAAKiwB,IAGAjwB,KAAQ8vB,GACL9vB,EAED+vB,GAAa/vB,GAxBrB,SAAyBA,GAGxB,IAAImwB,EAAUnwB,EAAM,GAAIkd,cAAgBld,EAAKpD,MAAO,GACnD6B,EAAIoxB,GAAYhwB,OAEjB,MAAQpB,IAEP,IADAuB,EAAO6vB,GAAapxB,GAAM0xB,KACbL,GACZ,OAAO9vB,EAeoBowB,CAAgBpwB,IAAUA,GAIxD,IAKCqwB,GAAe,4BACfC,GAAU,CAAE/B,SAAU,WAAYgC,WAAY,SAAUzQ,QAAS,SACjE0Q,GAAqB,CACpBC,cAAe,IACfC,WAAY,OAGd,SAASC,GAAmBrvB,EAAO+C,EAAOusB,GAIzC,IAAI1sB,EAAUqb,EAAQ5V,KAAMtF,GAC5B,OAAOH,EAGNzB,KAAKouB,IAAK,EAAG3sB,EAAS,IAAQ0sB,GAAY,KAAU1sB,EAAS,IAAO,MACpEG,EAGF,SAASysB,GAAoB/wB,EAAMgxB,EAAWC,EAAKC,EAAaC,EAAQC,GACvE,IAAI1yB,EAAkB,UAAdsyB,EAAwB,EAAI,EACnCK,EAAQ,EACRC,EAAQ,EACRC,EAAc,EAGf,GAAKN,KAAUC,EAAc,SAAW,WACvC,OAAO,EAGR,KAAQxyB,EAAI,EAAGA,GAAK,EAKN,WAARuyB,IACJM,GAAe/xB,GAAOwgB,IAAKhgB,EAAMixB,EAAMxR,EAAW/gB,IAAK,EAAMyyB,IAIxDD,GAmBQ,YAARD,IACJK,GAAS9xB,GAAOwgB,IAAKhgB,EAAM,UAAYyf,EAAW/gB,IAAK,EAAMyyB,IAIjD,WAARF,IACJK,GAAS9xB,GAAOwgB,IAAKhgB,EAAM,SAAWyf,EAAW/gB,GAAM,SAAS,EAAMyyB,MAtBvEG,GAAS9xB,GAAOwgB,IAAKhgB,EAAM,UAAYyf,EAAW/gB,IAAK,EAAMyyB,GAGhD,YAARF,EACJK,GAAS9xB,GAAOwgB,IAAKhgB,EAAM,SAAWyf,EAAW/gB,GAAM,SAAS,EAAMyyB,GAItEE,GAAS7xB,GAAOwgB,IAAKhgB,EAAM,SAAWyf,EAAW/gB,GAAM,SAAS,EAAMyyB,IAoCzE,OAhBMD,GAA8B,GAAfE,IAIpBE,GAAS5uB,KAAKouB,IAAK,EAAGpuB,KAAK8uB,KAC1BxxB,EAAM,SAAWgxB,EAAW,GAAI7T,cAAgB6T,EAAUn0B,MAAO,IACjEu0B,EACAE,EACAD,EACA,MAIM,GAGDC,EAAQC,EAGhB,SAASE,GAAkBzxB,EAAMgxB,EAAWK,GAG3C,IAAIF,EAASvE,GAAW5sB,GAKvBkxB,IADmBvzB,GAAQsxB,qBAAuBoC,IAEE,eAAnD7xB,GAAOwgB,IAAKhgB,EAAM,aAAa,EAAOmxB,GACvCO,EAAmBR,EAEnBvyB,EAAMuuB,GAAQltB,EAAMgxB,EAAWG,GAC/BQ,EAAa,SAAWX,EAAW,GAAI7T,cAAgB6T,EAAUn0B,MAAO,GAIzE,GAAK6vB,GAAU1oB,KAAMrF,GAAQ,CAC5B,IAAM0yB,EACL,OAAO1yB,EAERA,EAAM,OAyCP,QAlCQhB,GAAQsxB,qBAAuBiC,IAMrCvzB,GAAQ0xB,wBAA0BtvB,GAAUC,EAAM,OAI3C,SAARrB,IAICkwB,WAAYlwB,IAA0D,WAAjDa,GAAOwgB,IAAKhgB,EAAM,WAAW,EAAOmxB,KAG1DnxB,EAAK4xB,iBAAiB9xB,SAEtBoxB,EAAiE,eAAnD1xB,GAAOwgB,IAAKhgB,EAAM,aAAa,EAAOmxB,IAKpDO,EAAmBC,KAAc3xB,KAEhCrB,EAAMqB,EAAM2xB,MAKdhzB,EAAMkwB,WAAYlwB,IAAS,GAI1BoyB,GACC/wB,EACAgxB,EACAK,IAAWH,EAAc,SAAW,WACpCQ,EACAP,EAGAxyB,GAEE,KAwTL,SAASkzB,GAAO7xB,EAAM+B,EAAS+b,EAAMnc,EAAKmwB,GACzC,OAAO,IAAID,GAAM1xB,UAAUP,KAAMI,EAAM+B,EAAS+b,EAAMnc,EAAKmwB,GAtT5DtyB,GAAOsC,OAAQ,CAIdiwB,SAAU,CACTC,QAAS,CACRzxB,IAAK,SAAUP,EAAMmtB,GACpB,GAAKA,EAAW,CAGf,IAAIxsB,EAAMusB,GAAQltB,EAAM,WACxB,MAAe,KAARW,EAAa,IAAMA,MAO9B+f,UAAW,CACVuR,yBAAyB,EACzBC,aAAa,EACbC,kBAAkB,EAClBC,aAAa,EACbC,UAAU,EACVC,YAAY,EACZ3B,YAAY,EACZ4B,UAAU,EACVC,YAAY,EACZC,eAAe,EACfC,iBAAiB,EACjBC,SAAS,EACTC,YAAY,EACZC,cAAc,EACdC,YAAY,EACZd,SAAS,EACTe,OAAO,EACPC,SAAS,EACT3S,OAAO,EACP4S,QAAQ,EACRC,QAAQ,EACRC,MAAM,EAGNC,aAAa,EACbC,cAAc,EACdC,aAAa,EACbC,kBAAkB,EAClBC,eAAe,GAKhBrD,SAAU,GAGVrQ,MAAO,SAAU9f,EAAMC,EAAMqE,EAAO+sB,GAGnC,GAAMrxB,GAA0B,IAAlBA,EAAKlC,UAAoC,IAAlBkC,EAAKlC,UAAmBkC,EAAK8f,MAAlE,CAKA,IAAInf,EAAKzC,EAAM2gB,EACd4U,EAAWrW,EAAWnd,GACtBstB,EAAeZ,GAAY3oB,KAAM/D,GACjC6f,EAAQ9f,EAAK8f,MAad,GARMyN,IACLttB,EAAOgwB,GAAewD,IAIvB5U,EAAQrf,GAAOuyB,SAAU9xB,IAAUT,GAAOuyB,SAAU0B,QAGrCjxB,IAAV8B,EA0CJ,OAAKua,GAAS,QAASA,QACwBrc,KAA5C7B,EAAMke,EAAMte,IAAKP,GAAM,EAAOqxB,IAEzB1wB,EAIDmf,EAAO7f,GA7CA,YAHd/B,SAAcoG,KAGc3D,EAAM6e,EAAQ5V,KAAMtF,KAAa3D,EAAK,KACjE2D,EAAQ2b,GAAWjgB,EAAMC,EAAMU,GAG/BzC,EAAO,UAIM,MAAToG,GAAiBA,GAAUA,IAOlB,WAATpG,GAAsBqvB,IAC1BjpB,GAAS3D,GAAOA,EAAK,KAASnB,GAAOkhB,UAAW+S,GAAa,GAAK,OAI7D91B,GAAQqxB,iBAA6B,KAAV1qB,GAAiD,IAAjCrE,EAAK7C,QAAS,gBAC9D0iB,EAAO7f,GAAS,WAIX4e,GAAY,QAASA,QACsBrc,KAA9C8B,EAAQua,EAAMjB,IAAK5d,EAAMsE,EAAO+sB,MAE7B9D,EACJzN,EAAM4T,YAAazzB,EAAMqE,GAEzBwb,EAAO7f,GAASqE,MAkBpB0b,IAAK,SAAUhgB,EAAMC,EAAMoxB,EAAOF,GACjC,IAAIxyB,EAAK6B,EAAKqe,EACb4U,EAAWrW,EAAWnd,GA6BvB,OA5BgB0sB,GAAY3oB,KAAM/D,KAMjCA,EAAOgwB,GAAewD,KAIvB5U,EAAQrf,GAAOuyB,SAAU9xB,IAAUT,GAAOuyB,SAAU0B,KAGtC,QAAS5U,IACtBlgB,EAAMkgB,EAAMte,IAAKP,GAAM,EAAMqxB,SAIjB7uB,IAAR7D,IACJA,EAAMuuB,GAAQltB,EAAMC,EAAMkxB,IAId,WAARxyB,GAAoBsB,KAAQwwB,KAChC9xB,EAAM8xB,GAAoBxwB,IAIZ,KAAVoxB,GAAgBA,GACpB7wB,EAAMquB,WAAYlwB,IACD,IAAV0yB,GAAkBsC,SAAUnzB,GAAQA,GAAO,EAAI7B,GAGhDA,KAITa,GAAOsB,KAAM,CAAE,SAAU,SAAW,SAAU6D,EAAIqsB,GACjDxxB,GAAOuyB,SAAUf,GAAc,CAC9BzwB,IAAK,SAAUP,EAAMmtB,EAAUkE,GAC9B,GAAKlE,EAIJ,OAAOmD,GAAatsB,KAAMxE,GAAOwgB,IAAKhgB,EAAM,aAQxCA,EAAK4xB,iBAAiB9xB,QAAWE,EAAK4zB,wBAAwBxG,MAIjEqE,GAAkBzxB,EAAMgxB,EAAWK,GAHnCtE,GAAM/sB,EAAMuwB,GAAS,WACpB,OAAOkB,GAAkBzxB,EAAMgxB,EAAWK,MAM9CzT,IAAK,SAAU5d,EAAMsE,EAAO+sB,GAC3B,IAAIltB,EACHgtB,EAASvE,GAAW5sB,GAIpB6zB,GAAsBl2B,GAAQyxB,iBACT,aAApB+B,EAAO3C,SAIR0C,GADkB2C,GAAsBxC,IAEY,eAAnD7xB,GAAOwgB,IAAKhgB,EAAM,aAAa,EAAOmxB,GACvCN,EAAWQ,EACVN,GACC/wB,EACAgxB,EACAK,EACAH,EACAC,GAED,EAqBF,OAjBKD,GAAe2C,IACnBhD,GAAYnuB,KAAK8uB,KAChBxxB,EAAM,SAAWgxB,EAAW,GAAI7T,cAAgB6T,EAAUn0B,MAAO,IACjEgyB,WAAYsC,EAAQH,IACpBD,GAAoB/wB,EAAMgxB,EAAW,UAAU,EAAOG,GACtD,KAKGN,IAAc1sB,EAAUqb,EAAQ5V,KAAMtF,KACb,QAA3BH,EAAS,IAAO,QAElBnE,EAAK8f,MAAOkR,GAAc1sB,EAC1BA,EAAQ9E,GAAOwgB,IAAKhgB,EAAMgxB,IAGpBJ,GAAmB5wB,EAAMsE,EAAOusB,OAK1CrxB,GAAOuyB,SAAS3D,WAAaV,GAAc/vB,GAAQwxB,mBAClD,SAAUnvB,EAAMmtB,GACf,GAAKA,EACJ,OAAS0B,WAAY3B,GAAQltB,EAAM,gBAClCA,EAAK4zB,wBAAwBE,KAC5B/G,GAAM/sB,EAAM,CAAEouB,WAAY,GAAK,WAC9B,OAAOpuB,EAAK4zB,wBAAwBE,QAEnC,OAMPt0B,GAAOsB,KAAM,CACZizB,OAAQ,GACRC,QAAS,GACTC,OAAQ,SACN,SAAUC,EAAQC,GACpB30B,GAAOuyB,SAAUmC,EAASC,GAAW,CACpCC,OAAQ,SAAU9vB,GAOjB,IANA,IAAI5F,EAAI,EACP21B,EAAW,GAGXC,EAAyB,iBAAVhwB,EAAqBA,EAAMI,MAAO,KAAQ,CAAEJ,GAEpD5F,EAAI,EAAGA,IACd21B,EAAUH,EAASzU,EAAW/gB,GAAMy1B,GACnCG,EAAO51B,IAAO41B,EAAO51B,EAAI,IAAO41B,EAAO,GAGzC,OAAOD,IAIO,WAAXH,IACJ10B,GAAOuyB,SAAUmC,EAASC,GAASvW,IAAMgT,MAI3CpxB,GAAOG,GAAGmC,OAAQ,CACjBke,IAAK,SAAU/f,EAAMqE,GACpB,OAAOkY,EAAQjgB,KAAM,SAAUyD,EAAMC,EAAMqE,GAC1C,IAAI6sB,EAAQ1vB,EACXT,EAAM,GACNtC,EAAI,EAEL,GAAK4D,MAAMC,QAAStC,GAAS,CAI5B,IAHAkxB,EAASvE,GAAW5sB,GACpByB,EAAMxB,EAAKH,OAEHpB,EAAI+C,EAAK/C,IAChBsC,EAAKf,EAAMvB,IAAQc,GAAOwgB,IAAKhgB,EAAMC,EAAMvB,IAAK,EAAOyyB,GAGxD,OAAOnwB,EAGR,YAAiBwB,IAAV8B,EACN9E,GAAOsgB,MAAO9f,EAAMC,EAAMqE,GAC1B9E,GAAOwgB,IAAKhgB,EAAMC,IACjBA,EAAMqE,EAA0B,EAAnBrD,UAAUnB,aAQ5BN,GAAOqyB,MAAQA,IAET1xB,UAAY,CACjBE,YAAawxB,GACbjyB,KAAM,SAAUI,EAAM+B,EAAS+b,EAAMnc,EAAKmwB,EAAQrR,GACjDlkB,KAAKyD,KAAOA,EACZzD,KAAKuhB,KAAOA,EACZvhB,KAAKu1B,OAASA,GAAUtyB,GAAOsyB,OAAO5P,SACtC3lB,KAAKwF,QAAUA,EACfxF,KAAKsS,MAAQtS,KAAKmrB,IAAMnrB,KAAK4Z,MAC7B5Z,KAAKoF,IAAMA,EACXpF,KAAKkkB,KAAOA,IAAUjhB,GAAOkhB,UAAW5C,GAAS,GAAK,OAEvD3H,IAAK,WACJ,IAAI0I,EAAQgT,GAAM0C,UAAWh4B,KAAKuhB,MAElC,OAAOe,GAASA,EAAMte,IACrBse,EAAMte,IAAKhE,MACXs1B,GAAM0C,UAAUrS,SAAS3hB,IAAKhE,OAEhCi4B,IAAK,SAAUC,GACd,IAAIC,EACH7V,EAAQgT,GAAM0C,UAAWh4B,KAAKuhB,MAoB/B,OAlBKvhB,KAAKwF,QAAQ4yB,SACjBp4B,KAAKq4B,IAAMF,EAAQl1B,GAAOsyB,OAAQv1B,KAAKu1B,QACtC2C,EAASl4B,KAAKwF,QAAQ4yB,SAAWF,EAAS,EAAG,EAAGl4B,KAAKwF,QAAQ4yB,UAG9Dp4B,KAAKq4B,IAAMF,EAAQD,EAEpBl4B,KAAKmrB,KAAQnrB,KAAKoF,IAAMpF,KAAKsS,OAAU6lB,EAAQn4B,KAAKsS,MAE/CtS,KAAKwF,QAAQ8yB,MACjBt4B,KAAKwF,QAAQ8yB,KAAK73B,KAAMT,KAAKyD,KAAMzD,KAAKmrB,IAAKnrB,MAGzCsiB,GAASA,EAAMjB,IACnBiB,EAAMjB,IAAKrhB,MAEXs1B,GAAM0C,UAAUrS,SAAStE,IAAKrhB,MAExBA,QAIOqD,KAAKO,UAAY0xB,GAAM1xB,WAEvC0xB,GAAM0C,UAAY,CACjBrS,SAAU,CACT3hB,IAAK,SAAU4f,GACd,IAAIhS,EAIJ,OAA6B,IAAxBgS,EAAMngB,KAAKlC,UACa,MAA5BqiB,EAAMngB,KAAMmgB,EAAMrC,OAAoD,MAAlCqC,EAAMngB,KAAK8f,MAAOK,EAAMrC,MACrDqC,EAAMngB,KAAMmgB,EAAMrC,OAO1B3P,EAAS3O,GAAOwgB,IAAKG,EAAMngB,KAAMmgB,EAAMrC,KAAM,MAGhB,SAAX3P,EAAwBA,EAAJ,GAEvCyP,IAAK,SAAUuC,GAKT3gB,GAAOs1B,GAAGD,KAAM1U,EAAMrC,MAC1Bte,GAAOs1B,GAAGD,KAAM1U,EAAMrC,MAAQqC,GACK,IAAxBA,EAAMngB,KAAKlC,WACtB0B,GAAOuyB,SAAU5R,EAAMrC,OAC6B,MAAnDqC,EAAMngB,KAAK8f,MAAOmQ,GAAe9P,EAAMrC,OAGxCqC,EAAMngB,KAAMmgB,EAAMrC,MAASqC,EAAMuH,IAFjCloB,GAAOsgB,MAAOK,EAAMngB,KAAMmgB,EAAMrC,KAAMqC,EAAMuH,IAAMvH,EAAMM,UAU5CsU,UAAYlD,GAAM0C,UAAUS,WAAa,CACxDpX,IAAK,SAAUuC,GACTA,EAAMngB,KAAKlC,UAAYqiB,EAAMngB,KAAKb,aACtCghB,EAAMngB,KAAMmgB,EAAMrC,MAASqC,EAAMuH,OAKpCloB,GAAOsyB,OAAS,CACfmD,OAAQ,SAAUC,GACjB,OAAOA,GAERC,MAAO,SAAUD,GAChB,MAAO,GAAMxyB,KAAK0yB,IAAKF,EAAIxyB,KAAK2yB,IAAO,GAExCnT,SAAU,SAGX1iB,GAAOs1B,GAAKjD,GAAM1xB,UAAUP,KAG5BJ,GAAOs1B,GAAGD,KAAO,GAKjB,IACCS,GAAOC,GAkrBH9oB,GAEH+oB,GAnrBDC,GAAW,yBACXC,GAAO,cAER,SAASC,KACHJ,MACqB,IAApBp5B,EAASy5B,QAAoBt5B,GAAOu5B,sBACxCv5B,GAAOu5B,sBAAuBF,IAE9Br5B,GAAO2e,WAAY0a,GAAUn2B,GAAOs1B,GAAGgB,UAGxCt2B,GAAOs1B,GAAGiB,QAKZ,SAASC,KAIR,OAHA15B,GAAO2e,WAAY,WAClBqa,QAAQ9yB,IAEA8yB,GAAQ7N,KAAKC,MAIvB,SAASuO,GAAO/3B,EAAMg4B,GACrB,IAAI3M,EACH7qB,EAAI,EACJggB,EAAQ,CAAE+Q,OAAQvxB,GAKnB,IADAg4B,EAAeA,EAAe,EAAI,EAC1Bx3B,EAAI,EAAGA,GAAK,EAAIw3B,EAEvBxX,EAAO,UADP6K,EAAQ9J,EAAW/gB,KACSggB,EAAO,UAAY6K,GAAUrrB,EAO1D,OAJKg4B,IACJxX,EAAMsT,QAAUtT,EAAM0O,MAAQlvB,GAGxBwgB,EAGR,SAASyX,GAAa7xB,EAAOwZ,EAAMsY,GAKlC,IAJA,IAAIjW,EACH4K,GAAesL,GAAUC,SAAUxY,IAAU,IAAK7gB,OAAQo5B,GAAUC,SAAU,MAC9E/f,EAAQ,EACRzW,EAASirB,EAAWjrB,OACbyW,EAAQzW,EAAQyW,IACvB,GAAO4J,EAAQ4K,EAAYxU,GAAQvZ,KAAMo5B,EAAWtY,EAAMxZ,GAGzD,OAAO6b,EAsNV,SAASkW,GAAWr2B,EAAMu2B,EAAYx0B,GACrC,IAAIoM,EACHqoB,EACAjgB,EAAQ,EACRzW,EAASu2B,GAAUI,WAAW32B,OAC9ByZ,EAAW/Z,GAAO0Z,WAAWI,OAAQ,kBAG7Byc,EAAK/1B,OAEb+1B,EAAO,WACN,GAAKS,EACJ,OAAO,EAYR,IAVA,IAAIE,EAAcpB,IAASU,KAC1B3a,EAAY3Y,KAAKouB,IAAK,EAAGsF,EAAUO,UAAYP,EAAUzB,SAAW+B,GAKpEjC,EAAU,GADHpZ,EAAY+a,EAAUzB,UAAY,GAEzCpe,EAAQ,EACRzW,EAASs2B,EAAUQ,OAAO92B,OAEnByW,EAAQzW,EAAQyW,IACvB6f,EAAUQ,OAAQrgB,GAAQie,IAAKC,GAMhC,OAHAlb,EAASmB,WAAY1a,EAAM,CAAEo2B,EAAW3B,EAASpZ,IAG5CoZ,EAAU,GAAK30B,EACZub,GAIFvb,GACLyZ,EAASmB,WAAY1a,EAAM,CAAEo2B,EAAW,EAAG,IAI5C7c,EAASoB,YAAa3a,EAAM,CAAEo2B,KACvB,IAERA,EAAY7c,EAAS1B,QAAS,CAC7B7X,KAAMA,EACNonB,MAAO5nB,GAAOsC,OAAQ,GAAIy0B,GAC1BM,KAAMr3B,GAAOsC,QAAQ,EAAM,CAC1Bg1B,cAAe,GACfhF,OAAQtyB,GAAOsyB,OAAO5P,UACpBngB,GACHg1B,mBAAoBR,EACpBS,gBAAiBj1B,EACjB40B,UAAWrB,IAASU,KACpBrB,SAAU5yB,EAAQ4yB,SAClBiC,OAAQ,GACRT,YAAa,SAAUrY,EAAMnc,GAC5B,IAAIwe,EAAQ3gB,GAAOqyB,MAAO7xB,EAAMo2B,EAAUS,KAAM/Y,EAAMnc,EACrDy0B,EAAUS,KAAKC,cAAehZ,IAAUsY,EAAUS,KAAK/E,QAExD,OADAsE,EAAUQ,OAAOz5B,KAAMgjB,GAChBA,GAERnB,KAAM,SAAUiY,GACf,IAAI1gB,EAAQ,EAIXzW,EAASm3B,EAAUb,EAAUQ,OAAO92B,OAAS,EAC9C,GAAK02B,EACJ,OAAOj6B,KAGR,IADAi6B,GAAU,EACFjgB,EAAQzW,EAAQyW,IACvB6f,EAAUQ,OAAQrgB,GAAQie,IAAK,GAUhC,OANKyC,GACJ1d,EAASmB,WAAY1a,EAAM,CAAEo2B,EAAW,EAAG,IAC3C7c,EAASoB,YAAa3a,EAAM,CAAEo2B,EAAWa,KAEzC1d,EAASuB,WAAY9a,EAAM,CAAEo2B,EAAWa,IAElC16B,QAGT6qB,EAAQgP,EAAUhP,MAInB,KA/HD,SAAqBA,EAAO0P,GAC3B,IAAIvgB,EAAOtW,EAAM6xB,EAAQxtB,EAAOua,EAGhC,IAAMtI,KAAS6Q,EAed,GAbA0K,EAASgF,EADT72B,EAAOmd,EAAW7G,IAElBjS,EAAQ8iB,EAAO7Q,GACVjU,MAAMC,QAAS+B,KACnBwtB,EAASxtB,EAAO,GAChBA,EAAQ8iB,EAAO7Q,GAAUjS,EAAO,IAG5BiS,IAAUtW,IACdmnB,EAAOnnB,GAASqE,SACT8iB,EAAO7Q,KAGfsI,EAAQrf,GAAOuyB,SAAU9xB,KACX,WAAY4e,EAMzB,IAAMtI,KALNjS,EAAQua,EAAMuV,OAAQ9vB,UACf8iB,EAAOnnB,GAICqE,EACNiS,KAAS6Q,IAChBA,EAAO7Q,GAAUjS,EAAOiS,GACxBugB,EAAevgB,GAAUub,QAI3BgF,EAAe72B,GAAS6xB,EA6F1BoF,CAAY9P,EAAOgP,EAAUS,KAAKC,eAE1BvgB,EAAQzW,EAAQyW,IAEvB,GADApI,EAASkoB,GAAUI,WAAYlgB,GAAQvZ,KAAMo5B,EAAWp2B,EAAMonB,EAAOgP,EAAUS,MAM9E,OAJKj5B,EAAYuQ,EAAO6Q,QACvBxf,GAAOsf,YAAasX,EAAUp2B,KAAMo2B,EAAUS,KAAKpe,OAAQuG,KAC1D7Q,EAAO6Q,KAAKmY,KAAMhpB,IAEbA,EAyBT,OArBA3O,GAAOwB,IAAKomB,EAAO+O,GAAaC,GAE3Bx4B,EAAYw4B,EAAUS,KAAKhoB,QAC/BunB,EAAUS,KAAKhoB,MAAM7R,KAAMgD,EAAMo2B,GAIlCA,EACEtc,SAAUsc,EAAUS,KAAK/c,UACzBzT,KAAM+vB,EAAUS,KAAKxwB,KAAM+vB,EAAUS,KAAKO,UAC1Ctf,KAAMse,EAAUS,KAAK/e,MACrBwB,OAAQ8c,EAAUS,KAAKvd,QAEzB9Z,GAAOs1B,GAAGuC,MACT73B,GAAOsC,OAAQi0B,EAAM,CACpB/1B,KAAMA,EACNs3B,KAAMlB,EACN3d,MAAO2d,EAAUS,KAAKpe,SAIjB2d,EAGR52B,GAAO62B,UAAY72B,GAAOsC,OAAQu0B,GAAW,CAE5CC,SAAU,CACTiB,IAAK,CAAE,SAAUzZ,EAAMxZ,GACtB,IAAI6b,EAAQ5jB,KAAK45B,YAAarY,EAAMxZ,GAEpC,OADA2b,GAAWE,EAAMngB,KAAM8d,EAAM0B,EAAQ5V,KAAMtF,GAAS6b,GAC7CA,KAITqX,QAAS,SAAUpQ,EAAOrmB,GACpBnD,EAAYwpB,IAChBrmB,EAAWqmB,EACXA,EAAQ,CAAE,MAEVA,EAAQA,EAAM5d,MAAO2N,GAOtB,IAJA,IAAI2G,EACHvH,EAAQ,EACRzW,EAASsnB,EAAMtnB,OAERyW,EAAQzW,EAAQyW,IACvBuH,EAAOsJ,EAAO7Q,GACd8f,GAAUC,SAAUxY,GAASuY,GAAUC,SAAUxY,IAAU,GAC3DuY,GAAUC,SAAUxY,GAAOiB,QAAShe,IAItC01B,WAAY,CA3Wb,SAA2Bz2B,EAAMonB,EAAOyP,GACvC,IAAI/Y,EAAMxZ,EAAO4c,EAAQrC,EAAO4Y,EAASC,EAAWC,EAAgB5X,EACnE6X,EAAQ,UAAWxQ,GAAS,WAAYA,EACxCkQ,EAAO/6B,KACP2tB,EAAO,GACPpK,EAAQ9f,EAAK8f,MACb8V,EAAS51B,EAAKlC,UAAY+hB,GAAoB7f,GAC9C63B,EAAW7Z,EAASzd,IAAKP,EAAM,UA6BhC,IAAM8d,KA1BA+Y,EAAKpe,QAEa,OADvBoG,EAAQrf,GAAOsf,YAAa9e,EAAM,OACvB83B,WACVjZ,EAAMiZ,SAAW,EACjBL,EAAU5Y,EAAMhO,MAAM8H,KACtBkG,EAAMhO,MAAM8H,KAAO,WACZkG,EAAMiZ,UACXL,MAIH5Y,EAAMiZ,WAENR,EAAKhe,OAAQ,WAGZge,EAAKhe,OAAQ,WACZuF,EAAMiZ,WACAt4B,GAAOiZ,MAAOzY,EAAM,MAAOF,QAChC+e,EAAMhO,MAAM8H,YAOFyO,EAEb,GADA9iB,EAAQ8iB,EAAOtJ,GACV2X,GAASzxB,KAAMM,GAAU,CAG7B,UAFO8iB,EAAOtJ,GACdoD,EAASA,GAAoB,WAAV5c,EACdA,KAAYsxB,EAAS,OAAS,QAAW,CAI7C,GAAe,SAAVtxB,IAAoBuzB,QAAiCr1B,IAArBq1B,EAAU/Z,GAK9C,SAJA8X,GAAS,EAOX1L,EAAMpM,GAAS+Z,GAAYA,EAAU/Z,IAAUte,GAAOsgB,MAAO9f,EAAM8d,GAMrE,IADA4Z,GAAal4B,GAAO2D,cAAeikB,MAChB5nB,GAAO2D,cAAe+mB,GA8DzC,IAAMpM,KAzDD8Z,GAA2B,IAAlB53B,EAAKlC,WAMlB+4B,EAAKkB,SAAW,CAAEjY,EAAMiY,SAAUjY,EAAMkY,UAAWlY,EAAMmY,WAIlC,OADvBN,EAAiBE,GAAYA,EAAS9X,WAErC4X,EAAiB3Z,EAASzd,IAAKP,EAAM,YAGrB,UADjB+f,EAAUvgB,GAAOwgB,IAAKhgB,EAAM,cAEtB23B,EACJ5X,EAAU4X,GAIV9W,GAAU,CAAE7gB,IAAQ,GACpB23B,EAAiB33B,EAAK8f,MAAMC,SAAW4X,EACvC5X,EAAUvgB,GAAOwgB,IAAKhgB,EAAM,WAC5B6gB,GAAU,CAAE7gB,OAKG,WAAZ+f,GAAoC,iBAAZA,GAAgD,MAAlB4X,IACrB,SAAhCn4B,GAAOwgB,IAAKhgB,EAAM,WAGhB03B,IACLJ,EAAKjxB,KAAM,WACVyZ,EAAMC,QAAU4X,IAEM,MAAlBA,IACJ5X,EAAUD,EAAMC,QAChB4X,EAA6B,SAAZ5X,EAAqB,GAAKA,IAG7CD,EAAMC,QAAU,iBAKd8W,EAAKkB,WACTjY,EAAMiY,SAAW,SACjBT,EAAKhe,OAAQ,WACZwG,EAAMiY,SAAWlB,EAAKkB,SAAU,GAChCjY,EAAMkY,UAAYnB,EAAKkB,SAAU,GACjCjY,EAAMmY,UAAYpB,EAAKkB,SAAU,MAKnCL,GAAY,EACExN,EAGPwN,IACAG,EACC,WAAYA,IAChBjC,EAASiC,EAASjC,QAGnBiC,EAAW7Z,EAASxB,OAAQxc,EAAM,SAAU,CAAE+f,QAAS4X,IAInDzW,IACJ2W,EAASjC,QAAUA,GAIfA,GACJ/U,GAAU,CAAE7gB,IAAQ,GAKrBs3B,EAAKjxB,KAAM,WASV,IAAMyX,KAJA8X,GACL/U,GAAU,CAAE7gB,IAEbge,EAASlF,OAAQ9Y,EAAM,UACTkqB,EACb1qB,GAAOsgB,MAAO9f,EAAM8d,EAAMoM,EAAMpM,OAMnC4Z,EAAYvB,GAAaP,EAASiC,EAAU/Z,GAAS,EAAGA,EAAMwZ,GACtDxZ,KAAQ+Z,IACfA,EAAU/Z,GAAS4Z,EAAU7oB,MACxB+mB,IACJ8B,EAAU/1B,IAAM+1B,EAAU7oB,MAC1B6oB,EAAU7oB,MAAQ,MAuMrBqpB,UAAW,SAAUn3B,EAAU+qB,GACzBA,EACJuK,GAAUI,WAAW1X,QAAShe,GAE9Bs1B,GAAUI,WAAWt5B,KAAM4D,MAK9BvB,GAAO24B,MAAQ,SAAUA,EAAOrG,EAAQnyB,GACvC,IAAI61B,EAAM2C,GAA0B,iBAAVA,EAAqB34B,GAAOsC,OAAQ,GAAIq2B,GAAU,CAC3Ef,SAAUz3B,IAAOA,GAAMmyB,GACtBl0B,EAAYu6B,IAAWA,EACxBxD,SAAUwD,EACVrG,OAAQnyB,GAAMmyB,GAAUA,IAAWl0B,EAAYk0B,IAAYA,GAoC5D,OAhCKtyB,GAAOs1B,GAAG/Q,IACdyR,EAAIb,SAAW,EAGc,iBAAjBa,EAAIb,WACVa,EAAIb,YAAYn1B,GAAOs1B,GAAGsD,OAC9B5C,EAAIb,SAAWn1B,GAAOs1B,GAAGsD,OAAQ5C,EAAIb,UAGrCa,EAAIb,SAAWn1B,GAAOs1B,GAAGsD,OAAOlW,UAMjB,MAAbsT,EAAI/c,QAA+B,IAAd+c,EAAI/c,QAC7B+c,EAAI/c,MAAQ,MAIb+c,EAAIxI,IAAMwI,EAAI4B,SAEd5B,EAAI4B,SAAW,WACTx5B,EAAY43B,EAAIxI,MACpBwI,EAAIxI,IAAIhwB,KAAMT,MAGVi5B,EAAI/c,OACRjZ,GAAOmf,QAASpiB,KAAMi5B,EAAI/c,QAIrB+c,GAGRh2B,GAAOG,GAAGmC,OAAQ,CACjBu2B,OAAQ,SAAUF,EAAOG,EAAIxG,EAAQ/wB,GAGpC,OAAOxE,KAAK6P,OAAQyT,IAAqBG,IAAK,UAAW,GAAIc,OAG3Dnf,MAAM42B,QAAS,CAAEvG,QAASsG,GAAMH,EAAOrG,EAAQ/wB,IAElDw3B,QAAS,SAAUza,EAAMqa,EAAOrG,EAAQ/wB,GACvC,IAAI8P,EAAQrR,GAAO2D,cAAe2a,GACjC0a,EAASh5B,GAAO24B,MAAOA,EAAOrG,EAAQ/wB,GACtC03B,EAAc,WAGb,IAAInB,EAAOjB,GAAW95B,KAAMiD,GAAOsC,OAAQ,GAAIgc,GAAQ0a,IAGlD3nB,GAASmN,EAASzd,IAAKhE,KAAM,YACjC+6B,EAAKtY,MAAM,IAMd,OAFAyZ,EAAYC,OAASD,EAEd5nB,IAA0B,IAAjB2nB,EAAO/f,MACtBlc,KAAKuE,KAAM23B,GACXl8B,KAAKkc,MAAO+f,EAAO/f,MAAOggB,IAE5BzZ,KAAM,SAAU9gB,EAAMghB,EAAY+X,GACjC,IAAI0B,EAAY,SAAU9Z,GACzB,IAAIG,EAAOH,EAAMG,YACVH,EAAMG,KACbA,EAAMiY,IAYP,MATqB,iBAAT/4B,IACX+4B,EAAU/X,EACVA,EAAahhB,EACbA,OAAOsE,GAEH0c,GACJ3iB,KAAKkc,MAAOva,GAAQ,KAAM,IAGpB3B,KAAKuE,KAAM,WACjB,IAAI6d,GAAU,EACbpI,EAAgB,MAARrY,GAAgBA,EAAO,aAC/B06B,EAASp5B,GAAOo5B,OAChB/a,EAAOG,EAASzd,IAAKhE,MAEtB,GAAKga,EACCsH,EAAMtH,IAAWsH,EAAMtH,GAAQyI,MACnC2Z,EAAW9a,EAAMtH,SAGlB,IAAMA,KAASsH,EACTA,EAAMtH,IAAWsH,EAAMtH,GAAQyI,MAAQ0W,GAAK1xB,KAAMuS,IACtDoiB,EAAW9a,EAAMtH,IAKpB,IAAMA,EAAQqiB,EAAO94B,OAAQyW,KACvBqiB,EAAQriB,GAAQvW,OAASzD,MACnB,MAAR2B,GAAgB06B,EAAQriB,GAAQkC,QAAUva,IAE5C06B,EAAQriB,GAAQ+gB,KAAKtY,KAAMiY,GAC3BtY,GAAU,EACVia,EAAO/2B,OAAQ0U,EAAO,KAOnBoI,GAAYsY,GAChBz3B,GAAOmf,QAASpiB,KAAM2B,MAIzBw6B,OAAQ,SAAUx6B,GAIjB,OAHc,IAATA,IACJA,EAAOA,GAAQ,MAET3B,KAAKuE,KAAM,WACjB,IAAIyV,EACHsH,EAAOG,EAASzd,IAAKhE,MACrBkc,EAAQoF,EAAM3f,EAAO,SACrB2gB,EAAQhB,EAAM3f,EAAO,cACrB06B,EAASp5B,GAAOo5B,OAChB94B,EAAS2Y,EAAQA,EAAM3Y,OAAS,EAajC,IAVA+d,EAAK6a,QAAS,EAGdl5B,GAAOiZ,MAAOlc,KAAM2B,EAAM,IAErB2gB,GAASA,EAAMG,MACnBH,EAAMG,KAAKhiB,KAAMT,MAAM,GAIlBga,EAAQqiB,EAAO94B,OAAQyW,KACvBqiB,EAAQriB,GAAQvW,OAASzD,MAAQq8B,EAAQriB,GAAQkC,QAAUva,IAC/D06B,EAAQriB,GAAQ+gB,KAAKtY,MAAM,GAC3B4Z,EAAO/2B,OAAQ0U,EAAO,IAKxB,IAAMA,EAAQ,EAAGA,EAAQzW,EAAQyW,IAC3BkC,EAAOlC,IAAWkC,EAAOlC,GAAQmiB,QACrCjgB,EAAOlC,GAAQmiB,OAAO17B,KAAMT,aAKvBshB,EAAK6a,YAKfl5B,GAAOsB,KAAM,CAAE,SAAU,OAAQ,QAAU,SAAU6D,EAAI1E,GACxD,IAAI44B,EAAQr5B,GAAOG,GAAIM,GACvBT,GAAOG,GAAIM,GAAS,SAAUk4B,EAAOrG,EAAQ/wB,GAC5C,OAAgB,MAATo3B,GAAkC,kBAAVA,EAC9BU,EAAM37B,MAAOX,KAAM0E,WACnB1E,KAAKg8B,QAAStC,GAAOh2B,GAAM,GAAQk4B,EAAOrG,EAAQ/wB,MAKrDvB,GAAOsB,KAAM,CACZg4B,UAAW7C,GAAO,QAClB8C,QAAS9C,GAAO,QAChB+C,YAAa/C,GAAO,UACpBgD,OAAQ,CAAEjH,QAAS,QACnBkH,QAAS,CAAElH,QAAS,QACpBmH,WAAY,CAAEnH,QAAS,WACrB,SAAU/xB,EAAMmnB,GAClB5nB,GAAOG,GAAIM,GAAS,SAAUk4B,EAAOrG,EAAQ/wB,GAC5C,OAAOxE,KAAKg8B,QAASnR,EAAO+Q,EAAOrG,EAAQ/wB,MAI7CvB,GAAOo5B,OAAS,GAChBp5B,GAAOs1B,GAAGiB,KAAO,WAChB,IAAIsB,EACH34B,EAAI,EACJk6B,EAASp5B,GAAOo5B,OAIjB,IAFAtD,GAAQ7N,KAAKC,MAELhpB,EAAIk6B,EAAO94B,OAAQpB,KAC1B24B,EAAQuB,EAAQl6B,OAGCk6B,EAAQl6B,KAAQ24B,GAChCuB,EAAO/2B,OAAQnD,IAAK,GAIhBk6B,EAAO94B,QACZN,GAAOs1B,GAAG9V,OAEXsW,QAAQ9yB,GAGThD,GAAOs1B,GAAGuC,MAAQ,SAAUA,GAC3B73B,GAAOo5B,OAAOz7B,KAAMk6B,GACpB73B,GAAOs1B,GAAGjmB,SAGXrP,GAAOs1B,GAAGgB,SAAW,GACrBt2B,GAAOs1B,GAAGjmB,MAAQ,WACZ0mB,KAILA,IAAa,EACbI,OAGDn2B,GAAOs1B,GAAG9V,KAAO,WAChBuW,GAAa,MAGd/1B,GAAOs1B,GAAGsD,OAAS,CAClBgB,KAAM,IACNC,KAAM,IAGNnX,SAAU,KAKX1iB,GAAOG,GAAG25B,MAAQ,SAAUC,EAAMr7B,GAIjC,OAHAq7B,EAAO/5B,GAAOs1B,IAAKt1B,GAAOs1B,GAAGsD,OAAQmB,IAAiBA,EACtDr7B,EAAOA,GAAQ,KAER3B,KAAKkc,MAAOva,EAAM,SAAU8K,EAAM6V,GACxC,IAAI2a,EAAUl9B,GAAO2e,WAAYjS,EAAMuwB,GACvC1a,EAAMG,KAAO,WACZ1iB,GAAOm9B,aAAcD,OAOnB/sB,GAAQtQ,EAAS0C,cAAe,SAEnC22B,GADSr5B,EAAS0C,cAAe,UACpBK,YAAa/C,EAAS0C,cAAe,WAEnD4N,GAAMvO,KAAO,WAIbP,GAAQ+7B,QAA0B,KAAhBjtB,GAAMnI,MAIxB3G,GAAQg8B,YAAcnE,GAAI7kB,UAI1BlE,GAAQtQ,EAAS0C,cAAe,UAC1ByF,MAAQ,IACdmI,GAAMvO,KAAO,QACbP,GAAQi8B,WAA6B,MAAhBntB,GAAMnI,MAI5B,IAAIu1B,GACH5sB,GAAazN,GAAOqN,KAAKI,WAE1BzN,GAAOG,GAAGmC,OAAQ,CACjBkL,KAAM,SAAU/M,EAAMqE,GACrB,OAAOkY,EAAQjgB,KAAMiD,GAAOwN,KAAM/M,EAAMqE,EAA0B,EAAnBrD,UAAUnB,SAG1Dg6B,WAAY,SAAU75B,GACrB,OAAO1D,KAAKuE,KAAM,WACjBtB,GAAOs6B,WAAYv9B,KAAM0D,QAK5BT,GAAOsC,OAAQ,CACdkL,KAAM,SAAUhN,EAAMC,EAAMqE,GAC3B,IAAI3D,EAAKke,EACRkb,EAAQ/5B,EAAKlC,SAGd,GAAe,IAAVi8B,GAAyB,IAAVA,GAAyB,IAAVA,EAKnC,MAAkC,oBAAtB/5B,EAAKjB,aACTS,GAAOse,KAAM9d,EAAMC,EAAMqE,IAKlB,IAAVy1B,GAAgBv6B,GAAOmE,SAAU3D,KACrC6e,EAAQrf,GAAOw6B,UAAW/5B,EAAKC,iBAC5BV,GAAOqN,KAAKrD,MAAM3B,KAAK7D,KAAM/D,GAAS45B,QAAWr3B,SAGtCA,IAAV8B,EACW,OAAVA,OACJ9E,GAAOs6B,WAAY95B,EAAMC,GAIrB4e,GAAS,QAASA,QACuBrc,KAA3C7B,EAAMke,EAAMjB,IAAK5d,EAAMsE,EAAOrE,IACzBU,GAGRX,EAAKhB,aAAciB,EAAMqE,EAAQ,IAC1BA,GAGHua,GAAS,QAASA,GAA+C,QAApCle,EAAMke,EAAMte,IAAKP,EAAMC,IACjDU,EAMM,OAHdA,EAAMnB,GAAO4J,KAAK4D,KAAMhN,EAAMC,SAGTuC,EAAY7B,IAGlCq5B,UAAW,CACV97B,KAAM,CACL0f,IAAK,SAAU5d,EAAMsE,GACpB,IAAM3G,GAAQi8B,YAAwB,UAAVt1B,GAC3BvE,GAAUC,EAAM,SAAY,CAC5B,IAAIrB,EAAMqB,EAAKsE,MAKf,OAJAtE,EAAKhB,aAAc,OAAQsF,GACtB3F,IACJqB,EAAKsE,MAAQ3F,GAEP2F,MAMXw1B,WAAY,SAAU95B,EAAMsE,GAC3B,IAAIrE,EACHvB,EAAI,EAIJu7B,EAAY31B,GAASA,EAAMkF,MAAO2N,GAEnC,GAAK8iB,GAA+B,IAAlBj6B,EAAKlC,SACtB,MAAUmC,EAAOg6B,EAAWv7B,KAC3BsB,EAAKwK,gBAAiBvK,MAO1B45B,GAAW,CACVjc,IAAK,SAAU5d,EAAMsE,EAAOrE,GAQ3B,OAPe,IAAVqE,EAGJ9E,GAAOs6B,WAAY95B,EAAMC,GAEzBD,EAAKhB,aAAciB,EAAMA,GAEnBA,IAITT,GAAOsB,KAAMtB,GAAOqN,KAAKrD,MAAM3B,KAAK0X,OAAO/V,MAAO,QAAU,SAAU7E,EAAI1E,GACzE,IAAIi6B,EAASjtB,GAAYhN,IAAUT,GAAO4J,KAAK4D,KAE/CC,GAAYhN,GAAS,SAAUD,EAAMC,EAAM6U,GAC1C,IAAInU,EAAKykB,EACR+U,EAAgBl6B,EAAKC,cAYtB,OAVM4U,IAGLsQ,EAASnY,GAAYktB,GACrBltB,GAAYktB,GAAkBx5B,EAC9BA,EAAqC,MAA/Bu5B,EAAQl6B,EAAMC,EAAM6U,GACzBqlB,EACA,KACDltB,GAAYktB,GAAkB/U,GAExBzkB,KAOT,IAAIy5B,GAAa,sCAChBC,GAAa,gBAwIb,SAASC,GAAkBh2B,GAE1B,OADaA,EAAMkF,MAAO2N,IAAmB,IAC/B9M,KAAM,KAItB,SAASkwB,GAAUv6B,GAClB,OAAOA,EAAKjB,cAAgBiB,EAAKjB,aAAc,UAAa,GAG7D,SAASy7B,GAAgBl2B,GACxB,OAAKhC,MAAMC,QAAS+B,GACZA,EAEc,iBAAVA,GACJA,EAAMkF,MAAO2N,IAEd,GAvJR3X,GAAOG,GAAGmC,OAAQ,CACjBgc,KAAM,SAAU7d,EAAMqE,GACrB,OAAOkY,EAAQjgB,KAAMiD,GAAOse,KAAM7d,EAAMqE,EAA0B,EAAnBrD,UAAUnB,SAG1D26B,WAAY,SAAUx6B,GACrB,OAAO1D,KAAKuE,KAAM,kBACVvE,KAAMiD,GAAOk7B,QAASz6B,IAAUA,QAK1CT,GAAOsC,OAAQ,CACdgc,KAAM,SAAU9d,EAAMC,EAAMqE,GAC3B,IAAI3D,EAAKke,EACRkb,EAAQ/5B,EAAKlC,SAGd,GAAe,IAAVi8B,GAAyB,IAAVA,GAAyB,IAAVA,EAWnC,OAPe,IAAVA,GAAgBv6B,GAAOmE,SAAU3D,KAGrCC,EAAOT,GAAOk7B,QAASz6B,IAAUA,EACjC4e,EAAQrf,GAAO+0B,UAAWt0B,SAGZuC,IAAV8B,EACCua,GAAS,QAASA,QACuBrc,KAA3C7B,EAAMke,EAAMjB,IAAK5d,EAAMsE,EAAOrE,IACzBU,EAGCX,EAAMC,GAASqE,EAGpBua,GAAS,QAASA,GAA+C,QAApCle,EAAMke,EAAMte,IAAKP,EAAMC,IACjDU,EAGDX,EAAMC,IAGds0B,UAAW,CACV/jB,SAAU,CACTjQ,IAAK,SAAUP,GAMd,IAAI26B,EAAWn7B,GAAO4J,KAAK4D,KAAMhN,EAAM,YAEvC,OAAK26B,EACGjL,SAAUiL,EAAU,IAI3BP,GAAWp2B,KAAMhE,EAAKD,WACtBs6B,GAAWr2B,KAAMhE,EAAKD,WACtBC,EAAKuQ,KAEE,GAGA,KAKXmqB,QAAS,CACRE,MAAO,UACPC,QAAS,eAYLl9B,GAAQg8B,cACbn6B,GAAO+0B,UAAU5jB,SAAW,CAC3BpQ,IAAK,SAAUP,GAId,IAAI8O,EAAS9O,EAAKb,WAIlB,OAHK2P,GAAUA,EAAO3P,YACrB2P,EAAO3P,WAAWyR,cAEZ,MAERgN,IAAK,SAAU5d,GAId,IAAI8O,EAAS9O,EAAKb,WACb2P,IACJA,EAAO8B,cAEF9B,EAAO3P,YACX2P,EAAO3P,WAAWyR,kBAOvBpR,GAAOsB,KAAM,CACZ,WACA,WACA,YACA,cACA,cACA,UACA,UACA,SACA,cACA,mBACE,WACFtB,GAAOk7B,QAASn+B,KAAK2D,eAAkB3D,OA4BxCiD,GAAOG,GAAGmC,OAAQ,CACjBg5B,SAAU,SAAUx2B,GACnB,IAAIy2B,EAAY5kB,EAAK6kB,EAAUxuB,EAAW9N,EAAGu8B,EAE7C,OAAKr9B,EAAY0G,GACT/H,KAAKuE,KAAM,SAAUY,GAC3BlC,GAAQjD,MAAOu+B,SAAUx2B,EAAMtH,KAAMT,KAAMmF,EAAG64B,GAAUh+B,WAI1Dw+B,EAAaP,GAAgBl2B,IAEbxE,OACRvD,KAAKuE,KAAM,WAIjB,GAHAk6B,EAAWT,GAAUh+B,MACrB4Z,EAAwB,IAAlB5Z,KAAKuB,UAAoB,IAAMw8B,GAAkBU,GAAa,IAEzD,CACV,IAAMt8B,EAAI,EAAGA,EAAIq8B,EAAWj7B,OAAQpB,IACnC8N,EAAYuuB,EAAYr8B,GACnByX,EAAI/Y,QAAS,IAAMoP,EAAY,KAAQ,IAC3C2J,GAAO3J,EAAY,KAKrByuB,EAAaX,GAAkBnkB,GAC1B6kB,IAAaC,GACjB1+B,KAAKyC,aAAc,QAASi8B,MAMzB1+B,MAGR2+B,YAAa,SAAU52B,GACtB,IAAIy2B,EAAY5kB,EAAK6kB,EAAUxuB,EAAW9N,EAAGu8B,EAE7C,OAAKr9B,EAAY0G,GACT/H,KAAKuE,KAAM,SAAUY,GAC3BlC,GAAQjD,MAAO2+B,YAAa52B,EAAMtH,KAAMT,KAAMmF,EAAG64B,GAAUh+B,UAIvD0E,UAAUnB,QAIhBi7B,EAAaP,GAAgBl2B,IAEbxE,OACRvD,KAAKuE,KAAM,WAMjB,GALAk6B,EAAWT,GAAUh+B,MAGrB4Z,EAAwB,IAAlB5Z,KAAKuB,UAAoB,IAAMw8B,GAAkBU,GAAa,IAEzD,CACV,IAAMt8B,EAAI,EAAGA,EAAIq8B,EAAWj7B,OAAQpB,IAAM,CACzC8N,EAAYuuB,EAAYr8B,GAGxB,OAAgD,EAAxCyX,EAAI/Y,QAAS,IAAMoP,EAAY,KACtC2J,EAAMA,EAAIvT,QAAS,IAAM4J,EAAY,IAAK,KAK5CyuB,EAAaX,GAAkBnkB,GAC1B6kB,IAAaC,GACjB1+B,KAAKyC,aAAc,QAASi8B,MAMzB1+B,KA/BCA,KAAKyQ,KAAM,QAAS,KAkC7BmuB,YAAa,SAAU72B,EAAO82B,GAC7B,IAAIL,EAAYvuB,EAAW9N,EAAG+W,EAC7BvX,SAAcoG,EACd+2B,EAAwB,WAATn9B,GAAqBoE,MAAMC,QAAS+B,GAEpD,OAAK1G,EAAY0G,GACT/H,KAAKuE,KAAM,SAAUpC,GAC3Bc,GAAQjD,MAAO4+B,YACd72B,EAAMtH,KAAMT,KAAMmC,EAAG67B,GAAUh+B,MAAQ6+B,GACvCA,KAKsB,kBAAbA,GAA0BC,EAC9BD,EAAW7+B,KAAKu+B,SAAUx2B,GAAU/H,KAAK2+B,YAAa52B,IAG9Dy2B,EAAaP,GAAgBl2B,GAEtB/H,KAAKuE,KAAM,WACjB,GAAKu6B,EAKJ,IAFA5lB,EAAOjW,GAAQjD,MAETmC,EAAI,EAAGA,EAAIq8B,EAAWj7B,OAAQpB,IACnC8N,EAAYuuB,EAAYr8B,GAGnB+W,EAAK6lB,SAAU9uB,GACnBiJ,EAAKylB,YAAa1uB,GAElBiJ,EAAKqlB,SAAUtuB,aAKIhK,IAAV8B,GAAgC,YAATpG,KAClCsO,EAAY+tB,GAAUh+B,QAIrByhB,EAASJ,IAAKrhB,KAAM,gBAAiBiQ,GAOjCjQ,KAAKyC,cACTzC,KAAKyC,aAAc,QAClBwN,IAAuB,IAAVlI,EACZ,GACA0Z,EAASzd,IAAKhE,KAAM,kBAAqB,SAO/C++B,SAAU,SAAU77B,GACnB,IAAI+M,EAAWxM,EACdtB,EAAI,EAEL8N,EAAY,IAAM/M,EAAW,IAC7B,MAAUO,EAAOzD,KAAMmC,KACtB,GAAuB,IAAlBsB,EAAKlC,WACoE,GAA3E,IAAMw8B,GAAkBC,GAAUv6B,IAAW,KAAM5C,QAASoP,GAC9D,OAAO,EAIT,OAAO,KAOT,IAAI+uB,GAAU,MAEd/7B,GAAOG,GAAGmC,OAAQ,CACjBnD,IAAK,SAAU2F,GACd,IAAIua,EAAOle,EAAKuqB,EACflrB,EAAOzD,KAAM,GAEd,OAAM0E,UAAUnB,QA0BhBorB,EAAkBttB,EAAY0G,GAEvB/H,KAAKuE,KAAM,SAAUpC,GAC3B,IAAIC,EAEmB,IAAlBpC,KAAKuB,WAWE,OANXa,EADIusB,EACE5mB,EAAMtH,KAAMT,KAAMmC,EAAGc,GAAQjD,MAAOoC,OAEpC2F,GAKN3F,EAAM,GAEoB,iBAARA,EAClBA,GAAO,GAEI2D,MAAMC,QAAS5D,KAC1BA,EAAMa,GAAOwB,IAAKrC,EAAK,SAAU2F,GAChC,OAAgB,MAATA,EAAgB,GAAKA,EAAQ,OAItCua,EAAQrf,GAAOg8B,SAAUj/B,KAAK2B,OAAUsB,GAAOg8B,SAAUj/B,KAAKwD,SAASG,iBAGrD,QAAS2e,QAA+Crc,IAApCqc,EAAMjB,IAAKrhB,KAAMoC,EAAK,WAC3DpC,KAAK+H,MAAQ3F,OAzDTqB,GACJ6e,EAAQrf,GAAOg8B,SAAUx7B,EAAK9B,OAC7BsB,GAAOg8B,SAAUx7B,EAAKD,SAASG,iBAG/B,QAAS2e,QACgCrc,KAAvC7B,EAAMke,EAAMte,IAAKP,EAAM,UAElBW,EAMY,iBAHpBA,EAAMX,EAAKsE,OAIH3D,EAAIiC,QAAS24B,GAAS,IAIhB,MAAP56B,EAAc,GAAKA,OAG3B,KAyCHnB,GAAOsC,OAAQ,CACd05B,SAAU,CACT5Z,OAAQ,CACPrhB,IAAK,SAAUP,GAEd,IAAIrB,EAAMa,GAAO4J,KAAK4D,KAAMhN,EAAM,SAClC,OAAc,MAAPrB,EACNA,EAMA27B,GAAkB96B,GAAOV,KAAMkB,MAGlCyK,OAAQ,CACPlK,IAAK,SAAUP,GACd,IAAIsE,EAAOsd,EAAQljB,EAClBqD,EAAU/B,EAAK+B,QACfwU,EAAQvW,EAAK4Q,cACbgT,EAAoB,eAAd5jB,EAAK9B,KACX6iB,EAAS6C,EAAM,KAAO,GACtBkN,EAAMlN,EAAMrN,EAAQ,EAAIxU,EAAQjC,OAUjC,IAPCpB,EADI6X,EAAQ,EACRua,EAGAlN,EAAMrN,EAAQ,EAIX7X,EAAIoyB,EAAKpyB,IAKhB,KAJAkjB,EAAS7f,EAASrD,IAIJiS,UAAYjS,IAAM6X,KAG7BqL,EAAO9Y,YACL8Y,EAAOziB,WAAW2J,WACnB/I,GAAU6hB,EAAOziB,WAAY,aAAiB,CAMjD,GAHAmF,EAAQ9E,GAAQoiB,GAASjjB,MAGpBilB,EACJ,OAAOtf,EAIRyc,EAAO5jB,KAAMmH,GAIf,OAAOyc,GAGRnD,IAAK,SAAU5d,EAAMsE,GACpB,IAAIm3B,EAAW7Z,EACd7f,EAAU/B,EAAK+B,QACfgf,EAASvhB,GAAOgE,UAAWc,GAC3B5F,EAAIqD,EAAQjC,OAEb,MAAQpB,MACPkjB,EAAS7f,EAASrD,IAINiS,UACuD,EAAlEnR,GAAOkE,QAASlE,GAAOg8B,SAAS5Z,OAAOrhB,IAAKqhB,GAAUb,MAEtD0a,GAAY,GAUd,OAHMA,IACLz7B,EAAK4Q,eAAiB,GAEhBmQ,OAOXvhB,GAAOsB,KAAM,CAAE,QAAS,YAAc,WACrCtB,GAAOg8B,SAAUj/B,MAAS,CACzBqhB,IAAK,SAAU5d,EAAMsE,GACpB,GAAKhC,MAAMC,QAAS+B,GACnB,OAAStE,EAAK0Q,SAA2D,EAAjDlR,GAAOkE,QAASlE,GAAQQ,GAAOrB,MAAO2F,KAI3D3G,GAAQ+7B,UACbl6B,GAAOg8B,SAAUj/B,MAAOgE,IAAM,SAAUP,GACvC,OAAwC,OAAjCA,EAAKjB,aAAc,SAAqB,KAAOiB,EAAKsE,UAS9D,IAAI0L,GAAW1T,GAAO0T,SAElB5R,GAAQ,CAAEmG,KAAMkjB,KAAKC,OAErBgU,GAAS,KAKbl8B,GAAOm8B,SAAW,SAAU9d,GAC3B,IAAInP,EAAKktB,EACT,IAAM/d,GAAwB,iBAATA,EACpB,OAAO,KAKR,IACCnP,GAAM,IAAMpS,GAAOu/B,WAAcC,gBAAiBje,EAAM,YACvD,MAAQ3U,IAYV,OAVA0yB,EAAkBltB,GAAOA,EAAI3E,qBAAsB,eAAiB,GAC9D2E,IAAOktB,GACZp8B,GAAOsD,MAAO,iBACb84B,EACCp8B,GAAOwB,IAAK46B,EAAgB3yB,WAAY,SAAUgC,GACjD,OAAOA,EAAG5H,cACPgH,KAAM,MACVwT,IAGInP,GAIR,IAAIqtB,GAAc,kCACjBC,GAA0B,SAAU9yB,GACnCA,EAAEmb,mBAGJ7kB,GAAOsC,OAAQtC,GAAOskB,MAAO,CAE5BU,QAAS,SAAUV,EAAOjG,EAAM7d,EAAMi8B,GAErC,IAAIv9B,EAAGyX,EAAKgJ,EAAK+c,EAAYC,EAAQ/W,EAAQ9K,EAAS8hB,EACrDC,EAAY,CAAEr8B,GAAQ7D,GACtB+B,EAAOX,GAAOP,KAAM8mB,EAAO,QAAWA,EAAM5lB,KAAO4lB,EACnDkB,EAAaznB,GAAOP,KAAM8mB,EAAO,aAAgBA,EAAMlgB,UAAUc,MAAO,KAAQ,GAKjF,GAHAyR,EAAMimB,EAAcjd,EAAMnf,EAAOA,GAAQ7D,EAGlB,IAAlB6D,EAAKlC,UAAoC,IAAlBkC,EAAKlC,WAK5Bi+B,GAAY/3B,KAAM9F,EAAOsB,GAAOskB,MAAMuB,cAIf,EAAvBnnB,EAAKd,QAAS,OAIlBc,GADA8mB,EAAa9mB,EAAKwG,MAAO,MACPoG,QAClBka,EAAWpjB,QAEZu6B,EAASj+B,EAAKd,QAAS,KAAQ,GAAK,KAAOc,GAG3C4lB,EAAQA,EAAOtkB,GAAOiD,SACrBqhB,EACA,IAAItkB,GAAOmnB,MAAOzoB,EAAuB,iBAAV4lB,GAAsBA,IAGhDK,UAAY8X,EAAe,EAAI,EACrCnY,EAAMlgB,UAAYohB,EAAW3a,KAAM,KACnCyZ,EAAMuC,WAAavC,EAAMlgB,UACxB,IAAImB,OAAQ,UAAYigB,EAAW3a,KAAM,iBAAoB,WAC7D,KAGDyZ,EAAM3V,YAAS3L,EACTshB,EAAM3hB,SACX2hB,EAAM3hB,OAASnC,GAIhB6d,EAAe,MAARA,EACN,CAAEiG,GACFtkB,GAAOgE,UAAWqa,EAAM,CAAEiG,IAG3BxJ,EAAU9a,GAAOskB,MAAMxJ,QAASpc,IAAU,GACpC+9B,IAAgB3hB,EAAQkK,UAAmD,IAAxClK,EAAQkK,QAAQtnB,MAAO8C,EAAM6d,IAAtE,CAMA,IAAMoe,IAAiB3hB,EAAQ0M,WAAahpB,EAAUgC,GAAS,CAM9D,IAJAk8B,EAAa5hB,EAAQ8J,cAAgBlmB,EAC/B69B,GAAY/3B,KAAMk4B,EAAah+B,KACpCiY,EAAMA,EAAIhX,YAEHgX,EAAKA,EAAMA,EAAIhX,WACtBk9B,EAAUl/B,KAAMgZ,GAChBgJ,EAAMhJ,EAIFgJ,KAAUnf,EAAK+D,eAAiB5H,IACpCkgC,EAAUl/B,KAAMgiB,EAAIvT,aAAeuT,EAAImd,cAAgBhgC,IAKzDoC,EAAI,EACJ,OAAUyX,EAAMkmB,EAAW39B,QAAYolB,EAAMqC,uBAC5CiW,EAAcjmB,EACd2N,EAAM5lB,KAAW,EAAJQ,EACZw9B,EACA5hB,EAAQiL,UAAYrnB,GAGrBknB,GAAWpH,EAASzd,IAAK4V,EAAK,WAAcxZ,OAAOwoB,OAAQ,OAAUrB,EAAM5lB,OAC1E8f,EAASzd,IAAK4V,EAAK,YAEnBiP,EAAOloB,MAAOiZ,EAAK0H,IAIpBuH,EAAS+W,GAAUhmB,EAAKgmB,KACT/W,EAAOloB,OAASogB,EAAYnH,KAC1C2N,EAAM3V,OAASiX,EAAOloB,MAAOiZ,EAAK0H,IACZ,IAAjBiG,EAAM3V,QACV2V,EAAMS,kBA8CT,OA1CAT,EAAM5lB,KAAOA,EAGP+9B,GAAiBnY,EAAMuD,sBAEpB/M,EAAQ4H,WACqC,IAApD5H,EAAQ4H,SAAShlB,MAAOm/B,EAAUz3B,MAAOiZ,KACzCP,EAAYtd,IAIPm8B,GAAUv+B,EAAYoC,EAAM9B,MAAaF,EAAUgC,MAGvDmf,EAAMnf,EAAMm8B,MAGXn8B,EAAMm8B,GAAW,MAIlB38B,GAAOskB,MAAMuB,UAAYnnB,EAEpB4lB,EAAMqC,wBACViW,EAAYtwB,iBAAkB5N,EAAM89B,IAGrCh8B,EAAM9B,KAED4lB,EAAMqC,wBACViW,EAAYjgB,oBAAqBje,EAAM89B,IAGxCx8B,GAAOskB,MAAMuB,eAAY7iB,EAEpB2c,IACJnf,EAAMm8B,GAAWhd,IAMd2E,EAAM3V,SAKdwb,SAAU,SAAUzrB,EAAM8B,EAAM8jB,GAC/B,IAAI5a,EAAI1J,GAAOsC,OACd,IAAItC,GAAOmnB,MACX7C,EACA,CACC5lB,KAAMA,EACNypB,aAAa,IAIfnoB,GAAOskB,MAAMU,QAAStb,EAAG,KAAMlJ,MAKjCR,GAAOG,GAAGmC,OAAQ,CAEjB0iB,QAAS,SAAUtmB,EAAM2f,GACxB,OAAOthB,KAAKuE,KAAM,WACjBtB,GAAOskB,MAAMU,QAAStmB,EAAM2f,EAAMthB,SAGpCggC,eAAgB,SAAUr+B,EAAM2f,GAC/B,IAAI7d,EAAOzD,KAAM,GACjB,GAAKyD,EACJ,OAAOR,GAAOskB,MAAMU,QAAStmB,EAAM2f,EAAM7d,GAAM,MAMlD,IACCw8B,GAAW,QACXC,GAAQ,SACRC,GAAkB,wCAClBC,GAAe,qCAEhB,SAASC,GAAa1I,EAAQr2B,EAAKg/B,EAAapmB,GAC/C,IAAIxW,EAEJ,GAAKqC,MAAMC,QAAS1E,GAGnB2B,GAAOsB,KAAMjD,EAAK,SAAUa,EAAG2Y,GACzBwlB,GAAeL,GAASx4B,KAAMkwB,GAGlCzd,EAAKyd,EAAQ7c,GAKbulB,GACC1I,EAAS,KAAqB,iBAAN7c,GAAuB,MAALA,EAAY3Y,EAAI,IAAO,IACjE2Y,EACAwlB,EACApmB,UAKG,GAAMomB,GAAiC,WAAlBx9B,EAAQxB,GAUnC4Y,EAAKyd,EAAQr2B,QAPb,IAAMoC,KAAQpC,EACb++B,GAAa1I,EAAS,IAAMj0B,EAAO,IAAKpC,EAAKoC,GAAQ48B,EAAapmB,GAYrEjX,GAAOs9B,MAAQ,SAAU73B,EAAG43B,GAC3B,IAAI3I,EACH6I,EAAI,GACJtmB,EAAM,SAAU7L,EAAKoyB,GAGpB,IAAI14B,EAAQ1G,EAAYo/B,GACvBA,IACAA,EAEDD,EAAGA,EAAEj9B,QAAWm9B,mBAAoBryB,GAAQ,IAC3CqyB,mBAA6B,MAAT34B,EAAgB,GAAKA,IAG5C,GAAU,MAALW,EACJ,MAAO,GAIR,GAAK3C,MAAMC,QAAS0C,IAASA,EAAE7E,SAAWZ,GAAO6C,cAAe4C,GAG/DzF,GAAOsB,KAAMmE,EAAG,WACfwR,EAAKla,KAAK0D,KAAM1D,KAAK+H,cAOtB,IAAM4vB,KAAUjvB,EACf23B,GAAa1I,EAAQjvB,EAAGivB,GAAU2I,EAAapmB,GAKjD,OAAOsmB,EAAE1yB,KAAM,MAGhB7K,GAAOG,GAAGmC,OAAQ,CACjBo7B,UAAW,WACV,OAAO19B,GAAOs9B,MAAOvgC,KAAK4gC,mBAE3BA,eAAgB,WACf,OAAO5gC,KAAKyE,IAAK,WAGhB,IAAI8L,EAAWtN,GAAOse,KAAMvhB,KAAM,YAClC,OAAOuQ,EAAWtN,GAAOgE,UAAWsJ,GAAavQ,OAC9C6P,OAAQ,WACX,IAAIlO,EAAO3B,KAAK2B,KAGhB,OAAO3B,KAAK0D,OAAST,GAAQjD,MAAO2Y,GAAI,cACvCynB,GAAa34B,KAAMzH,KAAKwD,YAAe28B,GAAgB14B,KAAM9F,KAC3D3B,KAAKmU,UAAY0Q,GAAepd,KAAM9F,MACtC8C,IAAK,SAAU2D,EAAI3E,GACtB,IAAIrB,EAAMa,GAAQjD,MAAOoC,MAEzB,OAAY,MAAPA,EACG,KAGH2D,MAAMC,QAAS5D,GACZa,GAAOwB,IAAKrC,EAAK,SAAUA,GACjC,MAAO,CAAEsB,KAAMD,EAAKC,KAAMqE,MAAO3F,EAAIiE,QAAS65B,GAAO,WAIhD,CAAEx8B,KAAMD,EAAKC,KAAMqE,MAAO3F,EAAIiE,QAAS65B,GAAO,WAClDl8B,SAKN,IACC68B,GAAM,OACNC,GAAQ,OACRC,GAAa,gBACbC,GAAW,6BAIXC,GAAa,iBACbC,GAAY,QAWZhH,GAAa,GAObiH,GAAa,GAGbC,GAAW,KAAK1gC,OAAQ,KAGxB2gC,GAAezhC,EAAS0C,cAAe,KAKxC,SAASg/B,GAA6BC,GAGrC,OAAO,SAAUC,EAAoB5kB,GAED,iBAAvB4kB,IACX5kB,EAAO4kB,EACPA,EAAqB,KAGtB,IAAIC,EACHt/B,EAAI,EACJu/B,EAAYF,EAAmB79B,cAAcsJ,MAAO2N,IAAmB,GAExE,GAAKvZ,EAAYub,GAGhB,MAAU6kB,EAAWC,EAAWv/B,KAGR,MAAlBs/B,EAAU,IACdA,EAAWA,EAASnhC,MAAO,IAAO,KAChCihC,EAAWE,GAAaF,EAAWE,IAAc,IAAKjf,QAAS5F,KAI/D2kB,EAAWE,GAAaF,EAAWE,IAAc,IAAK7gC,KAAMgc,IAQnE,SAAS+kB,GAA+BJ,EAAW/7B,EAASi1B,EAAiBmH,GAE5E,IAAIC,EAAY,GACfC,EAAqBP,IAAcJ,GAEpC,SAASY,EAASN,GACjB,IAAIrtB,EAcJ,OAbAytB,EAAWJ,IAAa,EACxBx+B,GAAOsB,KAAMg9B,EAAWE,IAAc,GAAI,SAAU9lB,EAAGqmB,GACtD,IAAIC,EAAsBD,EAAoBx8B,EAASi1B,EAAiBmH,GACxE,MAAoC,iBAAxBK,GACVH,GAAqBD,EAAWI,GAKtBH,IACD1tB,EAAW6tB,QADf,GAHNz8B,EAAQk8B,UAAUlf,QAASyf,GAC3BF,EAASE,IACF,KAKF7tB,EAGR,OAAO2tB,EAASv8B,EAAQk8B,UAAW,MAAUG,EAAW,MAASE,EAAS,KAM3E,SAASG,GAAYt8B,EAAQhE,GAC5B,IAAIyM,EAAKxI,EACRs8B,EAAcl/B,GAAOm/B,aAAaD,aAAe,GAElD,IAAM9zB,KAAOzM,OACQqE,IAAfrE,EAAKyM,MACP8zB,EAAa9zB,GAAQzI,EAAWC,IAAUA,EAAO,KAAUwI,GAAQzM,EAAKyM,IAO5E,OAJKxI,GACJ5C,GAAOsC,QAAQ,EAAMK,EAAQC,GAGvBD,EA/ERy7B,GAAartB,KAAOP,GAASO,KAgP7B/Q,GAAOsC,OAAQ,CAGd88B,OAAQ,EAGRC,aAAc,GACdC,KAAM,GAENH,aAAc,CACbI,IAAK/uB,GAASO,KACdrS,KAAM,MACN8gC,QAxRgB,4DAwRQh7B,KAAMgM,GAASivB,UACvCljC,QAAQ,EACRmjC,aAAa,EACbC,OAAO,EACPC,YAAa,mDAcbC,QAAS,CACR9H,IAAKoG,GACL7+B,KAAM,aACNqsB,KAAM,YACNzc,IAAK,4BACL4wB,KAAM,qCAGPtpB,SAAU,CACTtH,IAAK,UACLyc,KAAM,SACNmU,KAAM,YAGPC,eAAgB,CACf7wB,IAAK,cACL5P,KAAM,eACNwgC,KAAM,gBAKPE,WAAY,CAGXC,SAAUj3B,OAGVk3B,aAAa,EAGbC,YAAathB,KAAKC,MAGlBshB,WAAYpgC,GAAOm8B,UAOpB+C,YAAa,CACZK,KAAK,EACLr/B,SAAS,IAOXmgC,UAAW,SAAU19B,EAAQ29B,GAC5B,OAAOA,EAGNrB,GAAYA,GAAYt8B,EAAQ3C,GAAOm/B,cAAgBmB,GAGvDrB,GAAYj/B,GAAOm/B,aAAcx8B,IAGnC49B,cAAelC,GAA6BpH,IAC5CuJ,cAAenC,GAA6BH,IAG5CuC,KAAM,SAAUlB,EAAKh9B,GAGA,iBAARg9B,IACXh9B,EAAUg9B,EACVA,OAAMv8B,GAIPT,EAAUA,GAAW,GAErB,IAAIm+B,EAGHC,EAGAC,EACAC,EAGAC,EAGAC,EAGArkB,EAGAskB,EAGA9hC,EAGA+hC,EAGA1D,EAAIv9B,GAAOqgC,UAAW,GAAI99B,GAG1B2+B,EAAkB3D,EAAEr9B,SAAWq9B,EAG/B4D,EAAqB5D,EAAEr9B,UACpBghC,EAAgB5iC,UAAY4iC,EAAgBtgC,QAC9CZ,GAAQkhC,GACRlhC,GAAOskB,MAGRvK,EAAW/Z,GAAO0Z,WAClB0nB,EAAmBphC,GAAOwY,UAAW,eAGrC6oB,EAAa9D,EAAE8D,YAAc,GAG7BC,EAAiB,GACjBC,EAAsB,GAGtBC,EAAW,WAGX7C,EAAQ,CACP7hB,WAAY,EAGZ2kB,kBAAmB,SAAUr2B,GAC5B,IAAIpB,EACJ,GAAK0S,EAAY,CAChB,IAAMmkB,EAAkB,CACvBA,EAAkB,GAClB,MAAU72B,EAAQ+zB,GAAS3zB,KAAMw2B,GAChCC,EAAiB72B,EAAO,GAAItJ,cAAgB,MACzCmgC,EAAiB72B,EAAO,GAAItJ,cAAgB,MAAS,IACrDjD,OAAQuM,EAAO,IAGpBA,EAAQ62B,EAAiBz1B,EAAI1K,cAAgB,KAE9C,OAAgB,MAATsJ,EAAgB,KAAOA,EAAMa,KAAM,OAI3C62B,sBAAuB,WACtB,OAAOhlB,EAAYkkB,EAAwB,MAI5Ce,iBAAkB,SAAUlhC,EAAMqE,GAMjC,OALkB,MAAb4X,IACJjc,EAAO8gC,EAAqB9gC,EAAKC,eAChC6gC,EAAqB9gC,EAAKC,gBAAmBD,EAC9C6gC,EAAgB7gC,GAASqE,GAEnB/H,MAIR6kC,iBAAkB,SAAUljC,GAI3B,OAHkB,MAAbge,IACJ6gB,EAAEsE,SAAWnjC,GAEP3B,MAIRskC,WAAY,SAAU7/B,GACrB,IAAIzC,EACJ,GAAKyC,EACJ,GAAKkb,EAGJiiB,EAAM7kB,OAAQtY,EAAKm9B,EAAMmD,cAIzB,IAAM/iC,KAAQyC,EACb6/B,EAAYtiC,GAAS,CAAEsiC,EAAYtiC,GAAQyC,EAAKzC,IAInD,OAAOhC,MAIRglC,MAAO,SAAUC,GAChB,IAAIC,EAAYD,GAAcR,EAK9B,OAJKd,GACJA,EAAUqB,MAAOE,GAElBp7B,EAAM,EAAGo7B,GACFllC,OAoBV,GAfAgd,EAAS1B,QAASsmB,GAKlBpB,EAAEgC,MAAUA,GAAOhC,EAAEgC,KAAO/uB,GAASO,MAAS,IAC5C3N,QAAS66B,GAAWztB,GAASivB,SAAW,MAG1ClC,EAAE7+B,KAAO6D,EAAQ6V,QAAU7V,EAAQ7D,MAAQ6+B,EAAEnlB,QAAUmlB,EAAE7+B,KAGzD6+B,EAAEkB,WAAclB,EAAEiB,UAAY,KAAM99B,cAAcsJ,MAAO2N,IAAmB,CAAE,IAGxD,MAAjB4lB,EAAE2E,YAAsB,CAC5BnB,EAAYpkC,EAAS0C,cAAe,KAKpC,IACC0hC,EAAUhwB,KAAOwsB,EAAEgC,IAInBwB,EAAUhwB,KAAOgwB,EAAUhwB,KAC3BwsB,EAAE2E,YAAc9D,GAAaqB,SAAW,KAAOrB,GAAa+D,MAC3DpB,EAAUtB,SAAW,KAAOsB,EAAUoB,KACtC,MAAQz4B,GAIT6zB,EAAE2E,aAAc,GAalB,GARK3E,EAAElf,MAAQkf,EAAEmC,aAAiC,iBAAXnC,EAAElf,OACxCkf,EAAElf,KAAOre,GAAOs9B,MAAOC,EAAElf,KAAMkf,EAAEF,cAIlCqB,GAA+BzH,GAAYsG,EAAGh7B,EAASo8B,GAGlDjiB,EACJ,OAAOiiB,EA8ER,IAAMz/B,KAzEN8hC,EAAchhC,GAAOskB,OAASiZ,EAAEhhC,SAGQ,GAApByD,GAAOo/B,UAC1Bp/B,GAAOskB,MAAMU,QAAS,aAIvBuY,EAAE7+B,KAAO6+B,EAAE7+B,KAAKif,cAGhB4f,EAAE6E,YAAcpE,GAAWx5B,KAAM+4B,EAAE7+B,MAKnCiiC,EAAWpD,EAAEgC,IAAIn8B,QAASy6B,GAAO,IAG3BN,EAAE6E,WAwBI7E,EAAElf,MAAQkf,EAAEmC,aACoD,KAAzEnC,EAAEqC,aAAe,IAAKhiC,QAAS,uCACjC2/B,EAAElf,KAAOkf,EAAElf,KAAKjb,QAASw6B,GAAK,OAvB9BqD,EAAW1D,EAAEgC,IAAIliC,MAAOsjC,EAASrgC,QAG5Bi9B,EAAElf,OAAUkf,EAAEmC,aAAiC,iBAAXnC,EAAElf,QAC1CsiB,IAAczE,GAAO13B,KAAMm8B,GAAa,IAAM,KAAQpD,EAAElf,YAGjDkf,EAAElf,OAIO,IAAZkf,EAAEpyB,QACNw1B,EAAWA,EAASv9B,QAAS06B,GAAY,MACzCmD,GAAa/E,GAAO13B,KAAMm8B,GAAa,IAAM,KAAQ,KAAS/hC,GAAMmG,OACnEk8B,GAIF1D,EAAEgC,IAAMoB,EAAWM,GASf1D,EAAE8E,aACDriC,GAAOq/B,aAAcsB,IACzBhC,EAAMgD,iBAAkB,oBAAqB3hC,GAAOq/B,aAAcsB,IAE9D3gC,GAAOs/B,KAAMqB,IACjBhC,EAAMgD,iBAAkB,gBAAiB3hC,GAAOs/B,KAAMqB,MAKnDpD,EAAElf,MAAQkf,EAAE6E,aAAgC,IAAlB7E,EAAEqC,aAAyBr9B,EAAQq9B,cACjEjB,EAAMgD,iBAAkB,eAAgBpE,EAAEqC,aAI3CjB,EAAMgD,iBACL,SACApE,EAAEkB,UAAW,IAAOlB,EAAEsC,QAAStC,EAAEkB,UAAW,IAC3ClB,EAAEsC,QAAStC,EAAEkB,UAAW,KACA,MAArBlB,EAAEkB,UAAW,GAAc,KAAON,GAAW,WAAa,IAC7DZ,EAAEsC,QAAS,MAIFtC,EAAE+E,QACZ3D,EAAMgD,iBAAkBziC,EAAGq+B,EAAE+E,QAASpjC,IAIvC,GAAKq+B,EAAEgF,cAC+C,IAAnDhF,EAAEgF,WAAW/kC,KAAM0jC,EAAiBvC,EAAOpB,IAAiB7gB,GAG9D,OAAOiiB,EAAMoD,QAed,GAXAP,EAAW,QAGXJ,EAAiBnqB,IAAKsmB,EAAE3F,UACxB+G,EAAM93B,KAAM02B,EAAEiF,SACd7D,EAAMrmB,KAAMilB,EAAEj6B,OAGdo9B,EAAYhC,GAA+BR,GAAYX,EAAGh7B,EAASo8B,GAK5D,CASN,GARAA,EAAM7hB,WAAa,EAGdkkB,GACJG,EAAmBnc,QAAS,WAAY,CAAE2Z,EAAOpB,IAI7C7gB,EACJ,OAAOiiB,EAIHpB,EAAEoC,OAAqB,EAAZpC,EAAEvD,UACjB8G,EAAehkC,GAAO2e,WAAY,WACjCkjB,EAAMoD,MAAO,YACXxE,EAAEvD,UAGN,IACCtd,GAAY,EACZgkB,EAAU+B,KAAMnB,EAAgBz6B,GAC/B,MAAQ6C,GAGT,GAAKgT,EACJ,MAAMhT,EAIP7C,GAAO,EAAG6C,SAhCX7C,GAAO,EAAG,gBAqCX,SAASA,EAAMi7B,EAAQY,EAAkBC,EAAWL,GACnD,IAAIM,EAAWJ,EAASl/B,EAAOu/B,EAAUC,EACxCd,EAAaU,EAGThmB,IAILA,GAAY,EAGPokB,GACJhkC,GAAOm9B,aAAc6G,GAKtBJ,OAAY19B,EAGZ49B,EAAwB0B,GAAW,GAGnC3D,EAAM7hB,WAAsB,EAATglB,EAAa,EAAI,EAGpCc,EAAsB,KAAVd,GAAiBA,EAAS,KAAkB,MAAXA,EAGxCa,IACJE,EA7lBJ,SAA8BtF,EAAGoB,EAAOgE,GAEvC,IAAII,EAAIrkC,EAAMskC,EAAeC,EAC5BzsB,EAAW+mB,EAAE/mB,SACbioB,EAAYlB,EAAEkB,UAGf,MAA2B,MAAnBA,EAAW,GAClBA,EAAUnzB,aACEtI,IAAP+/B,IACJA,EAAKxF,EAAEsE,UAAYlD,EAAM8C,kBAAmB,iBAK9C,GAAKsB,EACJ,IAAMrkC,KAAQ8X,EACb,GAAKA,EAAU9X,IAAU8X,EAAU9X,GAAO8F,KAAMu+B,GAAO,CACtDtE,EAAUlf,QAAS7gB,GACnB,MAMH,GAAK+/B,EAAW,KAAOkE,EACtBK,EAAgBvE,EAAW,OACrB,CAGN,IAAM//B,KAAQikC,EAAY,CACzB,IAAMlE,EAAW,IAAOlB,EAAEyC,WAAYthC,EAAO,IAAM+/B,EAAW,IAAQ,CACrEuE,EAAgBtkC,EAChB,MAEKukC,IACLA,EAAgBvkC,GAKlBskC,EAAgBA,GAAiBC,EAMlC,GAAKD,EAIJ,OAHKA,IAAkBvE,EAAW,IACjCA,EAAUlf,QAASyjB,GAEbL,EAAWK,GA0iBLE,CAAqB3F,EAAGoB,EAAOgE,KAIrCC,IACsC,EAA3C5iC,GAAOkE,QAAS,SAAUq5B,EAAEkB,YAC5Bz+B,GAAOkE,QAAS,OAAQq5B,EAAEkB,WAAc,IACxClB,EAAEyC,WAAY,eAAkB,cAIjC6C,EA9iBH,SAAsBtF,EAAGsF,EAAUlE,EAAOiE,GACzC,IAAIO,EAAOC,EAASC,EAAM1jB,EAAKlJ,EAC9BupB,EAAa,GAGbvB,EAAYlB,EAAEkB,UAAUphC,QAGzB,GAAKohC,EAAW,GACf,IAAM4E,KAAQ9F,EAAEyC,WACfA,EAAYqD,EAAK3iC,eAAkB68B,EAAEyC,WAAYqD,GAInDD,EAAU3E,EAAUnzB,QAGpB,MAAQ83B,EAcP,GAZK7F,EAAEwC,eAAgBqD,KACtBzE,EAAOpB,EAAEwC,eAAgBqD,IAAcP,IAIlCpsB,GAAQmsB,GAAarF,EAAE+F,aAC5BT,EAAWtF,EAAE+F,WAAYT,EAAUtF,EAAEiB,WAGtC/nB,EAAO2sB,EACPA,EAAU3E,EAAUnzB,QAKnB,GAAiB,MAAZ83B,EAEJA,EAAU3sB,OAGJ,GAAc,MAATA,GAAgBA,IAAS2sB,EAAU,CAM9C,KAHAC,EAAOrD,EAAYvpB,EAAO,IAAM2sB,IAAapD,EAAY,KAAOoD,IAI/D,IAAMD,KAASnD,EAId,IADArgB,EAAMwjB,EAAMj+B,MAAO,MACT,KAAQk+B,IAGjBC,EAAOrD,EAAYvpB,EAAO,IAAMkJ,EAAK,KACpCqgB,EAAY,KAAOrgB,EAAK,KACb,EAGG,IAAT0jB,EACJA,EAAOrD,EAAYmD,IAGgB,IAAxBnD,EAAYmD,KACvBC,EAAUzjB,EAAK,GACf8e,EAAUlf,QAASI,EAAK,KAEzB,MAOJ,IAAc,IAAT0jB,EAGJ,GAAKA,GAAQ9F,EAAEgG,UACdV,EAAWQ,EAAMR,QAEjB,IACCA,EAAWQ,EAAMR,GAChB,MAAQn5B,GACT,MAAO,CACNmQ,MAAO,cACPvW,MAAO+/B,EAAO35B,EAAI,sBAAwB+M,EAAO,OAAS2sB,IASjE,MAAO,CAAEvpB,MAAO,UAAWwE,KAAMwkB,GAidpBW,CAAajG,EAAGsF,EAAUlE,EAAOiE,GAGvCA,GAGCrF,EAAE8E,cACNS,EAAWnE,EAAM8C,kBAAmB,oBAEnCzhC,GAAOq/B,aAAcsB,GAAamC,IAEnCA,EAAWnE,EAAM8C,kBAAmB,WAEnCzhC,GAAOs/B,KAAMqB,GAAamC,IAKZ,MAAXhB,GAA6B,SAAXvE,EAAE7+B,KACxBsjC,EAAa,YAGS,MAAXF,EACXE,EAAa,eAIbA,EAAaa,EAAShpB,MACtB2oB,EAAUK,EAASxkB,KAEnBukB,IADAt/B,EAAQu/B,EAASv/B,UAMlBA,EAAQ0+B,GACHF,GAAWE,IACfA,EAAa,QACRF,EAAS,IACbA,EAAS,KAMZnD,EAAMmD,OAASA,EACfnD,EAAMqD,YAAeU,GAAoBV,GAAe,GAGnDY,EACJ7oB,EAASoB,YAAa+lB,EAAiB,CAAEsB,EAASR,EAAYrD,IAE9D5kB,EAASuB,WAAY4lB,EAAiB,CAAEvC,EAAOqD,EAAY1+B,IAI5Dq7B,EAAM0C,WAAYA,GAClBA,OAAar+B,EAERg+B,GACJG,EAAmBnc,QAAS4d,EAAY,cAAgB,YACvD,CAAEjE,EAAOpB,EAAGqF,EAAYJ,EAAUl/B,IAIpC89B,EAAiB3nB,SAAUynB,EAAiB,CAAEvC,EAAOqD,IAEhDhB,IACJG,EAAmBnc,QAAS,eAAgB,CAAE2Z,EAAOpB,MAG3Cv9B,GAAOo/B,QAChBp/B,GAAOskB,MAAMU,QAAS,cAKzB,OAAO2Z,GAGR8E,QAAS,SAAUlE,EAAKlhB,EAAM9c,GAC7B,OAAOvB,GAAOe,IAAKw+B,EAAKlhB,EAAM9c,EAAU,SAGzCmiC,UAAW,SAAUnE,EAAKh+B,GACzB,OAAOvB,GAAOe,IAAKw+B,OAAKv8B,EAAWzB,EAAU,aAI/CvB,GAAOsB,KAAM,CAAE,MAAO,QAAU,SAAU6D,EAAIiT,GAC7CpY,GAAQoY,GAAW,SAAUmnB,EAAKlhB,EAAM9c,EAAU7C,GAUjD,OAPKN,EAAYigB,KAChB3f,EAAOA,GAAQ6C,EACfA,EAAW8c,EACXA,OAAOrb,GAIDhD,GAAOygC,KAAMzgC,GAAOsC,OAAQ,CAClCi9B,IAAKA,EACL7gC,KAAM0Z,EACNomB,SAAU9/B,EACV2f,KAAMA,EACNmkB,QAASjhC,GACPvB,GAAO6C,cAAe08B,IAASA,OAIpCv/B,GAAOugC,cAAe,SAAUhD,GAC/B,IAAIr+B,EACJ,IAAMA,KAAKq+B,EAAE+E,QACa,iBAApBpjC,EAAEwB,gBACN68B,EAAEqC,YAAcrC,EAAE+E,QAASpjC,IAAO,MAMrCc,GAAO4rB,SAAW,SAAU2T,EAAKh9B,EAAStD,GACzC,OAAOe,GAAOygC,KAAM,CACnBlB,IAAKA,EAGL7gC,KAAM,MACN8/B,SAAU,SACVrzB,OAAO,EACPw0B,OAAO,EACPpjC,QAAQ,EAKRyjC,WAAY,CACX2D,cAAe,cAEhBL,WAAY,SAAUT,GACrB7iC,GAAO4D,WAAYi/B,EAAUtgC,EAAStD,OAMzCe,GAAOG,GAAGmC,OAAQ,CACjBshC,QAAS,SAAUjY,GAClB,IAAIlI,EAyBJ,OAvBK1mB,KAAM,KACLqB,EAAYutB,KAChBA,EAAOA,EAAKnuB,KAAMT,KAAM,KAIzB0mB,EAAOzjB,GAAQ2rB,EAAM5uB,KAAM,GAAIwH,eAAgB5C,GAAI,GAAIe,OAAO,GAEzD3F,KAAM,GAAI4C,YACd8jB,EAAK8I,aAAcxvB,KAAM,IAG1B0mB,EAAKjiB,IAAK,WACT,IAAIhB,EAAOzD,KAEX,MAAQyD,EAAKqjC,kBACZrjC,EAAOA,EAAKqjC,kBAGb,OAAOrjC,IACJ6rB,OAAQtvB,OAGNA,MAGR+mC,UAAW,SAAUnY,GACpB,OAAKvtB,EAAYutB,GACT5uB,KAAKuE,KAAM,SAAUpC,GAC3Bc,GAAQjD,MAAO+mC,UAAWnY,EAAKnuB,KAAMT,KAAMmC,MAItCnC,KAAKuE,KAAM,WACjB,IAAI2U,EAAOjW,GAAQjD,MAClByZ,EAAWP,EAAKO,WAEZA,EAASlW,OACbkW,EAASotB,QAASjY,GAGlB1V,EAAKoW,OAAQV,MAKhBlI,KAAM,SAAUkI,GACf,IAAIoY,EAAiB3lC,EAAYutB,GAEjC,OAAO5uB,KAAKuE,KAAM,SAAUpC,GAC3Bc,GAAQjD,MAAO6mC,QAASG,EAAiBpY,EAAKnuB,KAAMT,KAAMmC,GAAMysB,MAIlEqY,OAAQ,SAAU/jC,GAIjB,OAHAlD,KAAKuS,OAAQrP,GAAW+P,IAAK,QAAS1O,KAAM,WAC3CtB,GAAQjD,MAAO2vB,YAAa3vB,KAAK0M,cAE3B1M,QAKTiD,GAAOqN,KAAK9F,QAAQ6uB,OAAS,SAAU51B,GACtC,OAAQR,GAAOqN,KAAK9F,QAAQ08B,QAASzjC,IAEtCR,GAAOqN,KAAK9F,QAAQ08B,QAAU,SAAUzjC,GACvC,SAAWA,EAAK0uB,aAAe1uB,EAAK6vB,cAAgB7vB,EAAK4xB,iBAAiB9xB,SAM3EN,GAAOm/B,aAAa+E,IAAM,WACzB,IACC,OAAO,IAAIpnC,GAAOqnC,eACjB,MAAQz6B,MAGX,IAAI06B,GAAmB,CAGrBC,EAAG,IAIHC,KAAM,KAEPC,GAAevkC,GAAOm/B,aAAa+E,MAEpC/lC,GAAQqmC,OAASD,IAAkB,oBAAqBA,GACxDpmC,GAAQsiC,KAAO8D,KAAiBA,GAEhCvkC,GAAOwgC,cAAe,SAAUj+B,GAC/B,IAAIhB,EAAUkjC,EAGd,GAAKtmC,GAAQqmC,MAAQD,KAAiBhiC,EAAQ2/B,YAC7C,MAAO,CACNO,KAAM,SAAUH,EAAS1K,GACxB,IAAI14B,EACHglC,EAAM3hC,EAAQ2hC,MAWf,GATAA,EAAIQ,KACHniC,EAAQ7D,KACR6D,EAAQg9B,IACRh9B,EAAQo9B,MACRp9B,EAAQoiC,SACRpiC,EAAQyP,UAIJzP,EAAQqiC,UACZ,IAAM1lC,KAAKqD,EAAQqiC,UAClBV,EAAKhlC,GAAMqD,EAAQqiC,UAAW1lC,GAmBhC,IAAMA,KAdDqD,EAAQs/B,UAAYqC,EAAItC,kBAC5BsC,EAAItC,iBAAkBr/B,EAAQs/B,UAQzBt/B,EAAQ2/B,aAAgBI,EAAS,sBACtCA,EAAS,oBAAuB,kBAItBA,EACV4B,EAAIvC,iBAAkBziC,EAAGojC,EAASpjC,IAInCqC,EAAW,SAAU7C,GACpB,OAAO,WACD6C,IACJA,EAAWkjC,EAAgBP,EAAIW,OAC9BX,EAAIY,QAAUZ,EAAIa,QAAUb,EAAIc,UAC/Bd,EAAIe,mBAAqB,KAEb,UAATvmC,EACJwlC,EAAInC,QACgB,UAATrjC,EAKgB,iBAAfwlC,EAAIpC,OACflK,EAAU,EAAG,SAEbA,EAGCsM,EAAIpC,OACJoC,EAAIlC,YAINpK,EACCwM,GAAkBF,EAAIpC,SAAYoC,EAAIpC,OACtCoC,EAAIlC,WAK+B,UAAjCkC,EAAIgB,cAAgB,SACM,iBAArBhB,EAAIiB,aACV,CAAEC,OAAQlB,EAAIrB,UACd,CAAEvjC,KAAM4kC,EAAIiB,cACbjB,EAAIxC,4BAQTwC,EAAIW,OAAStjC,IACbkjC,EAAgBP,EAAIY,QAAUZ,EAAIc,UAAYzjC,EAAU,cAKnCyB,IAAhBkhC,EAAIa,QACRb,EAAIa,QAAUN,EAEdP,EAAIe,mBAAqB,WAGA,IAAnBf,EAAIpnB,YAMRhgB,GAAO2e,WAAY,WACbla,GACJkjC,OAQLljC,EAAWA,EAAU,SAErB,IAGC2iC,EAAIzB,KAAMlgC,EAAQ6/B,YAAc7/B,EAAQ8b,MAAQ,MAC/C,MAAQ3U,GAGT,GAAKnI,EACJ,MAAMmI,IAKTq4B,MAAO,WACDxgC,GACJA,QAWLvB,GAAOugC,cAAe,SAAUhD,GAC1BA,EAAE2E,cACN3E,EAAE/mB,SAASpX,QAAS,KAKtBY,GAAOqgC,UAAW,CACjBR,QAAS,CACRzgC,OAAQ,6FAGToX,SAAU,CACTpX,OAAQ,2BAET4gC,WAAY,CACX2D,cAAe,SAAUrkC,GAExB,OADAU,GAAO4D,WAAYtE,GACZA,MAMVU,GAAOugC,cAAe,SAAU,SAAUhD,QACxBv6B,IAAZu6B,EAAEpyB,QACNoyB,EAAEpyB,OAAQ,GAENoyB,EAAE2E,cACN3E,EAAE7+B,KAAO,SAKXsB,GAAOwgC,cAAe,SAAU,SAAUjD,GAIxC,IAAIn+B,EAAQmC,EADb,GAAKg8B,EAAE2E,aAAe3E,EAAE8H,YAEvB,MAAO,CACN5C,KAAM,SAAU/pB,EAAGkf,GAClBx4B,EAASY,GAAQ,YACfwN,KAAM+vB,EAAE8H,aAAe,IACvB/mB,KAAM,CAAEgnB,QAAS/H,EAAEgI,cAAe5mC,IAAK4+B,EAAEgC,MACzCrb,GAAI,aAAc3iB,EAAW,SAAUikC,GACvCpmC,EAAOka,SACP/X,EAAW,KACNikC,GACJ5N,EAAuB,UAAb4N,EAAI9mC,KAAmB,IAAM,IAAK8mC,EAAI9mC,QAKnD/B,EAAS8C,KAAKC,YAAaN,EAAQ,KAEpC2iC,MAAO,WACDxgC,GACJA,QAUL,IAqGKigB,GArGDikB,GAAe,GAClBC,GAAS,oBAGV1lC,GAAOqgC,UAAW,CACjBsF,MAAO,WACPC,cAAe,WACd,IAAIrkC,EAAWkkC,GAAargC,OAAWpF,GAAOiD,QAAU,IAAQrE,GAAMmG,OAEtE,OADAhI,KAAMwE,IAAa,EACZA,KAKTvB,GAAOugC,cAAe,aAAc,SAAUhD,EAAGsI,EAAkBlH,GAElE,IAAImH,EAAcC,EAAaC,EAC9BC,GAAuB,IAAZ1I,EAAEoI,QAAqBD,GAAOlhC,KAAM+4B,EAAEgC,KAChD,MACkB,iBAAXhC,EAAElf,MAE6C,KADnDkf,EAAEqC,aAAe,IACjBhiC,QAAS,sCACX8nC,GAAOlhC,KAAM+4B,EAAElf,OAAU,QAI5B,GAAK4nB,GAAiC,UAArB1I,EAAEkB,UAAW,GA8D7B,OA3DAqH,EAAevI,EAAEqI,cAAgBxnC,EAAYm/B,EAAEqI,eAC9CrI,EAAEqI,gBACFrI,EAAEqI,cAGEK,EACJ1I,EAAG0I,GAAa1I,EAAG0I,GAAW7iC,QAASsiC,GAAQ,KAAOI,IAC/B,IAAZvI,EAAEoI,QACbpI,EAAEgC,MAASrD,GAAO13B,KAAM+4B,EAAEgC,KAAQ,IAAM,KAAQhC,EAAEoI,MAAQ,IAAMG,GAIjEvI,EAAEyC,WAAY,eAAkB,WAI/B,OAHMgG,GACLhmC,GAAOsD,MAAOwiC,EAAe,mBAEvBE,EAAmB,IAI3BzI,EAAEkB,UAAW,GAAM,OAGnBsH,EAAcjpC,GAAQgpC,GACtBhpC,GAAQgpC,GAAiB,WACxBE,EAAoBvkC,WAIrBk9B,EAAM7kB,OAAQ,gBAGQ9W,IAAhB+iC,EACJ/lC,GAAQlD,IAASm+B,WAAY6K,GAI7BhpC,GAAQgpC,GAAiBC,EAIrBxI,EAAGuI,KAGPvI,EAAEqI,cAAgBC,EAAiBD,cAGnCH,GAAa9nC,KAAMmoC,IAIfE,GAAqB5nC,EAAY2nC,IACrCA,EAAaC,EAAmB,IAGjCA,EAAoBD,OAAc/iC,IAI5B,WAYT7E,GAAQ+nC,qBACH1kB,GAAO7kB,EAASwpC,eAAeD,mBAAoB,IAAK1kB,MACvDtU,UAAY,6BACiB,IAA3BsU,GAAK/X,WAAWnJ,QAQxBN,GAAOmW,UAAY,SAAUkI,EAAMne,EAASkmC,GAC3C,MAAqB,iBAAT/nB,EACJ,IAEgB,kBAAZne,IACXkmC,EAAclmC,EACdA,GAAU,GAKLA,IAIA/B,GAAQ+nC,qBAMZxzB,GALAxS,EAAUvD,EAASwpC,eAAeD,mBAAoB,KAKvC7mC,cAAe,SACzB0R,KAAOpU,EAAS6T,SAASO,KAC9B7Q,EAAQT,KAAKC,YAAagT,IAE1BxS,EAAUvD,GAKZ2mB,GAAW8iB,GAAe,IAD1BC,EAASvwB,EAAW1L,KAAMiU,IAKlB,CAAEne,EAAQb,cAAegnC,EAAQ,MAGzCA,EAAShjB,GAAe,CAAEhF,GAAQne,EAASojB,GAEtCA,GAAWA,EAAQhjB,QACvBN,GAAQsjB,GAAUhK,SAGZtZ,GAAOoB,MAAO,GAAIilC,EAAO58B,cAlChC,IAAIiJ,EAAM2zB,EAAQ/iB,GAyCnBtjB,GAAOG,GAAGonB,KAAO,SAAUgY,EAAK+G,EAAQ/kC,GACvC,IAAItB,EAAUvB,EAAMmkC,EACnB5sB,EAAOlZ,KACPwnB,EAAMgb,EAAI3hC,QAAS,KAsDpB,OApDY,EAAP2mB,IACJtkB,EAAW66B,GAAkByE,EAAIliC,MAAOknB,IACxCgb,EAAMA,EAAIliC,MAAO,EAAGknB,IAIhBnmB,EAAYkoC,IAGhB/kC,EAAW+kC,EACXA,OAAStjC,GAGEsjC,GAA4B,iBAAXA,IAC5B5nC,EAAO,QAIW,EAAduX,EAAK3V,QACTN,GAAOygC,KAAM,CACZlB,IAAKA,EAKL7gC,KAAMA,GAAQ,MACd8/B,SAAU,OACVngB,KAAMioB,IACHz/B,KAAM,SAAUs+B,GAGnBtC,EAAWphC,UAEXwU,EAAK0V,KAAM1rB,EAIVD,GAAQ,SAAUqsB,OAAQrsB,GAAOmW,UAAWgvB,IAAiBv7B,KAAM3J,GAGnEklC,KAKErrB,OAAQvY,GAAY,SAAUo9B,EAAOmD,GACxC7rB,EAAK3U,KAAM,WACVC,EAAS7D,MAAOX,KAAM8lC,GAAY,CAAElE,EAAMwG,aAAcrD,EAAQnD,QAK5D5hC,MAMRiD,GAAOqN,KAAK9F,QAAQg/B,SAAW,SAAU/lC,GACxC,OAAOR,GAAO8B,KAAM9B,GAAOo5B,OAAQ,SAAUj5B,GAC5C,OAAOK,IAASL,EAAGK,OAChBF,QAMLN,GAAOwmC,OAAS,CACfC,UAAW,SAAUjmC,EAAM+B,EAASrD,GACnC,IAAIwnC,EAAaC,EAASC,EAAWC,EAAQC,EAAWC,EACvD/X,EAAWhvB,GAAOwgB,IAAKhgB,EAAM,YAC7BwmC,EAAUhnC,GAAQQ,GAClBonB,EAAQ,GAGS,WAAboH,IACJxuB,EAAK8f,MAAM0O,SAAW,YAGvB8X,EAAYE,EAAQR,SACpBI,EAAY5mC,GAAOwgB,IAAKhgB,EAAM,OAC9BumC,EAAa/mC,GAAOwgB,IAAKhgB,EAAM,SACI,aAAbwuB,GAAwC,UAAbA,KACA,GAA9C4X,EAAYG,GAAanpC,QAAS,SAMpCipC,GADAH,EAAcM,EAAQhY,YACD3iB,IACrBs6B,EAAUD,EAAYpS,OAGtBuS,EAASxX,WAAYuX,IAAe,EACpCD,EAAUtX,WAAY0X,IAAgB,GAGlC3oC,EAAYmE,KAGhBA,EAAUA,EAAQ/E,KAAMgD,EAAMtB,EAAGc,GAAOsC,OAAQ,GAAIwkC,KAGjC,MAAfvkC,EAAQ8J,MACZub,EAAMvb,IAAQ9J,EAAQ8J,IAAMy6B,EAAUz6B,IAAQw6B,GAE1B,MAAhBtkC,EAAQ+xB,OACZ1M,EAAM0M,KAAS/xB,EAAQ+xB,KAAOwS,EAAUxS,KAASqS,GAG7C,UAAWpkC,EACfA,EAAQ0kC,MAAMzpC,KAAMgD,EAAMonB,GAG1Bof,EAAQxmB,IAAKoH,KAKhB5nB,GAAOG,GAAGmC,OAAQ,CAGjBkkC,OAAQ,SAAUjkC,GAGjB,GAAKd,UAAUnB,OACd,YAAmB0C,IAAZT,EACNxF,KACAA,KAAKuE,KAAM,SAAUpC,GACpBc,GAAOwmC,OAAOC,UAAW1pC,KAAMwF,EAASrD,KAI3C,IAAIgoC,EAAMC,EACT3mC,EAAOzD,KAAM,GAEd,OAAMyD,EAQAA,EAAK4xB,iBAAiB9xB,QAK5B4mC,EAAO1mC,EAAK4zB,wBACZ+S,EAAM3mC,EAAK+D,cAAc6H,YAClB,CACNC,IAAK66B,EAAK76B,IAAM86B,EAAIC,YACpB9S,KAAM4S,EAAK5S,KAAO6S,EAAIE,cARf,CAAEh7B,IAAK,EAAGioB,KAAM,QATxB,GAuBDtF,SAAU,WACT,GAAMjyB,KAAM,GAAZ,CAIA,IAAIuqC,EAAcd,EAAQvnC,EACzBuB,EAAOzD,KAAM,GACbwqC,EAAe,CAAEl7B,IAAK,EAAGioB,KAAM,GAGhC,GAAwC,UAAnCt0B,GAAOwgB,IAAKhgB,EAAM,YAGtBgmC,EAAShmC,EAAK4zB,4BAER,CACNoS,EAASzpC,KAAKypC,SAIdvnC,EAAMuB,EAAK+D,cACX+iC,EAAe9mC,EAAK8mC,cAAgBroC,EAAI6E,gBACxC,MAAQwjC,IACLA,IAAiBroC,EAAIuiB,MAAQ8lB,IAAiBroC,EAAI6E,kBACT,WAA3C9D,GAAOwgB,IAAK8mB,EAAc,YAE1BA,EAAeA,EAAa3nC,WAExB2nC,GAAgBA,IAAiB9mC,GAAkC,IAA1B8mC,EAAahpC,YAG1DipC,EAAevnC,GAAQsnC,GAAed,UACzBn6B,KAAOrM,GAAOwgB,IAAK8mB,EAAc,kBAAkB,GAChEC,EAAajT,MAAQt0B,GAAOwgB,IAAK8mB,EAAc,mBAAmB,IAKpE,MAAO,CACNj7B,IAAKm6B,EAAOn6B,IAAMk7B,EAAal7B,IAAMrM,GAAOwgB,IAAKhgB,EAAM,aAAa,GACpE8zB,KAAMkS,EAAOlS,KAAOiT,EAAajT,KAAOt0B,GAAOwgB,IAAKhgB,EAAM,cAAc,MAc1E8mC,aAAc,WACb,OAAOvqC,KAAKyE,IAAK,WAChB,IAAI8lC,EAAevqC,KAAKuqC,aAExB,MAAQA,GAA2D,WAA3CtnC,GAAOwgB,IAAK8mB,EAAc,YACjDA,EAAeA,EAAaA,aAG7B,OAAOA,GAAgBxjC,OAM1B9D,GAAOsB,KAAM,CAAEk0B,WAAY,cAAeD,UAAW,eAAiB,SAAUnd,EAAQkG,GACvF,IAAIjS,EAAM,gBAAkBiS,EAE5Bte,GAAOG,GAAIiY,GAAW,SAAUjZ,GAC/B,OAAO6d,EAAQjgB,KAAM,SAAUyD,EAAM4X,EAAQjZ,GAG5C,IAAIgoC,EAOJ,GANK3oC,EAAUgC,GACd2mC,EAAM3mC,EACuB,IAAlBA,EAAKlC,WAChB6oC,EAAM3mC,EAAK4L,kBAGCpJ,IAAR7D,EACJ,OAAOgoC,EAAMA,EAAK7oB,GAAS9d,EAAM4X,GAG7B+uB,EACJA,EAAIK,SACFn7B,EAAY86B,EAAIE,YAAVloC,EACPkN,EAAMlN,EAAMgoC,EAAIC,aAIjB5mC,EAAM4X,GAAWjZ,GAEhBiZ,EAAQjZ,EAAKsC,UAAUnB,WAU5BN,GAAOsB,KAAM,CAAE,MAAO,QAAU,SAAU6D,EAAImZ,GAC7Cte,GAAOuyB,SAAUjU,GAAS4P,GAAc/vB,GAAQuxB,cAC/C,SAAUlvB,EAAMmtB,GACf,GAAKA,EAIJ,OAHAA,EAAWD,GAAQltB,EAAM8d,GAGlB4O,GAAU1oB,KAAMmpB,GACtB3tB,GAAQQ,GAAOwuB,WAAY1Q,GAAS,KACpCqP,MAQL3tB,GAAOsB,KAAM,CAAEmmC,OAAQ,SAAUC,MAAO,SAAW,SAAUjnC,EAAM/B,GAClEsB,GAAOsB,KAAM,CACZkzB,QAAS,QAAU/zB,EACnBgX,QAAS/Y,EACTipC,GAAI,QAAUlnC,GACZ,SAAUmnC,EAAcC,GAG1B7nC,GAAOG,GAAI0nC,GAAa,SAAUtT,EAAQzvB,GACzC,IAAImY,EAAYxb,UAAUnB,SAAYsnC,GAAkC,kBAAXrT,GAC5D1C,EAAQ+V,KAA6B,IAAXrT,IAA6B,IAAVzvB,EAAiB,SAAW,UAE1E,OAAOkY,EAAQjgB,KAAM,SAAUyD,EAAM9B,EAAMoG,GAC1C,IAAI7F,EAEJ,OAAKT,EAAUgC,GAGyB,IAAhCqnC,EAASjqC,QAAS,SACxB4C,EAAM,QAAUC,GAChBD,EAAK7D,SAASmH,gBAAiB,SAAWrD,GAIrB,IAAlBD,EAAKlC,UACTW,EAAMuB,EAAKsD,gBAIJZ,KAAKouB,IACX9wB,EAAKghB,KAAM,SAAW/gB,GAAQxB,EAAK,SAAWwB,GAC9CD,EAAKghB,KAAM,SAAW/gB,GAAQxB,EAAK,SAAWwB,GAC9CxB,EAAK,SAAWwB,UAIDuC,IAAV8B,EAGN9E,GAAOwgB,IAAKhgB,EAAM9B,EAAMmzB,GAGxB7xB,GAAOsgB,MAAO9f,EAAM9B,EAAMoG,EAAO+sB,IAChCnzB,EAAMue,EAAYsX,OAASvxB,EAAWia,QAM5Cjd,GAAOsB,KAAM,CACZ,YACA,WACA,eACA,YACA,cACA,YACE,SAAU6D,EAAIzG,GAChBsB,GAAOG,GAAIzB,GAAS,SAAUyB,GAC7B,OAAOpD,KAAKmnB,GAAIxlB,EAAMyB,MAOxBH,GAAOG,GAAGmC,OAAQ,CAEjBq1B,KAAM,SAAUxT,EAAO9F,EAAMle,GAC5B,OAAOpD,KAAKmnB,GAAIC,EAAO,KAAM9F,EAAMle,IAEpC2nC,OAAQ,SAAU3jB,EAAOhkB,GACxB,OAAOpD,KAAKwnB,IAAKJ,EAAO,KAAMhkB,IAG/B4nC,SAAU,SAAU9nC,EAAUkkB,EAAO9F,EAAMle,GAC1C,OAAOpD,KAAKmnB,GAAIC,EAAOlkB,EAAUoe,EAAMle,IAExC6nC,WAAY,SAAU/nC,EAAUkkB,EAAOhkB,GAGtC,OAA4B,IAArBsB,UAAUnB,OAChBvD,KAAKwnB,IAAKtkB,EAAU,MACpBlD,KAAKwnB,IAAKJ,EAAOlkB,GAAY,KAAME,IAGrC8nC,MAAO,SAAUC,EAAQC,GACxB,OAAOprC,KACLmnB,GAAI,aAAcgkB,GAClBhkB,GAAI,aAAcikB,GAASD,MAI/BloC,GAAOsB,KACN,wLAE4D4D,MAAO,KACnE,SAAUC,EAAI1E,GAGbT,GAAOG,GAAIM,GAAS,SAAU4d,EAAMle,GACnC,OAA0B,EAAnBsB,UAAUnB,OAChBvD,KAAKmnB,GAAIzjB,EAAM,KAAM4d,EAAMle,GAC3BpD,KAAKioB,QAASvkB,MAYlB,IAAI2nC,GAAQ,sDAMZpoC,GAAOqoC,MAAQ,SAAUloC,EAAID,GAC5B,IAAIyf,EAAK/P,EAAMy4B,EAUf,GARwB,iBAAZnoC,IACXyf,EAAMxf,EAAID,GACVA,EAAUC,EACVA,EAAKwf,GAKAvhB,EAAY+B,GAalB,OARAyP,EAAOvS,GAAMG,KAAMiE,UAAW,IAC9B4mC,EAAQ,WACP,OAAOloC,EAAGzC,MAAOwC,GAAWnD,KAAM6S,EAAKnS,OAAQJ,GAAMG,KAAMiE,eAItDsD,KAAO5E,EAAG4E,KAAO5E,EAAG4E,MAAQ/E,GAAO+E,OAElCsjC,GAGRroC,GAAOsoC,UAAY,SAAUC,GACvBA,EACJvoC,GAAO4c,YAEP5c,GAAOoW,OAAO,IAGhBpW,GAAO+C,QAAUD,MAAMC,QACvB/C,GAAOwoC,UAAY3pB,KAAKC,MACxB9e,GAAOO,SAAWA,GAClBP,GAAO5B,WAAaA,EACpB4B,GAAOxB,SAAWA,EAClBwB,GAAO4d,UAAYA,EACnB5d,GAAOtB,KAAOmB,EAEdG,GAAOkoB,IAAMD,KAAKC,IAElBloB,GAAOyoC,UAAY,SAAUpqC,GAK5B,IAAIK,EAAOsB,GAAOtB,KAAML,GACxB,OAAkB,WAATK,GAA8B,WAATA,KAK5BgqC,MAAOrqC,EAAMgxB,WAAYhxB,KAG5B2B,GAAO2oC,KAAO,SAAUrpC,GACvB,OAAe,MAARA,EACN,IACEA,EAAO,IAAK8D,QAASglC,GAAO,OAkBT,mBAAXQ,QAAyBA,OAAOC,KAC3CD,OAAQ,SAAU,GAAI,WACrB,OAAO5oC,KAOT,IAGC8oC,GAAUhsC,GAAOkD,OAGjB+oC,GAAKjsC,GAAOksC,EAwBb,OAtBAhpC,GAAOipC,WAAa,SAAUrmC,GAS7B,OARK9F,GAAOksC,IAAMhpC,KACjBlD,GAAOksC,EAAID,IAGPnmC,GAAQ9F,GAAOkD,SAAWA,KAC9BlD,GAAOkD,OAAS8oC,IAGV9oC,IAMiB,oBAAbhD,IACXF,GAAOkD,OAASlD,GAAOksC,EAAIhpC,IAMrBA","file":"jquery-3.7.1.min.js"} \ No newline at end of file
diff --git a/bitbake/lib/toaster/toastergui/static/js/jquery.dataTables-1.13.8.min.js b/bitbake/lib/toaster/toastergui/static/js/jquery.dataTables-1.13.8.min.js
new file mode 100644
index 0000000000..b6d9aa8c79
--- /dev/null
+++ b/bitbake/lib/toaster/toastergui/static/js/jquery.dataTables-1.13.8.min.js
@@ -0,0 +1,4 @@
+/*! DataTables 1.13.8
+ * ©2008-2023 SpryMedia Ltd - datatables.net/license
+ */
+!function(n){"use strict";var a;"function"==typeof define&&define.amd?define(["jquery"],function(t){return n(t,window,document)}):"object"==typeof exports?(a=require("jquery"),"undefined"==typeof window?module.exports=function(t,e){return t=t||window,e=e||a(t),n(e,t,t.document)}:module.exports=n(a,window,window.document)):window.DataTable=n(jQuery,window,document)}(function(P,j,v,H){"use strict";function d(t){var e=parseInt(t,10);return!isNaN(e)&&isFinite(t)?e:null}function l(t,e,n){var a=typeof t,r="string"==a;return"number"==a||"bigint"==a||!!h(t)||(e&&r&&(t=$(t,e)),n&&r&&(t=t.replace(q,"")),!isNaN(parseFloat(t))&&isFinite(t))}function a(t,e,n){var a;return!!h(t)||(h(a=t)||"string"==typeof a)&&!!l(t.replace(V,"").replace(/<script/i,""),e,n)||null}function m(t,e,n,a){var r=[],o=0,i=e.length;if(a!==H)for(;o<i;o++)t[e[o]][n]&&r.push(t[e[o]][n][a]);else for(;o<i;o++)r.push(t[e[o]][n]);return r}function f(t,e){var n,a=[];e===H?(e=0,n=t):(n=e,e=t);for(var r=e;r<n;r++)a.push(r);return a}function _(t){for(var e=[],n=0,a=t.length;n<a;n++)t[n]&&e.push(t[n]);return e}function s(t,e){return-1!==this.indexOf(t,e=e===H?0:e)}var p,e,t,w=function(t,v){if(w.factory(t,v))return w;if(this instanceof w)return P(t).DataTable(v);v=t,this.$=function(t,e){return this.api(!0).$(t,e)},this._=function(t,e){return this.api(!0).rows(t,e).data()},this.api=function(t){return new B(t?ge(this[p.iApiIndex]):this)},this.fnAddData=function(t,e){var n=this.api(!0),t=(Array.isArray(t)&&(Array.isArray(t[0])||P.isPlainObject(t[0]))?n.rows:n.row).add(t);return e!==H&&!e||n.draw(),t.flatten().toArray()},this.fnAdjustColumnSizing=function(t){var e=this.api(!0).columns.adjust(),n=e.settings()[0],a=n.oScroll;t===H||t?e.draw(!1):""===a.sX&&""===a.sY||Qt(n)},this.fnClearTable=function(t){var e=this.api(!0).clear();t!==H&&!t||e.draw()},this.fnClose=function(t){this.api(!0).row(t).child.hide()},this.fnDeleteRow=function(t,e,n){var a=this.api(!0),t=a.rows(t),r=t.settings()[0],o=r.aoData[t[0][0]];return t.remove(),e&&e.call(this,r,o),n!==H&&!n||a.draw(),o},this.fnDestroy=function(t){this.api(!0).destroy(t)},this.fnDraw=function(t){this.api(!0).draw(t)},this.fnFilter=function(t,e,n,a,r,o){var i=this.api(!0);(null===e||e===H?i:i.column(e)).search(t,n,a,o),i.draw()},this.fnGetData=function(t,e){var n,a=this.api(!0);return t!==H?(n=t.nodeName?t.nodeName.toLowerCase():"",e!==H||"td"==n||"th"==n?a.cell(t,e).data():a.row(t).data()||null):a.data().toArray()},this.fnGetNodes=function(t){var e=this.api(!0);return t!==H?e.row(t).node():e.rows().nodes().flatten().toArray()},this.fnGetPosition=function(t){var e=this.api(!0),n=t.nodeName.toUpperCase();return"TR"==n?e.row(t).index():"TD"==n||"TH"==n?[(n=e.cell(t).index()).row,n.columnVisible,n.column]:null},this.fnIsOpen=function(t){return this.api(!0).row(t).child.isShown()},this.fnOpen=function(t,e,n){return this.api(!0).row(t).child(e,n).show().child()[0]},this.fnPageChange=function(t,e){t=this.api(!0).page(t);e!==H&&!e||t.draw(!1)},this.fnSetColumnVis=function(t,e,n){t=this.api(!0).column(t).visible(e);n!==H&&!n||t.columns.adjust().draw()},this.fnSettings=function(){return ge(this[p.iApiIndex])},this.fnSort=function(t){this.api(!0).order(t).draw()},this.fnSortListener=function(t,e,n){this.api(!0).order.listener(t,e,n)},this.fnUpdate=function(t,e,n,a,r){var o=this.api(!0);return(n===H||null===n?o.row(e):o.cell(e,n)).data(t),r!==H&&!r||o.columns.adjust(),a!==H&&!a||o.draw(),0},this.fnVersionCheck=p.fnVersionCheck;var e,y=this,D=v===H,_=this.length;for(e in D&&(v={}),this.oApi=this.internal=p.internal,w.ext.internal)e&&(this[e]=$e(e));return this.each(function(){var r=1<_?be({},v,!0):v,o=0,t=this.getAttribute("id"),i=!1,e=w.defaults,l=P(this);if("table"!=this.nodeName.toLowerCase())W(null,0,"Non-table node initialisation ("+this.nodeName+")",2);else{K(e),Q(e.column),C(e,e,!0),C(e.column,e.column,!0),C(e,P.extend(r,l.data()),!0);for(var n=w.settings,o=0,s=n.length;o<s;o++){var a=n[o];if(a.nTable==this||a.nTHead&&a.nTHead.parentNode==this||a.nTFoot&&a.nTFoot.parentNode==this){var u=(r.bRetrieve!==H?r:e).bRetrieve,c=(r.bDestroy!==H?r:e).bDestroy;if(D||u)return a.oInstance;if(c){a.oInstance.fnDestroy();break}return void W(a,0,"Cannot reinitialise DataTable",3)}if(a.sTableId==this.id){n.splice(o,1);break}}null!==t&&""!==t||(t="DataTables_Table_"+w.ext._unique++,this.id=t);var f,d,h=P.extend(!0,{},w.models.oSettings,{sDestroyWidth:l[0].style.width,sInstance:t,sTableId:t}),p=(h.nTable=this,h.oApi=y.internal,h.oInit=r,n.push(h),h.oInstance=1===y.length?y:l.dataTable(),K(r),Z(r.oLanguage),r.aLengthMenu&&!r.iDisplayLength&&(r.iDisplayLength=(Array.isArray(r.aLengthMenu[0])?r.aLengthMenu[0]:r.aLengthMenu)[0]),r=be(P.extend(!0,{},e),r),F(h.oFeatures,r,["bPaginate","bLengthChange","bFilter","bSort","bSortMulti","bInfo","bProcessing","bAutoWidth","bSortClasses","bServerSide","bDeferRender"]),F(h,r,["asStripeClasses","ajax","fnServerData","fnFormatNumber","sServerMethod","aaSorting","aaSortingFixed","aLengthMenu","sPaginationType","sAjaxSource","sAjaxDataProp","iStateDuration","sDom","bSortCellsTop","iTabIndex","fnStateLoadCallback","fnStateSaveCallback","renderer","searchDelay","rowId",["iCookieDuration","iStateDuration"],["oSearch","oPreviousSearch"],["aoSearchCols","aoPreSearchCols"],["iDisplayLength","_iDisplayLength"]]),F(h.oScroll,r,[["sScrollX","sX"],["sScrollXInner","sXInner"],["sScrollY","sY"],["bScrollCollapse","bCollapse"]]),F(h.oLanguage,r,"fnInfoCallback"),L(h,"aoDrawCallback",r.fnDrawCallback,"user"),L(h,"aoServerParams",r.fnServerParams,"user"),L(h,"aoStateSaveParams",r.fnStateSaveParams,"user"),L(h,"aoStateLoadParams",r.fnStateLoadParams,"user"),L(h,"aoStateLoaded",r.fnStateLoaded,"user"),L(h,"aoRowCallback",r.fnRowCallback,"user"),L(h,"aoRowCreatedCallback",r.fnCreatedRow,"user"),L(h,"aoHeaderCallback",r.fnHeaderCallback,"user"),L(h,"aoFooterCallback",r.fnFooterCallback,"user"),L(h,"aoInitComplete",r.fnInitComplete,"user"),L(h,"aoPreDrawCallback",r.fnPreDrawCallback,"user"),h.rowIdFn=A(r.rowId),tt(h),h.oClasses),g=(P.extend(p,w.ext.classes,r.oClasses),l.addClass(p.sTable),h.iInitDisplayStart===H&&(h.iInitDisplayStart=r.iDisplayStart,h._iDisplayStart=r.iDisplayStart),null!==r.iDeferLoading&&(h.bDeferLoading=!0,t=Array.isArray(r.iDeferLoading),h._iRecordsDisplay=t?r.iDeferLoading[0]:r.iDeferLoading,h._iRecordsTotal=t?r.iDeferLoading[1]:r.iDeferLoading),h.oLanguage),t=(P.extend(!0,g,r.oLanguage),g.sUrl?(P.ajax({dataType:"json",url:g.sUrl,success:function(t){C(e.oLanguage,t),Z(t),P.extend(!0,g,t,h.oInit.oLanguage),R(h,null,"i18n",[h]),Jt(h)},error:function(){Jt(h)}}),i=!0):R(h,null,"i18n",[h]),null===r.asStripeClasses&&(h.asStripeClasses=[p.sStripeOdd,p.sStripeEven]),h.asStripeClasses),b=l.children("tbody").find("tr").eq(0),m=(-1!==P.inArray(!0,P.map(t,function(t,e){return b.hasClass(t)}))&&(P("tbody tr",this).removeClass(t.join(" ")),h.asDestroyStripes=t.slice()),[]),t=this.getElementsByTagName("thead");if(0!==t.length&&(wt(h.aoHeader,t[0]),m=Ct(h)),null===r.aoColumns)for(f=[],o=0,s=m.length;o<s;o++)f.push(null);else f=r.aoColumns;for(o=0,s=f.length;o<s;o++)nt(h,m?m[o]:null);st(h,r.aoColumnDefs,f,function(t,e){at(h,t,e)}),b.length&&(d=function(t,e){return null!==t.getAttribute("data-"+e)?e:null},P(b[0]).children("th, td").each(function(t,e){var n,a=h.aoColumns[t];a||W(h,0,"Incorrect column count",18),a.mData===t&&(n=d(e,"sort")||d(e,"order"),e=d(e,"filter")||d(e,"search"),null===n&&null===e||(a.mData={_:t+".display",sort:null!==n?t+".@data-"+n:H,type:null!==n?t+".@data-"+n:H,filter:null!==e?t+".@data-"+e:H},a._isArrayHost=!0,at(h,t)))}));var S=h.oFeatures,t=function(){if(r.aaSorting===H){var t=h.aaSorting;for(o=0,s=t.length;o<s;o++)t[o][1]=h.aoColumns[o].asSorting[0]}ce(h),S.bSort&&L(h,"aoDrawCallback",function(){var t,n;h.bSorted&&(t=I(h),n={},P.each(t,function(t,e){n[e.src]=e.dir}),R(h,null,"order",[h,t,n]),le(h))}),L(h,"aoDrawCallback",function(){(h.bSorted||"ssp"===E(h)||S.bDeferRender)&&ce(h)},"sc");var e=l.children("caption").each(function(){this._captionSide=P(this).css("caption-side")}),n=l.children("thead"),a=(0===n.length&&(n=P("<thead/>").appendTo(l)),h.nTHead=n[0],l.children("tbody")),n=(0===a.length&&(a=P("<tbody/>").insertAfter(n)),h.nTBody=a[0],l.children("tfoot"));if(0===(n=0===n.length&&0<e.length&&(""!==h.oScroll.sX||""!==h.oScroll.sY)?P("<tfoot/>").appendTo(l):n).length||0===n.children().length?l.addClass(p.sNoFooter):0<n.length&&(h.nTFoot=n[0],wt(h.aoFooter,h.nTFoot)),r.aaData)for(o=0;o<r.aaData.length;o++)x(h,r.aaData[o]);else!h.bDeferLoading&&"dom"!=E(h)||ut(h,P(h.nTBody).children("tr"));h.aiDisplay=h.aiDisplayMaster.slice(),!(h.bInitialised=!0)===i&&Jt(h)};L(h,"aoDrawCallback",de,"state_save"),r.bStateSave?(S.bStateSave=!0,he(h,0,t)):t()}}),y=null,this},c={},U=/[\r\n\u2028]/g,V=/<.*?>/g,X=/^\d{2,4}[\.\/\-]\d{1,2}[\.\/\-]\d{1,2}([T ]{1}\d{1,2}[:\.]\d{2}([\.:]\d{2})?)?$/,J=new RegExp("(\\"+["/",".","*","+","?","|","(",")","[","]","{","}","\\","$","^","-"].join("|\\")+")","g"),q=/['\u00A0,$£€¥%\u2009\u202F\u20BD\u20a9\u20BArfkɃΞ]/gi,h=function(t){return!t||!0===t||"-"===t},$=function(t,e){return c[e]||(c[e]=new RegExp(Ot(e),"g")),"string"==typeof t&&"."!==e?t.replace(/\./g,"").replace(c[e],"."):t},N=function(t,e,n){var a=[],r=0,o=t.length;if(n!==H)for(;r<o;r++)t[r]&&t[r][e]&&a.push(t[r][e][n]);else for(;r<o;r++)t[r]&&a.push(t[r][e]);return a},G=function(t){if(!(t.length<2))for(var e=t.slice().sort(),n=e[0],a=1,r=e.length;a<r;a++){if(e[a]===n)return!1;n=e[a]}return!0},z=function(t){if(G(t))return t.slice();var e,n,a,r=[],o=t.length,i=0;t:for(n=0;n<o;n++){for(e=t[n],a=0;a<i;a++)if(r[a]===e)continue t;r.push(e),i++}return r},Y=function(t,e){if(Array.isArray(e))for(var n=0;n<e.length;n++)Y(t,e[n]);else t.push(e);return t};function i(n){var a,r,o={};P.each(n,function(t,e){(a=t.match(/^([^A-Z]+?)([A-Z])/))&&-1!=="a aa ai ao as b fn i m o s ".indexOf(a[1]+" ")&&(r=t.replace(a[0],a[2].toLowerCase()),o[r]=t,"o"===a[1])&&i(n[t])}),n._hungarianMap=o}function C(n,a,r){var o;n._hungarianMap||i(n),P.each(a,function(t,e){(o=n._hungarianMap[t])===H||!r&&a[o]!==H||("o"===o.charAt(0)?(a[o]||(a[o]={}),P.extend(!0,a[o],a[t]),C(n[o],a[o],r)):a[o]=a[t])})}function Z(t){var e,n=w.defaults.oLanguage,a=n.sDecimal;a&&Me(a),t&&(e=t.sZeroRecords,!t.sEmptyTable&&e&&"No data available in table"===n.sEmptyTable&&F(t,t,"sZeroRecords","sEmptyTable"),!t.sLoadingRecords&&e&&"Loading..."===n.sLoadingRecords&&F(t,t,"sZeroRecords","sLoadingRecords"),t.sInfoThousands&&(t.sThousands=t.sInfoThousands),e=t.sDecimal)&&a!==e&&Me(e)}Array.isArray||(Array.isArray=function(t){return"[object Array]"===Object.prototype.toString.call(t)}),Array.prototype.includes||(Array.prototype.includes=s),String.prototype.trim||(String.prototype.trim=function(){return this.replace(/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,"")}),String.prototype.includes||(String.prototype.includes=s),w.util={throttle:function(a,t){var r,o,i=t!==H?t:200;return function(){var t=this,e=+new Date,n=arguments;r&&e<r+i?(clearTimeout(o),o=setTimeout(function(){r=H,a.apply(t,n)},i)):(r=e,a.apply(t,n))}},escapeRegex:function(t){return t.replace(J,"\\$1")},set:function(a){var d;return P.isPlainObject(a)?w.util.set(a._):null===a?function(){}:"function"==typeof a?function(t,e,n){a(t,"set",e,n)}:"string"!=typeof a||-1===a.indexOf(".")&&-1===a.indexOf("[")&&-1===a.indexOf("(")?function(t,e){t[a]=e}:(d=function(t,e,n){for(var a,r,o,i,l=dt(n),n=l[l.length-1],s=0,u=l.length-1;s<u;s++){if("__proto__"===l[s]||"constructor"===l[s])throw new Error("Cannot set prototype values");if(a=l[s].match(ft),r=l[s].match(g),a){if(l[s]=l[s].replace(ft,""),t[l[s]]=[],(a=l.slice()).splice(0,s+1),i=a.join("."),Array.isArray(e))for(var c=0,f=e.length;c<f;c++)d(o={},e[c],i),t[l[s]].push(o);else t[l[s]]=e;return}r&&(l[s]=l[s].replace(g,""),t=t[l[s]](e)),null!==t[l[s]]&&t[l[s]]!==H||(t[l[s]]={}),t=t[l[s]]}n.match(g)?t[n.replace(g,"")](e):t[n.replace(ft,"")]=e},function(t,e){return d(t,e,a)})},get:function(r){var o,d;return P.isPlainObject(r)?(o={},P.each(r,function(t,e){e&&(o[t]=w.util.get(e))}),function(t,e,n,a){var r=o[e]||o._;return r!==H?r(t,e,n,a):t}):null===r?function(t){return t}:"function"==typeof r?function(t,e,n,a){return r(t,e,n,a)}:"string"!=typeof r||-1===r.indexOf(".")&&-1===r.indexOf("[")&&-1===r.indexOf("(")?function(t,e){return t[r]}:(d=function(t,e,n){var a,r,o;if(""!==n)for(var i=dt(n),l=0,s=i.length;l<s;l++){if(f=i[l].match(ft),a=i[l].match(g),f){if(i[l]=i[l].replace(ft,""),""!==i[l]&&(t=t[i[l]]),r=[],i.splice(0,l+1),o=i.join("."),Array.isArray(t))for(var u=0,c=t.length;u<c;u++)r.push(d(t[u],e,o));var f=f[0].substring(1,f[0].length-1);t=""===f?r:r.join(f);break}if(a)i[l]=i[l].replace(g,""),t=t[i[l]]();else{if(null===t||null===t[i[l]])return null;if(t===H||t[i[l]]===H)return H;t=t[i[l]]}}return t},function(t,e){return d(t,e,r)})}};var r=function(t,e,n){t[e]!==H&&(t[n]=t[e])};function K(t){r(t,"ordering","bSort"),r(t,"orderMulti","bSortMulti"),r(t,"orderClasses","bSortClasses"),r(t,"orderCellsTop","bSortCellsTop"),r(t,"order","aaSorting"),r(t,"orderFixed","aaSortingFixed"),r(t,"paging","bPaginate"),r(t,"pagingType","sPaginationType"),r(t,"pageLength","iDisplayLength"),r(t,"searching","bFilter"),"boolean"==typeof t.sScrollX&&(t.sScrollX=t.sScrollX?"100%":""),"boolean"==typeof t.scrollX&&(t.scrollX=t.scrollX?"100%":"");var e=t.aoSearchCols;if(e)for(var n=0,a=e.length;n<a;n++)e[n]&&C(w.models.oSearch,e[n])}function Q(t){r(t,"orderable","bSortable"),r(t,"orderData","aDataSort"),r(t,"orderSequence","asSorting"),r(t,"orderDataType","sortDataType");var e=t.aDataSort;"number"!=typeof e||Array.isArray(e)||(t.aDataSort=[e])}function tt(t){var e,n,a,r;w.__browser||(w.__browser=e={},r=(a=(n=P("<div/>").css({position:"fixed",top:0,left:-1*P(j).scrollLeft(),height:1,width:1,overflow:"hidden"}).append(P("<div/>").css({position:"absolute",top:1,left:1,width:100,overflow:"scroll"}).append(P("<div/>").css({width:"100%",height:10}))).appendTo("body")).children()).children(),e.barWidth=a[0].offsetWidth-a[0].clientWidth,e.bScrollOversize=100===r[0].offsetWidth&&100!==a[0].clientWidth,e.bScrollbarLeft=1!==Math.round(r.offset().left),e.bBounding=!!n[0].getBoundingClientRect().width,n.remove()),P.extend(t.oBrowser,w.__browser),t.oScroll.iBarWidth=w.__browser.barWidth}function et(t,e,n,a,r,o){var i,l=a,s=!1;for(n!==H&&(i=n,s=!0);l!==r;)t.hasOwnProperty(l)&&(i=s?e(i,t[l],l,t):t[l],s=!0,l+=o);return i}function nt(t,e){var n=w.defaults.column,a=t.aoColumns.length,n=P.extend({},w.models.oColumn,n,{nTh:e||v.createElement("th"),sTitle:n.sTitle||(e?e.innerHTML:""),aDataSort:n.aDataSort||[a],mData:n.mData||a,idx:a}),n=(t.aoColumns.push(n),t.aoPreSearchCols);n[a]=P.extend({},w.models.oSearch,n[a]),at(t,a,P(e).data())}function at(t,e,n){function a(t){return"string"==typeof t&&-1!==t.indexOf("@")}var e=t.aoColumns[e],r=t.oClasses,o=P(e.nTh),i=(!e.sWidthOrig&&(e.sWidthOrig=o.attr("width")||null,u=(o.attr("style")||"").match(/width:\s*(\d+[pxem%]+)/))&&(e.sWidthOrig=u[1]),n!==H&&null!==n&&(Q(n),C(w.defaults.column,n,!0),n.mDataProp===H||n.mData||(n.mData=n.mDataProp),n.sType&&(e._sManualType=n.sType),n.className&&!n.sClass&&(n.sClass=n.className),n.sClass&&o.addClass(n.sClass),u=e.sClass,P.extend(e,n),F(e,n,"sWidth","sWidthOrig"),u!==e.sClass&&(e.sClass=u+" "+e.sClass),n.iDataSort!==H&&(e.aDataSort=[n.iDataSort]),F(e,n,"aDataSort"),e.ariaTitle||(e.ariaTitle=o.attr("aria-label"))),e.mData),l=A(i),s=e.mRender?A(e.mRender):null,u=(e._bAttrSrc=P.isPlainObject(i)&&(a(i.sort)||a(i.type)||a(i.filter)),e._setter=null,e.fnGetData=function(t,e,n){var a=l(t,e,H,n);return s&&e?s(a,e,t,n):a},e.fnSetData=function(t,e,n){return b(i)(t,e,n)},"number"==typeof i||e._isArrayHost||(t._rowReadObject=!0),t.oFeatures.bSort||(e.bSortable=!1,o.addClass(r.sSortableNone)),-1!==P.inArray("asc",e.asSorting)),n=-1!==P.inArray("desc",e.asSorting);e.bSortable&&(u||n)?u&&!n?(e.sSortingClass=r.sSortableAsc,e.sSortingClassJUI=r.sSortJUIAscAllowed):!u&&n?(e.sSortingClass=r.sSortableDesc,e.sSortingClassJUI=r.sSortJUIDescAllowed):(e.sSortingClass=r.sSortable,e.sSortingClassJUI=r.sSortJUI):(e.sSortingClass=r.sSortableNone,e.sSortingClassJUI="")}function O(t){if(!1!==t.oFeatures.bAutoWidth){var e=t.aoColumns;ee(t);for(var n=0,a=e.length;n<a;n++)e[n].nTh.style.width=e[n].sWidth}var r=t.oScroll;""===r.sY&&""===r.sX||Qt(t),R(t,null,"column-sizing",[t])}function rt(t,e){t=it(t,"bVisible");return"number"==typeof t[e]?t[e]:null}function ot(t,e){t=it(t,"bVisible"),e=P.inArray(e,t);return-1!==e?e:null}function T(t){var n=0;return P.each(t.aoColumns,function(t,e){e.bVisible&&"none"!==P(e.nTh).css("display")&&n++}),n}function it(t,n){var a=[];return P.map(t.aoColumns,function(t,e){t[n]&&a.push(e)}),a}function lt(t){for(var e,n,a,r,o,i,l,s=t.aoColumns,u=t.aoData,c=w.ext.type.detect,f=0,d=s.length;f<d;f++)if(l=[],!(o=s[f]).sType&&o._sManualType)o.sType=o._sManualType;else if(!o.sType){for(e=0,n=c.length;e<n;e++){for(a=0,r=u.length;a<r&&(l[a]===H&&(l[a]=S(t,a,f,"type")),(i=c[e](l[a],t))||e===c.length-1)&&("html"!==i||h(l[a]));a++);if(i){o.sType=i;break}}o.sType||(o.sType="string")}}function st(t,e,n,a){var r,o,i,l,s=t.aoColumns;if(e)for(r=e.length-1;0<=r;r--)for(var u,c=(u=e[r]).target!==H?u.target:u.targets!==H?u.targets:u.aTargets,f=0,d=(c=Array.isArray(c)?c:[c]).length;f<d;f++)if("number"==typeof c[f]&&0<=c[f]){for(;s.length<=c[f];)nt(t);a(c[f],u)}else if("number"==typeof c[f]&&c[f]<0)a(s.length+c[f],u);else if("string"==typeof c[f])for(i=0,l=s.length;i<l;i++)"_all"!=c[f]&&!P(s[i].nTh).hasClass(c[f])||a(i,u);if(n)for(r=0,o=n.length;r<o;r++)a(r,n[r])}function x(t,e,n,a){for(var r=t.aoData.length,o=P.extend(!0,{},w.models.oRow,{src:n?"dom":"data",idx:r}),i=(o._aData=e,t.aoData.push(o),t.aoColumns),l=0,s=i.length;l<s;l++)i[l].sType=null;t.aiDisplayMaster.push(r);e=t.rowIdFn(e);return e!==H&&(t.aIds[e]=o),!n&&t.oFeatures.bDeferRender||St(t,r,n,a),r}function ut(n,t){var a;return(t=t instanceof P?t:P(t)).map(function(t,e){return a=mt(n,e),x(n,a.data,e,a.cells)})}function S(t,e,n,a){"search"===a?a="filter":"order"===a&&(a="sort");var r=t.iDraw,o=t.aoColumns[n],i=t.aoData[e]._aData,l=o.sDefaultContent,s=o.fnGetData(i,a,{settings:t,row:e,col:n});if(s===H)return t.iDrawError!=r&&null===l&&(W(t,0,"Requested unknown parameter "+("function"==typeof o.mData?"{function}":"'"+o.mData+"'")+" for row "+e+", column "+n,4),t.iDrawError=r),l;if(s!==i&&null!==s||null===l||a===H){if("function"==typeof s)return s.call(i)}else s=l;return null===s&&"display"===a?"":"filter"===a&&(e=w.ext.type.search)[o.sType]?e[o.sType](s):s}function ct(t,e,n,a){var r=t.aoColumns[n],o=t.aoData[e]._aData;r.fnSetData(o,a,{settings:t,row:e,col:n})}var ft=/\[.*?\]$/,g=/\(\)$/;function dt(t){return P.map(t.match(/(\\.|[^\.])+/g)||[""],function(t){return t.replace(/\\\./g,".")})}var A=w.util.get,b=w.util.set;function ht(t){return N(t.aoData,"_aData")}function pt(t){t.aoData.length=0,t.aiDisplayMaster.length=0,t.aiDisplay.length=0,t.aIds={}}function gt(t,e,n){for(var a=-1,r=0,o=t.length;r<o;r++)t[r]==e?a=r:t[r]>e&&t[r]--;-1!=a&&n===H&&t.splice(a,1)}function bt(n,a,t,e){function r(t,e){for(;t.childNodes.length;)t.removeChild(t.firstChild);t.innerHTML=S(n,a,e,"display")}var o,i,l=n.aoData[a];if("dom"!==t&&(t&&"auto"!==t||"dom"!==l.src)){var s=l.anCells;if(s)if(e!==H)r(s[e],e);else for(o=0,i=s.length;o<i;o++)r(s[o],o)}else l._aData=mt(n,l,e,e===H?H:l._aData).data;l._aSortData=null,l._aFilterData=null;var u=n.aoColumns;if(e!==H)u[e].sType=null;else{for(o=0,i=u.length;o<i;o++)u[o].sType=null;vt(n,l)}}function mt(t,e,n,a){function r(t,e){var n;"string"==typeof t&&-1!==(n=t.indexOf("@"))&&(n=t.substring(n+1),b(t)(a,e.getAttribute(n)))}function o(t){n!==H&&n!==f||(l=d[f],s=t.innerHTML.trim(),l&&l._bAttrSrc?(b(l.mData._)(a,s),r(l.mData.sort,t),r(l.mData.type,t),r(l.mData.filter,t)):h?(l._setter||(l._setter=b(l.mData)),l._setter(a,s)):a[f]=s),f++}var i,l,s,u=[],c=e.firstChild,f=0,d=t.aoColumns,h=t._rowReadObject;a=a!==H?a:h?{}:[];if(c)for(;c;)"TD"!=(i=c.nodeName.toUpperCase())&&"TH"!=i||(o(c),u.push(c)),c=c.nextSibling;else for(var p=0,g=(u=e.anCells).length;p<g;p++)o(u[p]);var e=e.firstChild?e:e.nTr;return e&&(e=e.getAttribute("id"))&&b(t.rowId)(a,e),{data:a,cells:u}}function St(t,e,n,a){var r,o,i,l,s,u,c=t.aoData[e],f=c._aData,d=[];if(null===c.nTr){for(r=n||v.createElement("tr"),c.nTr=r,c.anCells=d,r._DT_RowIndex=e,vt(t,c),l=0,s=t.aoColumns.length;l<s;l++)i=t.aoColumns[l],(o=(u=!n)?v.createElement(i.sCellType):a[l])||W(t,0,"Incorrect column count",18),o._DT_CellIndex={row:e,column:l},d.push(o),!u&&(!i.mRender&&i.mData===l||P.isPlainObject(i.mData)&&i.mData._===l+".display")||(o.innerHTML=S(t,e,l,"display")),i.sClass&&(o.className+=" "+i.sClass),i.bVisible&&!n?r.appendChild(o):!i.bVisible&&n&&o.parentNode.removeChild(o),i.fnCreatedCell&&i.fnCreatedCell.call(t.oInstance,o,S(t,e,l),f,e,l);R(t,"aoRowCreatedCallback",null,[r,f,e,d])}}function vt(t,e){var n=e.nTr,a=e._aData;n&&((t=t.rowIdFn(a))&&(n.id=t),a.DT_RowClass&&(t=a.DT_RowClass.split(" "),e.__rowc=e.__rowc?z(e.__rowc.concat(t)):t,P(n).removeClass(e.__rowc.join(" ")).addClass(a.DT_RowClass)),a.DT_RowAttr&&P(n).attr(a.DT_RowAttr),a.DT_RowData)&&P(n).data(a.DT_RowData)}function yt(t){var e,n,a,r=t.nTHead,o=t.nTFoot,i=0===P("th, td",r).length,l=t.oClasses,s=t.aoColumns;for(i&&(n=P("<tr/>").appendTo(r)),c=0,f=s.length;c<f;c++)a=s[c],e=P(a.nTh).addClass(a.sClass),i&&e.appendTo(n),t.oFeatures.bSort&&(e.addClass(a.sSortingClass),!1!==a.bSortable)&&(e.attr("tabindex",t.iTabIndex).attr("aria-controls",t.sTableId),ue(t,a.nTh,c)),a.sTitle!=e[0].innerHTML&&e.html(a.sTitle),ve(t,"header")(t,e,a,l);if(i&&wt(t.aoHeader,r),P(r).children("tr").children("th, td").addClass(l.sHeaderTH),P(o).children("tr").children("th, td").addClass(l.sFooterTH),null!==o)for(var u=t.aoFooter[0],c=0,f=u.length;c<f;c++)(a=s[c])?(a.nTf=u[c].cell,a.sClass&&P(a.nTf).addClass(a.sClass)):W(t,0,"Incorrect column count",18)}function Dt(t,e,n){var a,r,o,i,l,s,u,c,f,d=[],h=[],p=t.aoColumns.length;if(e){for(n===H&&(n=!1),a=0,r=e.length;a<r;a++){for(d[a]=e[a].slice(),d[a].nTr=e[a].nTr,o=p-1;0<=o;o--)t.aoColumns[o].bVisible||n||d[a].splice(o,1);h.push([])}for(a=0,r=d.length;a<r;a++){if(u=d[a].nTr)for(;s=u.firstChild;)u.removeChild(s);for(o=0,i=d[a].length;o<i;o++)if(f=c=1,h[a][o]===H){for(u.appendChild(d[a][o].cell),h[a][o]=1;d[a+c]!==H&&d[a][o].cell==d[a+c][o].cell;)h[a+c][o]=1,c++;for(;d[a][o+f]!==H&&d[a][o].cell==d[a][o+f].cell;){for(l=0;l<c;l++)h[a+l][o+f]=1;f++}P(d[a][o].cell).attr("rowspan",c).attr("colspan",f)}}}}function y(t,e){n="ssp"==E(s=t),(l=s.iInitDisplayStart)!==H&&-1!==l&&(s._iDisplayStart=!n&&l>=s.fnRecordsDisplay()?0:l,s.iInitDisplayStart=-1);var n=R(t,"aoPreDrawCallback","preDraw",[t]);if(-1!==P.inArray(!1,n))D(t,!1);else{var a=[],r=0,o=t.asStripeClasses,i=o.length,l=t.oLanguage,s="ssp"==E(t),u=t.aiDisplay,n=t._iDisplayStart,c=t.fnDisplayEnd();if(t.bDrawing=!0,t.bDeferLoading)t.bDeferLoading=!1,t.iDraw++,D(t,!1);else if(s){if(!t.bDestroying&&!e)return void xt(t)}else t.iDraw++;if(0!==u.length)for(var f=s?t.aoData.length:c,d=s?0:n;d<f;d++){var h,p=u[d],g=t.aoData[p],b=(null===g.nTr&&St(t,p),g.nTr);0!==i&&(h=o[r%i],g._sRowStripe!=h)&&(P(b).removeClass(g._sRowStripe).addClass(h),g._sRowStripe=h),R(t,"aoRowCallback",null,[b,g._aData,r,d,p]),a.push(b),r++}else{e=l.sZeroRecords;1==t.iDraw&&"ajax"==E(t)?e=l.sLoadingRecords:l.sEmptyTable&&0===t.fnRecordsTotal()&&(e=l.sEmptyTable),a[0]=P("<tr/>",{class:i?o[0]:""}).append(P("<td />",{valign:"top",colSpan:T(t),class:t.oClasses.sRowEmpty}).html(e))[0]}R(t,"aoHeaderCallback","header",[P(t.nTHead).children("tr")[0],ht(t),n,c,u]),R(t,"aoFooterCallback","footer",[P(t.nTFoot).children("tr")[0],ht(t),n,c,u]);s=P(t.nTBody);s.children().detach(),s.append(P(a)),R(t,"aoDrawCallback","draw",[t]),t.bSorted=!1,t.bFiltered=!1,t.bDrawing=!1}}function u(t,e){var n=t.oFeatures,a=n.bSort,n=n.bFilter;a&&ie(t),n?Rt(t,t.oPreviousSearch):t.aiDisplay=t.aiDisplayMaster.slice(),!0!==e&&(t._iDisplayStart=0),t._drawHold=e,y(t),t._drawHold=!1}function _t(t){for(var e,n,a,r,o,i,l,s=t.oClasses,u=P(t.nTable),u=P("<div/>").insertBefore(u),c=t.oFeatures,f=P("<div/>",{id:t.sTableId+"_wrapper",class:s.sWrapper+(t.nTFoot?"":" "+s.sNoFooter)}),d=(t.nHolding=u[0],t.nTableWrapper=f[0],t.nTableReinsertBefore=t.nTable.nextSibling,t.sDom.split("")),h=0;h<d.length;h++){if(e=null,"<"==(n=d[h])){if(a=P("<div/>")[0],"'"==(r=d[h+1])||'"'==r){for(o="",i=2;d[h+i]!=r;)o+=d[h+i],i++;"H"==o?o=s.sJUIHeader:"F"==o&&(o=s.sJUIFooter),-1!=o.indexOf(".")?(l=o.split("."),a.id=l[0].substr(1,l[0].length-1),a.className=l[1]):"#"==o.charAt(0)?a.id=o.substr(1,o.length-1):a.className=o,h+=i}f.append(a),f=P(a)}else if(">"==n)f=f.parent();else if("l"==n&&c.bPaginate&&c.bLengthChange)e=Gt(t);else if("f"==n&&c.bFilter)e=Lt(t);else if("r"==n&&c.bProcessing)e=Zt(t);else if("t"==n)e=Kt(t);else if("i"==n&&c.bInfo)e=Ut(t);else if("p"==n&&c.bPaginate)e=zt(t);else if(0!==w.ext.feature.length)for(var p=w.ext.feature,g=0,b=p.length;g<b;g++)if(n==p[g].cFeature){e=p[g].fnInit(t);break}e&&((l=t.aanFeatures)[n]||(l[n]=[]),l[n].push(e),f.append(e))}u.replaceWith(f),t.nHolding=null}function wt(t,e){var n,a,r,o,i,l,s,u,c,f,d=P(e).children("tr");for(t.splice(0,t.length),r=0,l=d.length;r<l;r++)t.push([]);for(r=0,l=d.length;r<l;r++)for(a=(n=d[r]).firstChild;a;){if("TD"==a.nodeName.toUpperCase()||"TH"==a.nodeName.toUpperCase())for(u=(u=+a.getAttribute("colspan"))&&0!=u&&1!=u?u:1,c=(c=+a.getAttribute("rowspan"))&&0!=c&&1!=c?c:1,s=function(t,e,n){for(var a=t[e];a[n];)n++;return n}(t,r,0),f=1==u,i=0;i<u;i++)for(o=0;o<c;o++)t[r+o][s+i]={cell:a,unique:f},t[r+o].nTr=n;a=a.nextSibling}}function Ct(t,e,n){var a=[];n||(n=t.aoHeader,e&&wt(n=[],e));for(var r=0,o=n.length;r<o;r++)for(var i=0,l=n[r].length;i<l;i++)!n[r][i].unique||a[i]&&t.bSortCellsTop||(a[i]=n[r][i].cell);return a}function Tt(r,t,n){function e(t){var e=r.jqXHR?r.jqXHR.status:null;(null===t||"number"==typeof e&&204==e)&&Ft(r,t={},[]),(e=t.error||t.sError)&&W(r,0,e),r.json=t,R(r,null,"xhr",[r,t,r.jqXHR]),n(t)}R(r,"aoServerParams","serverParams",[t]),t&&Array.isArray(t)&&(a={},o=/(.*?)\[\]$/,P.each(t,function(t,e){var n=e.name.match(o);n?(n=n[0],a[n]||(a[n]=[]),a[n].push(e.value)):a[e.name]=e.value}),t=a);var a,o,i,l=r.ajax,s=r.oInstance,u=(P.isPlainObject(l)&&l.data&&(u="function"==typeof(i=l.data)?i(t,r):i,t="function"==typeof i&&u?u:P.extend(!0,t,u),delete l.data),{data:t,success:e,dataType:"json",cache:!1,type:r.sServerMethod,error:function(t,e,n){var a=R(r,null,"xhr",[r,null,r.jqXHR]);-1===P.inArray(!0,a)&&("parsererror"==e?W(r,0,"Invalid JSON response",1):4===t.readyState&&W(r,0,"Ajax error",7)),D(r,!1)}});r.oAjaxData=t,R(r,null,"preXhr",[r,t]),r.fnServerData?r.fnServerData.call(s,r.sAjaxSource,P.map(t,function(t,e){return{name:e,value:t}}),e,r):r.sAjaxSource||"string"==typeof l?r.jqXHR=P.ajax(P.extend(u,{url:l||r.sAjaxSource})):"function"==typeof l?r.jqXHR=l.call(s,t,e,r):(r.jqXHR=P.ajax(P.extend(u,l)),l.data=i)}function xt(e){e.iDraw++,D(e,!0);var n=e._drawHold;Tt(e,At(e),function(t){e._drawHold=n,It(e,t),e._drawHold=!1})}function At(t){for(var e,n,a,r=t.aoColumns,o=r.length,i=t.oFeatures,l=t.oPreviousSearch,s=t.aoPreSearchCols,u=[],c=I(t),f=t._iDisplayStart,d=!1!==i.bPaginate?t._iDisplayLength:-1,h=function(t,e){u.push({name:t,value:e})},p=(h("sEcho",t.iDraw),h("iColumns",o),h("sColumns",N(r,"sName").join(",")),h("iDisplayStart",f),h("iDisplayLength",d),{draw:t.iDraw,columns:[],order:[],start:f,length:d,search:{value:l.sSearch,regex:l.bRegex}}),g=0;g<o;g++)n=r[g],a=s[g],e="function"==typeof n.mData?"function":n.mData,p.columns.push({data:e,name:n.sName,searchable:n.bSearchable,orderable:n.bSortable,search:{value:a.sSearch,regex:a.bRegex}}),h("mDataProp_"+g,e),i.bFilter&&(h("sSearch_"+g,a.sSearch),h("bRegex_"+g,a.bRegex),h("bSearchable_"+g,n.bSearchable)),i.bSort&&h("bSortable_"+g,n.bSortable);i.bFilter&&(h("sSearch",l.sSearch),h("bRegex",l.bRegex)),i.bSort&&(P.each(c,function(t,e){p.order.push({column:e.col,dir:e.dir}),h("iSortCol_"+t,e.col),h("sSortDir_"+t,e.dir)}),h("iSortingCols",c.length));f=w.ext.legacy.ajax;return null===f?t.sAjaxSource?u:p:f?u:p}function It(t,n){function e(t,e){return n[t]!==H?n[t]:n[e]}var a=Ft(t,n),r=e("sEcho","draw"),o=e("iTotalRecords","recordsTotal"),i=e("iTotalDisplayRecords","recordsFiltered");if(r!==H){if(+r<t.iDraw)return;t.iDraw=+r}a=a||[],pt(t),t._iRecordsTotal=parseInt(o,10),t._iRecordsDisplay=parseInt(i,10);for(var l=0,s=a.length;l<s;l++)x(t,a[l]);t.aiDisplay=t.aiDisplayMaster.slice(),y(t,!0),t._bInitComplete||qt(t,n),D(t,!1)}function Ft(t,e,n){t=P.isPlainObject(t.ajax)&&t.ajax.dataSrc!==H?t.ajax.dataSrc:t.sAjaxDataProp;if(!n)return"data"===t?e.aaData||e[t]:""!==t?A(t)(e):e;b(t)(e,n)}function Lt(n){function e(t){i.f;var e=this.value||"";o.return&&"Enter"!==t.key||e!=o.sSearch&&(Rt(n,{sSearch:e,bRegex:o.bRegex,bSmart:o.bSmart,bCaseInsensitive:o.bCaseInsensitive,return:o.return}),n._iDisplayStart=0,y(n))}var t=n.oClasses,a=n.sTableId,r=n.oLanguage,o=n.oPreviousSearch,i=n.aanFeatures,l='<input type="search" class="'+t.sFilterInput+'"/>',s=(s=r.sSearch).match(/_INPUT_/)?s.replace("_INPUT_",l):s+l,l=P("<div/>",{id:i.f?null:a+"_filter",class:t.sFilter}).append(P("<label/>").append(s)),t=null!==n.searchDelay?n.searchDelay:"ssp"===E(n)?400:0,u=P("input",l).val(o.sSearch).attr("placeholder",r.sSearchPlaceholder).on("keyup.DT search.DT input.DT paste.DT cut.DT",t?ne(e,t):e).on("mouseup.DT",function(t){setTimeout(function(){e.call(u[0],t)},10)}).on("keypress.DT",function(t){if(13==t.keyCode)return!1}).attr("aria-controls",a);return P(n.nTable).on("search.dt.DT",function(t,e){if(n===e)try{u[0]!==v.activeElement&&u.val(o.sSearch)}catch(t){}}),l[0]}function Rt(t,e,n){function a(t){o.sSearch=t.sSearch,o.bRegex=t.bRegex,o.bSmart=t.bSmart,o.bCaseInsensitive=t.bCaseInsensitive,o.return=t.return}function r(t){return t.bEscapeRegex!==H?!t.bEscapeRegex:t.bRegex}var o=t.oPreviousSearch,i=t.aoPreSearchCols;if(lt(t),"ssp"!=E(t)){Ht(t,e.sSearch,n,r(e),e.bSmart,e.bCaseInsensitive),a(e);for(var l=0;l<i.length;l++)jt(t,i[l].sSearch,l,r(i[l]),i[l].bSmart,i[l].bCaseInsensitive);Pt(t)}else a(e);t.bFiltered=!0,R(t,null,"search",[t])}function Pt(t){for(var e,n,a=w.ext.search,r=t.aiDisplay,o=0,i=a.length;o<i;o++){for(var l=[],s=0,u=r.length;s<u;s++)n=r[s],e=t.aoData[n],a[o](t,e._aFilterData,n,e._aData,s)&&l.push(n);r.length=0,P.merge(r,l)}}function jt(t,e,n,a,r,o){if(""!==e){for(var i,l=[],s=t.aiDisplay,u=Nt(e,a,r,o),c=0;c<s.length;c++)i=t.aoData[s[c]]._aFilterData[n],u.test(i)&&l.push(s[c]);t.aiDisplay=l}}function Ht(t,e,n,a,r,o){var i,l,s,u=Nt(e,a,r,o),r=t.oPreviousSearch.sSearch,o=t.aiDisplayMaster,c=[];if(0!==w.ext.search.length&&(n=!0),l=Wt(t),e.length<=0)t.aiDisplay=o.slice();else{for((l||n||a||r.length>e.length||0!==e.indexOf(r)||t.bSorted)&&(t.aiDisplay=o.slice()),i=t.aiDisplay,s=0;s<i.length;s++)u.test(t.aoData[i[s]]._sFilterRow)&&c.push(i[s]);t.aiDisplay=c}}function Nt(t,e,n,a){return t=e?t:Ot(t),n&&(t="^(?=.*?"+P.map(t.match(/["\u201C][^"\u201D]+["\u201D]|[^ ]+/g)||[""],function(t){var e;return'"'===t.charAt(0)?t=(e=t.match(/^"(.*)"$/))?e[1]:t:"“"===t.charAt(0)&&(t=(e=t.match(/^\u201C(.*)\u201D$/))?e[1]:t),t.replace('"',"")}).join(")(?=.*?")+").*$"),new RegExp(t,a?"i":"")}var Ot=w.util.escapeRegex,kt=P("<div>")[0],Mt=kt.textContent!==H;function Wt(t){for(var e,n,a,r,o,i=t.aoColumns,l=!1,s=0,u=t.aoData.length;s<u;s++)if(!(o=t.aoData[s])._aFilterData){for(a=[],e=0,n=i.length;e<n;e++)i[e].bSearchable?"string"!=typeof(r=null===(r=S(t,s,e,"filter"))?"":r)&&r.toString&&(r=r.toString()):r="",r.indexOf&&-1!==r.indexOf("&")&&(kt.innerHTML=r,r=Mt?kt.textContent:kt.innerText),r.replace&&(r=r.replace(/[\r\n\u2028]/g,"")),a.push(r);o._aFilterData=a,o._sFilterRow=a.join(" "),l=!0}return l}function Et(t){return{search:t.sSearch,smart:t.bSmart,regex:t.bRegex,caseInsensitive:t.bCaseInsensitive}}function Bt(t){return{sSearch:t.search,bSmart:t.smart,bRegex:t.regex,bCaseInsensitive:t.caseInsensitive}}function Ut(t){var e=t.sTableId,n=t.aanFeatures.i,a=P("<div/>",{class:t.oClasses.sInfo,id:n?null:e+"_info"});return n||(t.aoDrawCallback.push({fn:Vt,sName:"information"}),a.attr("role","status").attr("aria-live","polite"),P(t.nTable).attr("aria-describedby",e+"_info")),a[0]}function Vt(t){var e,n,a,r,o,i,l=t.aanFeatures.i;0!==l.length&&(i=t.oLanguage,e=t._iDisplayStart+1,n=t.fnDisplayEnd(),a=t.fnRecordsTotal(),o=(r=t.fnRecordsDisplay())?i.sInfo:i.sInfoEmpty,r!==a&&(o+=" "+i.sInfoFiltered),o=Xt(t,o+=i.sInfoPostFix),null!==(i=i.fnInfoCallback)&&(o=i.call(t.oInstance,t,e,n,a,r,o)),P(l).html(o))}function Xt(t,e){var n=t.fnFormatNumber,a=t._iDisplayStart+1,r=t._iDisplayLength,o=t.fnRecordsDisplay(),i=-1===r;return e.replace(/_START_/g,n.call(t,a)).replace(/_END_/g,n.call(t,t.fnDisplayEnd())).replace(/_MAX_/g,n.call(t,t.fnRecordsTotal())).replace(/_TOTAL_/g,n.call(t,o)).replace(/_PAGE_/g,n.call(t,i?1:Math.ceil(a/r))).replace(/_PAGES_/g,n.call(t,i?1:Math.ceil(o/r)))}function Jt(n){var a,t,e,r=n.iInitDisplayStart,o=n.aoColumns,i=n.oFeatures,l=n.bDeferLoading;if(n.bInitialised){for(_t(n),yt(n),Dt(n,n.aoHeader),Dt(n,n.aoFooter),D(n,!0),i.bAutoWidth&&ee(n),a=0,t=o.length;a<t;a++)(e=o[a]).sWidth&&(e.nTh.style.width=M(e.sWidth));R(n,null,"preInit",[n]),u(n);i=E(n);"ssp"==i&&!l||("ajax"==i?Tt(n,[],function(t){var e=Ft(n,t);for(a=0;a<e.length;a++)x(n,e[a]);n.iInitDisplayStart=r,u(n),D(n,!1),qt(n,t)}):(D(n,!1),qt(n)))}else setTimeout(function(){Jt(n)},200)}function qt(t,e){t._bInitComplete=!0,(e||t.oInit.aaData)&&O(t),R(t,null,"plugin-init",[t,e]),R(t,"aoInitComplete","init",[t,e])}function $t(t,e){e=parseInt(e,10);t._iDisplayLength=e,Se(t),R(t,null,"length",[t,e])}function Gt(a){for(var t=a.oClasses,e=a.sTableId,n=a.aLengthMenu,r=Array.isArray(n[0]),o=r?n[0]:n,i=r?n[1]:n,l=P("<select/>",{name:e+"_length","aria-controls":e,class:t.sLengthSelect}),s=0,u=o.length;s<u;s++)l[0][s]=new Option("number"==typeof i[s]?a.fnFormatNumber(i[s]):i[s],o[s]);var c=P("<div><label/></div>").addClass(t.sLength);return a.aanFeatures.l||(c[0].id=e+"_length"),c.children().append(a.oLanguage.sLengthMenu.replace("_MENU_",l[0].outerHTML)),P("select",c).val(a._iDisplayLength).on("change.DT",function(t){$t(a,P(this).val()),y(a)}),P(a.nTable).on("length.dt.DT",function(t,e,n){a===e&&P("select",c).val(n)}),c[0]}function zt(t){function c(t){y(t)}var e=t.sPaginationType,f=w.ext.pager[e],d="function"==typeof f,e=P("<div/>").addClass(t.oClasses.sPaging+e)[0],h=t.aanFeatures;return d||f.fnInit(t,e,c),h.p||(e.id=t.sTableId+"_paginate",t.aoDrawCallback.push({fn:function(t){if(d)for(var e=t._iDisplayStart,n=t._iDisplayLength,a=t.fnRecordsDisplay(),r=-1===n,o=r?0:Math.ceil(e/n),i=r?1:Math.ceil(a/n),l=f(o,i),s=0,u=h.p.length;s<u;s++)ve(t,"pageButton")(t,h.p[s],s,l,o,i);else f.fnUpdate(t,c)},sName:"pagination"})),e}function Yt(t,e,n){var a=t._iDisplayStart,r=t._iDisplayLength,o=t.fnRecordsDisplay(),o=(0===o||-1===r?a=0:"number"==typeof e?o<(a=e*r)&&(a=0):"first"==e?a=0:"previous"==e?(a=0<=r?a-r:0)<0&&(a=0):"next"==e?a+r<o&&(a+=r):"last"==e?a=Math.floor((o-1)/r)*r:W(t,0,"Unknown paging action: "+e,5),t._iDisplayStart!==a);return t._iDisplayStart=a,o?(R(t,null,"page",[t]),n&&y(t)):R(t,null,"page-nc",[t]),o}function Zt(t){return P("<div/>",{id:t.aanFeatures.r?null:t.sTableId+"_processing",class:t.oClasses.sProcessing,role:"status"}).html(t.oLanguage.sProcessing).append("<div><div></div><div></div><div></div><div></div></div>").insertBefore(t.nTable)[0]}function D(t,e){t.oFeatures.bProcessing&&P(t.aanFeatures.r).css("display",e?"block":"none"),R(t,null,"processing",[t,e])}function Kt(t){var e,n,a,r,o,i,l,s,u,c,f,d,h=P(t.nTable),p=t.oScroll;return""===p.sX&&""===p.sY?t.nTable:(e=p.sX,n=p.sY,a=t.oClasses,o=(r=h.children("caption")).length?r[0]._captionSide:null,s=P(h[0].cloneNode(!1)),i=P(h[0].cloneNode(!1)),u=function(t){return t?M(t):null},(l=h.children("tfoot")).length||(l=null),s=P(f="<div/>",{class:a.sScrollWrapper}).append(P(f,{class:a.sScrollHead}).css({overflow:"hidden",position:"relative",border:0,width:e?u(e):"100%"}).append(P(f,{class:a.sScrollHeadInner}).css({"box-sizing":"content-box",width:p.sXInner||"100%"}).append(s.removeAttr("id").css("margin-left",0).append("top"===o?r:null).append(h.children("thead"))))).append(P(f,{class:a.sScrollBody}).css({position:"relative",overflow:"auto",width:u(e)}).append(h)),l&&s.append(P(f,{class:a.sScrollFoot}).css({overflow:"hidden",border:0,width:e?u(e):"100%"}).append(P(f,{class:a.sScrollFootInner}).append(i.removeAttr("id").css("margin-left",0).append("bottom"===o?r:null).append(h.children("tfoot"))))),u=s.children(),c=u[0],f=u[1],d=l?u[2]:null,e&&P(f).on("scroll.DT",function(t){var e=this.scrollLeft;c.scrollLeft=e,l&&(d.scrollLeft=e)}),P(f).css("max-height",n),p.bCollapse||P(f).css("height",n),t.nScrollHead=c,t.nScrollBody=f,t.nScrollFoot=d,t.aoDrawCallback.push({fn:Qt,sName:"scrolling"}),s[0])}function Qt(n){function t(t){(t=t.style).paddingTop="0",t.paddingBottom="0",t.borderTopWidth="0",t.borderBottomWidth="0",t.height=0}var e,a,r,o,i,l=n.oScroll,s=l.sX,u=l.sXInner,c=l.sY,l=l.iBarWidth,f=P(n.nScrollHead),d=f[0].style,h=f.children("div"),p=h[0].style,h=h.children("table"),g=n.nScrollBody,b=P(g),m=g.style,S=P(n.nScrollFoot).children("div"),v=S.children("table"),y=P(n.nTHead),D=P(n.nTable),_=D[0],w=_.style,C=n.nTFoot?P(n.nTFoot):null,T=n.oBrowser,x=T.bScrollOversize,A=(N(n.aoColumns,"nTh"),[]),I=[],F=[],L=[],R=g.scrollHeight>g.clientHeight;n.scrollBarVis!==R&&n.scrollBarVis!==H?(n.scrollBarVis=R,O(n)):(n.scrollBarVis=R,D.children("thead, tfoot").remove(),C&&(R=C.clone().prependTo(D),i=C.find("tr"),a=R.find("tr"),R.find("[id]").removeAttr("id")),R=y.clone().prependTo(D),y=y.find("tr"),e=R.find("tr"),R.find("th, td").removeAttr("tabindex"),R.find("[id]").removeAttr("id"),s||(m.width="100%",f[0].style.width="100%"),P.each(Ct(n,R),function(t,e){r=rt(n,t),e.style.width=n.aoColumns[r].sWidth}),C&&k(function(t){t.style.width=""},a),f=D.outerWidth(),""===s?(w.width="100%",x&&(D.find("tbody").height()>g.offsetHeight||"scroll"==b.css("overflow-y"))&&(w.width=M(D.outerWidth()-l)),f=D.outerWidth()):""!==u&&(w.width=M(u),f=D.outerWidth()),k(t,e),k(function(t){var e=j.getComputedStyle?j.getComputedStyle(t).width:M(P(t).width());F.push(t.innerHTML),A.push(e)},e),k(function(t,e){t.style.width=A[e]},y),P(e).css("height",0),C&&(k(t,a),k(function(t){L.push(t.innerHTML),I.push(M(P(t).css("width")))},a),k(function(t,e){t.style.width=I[e]},i),P(a).height(0)),k(function(t,e){t.innerHTML='<div class="dataTables_sizing">'+F[e]+"</div>",t.childNodes[0].style.height="0",t.childNodes[0].style.overflow="hidden",t.style.width=A[e]},e),C&&k(function(t,e){t.innerHTML='<div class="dataTables_sizing">'+L[e]+"</div>",t.childNodes[0].style.height="0",t.childNodes[0].style.overflow="hidden",t.style.width=I[e]},a),Math.round(D.outerWidth())<Math.round(f)?(o=g.scrollHeight>g.offsetHeight||"scroll"==b.css("overflow-y")?f+l:f,x&&(g.scrollHeight>g.offsetHeight||"scroll"==b.css("overflow-y"))&&(w.width=M(o-l)),""!==s&&""===u||W(n,1,"Possible column misalignment",6)):o="100%",m.width=M(o),d.width=M(o),C&&(n.nScrollFoot.style.width=M(o)),c||x&&(m.height=M(_.offsetHeight+l)),R=D.outerWidth(),h[0].style.width=M(R),p.width=M(R),y=D.height()>g.clientHeight||"scroll"==b.css("overflow-y"),p[i="padding"+(T.bScrollbarLeft?"Left":"Right")]=y?l+"px":"0px",C&&(v[0].style.width=M(R),S[0].style.width=M(R),S[0].style[i]=y?l+"px":"0px"),D.children("colgroup").insertBefore(D.children("thead")),b.trigger("scroll"),!n.bSorted&&!n.bFiltered||n._drawHold||(g.scrollTop=0))}function k(t,e,n){for(var a,r,o=0,i=0,l=e.length;i<l;){for(a=e[i].firstChild,r=n?n[i].firstChild:null;a;)1===a.nodeType&&(n?t(a,r,o):t(a,o),o++),a=a.nextSibling,r=n?r.nextSibling:null;i++}}var te=/<.*?>/g;function ee(t){var e,n,a=t.nTable,r=t.aoColumns,o=t.oScroll,i=o.sY,l=o.sX,o=o.sXInner,s=r.length,u=it(t,"bVisible"),c=P("th",t.nTHead),f=a.getAttribute("width"),d=a.parentNode,h=!1,p=t.oBrowser,g=p.bScrollOversize,b=a.style.width,m=(b&&-1!==b.indexOf("%")&&(f=b),ae(N(r,"sWidthOrig"),d));for(_=0;_<u.length;_++)null!==(e=r[u[_]]).sWidth&&(e.sWidth=m[_],h=!0);if(g||!h&&!l&&!i&&s==T(t)&&s==c.length)for(_=0;_<s;_++){var S=rt(t,_);null!==S&&(r[S].sWidth=M(c.eq(_).width()))}else{var b=P(a).clone().css("visibility","hidden").removeAttr("id"),v=(b.find("tbody tr").remove(),P("<tr/>").appendTo(b.find("tbody")));for(b.find("thead, tfoot").remove(),b.append(P(t.nTHead).clone()).append(P(t.nTFoot).clone()),b.find("tfoot th, tfoot td").css("width",""),c=Ct(t,b.find("thead")[0]),_=0;_<u.length;_++)e=r[u[_]],c[_].style.width=null!==e.sWidthOrig&&""!==e.sWidthOrig?M(e.sWidthOrig):"",e.sWidthOrig&&l&&P(c[_]).append(P("<div/>").css({width:e.sWidthOrig,margin:0,padding:0,border:0,height:1}));if(t.aoData.length)for(_=0;_<u.length;_++)e=r[n=u[_]],P(re(t,n)).clone(!1).append(e.sContentPadding).appendTo(v);P("[name]",b).removeAttr("name");for(var y=P("<div/>").css(l||i?{position:"absolute",top:0,left:0,height:1,right:0,overflow:"hidden"}:{}).append(b).appendTo(d),D=(l&&o?b.width(o):l?(b.css("width","auto"),b.removeAttr("width"),b.width()<d.clientWidth&&f&&b.width(d.clientWidth)):i?b.width(d.clientWidth):f&&b.width(f),0),_=0;_<u.length;_++){var w=P(c[_]),C=w.outerWidth()-w.width(),w=p.bBounding?Math.ceil(c[_].getBoundingClientRect().width):w.outerWidth();D+=w,r[u[_]].sWidth=M(w-C)}a.style.width=M(D),y.remove()}f&&(a.style.width=M(f)),!f&&!l||t._reszEvt||(o=function(){P(j).on("resize.DT-"+t.sInstance,ne(function(){O(t)}))},g?setTimeout(o,1e3):o(),t._reszEvt=!0)}var ne=w.util.throttle;function ae(t,e){for(var n=[],a=[],r=0;r<t.length;r++)t[r]?n.push(P("<div/>").css("width",M(t[r])).appendTo(e||v.body)):n.push(null);for(r=0;r<t.length;r++)a.push(n[r]?n[r][0].offsetWidth:null);return P(n).remove(),a}function re(t,e){var n,a=oe(t,e);return a<0?null:(n=t.aoData[a]).nTr?n.anCells[e]:P("<td/>").html(S(t,a,e,"display"))[0]}function oe(t,e){for(var n,a=-1,r=-1,o=0,i=t.aoData.length;o<i;o++)(n=(n=(n=S(t,o,e,"display")+"").replace(te,"")).replace(/&nbsp;/g," ")).length>a&&(a=n.length,r=o);return r}function M(t){return null===t?"0px":"number"==typeof t?t<0?"0px":t+"px":t.match(/\d$/)?t+"px":t}function I(t){function e(t){t.length&&!Array.isArray(t[0])?h.push(t):P.merge(h,t)}var n,a,r,o,i,l,s,u=[],c=t.aoColumns,f=t.aaSortingFixed,d=P.isPlainObject(f),h=[];for(Array.isArray(f)&&e(f),d&&f.pre&&e(f.pre),e(t.aaSorting),d&&f.post&&e(f.post),n=0;n<h.length;n++)for(r=(o=c[s=h[n][a=0]].aDataSort).length;a<r;a++)l=c[i=o[a]].sType||"string",h[n]._idx===H&&(h[n]._idx=P.inArray(h[n][1],c[i].asSorting)),u.push({src:s,col:i,dir:h[n][1],index:h[n]._idx,type:l,formatter:w.ext.type.order[l+"-pre"]});return u}function ie(t){var e,n,a,r,c,f=[],u=w.ext.type.order,d=t.aoData,o=(t.aoColumns,0),i=t.aiDisplayMaster;for(lt(t),e=0,n=(c=I(t)).length;e<n;e++)(r=c[e]).formatter&&o++,fe(t,r.col);if("ssp"!=E(t)&&0!==c.length){for(e=0,a=i.length;e<a;e++)f[i[e]]=e;o===c.length?i.sort(function(t,e){for(var n,a,r,o,i=c.length,l=d[t]._aSortData,s=d[e]._aSortData,u=0;u<i;u++)if(0!=(r=(n=l[(o=c[u]).col])<(a=s[o.col])?-1:a<n?1:0))return"asc"===o.dir?r:-r;return(n=f[t])<(a=f[e])?-1:a<n?1:0}):i.sort(function(t,e){for(var n,a,r,o=c.length,i=d[t]._aSortData,l=d[e]._aSortData,s=0;s<o;s++)if(n=i[(r=c[s]).col],a=l[r.col],0!==(r=(u[r.type+"-"+r.dir]||u["string-"+r.dir])(n,a)))return r;return(n=f[t])<(a=f[e])?-1:a<n?1:0})}t.bSorted=!0}function le(t){for(var e=t.aoColumns,n=I(t),a=t.oLanguage.oAria,r=0,o=e.length;r<o;r++){var i=e[r],l=i.asSorting,s=i.ariaTitle||i.sTitle.replace(/<.*?>/g,""),u=i.nTh;u.removeAttribute("aria-sort"),i=i.bSortable?s+("asc"===(0<n.length&&n[0].col==r&&(u.setAttribute("aria-sort","asc"==n[0].dir?"ascending":"descending"),l[n[0].index+1])||l[0])?a.sSortAscending:a.sSortDescending):s,u.setAttribute("aria-label",i)}}function se(t,e,n,a){function r(t,e){var n=t._idx;return(n=n===H?P.inArray(t[1],s):n)+1<s.length?n+1:e?null:0}var o,i=t.aoColumns[e],l=t.aaSorting,s=i.asSorting;"number"==typeof l[0]&&(l=t.aaSorting=[l]),n&&t.oFeatures.bSortMulti?-1!==(i=P.inArray(e,N(l,"0")))?null===(o=null===(o=r(l[i],!0))&&1===l.length?0:o)?l.splice(i,1):(l[i][1]=s[o],l[i]._idx=o):(l.push([e,s[0],0]),l[l.length-1]._idx=0):l.length&&l[0][0]==e?(o=r(l[0]),l.length=1,l[0][1]=s[o],l[0]._idx=o):(l.length=0,l.push([e,s[0]]),l[0]._idx=0),u(t),"function"==typeof a&&a(t)}function ue(e,t,n,a){var r=e.aoColumns[n];me(t,{},function(t){!1!==r.bSortable&&(e.oFeatures.bProcessing?(D(e,!0),setTimeout(function(){se(e,n,t.shiftKey,a),"ssp"!==E(e)&&D(e,!1)},0)):se(e,n,t.shiftKey,a))})}function ce(t){var e,n,a,r=t.aLastSort,o=t.oClasses.sSortColumn,i=I(t),l=t.oFeatures;if(l.bSort&&l.bSortClasses){for(e=0,n=r.length;e<n;e++)a=r[e].src,P(N(t.aoData,"anCells",a)).removeClass(o+(e<2?e+1:3));for(e=0,n=i.length;e<n;e++)a=i[e].src,P(N(t.aoData,"anCells",a)).addClass(o+(e<2?e+1:3))}t.aLastSort=i}function fe(t,e){for(var n,a,r,o=t.aoColumns[e],i=w.ext.order[o.sSortDataType],l=(i&&(n=i.call(t.oInstance,t,e,ot(t,e))),w.ext.type.order[o.sType+"-pre"]),s=0,u=t.aoData.length;s<u;s++)(a=t.aoData[s])._aSortData||(a._aSortData=[]),a._aSortData[e]&&!i||(r=i?n[s]:S(t,s,e,"sort"),a._aSortData[e]=l?l(r):r)}function de(n){var t;n._bLoadingState||(t={time:+new Date,start:n._iDisplayStart,length:n._iDisplayLength,order:P.extend(!0,[],n.aaSorting),search:Et(n.oPreviousSearch),columns:P.map(n.aoColumns,function(t,e){return{visible:t.bVisible,search:Et(n.aoPreSearchCols[e])}})},n.oSavedState=t,R(n,"aoStateSaveParams","stateSaveParams",[n,t]),n.oFeatures.bStateSave&&!n.bDestroying&&n.fnStateSaveCallback.call(n.oInstance,n,t))}function he(e,t,n){var a;if(e.oFeatures.bStateSave)return(a=e.fnStateLoadCallback.call(e.oInstance,e,function(t){pe(e,t,n)}))!==H&&pe(e,a,n),!0;n()}function pe(n,t,e){var a,r,o=n.aoColumns,i=(n._bLoadingState=!0,n._bInitComplete?new w.Api(n):null);if(t&&t.time){var l=R(n,"aoStateLoadParams","stateLoadParams",[n,t]);if(-1!==P.inArray(!1,l))n._bLoadingState=!1;else{l=n.iStateDuration;if(0<l&&t.time<+new Date-1e3*l)n._bLoadingState=!1;else if(t.columns&&o.length!==t.columns.length)n._bLoadingState=!1;else{if(n.oLoadedState=P.extend(!0,{},t),t.length!==H&&(i?i.page.len(t.length):n._iDisplayLength=t.length),t.start!==H&&(null===i?(n._iDisplayStart=t.start,n.iInitDisplayStart=t.start):Yt(n,t.start/n._iDisplayLength)),t.order!==H&&(n.aaSorting=[],P.each(t.order,function(t,e){n.aaSorting.push(e[0]>=o.length?[0,e[1]]:e)})),t.search!==H&&P.extend(n.oPreviousSearch,Bt(t.search)),t.columns){for(a=0,r=t.columns.length;a<r;a++){var s=t.columns[a];s.visible!==H&&(i?i.column(a).visible(s.visible,!1):o[a].bVisible=s.visible),s.search!==H&&P.extend(n.aoPreSearchCols[a],Bt(s.search))}i&&i.columns.adjust()}n._bLoadingState=!1,R(n,"aoStateLoaded","stateLoaded",[n,t])}}}else n._bLoadingState=!1;e()}function ge(t){var e=w.settings,t=P.inArray(t,N(e,"nTable"));return-1!==t?e[t]:null}function W(t,e,n,a){if(n="DataTables warning: "+(t?"table id="+t.sTableId+" - ":"")+n,a&&(n+=". For more information about this error, please see https://datatables.net/tn/"+a),e)j.console&&console.log&&console.log(n);else{e=w.ext,e=e.sErrMode||e.errMode;if(t&&R(t,null,"error",[t,a,n]),"alert"==e)alert(n);else{if("throw"==e)throw new Error(n);"function"==typeof e&&e(t,a,n)}}}function F(n,a,t,e){Array.isArray(t)?P.each(t,function(t,e){Array.isArray(e)?F(n,a,e[0],e[1]):F(n,a,e)}):(e===H&&(e=t),a[t]!==H&&(n[e]=a[t]))}function be(t,e,n){var a,r;for(r in e)e.hasOwnProperty(r)&&(a=e[r],P.isPlainObject(a)?(P.isPlainObject(t[r])||(t[r]={}),P.extend(!0,t[r],a)):n&&"data"!==r&&"aaData"!==r&&Array.isArray(a)?t[r]=a.slice():t[r]=a);return t}function me(e,t,n){P(e).on("click.DT",t,function(t){P(e).trigger("blur"),n(t)}).on("keypress.DT",t,function(t){13===t.which&&(t.preventDefault(),n(t))}).on("selectstart.DT",function(){return!1})}function L(t,e,n,a){n&&t[e].push({fn:n,sName:a})}function R(n,t,e,a){var r=[];return t&&(r=P.map(n[t].slice().reverse(),function(t,e){return t.fn.apply(n.oInstance,a)})),null!==e&&(t=P.Event(e+".dt"),(e=P(n.nTable)).trigger(t,a),0===e.parents("body").length&&P("body").trigger(t,a),r.push(t.result)),r}function Se(t){var e=t._iDisplayStart,n=t.fnDisplayEnd(),a=t._iDisplayLength;n<=e&&(e=n-a),e-=e%a,t._iDisplayStart=e=-1===a||e<0?0:e}function ve(t,e){var t=t.renderer,n=w.ext.renderer[e];return P.isPlainObject(t)&&t[e]?n[t[e]]||n._:"string"==typeof t&&n[t]||n._}function E(t){return t.oFeatures.bServerSide?"ssp":t.ajax||t.sAjaxSource?"ajax":"dom"}function ye(t,n){var a;return Array.isArray(t)?P.map(t,function(t){return ye(t,n)}):"number"==typeof t?[n[t]]:(a=P.map(n,function(t,e){return t.nTable}),P(a).filter(t).map(function(t){var e=P.inArray(this,a);return n[e]}).toArray())}function De(r,o,t){var e,n;t&&(e=new B(r)).one("draw",function(){t(e.ajax.json())}),"ssp"==E(r)?u(r,o):(D(r,!0),(n=r.jqXHR)&&4!==n.readyState&&n.abort(),Tt(r,[],function(t){pt(r);for(var e=Ft(r,t),n=0,a=e.length;n<a;n++)x(r,e[n]);u(r,o),D(r,!1)}))}function _e(t,e,n,a,r){for(var o,i,l,s,u=[],c=typeof e,f=0,d=(e=e&&"string"!=c&&"function"!=c&&e.length!==H?e:[e]).length;f<d;f++)for(l=0,s=(i=e[f]&&e[f].split&&!e[f].match(/[\[\(:]/)?e[f].split(","):[e[f]]).length;l<s;l++)(o=n("string"==typeof i[l]?i[l].trim():i[l]))&&o.length&&(u=u.concat(o));var h=p.selector[t];if(h.length)for(f=0,d=h.length;f<d;f++)u=h[f](a,r,u);return z(u)}function we(t){return(t=t||{}).filter&&t.search===H&&(t.search=t.filter),P.extend({search:"none",order:"current",page:"all"},t)}function Ce(t){for(var e=0,n=t.length;e<n;e++)if(0<t[e].length)return t[0]=t[e],t[0].length=1,t.length=1,t.context=[t.context[e]],t;return t.length=0,t}function Te(o,t,e,n){function i(t,e){var n;if(Array.isArray(t)||t instanceof P)for(var a=0,r=t.length;a<r;a++)i(t[a],e);else t.nodeName&&"tr"===t.nodeName.toLowerCase()?l.push(t):(n=P("<tr><td></td></tr>").addClass(e),P("td",n).addClass(e).html(t)[0].colSpan=T(o),l.push(n[0]))}var l=[];i(e,n),t._details&&t._details.detach(),t._details=P(l),t._detailsShow&&t._details.insertAfter(t.nTr)}function xe(t,e){var n=t.context;if(n.length&&t.length){var a=n[0].aoData[t[0]];if(a._details){(a._detailsShow=e)?(a._details.insertAfter(a.nTr),P(a.nTr).addClass("dt-hasChild")):(a._details.detach(),P(a.nTr).removeClass("dt-hasChild")),R(n[0],null,"childRow",[e,t.row(t[0])]);var s=n[0],r=new B(s),a=".dt.DT_details",e="draw"+a,t="column-sizing"+a,a="destroy"+a,u=s.aoData;if(r.off(e+" "+t+" "+a),N(u,"_details").length>0){r.on(e,function(t,e){if(s!==e)return;r.rows({page:"current"}).eq(0).each(function(t){var e=u[t];if(e._detailsShow)e._details.insertAfter(e.nTr)})});r.on(t,function(t,e,n,a){if(s!==e)return;var r,o=T(e);for(var i=0,l=u.length;i<l;i++){r=u[i];if(r._details)r._details.each(function(){var t=P(this).children("td");if(t.length==1)t.attr("colspan",o)})}});r.on(a,function(t,e){if(s!==e)return;for(var n=0,a=u.length;n<a;n++)if(u[n]._details)Re(r,n)})}Le(n)}}}function Ae(t,e,n,a,r){for(var o=[],i=0,l=r.length;i<l;i++)o.push(S(t,r[i],e));return o}var Ie=[],o=Array.prototype,B=function(t,e){if(!(this instanceof B))return new B(t,e);function n(t){var e,n,a,r;t=t,a=w.settings,r=P.map(a,function(t,e){return t.nTable}),(t=t?t.nTable&&t.oApi?[t]:t.nodeName&&"table"===t.nodeName.toLowerCase()?-1!==(e=P.inArray(t,r))?[a[e]]:null:t&&"function"==typeof t.settings?t.settings().toArray():("string"==typeof t?n=P(t):t instanceof P&&(n=t),n?n.map(function(t){return-1!==(e=P.inArray(this,r))?a[e]:null}).toArray():void 0):[])&&o.push.apply(o,t)}var o=[];if(Array.isArray(t))for(var a=0,r=t.length;a<r;a++)n(t[a]);else n(t);this.context=z(o),e&&P.merge(this,e),this.selector={rows:null,cols:null,opts:null},B.extend(this,this,Ie)},Fe=(w.Api=B,P.extend(B.prototype,{any:function(){return 0!==this.count()},concat:o.concat,context:[],count:function(){return this.flatten().length},each:function(t){for(var e=0,n=this.length;e<n;e++)t.call(this,this[e],e,this);return this},eq:function(t){var e=this.context;return e.length>t?new B(e[t],this[t]):null},filter:function(t){var e=[];if(o.filter)e=o.filter.call(this,t,this);else for(var n=0,a=this.length;n<a;n++)t.call(this,this[n],n,this)&&e.push(this[n]);return new B(this.context,e)},flatten:function(){var t=[];return new B(this.context,t.concat.apply(t,this.toArray()))},join:o.join,indexOf:o.indexOf||function(t,e){for(var n=e||0,a=this.length;n<a;n++)if(this[n]===t)return n;return-1},iterator:function(t,e,n,a){var r,o,i,l,s,u,c,f,d=[],h=this.context,p=this.selector;for("string"==typeof t&&(a=n,n=e,e=t,t=!1),o=0,i=h.length;o<i;o++){var g=new B(h[o]);if("table"===e)(r=n.call(g,h[o],o))!==H&&d.push(r);else if("columns"===e||"rows"===e)(r=n.call(g,h[o],this[o],o))!==H&&d.push(r);else if("column"===e||"column-rows"===e||"row"===e||"cell"===e)for(c=this[o],"column-rows"===e&&(u=Fe(h[o],p.opts)),l=0,s=c.length;l<s;l++)f=c[l],(r="cell"===e?n.call(g,h[o],f.row,f.column,o,l):n.call(g,h[o],f,o,l,u))!==H&&d.push(r)}return d.length||a?((t=(a=new B(h,t?d.concat.apply([],d):d)).selector).rows=p.rows,t.cols=p.cols,t.opts=p.opts,a):this},lastIndexOf:o.lastIndexOf||function(t,e){return this.indexOf.apply(this.toArray.reverse(),arguments)},length:0,map:function(t){var e=[];if(o.map)e=o.map.call(this,t,this);else for(var n=0,a=this.length;n<a;n++)e.push(t.call(this,this[n],n));return new B(this.context,e)},pluck:function(t){var e=w.util.get(t);return this.map(function(t){return e(t)})},pop:o.pop,push:o.push,reduce:o.reduce||function(t,e){return et(this,t,e,0,this.length,1)},reduceRight:o.reduceRight||function(t,e){return et(this,t,e,this.length-1,-1,-1)},reverse:o.reverse,selector:null,shift:o.shift,slice:function(){return new B(this.context,this)},sort:o.sort,splice:o.splice,toArray:function(){return o.slice.call(this)},to$:function(){return P(this)},toJQuery:function(){return P(this)},unique:function(){return new B(this.context,z(this))},unshift:o.unshift}),B.extend=function(t,e,n){if(n.length&&e&&(e instanceof B||e.__dt_wrapper))for(var a,r=0,o=n.length;r<o;r++)e[(a=n[r]).name]="function"===a.type?function(e,n,a){return function(){var t=n.apply(e,arguments);return B.extend(t,t,a.methodExt),t}}(t,a.val,a):"object"===a.type?{}:a.val,e[a.name].__dt_wrapper=!0,B.extend(t,e[a.name],a.propExt)},B.register=e=function(t,e){if(Array.isArray(t))for(var n=0,a=t.length;n<a;n++)B.register(t[n],e);else for(var r=t.split("."),o=Ie,i=0,l=r.length;i<l;i++){var s,u,c=function(t,e){for(var n=0,a=t.length;n<a;n++)if(t[n].name===e)return t[n];return null}(o,u=(s=-1!==r[i].indexOf("()"))?r[i].replace("()",""):r[i]);c||o.push(c={name:u,val:{},methodExt:[],propExt:[],type:"object"}),i===l-1?(c.val=e,c.type="function"==typeof e?"function":P.isPlainObject(e)?"object":"other"):o=s?c.methodExt:c.propExt}},B.registerPlural=t=function(t,e,n){B.register(t,n),B.register(e,function(){var t=n.apply(this,arguments);return t===this?this:t instanceof B?t.length?Array.isArray(t[0])?new B(t.context,t[0]):t[0]:H:t})},e("tables()",function(t){return t!==H&&null!==t?new B(ye(t,this.context)):this}),e("table()",function(t){var t=this.tables(t),e=t.context;return e.length?new B(e[0]):t}),t("tables().nodes()","table().node()",function(){return this.iterator("table",function(t){return t.nTable},1)}),t("tables().body()","table().body()",function(){return this.iterator("table",function(t){return t.nTBody},1)}),t("tables().header()","table().header()",function(){return this.iterator("table",function(t){return t.nTHead},1)}),t("tables().footer()","table().footer()",function(){return this.iterator("table",function(t){return t.nTFoot},1)}),t("tables().containers()","table().container()",function(){return this.iterator("table",function(t){return t.nTableWrapper},1)}),e("draw()",function(e){return this.iterator("table",function(t){"page"===e?y(t):u(t,!1===(e="string"==typeof e?"full-hold"!==e:e))})}),e("page()",function(e){return e===H?this.page.info().page:this.iterator("table",function(t){Yt(t,e)})}),e("page.info()",function(t){var e,n,a,r,o;return 0===this.context.length?H:(n=(e=this.context[0])._iDisplayStart,a=e.oFeatures.bPaginate?e._iDisplayLength:-1,r=e.fnRecordsDisplay(),{page:(o=-1===a)?0:Math.floor(n/a),pages:o?1:Math.ceil(r/a),start:n,end:e.fnDisplayEnd(),length:a,recordsTotal:e.fnRecordsTotal(),recordsDisplay:r,serverSide:"ssp"===E(e)})}),e("page.len()",function(e){return e===H?0!==this.context.length?this.context[0]._iDisplayLength:H:this.iterator("table",function(t){$t(t,e)})}),e("ajax.json()",function(){var t=this.context;if(0<t.length)return t[0].json}),e("ajax.params()",function(){var t=this.context;if(0<t.length)return t[0].oAjaxData}),e("ajax.reload()",function(e,n){return this.iterator("table",function(t){De(t,!1===n,e)})}),e("ajax.url()",function(e){var t=this.context;return e===H?0===t.length?H:(t=t[0]).ajax?P.isPlainObject(t.ajax)?t.ajax.url:t.ajax:t.sAjaxSource:this.iterator("table",function(t){P.isPlainObject(t.ajax)?t.ajax.url=e:t.ajax=e})}),e("ajax.url().load()",function(e,n){return this.iterator("table",function(t){De(t,!1===n,e)})}),function(t,e){var n,a=[],r=t.aiDisplay,o=t.aiDisplayMaster,i=e.search,l=e.order,e=e.page;if("ssp"==E(t))return"removed"===i?[]:f(0,o.length);if("current"==e)for(u=t._iDisplayStart,c=t.fnDisplayEnd();u<c;u++)a.push(r[u]);else if("current"==l||"applied"==l){if("none"==i)a=o.slice();else if("applied"==i)a=r.slice();else if("removed"==i){for(var s={},u=0,c=r.length;u<c;u++)s[r[u]]=null;a=P.map(o,function(t){return s.hasOwnProperty(t)?null:t})}}else if("index"==l||"original"==l)for(u=0,c=t.aoData.length;u<c;u++)("none"==i||-1===(n=P.inArray(u,r))&&"removed"==i||0<=n&&"applied"==i)&&a.push(u);return a}),Le=(e("rows()",function(e,n){e===H?e="":P.isPlainObject(e)&&(n=e,e=""),n=we(n);var t=this.iterator("table",function(t){return _e("row",e,function(n){var t=d(n),a=r.aoData;if(null!==t&&!o)return[t];if(i=i||Fe(r,o),null!==t&&-1!==P.inArray(t,i))return[t];if(null===n||n===H||""===n)return i;if("function"==typeof n)return P.map(i,function(t){var e=a[t];return n(t,e._aData,e.nTr)?t:null});if(n.nodeName)return t=n._DT_RowIndex,e=n._DT_CellIndex,t!==H?a[t]&&a[t].nTr===n?[t]:[]:e?a[e.row]&&a[e.row].nTr===n.parentNode?[e.row]:[]:(t=P(n).closest("*[data-dt-row]")).length?[t.data("dt-row")]:[];if("string"==typeof n&&"#"===n.charAt(0)){var e=r.aIds[n.replace(/^#/,"")];if(e!==H)return[e.idx]}t=_(m(r.aoData,i,"nTr"));return P(t).filter(n).map(function(){return this._DT_RowIndex}).toArray()},r=t,o=n);var r,o,i},1);return t.selector.rows=e,t.selector.opts=n,t}),e("rows().nodes()",function(){return this.iterator("row",function(t,e){return t.aoData[e].nTr||H},1)}),e("rows().data()",function(){return this.iterator(!0,"rows",function(t,e){return m(t.aoData,e,"_aData")},1)}),t("rows().cache()","row().cache()",function(n){return this.iterator("row",function(t,e){t=t.aoData[e];return"search"===n?t._aFilterData:t._aSortData},1)}),t("rows().invalidate()","row().invalidate()",function(n){return this.iterator("row",function(t,e){bt(t,e,n)})}),t("rows().indexes()","row().index()",function(){return this.iterator("row",function(t,e){return e},1)}),t("rows().ids()","row().id()",function(t){for(var e=[],n=this.context,a=0,r=n.length;a<r;a++)for(var o=0,i=this[a].length;o<i;o++){var l=n[a].rowIdFn(n[a].aoData[this[a][o]]._aData);e.push((!0===t?"#":"")+l)}return new B(n,e)}),t("rows().remove()","row().remove()",function(){var f=this;return this.iterator("row",function(t,e,n){var a,r,o,i,l,s,u=t.aoData,c=u[e];for(u.splice(e,1),a=0,r=u.length;a<r;a++)if(s=(l=u[a]).anCells,null!==l.nTr&&(l.nTr._DT_RowIndex=a),null!==s)for(o=0,i=s.length;o<i;o++)s[o]._DT_CellIndex.row=a;gt(t.aiDisplayMaster,e),gt(t.aiDisplay,e),gt(f[n],e,!1),0<t._iRecordsDisplay&&t._iRecordsDisplay--,Se(t);n=t.rowIdFn(c._aData);n!==H&&delete t.aIds[n]}),this.iterator("table",function(t){for(var e=0,n=t.aoData.length;e<n;e++)t.aoData[e].idx=e}),this}),e("rows.add()",function(o){var t=this.iterator("table",function(t){for(var e,n=[],a=0,r=o.length;a<r;a++)(e=o[a]).nodeName&&"TR"===e.nodeName.toUpperCase()?n.push(ut(t,e)[0]):n.push(x(t,e));return n},1),e=this.rows(-1);return e.pop(),P.merge(e,t),e}),e("row()",function(t,e){return Ce(this.rows(t,e))}),e("row().data()",function(t){var e,n=this.context;return t===H?n.length&&this.length?n[0].aoData[this[0]]._aData:H:((e=n[0].aoData[this[0]])._aData=t,Array.isArray(t)&&e.nTr&&e.nTr.id&&b(n[0].rowId)(t,e.nTr.id),bt(n[0],this[0],"data"),this)}),e("row().node()",function(){var t=this.context;return t.length&&this.length&&t[0].aoData[this[0]].nTr||null}),e("row.add()",function(e){e instanceof P&&e.length&&(e=e[0]);var t=this.iterator("table",function(t){return e.nodeName&&"TR"===e.nodeName.toUpperCase()?ut(t,e)[0]:x(t,e)});return this.row(t[0])}),P(v).on("plugin-init.dt",function(t,e){var n=new B(e),a="on-plugin-init",r="stateSaveParams."+a,o="destroy. "+a,a=(n.on(r,function(t,e,n){for(var a=e.rowIdFn,r=e.aoData,o=[],i=0;i<r.length;i++)r[i]._detailsShow&&o.push("#"+a(r[i]._aData));n.childRows=o}),n.on(o,function(){n.off(r+" "+o)}),n.state.loaded());a&&a.childRows&&n.rows(P.map(a.childRows,function(t){return t.replace(/:/g,"\\:")})).every(function(){R(e,null,"requestChild",[this])})}),w.util.throttle(function(t){de(t[0])},500)),Re=function(t,e){var n=t.context;n.length&&(e=n[0].aoData[e!==H?e:t[0]])&&e._details&&(e._details.remove(),e._detailsShow=H,e._details=H,P(e.nTr).removeClass("dt-hasChild"),Le(n))},Pe="row().child",je=Pe+"()",He=(e(je,function(t,e){var n=this.context;return t===H?n.length&&this.length?n[0].aoData[this[0]]._details:H:(!0===t?this.child.show():!1===t?Re(this):n.length&&this.length&&Te(n[0],n[0].aoData[this[0]],t,e),this)}),e([Pe+".show()",je+".show()"],function(t){return xe(this,!0),this}),e([Pe+".hide()",je+".hide()"],function(){return xe(this,!1),this}),e([Pe+".remove()",je+".remove()"],function(){return Re(this),this}),e(Pe+".isShown()",function(){var t=this.context;return t.length&&this.length&&t[0].aoData[this[0]]._detailsShow||!1}),/^([^:]+):(name|visIdx|visible)$/),Ne=(e("columns()",function(n,a){n===H?n="":P.isPlainObject(n)&&(a=n,n=""),a=we(a);var t=this.iterator("table",function(t){return e=n,l=a,s=(i=t).aoColumns,u=N(s,"sName"),c=N(s,"nTh"),_e("column",e,function(n){var a,t=d(n);if(""===n)return f(s.length);if(null!==t)return[0<=t?t:s.length+t];if("function"==typeof n)return a=Fe(i,l),P.map(s,function(t,e){return n(e,Ae(i,e,0,0,a),c[e])?e:null});var r="string"==typeof n?n.match(He):"";if(r)switch(r[2]){case"visIdx":case"visible":var e,o=parseInt(r[1],10);return o<0?[(e=P.map(s,function(t,e){return t.bVisible?e:null}))[e.length+o]]:[rt(i,o)];case"name":return P.map(u,function(t,e){return t===r[1]?e:null});default:return[]}return n.nodeName&&n._DT_CellIndex?[n._DT_CellIndex.column]:(t=P(c).filter(n).map(function(){return P.inArray(this,c)}).toArray()).length||!n.nodeName?t:(t=P(n).closest("*[data-dt-column]")).length?[t.data("dt-column")]:[]},i,l);var i,e,l,s,u,c},1);return t.selector.cols=n,t.selector.opts=a,t}),t("columns().header()","column().header()",function(t,e){return this.iterator("column",function(t,e){return t.aoColumns[e].nTh},1)}),t("columns().footer()","column().footer()",function(t,e){return this.iterator("column",function(t,e){return t.aoColumns[e].nTf},1)}),t("columns().data()","column().data()",function(){return this.iterator("column-rows",Ae,1)}),t("columns().dataSrc()","column().dataSrc()",function(){return this.iterator("column",function(t,e){return t.aoColumns[e].mData},1)}),t("columns().cache()","column().cache()",function(o){return this.iterator("column-rows",function(t,e,n,a,r){return m(t.aoData,r,"search"===o?"_aFilterData":"_aSortData",e)},1)}),t("columns().nodes()","column().nodes()",function(){return this.iterator("column-rows",function(t,e,n,a,r){return m(t.aoData,r,"anCells",e)},1)}),t("columns().visible()","column().visible()",function(f,n){var e=this,t=this.iterator("column",function(t,e){if(f===H)return t.aoColumns[e].bVisible;var n,a,r=e,e=f,o=t.aoColumns,i=o[r],l=t.aoData;if(e===H)i.bVisible;else if(i.bVisible!==e){if(e)for(var s=P.inArray(!0,N(o,"bVisible"),r+1),u=0,c=l.length;u<c;u++)a=l[u].nTr,n=l[u].anCells,a&&a.insertBefore(n[r],n[s]||null);else P(N(t.aoData,"anCells",r)).detach();i.bVisible=e}});return f!==H&&this.iterator("table",function(t){Dt(t,t.aoHeader),Dt(t,t.aoFooter),t.aiDisplay.length||P(t.nTBody).find("td[colspan]").attr("colspan",T(t)),de(t),e.iterator("column",function(t,e){R(t,null,"column-visibility",[t,e,f,n])}),n!==H&&!n||e.columns.adjust()}),t}),t("columns().indexes()","column().index()",function(n){return this.iterator("column",function(t,e){return"visible"===n?ot(t,e):e},1)}),e("columns.adjust()",function(){return this.iterator("table",function(t){O(t)},1)}),e("column.index()",function(t,e){var n;if(0!==this.context.length)return n=this.context[0],"fromVisible"===t||"toData"===t?rt(n,e):"fromData"===t||"toVisible"===t?ot(n,e):void 0}),e("column()",function(t,e){return Ce(this.columns(t,e))}),e("cells()",function(g,t,b){var a,r,o,i,l,s,e;return P.isPlainObject(g)&&(g.row===H?(b=g,g=null):(b=t,t=null)),P.isPlainObject(t)&&(b=t,t=null),null===t||t===H?this.iterator("table",function(t){return a=t,t=g,e=we(b),f=a.aoData,d=Fe(a,e),n=_(m(f,d,"anCells")),h=P(Y([],n)),p=a.aoColumns.length,_e("cell",t,function(t){var e,n="function"==typeof t;if(null===t||t===H||n){for(o=[],i=0,l=d.length;i<l;i++)for(r=d[i],s=0;s<p;s++)u={row:r,column:s},(!n||(c=f[r],t(u,S(a,r,s),c.anCells?c.anCells[s]:null)))&&o.push(u);return o}return P.isPlainObject(t)?t.column!==H&&t.row!==H&&-1!==P.inArray(t.row,d)?[t]:[]:(e=h.filter(t).map(function(t,e){return{row:e._DT_CellIndex.row,column:e._DT_CellIndex.column}}).toArray()).length||!t.nodeName?e:(c=P(t).closest("*[data-dt-row]")).length?[{row:c.data("dt-row"),column:c.data("dt-column")}]:[]},a,e);var a,e,r,o,i,l,s,u,c,f,d,n,h,p}):(e=b?{page:b.page,order:b.order,search:b.search}:{},a=this.columns(t,e),r=this.rows(g,e),e=this.iterator("table",function(t,e){var n=[];for(o=0,i=r[e].length;o<i;o++)for(l=0,s=a[e].length;l<s;l++)n.push({row:r[e][o],column:a[e][l]});return n},1),e=b&&b.selected?this.cells(e,b):e,P.extend(e.selector,{cols:t,rows:g,opts:b}),e)}),t("cells().nodes()","cell().node()",function(){return this.iterator("cell",function(t,e,n){t=t.aoData[e];return t&&t.anCells?t.anCells[n]:H},1)}),e("cells().data()",function(){return this.iterator("cell",function(t,e,n){return S(t,e,n)},1)}),t("cells().cache()","cell().cache()",function(a){return a="search"===a?"_aFilterData":"_aSortData",this.iterator("cell",function(t,e,n){return t.aoData[e][a][n]},1)}),t("cells().render()","cell().render()",function(a){return this.iterator("cell",function(t,e,n){return S(t,e,n,a)},1)}),t("cells().indexes()","cell().index()",function(){return this.iterator("cell",function(t,e,n){return{row:e,column:n,columnVisible:ot(t,n)}},1)}),t("cells().invalidate()","cell().invalidate()",function(a){return this.iterator("cell",function(t,e,n){bt(t,e,a,n)})}),e("cell()",function(t,e,n){return Ce(this.cells(t,e,n))}),e("cell().data()",function(t){var e=this.context,n=this[0];return t===H?e.length&&n.length?S(e[0],n[0].row,n[0].column):H:(ct(e[0],n[0].row,n[0].column,t),bt(e[0],n[0].row,"data",n[0].column),this)}),e("order()",function(e,t){var n=this.context;return e===H?0!==n.length?n[0].aaSorting:H:("number"==typeof e?e=[[e,t]]:e.length&&!Array.isArray(e[0])&&(e=Array.prototype.slice.call(arguments)),this.iterator("table",function(t){t.aaSorting=e.slice()}))}),e("order.listener()",function(e,n,a){return this.iterator("table",function(t){ue(t,e,n,a)})}),e("order.fixed()",function(e){var t;return e?this.iterator("table",function(t){t.aaSortingFixed=P.extend(!0,{},e)}):(t=(t=this.context).length?t[0].aaSortingFixed:H,Array.isArray(t)?{pre:t}:t)}),e(["columns().order()","column().order()"],function(a){var r=this;return this.iterator("table",function(t,e){var n=[];P.each(r[e],function(t,e){n.push([e,a])}),t.aaSorting=n})}),e("search()",function(e,n,a,r){var t=this.context;return e===H?0!==t.length?t[0].oPreviousSearch.sSearch:H:this.iterator("table",function(t){t.oFeatures.bFilter&&Rt(t,P.extend({},t.oPreviousSearch,{sSearch:e+"",bRegex:null!==n&&n,bSmart:null===a||a,bCaseInsensitive:null===r||r}),1)})}),t("columns().search()","column().search()",function(a,r,o,i){return this.iterator("column",function(t,e){var n=t.aoPreSearchCols;if(a===H)return n[e].sSearch;t.oFeatures.bFilter&&(P.extend(n[e],{sSearch:a+"",bRegex:null!==r&&r,bSmart:null===o||o,bCaseInsensitive:null===i||i}),Rt(t,t.oPreviousSearch,1))})}),e("state()",function(){return this.context.length?this.context[0].oSavedState:null}),e("state.clear()",function(){return this.iterator("table",function(t){t.fnStateSaveCallback.call(t.oInstance,t,{})})}),e("state.loaded()",function(){return this.context.length?this.context[0].oLoadedState:null}),e("state.save()",function(){return this.iterator("table",function(t){de(t)})}),w.use=function(t,e){"lib"===e||t.fn?P=t:"win"==e||t.document?v=(j=t).document:"datetime"!==e&&"DateTime"!==t.type||(w.DateTime=t)},w.factory=function(t,e){var n=!1;return t&&t.document&&(v=(j=t).document),e&&e.fn&&e.fn.jquery&&(P=e,n=!0),n},w.versionCheck=w.fnVersionCheck=function(t){for(var e,n,a=w.version.split("."),r=t.split("."),o=0,i=r.length;o<i;o++)if((e=parseInt(a[o],10)||0)!==(n=parseInt(r[o],10)||0))return n<e;return!0},w.isDataTable=w.fnIsDataTable=function(t){var r=P(t).get(0),o=!1;return t instanceof w.Api||(P.each(w.settings,function(t,e){var n=e.nScrollHead?P("table",e.nScrollHead)[0]:null,a=e.nScrollFoot?P("table",e.nScrollFoot)[0]:null;e.nTable!==r&&n!==r&&a!==r||(o=!0)}),o)},w.tables=w.fnTables=function(e){var t=!1,n=(P.isPlainObject(e)&&(t=e.api,e=e.visible),P.map(w.settings,function(t){if(!e||P(t.nTable).is(":visible"))return t.nTable}));return t?new B(n):n},w.camelToHungarian=C,e("$()",function(t,e){e=this.rows(e).nodes(),e=P(e);return P([].concat(e.filter(t).toArray(),e.find(t).toArray()))}),P.each(["on","one","off"],function(t,n){e(n+"()",function(){var t=Array.prototype.slice.call(arguments),e=(t[0]=P.map(t[0].split(/\s/),function(t){return t.match(/\.dt\b/)?t:t+".dt"}).join(" "),P(this.tables().nodes()));return e[n].apply(e,t),this})}),e("clear()",function(){return this.iterator("table",function(t){pt(t)})}),e("settings()",function(){return new B(this.context,this.context)}),e("init()",function(){var t=this.context;return t.length?t[0].oInit:null}),e("data()",function(){return this.iterator("table",function(t){return N(t.aoData,"_aData")}).flatten()}),e("destroy()",function(c){return c=c||!1,this.iterator("table",function(e){var n,t=e.oClasses,a=e.nTable,r=e.nTBody,o=e.nTHead,i=e.nTFoot,l=P(a),r=P(r),s=P(e.nTableWrapper),u=P.map(e.aoData,function(t){return t.nTr}),i=(e.bDestroying=!0,R(e,"aoDestroyCallback","destroy",[e]),c||new B(e).columns().visible(!0),s.off(".DT").find(":not(tbody *)").off(".DT"),P(j).off(".DT-"+e.sInstance),a!=o.parentNode&&(l.children("thead").detach(),l.append(o)),i&&a!=i.parentNode&&(l.children("tfoot").detach(),l.append(i)),e.aaSorting=[],e.aaSortingFixed=[],ce(e),P(u).removeClass(e.asStripeClasses.join(" ")),P("th, td",o).removeClass(t.sSortable+" "+t.sSortableAsc+" "+t.sSortableDesc+" "+t.sSortableNone),r.children().detach(),r.append(u),e.nTableWrapper.parentNode),o=c?"remove":"detach",u=(l[o](),s[o](),!c&&i&&(i.insertBefore(a,e.nTableReinsertBefore),l.css("width",e.sDestroyWidth).removeClass(t.sTable),n=e.asDestroyStripes.length)&&r.children().each(function(t){P(this).addClass(e.asDestroyStripes[t%n])}),P.inArray(e,w.settings));-1!==u&&w.settings.splice(u,1)})}),P.each(["column","row","cell"],function(t,s){e(s+"s().every()",function(o){var i=this.selector.opts,l=this;return this.iterator(s,function(t,e,n,a,r){o.call(l[s](e,"cell"===s?n:i,"cell"===s?i:H),e,n,a,r)})})}),e("i18n()",function(t,e,n){var a=this.context[0],t=A(t)(a.oLanguage);return t===H&&(t=e),"string"==typeof(t=n!==H&&P.isPlainObject(t)?t[n]!==H?t[n]:t._:t)?t.replace("%d",n):t}),w.version="1.13.8",w.settings=[],w.models={},w.models.oSearch={bCaseInsensitive:!0,sSearch:"",bRegex:!1,bSmart:!0,return:!1},w.models.oRow={nTr:null,anCells:null,_aData:[],_aSortData:null,_aFilterData:null,_sFilterRow:null,_sRowStripe:"",src:null,idx:-1},w.models.oColumn={idx:null,aDataSort:null,asSorting:null,bSearchable:null,bSortable:null,bVisible:null,_sManualType:null,_bAttrSrc:!1,fnCreatedCell:null,fnGetData:null,fnSetData:null,mData:null,mRender:null,nTh:null,nTf:null,sClass:null,sContentPadding:null,sDefaultContent:null,sName:null,sSortDataType:"std",sSortingClass:null,sSortingClassJUI:null,sTitle:null,sType:null,sWidth:null,sWidthOrig:null},w.defaults={aaData:null,aaSorting:[[0,"asc"]],aaSortingFixed:[],ajax:null,aLengthMenu:[10,25,50,100],aoColumns:null,aoColumnDefs:null,aoSearchCols:[],asStripeClasses:null,bAutoWidth:!0,bDeferRender:!1,bDestroy:!1,bFilter:!0,bInfo:!0,bLengthChange:!0,bPaginate:!0,bProcessing:!1,bRetrieve:!1,bScrollCollapse:!1,bServerSide:!1,bSort:!0,bSortMulti:!0,bSortCellsTop:!1,bSortClasses:!0,bStateSave:!1,fnCreatedRow:null,fnDrawCallback:null,fnFooterCallback:null,fnFormatNumber:function(t){return t.toString().replace(/\B(?=(\d{3})+(?!\d))/g,this.oLanguage.sThousands)},fnHeaderCallback:null,fnInfoCallback:null,fnInitComplete:null,fnPreDrawCallback:null,fnRowCallback:null,fnServerData:null,fnServerParams:null,fnStateLoadCallback:function(t){try{return JSON.parse((-1===t.iStateDuration?sessionStorage:localStorage).getItem("DataTables_"+t.sInstance+"_"+location.pathname))}catch(t){return{}}},fnStateLoadParams:null,fnStateLoaded:null,fnStateSaveCallback:function(t,e){try{(-1===t.iStateDuration?sessionStorage:localStorage).setItem("DataTables_"+t.sInstance+"_"+location.pathname,JSON.stringify(e))}catch(t){}},fnStateSaveParams:null,iStateDuration:7200,iDeferLoading:null,iDisplayLength:10,iDisplayStart:0,iTabIndex:0,oClasses:{},oLanguage:{oAria:{sSortAscending:": activate to sort column ascending",sSortDescending:": activate to sort column descending"},oPaginate:{sFirst:"First",sLast:"Last",sNext:"Next",sPrevious:"Previous"},sEmptyTable:"No data available in table",sInfo:"Showing _START_ to _END_ of _TOTAL_ entries",sInfoEmpty:"Showing 0 to 0 of 0 entries",sInfoFiltered:"(filtered from _MAX_ total entries)",sInfoPostFix:"",sDecimal:"",sThousands:",",sLengthMenu:"Show _MENU_ entries",sLoadingRecords:"Loading...",sProcessing:"",sSearch:"Search:",sSearchPlaceholder:"",sUrl:"",sZeroRecords:"No matching records found"},oSearch:P.extend({},w.models.oSearch),sAjaxDataProp:"data",sAjaxSource:null,sDom:"lfrtip",searchDelay:null,sPaginationType:"simple_numbers",sScrollX:"",sScrollXInner:"",sScrollY:"",sServerMethod:"GET",renderer:null,rowId:"DT_RowId"},i(w.defaults),w.defaults.column={aDataSort:null,iDataSort:-1,asSorting:["asc","desc"],bSearchable:!0,bSortable:!0,bVisible:!0,fnCreatedCell:null,mData:null,mRender:null,sCellType:"td",sClass:"",sContentPadding:"",sDefaultContent:null,sName:"",sSortDataType:"std",sTitle:null,sType:null,sWidth:null},i(w.defaults.column),w.models.oSettings={oFeatures:{bAutoWidth:null,bDeferRender:null,bFilter:null,bInfo:null,bLengthChange:null,bPaginate:null,bProcessing:null,bServerSide:null,bSort:null,bSortMulti:null,bSortClasses:null,bStateSave:null},oScroll:{bCollapse:null,iBarWidth:0,sX:null,sXInner:null,sY:null},oLanguage:{fnInfoCallback:null},oBrowser:{bScrollOversize:!1,bScrollbarLeft:!1,bBounding:!1,barWidth:0},ajax:null,aanFeatures:[],aoData:[],aiDisplay:[],aiDisplayMaster:[],aIds:{},aoColumns:[],aoHeader:[],aoFooter:[],oPreviousSearch:{},aoPreSearchCols:[],aaSorting:null,aaSortingFixed:[],asStripeClasses:null,asDestroyStripes:[],sDestroyWidth:0,aoRowCallback:[],aoHeaderCallback:[],aoFooterCallback:[],aoDrawCallback:[],aoRowCreatedCallback:[],aoPreDrawCallback:[],aoInitComplete:[],aoStateSaveParams:[],aoStateLoadParams:[],aoStateLoaded:[],sTableId:"",nTable:null,nTHead:null,nTFoot:null,nTBody:null,nTableWrapper:null,bDeferLoading:!1,bInitialised:!1,aoOpenRows:[],sDom:null,searchDelay:null,sPaginationType:"two_button",iStateDuration:0,aoStateSave:[],aoStateLoad:[],oSavedState:null,oLoadedState:null,sAjaxSource:null,sAjaxDataProp:null,jqXHR:null,json:H,oAjaxData:H,fnServerData:null,aoServerParams:[],sServerMethod:null,fnFormatNumber:null,aLengthMenu:null,iDraw:0,bDrawing:!1,iDrawError:-1,_iDisplayLength:10,_iDisplayStart:0,_iRecordsTotal:0,_iRecordsDisplay:0,oClasses:{},bFiltered:!1,bSorted:!1,bSortCellsTop:null,oInit:null,aoDestroyCallback:[],fnRecordsTotal:function(){return"ssp"==E(this)?+this._iRecordsTotal:this.aiDisplayMaster.length},fnRecordsDisplay:function(){return"ssp"==E(this)?+this._iRecordsDisplay:this.aiDisplay.length},fnDisplayEnd:function(){var t=this._iDisplayLength,e=this._iDisplayStart,n=e+t,a=this.aiDisplay.length,r=this.oFeatures,o=r.bPaginate;return r.bServerSide?!1===o||-1===t?e+a:Math.min(e+t,this._iRecordsDisplay):!o||a<n||-1===t?a:n},oInstance:null,sInstance:null,iTabIndex:0,nScrollHead:null,nScrollFoot:null,aLastSort:[],oPlugins:{},rowIdFn:null,rowId:null},w.ext=p={buttons:{},classes:{},builder:"-source-",errMode:"alert",feature:[],search:[],selector:{cell:[],column:[],row:[]},internal:{},legacy:{ajax:null},pager:{},renderer:{pageButton:{},header:{}},order:{},type:{detect:[],search:{},order:{}},_unique:0,fnVersionCheck:w.fnVersionCheck,iApiIndex:0,oJUIClasses:{},sVersion:w.version},P.extend(p,{afnFiltering:p.search,aTypes:p.type.detect,ofnSearch:p.type.search,oSort:p.type.order,afnSortData:p.order,aoFeatures:p.feature,oApi:p.internal,oStdClasses:p.classes,oPagination:p.pager}),P.extend(w.ext.classes,{sTable:"dataTable",sNoFooter:"no-footer",sPageButton:"paginate_button",sPageButtonActive:"current",sPageButtonDisabled:"disabled",sStripeOdd:"odd",sStripeEven:"even",sRowEmpty:"dataTables_empty",sWrapper:"dataTables_wrapper",sFilter:"dataTables_filter",sInfo:"dataTables_info",sPaging:"dataTables_paginate paging_",sLength:"dataTables_length",sProcessing:"dataTables_processing",sSortAsc:"sorting_asc",sSortDesc:"sorting_desc",sSortable:"sorting",sSortableAsc:"sorting_desc_disabled",sSortableDesc:"sorting_asc_disabled",sSortableNone:"sorting_disabled",sSortColumn:"sorting_",sFilterInput:"",sLengthSelect:"",sScrollWrapper:"dataTables_scroll",sScrollHead:"dataTables_scrollHead",sScrollHeadInner:"dataTables_scrollHeadInner",sScrollBody:"dataTables_scrollBody",sScrollFoot:"dataTables_scrollFoot",sScrollFootInner:"dataTables_scrollFootInner",sHeaderTH:"",sFooterTH:"",sSortJUIAsc:"",sSortJUIDesc:"",sSortJUI:"",sSortJUIAscAllowed:"",sSortJUIDescAllowed:"",sSortJUIWrapper:"",sSortIcon:"",sJUIHeader:"",sJUIFooter:""}),w.ext.pager);function Oe(t,e){var n=[],a=Ne.numbers_length,r=Math.floor(a/2);return e<=a?n=f(0,e):t<=r?((n=f(0,a-2)).push("ellipsis"),n.push(e-1)):((e-1-r<=t?n=f(e-(a-2),e):((n=f(t-r+2,t+r-1)).push("ellipsis"),n.push(e-1),n)).splice(0,0,"ellipsis"),n.splice(0,0,0)),n.DT_el="span",n}P.extend(Ne,{simple:function(t,e){return["previous","next"]},full:function(t,e){return["first","previous","next","last"]},numbers:function(t,e){return[Oe(t,e)]},simple_numbers:function(t,e){return["previous",Oe(t,e),"next"]},full_numbers:function(t,e){return["first","previous",Oe(t,e),"next","last"]},first_last_numbers:function(t,e){return["first",Oe(t,e),"last"]},_numbers:Oe,numbers_length:7}),P.extend(!0,w.ext.renderer,{pageButton:{_:function(u,t,c,e,f,d){function h(t,e){for(var n,a=b.sPageButtonDisabled,r=function(t){Yt(u,t.data.action,!0)},o=0,i=e.length;o<i;o++)if(n=e[o],Array.isArray(n)){var l=P("<"+(n.DT_el||"div")+"/>").appendTo(t);h(l,n)}else{var s=!1;switch(p=null,g=n){case"ellipsis":t.append('<span class="ellipsis">&#x2026;</span>');break;case"first":p=m.sFirst,0===f&&(s=!0);break;case"previous":p=m.sPrevious,0===f&&(s=!0);break;case"next":p=m.sNext,0!==d&&f!==d-1||(s=!0);break;case"last":p=m.sLast,0!==d&&f!==d-1||(s=!0);break;default:p=u.fnFormatNumber(n+1),g=f===n?b.sPageButtonActive:""}null!==p&&(l=u.oInit.pagingTag||"a",s&&(g+=" "+a),me(P("<"+l+">",{class:b.sPageButton+" "+g,"aria-controls":u.sTableId,"aria-disabled":s?"true":null,"aria-label":S[n],role:"link","aria-current":g===b.sPageButtonActive?"page":null,"data-dt-idx":n,tabindex:s?-1:u.iTabIndex,id:0===c&&"string"==typeof n?u.sTableId+"_"+n:null}).html(p).appendTo(t),{action:n},r))}}var p,g,n,b=u.oClasses,m=u.oLanguage.oPaginate,S=u.oLanguage.oAria.paginate||{};try{n=P(t).find(v.activeElement).data("dt-idx")}catch(t){}h(P(t).empty(),e),n!==H&&P(t).find("[data-dt-idx="+n+"]").trigger("focus")}}}),P.extend(w.ext.type.detect,[function(t,e){e=e.oLanguage.sDecimal;return l(t,e)?"num"+e:null},function(t,e){var n;return(!t||t instanceof Date||X.test(t))&&(null!==(n=Date.parse(t))&&!isNaN(n)||h(t))?"date":null},function(t,e){e=e.oLanguage.sDecimal;return l(t,e,!0)?"num-fmt"+e:null},function(t,e){e=e.oLanguage.sDecimal;return a(t,e)?"html-num"+e:null},function(t,e){e=e.oLanguage.sDecimal;return a(t,e,!0)?"html-num-fmt"+e:null},function(t,e){return h(t)||"string"==typeof t&&-1!==t.indexOf("<")?"html":null}]),P.extend(w.ext.type.search,{html:function(t){return h(t)?t:"string"==typeof t?t.replace(U," ").replace(V,""):""},string:function(t){return!h(t)&&"string"==typeof t?t.replace(U," "):t}});function ke(t,e,n,a){var r;return 0===t||t&&"-"!==t?"number"==(r=typeof t)||"bigint"==r?t:+(t=(t=e?$(t,e):t).replace&&(n&&(t=t.replace(n,"")),a)?t.replace(a,""):t):-1/0}function Me(n){P.each({num:function(t){return ke(t,n)},"num-fmt":function(t){return ke(t,n,q)},"html-num":function(t){return ke(t,n,V)},"html-num-fmt":function(t){return ke(t,n,V,q)}},function(t,e){p.type.order[t+n+"-pre"]=e,t.match(/^html\-/)&&(p.type.search[t+n]=p.type.search.html)})}P.extend(p.type.order,{"date-pre":function(t){t=Date.parse(t);return isNaN(t)?-1/0:t},"html-pre":function(t){return h(t)?"":t.replace?t.replace(/<.*?>/g,"").toLowerCase():t+""},"string-pre":function(t){return h(t)?"":"string"==typeof t?t.toLowerCase():t.toString?t.toString():""},"string-asc":function(t,e){return t<e?-1:e<t?1:0},"string-desc":function(t,e){return t<e?1:e<t?-1:0}}),Me(""),P.extend(!0,w.ext.renderer,{header:{_:function(r,o,i,l){P(r.nTable).on("order.dt.DT",function(t,e,n,a){r===e&&(e=i.idx,o.removeClass(l.sSortAsc+" "+l.sSortDesc).addClass("asc"==a[e]?l.sSortAsc:"desc"==a[e]?l.sSortDesc:i.sSortingClass))})},jqueryui:function(r,o,i,l){P("<div/>").addClass(l.sSortJUIWrapper).append(o.contents()).append(P("<span/>").addClass(l.sSortIcon+" "+i.sSortingClassJUI)).appendTo(o),P(r.nTable).on("order.dt.DT",function(t,e,n,a){r===e&&(e=i.idx,o.removeClass(l.sSortAsc+" "+l.sSortDesc).addClass("asc"==a[e]?l.sSortAsc:"desc"==a[e]?l.sSortDesc:i.sSortingClass),o.find("span."+l.sSortIcon).removeClass(l.sSortJUIAsc+" "+l.sSortJUIDesc+" "+l.sSortJUI+" "+l.sSortJUIAscAllowed+" "+l.sSortJUIDescAllowed).addClass("asc"==a[e]?l.sSortJUIAsc:"desc"==a[e]?l.sSortJUIDesc:i.sSortingClassJUI))})}}});function We(t){return"string"==typeof(t=Array.isArray(t)?t.join(","):t)?t.replace(/&/g,"&amp;").replace(/</g,"&lt;").replace(/>/g,"&gt;").replace(/"/g,"&quot;"):t}function Ee(t,e,n,a,r){return j.moment?t[e](r):j.luxon?t[n](r):a?t[a](r):t}var Be=!1;function Ue(t,e,n){var a;if(j.moment){if(!(a=j.moment.utc(t,e,n,!0)).isValid())return null}else if(j.luxon){if(!(a=e&&"string"==typeof t?j.luxon.DateTime.fromFormat(t,e):j.luxon.DateTime.fromISO(t)).isValid)return null;a.setLocale(n)}else e?(Be||alert("DataTables warning: Formatted date without Moment.js or Luxon - https://datatables.net/tn/17"),Be=!0):a=new Date(t);return a}function Ve(s){return function(a,r,o,i){0===arguments.length?(o="en",a=r=null):1===arguments.length?(o="en",r=a,a=null):2===arguments.length&&(o=r,r=a,a=null);var l="datetime-"+r;return w.ext.type.order[l]||(w.ext.type.detect.unshift(function(t){return t===l&&l}),w.ext.type.order[l+"-asc"]=function(t,e){t=t.valueOf(),e=e.valueOf();return t===e?0:t<e?-1:1},w.ext.type.order[l+"-desc"]=function(t,e){t=t.valueOf(),e=e.valueOf();return t===e?0:e<t?-1:1}),function(t,e){var n;return null!==t&&t!==H||(t="--now"===i?(n=new Date,new Date(Date.UTC(n.getFullYear(),n.getMonth(),n.getDate(),n.getHours(),n.getMinutes(),n.getSeconds()))):""),"type"===e?l:""===t?"sort"!==e?"":Ue("0000-01-01 00:00:00",null,o):!(null===r||a!==r||"sort"===e||"type"===e||t instanceof Date)||null===(n=Ue(t,a,o))?t:"sort"===e?n:(t=null===r?Ee(n,"toDate","toJSDate","")[s]():Ee(n,"format","toFormat","toISOString",r),"display"===e?We(t):t)}}}var Xe=",",Je=".";if(j.Intl!==H)try{for(var qe=(new Intl.NumberFormat).formatToParts(100000.1),n=0;n<qe.length;n++)"group"===qe[n].type?Xe=qe[n].value:"decimal"===qe[n].type&&(Je=qe[n].value)}catch(t){}function $e(e){return function(){var t=[ge(this[w.ext.iApiIndex])].concat(Array.prototype.slice.call(arguments));return w.ext.internal[e].apply(this,t)}}return w.datetime=function(n,a){var r="datetime-detect-"+n;a=a||"en",w.ext.type.order[r]||(w.ext.type.detect.unshift(function(t){var e=Ue(t,n,a);return!(""!==t&&!e)&&r}),w.ext.type.order[r+"-pre"]=function(t){return Ue(t,n,a)||0})},w.render={date:Ve("toLocaleDateString"),datetime:Ve("toLocaleString"),time:Ve("toLocaleTimeString"),number:function(a,r,o,i,l){return null!==a&&a!==H||(a=Xe),null!==r&&r!==H||(r=Je),{display:function(t){if("number"!=typeof t&&"string"!=typeof t)return t;if(""===t||null===t)return t;var e=t<0?"-":"",n=parseFloat(t);if(isNaN(n))return We(t);n=n.toFixed(o),t=Math.abs(n);n=parseInt(t,10),t=o?r+(t-n).toFixed(o).substring(2):"";return(e=0===n&&0===parseFloat(t)?"":e)+(i||"")+n.toString().replace(/\B(?=(\d{3})+(?!\d))/g,a)+t+(l||"")}}},text:function(){return{display:We,filter:We}}},P.extend(w.ext.internal,{_fnExternApiFunc:$e,_fnBuildAjax:Tt,_fnAjaxUpdate:xt,_fnAjaxParameters:At,_fnAjaxUpdateDraw:It,_fnAjaxDataSrc:Ft,_fnAddColumn:nt,_fnColumnOptions:at,_fnAdjustColumnSizing:O,_fnVisibleToColumnIndex:rt,_fnColumnIndexToVisible:ot,_fnVisbleColumns:T,_fnGetColumns:it,_fnColumnTypes:lt,_fnApplyColumnDefs:st,_fnHungarianMap:i,_fnCamelToHungarian:C,_fnLanguageCompat:Z,_fnBrowserDetect:tt,_fnAddData:x,_fnAddTr:ut,_fnNodeToDataIndex:function(t,e){return e._DT_RowIndex!==H?e._DT_RowIndex:null},_fnNodeToColumnIndex:function(t,e,n){return P.inArray(n,t.aoData[e].anCells)},_fnGetCellData:S,_fnSetCellData:ct,_fnSplitObjNotation:dt,_fnGetObjectDataFn:A,_fnSetObjectDataFn:b,_fnGetDataMaster:ht,_fnClearTable:pt,_fnDeleteIndex:gt,_fnInvalidate:bt,_fnGetRowElements:mt,_fnCreateTr:St,_fnBuildHead:yt,_fnDrawHead:Dt,_fnDraw:y,_fnReDraw:u,_fnAddOptionsHtml:_t,_fnDetectHeader:wt,_fnGetUniqueThs:Ct,_fnFeatureHtmlFilter:Lt,_fnFilterComplete:Rt,_fnFilterCustom:Pt,_fnFilterColumn:jt,_fnFilter:Ht,_fnFilterCreateSearch:Nt,_fnEscapeRegex:Ot,_fnFilterData:Wt,_fnFeatureHtmlInfo:Ut,_fnUpdateInfo:Vt,_fnInfoMacros:Xt,_fnInitialise:Jt,_fnInitComplete:qt,_fnLengthChange:$t,_fnFeatureHtmlLength:Gt,_fnFeatureHtmlPaginate:zt,_fnPageChange:Yt,_fnFeatureHtmlProcessing:Zt,_fnProcessingDisplay:D,_fnFeatureHtmlTable:Kt,_fnScrollDraw:Qt,_fnApplyToChildren:k,_fnCalculateColumnWidths:ee,_fnThrottle:ne,_fnConvertToWidth:ae,_fnGetWidestNode:re,_fnGetMaxLenString:oe,_fnStringToCss:M,_fnSortFlatten:I,_fnSort:ie,_fnSortAria:le,_fnSortListener:se,_fnSortAttachListener:ue,_fnSortingClasses:ce,_fnSortData:fe,_fnSaveState:de,_fnLoadState:he,_fnImplementState:pe,_fnSettingsFromNode:ge,_fnLog:W,_fnMap:F,_fnBindAction:me,_fnCallbackReg:L,_fnCallbackFire:R,_fnLengthOverflow:Se,_fnRenderer:ve,_fnDataSource:E,_fnRowAttributes:vt,_fnExtend:be,_fnCalculateEnd:function(){}}),((P.fn.dataTable=w).$=P).fn.dataTableSettings=w.settings,P.fn.dataTableExt=w.ext,P.fn.DataTable=function(t){return P(this).dataTable(t).api()},P.each(w,function(t,e){P.fn.DataTable[t]=e}),w}); \ No newline at end of file
diff --git a/bitbake/lib/toaster/toastergui/static/js/libtoaster.js b/bitbake/lib/toaster/toastergui/static/js/libtoaster.js
index f2c45c833e..d4ac31234c 100644
--- a/bitbake/lib/toaster/toastergui/static/js/libtoaster.js
+++ b/bitbake/lib/toaster/toastergui/static/js/libtoaster.js
@@ -657,7 +657,7 @@ $(document).ready(function() {
hljs.initHighlightingOnLoad();
// Prevent invalid links from jumping page scroll
- $('a[href=#]').click(function() {
+ $('a[href="#"]').click(function() {
return false;
});
diff --git a/bitbake/lib/toaster/toastergui/static/js/projectpage.js b/bitbake/lib/toaster/toastergui/static/js/projectpage.js
index 506471e091..a3c95810a7 100644
--- a/bitbake/lib/toaster/toastergui/static/js/projectpage.js
+++ b/bitbake/lib/toaster/toastergui/static/js/projectpage.js
@@ -61,7 +61,7 @@ function projectPageInit(ctx) {
distroChangeInput.val(urlParams.setDistro);
distroChangeBtn.click();
} else {
- updateDistroName(prjInfo.distro.name);
+ updateDistroName(prjInfo.distro?.name);
}
/* Now we're really ready show the page */
diff --git a/bitbake/lib/toaster/toastergui/templates/base.html b/bitbake/lib/toaster/toastergui/templates/base.html
index 2b3054936a..e90be69620 100644
--- a/bitbake/lib/toaster/toastergui/templates/base.html
+++ b/bitbake/lib/toaster/toastergui/templates/base.html
@@ -14,11 +14,11 @@
<meta name="viewport" content="width=device-width, initial-scale=1.0" />
<meta http-equiv="Content-Type" content="text/html;charset=UTF-8" />
- <script src="{% static 'js/jquery-2.0.3.min.js' %}">
+ <script src="{% static 'js/jquery-3.7.1.min.js' %}">
</script>
<script src="{% static 'js/jquery.cookie.js' %}">
</script>
- <script src="{% static 'js/bootstrap.min.js' %}">
+ <script src="{% static 'js/bootstrap-3.4.1.min.js' %}">
</script>
<script src="{% static 'js/typeahead.jquery.js' %}">
</script>
@@ -94,7 +94,7 @@
</a>
<a class="brand" href="/">Toaster</a>
{% if DEBUG %}
- <span class="glyphicon glyphicon-info-sign" title="<strong>Toaster version information</strong>" data-content="<dl><dt>Git branch</dt><dd>{{TOASTER_BRANCH}}</dd><dt>Git revision</dt><dd>{{TOASTER_REVISION}}</dd></dl>"></i>
+ <span id="toaster-version-info-sign" class="glyphicon glyphicon-info-sign" title="<strong>Toaster version information</strong>" data-content="<dl><dt>Git branch</dt><dd>{{TOASTER_BRANCH}}</dd><dt>Git revision</dt><dd>{{TOASTER_REVISION}}</dd></dl>"></i>
{% endif %}
</div>
</div>
@@ -132,7 +132,8 @@
{% if project_enable %}
<a class="btn btn-default navbar-btn navbar-right" id="new-project-button" href="{% url 'newproject' %}">New project</a>
{% endif %}
- </div>
+ <a class="btn btn-default navbar-btn navbar-right" id="import_page" style="margin-right: 5px !important" id="import-cmdline-button" href="{% url 'cmdlines' %}">Import command line builds</a>
+ </div>
</div>
</nav>
diff --git a/bitbake/lib/toaster/toastergui/templates/base_specific.html b/bitbake/lib/toaster/toastergui/templates/base_specific.html
index e377cadd73..425f7ed73d 100644
--- a/bitbake/lib/toaster/toastergui/templates/base_specific.html
+++ b/bitbake/lib/toaster/toastergui/templates/base_specific.html
@@ -14,11 +14,11 @@
<meta name="viewport" content="width=device-width, initial-scale=1.0" />
<meta http-equiv="Content-Type" content="text/html;charset=UTF-8" />
- <script src="{% static 'js/jquery-2.0.3.min.js' %}">
+ <script src="{% static 'js/jquery-3.7.1.min.js' %}">
</script>
<script src="{% static 'js/jquery.cookie.js' %}">
</script>
- <script src="{% static 'js/bootstrap.min.js' %}">
+ <script src="{% static 'js/bootstrap-3.4.1.min.js' %}">
</script>
<script src="{% static 'js/typeahead.jquery.js' %}">
</script>
diff --git a/bitbake/lib/toaster/toastergui/templates/command_line_builds.html b/bitbake/lib/toaster/toastergui/templates/command_line_builds.html
new file mode 100644
index 0000000000..05db6727e7
--- /dev/null
+++ b/bitbake/lib/toaster/toastergui/templates/command_line_builds.html
@@ -0,0 +1,209 @@
+{% extends "base.html" %}
+{% load projecttags %}
+{% load humanize %}
+{% load static %}
+
+{% block title %} Import Builds from eventlogs - Toaster {% endblock %}
+
+{% block pagecontent %}
+
+<div class="container-fluid">
+ <div id="overlay" class="hide">
+ <div class="spinner">
+ <div class="fa-spin">
+ </div>
+ </div>
+ </div>
+ <div class="row">
+ <div class="col-md-12">
+ <div class="page-header">
+ <div class="row">
+ <div class="col-md-6">
+ <h1>Import command line builds</h1>
+ </div>
+ {% if import_all %}
+ <div class="col-md-6">
+ <button id="import_all" type="button" class="btn btn-primary navbar-btn navbar-right">
+ <span class="glyphicon glyphicon-upload" style="vertical-align: top;"></span> Import All
+ </button>
+ </div>
+ {% endif %}
+ </div>
+ </div>
+ {% if messages %}
+ <div class="row-fluid" id="empty-state-{{table_name}}">
+ {% for message in messages %}
+ <div class="alert alert-danger">{{message}}</div>
+ {%endfor%}
+ </div>
+ {% endif %}
+ <div class="row">
+ <h4 style="margin-left: 15px;"><strong>Import eventlog file</strong></h4>
+ <form method="POST" enctype="multipart/form-data" action="{% url 'cmdlines' %}" id="form_file">
+ {% csrf_token %}
+ <div class="col-md-6" style="padding-left: 20px;">
+ <div class="row">
+ <input type="hidden" value="{{dir}}" name="dir">
+ <div class="col-md-3"> {{ form.eventlog_file}} </div>
+ </div>
+ <div class="row" style="padding-top: 10px;">
+ <div class="col-md-6">
+ <button id="file_import" type="submit" disabled="disabled" class="btn btn-default navbar-btn" >
+ <span class="glyphicon glyphicon-upload" style="vertical-align: top;"></span> Import
+ </button>
+ </div>
+ </div>
+ </div>
+ </form>
+ </div>
+
+ <div class="row" style="padding-top: 20px;">
+ <div class="col-md-8 ">
+ <h4><strong>Eventlogs from existing build directory: </strong>
+ <a href="#" data-toggle="tooltip" title="{{dir}}">
+ <svg xmlns="http://www.w3.org/2000/svg" width="16" height="16" fill="currentColor" class="bi bi-info-circle" viewBox="0 0 16 16" data-toggle="tooltip">
+ <path d="M8 15A7 7 0 1 1 8 1a7 7 0 0 1 0 14m0 1A8 8 0 1 0 8 0a8 8 0 0 0 0 16"/>
+ <path d="m8.93 6.588-2.29.287-.082.38.45.083c.294.07.352.176.288.469l-.738 3.468c-.194.897.105 1.319.808 1.319.545 0 1.178-.252 1.465-.598l.088-.416c-.2.176-.492.246-.686.246-.275 0-.375-.193-.304-.533zM9 4.5a1 1 0 1 1-2 0 1 1 0 0 1 2 0"/>
+ </svg>
+ </a>
+ </h4>
+ {% if files %}
+ <div class="table-responsive">
+ <table class="table col-md-6 table-bordered table-hover" id="eventlog-table" style="border-collapse: collapse;">
+ <thead>
+ <tr class="row">
+ <th scope="col">Name</th>
+ <th scope="col">Size</th>
+ <th scope="col">Action</th>
+ </tr>
+ </thead>
+ <tbody>
+ {% for file in files %}
+ <tr class="row" style="height: 48px;">
+ <th scope="row" class="col-md-4" style="vertical-align: middle;">
+ <input type="hidden" value="{{file.name}}" name="{{file.name}}">{{file.name}}
+ </th>
+ <td class="col-md-4 align-middle" style="vertical-align: middle;">{{file.size|filesizeformat}}</td>
+ <td class="col-md-4 align-middle" style="vertical-align: middle;">
+ {% if file.imported == True and file.build_id is not None %}
+ <a href="{% url 'builddashboard' file.build_id %}">Build Details</a>
+ {% elif request.session.file == file.name or request.session.all_builds %}
+ <a data-toggle="tooltip" title="Build in progress">
+ <span class="glyphicon glyphicon-upload" style="font-size: 18px; color:grey"></span>
+ </a>
+ {%else%}
+ <a onclick="_ajax_update('{{file.name}}', false, '{{dir}}')" data-toggle="tooltip" title="Import File">
+ <span class="glyphicon glyphicon-upload" style="font-size: 18px;"></span>
+ </a>
+ {%endif%}
+ </td>
+ </tr>
+ {% endfor%}
+ </tbody>
+ </table>
+ </div>
+ {% else %}
+ <div class="row-fluid" id="empty-state-{{table_name}}">
+ <div class="alert alert-info">Sorry - no files found</div>
+ </div>
+ {%endif%}
+ </div>
+ </div>
+ </div>
+ </div>
+</div>
+
+<link rel="stylesheet" href="{% static 'css/jquery.dataTables-1.13.8.min.css' %}" type='text/css'/>
+<script src="{% static 'js/jquery.dataTables-1.13.8.min.js' %}"> </script>
+<script>
+
+function _ajax_update(file, all, dir){
+ function getCookie(name) {
+ var cookieValue = null;
+ if (document.cookie && document.cookie !== '') {
+ var cookies = document.cookie.split(';');
+ for (var i = 0; i < cookies.length; i++) {
+ var cookie = jQuery.trim(cookies[i]);
+ // Does this cookie string begin with the name we want?
+ if (cookie.substring(0, name.length + 1) === (name + '=')) {
+ cookieValue = decodeURIComponent(cookie.substring(name.length + 1));
+ break;
+ }
+ }
+ }
+ return cookieValue;
+ }
+ var csrftoken = getCookie('csrftoken');
+
+ function csrfSafeMethod(method) {
+ // these HTTP methods do not require CSRF protection
+ return (/^(GET|HEAD|OPTIONS|TRACE)$/.test(method));
+ }
+ $.ajaxSetup({
+ beforeSend: function (xhr, settings) {
+ if (!csrfSafeMethod(settings.type) && !this.crossDomain) {
+ xhr.setRequestHeader("X-CSRFToken", csrftoken);
+ }
+ }
+ });
+
+ $.ajax({
+ url:'/toastergui/cmdline/',
+ type: "POST",
+ data: {file: file, all: all, dir: dir},
+ success:function(data){
+ if (data['response']=='building'){
+ location.reload()
+ } else {
+ window.location = '/toastergui/builds/'
+ }
+ },
+ complete:function(data){
+ },
+ error:function (xhr, textStatus, thrownError){
+ console.log('fail');
+ }
+ });
+}
+
+$('#import_all').on('click', function(){
+ _ajax_update("{{files | safe}}", true, "{{dir | safe}}");
+});
+
+
+$('#import_page').hide();
+
+$(function () {
+ $('[data-toggle="tooltip"]').tooltip()
+})
+
+
+$("#id_eventlog_file").change(function(){
+ $('#file_import').prop("disabled", false);
+ $('#file_import').addClass('btn-primary')
+ $('#file_import').removeClass('btn-default')
+})
+
+$(document).ajaxStart(function(){
+ $('#overlay').removeClass('hide');
+ window.setTimeout(
+ function() {
+ window.location = '/toastergui/builds/'
+ }, 10000)
+});
+
+$( "#form_file").on( "submit", function( event ) {
+ $('#overlay').removeClass('hide');
+ window.setTimeout(
+ function() {
+ window.location = '/toastergui/builds/'
+ }, 10000)
+});
+
+$(document).ready( function () {
+ $('#eventlog-table').DataTable({order: [[0, 'desc']], "pageLength": 50});
+});
+
+</script>
+
+{% endblock %}
diff --git a/bitbake/lib/toaster/toastergui/templates/js-unit-tests.html b/bitbake/lib/toaster/toastergui/templates/js-unit-tests.html
index ca248962f0..41553c4f9d 100644
--- a/bitbake/lib/toaster/toastergui/templates/js-unit-tests.html
+++ b/bitbake/lib/toaster/toastergui/templates/js-unit-tests.html
@@ -11,7 +11,7 @@
<script src="{% static 'js/layerDepsModal.js' %}"></script>
<script src="{% static 'js/projectpage.js' %}"></script>
-<script src="{% static 'js/bootstrap.min.js' %}"></script>
+<script src="{% static 'js/bootstrap-3.4.1.min.js' %}"></script>
<script src="{% static 'js/filtersnippet.js' %}"></script>
<script src="{% static 'js/importlayer.js' %}"></script>
<script src="{% static 'js/highlight.pack.js' %}"></script>
diff --git a/bitbake/lib/toaster/toastergui/templates/landing.html b/bitbake/lib/toaster/toastergui/templates/landing.html
index 08b40fb2f2..589ee22634 100644
--- a/bitbake/lib/toaster/toastergui/templates/landing.html
+++ b/bitbake/lib/toaster/toastergui/templates/landing.html
@@ -12,10 +12,10 @@
<div class="col-md-6">
<h1>This is Toaster</h1>
- <p>A web interface to <a href="https://www.openembedded.org">OpenEmbedded</a> and <a href="https://www.yoctoproject.org/tools-resources/projects/bitbake">BitBake</a>, the <a href="https://www.yoctoproject.org">Yocto Project</a> build system.</p>
+ <p>A web interface to <a href="https://www.openembedded.org">OpenEmbedded</a> and <a href="https://docs.yoctoproject.org/bitbake.html">BitBake</a>, the <a href="https://www.yoctoproject.org">Yocto Project</a> build system.</p>
<p class="top-air">
- <a class="btn btn-info btn-lg" href="http://docs.yoctoproject.org/toaster-manual/setup-and-use.html#setting-up-and-using-toaster">
+ <a class="btn btn-info btn-lg" href="http://docs.yoctoproject.org/toaster-manual/setup-and-use.html#setting-up-and-using-toaster" style="min-width: 460px;">
Toaster is ready to capture your command line builds
</a>
</p>
@@ -23,7 +23,7 @@
{% if lvs_nos %}
{% if project_enable %}
<p class="top-air">
- <a class="btn btn-primary btn-lg" href="{% url 'newproject' %}">
+ <a class="btn btn-primary btn-lg" href="{% url 'newproject' %}" style="min-width: 460px;">
Create your first Toaster project to run manage builds
</a>
</p>
@@ -42,6 +42,12 @@
</div>
{% endif %}
+ <p class="top-air">
+ <a class="btn btn-info btn-lg" href="{% url 'cmdlines' %}" style="min-width: 460px;">
+ Import command line event logs from build directory
+ </a>
+ </p>
+
<ul class="list-unstyled lead">
<li>
<a href="http://docs.yoctoproject.org/toaster-manual/index.html#toaster-user-manual">
diff --git a/bitbake/lib/toaster/toastergui/templates/mrb_section.html b/bitbake/lib/toaster/toastergui/templates/mrb_section.html
index 98d9fac822..9fc7dfaee4 100644
--- a/bitbake/lib/toaster/toastergui/templates/mrb_section.html
+++ b/bitbake/lib/toaster/toastergui/templates/mrb_section.html
@@ -63,7 +63,7 @@
<%/if%>
</div>
- <div data-build-state="<%:state%>">
+ <div class="build-state" data-build-state="<%:state%>">
<%if state == 'Cloning'%>
<%include tmpl='#cloning-repos-build-template'/%>
<%else state == 'Parsing'%>
diff --git a/bitbake/lib/toaster/toastergui/templates/package_built_dependencies.html b/bitbake/lib/toaster/toastergui/templates/package_built_dependencies.html
index a5d5893571..2493954deb 100644
--- a/bitbake/lib/toaster/toastergui/templates/package_built_dependencies.html
+++ b/bitbake/lib/toaster/toastergui/templates/package_built_dependencies.html
@@ -18,7 +18,7 @@
</ul>
<div class="tab-content">
<div class="tab-pane active" id="dependencies">
- {% ifequal runtime_deps|length 0 %}
+ {% if runtime_deps|length == 0 %}
<div class="alert alert-info">
<strong>{{package.fullpackagespec}}</strong> has no runtime dependencies.
</div>
@@ -54,8 +54,8 @@
{% endfor %}
</tbody>
</table>
- {% endifequal %}
- {% ifnotequal other_deps|length 0 %}
+ {% endif %}
+ {% if other_deps|length != 0 %}
<h3>Other runtime relationships</h3>
<table class="table table-bordered table-hover">
<thead>
@@ -93,7 +93,7 @@
{% endfor %}
</tbody>
</table>
- {% endifnotequal %}
+ {% endif %}
</div> <!-- tab-pane -->
</div> <!-- tab-content -->
{% endblock tabcontent %}
diff --git a/bitbake/lib/toaster/toastergui/templates/package_included_dependencies.html b/bitbake/lib/toaster/toastergui/templates/package_included_dependencies.html
index 95e56ded26..1f5ed6d913 100644
--- a/bitbake/lib/toaster/toastergui/templates/package_included_dependencies.html
+++ b/bitbake/lib/toaster/toastergui/templates/package_included_dependencies.html
@@ -14,7 +14,7 @@
{% include "package_included_tabs.html" with active_tab="dependencies" %}
<div class="tab-content">
<div class="tab-pane active" id="dependencies">
- {% ifnotequal runtime_deps|length 0 %}
+ {% if runtime_deps|length != 0 %}
<table class="table table-bordered table-hover">
<thead>
<tr>
@@ -48,9 +48,9 @@
<div class="alert alert-info">
<strong>{{package.fullpackagespec}}</strong> has no runtime dependencies.
</div>
- {% endifnotequal %}
+ {% endif %}
- {% ifnotequal other_deps|length 0 %}
+ {% if other_deps|length != 0 %}
<h3>Other runtime relationships</h3>
<table class="table table-bordered table-hover">
<thead>
@@ -103,7 +103,7 @@
{% endfor %}
</tbody>
</table>
- {% endifnotequal %}
+ {% endif %}
</div> <!-- end tab-pane -->
</div> <!-- end tab content -->
{% endwith %}
diff --git a/bitbake/lib/toaster/toastergui/templates/package_included_reverse_dependencies.html b/bitbake/lib/toaster/toastergui/templates/package_included_reverse_dependencies.html
index fb310c7fc7..dae4549e21 100644
--- a/bitbake/lib/toaster/toastergui/templates/package_included_reverse_dependencies.html
+++ b/bitbake/lib/toaster/toastergui/templates/package_included_reverse_dependencies.html
@@ -15,7 +15,7 @@
<div class="tab-content">
<div class="tab-pane active" id="brought-in-by">
- {% ifequal reverse_count 0 %}
+ {% if reverse_count == 0 %}
<div class="alert alert-info">
<strong>{{package.fullpackagespec}}</strong> has no reverse runtime dependencies.
</div>
@@ -43,7 +43,7 @@
{% endfor %}
</tbody>
</table>
- {% endifequal %}
+ {% endif %}
</div> <!-- end tab-pane -->
</div> <!-- end tab content -->
{% endwith %}
diff --git a/bitbake/lib/toaster/toastergui/templates/recipe.html b/bitbake/lib/toaster/toastergui/templates/recipe.html
index 3f76e656fe..4b5301b548 100644
--- a/bitbake/lib/toaster/toastergui/templates/recipe.html
+++ b/bitbake/lib/toaster/toastergui/templates/recipe.html
@@ -186,9 +186,9 @@
<i class="icon-question-sign get-help hover-help" title="{{task.get_outcome_help}}"></i>
</td>
<td>
- {% ifnotequal task.sstate_result task.SSTATE_NA %}
+ {% if task.sstate_result != task.SSTATE_NA %}
{{task.get_sstate_result_display}}
- {% endifnotequal %}
+ {% endif %}
</td>
</tr>
diff --git a/bitbake/lib/toaster/toastergui/templates/target.html b/bitbake/lib/toaster/toastergui/templates/target.html
index 1924a0dad7..d5f60e77a8 100644
--- a/bitbake/lib/toaster/toastergui/templates/target.html
+++ b/bitbake/lib/toaster/toastergui/templates/target.html
@@ -8,11 +8,11 @@
{% block nav-target %}
{% for t in build.get_sorted_target_list %}
- {% ifequal target.pk t.pk %}
+ {% if target.pk == t.pk %}
<li class="active"><a href="{% url 'target' build.pk t.pk %}">{{t.target}}</a><li>
{% else %}
<li><a href="{% url 'target' build.pk t.pk %}">{{t.target}}</a><li>
- {% endifequal %}
+ {% endif %}
{% endfor %}
{% endblock %}
diff --git a/bitbake/lib/toaster/toastergui/templatetags/projecttags.py b/bitbake/lib/toaster/toastergui/templatetags/projecttags.py
index c432f59a78..bd398f0012 100644
--- a/bitbake/lib/toaster/toastergui/templatetags/projecttags.py
+++ b/bitbake/lib/toaster/toastergui/templatetags/projecttags.py
@@ -167,8 +167,8 @@ def check_filter_status(options, filter):
def variable_parent_name(value):
""" filter extended variable names to the parent name
"""
- value=re.sub('_\$.*', '', value)
- return re.sub('_[a-z].*', '', value)
+ value = re.sub(r'_\$.*', '', value)
+ return re.sub(r'_[a-z].*', '', value)
@register.filter
def filter_setin_files(file_list, matchstr):
diff --git a/bitbake/lib/toaster/toastergui/urls.py b/bitbake/lib/toaster/toastergui/urls.py
index d2df4e6048..7f8489d3aa 100644
--- a/bitbake/lib/toaster/toastergui/urls.py
+++ b/bitbake/lib/toaster/toastergui/urls.py
@@ -6,7 +6,7 @@
# SPDX-License-Identifier: GPL-2.0-only
#
-from django.conf.urls import url
+from django.urls import re_path as url
from django.views.generic import RedirectView
from toastergui import tables
@@ -95,6 +95,7 @@ urlpatterns = [
# project URLs
url(r'^newproject/$', views.newproject, name='newproject'),
+ url(r'^cmdline/$', views.CommandLineBuilds.as_view(), name='cmdlines'),
url(r'^projects/$',
tables.ProjectsTable.as_view(template_name="projects-toastertable.html"),
name='all-projects'),
@@ -206,8 +207,7 @@ urlpatterns = [
url(r'^js-unit-tests/$', views.jsunittests, name='js-unit-tests'),
# image customisation functionality
- url(r'^xhr_customrecipe/(?P<recipe_id>\d+)'
- '/packages/(?P<package_id>\d+|)$',
+ url(r'^xhr_customrecipe/(?P<recipe_id>\d+)/packages/(?P<package_id>\d+|)$',
api.XhrCustomRecipePackages.as_view(),
name='xhr_customrecipe_packages'),
diff --git a/bitbake/lib/toaster/toastergui/views.py b/bitbake/lib/toaster/toastergui/views.py
index a571b8cc18..40aed265dc 100644
--- a/bitbake/lib/toaster/toastergui/views.py
+++ b/bitbake/lib/toaster/toastergui/views.py
@@ -6,24 +6,36 @@
# SPDX-License-Identifier: GPL-2.0-only
#
+import ast
import re
+import subprocess
+import sys
+
+import bb.cooker
+from bb.ui import toasterui
+from bb.ui import eventreplay
from django.db.models import F, Q, Sum
from django.db import IntegrityError
-from django.shortcuts import render, redirect, get_object_or_404
+from django.shortcuts import render, redirect, get_object_or_404, HttpResponseRedirect
from django.utils.http import urlencode
from orm.models import Build, Target, Task, Layer, Layer_Version, Recipe
from orm.models import LogMessage, Variable, Package_Dependency, Package
from orm.models import Task_Dependency, Package_File
from orm.models import Target_Installed_Package, Target_File
from orm.models import TargetKernelFile, TargetSDKFile, Target_Image_File
-from orm.models import BitbakeVersion, CustomImageRecipe
+from orm.models import BitbakeVersion, CustomImageRecipe, EventLogsImports
from django.urls import reverse, resolve
+from django.contrib import messages
+
from django.core.exceptions import ObjectDoesNotExist
+from django.core.files.storage import FileSystemStorage
+from django.core.files.uploadedfile import InMemoryUploadedFile, TemporaryUploadedFile
from django.core.paginator import Paginator, EmptyPage, PageNotAnInteger
from django.http import HttpResponseNotFound, JsonResponse
from django.utils import timezone
+from django.views.generic import TemplateView
from datetime import timedelta, datetime
from toastergui.templatetags.projecttags import json as jsonfilter
from decimal import Decimal
@@ -32,13 +44,20 @@ import os
from os.path import dirname
import mimetypes
+from toastergui.forms import LoadFileForm
+
+from collections import namedtuple
+
import logging
+from toastermain.logs import log_view_mixin
+
logger = logging.getLogger("toaster")
# Project creation and managed build enable
project_enable = ('1' == os.environ.get('TOASTER_BUILDSERVER'))
is_project_specific = ('1' == os.environ.get('TOASTER_PROJECTSPECIFIC'))
+import_page = False
class MimeTypeFinder(object):
# setting this to False enables additional non-standard mimetypes
@@ -56,6 +75,7 @@ class MimeTypeFinder(object):
return guessed_type
# single point to add global values into the context before rendering
+@log_view_mixin
def toaster_render(request, page, context):
context['project_enable'] = project_enable
context['project_specific'] = is_project_specific
@@ -665,16 +685,17 @@ def recipe_packages(request, build_id, recipe_id):
return response
from django.http import HttpResponse
+@log_view_mixin
def xhr_dirinfo(request, build_id, target_id):
top = request.GET.get('start', '/')
return HttpResponse(_get_dir_entries(build_id, target_id, top), content_type = "application/json")
from django.utils.functional import Promise
-from django.utils.encoding import force_text
+from django.utils.encoding import force_str
class LazyEncoder(json.JSONEncoder):
def default(self, obj):
if isinstance(obj, Promise):
- return force_text(obj)
+ return force_str(obj)
return super(LazyEncoder, self).default(obj)
from toastergui.templatetags.projecttags import filtered_filesizeformat
@@ -1404,7 +1425,7 @@ if True:
if not os.path.isdir('%s/conf' % request.POST['importdir']):
raise BadParameterException("Bad path or missing 'conf' directory (%s)" % request.POST['importdir'])
from django.core import management
- management.call_command('buildimport', '--command=import', '--name=%s' % request.POST['projectname'], '--path=%s' % request.POST['importdir'], interactive=False)
+ management.call_command('buildimport', '--command=import', '--name=%s' % request.POST['projectname'], '--path=%s' % request.POST['importdir'])
prj = Project.objects.get(name = request.POST['projectname'])
prj.merged_attr = True
prj.save()
@@ -1606,12 +1627,13 @@ if True:
# make sure we have a machine set for this project
ProjectVariable.objects.get_or_create(project=new_project,
name="MACHINE",
- value="qemux86")
+ value="qemux86-64")
context = {'project': new_project}
return toaster_render(request, "js-unit-tests.html", context)
from django.views.decorators.csrf import csrf_exempt
@csrf_exempt
+ @log_view_mixin
def xhr_testreleasechange(request, pid):
def response(data):
return HttpResponse(jsonfilter(data),
@@ -1648,6 +1670,7 @@ if True:
except Exception as e:
return response({"error": str(e) })
+ @log_view_mixin
def xhr_configvaredit(request, pid):
try:
prj = Project.objects.get(id = pid)
@@ -1726,6 +1749,7 @@ if True:
return HttpResponse(json.dumps({"error":str(e) + "\n" + traceback.format_exc()}), content_type = "application/json")
+ @log_view_mixin
def customrecipe_download(request, pid, recipe_id):
recipe = get_object_or_404(CustomImageRecipe, pk=recipe_id)
@@ -1933,3 +1957,163 @@ if True:
except (ObjectDoesNotExist, IOError):
return toaster_render(request, "unavailable_artifact.html")
+
+class CommandLineBuilds(TemplateView):
+ model = EventLogsImports
+ template_name = 'command_line_builds.html'
+
+ def get_context_data(self, **kwargs):
+ context = super(CommandLineBuilds, self).get_context_data(**kwargs)
+ #get value from BB_DEFAULT_EVENTLOG defined in bitbake.conf
+ eventlog = subprocess.check_output(['bitbake-getvar', 'BB_DEFAULT_EVENTLOG', '--value'])
+ if eventlog:
+ logs_dir = os.path.dirname(eventlog.decode().strip('\n'))
+ files = os.listdir(logs_dir)
+ imported_files = EventLogsImports.objects.all()
+ files_list = []
+
+ # Filter files that end with ".json"
+ event_files = []
+ for file in files:
+ if file.endswith(".json"):
+ # because BB_DEFAULT_EVENTLOG is a directory, we need to check if the file is a valid eventlog
+ with open("{}/{}".format(logs_dir, file)) as efile:
+ content = efile.read()
+ if 'allvariables' in content:
+ event_files.append(file)
+
+ #build dict for template using db data
+ for event_file in event_files:
+ if imported_files.filter(name=event_file):
+ files_list.append({
+ 'name': event_file,
+ 'imported': True,
+ 'build_id': imported_files.filter(name=event_file)[0].build_id,
+ 'size': os.path.getsize("{}/{}".format(logs_dir, event_file))
+ })
+ else:
+ files_list.append({
+ 'name': event_file,
+ 'imported': False,
+ 'build_id': None,
+ 'size': os.path.getsize("{}/{}".format(logs_dir, event_file))
+ })
+ context['import_all'] = True
+
+ context['files'] = files_list
+ context['dir'] = logs_dir
+ else:
+ context['files'] = []
+ context['dir'] = ''
+
+ # enable session variable
+ if not self.request.session.get('file'):
+ self.request.session['file'] = ""
+
+ context['form'] = LoadFileForm()
+ context['project_enable'] = project_enable
+ return context
+
+ def post(self, request, **kwargs):
+ logs_dir = request.POST.get('dir')
+ all_files = request.POST.get('all')
+
+ # check if a build is already in progress
+ if Build.objects.filter(outcome=Build.IN_PROGRESS):
+ messages.add_message(
+ self.request,
+ messages.ERROR,
+ "A build is already in progress. Please wait for it to complete before starting a new build."
+ )
+ return JsonResponse({'response': 'building'})
+ imported_files = EventLogsImports.objects.all()
+ try:
+ if all_files == 'true':
+ # use of session variable to deactivate icon for builds in progress
+ request.session['all_builds'] = True
+ request.session.modified = True
+ request.session.save()
+
+ files = ast.literal_eval(request.POST.get('file'))
+ for file in files:
+ if imported_files.filter(name=file.get('name')).exists():
+ imported_files.filter(name=file.get('name'))[0].imported = True
+ else:
+ with open("{}/{}".format(logs_dir, file.get('name'))) as eventfile:
+ # load variables from the first line
+ variables = None
+ while line := eventfile.readline().strip():
+ try:
+ variables = json.loads(line)['allvariables']
+ break
+ except (KeyError, json.JSONDecodeError):
+ continue
+ if not variables:
+ raise Exception("File content missing build variables")
+ eventfile.seek(0)
+ params = namedtuple('ConfigParams', ['observe_only'])(True)
+ player = eventreplay.EventPlayer(eventfile, variables)
+
+ toasterui.main(player, player, params)
+ event_log_import = EventLogsImports.objects.create(name=file.get('name'), imported=True)
+ event_log_import.build_id = Build.objects.last().id
+ event_log_import.save()
+ else:
+ if self.request.FILES.get('eventlog_file'):
+ file = self.request.FILES['eventlog_file']
+ else:
+ file = request.POST.get('file')
+ # use of session variable to deactivate icon for build in progress
+ request.session['file'] = file
+ request.session['all_builds'] = False
+ request.session.modified = True
+ request.session.save()
+
+ if imported_files.filter(name=file).exists():
+ imported_files.filter(name=file)[0].imported = True
+ else:
+ if isinstance(file, InMemoryUploadedFile) or isinstance(file, TemporaryUploadedFile):
+ variables = None
+ while line := file.readline().strip():
+ try:
+ variables = json.loads(line)['allvariables']
+ break
+ except (KeyError, json.JSONDecodeError):
+ continue
+ if not variables:
+ raise Exception("File content missing build variables")
+ file.seek(0)
+ params = namedtuple('ConfigParams', ['observe_only'])(True)
+ player = eventreplay.EventPlayer(file, variables)
+ if not os.path.exists('{}/{}'.format(logs_dir, file.name)):
+ fs = FileSystemStorage(location=logs_dir)
+ fs.save(file.name, file)
+ toasterui.main(player, player, params)
+ else:
+ with open("{}/{}".format(logs_dir, file)) as eventfile:
+ # load variables from the first line
+ variables = None
+ while line := eventfile.readline().strip():
+ try:
+ variables = json.loads(line)['allvariables']
+ break
+ except (KeyError, json.JSONDecodeError):
+ continue
+ if not variables:
+ raise Exception("File content missing build variables")
+ eventfile.seek(0)
+ params = namedtuple('ConfigParams', ['observe_only'])(True)
+ player = eventreplay.EventPlayer(eventfile, variables)
+ toasterui.main(player, player, params)
+ event_log_import = EventLogsImports.objects.create(name=file, imported=True)
+ event_log_import.build_id = Build.objects.last().id
+ event_log_import.save()
+ request.session['file'] = ""
+ except Exception:
+ messages.add_message(
+ self.request,
+ messages.ERROR,
+ "The file content is not in the correct format. Update file content or upload a different file."
+ )
+ return HttpResponseRedirect("/toastergui/cmdline/")
+ return HttpResponseRedirect('/toastergui/builds/')
diff --git a/bitbake/lib/toaster/toastergui/widgets.py b/bitbake/lib/toaster/toastergui/widgets.py
index ceff52942e..b32abf40b3 100644
--- a/bitbake/lib/toaster/toastergui/widgets.py
+++ b/bitbake/lib/toaster/toastergui/widgets.py
@@ -7,6 +7,7 @@
#
from django.views.generic import View, TemplateView
+from django.utils.decorators import method_decorator
from django.views.decorators.cache import cache_control
from django.shortcuts import HttpResponse
from django.core.cache import cache
@@ -31,6 +32,7 @@ import re
import os
from toastergui.tablefilter import TableFilterMap
+from toastermain.logs import log_view_mixin
try:
from urllib import unquote_plus
@@ -63,8 +65,8 @@ class ToasterTable(TemplateView):
self.default_orderby = ""
# prevent HTTP caching of table data
- @cache_control(must_revalidate=True,
- max_age=0, no_store=True, no_cache=True)
+ @method_decorator(cache_control(must_revalidate=True,
+ max_age=0, no_store=True, no_cache=True))
def dispatch(self, *args, **kwargs):
return super(ToasterTable, self).dispatch(*args, **kwargs)
@@ -83,6 +85,7 @@ class ToasterTable(TemplateView):
return context
+ @log_view_mixin
def get(self, request, *args, **kwargs):
if request.GET.get('format', None) == 'json':
@@ -304,6 +307,7 @@ class ToasterTable(TemplateView):
self.setup_columns(**kwargs)
+ self.apply_orderby('pk')
if search:
self.apply_search(search)
if filters:
@@ -413,6 +417,7 @@ class ToasterTypeAhead(View):
def __init__(self, *args, **kwargs):
super(ToasterTypeAhead, self).__init__()
+ @log_view_mixin
def get(self, request, *args, **kwargs):
def response(data):
return HttpResponse(json.dumps(data,
@@ -468,6 +473,7 @@ class MostRecentBuildsView(View):
return False
+ @log_view_mixin
def get(self, request, *args, **kwargs):
"""
Returns a list of builds in JSON format.
diff --git a/bitbake/lib/toaster/toastermain/logs.py b/bitbake/lib/toaster/toastermain/logs.py
new file mode 100644
index 0000000000..62d871963a
--- /dev/null
+++ b/bitbake/lib/toaster/toastermain/logs.py
@@ -0,0 +1,158 @@
+#!/usr/bin/env python3
+# -*- coding: utf-8 -*-
+
+import os
+import logging
+import json
+from pathlib import Path
+from django.http import HttpRequest
+
+BUILDDIR = Path(os.environ.get('BUILDDIR', '/tmp'))
+
+def log_api_request(request, response, view, logger_name='api'):
+ """Helper function for LogAPIMixin"""
+
+ repjson = {
+ 'view': view,
+ 'path': request.path,
+ 'method': request.method,
+ 'status': response.status_code
+ }
+
+ logger = logging.getLogger(logger_name)
+ logger.info(
+ json.dumps(repjson, indent=4, separators=(", ", " : "))
+ )
+
+
+def log_view_mixin(view):
+ def log_view_request(*args, **kwargs):
+ # get request from args else kwargs
+ request = None
+ if len(args) > 0:
+ for req in args:
+ if isinstance(req, HttpRequest):
+ request = req
+ break
+ elif request is None:
+ request = kwargs.get('request')
+
+ response = view(*args, **kwargs)
+ view_name = 'unknown'
+ if hasattr(request, 'resolver_match'):
+ if hasattr(request.resolver_match, 'view_name'):
+ view_name = request.resolver_match.view_name
+
+ log_api_request(
+ request, response, view_name, 'toaster')
+ return response
+ return log_view_request
+
+
+
+class LogAPIMixin:
+ """Logs API requests
+
+ tested with:
+ - APIView
+ - ModelViewSet
+ - ReadOnlyModelViewSet
+ - GenericAPIView
+
+ Note: you can set `view_name` attribute in View to override get_view_name()
+ """
+
+ def get_view_name(self):
+ if hasattr(self, 'view_name'):
+ return self.view_name
+ return super().get_view_name()
+
+ def finalize_response(self, request, response, *args, **kwargs):
+ log_api_request(request, response, self.get_view_name())
+ return super().finalize_response(request, response, *args, **kwargs)
+
+
+LOGGING_SETTINGS = {
+ 'version': 1,
+ 'disable_existing_loggers': False,
+ 'filters': {
+ 'require_debug_false': {
+ '()': 'django.utils.log.RequireDebugFalse'
+ }
+ },
+ 'formatters': {
+ 'datetime': {
+ 'format': '%(asctime)s %(levelname)s %(message)s'
+ },
+ 'verbose': {
+ 'format': '{levelname} {asctime} {module} {name}.{funcName} {process:d} {thread:d} {message}',
+ 'datefmt': "%d/%b/%Y %H:%M:%S",
+ 'style': '{',
+ },
+ 'api': {
+ 'format': '\n{levelname} {asctime} {name}.{funcName}:\n{message}',
+ 'style': '{'
+ }
+ },
+ 'handlers': {
+ 'mail_admins': {
+ 'level': 'ERROR',
+ 'filters': ['require_debug_false'],
+ 'class': 'django.utils.log.AdminEmailHandler'
+ },
+ 'console': {
+ 'level': 'DEBUG',
+ 'class': 'logging.StreamHandler',
+ 'formatter': 'datetime',
+ },
+ 'file_django': {
+ 'level': 'INFO',
+ 'class': 'logging.handlers.TimedRotatingFileHandler',
+ 'filename': BUILDDIR / 'toaster_logs/django.log',
+ 'when': 'D', # interval type
+ 'interval': 1, # defaults to 1
+ 'backupCount': 10, # how many files to keep
+ 'formatter': 'verbose',
+ },
+ 'file_api': {
+ 'level': 'INFO',
+ 'class': 'logging.handlers.TimedRotatingFileHandler',
+ 'filename': BUILDDIR / 'toaster_logs/api.log',
+ 'when': 'D',
+ 'interval': 1,
+ 'backupCount': 10,
+ 'formatter': 'verbose',
+ },
+ 'file_toaster': {
+ 'level': 'INFO',
+ 'class': 'logging.handlers.TimedRotatingFileHandler',
+ 'filename': BUILDDIR / 'toaster_logs/web.log',
+ 'when': 'D',
+ 'interval': 1,
+ 'backupCount': 10,
+ 'formatter': 'verbose',
+ },
+ },
+ 'loggers': {
+ 'django.request': {
+ 'handlers': ['file_django', 'console'],
+ 'level': 'WARN',
+ 'propagate': True,
+ },
+ 'django': {
+ 'handlers': ['file_django', 'console'],
+ 'level': 'WARNING',
+ 'propogate': True,
+ },
+ 'toaster': {
+ 'handlers': ['file_toaster'],
+ 'level': 'INFO',
+ 'propagate': False,
+ },
+ 'api': {
+ 'handlers': ['file_api'],
+ 'level': 'INFO',
+ 'propagate': False,
+ }
+ }
+}
diff --git a/bitbake/lib/toaster/toastermain/management/commands/buildimport.py b/bitbake/lib/toaster/toastermain/management/commands/buildimport.py
index e25b55e5ab..f7139aa041 100644
--- a/bitbake/lib/toaster/toastermain/management/commands/buildimport.py
+++ b/bitbake/lib/toaster/toastermain/management/commands/buildimport.py
@@ -545,7 +545,7 @@ class Command(BaseCommand):
# Find the directory's release, and promote to default_release if local paths
release = self.find_import_release(layers_list,lv_dict,default_release)
# create project, SANITY: reuse any project of same name
- project = Project.objects.create_project(project_name,release,project)
+ project = Project.objects.create_project(project_name,release,project, imported=True)
# Apply any new layers or variables
self.apply_conf_variables(project,layers_list,lv_dict,release)
# WORKAROUND: since we now derive the release, redirect 'newproject_specific' to 'project_specific'
diff --git a/bitbake/lib/toaster/toastermain/management/commands/checksocket.py b/bitbake/lib/toaster/toastermain/management/commands/checksocket.py
index 811fd5d516..b2c002da7a 100644
--- a/bitbake/lib/toaster/toastermain/management/commands/checksocket.py
+++ b/bitbake/lib/toaster/toastermain/management/commands/checksocket.py
@@ -13,7 +13,7 @@ import errno
import socket
from django.core.management.base import BaseCommand, CommandError
-from django.utils.encoding import force_text
+from django.utils.encoding import force_str
DEFAULT_ADDRPORT = "0.0.0.0:8000"
@@ -51,7 +51,7 @@ class Command(BaseCommand):
if hasattr(err, 'errno') and err.errno in errors:
errtext = errors[err.errno]
else:
- errtext = force_text(err)
+ errtext = force_str(err)
raise CommandError(errtext)
self.stdout.write("OK")
diff --git a/bitbake/lib/toaster/toastermain/settings.py b/bitbake/lib/toaster/toastermain/settings.py
index 609c85d9d8..e06adc5a93 100644
--- a/bitbake/lib/toaster/toastermain/settings.py
+++ b/bitbake/lib/toaster/toastermain/settings.py
@@ -9,6 +9,8 @@
# Django settings for Toaster project.
import os
+from pathlib import Path
+from toastermain.logs import LOGGING_SETTINGS
DEBUG = True
@@ -87,14 +89,17 @@ else:
from pytz.exceptions import UnknownTimeZoneError
try:
if pytz.timezone(zonename) is not None:
- zonefilelist[hashlib.md5(open(filepath, 'rb').read()).hexdigest()] = zonename
+ with open(filepath, 'rb') as f:
+ zonefilelist[hashlib.md5(f.read()).hexdigest()] = zonename
except UnknownTimeZoneError as ValueError:
# we expect timezone failures here, just move over
pass
except ImportError:
- zonefilelist[hashlib.md5(open(filepath, 'rb').read()).hexdigest()] = zonename
+ with open(filepath, 'rb') as f:
+ zonefilelist[hashlib.md5(f.read()).hexdigest()] = zonename
- TIME_ZONE = zonefilelist[hashlib.md5(open('/etc/localtime', 'rb').read()).hexdigest()]
+ with open('/etc/localtime', 'rb') as f:
+ TIME_ZONE = zonefilelist[hashlib.md5(f.read()).hexdigest()]
# Language code for this installation. All choices can be found here:
# http://www.i18nguy.com/unicode/language-identifiers.html
@@ -106,10 +111,6 @@ SITE_ID = 1
# to load the internationalization machinery.
USE_I18N = True
-# If you set this to False, Django will not format dates, numbers and
-# calendars according to the current locale.
-USE_L10N = True
-
# If you set this to False, Django will not use timezone-aware datetimes.
USE_TZ = True
@@ -150,6 +151,8 @@ STATICFILES_FINDERS = (
# Make this unique, and don't share it with anybody.
SECRET_KEY = 'NOT_SUITABLE_FOR_HOSTED_DEPLOYMENT'
+TMPDIR = os.environ.get('TOASTER_DJANGO_TMPDIR', '/tmp')
+
class InvalidString(str):
def __mod__(self, other):
from django.template.base import TemplateSyntaxError
@@ -186,7 +189,13 @@ TEMPLATES = [
'django.template.loaders.app_directories.Loader',
#'django.template.loaders.eggs.Loader',
],
- 'string_if_invalid': InvalidString("%s"),
+ # https://docs.djangoproject.com/en/4.2/ref/templates/api/#how-invalid-variables-are-handled
+ # Generally, string_if_invalid should only be enabled in order to debug
+ # a specific template problem, then cleared once debugging is complete.
+ # If you assign a value other than '' to string_if_invalid,
+ # you will experience rendering problems with these templates and sites.
+ # 'string_if_invalid': InvalidString("%s"),
+ 'string_if_invalid': "",
'debug': DEBUG,
},
},
@@ -210,7 +219,7 @@ CACHES = {
# },
'default': {
'BACKEND': 'django.core.cache.backends.filebased.FileBasedCache',
- 'LOCATION': '/tmp/toaster_cache_%d' % os.getuid(),
+ 'LOCATION': '%s/toaster_cache_%d' % (TMPDIR, os.getuid()),
'TIMEOUT': 1,
}
}
@@ -242,6 +251,9 @@ INSTALLED_APPS = (
'django.contrib.humanize',
'bldcollector',
'toastermain',
+
+ # 3rd-lib
+ "log_viewer",
)
@@ -302,43 +314,21 @@ for t in os.walk(os.path.dirname(currentdir)):
# the site admins on every HTTP 500 error when DEBUG=False.
# See http://docs.djangoproject.com/en/dev/topics/logging for
# more details on how to customize your logging configuration.
-LOGGING = {
- 'version': 1,
- 'disable_existing_loggers': False,
- 'filters': {
- 'require_debug_false': {
- '()': 'django.utils.log.RequireDebugFalse'
- }
- },
- 'formatters': {
- 'datetime': {
- 'format': '%(asctime)s %(levelname)s %(message)s'
- }
- },
- 'handlers': {
- 'mail_admins': {
- 'level': 'ERROR',
- 'filters': ['require_debug_false'],
- 'class': 'django.utils.log.AdminEmailHandler'
- },
- 'console': {
- 'level': 'DEBUG',
- 'class': 'logging.StreamHandler',
- 'formatter': 'datetime',
- }
- },
- 'loggers': {
- 'toaster' : {
- 'handlers': ['console'],
- 'level': 'DEBUG',
- },
- 'django.request': {
- 'handlers': ['console'],
- 'level': 'WARN',
- 'propagate': True,
- },
- }
-}
+LOGGING = LOGGING_SETTINGS
+
+# Build paths inside the project like this: BASE_DIR / 'subdir'.
+BUILDDIR = os.environ.get("BUILDDIR", TMPDIR)
+
+# LOG VIEWER
+# https://pypi.org/project/django-log-viewer/
+LOG_VIEWER_FILES_PATTERN = '*.log*'
+LOG_VIEWER_FILES_DIR = os.path.join(BUILDDIR, "toaster_logs/")
+LOG_VIEWER_PAGE_LENGTH = 25 # total log lines per-page
+LOG_VIEWER_MAX_READ_LINES = 100000 # total log lines will be read
+LOG_VIEWER_PATTERNS = ['INFO', 'DEBUG', 'WARNING', 'ERROR', 'CRITICAL']
+
+# Optionally you can set the next variables in order to customize the admin:
+LOG_VIEWER_FILE_LIST_TITLE = "Logs list"
if DEBUG and SQL_DEBUG:
LOGGING['loggers']['django.db.backends'] = {
diff --git a/bitbake/lib/toaster/toastermain/settings_test.py b/bitbake/lib/toaster/toastermain/settings_test.py
index 6538d9e453..74def2d240 100644
--- a/bitbake/lib/toaster/toastermain/settings_test.py
+++ b/bitbake/lib/toaster/toastermain/settings_test.py
@@ -19,10 +19,10 @@ TEMPLATE_DEBUG = DEBUG
DATABASES = {
'default': {
'ENGINE': 'django.db.backends.sqlite3',
- 'NAME': '/tmp/toaster-test-db.sqlite',
+ 'NAME': '%s/toaster-test-db.sqlite' % TMPDIR,
'TEST': {
'ENGINE': 'django.db.backends.sqlite3',
- 'NAME': '/tmp/toaster-test-db.sqlite',
+ 'NAME': '%s/toaster-test-db.sqlite' % TMPDIR,
}
}
}
diff --git a/bitbake/lib/toaster/toastermain/urls.py b/bitbake/lib/toaster/toastermain/urls.py
index 5fb520b384..3be46fcf0c 100644
--- a/bitbake/lib/toaster/toastermain/urls.py
+++ b/bitbake/lib/toaster/toastermain/urls.py
@@ -6,7 +6,7 @@
# SPDX-License-Identifier: GPL-2.0-only
#
-from django.conf.urls import include, url
+from django.urls import re_path as url, include
from django.views.generic import RedirectView, TemplateView
from django.views.decorators.cache import never_cache
import bldcollector.views
@@ -28,6 +28,8 @@ urlpatterns = [
# url(r'^admin/doc/', include('django.contrib.admindocs.urls')),
+ url(r'^logs/', include('log_viewer.urls')),
+
# This is here to maintain backward compatibility and will be deprecated
# in the future.
url(r'^orm/eventfile$', bldcollector.views.eventfile),
diff --git a/bitbake/lib/toaster/tox.ini b/bitbake/lib/toaster/tox.ini
new file mode 100644
index 0000000000..1516a527ae
--- /dev/null
+++ b/bitbake/lib/toaster/tox.ini
@@ -0,0 +1,24 @@
+[tox]
+envlist = py38, py39, py310, py311, py312
+skipsdist = True
+toxworkdir = {env:TOX_WORKDIR:.tox}
+passenv = *
+
+[testenv]
+passenv =
+ SSTATE_DIR
+ DL_DIR
+ TOASTER_DJANGO_TMPDIR
+setenv =
+ DJANGO_SETTINGS_MODULE=toastermain.settings_test
+ TOASTER_BUILDSERVER=1
+ BUILDDIR = {env:BUILDDIR}
+ EVENTREPLAY_DIR = {env:EVENTREPLAY_DIR:BUILDDIR}
+commands =
+ python3 {toxinidir}/manage.py test tests.db tests.commands tests.builds tests.browser tests.functional tests.views
+deps =
+ -r {toxinidir}/../../toaster-requirements.txt
+ -r {toxinidir}/tests/toaster-tests-requirements.txt
+
+[testenv:chrome]
+commands={[testenv]commands} --splinter-webdriver=chrome \ No newline at end of file
diff --git a/bitbake/toaster-requirements.txt b/bitbake/toaster-requirements.txt
index dedd423556..d8e48b7f3a 100644
--- a/bitbake/toaster-requirements.txt
+++ b/bitbake/toaster-requirements.txt
@@ -1,3 +1,4 @@
-Django>3.2,<3.3
+Django>4.2,<4.3
beautifulsoup4>=4.4.0
pytz
+django-log-viewer==1.1.7